PL59248B1 - - Google Patents
Download PDFInfo
- Publication number
- PL59248B1 PL59248B1 PL116637A PL11663766A PL59248B1 PL 59248 B1 PL59248 B1 PL 59248B1 PL 116637 A PL116637 A PL 116637A PL 11663766 A PL11663766 A PL 11663766A PL 59248 B1 PL59248 B1 PL 59248B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compound
- thiadiazole
- chloro
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 229910052783 alkali metal Chemical group 0.000 claims 2
- 150000001340 alkali metals Chemical group 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 230000020477 pH reduction Effects 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- -1 (N4-benzoylsulfanilamide) -1,2,5-thiadiazole Chemical compound 0.000 description 9
- 241000287828 Gallus gallus Species 0.000 description 7
- 235000013330 chicken meat Nutrition 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000002699 waste material Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- UDGKZGLPXCRRAM-UHFFFAOYSA-N 1,2,5-thiadiazole Chemical compound C=1C=NSN=1 UDGKZGLPXCRRAM-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 239000003224 coccidiostatic agent Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 229940088594 vitamin Drugs 0.000 description 3
- 239000011782 vitamin Substances 0.000 description 3
- 235000013343 vitamin Nutrition 0.000 description 3
- 229930003231 vitamin Natural products 0.000 description 3
- 241000271566 Aves Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 208000003495 Coccidiosis Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 206010023076 Isosporiasis Diseases 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical class C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000005133 alkynyloxy group Chemical group 0.000 description 2
- LCTXBFGHZLGBNU-UHFFFAOYSA-M amprolium Chemical compound [Cl-].NC1=NC(CCC)=NC=C1C[N+]1=CC=CC=C1C LCTXBFGHZLGBNU-UHFFFAOYSA-M 0.000 description 2
- 229960003683 amprolium Drugs 0.000 description 2
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical compound NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 2
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003722 vitamin derivatives Chemical class 0.000 description 2
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- KZDCMKVLEYCGQX-UDPGNSCCSA-N 2-(diethylamino)ethyl 4-aminobenzoate;(2s,5r,6r)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrate Chemical compound O.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1.N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 KZDCMKVLEYCGQX-UDPGNSCCSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 1
- DDQHLKLRCTUFRW-UHFFFAOYSA-N 3-but-2-ynoxy-4-chloro-1,2,5-thiadiazole Chemical compound ClC1=NSN=C1OCC#CC DDQHLKLRCTUFRW-UHFFFAOYSA-N 0.000 description 1
- LWJPYRFOSYZGKP-UHFFFAOYSA-N 3-chloro-4-prop-2-ynoxy-1,2,5-thiadiazole Chemical class ClC1=NSN=C1OCC#C LWJPYRFOSYZGKP-UHFFFAOYSA-N 0.000 description 1
- WWCLVQQGRCZLLD-UHFFFAOYSA-N 4-amino-3-but-2-ynoxy-N-(1,2,5-thiadiazol-3-yl)benzenesulfonamide Chemical compound C(C#CC)OC=1C=C(S(=O)(=O)NC2=NSN=C2)C=CC1N WWCLVQQGRCZLLD-UHFFFAOYSA-N 0.000 description 1
- FFZQQPOZDHKNAT-UHFFFAOYSA-N 4-amino-3-prop-2-ynoxy-N-(1,2,5-thiadiazol-3-yl)benzenesulfonamide Chemical compound C(C#C)OC=1C=C(S(=O)(=O)NC2=NSN=C2)C=CC1N FFZQQPOZDHKNAT-UHFFFAOYSA-N 0.000 description 1
- XLYOGWXIKVUXCL-UHFFFAOYSA-N 4-bromobut-1-yne Chemical compound BrCCC#C XLYOGWXIKVUXCL-UHFFFAOYSA-N 0.000 description 1
- BHBZGQBBRQJXCY-UHFFFAOYSA-N 4-chloro-1,2,5-thiadiazol-3-one Chemical compound OC1=NSN=C1Cl BHBZGQBBRQJXCY-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 235000019743 Choline chloride Nutrition 0.000 description 1
- 239000004470 DL Methionine Substances 0.000 description 1
- 241000499566 Eimeria brunetti Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XIILFRYLHKYCPV-UHFFFAOYSA-N N-[4-[(4-but-2-ynoxy-1,2,5-thiadiazol-3-yl)sulfamoyl]phenyl]acetamide Chemical compound C(C#CC)OC1=NSN=C1NS(=O)(C1=CC=C(C=C1)NC(C)=O)=O XIILFRYLHKYCPV-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 238000005905 alkynylation reaction Methods 0.000 description 1
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229960002079 calcium pantothenate Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229960003178 choline chloride Drugs 0.000 description 1
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 1
- 230000002192 coccidiostatic effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003736 gastrointestinal content Anatomy 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- FFEARJCKVFRZRR-UHFFFAOYSA-N methionine Chemical compound CSCCC(N)C(O)=O FFEARJCKVFRZRR-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 235000006109 methionine Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PKOFBDHYTMYVGJ-UHFFFAOYSA-N n-(4-sulfamoylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S(N)(=O)=O)C=C1 PKOFBDHYTMYVGJ-UHFFFAOYSA-N 0.000 description 1
- VGYAUYNBRQPION-UHFFFAOYSA-N n-(4-sulfamoylphenyl)benzamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1NC(=O)C1=CC=CC=C1 VGYAUYNBRQPION-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 210000003250 oocyst Anatomy 0.000 description 1
- 210000000287 oocyte Anatomy 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 235000015099 wheat brans Nutrition 0.000 description 1
Publications (1)
Publication Number | Publication Date |
---|---|
PL59248B1 true PL59248B1 (cs) | 1969-12-29 |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4089975A (en) | Method of controlling manure-breeding insects | |
EP0015124B1 (en) | Parasiticidal heterocyclic ether derivatives, processes for the manufacture thereof and compositions thereof | |
NO165145B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 1h-imidazo-(4,5-c)-kinolin-4-aminderivater. | |
DE2125245C3 (de) | Isoflavone und Verfahren zu deren Herstellung | |
JPS6028836B2 (ja) | 5−メチル−イソフラボン誘導体の製造方法 | |
DE3408768A1 (de) | Immunstimulierende mittel | |
US4025532A (en) | 2-(O-Tolyl)imino-1,3-dithioles, a method for preparing the same, and their utilization as ixodicides | |
US4088770A (en) | Substituted 2-anilinobenzoxazoles used as immunosuppressive agents | |
PL59248B1 (cs) | ||
CA1250576A (en) | Quinazolin-4-one-3-acetonyl hydrazone and their use against coccidiosis | |
US3331738A (en) | 3-iodo-4-hydroxy-5-nitrobenzonitrile as an anthelmintic | |
JPS6116399B2 (cs) | ||
DE2143570A1 (de) | Pharmazeutisch wirksame Ätherverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
US4822814A (en) | New 1,3-dithiol-2-ylidene-alkylsulfonylacetates and their uses | |
US4275210A (en) | Substituted 2-anilinobenzoxazoles | |
US3773943A (en) | Alpha,alpha,alpha-trifluoro-6-substituted-5-nitro-m-toluic acid,5'-nitrofurylidene hydrazide compounds as growth promotants | |
US3001909A (en) | Coccidiosis control composition | |
US3075877A (en) | Anticoccidial compositions comprising 5-nitro-2-furaldehyde cyanoacetyl or dichloroacetyl-hydrazone | |
US2877154A (en) | Anthelmintic compositions containing chlorine substituted amides and methods for using same | |
US3786050A (en) | Diphenyl sulfones | |
US2929713A (en) | Preparation of coumestrol esters and use thereof | |
US4764534A (en) | Anticoccidial naphthalenamines and combinations thereof | |
SU1709909A3 (ru) | Способ получени производных /2-тиенилметил/-тиомочевины | |
US3466327A (en) | Benzoic acid hydrazide derivatives and compositions | |
US3467653A (en) | Anticoccidial sulfanilamidothiadiazoles |