PL47087B1 - - Google Patents
Download PDFInfo
- Publication number
- PL47087B1 PL47087B1 PL47087A PL4708760A PL47087B1 PL 47087 B1 PL47087 B1 PL 47087B1 PL 47087 A PL47087 A PL 47087A PL 4708760 A PL4708760 A PL 4708760A PL 47087 B1 PL47087 B1 PL 47087B1
- Authority
- PL
- Poland
- Prior art keywords
- halogen
- hydrogen
- quinazoline derivative
- general formula
- alkylthio
- Prior art date
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims 15
- 229910052736 halogen Inorganic materials 0.000 claims 8
- 150000002367 halogens Chemical group 0.000 claims 8
- 125000000217 alkyl group Chemical group 0.000 claims 7
- 229910052739 hydrogen Inorganic materials 0.000 claims 7
- 239000001257 hydrogen Substances 0.000 claims 7
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 claims 6
- 125000004414 alkyl thio group Chemical group 0.000 claims 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 150000007529 inorganic bases Chemical class 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 2
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical class N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 claims 1
- 125000004442 acylamino group Chemical group 0.000 claims 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- -1 nitro, amino Chemical group 0.000 claims 1
- 125000001453 quaternary ammonium group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- ONHUMNWRIVWZHH-UHFFFAOYSA-N n-[(2-amino-5-nitrophenyl)-phenylmethylidene]hydroxylamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(=NO)C1=CC=CC=C1 ONHUMNWRIVWZHH-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- PZPZDEIASIKHPY-UHFFFAOYSA-N (2-amino-5-nitrophenyl)-phenylmethanone Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=CC=C1 PZPZDEIASIKHPY-UHFFFAOYSA-N 0.000 description 1
- KJYDELJAWGDQPO-UHFFFAOYSA-N 2-(chloromethyl)-6-nitro-3-oxido-4-phenylquinazolin-3-ium Chemical compound ClCC1=NC2=CC=C(C=C2C(=[N+]1[O-])C1=CC=CC=C1)[N+](=O)[O-] KJYDELJAWGDQPO-UHFFFAOYSA-N 0.000 description 1
- OHNISMFYEZSZNG-UHFFFAOYSA-N BrC=1C=CC2=C(C(=[N+](CC(N2)=O)[O-])C2=CC=C(C=C2)C)C1 Chemical compound BrC=1C=CC2=C(C(=[N+](CC(N2)=O)[O-])C2=CC=C(C=C2)C)C1 OHNISMFYEZSZNG-UHFFFAOYSA-N 0.000 description 1
- MCTYNVDBNGNARP-UHFFFAOYSA-N CC=1C(=CC2=C(C(=[N+](CC(N2)=O)[O-])C2=CC=CC=C2)C1)C Chemical compound CC=1C(=CC2=C(C(=[N+](CC(N2)=O)[O-])C2=CC=CC=C2)C1)C MCTYNVDBNGNARP-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- KTJBKMAOHBRUTF-UHFFFAOYSA-N ClC=1C=CC2=C(C(=[N+](CC(N2)=O)[O-])C2=CC=C(C=C2)Cl)C1 Chemical compound ClC=1C=CC2=C(C(=[N+](CC(N2)=O)[O-])C2=CC=C(C=C2)Cl)C1 KTJBKMAOHBRUTF-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- OJDGPERBKOETAX-UHFFFAOYSA-N [O-][N+]1=C(c2ccccc2Cl)c2cc(Cl)ccc2NC(=O)C1 Chemical compound [O-][N+]1=C(c2ccccc2Cl)c2cc(Cl)ccc2NC(=O)C1 OJDGPERBKOETAX-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL47087B1 true PL47087B1 (Sortimente) | 1963-06-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4503054A (en) | 6-Aryl-1,2,4-triazin-6-ones which possess cardiotonic properties | |
| US3879522A (en) | New 2,3-dihydro-1,4-benzoxazines in compositions effecting the central nervous system | |
| CA1254207A (en) | THERAPEUTICALLY USEFUL IMIDAZO¬1,2-.alpha.|PYRIDINE DERIVATIVES | |
| FR2540871A1 (fr) | Amino-2 phenyl-5 benzodiazepines-1,3; procede de preparation et medicaments les contenant | |
| DE1620533A1 (de) | Verfahren zur Herstellung von neuen in 10-Stellung substituierten Dibenz[b,f][14]oxazepin-11(1OH)-onen | |
| US4013665A (en) | Antiviral, substituted 1,3-dimethyl-1h-pyrazolo(3,4b)quinolines | |
| PL119641B1 (en) | Process for preparing novel,condensed derivatives of pyrimidine pirimidina | |
| CA1073904A (en) | Substituted 6-aryl-4h-s-triazolo-(3,4c)-thieno-(2,3e)-1,4-diazepines and processes for production thereof | |
| SU1169538A3 (ru) | Способ получени трициклических соединений | |
| US3888983A (en) | Derivatives of thiazolino-pyrimidin-6-ones, in inducing analgesia | |
| US3654275A (en) | Quinoxalinecarboxamide antiinflammatory agents | |
| US3176017A (en) | Aroylalkyl derivatives of diazabicyclo-nonanes and-decanes | |
| US3661925A (en) | Process for the preparation of 2-benzimidazolecarboxamides | |
| US3121074A (en) | Nitro substituted jh-l | |
| CA1130806A (en) | 1,2,4-oxadiazole derivatives, their preparation and pharmaceutical use | |
| PL141127B1 (en) | Method of obtaining bis-/piperazinylo or homopiperazinylo/-alkanes | |
| PL47087B1 (Sortimente) | ||
| US3272816A (en) | 7-amino-2, 4-dioxo-1, 2, 3, 4-tetrahydropyrido[2, 3-d]pyrimidines | |
| US3740413A (en) | 2-benzimidazolecarboxamides | |
| US3751412A (en) | 2-amino-1,5-benzodiazocine derivatives | |
| US3849438A (en) | 2-substituted-3-disubstituted-4,5,6,7-substituted or unsubstituted phthalimidines | |
| CA1219264A (en) | Benzobisoxazinetetrones | |
| US3846412A (en) | Dihydro-2-amino-isoquinolines and their derivatives | |
| US3712889A (en) | Oxodihydrobenzothiazine-s-dioxides | |
| US3329701A (en) | Cyanobenzophenones |