PL40823B1 - - Google Patents
Download PDFInfo
- Publication number
- PL40823B1 PL40823B1 PL40823A PL4082356A PL40823B1 PL 40823 B1 PL40823 B1 PL 40823B1 PL 40823 A PL40823 A PL 40823A PL 4082356 A PL4082356 A PL 4082356A PL 40823 B1 PL40823 B1 PL 40823B1
- Authority
- PL
- Poland
- Prior art keywords
- chloride
- general formula
- residing
- acid
- pssp
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 150000007513 acids Chemical class 0.000 description 7
- 239000002904 solvent Substances 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- -1 di-n-propoxyphosphinylsulfenyl chloride Chemical compound 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- LIMPRBWQNDVVEY-UHFFFAOYSA-N diethoxyphosphoryl thiohypochlorite Chemical compound CCOP(=O)(SCl)OCC LIMPRBWQNDVVEY-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PKUWKAXTAVNIJR-UHFFFAOYSA-N O,O-diethyl hydrogen thiophosphate Chemical compound CCOP(O)(=S)OCC PKUWKAXTAVNIJR-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL40823B1 true PL40823B1 (enExample) | 1957-12-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Smith | Chemistry of Sulfur Tetrafluoride. VIII. Synthesis of Phenylfluorophosphoranes and Phenylarsenic (V) Fluorides1 | |
| US2792394A (en) | Preparation of sulfenyl dithiocarbamates | |
| US2632018A (en) | Halogen-containing phosphorus acids and esters | |
| US3089890A (en) | Method of purification for phosphorochloridothioates | |
| US3836524A (en) | Preparation of esters of thiocarbamic acids | |
| US20090253931A1 (en) | Process for the preparation of highly purified, dialkydithiophosphinic compounds | |
| US2685602A (en) | Alkene phosphonous dichlorides and methods of making the same | |
| US2690451A (en) | Method for preparation of sulfur-containing esters of phosphoric acid | |
| PL40823B1 (enExample) | ||
| CA1099279A (en) | Process for preparing dialkyl phosphorochloridothioates | |
| Stirling | 713. The reactions of phosphorothiolates with halogens | |
| US3983178A (en) | Immonium salts and derivatives thereof | |
| US2929843A (en) | Process for the manufacture of methyl dichloro phosphine oxide | |
| US2692893A (en) | Method of preparing dialkyl chlorothiophosphates | |
| Tsurugi et al. | Aralkyl hydrodisulfides. XI. Reaction with amines | |
| US4025586A (en) | Preparation of dialkyl phosphorochloridothioates | |
| US3098866A (en) | Process for decolorizing and purifying omicron, omicron-dialkylthiophosphoryl chlorides and thiohosphate condensates formed therefrom | |
| US3781389A (en) | Process for the production of substituted thionophosphoryl chlorides | |
| US3256328A (en) | Fluorine-containing sulfenyl chlorides | |
| JPS5949233B2 (ja) | O,o−ジアルキルチオノ燐酸クロリドの製造法 | |
| US4374783A (en) | O,O-Dialkyl-s-(2,3,4-trichloro)butyl thiophosphate | |
| US4069340A (en) | Immonium salts and derivatives thereof | |
| WO1979000172A1 (en) | Process for manufacturing substantially pure dialkyl phosporochloridothionates | |
| US3209036A (en) | Chemical compound and method of manufacture | |
| Lyashenko et al. | Reactions of O-(alkylchloroformoimino)-trichloromethylphosphoranes with S-nucleophiles |