NZ553277A - Novel azabicyclic aryl derivatives and their medical use - Google Patents
Novel azabicyclic aryl derivatives and their medical useInfo
- Publication number
- NZ553277A NZ553277A NZ553277A NZ55327705A NZ553277A NZ 553277 A NZ553277 A NZ 553277A NZ 553277 A NZ553277 A NZ 553277A NZ 55327705 A NZ55327705 A NZ 55327705A NZ 553277 A NZ553277 A NZ 553277A
- Authority
- NZ
- New Zealand
- Prior art keywords
- aza
- pyridazin
- bicyclo
- yloxy
- octane
- Prior art date
Links
- 125000003118 aryl group Chemical group 0.000 title claims description 32
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 94
- 201000010099 disease Diseases 0.000 claims abstract description 49
- 150000003839 salts Chemical class 0.000 claims abstract description 28
- 238000011282 treatment Methods 0.000 claims abstract description 24
- 239000000203 mixture Substances 0.000 claims abstract description 23
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 13
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims abstract description 11
- 102000005962 receptors Human genes 0.000 claims abstract description 10
- 108020003175 receptors Proteins 0.000 claims abstract description 10
- 108010009685 Cholinergic Receptors Proteins 0.000 claims abstract description 8
- 239000003814 drug Substances 0.000 claims abstract description 5
- 238000004519 manufacturing process Methods 0.000 claims abstract description 3
- 102000034337 acetylcholine receptors Human genes 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 69
- -1 selenophenyl Chemical group 0.000 claims description 52
- 208000035475 disorder Diseases 0.000 claims description 43
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 125000003545 alkoxy group Chemical group 0.000 claims description 28
- 125000000623 heterocyclic group Chemical group 0.000 claims description 23
- 125000001424 substituent group Chemical group 0.000 claims description 23
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 22
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 21
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 21
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 125000004952 trihaloalkoxy group Chemical group 0.000 claims description 19
- 125000004385 trihaloalkyl group Chemical group 0.000 claims description 19
- 125000001544 thienyl group Chemical group 0.000 claims description 16
- 125000002911 monocyclic heterocycle group Chemical group 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 11
- 208000002193 Pain Diseases 0.000 claims description 10
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000002541 furyl group Chemical group 0.000 claims description 9
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 9
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 9
- 125000002971 oxazolyl group Chemical group 0.000 claims description 9
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 8
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 7
- 208000024827 Alzheimer disease Diseases 0.000 claims description 7
- 208000007271 Substance Withdrawal Syndrome Diseases 0.000 claims description 7
- 125000002618 bicyclic heterocycle group Chemical group 0.000 claims description 7
- 125000002883 imidazolyl group Chemical group 0.000 claims description 7
- 208000032841 Bulimia Diseases 0.000 claims description 6
- 206010006550 Bulimia nervosa Diseases 0.000 claims description 6
- 206010010904 Convulsion Diseases 0.000 claims description 6
- 206010012735 Diarrhoea Diseases 0.000 claims description 6
- 206010020651 Hyperkinesia Diseases 0.000 claims description 6
- 208000000269 Hyperkinesis Diseases 0.000 claims description 6
- 206010043118 Tardive Dyskinesia Diseases 0.000 claims description 6
- 230000006735 deficit Effects 0.000 claims description 6
- 206010015037 epilepsy Diseases 0.000 claims description 6
- 125000001041 indolyl group Chemical group 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 208000011580 syndromic disease Diseases 0.000 claims description 6
- 208000019901 Anxiety disease Diseases 0.000 claims description 5
- 208000021384 Obsessive-Compulsive disease Diseases 0.000 claims description 5
- 230000036506 anxiety Effects 0.000 claims description 5
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 5
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 5
- 230000002265 prevention Effects 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 5
- GYEAYFHZMBIDHM-UHFFFAOYSA-N 3-[6-(2-pyridin-2-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CC=N1 GYEAYFHZMBIDHM-UHFFFAOYSA-N 0.000 claims description 4
- YBVYUFORDATUOZ-UHFFFAOYSA-N 3-[6-(2-pyridin-3-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CN=C1 YBVYUFORDATUOZ-UHFFFAOYSA-N 0.000 claims description 4
- VBHDJFYVKSCFIO-UHFFFAOYSA-N 3-[6-[2-(4-chlorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(Cl)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 VBHDJFYVKSCFIO-UHFFFAOYSA-N 0.000 claims description 4
- PZAILFSUYRYJHR-UHFFFAOYSA-N 3-[6-[2-(4-fluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(F)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 PZAILFSUYRYJHR-UHFFFAOYSA-N 0.000 claims description 4
- CGKPBRIKCHMNLK-UHFFFAOYSA-N 3-[6-[2-(6-methoxynaphthalen-2-yl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1N(CC2)CCC2C1OC(N=N1)=CC=C1C#CC1=CC2=CC=C(OC)C=C2C=C1 CGKPBRIKCHMNLK-UHFFFAOYSA-N 0.000 claims description 4
- VQLKUBDMYNNMRQ-UHFFFAOYSA-N 3-[6-[2-[2-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC(F)(F)C1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 VQLKUBDMYNNMRQ-UHFFFAOYSA-N 0.000 claims description 4
- JAIRXOCRPAYPQE-UHFFFAOYSA-N 3-[6-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC(F)(F)C1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 JAIRXOCRPAYPQE-UHFFFAOYSA-N 0.000 claims description 4
- XCVKSCYPLKCXCE-UHFFFAOYSA-N 3-[6-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(C(F)(F)F)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 XCVKSCYPLKCXCE-UHFFFAOYSA-N 0.000 claims description 4
- 208000026097 Factitious disease Diseases 0.000 claims description 4
- 206010039966 Senile dementia Diseases 0.000 claims description 4
- 239000000872 buffer Substances 0.000 claims description 4
- 230000004064 dysfunction Effects 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 4
- 125000004306 triazinyl group Chemical group 0.000 claims description 4
- 125000001425 triazolyl group Chemical group 0.000 claims description 4
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 claims description 3
- YKKIATAPPZNTRB-UHFFFAOYSA-N 3-[6-(2-pyridin-4-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=NC=C1 YKKIATAPPZNTRB-UHFFFAOYSA-N 0.000 claims description 3
- KBZWDHLBZUNDLT-UHFFFAOYSA-N 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC(F)=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 KBZWDHLBZUNDLT-UHFFFAOYSA-N 0.000 claims description 3
- XFWVOBNMDZIXEJ-UHFFFAOYSA-N 3-[6-[2-(3-methylimidazol-4-yl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound CN1C=NC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 XFWVOBNMDZIXEJ-UHFFFAOYSA-N 0.000 claims description 3
- 208000030507 AIDS Diseases 0.000 claims description 3
- 206010002383 Angina Pectoris Diseases 0.000 claims description 3
- 208000000103 Anorexia Nervosa Diseases 0.000 claims description 3
- 208000006096 Attention Deficit Disorder with Hyperactivity Diseases 0.000 claims description 3
- 208000036864 Attention deficit/hyperactivity disease Diseases 0.000 claims description 3
- 206010003805 Autism Diseases 0.000 claims description 3
- 208000020706 Autistic disease Diseases 0.000 claims description 3
- 208000020925 Bipolar disease Diseases 0.000 claims description 3
- 206010008874 Chronic Fatigue Syndrome Diseases 0.000 claims description 3
- 208000019888 Circadian rhythm sleep disease Diseases 0.000 claims description 3
- 206010009900 Colitis ulcerative Diseases 0.000 claims description 3
- 206010012289 Dementia Diseases 0.000 claims description 3
- 208000023105 Huntington disease Diseases 0.000 claims description 3
- 206010020772 Hypertension Diseases 0.000 claims description 3
- 206010020850 Hyperthyroidism Diseases 0.000 claims description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 claims description 3
- 208000001456 Jet Lag Syndrome Diseases 0.000 claims description 3
- 206010026749 Mania Diseases 0.000 claims description 3
- 208000026139 Memory disease Diseases 0.000 claims description 3
- 208000019695 Migraine disease Diseases 0.000 claims description 3
- 206010028403 Mutism Diseases 0.000 claims description 3
- 208000008589 Obesity Diseases 0.000 claims description 3
- 208000018737 Parkinson disease Diseases 0.000 claims description 3
- 208000004983 Phantom Limb Diseases 0.000 claims description 3
- 206010056238 Phantom pain Diseases 0.000 claims description 3
- 208000008348 Post-Concussion Syndrome Diseases 0.000 claims description 3
- 208000004550 Postoperative Pain Diseases 0.000 claims description 3
- 206010036600 Premature labour Diseases 0.000 claims description 3
- 206010052276 Pseudodementia Diseases 0.000 claims description 3
- 206010041250 Social phobia Diseases 0.000 claims description 3
- 208000000323 Tourette Syndrome Diseases 0.000 claims description 3
- 230000001154 acute effect Effects 0.000 claims description 3
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 claims description 3
- 206010003119 arrhythmia Diseases 0.000 claims description 3
- 230000006793 arrhythmia Effects 0.000 claims description 3
- 208000006673 asthma Diseases 0.000 claims description 3
- 208000015802 attention deficit-hyperactivity disease Diseases 0.000 claims description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 230000027455 binding Effects 0.000 claims description 3
- 208000028683 bipolar I disease Diseases 0.000 claims description 3
- 230000001684 chronic effect Effects 0.000 claims description 3
- 208000010877 cognitive disease Diseases 0.000 claims description 3
- 230000036461 convulsion Effects 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 206010013932 dyslexia Diseases 0.000 claims description 3
- 230000001856 erectile effect Effects 0.000 claims description 3
- 230000002757 inflammatory effect Effects 0.000 claims description 3
- 208000033915 jet lag type circadian rhythm sleep disease Diseases 0.000 claims description 3
- 125000005647 linker group Chemical group 0.000 claims description 3
- 230000029849 luteinization Effects 0.000 claims description 3
- 206010027599 migraine Diseases 0.000 claims description 3
- 208000029766 myalgic encephalomeyelitis/chronic fatigue syndrome Diseases 0.000 claims description 3
- 201000003631 narcolepsy Diseases 0.000 claims description 3
- 208000015122 neurodegenerative disease Diseases 0.000 claims description 3
- 230000007823 neuropathy Effects 0.000 claims description 3
- 201000001119 neuropathy Diseases 0.000 claims description 3
- 229960002715 nicotine Drugs 0.000 claims description 3
- 235000020824 obesity Nutrition 0.000 claims description 3
- 208000019906 panic disease Diseases 0.000 claims description 3
- 208000033808 peripheral neuropathy Diseases 0.000 claims description 3
- 208000028591 pheochromocytoma Diseases 0.000 claims description 3
- 206010036596 premature ejaculation Diseases 0.000 claims description 3
- 230000000306 recurrent effect Effects 0.000 claims description 3
- 201000000980 schizophrenia Diseases 0.000 claims description 3
- 230000020341 sensory perception of pain Effects 0.000 claims description 3
- 208000017520 skin disease Diseases 0.000 claims description 3
- 208000005057 thyrotoxicosis Diseases 0.000 claims description 3
- 208000002271 trichotillomania Diseases 0.000 claims description 3
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 claims description 2
- YNWCPUAHDWIRLJ-UHFFFAOYSA-N 3-[4-(2-phenylethynyl)phenoxy]-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(C=C1)=CC=C1C#CC1=CC=CC=C1 YNWCPUAHDWIRLJ-UHFFFAOYSA-N 0.000 claims description 2
- HBDKMKSCGQGTQR-UHFFFAOYSA-N 3-[4-[2-(3-fluorophenyl)ethynyl]phenoxy]-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC=CC(C#CC=2C=CC(OC3C4CCN(CC4)C3)=CC=2)=C1 HBDKMKSCGQGTQR-UHFFFAOYSA-N 0.000 claims description 2
- GBCWWFFIDIIHRX-UHFFFAOYSA-N 3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CC=C1 GBCWWFFIDIIHRX-UHFFFAOYSA-N 0.000 claims description 2
- MUUUWBFOBOZNAB-UHFFFAOYSA-N 3-[6-(2-thiophen-3-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC=1C=CSC=1 MUUUWBFOBOZNAB-UHFFFAOYSA-N 0.000 claims description 2
- NUDYGJZXQFIZHO-UHFFFAOYSA-N 3-[6-[2-(3,5-dimethoxyphenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound COC1=CC(OC)=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 NUDYGJZXQFIZHO-UHFFFAOYSA-N 0.000 claims description 2
- UDYNGLMVVWUSRP-UHFFFAOYSA-N 3-[6-[2-(4-methoxyphenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(OC)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 UDYNGLMVVWUSRP-UHFFFAOYSA-N 0.000 claims description 2
- WTIWLMMJSGFSET-UHFFFAOYSA-N 4-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]aniline Chemical compound C1=CC(N)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 WTIWLMMJSGFSET-UHFFFAOYSA-N 0.000 claims description 2
- 241000124008 Mammalia Species 0.000 claims description 2
- 206010036618 Premenstrual syndrome Diseases 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 6
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical compound C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 claims 3
- 238000003556 assay Methods 0.000 claims 2
- 230000009871 nonspecific binding Effects 0.000 claims 2
- 230000009870 specific binding Effects 0.000 claims 2
- 229930182840 (S)-nicotine Natural products 0.000 claims 1
- 239000003365 glass fiber Substances 0.000 claims 1
- 238000011534 incubation Methods 0.000 claims 1
- 238000005567 liquid scintillation counting Methods 0.000 claims 1
- 206010027175 memory impairment Diseases 0.000 claims 1
- 239000012085 test solution Substances 0.000 claims 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical class C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 abstract description 2
- 238000000034 method Methods 0.000 description 29
- 125000005843 halogen group Chemical group 0.000 description 21
- 102000019315 Nicotinic acetylcholine receptors Human genes 0.000 description 16
- 108050006807 Nicotinic acetylcholine receptors Proteins 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 10
- 125000002837 carbocyclic group Chemical group 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 description 8
- 210000003169 central nervous system Anatomy 0.000 description 7
- 230000001713 cholinergic effect Effects 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- 230000003287 optical effect Effects 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 102000009660 Cholinergic Receptors Human genes 0.000 description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 6
- HPCRQUVIHCWSAI-UHFFFAOYSA-N 3-(6-iodopyridazin-3-yl)oxy-1-azabicyclo[2.2.2]octane Chemical compound N1=NC(I)=CC=C1OC1C(CC2)CCN2C1 HPCRQUVIHCWSAI-UHFFFAOYSA-N 0.000 description 5
- 238000007796 conventional method Methods 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 230000004770 neurodegeneration Effects 0.000 description 5
- 210000001428 peripheral nervous system Anatomy 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- 102000014415 Muscarinic acetylcholine receptor Human genes 0.000 description 4
- 108050003473 Muscarinic acetylcholine receptor Proteins 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 4
- 230000007812 deficiency Effects 0.000 description 4
- 229960004132 diethyl ether Drugs 0.000 description 4
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 230000016160 smooth muscle contraction Effects 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- CGQMKTZPTXMPGJ-UHFFFAOYSA-N 3-(4-iodophenoxy)-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(I)=CC=C1OC1C(CC2)CCN2C1 CGQMKTZPTXMPGJ-UHFFFAOYSA-N 0.000 description 3
- PXQPUJNDUJHXRS-UHFFFAOYSA-N 3-[6-(2-naphthalen-2-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC=CC2=CC(C#CC3=CC=C(N=N3)OC3C4CCN(C3)CC4)=CC=C21 PXQPUJNDUJHXRS-UHFFFAOYSA-N 0.000 description 3
- AUWPHMPQFLCOOE-UHFFFAOYSA-N 3-[6-[2-(2-chlorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound ClC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 AUWPHMPQFLCOOE-UHFFFAOYSA-N 0.000 description 3
- VDEPQFNAXXSJAK-UHFFFAOYSA-N 3-[6-[2-(2-fluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 VDEPQFNAXXSJAK-UHFFFAOYSA-N 0.000 description 3
- PCFCQWAICOJBMH-UHFFFAOYSA-N 3-[6-[2-(2-nitrophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound [O-][N+](=O)C1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 PCFCQWAICOJBMH-UHFFFAOYSA-N 0.000 description 3
- NMTHHTUPHIMPMU-UHFFFAOYSA-N 3-[6-[2-(3-nitrophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound [O-][N+](=O)C1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 NMTHHTUPHIMPMU-UHFFFAOYSA-N 0.000 description 3
- HYLGRIAEGICHPR-UHFFFAOYSA-N 3-[6-[2-(4-nitrophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC([N+](=O)[O-])=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 HYLGRIAEGICHPR-UHFFFAOYSA-N 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 208000027866 inflammatory disease Diseases 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- XWIFEJCBRIMSJB-UHFFFAOYSA-N 2-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]aniline Chemical compound NC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 XWIFEJCBRIMSJB-UHFFFAOYSA-N 0.000 description 2
- IDDADLGMXRUAAJ-UHFFFAOYSA-N 3-[6-[2-(3-fluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 IDDADLGMXRUAAJ-UHFFFAOYSA-N 0.000 description 2
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 2
- 208000002874 Acne Vulgaris Diseases 0.000 description 2
- 108060003345 Adrenergic Receptor Proteins 0.000 description 2
- 102000017910 Adrenergic receptor Human genes 0.000 description 2
- 206010002660 Anoxia Diseases 0.000 description 2
- 241000976983 Anoxia Species 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 108010078791 Carrier Proteins Proteins 0.000 description 2
- 102000015554 Dopamine receptor Human genes 0.000 description 2
- 108050004812 Dopamine receptor Proteins 0.000 description 2
- 208000030814 Eating disease Diseases 0.000 description 2
- 208000017701 Endocrine disease Diseases 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- 208000019454 Feeding and Eating disease Diseases 0.000 description 2
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 2
- 206010021143 Hypoxia Diseases 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 241000208125 Nicotiana Species 0.000 description 2
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 2
- 108010029485 Protein Isoforms Proteins 0.000 description 2
- 102000001708 Protein Isoforms Human genes 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000005864 Sulphur Substances 0.000 description 2
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 2
- 229960004373 acetylcholine Drugs 0.000 description 2
- 206010000496 acne Diseases 0.000 description 2
- 230000007953 anoxia Effects 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229960003920 cocaine Drugs 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 229960002069 diamorphine Drugs 0.000 description 2
- 235000014632 disordered eating Nutrition 0.000 description 2
- 229960003638 dopamine Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000002124 endocrine Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 125000002496 methyl group Chemical class [H]C([H])([H])* 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 229960005181 morphine Drugs 0.000 description 2
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- 229940005483 opioid analgesics Drugs 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 201000004700 rosacea Diseases 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 230000001052 transient effect Effects 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- KPWKPGFLZGMMFX-VHSXEESVSA-N (-)-camphanic acid Chemical compound C1C[C@]2(C(O)=O)OC(=O)[C@@]1(C)C2(C)C KPWKPGFLZGMMFX-VHSXEESVSA-N 0.000 description 1
- KPWKPGFLZGMMFX-ZJUUUORDSA-N (1s,4r)-1,7,7-trimethyl-2-oxo-3-oxabicyclo[2.2.1]heptane-4-carboxylic acid Chemical compound C1C[C@@]2(C(O)=O)OC(=O)[C@]1(C)C2(C)C KPWKPGFLZGMMFX-ZJUUUORDSA-N 0.000 description 1
- IVLICPVPXWEGCA-SSDOTTSWSA-N (3s)-1-azabicyclo[2.2.2]octan-3-ol Chemical compound C1CC2[C@H](O)CN1CC2 IVLICPVPXWEGCA-SSDOTTSWSA-N 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 1
- WSWCOQWTEOXDQX-MQQKCMAXSA-M (E,E)-sorbate Chemical compound C\C=C\C=C\C([O-])=O WSWCOQWTEOXDQX-MQQKCMAXSA-M 0.000 description 1
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 description 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 1
- UZKBSZSTDQSMDR-UHFFFAOYSA-N 1-[(4-chlorophenyl)-phenylmethyl]piperazine Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)N1CCNCC1 UZKBSZSTDQSMDR-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- UYDJFXWILYZAEM-UHFFFAOYSA-N 3-(6-bromopyridazin-3-yl)oxy-1-azabicyclo[2.2.2]octane Chemical compound N1=NC(Br)=CC=C1OC1C(CC2)CCN2C1 UYDJFXWILYZAEM-UHFFFAOYSA-N 0.000 description 1
- UNPROPIGVAWRMD-UHFFFAOYSA-N 3-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]aniline Chemical compound NC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 UNPROPIGVAWRMD-UHFFFAOYSA-N 0.000 description 1
- NJBKKYUSIAGEGD-UHFFFAOYSA-N 3-[6-[2-(2,4-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC(F)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 NJBKKYUSIAGEGD-UHFFFAOYSA-N 0.000 description 1
- MGSBBEVEYLNZBM-UHFFFAOYSA-N 3-[6-[2-(3-chlorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound ClC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 MGSBBEVEYLNZBM-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- IVLICPVPXWEGCA-UHFFFAOYSA-N 3-quinuclidinol Chemical compound C1C[C@@H]2C(O)C[N@]1CC2 IVLICPVPXWEGCA-UHFFFAOYSA-N 0.000 description 1
- VSMDINRNYYEDRN-UHFFFAOYSA-N 4-iodophenol Chemical compound OC1=CC=C(I)C=C1 VSMDINRNYYEDRN-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 1
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 1
- 125000006164 6-membered heteroaryl group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N Alanine Chemical compound CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- 208000007848 Alcoholism Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000272079 Bungarus multicinctus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- ZGUNAGUHMKGQNY-SSDOTTSWSA-N D-alpha-phenylglycine Chemical compound OC(=O)[C@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-SSDOTTSWSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000272060 Elapidae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- NSGDYZCDUPSTQT-UHFFFAOYSA-N N-[5-bromo-1-[(4-fluorophenyl)methyl]-4-methyl-2-oxopyridin-3-yl]cycloheptanecarboxamide Chemical compound Cc1c(Br)cn(Cc2ccc(F)cc2)c(=O)c1NC(=O)C1CCCCCC1 NSGDYZCDUPSTQT-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000001431 Psychomotor Agitation Diseases 0.000 description 1
- 206010038743 Restlessness Diseases 0.000 description 1
- 241001303601 Rosacea Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 201000004810 Vascular dementia Diseases 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 201000007930 alcohol dependence Diseases 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 230000003281 allosteric effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 230000000035 biogenic effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000006931 brain damage Effects 0.000 description 1
- 231100000874 brain damage Toxicity 0.000 description 1
- 208000029028 brain injury Diseases 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical class C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 210000003710 cerebral cortex Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- 230000019771 cognition Effects 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000000032 diagnostic agent Substances 0.000 description 1
- 229940039227 diagnostic agent Drugs 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000003291 dopaminomimetic effect Effects 0.000 description 1
- 229950005627 embonate Drugs 0.000 description 1
- 229950011470 enantate Drugs 0.000 description 1
- 210000000750 endocrine system Anatomy 0.000 description 1
- 208000030172 endocrine system disease Diseases 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 206010021654 increased appetite Diseases 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000004807 localization Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000002175 menstrual effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 230000004118 muscle contraction Effects 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 238000002610 neuroimaging Methods 0.000 description 1
- 230000002232 neuromuscular Effects 0.000 description 1
- 210000000715 neuromuscular junction Anatomy 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000004031 partial agonist Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 230000000862 serotonergic effect Effects 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229940075554 sorbate Drugs 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 230000000472 traumatic effect Effects 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 208000037820 vascular cognitive impairment Diseases 0.000 description 1
- 239000002435 venom Substances 0.000 description 1
- 210000001048 venom Anatomy 0.000 description 1
- 231100000611 venom Toxicity 0.000 description 1
- 230000002747 voluntary effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US61859804P | 2004-10-15 | 2004-10-15 | |
| DKPA200401582 | 2004-10-15 | ||
| PCT/EP2005/055263 WO2006040352A1 (en) | 2004-10-15 | 2005-10-14 | Novel azabicyclic aryl derivatives and their medical use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ553277A true NZ553277A (en) | 2010-04-30 |
Family
ID=39509634
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ553277A NZ553277A (en) | 2004-10-15 | 2005-10-14 | Novel azabicyclic aryl derivatives and their medical use |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JP2008516930A (https=) |
| MX (1) | MX2007004245A (https=) |
| NZ (1) | NZ553277A (https=) |
-
2005
- 2005-10-14 JP JP2007536186A patent/JP2008516930A/ja not_active Abandoned
- 2005-10-14 NZ NZ553277A patent/NZ553277A/en not_active IP Right Cessation
- 2005-10-14 MX MX2007004245A patent/MX2007004245A/es active IP Right Grant
Also Published As
| Publication number | Publication date |
|---|---|
| JP2008516930A (ja) | 2008-05-22 |
| MX2007004245A (es) | 2007-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1532144B1 (en) | quinuclidine derivatives and their use | |
| US7750011B2 (en) | Diazabicyclic aryl derivatives and their medical use | |
| EP1805183B1 (en) | Novel diazabicyclic aryl derivatives and their medical use | |
| EP1562945A1 (en) | 1,4-diazabicyclo(3,2,2)nonane derivatives, preparation and therapeutical use thereof | |
| CA2554050A1 (en) | Diazabicyclic aryl derivatives as cholinergic receptor modulators | |
| EP1802616B1 (en) | Novel azabicyclic aryl derivatives and their medical use | |
| US7674899B2 (en) | Dimeric azacyclic compounds and their use | |
| US7223753B2 (en) | Diazabicyclic biaryl derivatives | |
| US7612074B2 (en) | Diazabicyclic aryl derivatives as cholinergy ligands | |
| NZ553277A (en) | Novel azabicyclic aryl derivatives and their medical use | |
| HK1106513B (en) | Novel azabicyclic aryl derivatives and their medical use | |
| MXPA06008748A (es) | Derivados arildiazabiciclos como moduladores del receptor colinérgico |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PSEA | Patent sealed | ||
| RENW | Renewal (renewal fees accepted) | ||
| LAPS | Patent lapsed |