JP2008516930A - 新規なアザ二環式アリール誘導体及びその医学的な使用 - Google Patents
新規なアザ二環式アリール誘導体及びその医学的な使用 Download PDFInfo
- Publication number
- JP2008516930A JP2008516930A JP2007536186A JP2007536186A JP2008516930A JP 2008516930 A JP2008516930 A JP 2008516930A JP 2007536186 A JP2007536186 A JP 2007536186A JP 2007536186 A JP2007536186 A JP 2007536186A JP 2008516930 A JP2008516930 A JP 2008516930A
- Authority
- JP
- Japan
- Prior art keywords
- aza
- bicyclo
- pyridazin
- yloxy
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 125000003118 aryl group Chemical group 0.000 title claims abstract description 45
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 105
- 201000010099 disease Diseases 0.000 claims abstract description 58
- 208000035475 disorder Diseases 0.000 claims abstract description 47
- 238000011282 treatment Methods 0.000 claims abstract description 23
- 239000000126 substance Substances 0.000 claims abstract description 13
- 102000005962 receptors Human genes 0.000 claims abstract description 12
- 108020003175 receptors Proteins 0.000 claims abstract description 12
- 208000002193 Pain Diseases 0.000 claims abstract description 11
- 210000003169 central nervous system Anatomy 0.000 claims abstract description 10
- 208000007271 Substance Withdrawal Syndrome Diseases 0.000 claims abstract description 8
- 230000004770 neurodegeneration Effects 0.000 claims abstract description 7
- 230000016160 smooth muscle contraction Effects 0.000 claims abstract description 5
- -1 cyano, amino Chemical group 0.000 claims description 59
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 125000003545 alkoxy group Chemical group 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 30
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 29
- 125000000623 heterocyclic group Chemical group 0.000 claims description 28
- 125000001424 substituent group Chemical group 0.000 claims description 28
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 25
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 24
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 24
- 125000004952 trihaloalkoxy group Chemical group 0.000 claims description 24
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 23
- 125000004385 trihaloalkyl group Chemical group 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 21
- 125000001544 thienyl group Chemical group 0.000 claims description 17
- 125000002837 carbocyclic group Chemical group 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 claims description 12
- 125000002911 monocyclic heterocycle group Chemical group 0.000 claims description 12
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000002541 furyl group Chemical group 0.000 claims description 9
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- 208000011580 syndromic disease Diseases 0.000 claims description 9
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- 125000002971 oxazolyl group Chemical group 0.000 claims description 8
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 8
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- 208000024827 Alzheimer disease Diseases 0.000 claims description 7
- 108010009685 Cholinergic Receptors Proteins 0.000 claims description 7
- 125000002618 bicyclic heterocycle group Chemical group 0.000 claims description 7
- 125000002883 imidazolyl group Chemical group 0.000 claims description 7
- 208000032841 Bulimia Diseases 0.000 claims description 6
- 206010006550 Bulimia nervosa Diseases 0.000 claims description 6
- 241001465754 Metazoa Species 0.000 claims description 6
- 208000021384 Obsessive-Compulsive disease Diseases 0.000 claims description 6
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 claims description 6
- 230000006735 deficit Effects 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 206010015037 epilepsy Diseases 0.000 claims description 6
- 208000013403 hyperactivity Diseases 0.000 claims description 6
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 206010043118 Tardive Dyskinesia Diseases 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000001041 indolyl group Chemical group 0.000 claims description 5
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 5
- 229960002715 nicotine Drugs 0.000 claims description 5
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 5
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 claims description 4
- 208000019901 Anxiety disease Diseases 0.000 claims description 4
- 208000028698 Cognitive impairment Diseases 0.000 claims description 4
- 206010010904 Convulsion Diseases 0.000 claims description 4
- 208000026097 Factitious disease Diseases 0.000 claims description 4
- 206010039966 Senile dementia Diseases 0.000 claims description 4
- 230000036506 anxiety Effects 0.000 claims description 4
- 208000010877 cognitive disease Diseases 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229940079593 drug Drugs 0.000 claims description 4
- 230000004064 dysfunction Effects 0.000 claims description 4
- 208000027866 inflammatory disease Diseases 0.000 claims description 4
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 claims description 4
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 4
- 125000004306 triazinyl group Chemical group 0.000 claims description 4
- 125000001425 triazolyl group Chemical group 0.000 claims description 4
- XWIFEJCBRIMSJB-UHFFFAOYSA-N 2-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]aniline Chemical compound NC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 XWIFEJCBRIMSJB-UHFFFAOYSA-N 0.000 claims description 3
- UNPROPIGVAWRMD-UHFFFAOYSA-N 3-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]aniline Chemical compound NC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 UNPROPIGVAWRMD-UHFFFAOYSA-N 0.000 claims description 3
- HBDKMKSCGQGTQR-UHFFFAOYSA-N 3-[4-[2-(3-fluorophenyl)ethynyl]phenoxy]-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC=CC(C#CC=2C=CC(OC3C4CCN(CC4)C3)=CC=2)=C1 HBDKMKSCGQGTQR-UHFFFAOYSA-N 0.000 claims description 3
- PXQPUJNDUJHXRS-UHFFFAOYSA-N 3-[6-(2-naphthalen-2-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC=CC2=CC(C#CC3=CC=C(N=N3)OC3C4CCN(C3)CC4)=CC=C21 PXQPUJNDUJHXRS-UHFFFAOYSA-N 0.000 claims description 3
- GYEAYFHZMBIDHM-UHFFFAOYSA-N 3-[6-(2-pyridin-2-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CC=N1 GYEAYFHZMBIDHM-UHFFFAOYSA-N 0.000 claims description 3
- YBVYUFORDATUOZ-UHFFFAOYSA-N 3-[6-(2-pyridin-3-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CN=C1 YBVYUFORDATUOZ-UHFFFAOYSA-N 0.000 claims description 3
- YKKIATAPPZNTRB-UHFFFAOYSA-N 3-[6-(2-pyridin-4-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=NC=C1 YKKIATAPPZNTRB-UHFFFAOYSA-N 0.000 claims description 3
- NJBKKYUSIAGEGD-UHFFFAOYSA-N 3-[6-[2-(2,4-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC(F)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 NJBKKYUSIAGEGD-UHFFFAOYSA-N 0.000 claims description 3
- AUWPHMPQFLCOOE-UHFFFAOYSA-N 3-[6-[2-(2-chlorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound ClC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 AUWPHMPQFLCOOE-UHFFFAOYSA-N 0.000 claims description 3
- VDEPQFNAXXSJAK-UHFFFAOYSA-N 3-[6-[2-(2-fluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 VDEPQFNAXXSJAK-UHFFFAOYSA-N 0.000 claims description 3
- PCFCQWAICOJBMH-UHFFFAOYSA-N 3-[6-[2-(2-nitrophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound [O-][N+](=O)C1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 PCFCQWAICOJBMH-UHFFFAOYSA-N 0.000 claims description 3
- KBZWDHLBZUNDLT-UHFFFAOYSA-N 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC(F)=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 KBZWDHLBZUNDLT-UHFFFAOYSA-N 0.000 claims description 3
- NUDYGJZXQFIZHO-UHFFFAOYSA-N 3-[6-[2-(3,5-dimethoxyphenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound COC1=CC(OC)=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 NUDYGJZXQFIZHO-UHFFFAOYSA-N 0.000 claims description 3
- MGSBBEVEYLNZBM-UHFFFAOYSA-N 3-[6-[2-(3-chlorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound ClC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 MGSBBEVEYLNZBM-UHFFFAOYSA-N 0.000 claims description 3
- IDDADLGMXRUAAJ-UHFFFAOYSA-N 3-[6-[2-(3-fluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 IDDADLGMXRUAAJ-UHFFFAOYSA-N 0.000 claims description 3
- XFWVOBNMDZIXEJ-UHFFFAOYSA-N 3-[6-[2-(3-methylimidazol-4-yl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound CN1C=NC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 XFWVOBNMDZIXEJ-UHFFFAOYSA-N 0.000 claims description 3
- NMTHHTUPHIMPMU-UHFFFAOYSA-N 3-[6-[2-(3-nitrophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound [O-][N+](=O)C1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 NMTHHTUPHIMPMU-UHFFFAOYSA-N 0.000 claims description 3
- VBHDJFYVKSCFIO-UHFFFAOYSA-N 3-[6-[2-(4-chlorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(Cl)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 VBHDJFYVKSCFIO-UHFFFAOYSA-N 0.000 claims description 3
- UDYNGLMVVWUSRP-UHFFFAOYSA-N 3-[6-[2-(4-methoxyphenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(OC)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 UDYNGLMVVWUSRP-UHFFFAOYSA-N 0.000 claims description 3
- HYLGRIAEGICHPR-UHFFFAOYSA-N 3-[6-[2-(4-nitrophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC([N+](=O)[O-])=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 HYLGRIAEGICHPR-UHFFFAOYSA-N 0.000 claims description 3
- CGKPBRIKCHMNLK-UHFFFAOYSA-N 3-[6-[2-(6-methoxynaphthalen-2-yl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1N(CC2)CCC2C1OC(N=N1)=CC=C1C#CC1=CC2=CC=C(OC)C=C2C=C1 CGKPBRIKCHMNLK-UHFFFAOYSA-N 0.000 claims description 3
- VQLKUBDMYNNMRQ-UHFFFAOYSA-N 3-[6-[2-[2-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC(F)(F)C1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 VQLKUBDMYNNMRQ-UHFFFAOYSA-N 0.000 claims description 3
- JAIRXOCRPAYPQE-UHFFFAOYSA-N 3-[6-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound FC(F)(F)C1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 JAIRXOCRPAYPQE-UHFFFAOYSA-N 0.000 claims description 3
- XCVKSCYPLKCXCE-UHFFFAOYSA-N 3-[6-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(C(F)(F)F)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 XCVKSCYPLKCXCE-UHFFFAOYSA-N 0.000 claims description 3
- WTIWLMMJSGFSET-UHFFFAOYSA-N 4-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]aniline Chemical compound C1=CC(N)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 WTIWLMMJSGFSET-UHFFFAOYSA-N 0.000 claims description 3
- GZHOJZSJMKDCQU-UHFFFAOYSA-N 5-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]-1h-indole Chemical compound C1=C2NC=CC2=CC(C#CC2=CC=C(N=N2)OC2C3CCN(C2)CC3)=C1 GZHOJZSJMKDCQU-UHFFFAOYSA-N 0.000 claims description 3
- 208000030507 AIDS Diseases 0.000 claims description 3
- 208000002874 Acne Vulgaris Diseases 0.000 claims description 3
- 201000004384 Alopecia Diseases 0.000 claims description 3
- 206010002383 Angina Pectoris Diseases 0.000 claims description 3
- 206010002660 Anoxia Diseases 0.000 claims description 3
- 241000976983 Anoxia Species 0.000 claims description 3
- 208000006096 Attention Deficit Disorder with Hyperactivity Diseases 0.000 claims description 3
- 208000036864 Attention deficit/hyperactivity disease Diseases 0.000 claims description 3
- 206010003805 Autism Diseases 0.000 claims description 3
- 208000020706 Autistic disease Diseases 0.000 claims description 3
- 208000020925 Bipolar disease Diseases 0.000 claims description 3
- 206010008874 Chronic Fatigue Syndrome Diseases 0.000 claims description 3
- 208000019888 Circadian rhythm sleep disease Diseases 0.000 claims description 3
- 206010009900 Colitis ulcerative Diseases 0.000 claims description 3
- 208000011231 Crohn disease Diseases 0.000 claims description 3
- 206010012289 Dementia Diseases 0.000 claims description 3
- 206010012735 Diarrhoea Diseases 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 claims description 3
- 208000023105 Huntington disease Diseases 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 206010020772 Hypertension Diseases 0.000 claims description 3
- 206010021143 Hypoxia Diseases 0.000 claims description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 claims description 3
- 208000001456 Jet Lag Syndrome Diseases 0.000 claims description 3
- 206010026749 Mania Diseases 0.000 claims description 3
- 208000019695 Migraine disease Diseases 0.000 claims description 3
- 241000208125 Nicotiana Species 0.000 claims description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims description 3
- 208000008589 Obesity Diseases 0.000 claims description 3
- 208000018737 Parkinson disease Diseases 0.000 claims description 3
- 208000004983 Phantom Limb Diseases 0.000 claims description 3
- 208000005374 Poisoning Diseases 0.000 claims description 3
- 208000008348 Post-Concussion Syndrome Diseases 0.000 claims description 3
- 208000004550 Postoperative Pain Diseases 0.000 claims description 3
- 208000005107 Premature Birth Diseases 0.000 claims description 3
- 206010036590 Premature baby Diseases 0.000 claims description 3
- 206010052276 Pseudodementia Diseases 0.000 claims description 3
- 206010000496 acne Diseases 0.000 claims description 3
- 230000001154 acute effect Effects 0.000 claims description 3
- 208000022531 anorexia Diseases 0.000 claims description 3
- 230000007953 anoxia Effects 0.000 claims description 3
- 230000006793 arrhythmia Effects 0.000 claims description 3
- 206010003119 arrhythmia Diseases 0.000 claims description 3
- 208000006673 asthma Diseases 0.000 claims description 3
- 208000015802 attention deficit-hyperactivity disease Diseases 0.000 claims description 3
- 229940049706 benzodiazepine Drugs 0.000 claims description 3
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 claims description 3
- 208000028683 bipolar I disease Diseases 0.000 claims description 3
- 230000001684 chronic effect Effects 0.000 claims description 3
- 229960003920 cocaine Drugs 0.000 claims description 3
- 230000036461 convulsion Effects 0.000 claims description 3
- 206010061428 decreased appetite Diseases 0.000 claims description 3
- 229960002069 diamorphine Drugs 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 206010013932 dyslexia Diseases 0.000 claims description 3
- 208000024963 hair loss Diseases 0.000 claims description 3
- 230000003676 hair loss Effects 0.000 claims description 3
- 201000009863 inflammatory diarrhea Diseases 0.000 claims description 3
- 230000002757 inflammatory effect Effects 0.000 claims description 3
- 208000033915 jet lag type circadian rhythm sleep disease Diseases 0.000 claims description 3
- 125000005647 linker group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 206010027175 memory impairment Diseases 0.000 claims description 3
- 206010027599 migraine Diseases 0.000 claims description 3
- 229960005181 morphine Drugs 0.000 claims description 3
- 208000029766 myalgic encephalomeyelitis/chronic fatigue syndrome Diseases 0.000 claims description 3
- ONEVHQBPAZMHSX-UHFFFAOYSA-N n-[2-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 ONEVHQBPAZMHSX-UHFFFAOYSA-N 0.000 claims description 3
- NQSGWKIJJNBFSD-UHFFFAOYSA-N n-[3-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(C#CC=2N=NC(OC3C4CCN(CC4)C3)=CC=2)=C1 NQSGWKIJJNBFSD-UHFFFAOYSA-N 0.000 claims description 3
- BATSDJUXECKTBY-UHFFFAOYSA-N n-[4-[2-[6-(1-azabicyclo[2.2.2]octan-3-yloxy)pyridazin-3-yl]ethynyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 BATSDJUXECKTBY-UHFFFAOYSA-N 0.000 claims description 3
- 201000003631 narcolepsy Diseases 0.000 claims description 3
- 208000015122 neurodegenerative disease Diseases 0.000 claims description 3
- 229940005483 opioid analgesics Drugs 0.000 claims description 3
- 208000019906 panic disease Diseases 0.000 claims description 3
- 208000033808 peripheral neuropathy Diseases 0.000 claims description 3
- 208000028591 pheochromocytoma Diseases 0.000 claims description 3
- 231100000572 poisoning Toxicity 0.000 claims description 3
- 230000000607 poisoning effect Effects 0.000 claims description 3
- 206010036596 premature ejaculation Diseases 0.000 claims description 3
- 230000000306 recurrent effect Effects 0.000 claims description 3
- 201000004700 rosacea Diseases 0.000 claims description 3
- 201000000980 schizophrenia Diseases 0.000 claims description 3
- 208000017520 skin disease Diseases 0.000 claims description 3
- 208000019116 sleep disease Diseases 0.000 claims description 3
- 208000020685 sleep-wake disease Diseases 0.000 claims description 3
- 210000001685 thyroid gland Anatomy 0.000 claims description 3
- 230000001052 transient effect Effects 0.000 claims description 3
- YNWCPUAHDWIRLJ-UHFFFAOYSA-N 3-[4-(2-phenylethynyl)phenoxy]-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(C=C1)=CC=C1C#CC1=CC=CC=C1 YNWCPUAHDWIRLJ-UHFFFAOYSA-N 0.000 claims description 2
- GBCWWFFIDIIHRX-UHFFFAOYSA-N 3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CC=C1 GBCWWFFIDIIHRX-UHFFFAOYSA-N 0.000 claims description 2
- MUUUWBFOBOZNAB-UHFFFAOYSA-N 3-[6-(2-thiophen-3-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC=1C=CSC=1 MUUUWBFOBOZNAB-UHFFFAOYSA-N 0.000 claims description 2
- PZAILFSUYRYJHR-UHFFFAOYSA-N 3-[6-[2-(4-fluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(F)=CC=C1C#CC(N=N1)=CC=C1OC1C(CC2)CCN2C1 PZAILFSUYRYJHR-UHFFFAOYSA-N 0.000 claims description 2
- 208000030814 Eating disease Diseases 0.000 claims description 2
- 208000019454 Feeding and Eating disease Diseases 0.000 claims description 2
- 241000282412 Homo Species 0.000 claims description 2
- 241000124008 Mammalia Species 0.000 claims description 2
- 206010056238 Phantom pain Diseases 0.000 claims description 2
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 claims description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 230000002920 convulsive effect Effects 0.000 claims description 2
- 235000014632 disordered eating Nutrition 0.000 claims description 2
- 210000000750 endocrine system Anatomy 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 235000020824 obesity Nutrition 0.000 claims description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 11
- 102000034337 acetylcholine receptors Human genes 0.000 claims 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims 2
- 208000012661 Dyskinesia Diseases 0.000 claims 1
- 208000010228 Erectile Dysfunction Diseases 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 201000001881 impotence Diseases 0.000 claims 1
- 230000000938 luteal effect Effects 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 68
- 102000019315 Nicotinic acetylcholine receptors Human genes 0.000 abstract description 16
- 108050006807 Nicotinic acetylcholine receptors Proteins 0.000 abstract description 16
- 230000001713 cholinergic effect Effects 0.000 abstract description 10
- 210000001428 peripheral nervous system Anatomy 0.000 abstract description 7
- 208000017701 Endocrine disease Diseases 0.000 abstract description 5
- 206010061218 Inflammation Diseases 0.000 abstract description 4
- 230000004054 inflammatory process Effects 0.000 abstract description 4
- 230000000144 pharmacologic effect Effects 0.000 abstract description 4
- 108010078791 Carrier Proteins Proteins 0.000 abstract description 3
- 208000030172 endocrine system disease Diseases 0.000 abstract description 3
- 239000003446 ligand Substances 0.000 abstract description 3
- 125000005843 halogen group Chemical group 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- HPCRQUVIHCWSAI-UHFFFAOYSA-N 3-(6-iodopyridazin-3-yl)oxy-1-azabicyclo[2.2.2]octane Chemical compound N1=NC(I)=CC=C1OC1C(CC2)CCN2C1 HPCRQUVIHCWSAI-UHFFFAOYSA-N 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 102000009660 Cholinergic Receptors Human genes 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- CGQMKTZPTXMPGJ-UHFFFAOYSA-N 3-(4-iodophenoxy)-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(I)=CC=C1OC1C(CC2)CCN2C1 CGQMKTZPTXMPGJ-UHFFFAOYSA-N 0.000 description 4
- 102000014415 Muscarinic acetylcholine receptor Human genes 0.000 description 4
- 108050003473 Muscarinic acetylcholine receptor Proteins 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 230000027455 binding Effects 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- 230000007547 defect Effects 0.000 description 4
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- SSRMAFONNPUBLF-WLHGVMLRSA-N (e)-but-2-enedioic acid;3-[4-(2-phenylethynyl)phenoxy]-1-azabicyclo[2.2.2]octane Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C2)CCC1C2OC(C=C1)=CC=C1C#CC1=CC=CC=C1 SSRMAFONNPUBLF-WLHGVMLRSA-N 0.000 description 2
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 2
- IVLICPVPXWEGCA-UHFFFAOYSA-N 3-quinuclidinol Chemical compound C1C[C@@H]2C(O)C[N@]1CC2 IVLICPVPXWEGCA-UHFFFAOYSA-N 0.000 description 2
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 108060003345 Adrenergic Receptor Proteins 0.000 description 2
- 102000017910 Adrenergic receptor Human genes 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 102000015554 Dopamine receptor Human genes 0.000 description 2
- 108050004812 Dopamine receptor Proteins 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 206010036618 Premenstrual syndrome Diseases 0.000 description 2
- 108010029485 Protein Isoforms Proteins 0.000 description 2
- 102000001708 Protein Isoforms Human genes 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 2
- 229960004373 acetylcholine Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 229960003638 dopamine Drugs 0.000 description 2
- 230000001856 erectile effect Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 2
- 125000002496 methyl group Chemical class [H]C([H])([H])* 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- KPWKPGFLZGMMFX-VHSXEESVSA-N (-)-camphanic acid Chemical compound C1C[C@]2(C(O)=O)OC(=O)[C@@]1(C)C2(C)C KPWKPGFLZGMMFX-VHSXEESVSA-N 0.000 description 1
- KPWKPGFLZGMMFX-ZJUUUORDSA-N (1s,4r)-1,7,7-trimethyl-2-oxo-3-oxabicyclo[2.2.1]heptane-4-carboxylic acid Chemical compound C1C[C@@]2(C(O)=O)OC(=O)[C@]1(C)C2(C)C KPWKPGFLZGMMFX-ZJUUUORDSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 1
- WSWCOQWTEOXDQX-MQQKCMAXSA-M (E,E)-sorbate Chemical compound C\C=C\C=C\C([O-])=O WSWCOQWTEOXDQX-MQQKCMAXSA-M 0.000 description 1
- 229930182840 (S)-nicotine Natural products 0.000 description 1
- QUICRFLMFHPXBX-WLHGVMLRSA-N (e)-but-2-enedioic acid;3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC1=CC=CC=C1 QUICRFLMFHPXBX-WLHGVMLRSA-N 0.000 description 1
- YJDCOEYLPNPOBB-WLHGVMLRSA-N (e)-but-2-enedioic acid;3-[6-(2-thiophen-3-ylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C2)CCC1C2OC(N=N1)=CC=C1C#CC=1C=CSC=1 YJDCOEYLPNPOBB-WLHGVMLRSA-N 0.000 description 1
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 description 1
- UZKBSZSTDQSMDR-UHFFFAOYSA-N 1-[(4-chlorophenyl)-phenylmethyl]piperazine Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)N1CCNCC1 UZKBSZSTDQSMDR-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- UYDJFXWILYZAEM-UHFFFAOYSA-N 3-(6-bromopyridazin-3-yl)oxy-1-azabicyclo[2.2.2]octane Chemical compound N1=NC(Br)=CC=C1OC1C(CC2)CCN2C1 UYDJFXWILYZAEM-UHFFFAOYSA-N 0.000 description 1
- NWXJCZHPCMOVFY-WLHGVMLRSA-N 3-(6-bromopyridazin-3-yl)oxy-1-azabicyclo[2.2.2]octane;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.N1=NC(Br)=CC=C1OC1C(CC2)CCN2C1 NWXJCZHPCMOVFY-WLHGVMLRSA-N 0.000 description 1
- QXFDBNDCWAPXKX-UHFFFAOYSA-N 3-[4-[2-(4-methoxyphenyl)ethynyl]phenoxy]-1-azabicyclo[2.2.2]octane Chemical compound C1=CC(OC)=CC=C1C#CC(C=C1)=CC=C1OC1C(CC2)CCN2C1 QXFDBNDCWAPXKX-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VSMDINRNYYEDRN-UHFFFAOYSA-N 4-iodophenol Chemical compound OC1=CC=C(I)C=C1 VSMDINRNYYEDRN-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 1
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 125000006164 6-membered heteroaryl group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N Alanine Chemical compound CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- 208000007848 Alcoholism Diseases 0.000 description 1
- 101710195183 Alpha-bungarotoxin Proteins 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000272074 Bungarus Species 0.000 description 1
- 0 CC1C(**I*)CN(*)CC1 Chemical compound CC1C(**I*)CN(*)CC1 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- ZGUNAGUHMKGQNY-SSDOTTSWSA-N D-alpha-phenylglycine Chemical compound OC(=O)[C@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-SSDOTTSWSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 206010028289 Muscle atrophy Diseases 0.000 description 1
- NSGDYZCDUPSTQT-UHFFFAOYSA-N N-[5-bromo-1-[(4-fluorophenyl)methyl]-4-methyl-2-oxopyridin-3-yl]cycloheptanecarboxamide Chemical compound Cc1c(Br)cn(Cc2ccc(F)cc2)c(=O)c1NC(=O)C1CCCCCC1 NSGDYZCDUPSTQT-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010034912 Phobia Diseases 0.000 description 1
- 208000001431 Psychomotor Agitation Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 206010038743 Restlessness Diseases 0.000 description 1
- 241000270295 Serpentes Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 201000007930 alcohol dependence Diseases 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 230000003281 allosteric effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000000035 biogenic effect Effects 0.000 description 1
- 208000029028 brain injury Diseases 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 210000003710 cerebral cortex Anatomy 0.000 description 1
- 208000013677 cerebrovascular dementia Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 230000019771 cognition Effects 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 210000004246 corpus luteum Anatomy 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 229940039227 diagnostic agent Drugs 0.000 description 1
- 239000000032 diagnostic agent Substances 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000003291 dopaminomimetic effect Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 235000005686 eating Nutrition 0.000 description 1
- 229950005627 embonate Drugs 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 206010021654 increased appetite Diseases 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 201000010901 lateral sclerosis Diseases 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005567 liquid scintillation counting Methods 0.000 description 1
- 230000004807 localization Effects 0.000 description 1
- 230000029849 luteinization Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- XLTANAWLDBYGFU-UHFFFAOYSA-N methyllycaconitine hydrochloride Natural products C1CC(OC)C2(C3C4OC)C5CC(C(C6)OC)C(OC)C5C6(O)C4(O)C2N(CC)CC31COC(=O)C1=CC=CC=C1N1C(=O)CC(C)C1=O XLTANAWLDBYGFU-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 208000005264 motor neuron disease Diseases 0.000 description 1
- 230000020763 muscle atrophy Effects 0.000 description 1
- 230000004118 muscle contraction Effects 0.000 description 1
- 201000000585 muscular atrophy Diseases 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 238000002610 neuroimaging Methods 0.000 description 1
- 230000002232 neuromuscular Effects 0.000 description 1
- 210000000715 neuromuscular junction Anatomy 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000004031 partial agonist Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 208000019899 phobic disease Diseases 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000020341 sensory perception of pain Effects 0.000 description 1
- 230000000862 serotonergic effect Effects 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229940075554 sorbate Drugs 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229940114926 stearate Drugs 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 239000002435 venom Substances 0.000 description 1
- 210000001048 venom Anatomy 0.000 description 1
- 231100000611 venom Toxicity 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- LYTCVQQGCSNFJU-LKGYBJPKSA-N α-bungarotoxin Chemical compound C(/[C@H]1O[C@H]2C[C@H]3O[C@@H](CC(=C)C=O)C[C@H](O)[C@]3(C)O[C@@H]2C[C@@H]1O[C@@H]1C2)=C/C[C@]1(C)O[C@H]1[C@@]2(C)O[C@]2(C)CC[C@@H]3O[C@@H]4C[C@]5(C)O[C@@H]6C(C)=CC(=O)O[C@H]6C[C@H]5O[C@H]4C[C@@H](C)[C@H]3O[C@H]2C1 LYTCVQQGCSNFJU-LKGYBJPKSA-N 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US61859804P | 2004-10-15 | 2004-10-15 | |
| DKPA200401582 | 2004-10-15 | ||
| PCT/EP2005/055263 WO2006040352A1 (en) | 2004-10-15 | 2005-10-14 | Novel azabicyclic aryl derivatives and their medical use |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2008516930A true JP2008516930A (ja) | 2008-05-22 |
| JP2008516930A5 JP2008516930A5 (https=) | 2008-12-04 |
Family
ID=39509634
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2007536186A Abandoned JP2008516930A (ja) | 2004-10-15 | 2005-10-14 | 新規なアザ二環式アリール誘導体及びその医学的な使用 |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JP2008516930A (https=) |
| MX (1) | MX2007004245A (https=) |
| NZ (1) | NZ553277A (https=) |
-
2005
- 2005-10-14 JP JP2007536186A patent/JP2008516930A/ja not_active Abandoned
- 2005-10-14 NZ NZ553277A patent/NZ553277A/en not_active IP Right Cessation
- 2005-10-14 MX MX2007004245A patent/MX2007004245A/es active IP Right Grant
Also Published As
| Publication number | Publication date |
|---|---|
| NZ553277A (en) | 2010-04-30 |
| MX2007004245A (es) | 2007-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US8236793B2 (en) | Diazabicyclic aryl derivatives as cholinergic receptor modulators | |
| AU2003250322B2 (en) | Novel quinuclidine derivatives and their use | |
| US7750011B2 (en) | Diazabicyclic aryl derivatives and their medical use | |
| WO2004043960A1 (en) | 1,4-diazabicyclo (3,2,2)nonane derivatives, preparation and therapeutical use thereof | |
| EP1805183B1 (en) | Novel diazabicyclic aryl derivatives and their medical use | |
| US7652010B2 (en) | Azabicyclic aryl derivatives and their medical use | |
| US7674899B2 (en) | Dimeric azacyclic compounds and their use | |
| JP2008530172A (ja) | ジアザ二環系アリール誘導体及びそれらのニコチン様アセチルコリン受容体におけるコリン作動性リガンドとしての使用 | |
| JP2007538046A (ja) | 新規なアザビシクロアリール誘導体 | |
| US7223753B2 (en) | Diazabicyclic biaryl derivatives | |
| US7612074B2 (en) | Diazabicyclic aryl derivatives as cholinergy ligands | |
| JP2008516930A (ja) | 新規なアザ二環式アリール誘導体及びその医学的な使用 | |
| US7750022B2 (en) | Quinuclidine derivatives and their pharmaceutical use | |
| HK1106513B (en) | Novel azabicyclic aryl derivatives and their medical use | |
| MXPA06008748A (es) | Derivados arildiazabiciclos como moduladores del receptor colinérgico | |
| HK1080860B (en) | Novel quinuclidine derivatives and their use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20081014 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20081014 |
|
| A762 | Written abandonment of application |
Free format text: JAPANESE INTERMEDIATE CODE: A762 Effective date: 20110217 |