NZ213629A - 4,4-diphenylpiperidine derivatives and pharmaceutical compositions - Google Patents
4,4-diphenylpiperidine derivatives and pharmaceutical compositionsInfo
- Publication number
- NZ213629A NZ213629A NZ213629A NZ21362985A NZ213629A NZ 213629 A NZ213629 A NZ 213629A NZ 213629 A NZ213629 A NZ 213629A NZ 21362985 A NZ21362985 A NZ 21362985A NZ 213629 A NZ213629 A NZ 213629A
- Authority
- NZ
- New Zealand
- Prior art keywords
- diphenylpiperidine
- derivatives
- pharmaceutical compositions
- pharmaceutical
- compositions
- Prior art date
Links
- BTVVEKSXUOEVAY-UHFFFAOYSA-N 4,4-diphenylpiperidine Chemical class C1CNCCC1(C=1C=CC=CC=1)C1=CC=CC=C1 BTVVEKSXUOEVAY-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH465284 | 1984-09-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ213629A true NZ213629A (en) | 1989-07-27 |
Family
ID=4280111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ213629A NZ213629A (en) | 1984-09-28 | 1985-09-27 | 4,4-diphenylpiperidine derivatives and pharmaceutical compositions |
Country Status (14)
| Country | Link |
|---|---|
| KR (1) | KR930001404B1 (ca) |
| AU (1) | AU574842B2 (ca) |
| CA (1) | CA1291137C (ca) |
| DK (1) | DK440885A (ca) |
| ES (3) | ES8703148A1 (ca) |
| FI (1) | FI83957C (ca) |
| GR (1) | GR852364B (ca) |
| HU (1) | HU194210B (ca) |
| IE (1) | IE66677B1 (ca) |
| IL (1) | IL76511A (ca) |
| NO (1) | NO169586C (ca) |
| NZ (1) | NZ213629A (ca) |
| PT (1) | PT81209B (ca) |
| ZA (1) | ZA857477B (ca) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK704488D0 (da) * | 1988-12-19 | 1988-12-19 | Novo Industri As | Nye n-substituerede azaheterocykliske carboxylsyrer |
| DK142287A (da) * | 1986-03-27 | 1987-09-28 | Byk Gulden Lomberg Chem Fab | Optisk aktive 1,4-dihydropyridinderivater |
| EP0401256B1 (de) * | 1988-02-19 | 1993-05-26 | Byk Gulden Lomberg Chemische Fabrik GmbH | Optisch reines dexniguldipin und dessen derivate zur behandlung von tumorerkrankungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI793848A7 (fi) * | 1978-12-18 | 1981-01-01 | Sandoz Ag | Bensoksadiatsoleja ja bensotiadiatsoleja, niiden valmistus ja farmaseuttisia yhdisteitä, jotka sisältävät näitä |
-
1985
- 1985-09-06 FI FI853415A patent/FI83957C/fi not_active IP Right Cessation
- 1985-09-25 HU HU853602A patent/HU194210B/hu unknown
- 1985-09-26 KR KR1019850007105A patent/KR930001404B1/ko not_active Expired - Fee Related
- 1985-09-27 PT PT81209A patent/PT81209B/pt not_active IP Right Cessation
- 1985-09-27 GR GR852364A patent/GR852364B/el unknown
- 1985-09-27 DK DK440885A patent/DK440885A/da not_active Application Discontinuation
- 1985-09-27 IE IE238485A patent/IE66677B1/en not_active IP Right Cessation
- 1985-09-27 IL IL76511A patent/IL76511A/xx not_active IP Right Cessation
- 1985-09-27 NO NO853833A patent/NO169586C/no unknown
- 1985-09-27 AU AU47948/85A patent/AU574842B2/en not_active Ceased
- 1985-09-27 ES ES547385A patent/ES8703148A1/es not_active Expired
- 1985-09-27 NZ NZ213629A patent/NZ213629A/xx unknown
- 1985-09-27 ZA ZA857477A patent/ZA857477B/xx unknown
- 1985-09-27 CA CA000491694A patent/CA1291137C/en not_active Expired
-
1986
- 1986-04-16 ES ES554068A patent/ES8708135A1/es not_active Expired
- 1986-04-16 ES ES554067A patent/ES8800201A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| HU194210B (en) | 1988-01-28 |
| HUT38627A (en) | 1986-06-30 |
| ES8703148A1 (es) | 1987-02-16 |
| ES554068A0 (es) | 1987-10-16 |
| ES554067A0 (es) | 1987-11-01 |
| PT81209A (de) | 1985-10-01 |
| FI853415L (fi) | 1986-03-29 |
| NO169586C (no) | 1992-07-15 |
| KR930001404B1 (ko) | 1993-02-27 |
| CA1291137C (en) | 1991-10-22 |
| IL76511A (en) | 1990-06-10 |
| AU574842B2 (en) | 1988-07-14 |
| FI853415A0 (fi) | 1985-09-06 |
| ES8800201A1 (es) | 1987-11-01 |
| FI83957C (fi) | 1991-09-25 |
| KR860002497A (ko) | 1986-04-26 |
| PT81209B (pt) | 1988-01-22 |
| DK440885A (da) | 1986-03-29 |
| IE852384L (en) | 1986-03-28 |
| AU4794885A (en) | 1986-04-10 |
| ES8708135A1 (es) | 1987-10-16 |
| NO853833L (no) | 1986-04-01 |
| DK440885D0 (da) | 1985-09-27 |
| GR852364B (ca) | 1985-12-13 |
| NO169586B (no) | 1992-04-06 |
| IE66677B1 (en) | 1996-01-24 |
| ES547385A0 (es) | 1987-02-16 |
| ZA857477B (en) | 1986-05-28 |
| FI83957B (fi) | 1991-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ210940A (en) | 1,2,3-trihydro-3-(1h-imidazol-1-ylmethyl)-4h-carbazol-4-one derivatives and pharmaceutical compositions | |
| NZ212895A (en) | 1,4-dihydropyridine derivatives and pharmaceutical compositions | |
| IL76405A (en) | 1,3-diacyl-2-oxindole derivatives and pharmaceutical compositions containing them | |
| NZ211145A (en) | 4-aza-5-alpha-androst-1-en-3-ones and pharmaceutical compositions | |
| NZ212005A (en) | Pyrrolobenzimidazoles and pharmaceutical compositions | |
| IL77004A0 (en) | 5-amino-4-hydroxyvaleryl derivatives,their manufacture and pharmaceutical compositions containing them | |
| NZ211031A (en) | 6-substituted-4-dialkylaminotetrahindole derivatives and pharmaceutical compositions | |
| NZ212099A (en) | Substituted arylhydroxamates and pharmaceutical compositions | |
| NZ222030A (en) | Substituted imidazo-(5,4-g (3,1 benzoxaminone derivatives and pharmaceutical compositions | |
| IL74865A (en) | 4'-amino-9a-aza-9a-homoerythromycin derivatives and pharmaceutical compositions containing them | |
| IL75943A0 (en) | 1,4-dihydropyridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL72562A (en) | 6,7-dimethoxy-4-piperidino-quinazoline derivatives and pharmaceutical compositions containing them | |
| NZ226516A (en) | 2,2 dimethylchromene derivatives and pharmaceutical compositions | |
| NZ210818A (en) | 8-alpha-acylaminoergoline derivatives and pharmaceutical compositions | |
| IL76823A0 (en) | 1,2,4-triazolo-carbamates,their preparation and pharmaceutical compositions containing them | |
| NZ214088A (en) | 1,3-diazoles and pharmaceutical compositions | |
| NZ212953A (en) | 3-acyl-1-aminoalkyl-1h-indoles and pharmaceutical compositions thereof | |
| IL74270A0 (en) | 1,2,4-triazole derivatives,their preparation and pharmaceutical compositions containing them | |
| EP0159652A3 (en) | 4-phenylphthalazine derivatives, their preparation and pharmaceutical compositions containing them | |
| NZ227235A (en) | Substituted 1,5-benzothiazepin-4-one derivatives and pharmaceutical compositions | |
| IL76312A (en) | Xenocoumacins and derivatives thereof,their preparation and pharmaceutical compositions containing them | |
| DE3268487D1 (en) | 2,3,4-trinor-m-inter-phenylene-prostaglandin derivatives, their preparation and pharmaceutical compositions | |
| DE3561808D1 (en) | Phenylnonatetraenic-acid derivatives, their preparation and pharmaceutical compositions containing them | |
| NZ213581A (en) | Carboxyalkyldipeptides and pharmaceutical compositions | |
| AU3454984A (en) | 1,z-dithiolanes and pharmaceutical compositions |