NZ204629A - Pyridyl-(oxy or thio)-phenoxy compounds and herbicidal compositions:intermediate compounds and process - Google Patents
Pyridyl-(oxy or thio)-phenoxy compounds and herbicidal compositions:intermediate compounds and processInfo
- Publication number
- NZ204629A NZ204629A NZ204629A NZ20462983A NZ204629A NZ 204629 A NZ204629 A NZ 204629A NZ 204629 A NZ204629 A NZ 204629A NZ 20462983 A NZ20462983 A NZ 20462983A NZ 204629 A NZ204629 A NZ 204629A
- Authority
- NZ
- New Zealand
- Prior art keywords
- compound
- fluoro
- phenoxy
- pyridinyloxy
- alkyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 105
- 239000000203 mixture Substances 0.000 title claims description 47
- 238000000034 method Methods 0.000 title claims description 35
- 230000008569 process Effects 0.000 title claims description 6
- 230000002363 herbicidal effect Effects 0.000 title description 11
- 125000000446 sulfanediyl group Chemical group *S* 0.000 title 1
- 241000196324 Embryophyta Species 0.000 claims abstract description 65
- -1 pyridinyloxyphenoxy Chemical group 0.000 claims abstract description 28
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 13
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 7
- 241000209140 Triticum Species 0.000 claims description 28
- 235000021307 Triticum Nutrition 0.000 claims description 28
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 229910052794 bromium Inorganic materials 0.000 claims description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 8
- 229920006395 saturated elastomer Polymers 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 230000008635 plant growth Effects 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 125000004417 unsaturated alkyl group Chemical group 0.000 claims description 6
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical group F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims description 5
- 108010081348 HRT1 protein Hairy Chemical group 0.000 claims description 5
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 150000001457 metallic cations Chemical group 0.000 claims description 5
- YUIKUTLBPMDDNQ-UHFFFAOYSA-N 2-[4-(5-chloro-3-fluoropyridin-2-yl)oxyphenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(Cl)C=C1F YUIKUTLBPMDDNQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- BDBJONVXJIXDSV-UHFFFAOYSA-N 2-[4-[3-fluoro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1F BDBJONVXJIXDSV-UHFFFAOYSA-N 0.000 claims description 3
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 230000000885 phytotoxic effect Effects 0.000 claims description 3
- 239000003880 polar aprotic solvent Substances 0.000 claims description 3
- DLNAZWMDOWVAGI-UHFFFAOYSA-N 2-[4-[3-fluoro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanenitrile Chemical compound C1=CC(OC(C)C#N)=CC=C1OC1=NC=C(C(F)(F)F)C=C1F DLNAZWMDOWVAGI-UHFFFAOYSA-N 0.000 claims description 2
- DNVIECHQUYQOOH-UHFFFAOYSA-N 2-bromo-3-fluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=CC(C(F)(F)F)=CN=C1Br DNVIECHQUYQOOH-UHFFFAOYSA-N 0.000 claims description 2
- QRDGJZIEMNJEKN-UHFFFAOYSA-N 4-(5-chloro-3-fluoropyridin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C(Cl)C=C1F QRDGJZIEMNJEKN-UHFFFAOYSA-N 0.000 claims description 2
- CNKVGMBZCWTWQY-UHFFFAOYSA-N 4-[3-fluoro-5-(trifluoromethyl)pyridin-2-yl]oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1F CNKVGMBZCWTWQY-UHFFFAOYSA-N 0.000 claims description 2
- QVIQXJRQVOPYGI-UHFFFAOYSA-N 5-bromo-2,3-difluoropyridine Chemical compound FC1=CC(Br)=CN=C1F QVIQXJRQVOPYGI-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 231100000208 phytotoxic Toxicity 0.000 claims description 2
- 150000003222 pyridines Chemical class 0.000 claims description 2
- JADOBTDMEBQAKN-UHFFFAOYSA-N 2-[4-(5-bromo-3-fluoropyridin-2-yl)oxyphenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(Br)C=C1F JADOBTDMEBQAKN-UHFFFAOYSA-N 0.000 claims 3
- 150000001340 alkali metals Chemical class 0.000 claims 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims 3
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 claims 2
- 150000001455 metallic ions Chemical class 0.000 claims 2
- GQOVRACYYSHEBJ-UHFFFAOYSA-N methyl 2-[4-[3-fluoro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate Chemical compound C1=CC(OC(C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1F GQOVRACYYSHEBJ-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Substances 0.000 abstract description 13
- 239000002253 acid Substances 0.000 abstract description 10
- 230000000694 effects Effects 0.000 abstract description 7
- 150000007513 acids Chemical class 0.000 abstract description 3
- 125000004076 pyridyl group Chemical group 0.000 abstract description 3
- 125000001309 chloro group Chemical group Cl* 0.000 abstract description 2
- 125000001424 substituent group Chemical group 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- 240000002439 Sorghum halepense Species 0.000 description 27
- 235000007320 Avena fatua Nutrition 0.000 description 26
- 244000075850 Avena orientalis Species 0.000 description 25
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 25
- 240000003176 Digitaria ciliaris Species 0.000 description 25
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 25
- 235000005476 Digitaria cruciata Nutrition 0.000 description 25
- 235000006830 Digitaria didactyla Nutrition 0.000 description 25
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 25
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 25
- 241000192043 Echinochloa Species 0.000 description 25
- 235000014716 Eleusine indica Nutrition 0.000 description 25
- 244000068988 Glycine max Species 0.000 description 25
- 235000010469 Glycine max Nutrition 0.000 description 25
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 25
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 24
- 229920000742 Cotton Polymers 0.000 description 24
- 241000219146 Gossypium Species 0.000 description 24
- 235000008515 Setaria glauca Nutrition 0.000 description 24
- 244000010062 Setaria pumila Species 0.000 description 24
- 235000021536 Sugar beet Nutrition 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 235000001155 Setaria leucopila Nutrition 0.000 description 23
- 239000004480 active ingredient Substances 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000002360 preparation method Methods 0.000 description 17
- 238000004458 analytical method Methods 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 229910052799 carbon Inorganic materials 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 7
- XJHCXCQVJFPJIK-UHFFFAOYSA-M cesium fluoride Substances [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000000623 heterocyclic group Chemical group 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 125000002723 alicyclic group Chemical group 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 230000012010 growth Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 238000002390 rotary evaporation Methods 0.000 description 5
- AQIHDXGKQHFBNW-UHFFFAOYSA-N 2-(4-hydroxyphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(O)C=C1 AQIHDXGKQHFBNW-UHFFFAOYSA-N 0.000 description 4
- PERMDYZFNQIKBL-UHFFFAOYSA-N 5-chloro-2,3-difluoropyridine Chemical compound FC1=CC(Cl)=CN=C1F PERMDYZFNQIKBL-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- JVTAAEKCZFNVCJ-REOHCLBHSA-N L-lactic acid Chemical compound C[C@H](O)C(O)=O JVTAAEKCZFNVCJ-REOHCLBHSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 230000000361 pesticidal effect Effects 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- XIFCGIKPAAZFFS-UHFFFAOYSA-N 2,3-difluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=CC(C(F)(F)F)=CN=C1F XIFCGIKPAAZFFS-UHFFFAOYSA-N 0.000 description 3
- GDSROTVTTLUHCO-UHFFFAOYSA-N 3-chloro-2-fluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=NC=C(C(F)(F)F)C=C1Cl GDSROTVTTLUHCO-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- 238000004293 19F NMR spectroscopy Methods 0.000 description 2
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical class C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 2
- FUPKVFJSGNZICR-UHFFFAOYSA-N 3-chloro-5-(trifluoromethyl)pyridine-2-carbonitrile Chemical compound FC(F)(F)C1=CN=C(C#N)C(Cl)=C1 FUPKVFJSGNZICR-UHFFFAOYSA-N 0.000 description 2
- APIYAXCKQVOAAR-UHFFFAOYSA-N 3-fluoro-5-(trifluoromethyl)pyridine-2-carbonitrile Chemical compound FC1=CC(C(F)(F)F)=CN=C1C#N APIYAXCKQVOAAR-UHFFFAOYSA-N 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 229910006124 SOCl2 Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 229960004132 diethyl ether Drugs 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 238000003682 fluorination reaction Methods 0.000 description 2
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical class F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- NIIPNAJXERMYOG-UHFFFAOYSA-N 1,1,2-trimethylhydrazine Chemical compound CNN(C)C NIIPNAJXERMYOG-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- BBHYMJRPJFVNPI-UHFFFAOYSA-N 2,3,5-tribromopyridine Chemical compound BrC1=CN=C(Br)C(Br)=C1 BBHYMJRPJFVNPI-UHFFFAOYSA-N 0.000 description 1
- CNLIIAKAAMFCJG-UHFFFAOYSA-N 2,3,5-trichloropyridine Chemical compound ClC1=CN=C(Cl)C(Cl)=C1 CNLIIAKAAMFCJG-UHFFFAOYSA-N 0.000 description 1
- XVBWGQSXLITICX-UHFFFAOYSA-N 2,3-dichloro-5-(trichloromethyl)pyridine Chemical compound ClC1=CC(C(Cl)(Cl)Cl)=CN=C1Cl XVBWGQSXLITICX-UHFFFAOYSA-N 0.000 description 1
- WZQQLMSKDLDZEL-UHFFFAOYSA-N 2-chloro-3-fluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=CC(C(F)(F)F)=CN=C1Cl WZQQLMSKDLDZEL-UHFFFAOYSA-N 0.000 description 1
- SCRAIOJQLNXLKL-UHFFFAOYSA-N 3-bromo-2,5-difluoropyridine Chemical class FC1=CN=C(F)C(Br)=C1 SCRAIOJQLNXLKL-UHFFFAOYSA-N 0.000 description 1
- CRZWUUUZTIMHML-UHFFFAOYSA-N 3-fluoro-5-(trifluoromethyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC=C(C(F)(F)F)C=C1F CRZWUUUZTIMHML-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 238000007241 Hunsdiecker-Borodin reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 241001268782 Paspalum dilatatum Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical class CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- YXJPWWGLCOPUGI-NCJHBDPTSA-N europium;(2z)-4,7,7-trimethyl-2-(2,2,2-trifluoro-1-hydroxyethylidene)bicyclo[2.2.1]heptan-3-one Chemical compound [Eu].C1CC2(C)C(=O)\C(=C(/O)C(F)(F)F)C1C2(C)C.C1CC2(C)C(=O)\C(=C(/O)C(F)(F)F)C1C2(C)C.C1CC2(C)C(=O)\C(=C(/O)C(F)(F)F)C1C2(C)C YXJPWWGLCOPUGI-NCJHBDPTSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical class O* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-M isobutyrate Chemical compound CC(C)C([O-])=O KQNPFQTWMSNSAP-UHFFFAOYSA-M 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- 150000002730 mercury Chemical class 0.000 description 1
- HJOZJSHSAQKXHM-UHFFFAOYSA-N methyl 2-[4-(5-chloro-3-fluoropyridin-2-yl)oxyphenoxy]propanoate Chemical compound C1=CC(OC(C)C(=O)OC)=CC=C1OC1=NC=C(Cl)C=C1F HJOZJSHSAQKXHM-UHFFFAOYSA-N 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 230000000051 modifying effect Effects 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 235000021049 nutrient content Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Hydrogenated Pyridines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38984082A | 1982-06-18 | 1982-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ204629A true NZ204629A (en) | 1986-10-08 |
Family
ID=23539946
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ204629A NZ204629A (en) | 1982-06-18 | 1983-06-17 | Pyridyl-(oxy or thio)-phenoxy compounds and herbicidal compositions:intermediate compounds and process |
Country Status (19)
| Country | Link |
|---|---|
| EP (1) | EP0097460B1 (OSRAM) |
| JP (4) | JPS597165A (OSRAM) |
| KR (1) | KR900005134B1 (OSRAM) |
| AT (1) | ATE33387T1 (OSRAM) |
| AU (1) | AU556172B2 (OSRAM) |
| BR (1) | BR8303329A (OSRAM) |
| CA (1) | CA1179350A (OSRAM) |
| DE (1) | DE3376211D1 (OSRAM) |
| DK (1) | DK157015C (OSRAM) |
| EG (1) | EG17924A (OSRAM) |
| ES (3) | ES523398A0 (OSRAM) |
| GB (1) | GB2123819B (OSRAM) |
| GR (1) | GR79319B (OSRAM) |
| IL (1) | IL68822A (OSRAM) |
| KE (1) | KE3734A (OSRAM) |
| MY (1) | MY8700280A (OSRAM) |
| NZ (1) | NZ204629A (OSRAM) |
| PH (1) | PH21942A (OSRAM) |
| ZA (1) | ZA834462B (OSRAM) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| US4480102A (en) * | 1982-07-23 | 1984-10-30 | The Dow Chemical Company | 2,3-Difluoro-5-(trifluoromethyl)pyridine and methods of making and using the same |
| ES535014A0 (es) * | 1983-08-11 | 1985-08-01 | Monsanto Co | Un procedimiento para preparar derivados de piridina sustituidos en las posiciones 2 y 6 |
| EP0148119B1 (de) * | 1983-12-06 | 1989-05-03 | Ciba-Geigy Ag | 2-Phenoxypropions ure-cyanamide |
| CA1292746C (en) * | 1983-12-23 | 1991-12-03 | Charles A. Wilson | Preparation of difluoropyridine compounds |
| DE3577704D1 (de) * | 1984-10-10 | 1990-06-21 | Ciba Geigy Ag | Verfahren zur herstellung von fluorierten pyridin-derivaten. |
| US4563530A (en) * | 1984-10-29 | 1986-01-07 | The Dow Chemical Company | Preparation of fluoropyridines |
| DD281379A5 (de) | 1985-02-14 | 1990-08-08 | Ciba Geigy Ag,Ch | Verfahren zur herstellung von neuen chinolinderivaten |
| DE3680212D1 (de) * | 1985-02-14 | 1991-08-22 | Ciba Geigy Ag | Verwendung von chinolinderivaten zum schuetzen von kulturpflanzen. |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| IL91083A (en) * | 1988-07-25 | 1993-04-04 | Ciba Geigy | Cyclohexanedione derivatives, their preparation and their use as herbicides |
| US5650517A (en) * | 1994-11-01 | 1997-07-22 | Ciba-Geigy Corporation | Process for the preparation of 2,3-difluoro-5-halopyridines |
| RU2266900C2 (ru) * | 2000-08-25 | 2005-12-27 | Байер Кропсайенс Са | Способы получения производных 2-аминометилпиридина и 2-цианопиридина |
| CA2472806A1 (en) | 2004-05-18 | 2005-11-18 | Petro-Canada | Compositions and methods for treating turf insect pests and diseases such as fungal infestations |
| PE20060115A1 (es) | 2004-07-23 | 2006-03-23 | Basf Ag | 2-(piridin-2-il)-pirimidinas como agentes fungicidas |
| JP4719523B2 (ja) * | 2005-07-06 | 2011-07-06 | ユニオンマシナリ株式会社 | 電池ホルダ |
| US9357768B2 (en) | 2006-10-05 | 2016-06-07 | Suncor Energy Inc. | Herbicidal composition with increased herbicidal efficacy |
| WO2009155693A1 (en) | 2008-06-26 | 2009-12-30 | Petro-Canada | Improved turfgrass fungicide formulation with pigment |
| CA2810578C (en) | 2010-09-09 | 2016-08-30 | Suncor Energy Inc. | Synergistic paraffinic oil and boscalid fungicides |
| WO2012162846A1 (en) | 2011-06-03 | 2012-12-06 | Suncor Energy Inc. | Paraffinic oil-in-water emulsions for controlling infection of crop plants by fungal pathogens |
| EP2858503B1 (en) | 2012-06-04 | 2020-06-03 | Suncor Energy Inc. | Formulations containing paraffinic oil and anti-settling agent |
| CN106349159B (zh) * | 2016-08-29 | 2019-03-22 | 山东省联合农药工业有限公司 | 一种3-氯-2-氰基-5-三氟甲基吡啶的制备方法 |
| US12207655B2 (en) | 2019-02-15 | 2025-01-28 | Nutrien Ag Solutions (Canada) Inc. | Protoporphyrin IX derivatives and use thereof to improve the health of plants |
| CN112390748B (zh) * | 2020-11-03 | 2022-04-26 | 内蒙古佳瑞米精细化工有限公司 | 一种2-氰基-3-氟-5-三氟甲基吡啶的制备方法 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| JPS54119476A (en) * | 1978-03-10 | 1979-09-17 | Ishihara Sangyo Kaisha Ltd | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| DE2862462D1 (de) * | 1977-08-12 | 1985-05-15 | Ici Plc | 2-chloro-5-trichloromethylpyridine |
| JPS5461183A (en) * | 1977-10-21 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-substituted-5-trifluoromethyl pyridine compounds |
| FR2412532A1 (fr) * | 1977-12-23 | 1979-07-20 | Ciba Geigy Ag | Nouveaux derives d'acide pyridyloxyphenoxypropionique ayant une action herbicide et phytoregulatrice |
| JPS5492970A (en) * | 1977-12-29 | 1979-07-23 | Ciba Geigy Ag | Pyridyloxyyphenoxyypropionic acid derivative* its manufacture and herbicide or plant growth regulating composition |
| DE2960106D1 (en) * | 1978-01-27 | 1981-02-26 | Ciba Geigy Ag | Aminoalkyl esters of pyridyloxy-phenoxy-alpha-propionic acids with herbicidal activity, their preparation, compositions containing them and their application |
| JPH0224818B2 (OSRAM) * | 1978-02-15 | 1990-05-30 | Imuperiaru Chem Ind Plc | |
| JPS55111467A (en) * | 1979-02-22 | 1980-08-28 | Ishihara Sangyo Kaisha Ltd | 44*55trifluoromethylpyridinn22yloxy**halogenophenoxy alkane carboxylic acid derivative and herbicide comprising it |
| JPS55120565A (en) * | 1979-03-08 | 1980-09-17 | Ishihara Sangyo Kaisha Ltd | 2-(halogen substituted phenoxy)-5-trifluoromethylpyridine |
| GB2051778A (en) * | 1979-07-05 | 1981-01-21 | Ici Ltd | Process for the preparation of certain pyridine derivatives having herbicidal properties |
| JPS56118066A (en) * | 1980-02-21 | 1981-09-16 | Ishihara Sangyo Kaisha Ltd | 2-cyano-3-halogeno-5-trifluoromethylpyridine and its preparation |
| JPS56118065A (en) * | 1980-02-21 | 1981-09-16 | Ishihara Sangyo Kaisha Ltd | 5-trifluoromethylpyridine-2-carboxylic acid, its salt, and their preparation |
| IL63944A (en) * | 1980-10-14 | 1985-02-28 | Zoecon Corp | Substituted phenoxy aliphatic compounds and weed control compositions containing the same |
| PH17279A (en) * | 1980-10-15 | 1984-07-06 | Ciba Geigy | Novel alpha-(pyridyl-2-oxy-phenoxy)-propionic acid derivatives and their use as herbicides and/or regulators of plant growth |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
-
1983
- 1983-05-31 IL IL68822A patent/IL68822A/xx unknown
- 1983-06-02 AU AU15334/83A patent/AU556172B2/en not_active Expired
- 1983-06-09 EP EP83303353A patent/EP0097460B1/en not_active Expired
- 1983-06-09 DE DE8383303353T patent/DE3376211D1/de not_active Expired
- 1983-06-09 AT AT83303353T patent/ATE33387T1/de active
- 1983-06-09 GB GB08315847A patent/GB2123819B/en not_active Expired
- 1983-06-15 PH PH29061A patent/PH21942A/en unknown
- 1983-06-15 GR GR71688A patent/GR79319B/el unknown
- 1983-06-17 DK DK281183A patent/DK157015C/da not_active IP Right Cessation
- 1983-06-17 CA CA000430592A patent/CA1179350A/en not_active Expired
- 1983-06-17 BR BR8303329A patent/BR8303329A/pt not_active IP Right Cessation
- 1983-06-17 KR KR1019830002719A patent/KR900005134B1/ko not_active Expired
- 1983-06-17 ES ES523398A patent/ES523398A0/es active Granted
- 1983-06-17 ZA ZA834462A patent/ZA834462B/xx unknown
- 1983-06-17 NZ NZ204629A patent/NZ204629A/en unknown
- 1983-06-18 JP JP58110033A patent/JPS597165A/ja active Granted
- 1983-06-19 EG EG373/83A patent/EG17924A/xx active
-
1984
- 1984-03-16 ES ES530712A patent/ES8505346A1/es not_active Expired
- 1984-03-16 ES ES530713A patent/ES530713A0/es active Granted
-
1986
- 1986-11-20 JP JP61275484A patent/JPS62142154A/ja active Pending
- 1986-11-20 JP JP61275483A patent/JPS62142156A/ja active Pending
- 1986-11-20 JP JP61275485A patent/JPS62142157A/ja active Pending
-
1987
- 1987-05-29 KE KE3734A patent/KE3734A/xx unknown
- 1987-12-30 MY MY280/87A patent/MY8700280A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA1179350A (en) | 1984-12-11 |
| JPS62142157A (ja) | 1987-06-25 |
| ATE33387T1 (de) | 1988-04-15 |
| GR79319B (OSRAM) | 1984-10-22 |
| GB2123819A (en) | 1984-02-08 |
| ZA834462B (en) | 1985-02-27 |
| KR840005098A (ko) | 1984-11-03 |
| KR900005134B1 (ko) | 1990-07-20 |
| ES8504716A1 (es) | 1985-05-01 |
| EG17924A (en) | 1991-08-30 |
| AU556172B2 (en) | 1986-10-23 |
| KE3734A (en) | 1987-06-19 |
| DE3376211D1 (en) | 1988-05-11 |
| IL68822A (en) | 1990-07-12 |
| GB2123819B (en) | 1986-04-16 |
| GB8315847D0 (en) | 1983-07-13 |
| MY8700280A (en) | 1987-12-31 |
| DK281183D0 (da) | 1983-06-17 |
| DK157015B (da) | 1989-10-30 |
| EP0097460B1 (en) | 1988-04-06 |
| JPS62142156A (ja) | 1987-06-25 |
| BR8303329A (pt) | 1984-02-07 |
| ES8500236A1 (es) | 1984-10-01 |
| DK281183A (da) | 1983-12-19 |
| PH21942A (en) | 1988-04-15 |
| EP0097460A1 (en) | 1984-01-04 |
| ES523398A0 (es) | 1984-10-01 |
| AU1533483A (en) | 1983-12-15 |
| DK157015C (da) | 1990-03-26 |
| JPS597165A (ja) | 1984-01-14 |
| ES530712A0 (es) | 1985-05-16 |
| JPS6249269B2 (OSRAM) | 1987-10-19 |
| ES530713A0 (es) | 1985-05-01 |
| ES8505346A1 (es) | 1985-05-16 |
| JPS62142154A (ja) | 1987-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ204629A (en) | Pyridyl-(oxy or thio)-phenoxy compounds and herbicidal compositions:intermediate compounds and process | |
| US4565568A (en) | Pyridyl(oxy/thio)phenoxy compounds, herbicidal compositions and methods | |
| EP0000483B1 (en) | Trifluoromethyl pyridinyl(oxy/thio)phenoxy propanoic acids and propanols and derivatives thereof | |
| US4550192A (en) | Fluorophenoxyphenoxypropionates and derivatives thereof | |
| US4808750A (en) | Fluorophenoxyphenoxypropionates and derivatives thereof | |
| EP0142328B1 (en) | Fluorophenoxy compounds, herbicidal compositions and methods | |
| US4851539A (en) | 2,3-Difluoropyridine and 3-fluoro-2-pyridinyloxyphenol compounds | |
| US4751329A (en) | Fluorophenoxyphenoxypropionates and derivatives thereof 18-methyl-4,15-estradien-3-one, and the novel starting compounds for this process | |
| US4678509A (en) | Certain pyridyloxy or thio-phenoxy-propanoic acids or salts thereof useful as herbicides | |
| US4725683A (en) | Fluorophenoxyphenoxypropionates and derivatives thereof | |
| US4750931A (en) | Certain 3,5-disubstituted-2-pyridyloxy-fluorophenoxy-alkanoic acids, derivatives thereof and herbicidal properties | |
| US4642338A (en) | Fluorophenoxyphenoxypropionates and derivatives thereof | |
| EP0050019A1 (en) | 3-Keto-4-(4'-aromatically substituted-phenoxy) compounds, their 3- alkylated enol and 2,3-hydrogenated derivatives and the use thereof for the control of weeds | |
| US4448966A (en) | Substituted 2-pyridyloxyphenoxy-alkanetriones | |
| US4448965A (en) | Substituted cycloalkanediones | |
| USRE33478E (en) | Pyridyl(oxy/thio)phenoxy compounds herbicidal compositions and methods | |
| WO1982000401A1 (en) | Certain 2-(4-((5-trifluoromethyl)-2-pyridinyl)oxy)phenoxy)-n-pyridinyl propanamide and derivatives thereof and a method for selectively controlling grassy weeds in rice | |
| US5032168A (en) | 4-((aryloxy)phenoxy)fluoroalkanoic acid derivatives and their herbicidal uses | |
| CA1182459A (en) | Pyridine intermediates for the preparation of pyridyl(oxy/thio)phenoxy compounds | |
| US4483992A (en) | Alkylthio substituted phenoxy alkanoic acid esters | |
| US4529438A (en) | Pyridyloxy-phenoxy-alkanoic acid esters and derivatives | |
| US4599105A (en) | 2-[16-(3-fluoro-5-trifluoromethyl-pyridinyl-2-oxy)-3-nitro-phenoxy]-propionic acid derivatives, herbicidal compositions containing same and herbicidal method of use | |
| US4520199A (en) | Alkoxy substituted phenoxy alkanoic acid esters | |
| US5180417A (en) | 4-((aryloxy)phenoxy)fluoroalkanoic acid derivatives and their herbicidal uses | |
| US4888050A (en) | Fluorophenoxy compounds, herbicidal compositions and methods |