NZ198884A - N-(4-(omega-hydroxyalkoxy)phenalkyl)-2-phenylethan-2-olamines - Google Patents
N-(4-(omega-hydroxyalkoxy)phenalkyl)-2-phenylethan-2-olaminesInfo
- Publication number
- NZ198884A NZ198884A NZ198884A NZ19888481A NZ198884A NZ 198884 A NZ198884 A NZ 198884A NZ 198884 A NZ198884 A NZ 198884A NZ 19888481 A NZ19888481 A NZ 19888481A NZ 198884 A NZ198884 A NZ 198884A
- Authority
- NZ
- New Zealand
- Prior art keywords
- formula
- compound
- hydroxy
- phenyl
- ethanamine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 136
- 239000000203 mixture Substances 0.000 claims description 45
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 26
- 150000002431 hydrogen Chemical group 0.000 claims description 16
- 241000699670 Mus sp. Species 0.000 claims description 13
- 125000004043 oxo group Chemical group O=* 0.000 claims description 13
- 230000000694 effects Effects 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- -1 4- (2-hydroxyethoxy) phenyl Chemical group 0.000 claims description 10
- 210000004369 blood Anatomy 0.000 claims description 10
- 239000008280 blood Substances 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000002947 alkylene group Chemical group 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 239000011737 fluorine Chemical group 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 241001465754 Metazoa Species 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 231100000252 nontoxic Toxicity 0.000 claims description 6
- 230000003000 nontoxic effect Effects 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 241000699666 Mus <mouse, genus> Species 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 4
- 238000002347 injection Methods 0.000 claims description 4
- 239000007924 injection Substances 0.000 claims description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 3
- 208000008589 Obesity Diseases 0.000 claims description 3
- 206010050661 Platelet aggregation inhibition Diseases 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 235000020824 obesity Nutrition 0.000 claims description 3
- 230000004044 response Effects 0.000 claims description 3
- 238000011282 treatment Methods 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- RQIVJIFVQGCARO-UHFFFAOYSA-N 1-(2-fluorophenyl)-2-[1-[4-(2-hydroxyethoxy)phenyl]propan-2-ylamino]ethanol Chemical compound C=1C=CC=C(F)C=1C(O)CNC(C)CC1=CC=C(OCCO)C=C1 RQIVJIFVQGCARO-UHFFFAOYSA-N 0.000 claims description 2
- FSOBGMBQSLWEPZ-UHFFFAOYSA-N 1-(3-chlorophenyl)-2-[1-[4-(2-hydroxyethoxy)phenyl]propan-2-ylamino]ethanol Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)CC1=CC=C(OCCO)C=C1 FSOBGMBQSLWEPZ-UHFFFAOYSA-N 0.000 claims description 2
- HKIVYKUKIYPTSU-UHFFFAOYSA-N 11-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]undecan-1-ol Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(O)CNC(C)CC1=CC=C(OCCCCCCCCCCCO)C=C1 HKIVYKUKIYPTSU-UHFFFAOYSA-N 0.000 claims description 2
- KXHNXMHJXODIEX-UHFFFAOYSA-N 2-[[4-[4-(2-hydroxyethoxy)phenyl]-2-methylbutan-2-yl]amino]-1-phenylethanol Chemical compound C=1C=CC=CC=1C(O)CNC(C)(C)CCC1=CC=C(OCCO)C=C1 KXHNXMHJXODIEX-UHFFFAOYSA-N 0.000 claims description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 claims description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 claims description 2
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000003981 vehicle Substances 0.000 claims description 2
- 102000008186 Collagen Human genes 0.000 claims 4
- 108010035532 Collagen Proteins 0.000 claims 4
- 229920001436 collagen Polymers 0.000 claims 4
- 210000001772 blood platelet Anatomy 0.000 claims 2
- NRHVNPYOTNGECT-UHFFFAOYSA-N 2-(3-chlorophenyl)ethanamine Chemical compound NCCC1=CC=CC(Cl)=C1 NRHVNPYOTNGECT-UHFFFAOYSA-N 0.000 claims 1
- ANXQEJIXYBXTCO-UHFFFAOYSA-N 2-[1-[4-(2-hydroxyethoxy)phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(O)CNC(C)CC1=CC=C(OCCO)C=C1 ANXQEJIXYBXTCO-UHFFFAOYSA-N 0.000 claims 1
- 230000005764 inhibitory process Effects 0.000 claims 1
- 238000001990 intravenous administration Methods 0.000 claims 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims 1
- 230000029058 respiratory gaseous exchange Effects 0.000 claims 1
- 210000001631 vena cava inferior Anatomy 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 81
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- 239000000243 solution Substances 0.000 description 31
- 239000002904 solvent Substances 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 239000003814 drug Substances 0.000 description 11
- 239000012279 sodium borohydride Substances 0.000 description 11
- 229910000033 sodium borohydride Inorganic materials 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 101150041968 CDC13 gene Proteins 0.000 description 10
- 229940079593 drug Drugs 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 230000009467 reduction Effects 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 229960001866 silicon dioxide Drugs 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 230000002829 reductive effect Effects 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 7
- 241000282412 Homo Species 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000008103 glucose Substances 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 6
- 239000012280 lithium aluminium hydride Substances 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- RRBRWAPWPGAJMA-UHFFFAOYSA-N 2-amino-1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound NCC(O)C1=CC=CC(C(F)(F)F)=C1 RRBRWAPWPGAJMA-UHFFFAOYSA-N 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 230000003579 anti-obesity Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 206010061218 Inflammation Diseases 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 230000002218 hypoglycaemic effect Effects 0.000 description 4
- 230000004054 inflammatory process Effects 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- STJIXOUDTUPEEL-UHFFFAOYSA-N 2-amino-1-(3-chlorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC(Cl)=C1 STJIXOUDTUPEEL-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 3
- 230000037406 food intake Effects 0.000 description 3
- 235000012631 food intake Nutrition 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- PZTIBMLVOICBNU-UHFFFAOYSA-N 1-[4-(3-hydroxypropoxy)phenyl]propan-2-one Chemical compound CC(=O)CC1=CC=C(OCCCO)C=C1 PZTIBMLVOICBNU-UHFFFAOYSA-N 0.000 description 2
- YPPDRNOHVDQCOJ-UHFFFAOYSA-N 1-[4-(6-hydroxyhexoxy)phenyl]propan-2-one Chemical compound CC(=O)CC1=CC=C(OCCCCCCO)C=C1 YPPDRNOHVDQCOJ-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- HLFRCDBVNMTVNE-UHFFFAOYSA-N 2-amino-1-(3-fluoro-4-methoxyphenyl)ethanol Chemical compound COC1=CC=C(C(O)CN)C=C1F HLFRCDBVNMTVNE-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- JAJIUWBRJAQOHS-UHFFFAOYSA-N 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol Chemical compound C=1C=C(O)C=CC=1CC1(C)OCCO1 JAJIUWBRJAQOHS-UHFFFAOYSA-N 0.000 description 2
- SKAOSGPTGMBFLO-UHFFFAOYSA-N 4-[4-(2-hydroxyethoxy)phenyl]butan-2-one Chemical compound CC(=O)CCC1=CC=C(OCCO)C=C1 SKAOSGPTGMBFLO-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- HSHGVWRPHVKLMV-UHFFFAOYSA-N methyl 2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]-2-methylphenoxy]acetate Chemical compound C1=C(C)C(OCC(=O)OC)=CC=C1CC(C)NCC(O)C1=CC=CC(C(F)(F)F)=C1 HSHGVWRPHVKLMV-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229960002052 salbutamol Drugs 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000000707 stereoselective effect Effects 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- FATVIFHFUOXCPH-UHFFFAOYSA-N 1-(3-chlorophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]butan-2-ylamino]ethanol Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)CCC1=CC=C(OCCO)C=C1 FATVIFHFUOXCPH-UHFFFAOYSA-N 0.000 description 1
- SAGBXHOHODTRSW-UHFFFAOYSA-N 1-(3-fluoro-4-methoxyphenyl)-2-[1-[4-(2-hydroxyethoxy)phenyl]propan-2-ylamino]ethanol Chemical compound C1=C(F)C(OC)=CC=C1C(O)CNC(C)CC1=CC=C(OCCO)C=C1 SAGBXHOHODTRSW-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- CKJZLYCLFZWGKK-UHFFFAOYSA-N 1-[4-(11-hydroxyundecoxy)phenyl]propan-2-one Chemical compound CC(=O)CC1=CC=C(OCCCCCCCCCCCO)C=C1 CKJZLYCLFZWGKK-UHFFFAOYSA-N 0.000 description 1
- FUYUEWDTYINTJK-UHFFFAOYSA-N 1-[4-(2-hydroxyethoxy)phenyl]propan-2-one Chemical compound CC(=O)CC1=CC=C(OCCO)C=C1 FUYUEWDTYINTJK-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- WQXHMHUZVHASLO-UHFFFAOYSA-N 2-[1-[4-(2-hydroxyethoxy)-3-methylphenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(O)CNC(C)CC1=CC=C(OCCO)C(C)=C1 WQXHMHUZVHASLO-UHFFFAOYSA-N 0.000 description 1
- SCQOUKNTVHDWKV-UHFFFAOYSA-N 2-[4-(3-amino-3-methylbutyl)phenoxy]ethanol Chemical compound CC(C)(N)CCC1=CC=C(OCCO)C=C1 SCQOUKNTVHDWKV-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- YQBLQKZERMAVDO-UHFFFAOYSA-N 2-oxo-2-phenylacetaldehyde;hydrate Chemical compound O.O=CC(=O)C1=CC=CC=C1 YQBLQKZERMAVDO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SOQCZBSZZLWDGU-UHFFFAOYSA-N 3-fluoro-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1F SOQCZBSZZLWDGU-UHFFFAOYSA-N 0.000 description 1
- NPZDLCGRULLVSV-UHFFFAOYSA-N 4-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]butan-1-ol Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(O)CNC(C)CC1=CC=C(OCCCCO)C=C1 NPZDLCGRULLVSV-UHFFFAOYSA-N 0.000 description 1
- SKYVBXXOOKDZEO-UHFFFAOYSA-N 6-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]hexan-1-ol Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(O)CNC(C)CC1=CC=C(OCCCCCCO)C=C1 SKYVBXXOOKDZEO-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 229940117173 croton oil Drugs 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002373 hemiacetals Chemical class 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000003345 hyperglycaemic effect Effects 0.000 description 1
- 201000001421 hyperglycemia Diseases 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UPRNMFPLJCNKSD-UHFFFAOYSA-N methyl 2-[2-methyl-4-(2-oxopropyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=C(CC(C)=O)C=C1C UPRNMFPLJCNKSD-UHFFFAOYSA-N 0.000 description 1
- BLODOBGCBZUDTQ-UHFFFAOYSA-N methyl 2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OC)=CC=C1CC(C)NCC(O)C1=CC=CC(C(F)(F)F)=C1 BLODOBGCBZUDTQ-UHFFFAOYSA-N 0.000 description 1
- VUDXZDLWPZDJBV-UHFFFAOYSA-N methyl 2-[4-[3-(4-methylphenyl)sulfonyloxypropyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OC)=CC=C1CCCOS(=O)(=O)C1=CC=C(C)C=C1 VUDXZDLWPZDJBV-UHFFFAOYSA-N 0.000 description 1
- IWXZHJSAXANMTO-UHFFFAOYSA-N methyl 4-[4-(2-oxopropyl)phenoxy]butanoate Chemical compound COC(=O)CCCOC1=CC=C(CC(C)=O)C=C1 IWXZHJSAXANMTO-UHFFFAOYSA-N 0.000 description 1
- OVJTYMFMHLGRNA-UHFFFAOYSA-N methyl 4-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]but-2-enoate Chemical compound C1=CC(OCC=CC(=O)OC)=CC=C1CC(C)NCC(O)C1=CC=CC(C(F)(F)F)=C1 OVJTYMFMHLGRNA-UHFFFAOYSA-N 0.000 description 1
- WNFXNPNLPLITFD-UHFFFAOYSA-N methyl 4-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]butanoate Chemical compound C1=CC(OCCCC(=O)OC)=CC=C1CC(C)NCC(O)C1=CC=CC(C(F)(F)F)=C1 WNFXNPNLPLITFD-UHFFFAOYSA-N 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000013116 obese mouse model Methods 0.000 description 1
- 238000003305 oral gavage Methods 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 229950006768 phenylethanolamine Drugs 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000001253 polyvinylpolypyrrolidone Substances 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- NJGBTKGETPDVIK-UHFFFAOYSA-N raspberry ketone Chemical compound CC(=O)CCC1=CC=C(O)C=C1 NJGBTKGETPDVIK-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940080313 sodium starch Drugs 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/62—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms linked by carbon chains having at least three carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/57—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom
- C07C45/59—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom in five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8037299 | 1980-11-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ198884A true NZ198884A (en) | 1985-07-31 |
Family
ID=10517449
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ198884A NZ198884A (en) | 1980-11-20 | 1981-11-06 | N-(4-(omega-hydroxyalkoxy)phenalkyl)-2-phenylethan-2-olamines |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4382958A (enExample) |
| EP (1) | EP0052963B1 (enExample) |
| JP (1) | JPS57116030A (enExample) |
| AU (1) | AU546377B2 (enExample) |
| CA (1) | CA1175444A (enExample) |
| DE (1) | DE3169094D1 (enExample) |
| ES (2) | ES507298A0 (enExample) |
| GB (1) | GB2096988B (enExample) |
| GR (1) | GR77306B (enExample) |
| IE (1) | IE52403B1 (enExample) |
| NZ (1) | NZ198884A (enExample) |
| PT (1) | PT73997B (enExample) |
| ZA (1) | ZA817881B (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0070134B1 (en) * | 1981-07-11 | 1985-11-13 | Beecham Group Plc | Secondary phenyl ethanol amines and their pharmaceutical use |
| DE3271132D1 (en) * | 1981-07-11 | 1986-06-19 | Beecham Group Plc | Secondary phenylethanol amines, processes for their preparation and their pharmaceutical application |
| CA1219865A (en) * | 1982-05-14 | 1987-03-31 | Leo Alig | Aziridine phenethanolamine derivatives |
| EP0099707B1 (en) * | 1982-07-16 | 1986-12-10 | Beecham Group Plc | 2-aminoethyl ether derivatives, processes for their preparation and pharmaceutical compositions containing them |
| WO1984000956A1 (en) * | 1982-08-27 | 1984-03-15 | Beecham Group Plc | Secondary arylethanolamines |
| GB8310556D0 (en) * | 1983-04-19 | 1983-05-25 | Beecham Group Plc | Compounds |
| DE3462789D1 (en) * | 1983-08-17 | 1987-04-30 | Beecham Group Plc | 2-phenylethylamine derivatives |
| CA1262729A (en) * | 1983-10-19 | 1989-11-07 | Leo Alig | Phenoxypropanolamines |
| US5166218A (en) * | 1983-10-19 | 1992-11-24 | Hoffmann-La Roche Inc. | Phenoxypropanolamines and pharmaceutical compositions thereof |
| US4602044A (en) * | 1983-12-19 | 1986-07-22 | Eli Lilly And Company | β-phenethanolamine antiobesity agents |
| GB8412862D0 (en) * | 1984-05-19 | 1984-06-27 | Beecham Group Plc | Compounds |
| GB8615995D0 (en) * | 1986-07-01 | 1986-08-06 | Glaxo Group Ltd | Veterinary preparations |
| DE3623940A1 (de) * | 1986-07-16 | 1988-01-21 | Bayer Ag | Arylethanolhydroxylamine, verfahren zu ihrer herstellung und ihre verwendung zur leistungsfoerderung |
| DE3866984D1 (en) * | 1987-07-21 | 1992-01-30 | Hoffmann La Roche | Phenoxypropanolamine. |
| FR2619379B1 (fr) * | 1987-08-12 | 1990-01-12 | Midy Spa | Procede pour la o-alkylation de n-(hydroxy) aralkyl-phenylethanolamines |
| US4927955A (en) * | 1987-08-12 | 1990-05-22 | Sanofi | Process for the O-alkylation of N-(hydroxy)aralkylphenylethanolamines |
| CA2010638A1 (en) * | 1989-03-07 | 1990-09-07 | Leo Alig | Bisphenethanolamines |
| WO1991012003A1 (en) * | 1990-02-09 | 1991-08-22 | The Upjohn Company | Use of insulin sensitizing agents to treat hypertension |
| US5356913A (en) * | 1990-02-09 | 1994-10-18 | The Upjohn Company | Use of insulin sensitizing agents to treat hypertension |
| US5245053A (en) * | 1990-05-04 | 1993-09-14 | American Cyanamid Company | Substituted 5-(2-(2-aryl-2-hydroxyethyl)-amino)propyl)-1,3-benzodioxoles |
| US5151439A (en) * | 1990-05-04 | 1992-09-29 | American Cyanamid Company | Substituted 5-(2-((2-aryl-2-hydroxyethyl)amino)propyl)-1,3-benzodioxoles |
| US5061727A (en) | 1990-05-04 | 1991-10-29 | American Cyanamid Company | Substituted 5-(2-((2-aryl-2-hydroxyethyl)amino)propyl)-1,3-benzodioxoles |
| US5106867A (en) * | 1990-05-04 | 1992-04-21 | American Cyanamid Company | Method of increasing lean meat in edible animals |
| PL312005A1 (en) * | 1993-06-14 | 1996-04-01 | Pfizer | Binary amines as antidiabetic and antiobesitic agents |
| US5563171A (en) * | 1993-11-05 | 1996-10-08 | American Cyanamid Company | Treatment of glaucoma and ocular hypertension with β3-adrenergic agonists |
| US5578638A (en) * | 1993-11-05 | 1996-11-26 | American Cyanamid Company | Treatment of glaucoma and ocular hypertension with β3 -adrenergic agonists |
| US5627200A (en) * | 1994-09-26 | 1997-05-06 | Pfizer Inc | β3 -Adrenoceptor agonists and antagonists for the treatment of intestinal motility disorders, depression, prostate disease and dyslipidemia |
| ZA967892B (en) * | 1995-09-21 | 1998-03-18 | Lilly Co Eli | Selective β3 adrenergic agonists. |
| US5808080A (en) * | 1996-09-05 | 1998-09-15 | Eli Lilly And Company | Selective β3 adrenergic agonists |
| ATE215369T1 (de) | 1996-09-05 | 2002-04-15 | Lilly Co Eli | Carbazolanaloge als selektive beta3-adrenergische agonisten |
| CO5011072A1 (es) * | 1997-12-05 | 2001-02-28 | Lilly Co Eli | Etanolaminas pirazinil substituidas como agfonistas de los receptores |
| SE9802974D0 (sv) * | 1998-09-03 | 1998-09-03 | Astra Ab | New crystalline forms |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2034277A1 (en) * | 1970-07-10 | 1972-01-20 | Troponwerke Dinklage & Co, 5000 Köln Mulheim | 1-(3-hydroxyphenyl)-2-(1-(4-(2-hydroxy or ethoxy)-phenyl) - propyl-2-amino)-ethanol-(1)-with bronchodilatory action |
| IL45396A0 (en) * | 1973-08-23 | 1974-11-29 | Beecham Group Ltd | Pharmaceutical compositions containing aryl aralkyl ether and thioether derivatives,certain such novel compounds and their preparation |
| GB1531718A (en) * | 1974-11-20 | 1978-11-08 | Pharmacia As | Phenylethanolamines |
| FR2328456A1 (fr) * | 1975-10-22 | 1977-05-20 | Bruneau & Cie Lab | Derives de phenylethanolamine, leur preparation et leur application en therapeutique |
| FR2367487A2 (fr) * | 1976-10-12 | 1978-05-12 | Bruneau & Cie Lab | Melanges racemiques d'(hydroxy-4 (hy |
| US4490392A (en) * | 1977-08-11 | 1984-12-25 | Tanabe Seiyaku Co., Ltd. | Benzylalcohol derivative and process for preparing |
| ZA791403B (en) * | 1978-04-10 | 1980-05-28 | Draco Ab | Composition of matter |
| EP0025331B1 (en) * | 1979-09-06 | 1983-03-02 | Beecham Group Plc | Cinnamic acid derivatives, their preparation, and pharmaceutical compositions containing them |
-
1981
- 1981-11-02 EP EP81305206A patent/EP0052963B1/en not_active Expired
- 1981-11-02 DE DE8181305206T patent/DE3169094D1/de not_active Expired
- 1981-11-02 GB GB8133017A patent/GB2096988B/en not_active Expired
- 1981-11-06 NZ NZ198884A patent/NZ198884A/en unknown
- 1981-11-09 US US06/319,604 patent/US4382958A/en not_active Expired - Fee Related
- 1981-11-10 CA CA000389774A patent/CA1175444A/en not_active Expired
- 1981-11-13 ZA ZA817881A patent/ZA817881B/xx unknown
- 1981-11-16 PT PT73997A patent/PT73997B/pt unknown
- 1981-11-17 GR GR66551A patent/GR77306B/el unknown
- 1981-11-18 AU AU77624/81A patent/AU546377B2/en not_active Ceased
- 1981-11-19 ES ES507298A patent/ES507298A0/es active Granted
- 1981-11-19 IE IE2715/81A patent/IE52403B1/en unknown
- 1981-11-20 JP JP56186767A patent/JPS57116030A/ja active Pending
-
1982
- 1982-10-13 ES ES516472A patent/ES516472A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0052963A1 (en) | 1982-06-02 |
| ES8304063A1 (es) | 1983-02-16 |
| ES507298A0 (es) | 1983-02-16 |
| CA1175444A (en) | 1984-10-02 |
| AU546377B2 (en) | 1985-08-29 |
| PT73997A (en) | 1981-12-01 |
| AU7762481A (en) | 1982-05-27 |
| GR77306B (enExample) | 1984-09-11 |
| ZA817881B (en) | 1982-10-27 |
| JPS57116030A (en) | 1982-07-19 |
| IE812715L (en) | 1982-05-20 |
| GB2096988B (en) | 1984-08-01 |
| DE3169094D1 (en) | 1985-03-28 |
| PT73997B (en) | 1983-03-31 |
| ES8400390A1 (es) | 1983-11-01 |
| ES516472A0 (es) | 1983-11-01 |
| GB2096988A (en) | 1982-10-27 |
| IE52403B1 (en) | 1987-10-14 |
| US4382958A (en) | 1983-05-10 |
| EP0052963B1 (en) | 1985-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0052963B1 (en) | Secondary amines | |
| CA1150297A (en) | Ethanamine derivatives their preparation and use in pharmaceutical compositions | |
| US4588749A (en) | Arylethanolamine derivatives, their preparation and use in pharmaceutical compositions | |
| EP0040915B1 (en) | Arylethanolamine derivatives, their preparation and use in pharmaceutical compositions | |
| EP0021636A1 (en) | Secondary amines, their preparation and use in pharmaceutical compositions | |
| JPH05320153A (ja) | 置換5−(2−((2−アリール−2−ヒドロキシエチル)−アミノ)−プロピル)−1,3−ベンゾジオキソール | |
| EP0051917B1 (en) | Benzofuran ethanolamine derivatives, processes for their preparation, and their use in medicine | |
| NZ204901A (en) | N-(2-phenyl-2-hydrocarbyloxyethyl)-n-(omega-phenylalkyl)amines | |
| US4329358A (en) | 3-Chlorophenyl anti-obesity agents | |
| US4341793A (en) | Secondary amines and their use in pharmaceutical compositions | |
| US4622342A (en) | Secondary amines | |
| EP0068669A1 (en) | Secondary phenylethanol amines, processes for their preparation and their pharmaceutical application | |
| EP0061907B1 (en) | Secondary amines, their preparation, pharmaceutical compositions containing them and their use | |
| EP0070133B1 (en) | Secondary phenylethanol amines, processes for their preparation and their pharmaceutical application | |
| EP0063004A1 (en) | Secondary amines, processes for their preparation, and pharmaceutical compositions containing them | |
| EP0066351B1 (en) | Arylethanol amine derivatives, their preparation and use in pharmaceutical compositions | |
| EP0095827B1 (en) | N-substituted derivatives of ethanol amine | |
| WO1984000956A1 (en) | Secondary arylethanolamines | |
| GB2084577A (en) | Secondary Amines |