NZ181168A - 3-sulphamyl benzylamine derivatives and pharmaceutical compositions intermidiates - Google Patents
3-sulphamyl benzylamine derivatives and pharmaceutical compositions intermidiatesInfo
- Publication number
- NZ181168A NZ181168A NZ181168A NZ18116876A NZ181168A NZ 181168 A NZ181168 A NZ 181168A NZ 181168 A NZ181168 A NZ 181168A NZ 18116876 A NZ18116876 A NZ 18116876A NZ 181168 A NZ181168 A NZ 181168A
- Authority
- NZ
- New Zealand
- Prior art keywords
- intermidiates
- sulphamyl
- pharmaceutical compositions
- benzylamine derivatives
- benzylamine
- Prior art date
Links
- HNENXADRSCEPIJ-UHFFFAOYSA-N 3-(aminomethyl)benzenesulfonamide Chemical class NCC1=CC=CC(S(N)(=O)=O)=C1 HNENXADRSCEPIJ-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2877475 | 1975-07-08 | ||
| GB28770/75A GB1523631A (en) | 1975-07-08 | 1975-07-08 | Sulphonamide derivatives |
| GB2877375 | 1975-07-08 | ||
| GB2877275 | 1975-07-08 | ||
| GB2877575 | 1975-07-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ181168A true NZ181168A (en) | 1978-09-25 |
Family
ID=27516295
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ181168A NZ181168A (en) | 1975-07-08 | 1976-06-15 | 3-sulphamyl benzylamine derivatives and pharmaceutical compositions intermidiates |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4082851A (ref) |
| AT (1) | AT345783B (ref) |
| AU (1) | AU503344B2 (ref) |
| BE (1) | BE843828A (ref) |
| CA (1) | CA1077953A (ref) |
| DE (1) | DE2630637C2 (ref) |
| DK (1) | DK302776A (ref) |
| FI (1) | FI761987A7 (ref) |
| FR (1) | FR2316929A1 (ref) |
| GB (1) | GB1523631A (ref) |
| GR (1) | GR60429B (ref) |
| IE (1) | IE43009B1 (ref) |
| IT (1) | IT1063145B (ref) |
| LU (1) | LU75322A1 (ref) |
| NL (1) | NL7607505A (ref) |
| NZ (1) | NZ181168A (ref) |
| PT (1) | PT65317B (ref) |
| SE (1) | SE7607786L (ref) |
| SU (1) | SU644374A3 (ref) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4247550A (en) * | 1975-07-08 | 1981-01-27 | Leo Pharmaceutical Products Ltd. A/S (Lovens Kemiske Fabrik Produktionsaktieselskab) | Compositions and methods for the treatment of hypertension or oedemas |
| CH628622A5 (de) * | 1976-12-24 | 1982-03-15 | Ciba Geigy Ag | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
| GB1600840A (en) * | 1978-05-30 | 1981-10-21 | Wellcome Found | Diphenylether derivatives useful as flukicidal agents |
| DE3041812A1 (de) * | 1980-11-06 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Basisch substituierte 5-phenyltetrazole, verfahren zu ihrer herstellung und ihre verwendung als heilmittel |
| DE3208189A1 (de) * | 1982-03-06 | 1983-09-08 | Hoechst Ag, 6230 Frankfurt | 2-aminomethyl-6-sulfamoylphenolderivate, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen |
| PL350769A1 (en) * | 1999-03-31 | 2003-01-27 | Basf Ag | Substituted aniline compounds |
| TWI449692B (zh) | 2005-05-13 | 2014-08-21 | Otsuka Pharma Co Ltd | 吡咯烷化合物(三) |
| SK542007A3 (sk) * | 2007-04-20 | 2008-11-06 | Unimed Pharma, Spol. S R. O. | Substituované sulfónamidy, spôsob ich prípravy, farmaceutický prostriedok s ich obsahom a ich použitie |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2871233A (en) * | 1954-06-16 | 1959-01-27 | Basf Ag | Cobalt containing azo dyestuffs |
| US3565920A (en) * | 1966-12-29 | 1971-02-23 | Ciba Geigy Corp | 5-sulfamyl-anthranilic acids |
| US3565952A (en) * | 1968-09-06 | 1971-02-23 | Beiersdorf Ag | 4 - chloro - 3 - nitro - 5 - sulfamyl salicylic acid - (2',6' - dimethyl) - anilide and its salts |
| GB1249490A (en) * | 1968-12-24 | 1971-10-13 | Leo Pharm Prod Ltd | New sulphamyl-benzoic acid derivatives |
| US3806542A (en) * | 1969-06-10 | 1974-04-23 | Ciba Geigy Corp | 5-arylsulfamyl-anthranilic acids |
| US3706790A (en) * | 1970-02-27 | 1972-12-19 | Merck & Co Inc | (mono-and di-substituted sulfamoyl) benzoic acids |
| US3816482A (en) * | 1970-06-18 | 1974-06-11 | Leo Pharm Prod Ltd | Sulfamylbenzoic acids |
| US3860647A (en) * | 1973-08-20 | 1975-01-14 | Smithkline Corp | {60 -Aminomethyl-4-hydroxy-3-sulfamyl-benzyl alcohols and 4-hydroxy-3-sulfamyl phenethylamines |
| GB1434405A (en) * | 1973-09-06 | 1976-05-05 | Leo Pharm Prod Ltd | Phenyl-benzoic acid derivatives |
-
1975
- 1975-07-08 GB GB28770/75A patent/GB1523631A/en not_active Expired
-
1976
- 1976-06-14 IE IE1285/76A patent/IE43009B1/en unknown
- 1976-06-15 NZ NZ181168A patent/NZ181168A/xx unknown
- 1976-06-16 US US05/696,547 patent/US4082851A/en not_active Expired - Lifetime
- 1976-06-25 GR GR51105A patent/GR60429B/el unknown
- 1976-06-29 AT AT473076A patent/AT345783B/de not_active IP Right Cessation
- 1976-07-02 PT PT65317A patent/PT65317B/pt unknown
- 1976-07-02 SU SU762377347A patent/SU644374A3/ru active
- 1976-07-05 CA CA256,326A patent/CA1077953A/en not_active Expired
- 1976-07-05 DK DK302776A patent/DK302776A/da not_active Application Discontinuation
- 1976-07-06 BE BE168670A patent/BE843828A/xx unknown
- 1976-07-07 DE DE2630637A patent/DE2630637C2/de not_active Expired
- 1976-07-07 SE SE7607786A patent/SE7607786L/xx unknown
- 1976-07-07 LU LU75322A patent/LU75322A1/xx unknown
- 1976-07-07 IT IT7668697A patent/IT1063145B/it active
- 1976-07-07 FR FR7620790A patent/FR2316929A1/fr active Granted
- 1976-07-07 NL NL7607505A patent/NL7607505A/xx not_active Application Discontinuation
- 1976-07-07 FI FI761987A patent/FI761987A7/fi not_active Application Discontinuation
- 1976-07-07 AU AU15677/76A patent/AU503344B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PT65317A (en) | 1976-08-01 |
| DK302776A (da) | 1977-01-09 |
| LU75322A1 (ref) | 1977-04-01 |
| IE43009L (en) | 1977-01-08 |
| BE843828A (fr) | 1977-01-06 |
| AU1567776A (en) | 1978-01-12 |
| ATA473076A (de) | 1978-02-15 |
| FR2316929A1 (fr) | 1977-02-04 |
| CA1077953A (en) | 1980-05-20 |
| DE2630637A1 (de) | 1977-01-27 |
| AU503344B2 (en) | 1979-08-30 |
| SU644374A3 (ru) | 1979-01-25 |
| SE7607786L (sv) | 1977-01-09 |
| FI761987A7 (ref) | 1977-01-09 |
| US4082851A (en) | 1978-04-04 |
| PT65317B (en) | 1978-01-05 |
| DE2630637C2 (de) | 1986-09-25 |
| NL7607505A (nl) | 1977-01-11 |
| IT1063145B (it) | 1985-02-11 |
| GR60429B (en) | 1978-05-26 |
| IE43009B1 (en) | 1980-12-03 |
| AT345783B (de) | 1978-10-10 |
| FR2316929B1 (ref) | 1979-09-21 |
| GB1523631A (en) | 1978-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ180529A (en) | Erythromyc-9-yl-amine derivatives and pharmaceutical compositions | |
| NZ181726A (en) | Pyrrolidine derivatives and pharmaceutical compositions | |
| NZ181444A (en) | -phenyl benzylidene derivatives and pharmaceutical compositions | |
| NZ182837A (en) | Glucosamine derivatives and pharmaceutical compositions | |
| NZ182493A (en) | Aminobenzamides and pharmaceutical compositions | |
| NZ183150A (en) | 7-aminothiazolyl-iminoa-cetamido-cephalosporin derivatives and pharmaceutical compositions | |
| NZ182665A (en) | Amine derivatives and pharmaceutical compositions | |
| GB1520447A (en) | Benzisoquinoline derivatives and pharmaceutical uses thereof | |
| NZ181959A (en) | Pyrimidine derivatives and pharmaceutical compositions | |
| NZ182759A (en) | Pyrimidine derivatives and pharmaceutical compositions | |
| ZA763917B (en) | Pharmaceutical compositions and compounds | |
| PH15711A (en) | Acylamino derivatives and pharmaceutical compositions thereof | |
| GB1518041A (en) | Oxadiazolinone derivatives and compositions containing them | |
| GB1537880A (en) | 1-triarylalkyl-4-phenyl-4-piperidine-methanols and derivatives and pharmaceutical compositions containing them | |
| NZ184755A (en) | 2-benzylpyrrolidine derivatives and pharmaceutical compositions | |
| NZ181503A (en) | Substituted diphenyls-ulphides and pharmaceutical compositions | |
| NZ185642A (en) | Morphanthridine derivatives and pharmaceutical compositions | |
| NZ182591A (en) | 14-substituted-daunorubicins and pharmaceutical compositions | |
| NZ181972A (en) | N-aryl-n-(4-piperidyl)-arylacetamide derivatives and pharmaceutical compositions | |
| NZ182161A (en) | Alkoxy-pyridine-carobxamide derivatives and pharmaceutical compositions | |
| NZ182581A (en) | -amino-ketones and pharmaceutical compositions | |
| NZ181864A (en) | Noroxymorphones and pharmaceutical compositions | |
| PH13912A (en) | Substituted benzamide derivatives and pharmaceutical compositions thereof | |
| NZ184103A (en) | Fenzodioxole derivatives and pharmaceutical compositions | |
| NZ181168A (en) | 3-sulphamyl benzylamine derivatives and pharmaceutical compositions intermidiates |