NO960796D0 - Benzotiofenonforbindelser, mellomprodukter, sammensetninger og fremgangsmåter - Google Patents
Benzotiofenonforbindelser, mellomprodukter, sammensetninger og fremgangsmåterInfo
- Publication number
- NO960796D0 NO960796D0 NO960796A NO960796A NO960796D0 NO 960796 D0 NO960796 D0 NO 960796D0 NO 960796 A NO960796 A NO 960796A NO 960796 A NO960796 A NO 960796A NO 960796 D0 NO960796 D0 NO 960796D0
- Authority
- NO
- Norway
- Prior art keywords
- benzothiophenone
- intermediates
- compositions
- compounds
- methods
- Prior art date
Links
- 239000000543 intermediate Substances 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- XDDVRYDDMGRFAZ-UHFFFAOYSA-N thiobenzophenone Chemical class C=1C=CC=CC=1C(=S)C1=CC=CC=C1 XDDVRYDDMGRFAZ-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/396,401 US5510357A (en) | 1995-02-28 | 1995-02-28 | Benzothiophene compounds as anti-estrogenic agents |
| US55276095A | 1995-11-03 | 1995-11-03 | |
| US08/552,679 US5856339A (en) | 1995-02-28 | 1995-11-03 | Benzothiophene compounds, intermediates, compositions, and methods |
| US08/552,564 US5998441A (en) | 1995-02-28 | 1995-11-03 | Benzothiophene compounds, intermediates, compositions, and methods |
| US08/552,636 US5723474A (en) | 1995-02-28 | 1995-11-03 | Benzothiophene compounds, intermediates, compositions, and methods |
| US08/554,223 US5856340A (en) | 1995-02-28 | 1995-11-03 | Method of treating estrogen dependent cancers |
| US08/552,890 US5919800A (en) | 1995-02-28 | 1995-11-03 | Benzothiophene compounds, intermediates, compositions, and methods |
| US08/552,565 US5977093A (en) | 1995-02-28 | 1995-11-03 | Benzothiophene compounds, intermediates, compositions, and methods |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO960796D0 true NO960796D0 (no) | 1996-02-27 |
| NO960796L NO960796L (no) | 1996-08-29 |
| NO314229B1 NO314229B1 (no) | 2003-02-17 |
Family
ID=27575428
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO19960796A NO314229B1 (no) | 1995-02-28 | 1996-02-27 | Benzotiofenforbindelser, mellomprodukter, sammensetninger, fremgangsmåter og anvendelse av samme |
Country Status (8)
| Country | Link |
|---|---|
| CN (1) | CN1086700C (no) |
| BR (1) | BR9600829A (no) |
| CA (1) | CA2170479C (no) |
| CZ (1) | CZ290200B6 (no) |
| FI (1) | FI120345B (no) |
| HU (1) | HU226326B1 (no) |
| NO (1) | NO314229B1 (no) |
| TR (1) | TR199600127A2 (no) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE535691C2 (sv) * | 2011-03-08 | 2012-11-13 | Kat2Biz Ab | Reduktion av C-O-bindningar via katalytisk transfer hydrogenolys |
| CN102746290B (zh) * | 2012-06-21 | 2014-08-27 | 成都苑东药业有限公司 | 一种噻唑类化合物及其制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4117512A1 (de) * | 1991-05-25 | 1992-11-26 | Schering Ag | 2-phenylbenzo(b)furane und -thiophene, verfahren zu deren herstellung und diese enthaltende pharmazeutische praeparate |
-
1996
- 1996-02-16 TR TR96/00127A patent/TR199600127A2/xx unknown
- 1996-02-27 HU HU9600476A patent/HU226326B1/hu not_active IP Right Cessation
- 1996-02-27 BR BR9600829A patent/BR9600829A/pt not_active IP Right Cessation
- 1996-02-27 NO NO19960796A patent/NO314229B1/no not_active IP Right Cessation
- 1996-02-27 FI FI960909A patent/FI120345B/fi not_active IP Right Cessation
- 1996-02-27 CA CA 2170479 patent/CA2170479C/en not_active Expired - Fee Related
- 1996-02-27 CN CN96105752A patent/CN1086700C/zh not_active Expired - Fee Related
- 1996-02-27 CZ CZ1996588A patent/CZ290200B6/cs not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CN1159448A (zh) | 1997-09-17 |
| FI120345B (fi) | 2009-09-30 |
| AU4579796A (en) | 1996-09-05 |
| HU9600476D0 (en) | 1996-04-29 |
| HUP9600476A2 (hu) | 1999-06-28 |
| NO314229B1 (no) | 2003-02-17 |
| CN1086700C (zh) | 2002-06-26 |
| HUP9600476A3 (en) | 1999-07-28 |
| CZ58896A3 (en) | 1996-09-11 |
| CA2170479A1 (en) | 1996-08-29 |
| TR199600127A2 (tr) | 1996-10-21 |
| CA2170479C (en) | 2009-04-14 |
| AU699753B2 (en) | 1998-12-17 |
| BR9600829A (pt) | 1997-12-30 |
| FI960909A0 (fi) | 1996-02-27 |
| NO960796L (no) | 1996-08-29 |
| HU226326B1 (en) | 2008-08-28 |
| FI960909L (fi) | 1996-08-29 |
| CZ290200B6 (cs) | 2002-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI20095804A7 (fi) | Bentsotiofeeniyhdisteet, välituotteet, koostumukset ja menetelmät | |
| FI960889A7 (fi) | Naftyyliyhdisteitä, välituotteita, koostumuksia ja menetelmiä | |
| IS4565A (is) | 2-methýl-thíenó-bensódíasepín, samsetning til inntöku | |
| FI974241A7 (fi) | BPM-15 -koostumukset | |
| NO982625L (no) | R°rkopling | |
| BR9611184B8 (pt) | Composto e composição. | |
| BR9606809A (pt) | Composição inseticidamente ativa | |
| BR9607058A (pt) | Composição | |
| DE69617029D1 (de) | Organoton-zusammensetzungen | |
| NO981568D0 (no) | Randtennings-tennsatssammensetninger | |
| PT728814E (pt) | Composicao betuminosa | |
| DE69601423D1 (de) | Federball | |
| BR9609615A (pt) | Composição herbicida seletiva | |
| BR9609903A (pt) | ComposiçÃo inseticidamente ativa | |
| BR9607487A (pt) | Composição herbicida | |
| NO990913L (no) | Naftylforbindelser, intermediater, sammensetninger og metoder for anvendelse | |
| DE69616374D1 (de) | Germizide zusammensetzung | |
| DE69603228D1 (de) | Aluminoxanate-Zusammensetzungen | |
| FI956015L (fi) | 5-asyyli-1,4-dihydropyridiinien käyttö | |
| DE69605016D1 (de) | Intumeszenzzusammensetzung | |
| BR9608890A (pt) | N-metilenotiouréias substituídas | |
| BR9607946A (pt) | Composição | |
| DE69603749D1 (de) | Feste zusammensetzung | |
| ATE206150T1 (de) | Farbstoffstabilisierte zusammensetzungen | |
| FR2865535B1 (fr) | Penetreur |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM1K | Lapsed by not paying the annual fees |