NO162278B - Emulsjonssprengstoff. - Google Patents
Emulsjonssprengstoff. Download PDFInfo
- Publication number
- NO162278B NO162278B NO850973A NO850973A NO162278B NO 162278 B NO162278 B NO 162278B NO 850973 A NO850973 A NO 850973A NO 850973 A NO850973 A NO 850973A NO 162278 B NO162278 B NO 162278B
- Authority
- NO
- Norway
- Prior art keywords
- emulsion
- explosive
- explosives
- electrical conductivity
- modifier
- Prior art date
Links
- 239000000839 emulsion Substances 0.000 title claims description 103
- 239000002360 explosive Substances 0.000 title claims description 92
- 239000003607 modifier Substances 0.000 claims description 46
- 239000000203 mixture Substances 0.000 claims description 29
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 28
- 229940014800 succinic anhydride Drugs 0.000 claims description 27
- -1 sorbitan ester Chemical class 0.000 claims description 25
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 claims description 23
- 239000003995 emulsifying agent Substances 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 230000001804 emulsifying effect Effects 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 238000009884 interesterification Methods 0.000 claims description 5
- 229920000642 polymer Polymers 0.000 claims description 5
- 229920002367 Polyisobutene Polymers 0.000 claims description 4
- 239000006185 dispersion Substances 0.000 claims description 4
- 229920005862 polyol Polymers 0.000 claims description 4
- 150000003077 polyols Chemical class 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 150000005673 monoalkenes Chemical class 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims 1
- 239000012071 phase Substances 0.000 description 36
- 238000000034 method Methods 0.000 description 27
- 239000007789 gas Substances 0.000 description 17
- 230000001590 oxidative effect Effects 0.000 description 14
- 238000003860 storage Methods 0.000 description 13
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 12
- 239000000446 fuel Substances 0.000 description 12
- 150000003839 salts Chemical class 0.000 description 12
- 239000000523 sample Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000001993 wax Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 7
- 150000002430 hydrocarbons Chemical group 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000000600 sorbitol Substances 0.000 description 7
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 6
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 6
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 6
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 5
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000004945 emulsification Methods 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 4
- ULQISTXYYBZJSJ-UHFFFAOYSA-N 12-hydroxyoctadecanoic acid Chemical compound CCCCCCC(O)CCCCCCCCCCC(O)=O ULQISTXYYBZJSJ-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000005422 blasting Methods 0.000 description 4
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 238000005474 detonation Methods 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000004005 microsphere Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 229940114072 12-hydroxystearic acid Drugs 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000004312 hexamethylene tetramine Substances 0.000 description 3
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 3
- 238000010952 in-situ formation Methods 0.000 description 3
- 229960004011 methenamine Drugs 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 2
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 2
- DYSXLQBUUOPLBB-UHFFFAOYSA-N 2,3-dinitrotoluene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O DYSXLQBUUOPLBB-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 2
- 229930091371 Fructose Natural products 0.000 description 2
- 239000005715 Fructose Substances 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 239000004166 Lanolin Substances 0.000 description 2
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 239000005662 Paraffin oil Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000004581 coalescence Methods 0.000 description 2
- 230000001687 destabilization Effects 0.000 description 2
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000000295 fuel oil Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 235000019388 lanolin Nutrition 0.000 description 2
- 229940039717 lanolin Drugs 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- PTIUDKQYXMFYAI-UHFFFAOYSA-N methylammonium nitrate Chemical compound NC.O[N+]([O-])=O PTIUDKQYXMFYAI-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000011236 particulate material Substances 0.000 description 2
- 229940059574 pentaerithrityl Drugs 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 238000000518 rheometry Methods 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000001593 sorbitan monooleate Substances 0.000 description 2
- 235000011069 sorbitan monooleate Nutrition 0.000 description 2
- 229940035049 sorbitan monooleate Drugs 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical class O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 2
- 239000007762 w/o emulsion Substances 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- CMCBDXRRFKYBDG-UHFFFAOYSA-N 1-dodecoxydodecane Chemical compound CCCCCCCCCCCCOCCCCCCCCCCCC CMCBDXRRFKYBDG-UHFFFAOYSA-N 0.000 description 1
- JLPULHDHAOZNQI-ZTIMHPMXSA-N 1-hexadecanoyl-2-(9Z,12Z-octadecadienoyl)-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCC\C=C/C\C=C/CCCCC JLPULHDHAOZNQI-ZTIMHPMXSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- HZTVIZREFBBQMG-UHFFFAOYSA-N 2-methyl-1,3,5-trinitrobenzene;[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O HZTVIZREFBBQMG-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 description 1
- 239000010963 304 stainless steel Substances 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VHOQXEIFYTTXJU-UHFFFAOYSA-N Isobutylene-isoprene copolymer Chemical group CC(C)=C.CC(=C)C=C VHOQXEIFYTTXJU-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000935974 Paralichthys dentatus Species 0.000 description 1
- 229920005439 Perspex® Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229910000589 SAE 304 stainless steel Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- IYFATESGLOUGBX-YVNJGZBMSA-N Sorbitan monopalmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O IYFATESGLOUGBX-YVNJGZBMSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 239000004164 Wax ester Substances 0.000 description 1
- IJCWFDPJFXGQBN-RYNSOKOISA-N [(2R)-2-[(2R,3R,4S)-4-hydroxy-3-octadecanoyloxyoxolan-2-yl]-2-octadecanoyloxyethyl] octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCCCCCCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCCCCCCCCCCCC IJCWFDPJFXGQBN-RYNSOKOISA-N 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- RAESLDWEUUSRLO-UHFFFAOYSA-O aminoazanium;nitrate Chemical compound [NH3+]N.[O-][N+]([O-])=O RAESLDWEUUSRLO-UHFFFAOYSA-O 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- CLXPQCKVAYIJQB-UHFFFAOYSA-N carbamoylazanium;perchlorate Chemical compound NC(N)=O.OCl(=O)(=O)=O CLXPQCKVAYIJQB-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- PSIQSMXODVNUAM-UHFFFAOYSA-N ethene;2-methylprop-1-ene Chemical group C=C.CC(C)=C PSIQSMXODVNUAM-UHFFFAOYSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 150000002195 fatty ethers Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 235000013379 molasses Nutrition 0.000 description 1
- 150000004712 monophosphates Chemical class 0.000 description 1
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 1
- 239000002103 nanocoating Substances 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- XKLJHFLUAHKGGU-UHFFFAOYSA-N nitrous amide Chemical class ON=N XKLJHFLUAHKGGU-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229940082615 organic nitrates used in cardiac disease Drugs 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000001570 sorbitan monopalmitate Substances 0.000 description 1
- 235000011071 sorbitan monopalmitate Nutrition 0.000 description 1
- 229940031953 sorbitan monopalmitate Drugs 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000001589 sorbitan tristearate Substances 0.000 description 1
- 235000011078 sorbitan tristearate Nutrition 0.000 description 1
- 229960004129 sorbitan tristearate Drugs 0.000 description 1
- 229940083466 soybean lecithin Drugs 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000019386 wax ester Nutrition 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Colloid Chemistry (AREA)
- Cosmetics (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8407302 | 1984-03-21 | ||
| GB848415205A GB8415205D0 (en) | 1984-06-14 | 1984-06-14 | Emulsion explosive composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO850973L NO850973L (no) | 1985-09-23 |
| NO162278B true NO162278B (no) | 1989-08-28 |
Family
ID=26287483
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO850973A NO162278B (no) | 1984-03-21 | 1985-03-12 | Emulsjonssprengstoff. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4822433A (xx) |
| EP (1) | EP0155800B2 (xx) |
| JP (1) | JPH0725625B2 (xx) |
| AU (3) | AU574140B2 (xx) |
| CA (1) | CA1321880C (xx) |
| DE (1) | DE3568035D1 (xx) |
| GB (1) | GB2156799B (xx) |
| HK (1) | HK50789A (xx) |
| IE (1) | IE58008B1 (xx) |
| IN (1) | IN163182B (xx) |
| MY (1) | MY101123A (xx) |
| NO (1) | NO162278B (xx) |
| NZ (1) | NZ211346A (xx) |
| SG (1) | SG75788G (xx) |
| ZW (1) | ZW3885A1 (xx) |
Families Citing this family (63)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59156991A (ja) * | 1983-02-24 | 1984-09-06 | 日本化薬株式会社 | 油中水滴型エマルジヨン爆薬 |
| IE59303B1 (en) * | 1985-08-21 | 1994-02-09 | Ici Australia Ltd | Composition |
| AU601690B2 (en) * | 1985-08-21 | 1990-09-20 | Orica Australia Pty Ltd | Emulsion explosive |
| GB2181725B (en) * | 1985-09-19 | 1989-08-31 | Ici Plc | Method and apparatus for improving the quality of an emulsion explosive composition |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
| US4844756A (en) * | 1985-12-06 | 1989-07-04 | The Lubrizol Corporation | Water-in-oil emulsions |
| ZW23786A1 (en) * | 1985-12-06 | 1987-04-29 | Lubrizol Corp | Water-in-oil-emulsions |
| AU600927B2 (en) * | 1986-02-28 | 1990-08-30 | Ici Australia Limited | Explosive composition |
| US5047175A (en) * | 1987-12-23 | 1991-09-10 | The Lubrizol Corporation | Salt composition and explosives using same |
| US4828633A (en) * | 1987-12-23 | 1989-05-09 | The Lubrizol Corporation | Salt compositions for explosives |
| US5527491A (en) | 1986-11-14 | 1996-06-18 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| US4840687A (en) * | 1986-11-14 | 1989-06-20 | The Lubrizol Corporation | Explosive compositions |
| US4863534A (en) * | 1987-12-23 | 1989-09-05 | The Lubrizol Corporation | Explosive compositions using a combination of emulsifying salts |
| US4919178A (en) * | 1986-11-14 | 1990-04-24 | The Lubrizol Corporation | Explosive emulsion |
| GB8700658D0 (en) * | 1987-01-13 | 1987-02-18 | Ici Plc | Formulation process |
| US4784706A (en) * | 1987-12-03 | 1988-11-15 | Ireco Incorporated | Emulsion explosive containing phenolic emulsifier derivative |
| US4820361A (en) * | 1987-12-03 | 1989-04-11 | Ireco Incorporated | Emulsion explosive containing organic microspheres |
| US5129972A (en) | 1987-12-23 | 1992-07-14 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| NZ227899A (en) * | 1988-02-23 | 1992-03-26 | Ici Australia Operations | Emulsion explosive compositions containing a poly(alk(en)yl) succinic acid secondary amine condensation product, and the preparation of the explosive |
| AU610692B2 (en) * | 1988-02-23 | 1991-05-23 | Orica Explosives Technology Pty Ltd | Explosive composition |
| NZ227918A (en) * | 1988-02-23 | 1992-03-26 | Ici Australia Operations | Emulsion explosive composition containing primary amine-poly(alk(en)yl)succinic acid condensate as emulsifier |
| GB8822187D0 (en) * | 1988-09-21 | 1988-10-26 | Ici Plc | Water-in-oil emulsion explosive |
| CA2000964A1 (en) * | 1989-03-02 | 1990-09-02 | Richard W. Jahnke | Oil-water emulsions |
| US4931110A (en) * | 1989-03-03 | 1990-06-05 | Ireco Incorporated | Emulsion explosives containing a polymeric emulsifier |
| GB2232614B (en) | 1989-06-16 | 1993-05-26 | Ici Plc | Emulsification method |
| ZW13990A1 (en) * | 1989-09-05 | 1992-06-10 | Ici Australia Operations | Explosive composition |
| CA2030169C (en) * | 1989-11-16 | 2000-08-22 | Vladimir Sujansky | Emulsion explosive |
| US5120375A (en) * | 1990-06-14 | 1992-06-09 | Atlas Powder Company | Explosive with-coated solid additives |
| US5123981A (en) * | 1990-06-14 | 1992-06-23 | Atlas Powder Company | Coated solid additives for explosives |
| US5034071A (en) * | 1990-06-14 | 1991-07-23 | Atlas Powder Company | Prill for emulsion explosives |
| US8025010B1 (en) * | 1990-09-18 | 2011-09-27 | Alliant Techsystems Inc. | Method for reducing charge retention properties of solid propellants |
| CA2049628C (en) * | 1991-08-21 | 2002-02-26 | Clare T. Aitken | Vegetable oil emulsion explosive |
| GB9118628D0 (en) * | 1991-08-30 | 1991-10-16 | Ici Canada | Mixed surfactant system |
| US5920031A (en) * | 1992-03-17 | 1999-07-06 | The Lubrizol Corporation | Water-in-oil emulsions |
| FR2701942B1 (fr) * | 1993-02-24 | 1995-05-19 | Prod Ind Cfpi Franc | Additif interne et procédé pour la préparation de certaines formes cristallisées du nitrate d'ammonium et applications industrielles de celles-ci. |
| US5401341A (en) * | 1993-04-14 | 1995-03-28 | The Lubrizol Corporation | Cross-linked emulsion explosive composition |
| SE512666C2 (sv) * | 1993-12-16 | 2000-04-17 | Nitro Nobel Ab | Partikulärt sprängämne, tillverkningsmetod och användning |
| US5397399A (en) * | 1994-06-22 | 1995-03-14 | Mining Services International | Emulsified gassing agents containing hydrogen peroxide and methods for their use |
| AU710644B2 (en) * | 1994-12-20 | 1999-09-23 | Sasol Chemical Industries Limited | Emulsifier |
| AUPN737395A0 (en) * | 1995-12-29 | 1996-01-25 | Ici Australia Operations Proprietary Limited | Process and apparatus for the manufacture of emulsion explosive compositions |
| US5920030A (en) * | 1996-05-02 | 1999-07-06 | Mining Services International | Methods of blasting using nitrogen-free explosives |
| DE19649763A1 (de) * | 1996-11-30 | 1998-06-04 | Appenzeller Albert | Sprengstoff für zivile, insbesondere bergmännische Zwecke |
| US5936194A (en) * | 1998-02-18 | 1999-08-10 | The Lubrizol Corporation | Thickened emulsion compositions for use as propellants and explosives |
| US6051086A (en) * | 1998-06-08 | 2000-04-18 | Orica Explosives Technology Pty Ltd. | Buffered emulsion blasting agent |
| FR2780726B1 (fr) * | 1998-07-03 | 2000-08-25 | Nobel Explosifs France | Emulsions explosives encartouchees energetiques |
| DE19847868C2 (de) | 1998-10-16 | 2003-09-25 | Clariant Gmbh | Sprengstoffe, enthaltend modifizierte Copolymere aus Polyisobutylen und Maleinsäureanhydrid als Emulgatoren |
| US6200398B1 (en) | 1998-12-30 | 2001-03-13 | The Lubrizol Corporation | Emulsion explosive compositions |
| US6984273B1 (en) * | 1999-07-29 | 2006-01-10 | Aerojet-General Corporation | Premixed liquid monopropellant solutions and mixtures |
| US6425965B1 (en) * | 1999-08-20 | 2002-07-30 | Guillermo Silva | Ultra low density explosive composition |
| DE10003297C2 (de) * | 2000-01-27 | 2003-08-21 | Clariant Gmbh | Sprengstoffe, enthaltend modifizierte Copolymere aus Polyisobutylen, Vinylestern und Maleinsäureanhydrid als Emulgatoren |
| AUPR024400A0 (en) * | 2000-09-20 | 2000-10-12 | Orica Explosives Technology Pty Ltd | Sensitisation of emulsion explosives |
| US7344570B2 (en) | 2001-08-24 | 2008-03-18 | Clean Fuels Technology, Inc. | Method for manufacturing an emulsified fuel |
| FR2871688B1 (fr) | 2004-06-16 | 2008-05-16 | Oreal | Procede pour favoriser la penetration d'un actif et composition permettant sa mise en oeuvre |
| FR2873573B1 (fr) | 2004-08-02 | 2006-11-17 | Oreal | Emulsion eau-dans-huile comprenant une huile non-volatile non-siliconee, un tensioactif cationique, une polyolefine a partie's) polaire(s), et un alkylmonoglycoside ou alkylpolyglycoside |
| FR2902999B1 (fr) | 2006-07-03 | 2012-09-28 | Oreal | Utilisation de derives c-glycoside a titre d'actif prodesquamant |
| FR2910286B1 (fr) | 2006-12-20 | 2009-04-17 | Oreal | Composition comprenant des composes silicones encapsules |
| FR2918561B1 (fr) | 2007-07-09 | 2009-10-09 | Oreal | Utilisation pour la coloration de la peau de l'acide dehydroascorbique ou des derives polymeres ; procedes de soin et/ou de maquillage. |
| FR2939036B1 (fr) | 2008-12-01 | 2010-12-17 | Oreal | Procede de coloration artificielle de la peau utilisant un melange de carotenoide et de colorant vert lidophile ; nouveau melange de colorants lipophiles ; composition |
| RU2540671C2 (ru) * | 2013-06-27 | 2015-02-10 | Федеральное Казенное Предприятие "Бийский Олеумный Завод" | Эмульгирующий состав для производства эмульсионных взрывчатых веществ (варианты) |
| US9175933B2 (en) | 2014-02-21 | 2015-11-03 | The United States Of America, As Represented By The Secretary Of The Army | Simple low-cost hand-held landmine neutralization device |
| CA2963986A1 (en) * | 2014-10-14 | 2016-04-21 | Orica International Pte Ltd | Product |
| US10065898B1 (en) | 2017-09-21 | 2018-09-04 | Exsa S.A. | Bulk pumpable granulated explosive mix |
| FR3106073B1 (fr) * | 2020-01-10 | 2022-01-21 | Nitrates & Innovation | Installation pour la préparation d’une composition explosive et procédé de préparation d’une composition explosive |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1270723B (de) * | 1961-08-30 | 1968-06-20 | Lubrizol Corp | Wasser-in-OEl-Emulsion fuer Schmierzwecke |
| US3269946A (en) * | 1961-08-30 | 1966-08-30 | Lubrizol Corp | Stable water-in-oil emulsions |
| GB1054093A (xx) * | 1963-06-17 | |||
| US3513093A (en) * | 1963-06-17 | 1970-05-19 | Lubrizol Corp | Lubricant containing nitrogen-containing and phosphorus-containing succinic derivatives |
| US3324033A (en) * | 1966-03-29 | 1967-06-06 | Ethyl Corp | Ester-amides of alkenyl succinic anhydride and diethanolamine as ashless dispersants |
| US3397097A (en) * | 1966-07-12 | 1968-08-13 | Du Pont | Thickened aqueous inorganic oxidizer salt blasting compositions containing gas bubbles and a crystal habit modifier and method of preparation |
| US3542678A (en) * | 1968-03-13 | 1970-11-24 | Lubrizol Corp | Lubricant and fuel compositions containing esters |
| US3576743A (en) * | 1969-04-11 | 1971-04-27 | Lubrizol Corp | Lubricant and fuel additives and process for making the additives |
| US3632511A (en) * | 1969-11-10 | 1972-01-04 | Lubrizol Corp | Acylated nitrogen-containing compositions processes for their preparationand lubricants and fuels containing the same |
| US3639242A (en) * | 1969-12-29 | 1972-02-01 | Lubrizol Corp | Lubricating oil or fuel containing sludge-dispersing additive |
| US3755169A (en) * | 1970-10-13 | 1973-08-28 | Lubrizol Corp | High molecular weight carboxylic acid acylating agents and the process for preparing the same |
| AU515896B2 (en) * | 1976-11-09 | 1981-05-07 | Atlas Powder Company | Water-in-oil explosive |
| BR7800984A (pt) * | 1977-02-25 | 1979-01-02 | Lubrizol Corp | Composicao lubrificante;e concentrado para formulacao de composicoes lubrificantes |
| US4666620A (en) * | 1978-09-27 | 1987-05-19 | The Lubrizol Corporation | Carboxylic solubilizer/surfactant combinations and aqueous compositions containing same |
| US4329249A (en) * | 1978-09-27 | 1982-05-11 | The Lubrizol Corporation | Carboxylic acid derivatives of alkanol tertiary monoamines and lubricants or functional fluids containing the same |
| US4435297A (en) * | 1978-09-27 | 1984-03-06 | The Lubrizol Corporation | Carboxylic acid derivatives of alkanol tertiary monoamines |
| FR2437242A1 (fr) * | 1978-09-27 | 1980-04-25 | Lubrizol Corp | Combinaisons solubilisant carboxylique/agent tensio-actif et compositions les contenant |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
| US4234435A (en) * | 1979-02-23 | 1980-11-18 | The Lubrizol Corporation | Novel carboxylic acid acylating agents, derivatives thereof, concentrate and lubricant compositions containing the same, and processes for their preparation |
| US4368133A (en) * | 1979-04-02 | 1983-01-11 | The Lubrizol Corporation | Aqueous systems containing nitrogen-containing, phosphorous-free carboxylic solubilizer/surfactant additives |
| NZ192888A (en) * | 1979-04-02 | 1982-03-30 | Canadian Ind | Water-in-oil microemulsion explosive compositions |
| US4287010A (en) * | 1979-08-06 | 1981-09-01 | E. I. Du Pont De Nemours & Company | Emulsion-type explosive composition and method for the preparation thereof |
| US4447348A (en) * | 1981-02-25 | 1984-05-08 | The Lubrizol Corporation | Carboxylic solubilizer/surfactant combinations and aqueous compositions containing same |
| US4448703A (en) * | 1981-02-25 | 1984-05-15 | The Lubrizol Corporation | Carboxylic solubilizer/surfactant combinations and aqueous compositions containing same |
| DE3375475D1 (en) * | 1982-07-21 | 1988-03-03 | Ici Plc | Emulsion explosive composition |
| US4471091A (en) * | 1982-08-09 | 1984-09-11 | The Lubrizol Corporation | Combinations of carboxylic acylating agents substituted with olefin polymers of high and low molecular weight mono-olefins, derivatives thereof, and fuels and lubricants containing same |
| US4489194A (en) * | 1982-08-09 | 1984-12-18 | The Lubrizol Corporation | Carboxylic acylating agents substituted with olefin polymers of high/low molecular weight mono-olefins, derivatives thereof, and fuels and lubricants containing same |
| US4509955A (en) * | 1982-08-09 | 1985-04-09 | The Lubrizol Corporation | Combinations of carboxylic acylating agents substituted with olefin polymers of high and low molecular weight mono-olefins, derivatives thereof, and fuels and lubricants containing same |
| US4486573A (en) * | 1982-08-09 | 1984-12-04 | The Lubrizol Corporation | Carboxylic acylating agents substituted with olefin polymers of high molecular weight mono-olefins, derivatives thereof, and fuels and lubricants containing same |
| EP0107368B1 (en) * | 1982-10-22 | 1988-05-04 | Imperial Chemical Industries Plc | Emulsion explosive composition |
| GB2131787B (en) * | 1982-10-29 | 1986-08-20 | Cil Inc | Emulsion explosive composition |
| US4496405A (en) * | 1983-09-08 | 1985-01-29 | Michael Cechanski | Explosive |
| IE59303B1 (en) * | 1985-08-21 | 1994-02-09 | Ici Australia Ltd | Composition |
| NO863451L (no) * | 1985-09-19 | 1987-03-20 | Ici Plc | Fremgangsmaate og apparat til aa forbedre kvaliteten av en emulsjons-sprengstoffblanding. |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
-
1985
- 1985-03-04 GB GB08505485A patent/GB2156799B/en not_active Expired
- 1985-03-06 DE DE8585301543T patent/DE3568035D1/de not_active Expired
- 1985-03-06 EP EP85301543A patent/EP0155800B2/en not_active Expired - Lifetime
- 1985-03-07 NZ NZ211346A patent/NZ211346A/xx unknown
- 1985-03-08 IE IE615/85A patent/IE58008B1/en not_active IP Right Cessation
- 1985-03-11 ZW ZW38/85A patent/ZW3885A1/xx unknown
- 1985-03-11 IN IN201/DEL/85A patent/IN163182B/en unknown
- 1985-03-12 NO NO850973A patent/NO162278B/no unknown
- 1985-03-15 AU AU40006/85A patent/AU574140B2/en not_active Expired
- 1985-03-21 CA CA000477186A patent/CA1321880C/en not_active Expired - Lifetime
- 1985-03-22 JP JP5575085A patent/JPH0725625B2/ja not_active Expired - Lifetime
-
1986
- 1986-11-25 MY MYPI86000135A patent/MY101123A/en unknown
-
1987
- 1987-06-05 US US07/059,225 patent/US4822433A/en not_active Expired - Lifetime
-
1988
- 1988-11-14 SG SG757/88A patent/SG75788G/en unknown
-
1989
- 1989-06-22 HK HK507/89A patent/HK50789A/xx not_active IP Right Cessation
- 1989-10-06 AU AU42624/89A patent/AU623933B2/en not_active Expired
- 1989-10-06 AU AU4262489D patent/AU616803B2/xx not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE3568035D1 (en) | 1989-03-09 |
| EP0155800A1 (en) | 1985-09-25 |
| US4822433A (en) | 1989-04-18 |
| GB2156799A (en) | 1985-10-16 |
| MY101123A (en) | 1991-07-31 |
| AU4000685A (en) | 1985-09-26 |
| NO850973L (no) | 1985-09-23 |
| HK50789A (en) | 1989-06-30 |
| ZW3885A1 (en) | 1986-10-22 |
| IE850615L (en) | 1985-09-21 |
| EP0155800B2 (en) | 1996-05-15 |
| GB2156799B (en) | 1987-12-16 |
| AU616803B2 (en) | 1991-11-07 |
| JPS60210590A (ja) | 1985-10-23 |
| AU623933B2 (en) | 1992-05-28 |
| IE58008B1 (en) | 1993-06-02 |
| AU4262489A (en) | 1990-02-01 |
| SG75788G (en) | 1989-03-23 |
| CA1321880C (en) | 1993-09-07 |
| AU574140B2 (en) | 1988-06-30 |
| JPH0725625B2 (ja) | 1995-03-22 |
| NZ211346A (en) | 1989-10-27 |
| IN163182B (xx) | 1988-08-20 |
| EP0155800B1 (en) | 1989-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4822433A (en) | Emulsion explosive composition | |
| US4818309A (en) | Primer composition | |
| US4820361A (en) | Emulsion explosive containing organic microspheres | |
| US4710248A (en) | Emulsion explosive composition | |
| US4931110A (en) | Emulsion explosives containing a polymeric emulsifier | |
| EP0107368B1 (en) | Emulsion explosive composition | |
| US5322576A (en) | Vegetable oil modified explosive | |
| US5074939A (en) | Explosive composition | |
| AU597973B2 (en) | Explosive compound | |
| CA1339057C (en) | Explosive composition | |
| US4936932A (en) | Aromatic hydrocarbon-based emulsion explosive composition | |
| US4936931A (en) | Nitroalkane-based emulsion explosive composition | |
| CA1331514C (en) | Emulsion explosive-containing composition having a high viscosity | |
| AU601690B2 (en) | Emulsion explosive | |
| KR20030085479A (ko) | 주조 입자를 포함하는 고 에너지 폭발물 |