NO136186B - - Google Patents
Download PDFInfo
- Publication number
- NO136186B NO136186B NO741397A NO741397A NO136186B NO 136186 B NO136186 B NO 136186B NO 741397 A NO741397 A NO 741397A NO 741397 A NO741397 A NO 741397A NO 136186 B NO136186 B NO 136186B
- Authority
- NO
- Norway
- Prior art keywords
- silicon carbide
- chloride
- reaction
- temperature
- reactor
- Prior art date
Links
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims description 23
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 23
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 8
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 claims description 7
- 239000005049 silicon tetrachloride Substances 0.000 claims description 7
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 claims description 6
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 claims description 5
- 150000001805 chlorine compounds Chemical class 0.000 claims description 3
- 229910001385 heavy metal Inorganic materials 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 238000005660 chlorination reaction Methods 0.000 description 5
- 238000009826 distribution Methods 0.000 description 5
- 230000007306 turnover Effects 0.000 description 5
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 150000002736 metal compounds Chemical class 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910000519 Ferrosilicon Inorganic materials 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- -1 ferric chloride Chemical class 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/08—Compounds containing halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Silicon Compounds (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2319995A DE2319995C3 (de) | 1973-04-19 | 1973-04-19 | Verfahren zur Herstellung von SiIiciumtetrachlorid aus Siliciumcarbid mit Chlorwasserstoff |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO741397L NO741397L (no) | 1974-10-22 |
| NO136186B true NO136186B (ja) | 1977-04-25 |
| NO136186C NO136186C (no) | 1977-08-03 |
Family
ID=5878697
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO741397A NO136186C (no) | 1973-04-19 | 1974-04-18 | Fremgangsm}te ved fremstilling av siliciumtetraklorid fra siliciumcarbid og hydrogenklorid. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3920799A (ja) |
| JP (1) | JPS5026520B2 (ja) |
| DE (1) | DE2319995C3 (ja) |
| FR (1) | FR2226359B1 (ja) |
| GB (1) | GB1445226A (ja) |
| IT (1) | IT1005976B (ja) |
| NL (1) | NL7405276A (ja) |
| NO (1) | NO136186C (ja) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5120262B2 (ja) * | 1972-08-31 | 1976-06-23 | ||
| US7147713B2 (en) * | 2003-04-30 | 2006-12-12 | Cree, Inc. | Phase controlled sublimation |
| US7247513B2 (en) * | 2003-05-08 | 2007-07-24 | Caracal, Inc. | Dissociation of silicon clusters in a gas phase during chemical vapor deposition homo-epitaxial growth of silicon carbide |
| CN116395702B (zh) * | 2023-03-24 | 2024-07-02 | 四川纳毕材料科技有限公司 | 一种短流程制备高纯四氯化硅和多晶硅的装置及方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1939647A (en) * | 1930-07-23 | 1933-12-19 | Du Pont | Method of impregnating porous materials |
| US2686819A (en) * | 1949-09-01 | 1954-08-17 | Kellogg M W Co | Synthesis of methane |
| US2843458A (en) * | 1955-10-20 | 1958-07-15 | Cabot Godfrey L Inc | Process for producing silicon tetrachloride |
-
1973
- 1973-04-19 DE DE2319995A patent/DE2319995C3/de not_active Expired
-
1974
- 1974-04-17 IT IT50427/74A patent/IT1005976B/it active
- 1974-04-17 JP JP49043209A patent/JPS5026520B2/ja not_active Expired
- 1974-04-18 GB GB1703274A patent/GB1445226A/en not_active Expired
- 1974-04-18 NO NO741397A patent/NO136186C/no unknown
- 1974-04-18 US US462072A patent/US3920799A/en not_active Expired - Lifetime
- 1974-04-18 NL NL7405276A patent/NL7405276A/xx not_active Application Discontinuation
- 1974-04-19 FR FR7413712A patent/FR2226359B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1005976B (it) | 1976-09-30 |
| JPS5026520B2 (ja) | 1975-09-01 |
| DE2319995C3 (de) | 1978-09-07 |
| FR2226359A1 (ja) | 1974-11-15 |
| NO741397L (no) | 1974-10-22 |
| JPS509595A (ja) | 1975-01-31 |
| NO136186C (no) | 1977-08-03 |
| GB1445226A (en) | 1976-08-04 |
| NL7405276A (ja) | 1974-10-22 |
| FR2226359B1 (ja) | 1976-06-25 |
| DE2319995B2 (de) | 1977-12-08 |
| DE2319995A1 (de) | 1974-11-07 |
| US3920799A (en) | 1975-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4116996A (en) | Catalyst for methane production | |
| US2488487A (en) | Production of alkyl silicon halides | |
| US2214859A (en) | Process for production of hydrogen sulphide | |
| GB1347394A (en) | Process for manufacturing crystalline silicon carbide whiskers | |
| NO136186B (ja) | ||
| US2786874A (en) | Carbon and fluorine-containing polymer | |
| US3030184A (en) | Method for production of magnesium hydride | |
| US3153044A (en) | Process for the preparation of 2-chloropyridine | |
| US2534676A (en) | Preparation of compounds of uranium and nonmetals | |
| GB959244A (en) | Chlorination of hydrocarbons | |
| ES479601A1 (es) | Procedimiento para la preparacion de 1,2-dicloroetano. | |
| US4436942A (en) | Process for the catalyzed fluorination of haloalkyl aromatic compounds | |
| US3138643A (en) | Preparation of trichloroethanes | |
| US2621111A (en) | Production of silicon chlorides | |
| US3187012A (en) | Process for preparing 2-hydroxymethyl-tetrahydropyran | |
| US2839589A (en) | Chloringation process | |
| GB1033655A (en) | Process for the performance of chemical reactions | |
| Petrova et al. | Solid-phase synthesis of iron (III) acetylacetonate upon mechanical activation | |
| GB890268A (en) | Improvements relating to the production of cyanogen halides | |
| GB1155281A (en) | Process for Preparing Allyl Chloride and its Monomethyl Substitution Products. | |
| Johnson et al. | Preparation of Vinylene Carbonate | |
| US3025139A (en) | Process for making boron trichloride | |
| US3564066A (en) | Fixed bed catalytic process for the preparation of trichloropropanes | |
| US3697610A (en) | Production of carbon tetrachloride | |
| US3359336A (en) | Manufacture of pentachlorobenzene |