NO131186B - - Google Patents
Download PDFInfo
- Publication number
- NO131186B NO131186B NO4157/72A NO415772A NO131186B NO 131186 B NO131186 B NO 131186B NO 4157/72 A NO4157/72 A NO 4157/72A NO 415772 A NO415772 A NO 415772A NO 131186 B NO131186 B NO 131186B
- Authority
- NO
- Norway
- Prior art keywords
- parts
- hydrochloride
- hour
- methylpyrrolidone
- aliphatic
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 20
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 20
- -1 cycloaliphatic Chemical group 0.000 claims description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical class C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 125000001931 aliphatic group Chemical group 0.000 claims description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 150000001298 alcohols Chemical class 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000003840 hydrochlorides Chemical class 0.000 claims description 3
- 150000003951 lactams Chemical class 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 239000000975 dye Substances 0.000 description 35
- 239000013078 crystal Substances 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 14
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229920000742 Cotton Polymers 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 7
- 230000007306 turnover Effects 0.000 description 7
- CTGJDBCTMNANBE-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-carbohydrazide Chemical compound C1=CC=C2C(=O)C3=C(N)C(C(=O)NN)=CC=C3C(=O)C2=C1 CTGJDBCTMNANBE-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LIDQMUOKSKTIHC-UHFFFAOYSA-N NC1=C(C=C(C=2C(C3=CC=CC=C3C(C12)=O)=O)N)C(=O)NN Chemical compound NC1=C(C=C(C=2C(C3=CC=CC=C3C(C12)=O)=O)N)C(=O)NN LIDQMUOKSKTIHC-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- MODZVIMSNXSQIH-UHFFFAOYSA-N ethyl benzenecarboximidate;hydron;chloride Chemical compound Cl.CCOC(=N)C1=CC=CC=C1 MODZVIMSNXSQIH-UHFFFAOYSA-N 0.000 description 6
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 5
- 239000004952 Polyamide Substances 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- MMKNBFSDCOALQO-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(C(O)=O)=C2N MMKNBFSDCOALQO-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- DNIHCFWMWZCKCQ-UHFFFAOYSA-N 1,4-diamino-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(C(O)=O)C=C2N DNIHCFWMWZCKCQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- ALHNLFMSAXZKRC-UHFFFAOYSA-N benzene-1,4-dicarbohydrazide Chemical compound NNC(=O)C1=CC=C(C(=O)NN)C=C1 ALHNLFMSAXZKRC-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- OWEXDTOHARDIKZ-UHFFFAOYSA-N 1,4-diamino-9,10-dioxoanthracene-2-carbaldehyde Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(C=O)C=C2N OWEXDTOHARDIKZ-UHFFFAOYSA-N 0.000 description 1
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 1
- ZNYUIVVJRHPTGM-UHFFFAOYSA-N 2-cyclohexyl-5-phenyl-1,3,4-oxadiazole Chemical compound C1CCCCC1C1=NN=C(C=2C=CC=CC=2)O1 ZNYUIVVJRHPTGM-UHFFFAOYSA-N 0.000 description 1
- NDQACJBDAQZPCW-UHFFFAOYSA-N 2-methyl-5-phenyl-1,3,4-oxadiazole Chemical compound O1C(C)=NN=C1C1=CC=CC=C1 NDQACJBDAQZPCW-UHFFFAOYSA-N 0.000 description 1
- ASDLSKCKYGVMAI-UHFFFAOYSA-N 9,10-dioxoanthracene-2-carboxylic acid Chemical class C1=CC=C2C(=O)C3=CC(C(=O)O)=CC=C3C(=O)C2=C1 ASDLSKCKYGVMAI-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 244000172533 Viola sororia Species 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000008395 clarifying agent Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- HUYREUUJFLHEDE-UHFFFAOYSA-N cyclohexanecarbohydrazide Chemical compound NNC(=O)C1CCCCC1 HUYREUUJFLHEDE-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04J—MULTIPLEX COMMUNICATION
- H04J3/00—Time-division multiplex systems
- H04J3/02—Details
- H04J3/14—Monitoring arrangements
Landscapes
- Engineering & Computer Science (AREA)
- Computer Networks & Wireless Communication (AREA)
- Signal Processing (AREA)
- Monitoring And Testing Of Transmission In General (AREA)
- Analogue/Digital Conversion (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH48872A CH535512A (de) | 1972-01-13 | 1972-01-13 | Verfahren zur Überwachung der Arbeitsweise einer Codierer- und Decodierer-Anordnung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131186B true NO131186B (enExample) | 1975-01-06 |
| NO131186C NO131186C (enExample) | 1975-04-16 |
Family
ID=4188152
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4157/72A NO131186C (enExample) | 1972-01-13 | 1972-11-15 |
Country Status (8)
| Country | Link |
|---|---|
| CH (1) | CH535512A (enExample) |
| DK (1) | DK137256B (enExample) |
| FI (1) | FI56599C (enExample) |
| IL (1) | IL40947A (enExample) |
| IT (1) | IT988581B (enExample) |
| NL (1) | NL7300190A (enExample) |
| NO (1) | NO131186C (enExample) |
| SE (1) | SE375668B (enExample) |
-
1972
- 1972-01-13 CH CH48872A patent/CH535512A/de not_active IP Right Cessation
- 1972-11-15 NO NO4157/72A patent/NO131186C/no unknown
- 1972-11-24 FI FI3333/72A patent/FI56599C/fi active
- 1972-11-28 IL IL40947A patent/IL40947A/xx unknown
- 1972-12-29 IT IT33938/72A patent/IT988581B/it active
-
1973
- 1973-01-05 NL NL7300190A patent/NL7300190A/xx unknown
- 1973-01-08 DK DK7673AA patent/DK137256B/da unknown
- 1973-01-10 SE SE7300296A patent/SE375668B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE375668B (enExample) | 1975-04-21 |
| DE2253212A1 (de) | 1973-07-26 |
| NO131186C (enExample) | 1975-04-16 |
| DE2253212B2 (de) | 1977-06-02 |
| NL7300190A (enExample) | 1973-07-17 |
| DK137256C (enExample) | 1978-07-10 |
| IT988581B (it) | 1975-04-30 |
| DK137256B (da) | 1978-02-06 |
| FI56599C (fi) | 1980-02-11 |
| FI56599B (fi) | 1979-10-31 |
| IL40947A (en) | 1975-05-22 |
| CH535512A (de) | 1973-03-31 |
| IL40947A0 (en) | 1973-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO121015B (enExample) | ||
| US3065238A (en) | Production of 1, 3, 4-oxdiazoles | |
| US4064136A (en) | Process for the manufacture of benzoxazole, benzthiazole and benzimidazole derivatives | |
| US4435589A (en) | Process for the preparation of dimethyl succinylosuccinate, the disodium salt thereof, dianilinodihydroterephthalic acids, the dimethyl esters and salts thereof, and dianilinoterephthalic acids, and the dimethyl esters and salts thereof | |
| NO121019B (enExample) | ||
| US3342831A (en) | Process for the production of a primary aminoanthraquinone by conversion of an n-cyclohexylaminoanthraquinone | |
| NO131186B (enExample) | ||
| US4336383A (en) | 1-1-Binaphthyl-4,4',5,5',8,8'-hexacarboxylic acid compounds, method of preparation and use thereof for the synthesis of asymmetric derivatives of 3,4,9,10-perylenetetracarboxylic acid, and for dyeing and printing of textile materials | |
| US3637672A (en) | Azole compounds | |
| US3340264A (en) | Process for preparing n, n'-diarylperylenetetracarboxylic diimides | |
| JP4213237B2 (ja) | ジオキサジン化合物の製造方法 | |
| US3294814A (en) | 4-nitropyrazoles | |
| US3959285A (en) | Imides of 1,1'-dinaphthyl-4,4',5,5',8,8'-hexacarboxylic acid | |
| JP4407131B2 (ja) | ビピロリノニリデン系化合物、該化合物を含有する着色剤およびビピロリノニリデン系化合物の製造方法 | |
| US3294815A (en) | Process for producing 1, 4-naphthoquinones [2, 3-f]-phthalimides | |
| US2499003A (en) | Method of preparing 1-chloro-2-carboxyanthraquinone | |
| US2525621A (en) | Process for the preparation of aromatic orthodinitriles | |
| US2770625A (en) | Anthraquinone dyestuffs | |
| US2708670A (en) | Preparation of a thiadiazole compound | |
| US2174751A (en) | Naphthindenones | |
| US1913484A (en) | New hydroxy-thionaphthene compounds | |
| US2273444A (en) | Process of producing sulphamides of ortho-dicarboxylic acid imides | |
| SU591473A1 (ru) | Производные 6н-дибензо пиран-6-она и способ их получени | |
| SU919342A1 (ru) | Производные 1,1-бинафтил-4,4,5,5,8,8-гексакарбоновой кислоты в качестве красителей дл хлопчатобумажных,льн ных и вискозных материалов и способ их получени | |
| US3663539A (en) | Process for the manufacture of basic oxazine dyestuffs |