NO130646B - - Google Patents
Download PDFInfo
- Publication number
- NO130646B NO130646B NO01128/69A NO112869A NO130646B NO 130646 B NO130646 B NO 130646B NO 01128/69 A NO01128/69 A NO 01128/69A NO 112869 A NO112869 A NO 112869A NO 130646 B NO130646 B NO 130646B
- Authority
- NO
- Norway
- Prior art keywords
- diene rubber
- vulcanization
- rubber mixture
- rubber
- inhibitor
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 38
- 238000004073 vulcanization Methods 0.000 claims description 35
- 229920003244 diene elastomer Polymers 0.000 claims description 28
- 239000003112 inhibitor Substances 0.000 claims description 22
- 229920001971 elastomer Polymers 0.000 claims description 20
- 239000005060 rubber Substances 0.000 claims description 20
- 239000003795 chemical substances by application Substances 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 238000006731 degradation reaction Methods 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 1
- DIFCZTZSUFXWEJ-UHFFFAOYSA-N s-(4-butyl-1,3-benzothiazol-2-yl)thiohydroxylamine Chemical compound CCCCC1=CC=CC2=C1N=C(SN)S2 DIFCZTZSUFXWEJ-UHFFFAOYSA-N 0.000 claims 1
- 230000002028 premature Effects 0.000 description 16
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 8
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- 241001441571 Hiodontidae Species 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- MHKLKWCYGIBEQF-UHFFFAOYSA-N 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine Chemical compound C1COCCN1SC1=NC2=CC=CC=C2S1 MHKLKWCYGIBEQF-UHFFFAOYSA-N 0.000 description 4
- 230000003111 delayed effect Effects 0.000 description 4
- -1 imidazolinonyl Chemical group 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- IUJLOAKJZQBENM-UHFFFAOYSA-N n-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpropan-2-amine Chemical compound C1=CC=C2SC(SNC(C)(C)C)=NC2=C1 IUJLOAKJZQBENM-UHFFFAOYSA-N 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- ZJNLYGOUHDJHMG-UHFFFAOYSA-N 1-n,4-n-bis(5-methylhexan-2-yl)benzene-1,4-diamine Chemical compound CC(C)CCC(C)NC1=CC=C(NC(C)CCC(C)C)C=C1 ZJNLYGOUHDJHMG-UHFFFAOYSA-N 0.000 description 3
- UBUCNCOMADRQHX-UHFFFAOYSA-N N-Nitrosodiphenylamine Chemical compound C=1C=CC=CC=1N(N=O)C1=CC=CC=C1 UBUCNCOMADRQHX-UHFFFAOYSA-N 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000004636 vulcanized rubber Substances 0.000 description 3
- ZZMVLMVFYMGSMY-UHFFFAOYSA-N 4-n-(4-methylpentan-2-yl)-1-n-phenylbenzene-1,4-diamine Chemical compound C1=CC(NC(C)CC(C)C)=CC=C1NC1=CC=CC=C1 ZZMVLMVFYMGSMY-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- KQWFWGSKJHLASQ-UHFFFAOYSA-N N,N-bis(phenylsulfanyl)acetamide Chemical compound C(C)(=O)N(SC1=CC=CC=C1)SC1=CC=CC=C1 KQWFWGSKJHLASQ-UHFFFAOYSA-N 0.000 description 2
- GIVOIPAVPWFKAN-UHFFFAOYSA-N N-phenylsulfanylbenzamide Chemical compound C=1C=CC=CC=1C(=O)NSC1=CC=CC=C1 GIVOIPAVPWFKAN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- XRFDWTWFFLOKAV-UHFFFAOYSA-N cyclohexyl thiohypochlorite Chemical compound ClSC1CCCCC1 XRFDWTWFFLOKAV-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- LFMQNMXVVXHZCC-UHFFFAOYSA-N 1,3-benzothiazol-2-yl n,n-diethylcarbamodithioate Chemical compound C1=CC=C2SC(SC(=S)N(CC)CC)=NC2=C1 LFMQNMXVVXHZCC-UHFFFAOYSA-N 0.000 description 1
- OWRCNXZUPFZXOS-UHFFFAOYSA-N 1,3-diphenylguanidine Chemical compound C=1C=CC=CC=1NC(=N)NC1=CC=CC=C1 OWRCNXZUPFZXOS-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical class CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- BUZICZZQJDLXJN-UHFFFAOYSA-N 3-azaniumyl-4-hydroxybutanoate Chemical compound OCC(N)CC(O)=O BUZICZZQJDLXJN-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 229910000746 Structural steel Inorganic materials 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- UEZWYKZHXASYJN-UHFFFAOYSA-N cyclohexylthiophthalimide Chemical compound O=C1C2=CC=CC=C2C(=O)N1SC1CCCCC1 UEZWYKZHXASYJN-UHFFFAOYSA-N 0.000 description 1
- 239000008380 degradant Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000006232 furnace black Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- ZIDQGJBLTDGQKW-UHFFFAOYSA-N n-cyclohexylsulfanylacetamide Chemical compound CC(=O)NSC1CCCCC1 ZIDQGJBLTDGQKW-UHFFFAOYSA-N 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- XKLJHFLUAHKGGU-UHFFFAOYSA-N nitrous amide Chemical class ON=N XKLJHFLUAHKGGU-UHFFFAOYSA-N 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical class CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/72—4,7-Endo-alkylene-iso-indoles
- C07D209/76—4,7-Endo-alkylene-iso-indoles with oxygen atoms in positions 1 and 3
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/43—Compounds containing sulfur bound to nitrogen
- C08K5/44—Sulfenamides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71444568A | 1968-03-20 | 1968-03-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO130646B true NO130646B (de) | 1974-10-07 |
| NO130646C NO130646C (de) | 1975-01-15 |
Family
ID=24870072
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1128/69A NO130646C (de) | 1968-03-20 | 1969-03-19 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3546185A (de) |
| AT (1) | AT312920B (de) |
| BE (1) | BE729964A (de) |
| BR (1) | BR6907347D0 (de) |
| CH (1) | CH506568A (de) |
| DE (1) | DE1913725C3 (de) |
| ES (1) | ES364972A1 (de) |
| FR (1) | FR2004295A1 (de) |
| GB (1) | GB1257460A (de) |
| IL (1) | IL31820A (de) |
| LU (1) | LU58260A1 (de) |
| NL (1) | NL6904258A (de) |
| NO (1) | NO130646C (de) |
| SE (2) | SE380259B (de) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3855262A (en) * | 1968-03-20 | 1974-12-17 | Monsanto Co | N-(hydrocarbylthio) amides |
| DE1962604A1 (de) * | 1969-12-13 | 1971-06-24 | Bayer Ag | Vulkanisationsverzoegerer |
| US3904664A (en) * | 1970-04-07 | 1975-09-09 | Goodyear Tire & Rubber | Inhibiting premature vulcanization of rubbers |
| US3872061A (en) * | 1970-07-20 | 1975-03-18 | Monsanto Co | Diazacyclodiones |
| US3862051A (en) * | 1971-02-08 | 1975-01-21 | Monsanto Co | Composition of poly(thioamides) and accelerator |
| US3974163A (en) * | 1971-02-08 | 1976-08-10 | Monsanto Company | Poly(thiomaides) |
| US3855192A (en) * | 1971-06-07 | 1974-12-17 | Monsanto Chemicals | Inhibiting premature vulcanization of w-type polychloroprene rubber with n-hydrocarbyl-thioimides |
| US3928340A (en) * | 1972-06-26 | 1975-12-23 | Goodyear Tire & Rubber | N-{8 (Substituted amino) thio{9 -imides |
| US4244843A (en) * | 1973-04-28 | 1981-01-13 | Mitsubishi Belting, Ltd. | Covulcanized rubber |
| US4209596A (en) * | 1973-04-28 | 1980-06-24 | Mitsuboshi Belting, Ltd. | Two step process for producing vulcanized rubber |
| US3910864A (en) * | 1973-06-06 | 1975-10-07 | Goodrich Co B F | Vulcanizable rubber compositions |
| US3865781A (en) * | 1973-08-31 | 1975-02-11 | Firestone Tire & Rubber Co | N-(dihydrocarbylphosphorodithio)imides as premature vulcanization inhibitors |
| US3898203A (en) * | 1973-11-05 | 1975-08-05 | Goodyear Tire & Rubber | Epihalohydrin cure regulators |
| US3898202A (en) * | 1973-11-05 | 1975-08-05 | Goodyear Tire & Rubber | Epihalohydrin cure regulators |
| US3993633A (en) * | 1975-09-11 | 1976-11-23 | Monsanto Company | 2(1(2H)-phthalazinone)sulfenamides vulcanization inhibitors |
| US4168625A (en) * | 1976-09-23 | 1979-09-25 | Westinghouse Electric Corp. | N-thiophthalimide composition for forming thermoparticulating coating |
| US4311813A (en) * | 1976-12-06 | 1982-01-19 | Monsanto Company | N-(α-Alkylbenzylthio)succinimide |
| US4165417A (en) * | 1977-11-23 | 1979-08-21 | Monsanto Company | 3-(Tert-alkylthio)-1,3-thiazolidin-2,4-dione used to inhibit premature vulcanization of diene rubbers |
| US4207236A (en) * | 1977-11-23 | 1980-06-10 | Monsanto Company | 3-(tert-Alkylthio)-1,3-thiazolidin-2,4-dione |
| US4156680A (en) * | 1978-07-31 | 1979-05-29 | Monsanto Company | Scorch inhibited vulcanizable rubber compositions containing carbamic acid esters |
| US4207216A (en) * | 1978-10-02 | 1980-06-10 | Monsanto Company | Scorch inhibited vulcanizable rubber compositions |
| US4281139A (en) * | 1978-10-02 | 1981-07-28 | Monsanto Company | Alkylthioimidazolidinetriones |
| US4248805A (en) * | 1979-04-26 | 1981-02-03 | Monsanto Company | Vulcanizable rubber compositions containing N-(sulfenyl) phthalamides as scorch inhibitors |
| US4313892A (en) * | 1979-04-26 | 1982-02-02 | Monsanto Company | N-(Sulfenyl) phthalamides |
| US4291141A (en) * | 1979-07-30 | 1981-09-22 | Monsanto Company | Vulcanizable rubber compositions containing N-(sulfenyl) methacrylamides as scorch inhibitors |
| US4311648A (en) * | 1979-07-30 | 1982-01-19 | Monsanto Company | N-(Sulfenyl) methacrylamides |
| US4342705A (en) * | 1979-11-23 | 1982-08-03 | Monsanto Company | Methylene thioethers |
| FR2472000A1 (fr) * | 1979-12-20 | 1981-06-26 | Rhone Poulenc Ind | Procede pour ameliorer la compatibilite des plastifiants et des charges dans les polymeres |
| US4469874A (en) * | 1980-05-22 | 1984-09-04 | Monsanto Company | Fragrant prevulcanization inhibitors |
| US4283508A (en) * | 1980-05-22 | 1981-08-11 | Monsanto Company | Fragrant prevulcanization inhibitors |
| US4631316A (en) * | 1984-03-01 | 1986-12-23 | Uniroyal Chemical Company, Inc. | Curable rubber compositions comprising substituted dithiocarbamylurea accelerators |
| DE3610796A1 (de) * | 1986-04-01 | 1987-10-08 | Degussa | Verwendung von substituierten n-trichlormethylthiohydantoinen in kombination mit bis-(2,4-diamino-s-triazin-6-yl)-oligosulfiden in vulkanisierbaren kautschukmischungen und derartige kautschukmischungen |
| DE3610811A1 (de) * | 1986-04-01 | 1987-10-08 | Degussa | Verwendung von substituierten n-trichlormethylthiodicarboximiden in kombination mit n;n'-substituierten bis-(2,4-diamino-s-triazin-6-yl)-oligosulfiden in vulkanisierbaren kautschukmischungen und derartige kautschukmischungen |
| US4866138A (en) * | 1987-07-20 | 1989-09-12 | The B. F. Goodrich Company | Vulcanization accelerators |
| GB9717158D0 (en) | 1997-08-13 | 1997-10-22 | King S College London | Solution synthesis of oligonucleotides and their phosphorothioate analogues |
| EP1954754A1 (de) * | 2005-11-29 | 2008-08-13 | PIRELLI TYRE S.p.A. | Reifen und vernetzbare elastomere zusammensetzung |
| WO2013062649A1 (en) | 2011-10-24 | 2013-05-02 | Bridgestone Americas Tire Operations, Llc | Silica-filled rubber composition and method for making the same |
| WO2019022995A1 (en) | 2017-07-25 | 2019-01-31 | Eastman Chemical Company | METHODS OF FORMING VULCANIZABLE ELASTOMERIC FORMULATIONS AND VULCANIZED ELASTOMERIC ARTICLES |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2171901A (en) * | 1937-07-03 | 1939-09-05 | Rare Metal Products Company | Process of vulcanizing rubber |
| AT214703B (de) * | 1948-05-18 | Exxon Research Engineering Co | Verfahren zur Bekämpfung von Schädlingen | |
| GB969281A (en) * | 1961-08-14 | 1964-09-09 | Us Rubber Co | N-substituted maleimide |
| US3276855A (en) * | 1962-01-04 | 1966-10-04 | Velsicol Chemical Corp | N-alkylmercapto-ureas and a method for controlling weeds |
| US3427319A (en) * | 1968-01-08 | 1969-02-11 | Monsanto Co | Benzimidazolinones |
-
1968
- 1968-03-20 US US714445A patent/US3546185A/en not_active Expired - Lifetime
-
1969
- 1969-03-14 IL IL31820A patent/IL31820A/xx unknown
- 1969-03-17 BE BE729964D patent/BE729964A/xx not_active IP Right Cessation
- 1969-03-17 AT AT259269A patent/AT312920B/de not_active IP Right Cessation
- 1969-03-18 DE DE1913725A patent/DE1913725C3/de not_active Expired
- 1969-03-19 NO NO1128/69A patent/NO130646C/no unknown
- 1969-03-19 NL NL6904258A patent/NL6904258A/xx unknown
- 1969-03-19 FR FR6907878A patent/FR2004295A1/fr active Pending
- 1969-03-19 SE SE6903818A patent/SE380259B/xx unknown
- 1969-03-20 GB GB1257460D patent/GB1257460A/en not_active Expired
- 1969-03-20 BR BR207347/69A patent/BR6907347D0/pt unknown
- 1969-03-20 CH CH423169A patent/CH506568A/fr not_active IP Right Cessation
- 1969-03-20 ES ES364972A patent/ES364972A1/es not_active Expired
- 1969-03-20 LU LU58260D patent/LU58260A1/xx unknown
-
1972
- 1972-11-21 SE SE7215108A patent/SE404533B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT312920B (de) | 1974-01-25 |
| SE380259B (sv) | 1975-11-03 |
| DE1913725A1 (de) | 1969-10-09 |
| US3546185A (en) | 1970-12-08 |
| DE1913725B2 (de) | 1978-08-31 |
| FR2004295A1 (de) | 1969-11-21 |
| LU58260A1 (de) | 1969-10-28 |
| BR6907347D0 (pt) | 1973-02-20 |
| GB1257460A (de) | 1971-12-22 |
| NL6904258A (de) | 1969-09-23 |
| IL31820A (en) | 1973-02-28 |
| NO130646C (de) | 1975-01-15 |
| ES364972A1 (es) | 1971-03-16 |
| DE1913725C3 (de) | 1979-04-26 |
| IL31820A0 (en) | 1969-05-28 |
| CH506568A (fr) | 1971-04-30 |
| SE404533B (sv) | 1978-10-09 |
| BE729964A (de) | 1969-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO130646B (de) | ||
| US5130363A (en) | Rubber vulcanizates having improved hysteresis behavior | |
| EP1420044B1 (de) | Hydrazonderivate | |
| Morita | SN compounds as delayed action chemicals in vulcanization | |
| US4119588A (en) | Reversion resistant rubber compositions with thio carbamyl sulfenamides | |
| EP1101793B1 (de) | Hitzebeständige Elastomerzusammensetzung | |
| Trivette Jr et al. | Prevulcanization inhibitors | |
| US3427319A (en) | Benzimidazolinones | |
| CA1041503A (en) | Imide additives for sulfur vulcanization polymers | |
| RU2265626C2 (ru) | Производные пиримидина в качестве стабилизаторов твердости | |
| GB1336946A (en) | Inhibiting premature vulcanization | |
| US3640976A (en) | Certain cycloalkylsulfenamides as prevulcanization inhibitors | |
| US3586696A (en) | (alkyl-,aralkyl-,and cycloalkylthio) arylenedicarboximides | |
| CA1082837A (en) | Thiocarbamate additives for sulfur vulcanizable polymers | |
| US2809202A (en) | N-cyanoethyl benzothiazole sulfenamides | |
| US3709907A (en) | Dithioamides | |
| NO121118B (de) | ||
| US3539538A (en) | Inhibiting premature vulcanization of diene rubbers | |
| US3898206A (en) | Sulfonamide additives for sulfur vulcanizable polymers | |
| JP5067687B2 (ja) | 加硫戻りが抑制されたジエン系ゴム組成物 | |
| US3776891A (en) | 1,1-di(aminoalkylthio)-2,2-dicyano-ethylenes | |
| US4714742A (en) | Cyanamide derivatives as vulcanization rate modifiers | |
| US3880816A (en) | Unsymmetrical disulfides as premature vulcanization inhibitors | |
| US4080342A (en) | N-(α-alkylbenzylthio)succinimide | |
| US3929857A (en) | 1,1-Di(aminoalkylthio)-2,2-dicyanoethylenes |