NO129907B - - Google Patents
Download PDFInfo
- Publication number
- NO129907B NO129907B NO03617/70A NO361770A NO129907B NO 129907 B NO129907 B NO 129907B NO 03617/70 A NO03617/70 A NO 03617/70A NO 361770 A NO361770 A NO 361770A NO 129907 B NO129907 B NO 129907B
- Authority
- NO
- Norway
- Prior art keywords
- solutions
- dimethyl
- carbon atoms
- stated
- dialkyl
- Prior art date
Links
- 229920000728 polyester Polymers 0.000 claims description 62
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 55
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 37
- 150000002148 esters Chemical class 0.000 claims description 30
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 28
- 239000000203 mixture Substances 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical group OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 11
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 11
- 229930195729 fatty acid Natural products 0.000 claims description 11
- 239000000194 fatty acid Substances 0.000 claims description 11
- 150000004665 fatty acids Chemical class 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 239000000835 fiber Substances 0.000 claims description 8
- -1 aromatic dicarboxylic acids Chemical class 0.000 claims description 7
- PODMJVMUYCFFMK-UHFFFAOYSA-N dimethyl icosanedioate Chemical compound COC(=O)CCCCCCCCCCCCCCCCCCC(=O)OC PODMJVMUYCFFMK-UHFFFAOYSA-N 0.000 claims description 7
- 238000009987 spinning Methods 0.000 claims description 7
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 150000002334 glycols Chemical class 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 229920006324 polyoxymethylene Polymers 0.000 claims description 3
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000000034 method Methods 0.000 description 9
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000012932 acetate dye Substances 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- 150000005690 diesters Chemical class 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000000578 dry spinning Methods 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000005809 transesterification reaction Methods 0.000 description 3
- JHRJYXZOXJXEJJ-UHFFFAOYSA-N 8-ethyloctadecanedioic acid Chemical compound OC(=O)CCCCCCC(CC)CCCCCCCCCC(O)=O JHRJYXZOXJXEJJ-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- GBIBDFBIBIFTLW-UHFFFAOYSA-N dimethyl 8-ethyloctadecanedioate Chemical compound CCC(CCCCCCCCCC(=O)OC)CCCCCCC(=O)OC GBIBDFBIBIFTLW-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- BHVPEUGTPDJECS-UHFFFAOYSA-L manganese(2+);diformate Chemical compound [Mn+2].[O-]C=O.[O-]C=O BHVPEUGTPDJECS-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002074 melt spinning Methods 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000002166 wet spinning Methods 0.000 description 2
- PWOBDMNCYMQTCE-UHFFFAOYSA-N 2-chlorobenzenethiol Chemical compound SC1=CC=CC=C1Cl PWOBDMNCYMQTCE-UHFFFAOYSA-N 0.000 description 1
- VMKYTRPNOVFCGZ-UHFFFAOYSA-N 2-sulfanylphenol Chemical compound OC1=CC=CC=C1S VMKYTRPNOVFCGZ-UHFFFAOYSA-N 0.000 description 1
- KFFUEVDMVNIOHA-UHFFFAOYSA-N 3-aminobenzenethiol Chemical compound NC1=CC=CC(S)=C1 KFFUEVDMVNIOHA-UHFFFAOYSA-N 0.000 description 1
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 1
- WRXOZRLZDJAYDR-UHFFFAOYSA-N 3-methylbenzenethiol Chemical compound CC1=CC=CC(S)=C1 WRXOZRLZDJAYDR-UHFFFAOYSA-N 0.000 description 1
- DOFIAZGYBIBEGI-UHFFFAOYSA-N 3-sulfanylphenol Chemical compound OC1=CC=CC(S)=C1 DOFIAZGYBIBEGI-UHFFFAOYSA-N 0.000 description 1
- MJPVYTKZYZPIQA-UHFFFAOYSA-N 3-thiophen-2-ylpropanoic acid Chemical compound OC(=O)CCC1=CC=CS1 MJPVYTKZYZPIQA-UHFFFAOYSA-N 0.000 description 1
- AMOCULYAYHRIOX-UHFFFAOYSA-N 6,7-dithiabicyclo[3.2.1]octa-1(8),2,4-triene Chemical compound C1=CC=C2SSC1=C2 AMOCULYAYHRIOX-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- ONIHPYYWNBVMID-UHFFFAOYSA-N diethyl benzene-1,4-dicarboxylate Chemical compound CCOC(=O)C1=CC=C(C(=O)OCC)C=C1 ONIHPYYWNBVMID-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 1
- NYZQPYQDUBTTSE-UHFFFAOYSA-N dipropyl icosanedioate Chemical class CCCOC(=O)CCCCCCCCCCCCCCCCCCC(=O)OCCC NYZQPYQDUBTTSE-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical class C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7612569 | 1969-09-24 | ||
| JP5498470A JPS4811116B1 (de) | 1970-06-24 | 1970-06-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO129907B true NO129907B (de) | 1974-06-10 |
Family
ID=26395813
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO03617/70A NO129907B (de) | 1969-09-24 | 1970-09-23 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3764598A (de) |
| AT (1) | AT299218B (de) |
| BE (1) | BE756508A (de) |
| CA (1) | CA955941A (de) |
| CH (1) | CH547298A (de) |
| DE (1) | DE2046577A1 (de) |
| DK (1) | DK125472B (de) |
| FR (1) | FR2070085B1 (de) |
| GB (2) | GB1325770A (de) |
| HU (1) | HU164522B (de) |
| NL (1) | NL143932B (de) |
| NO (1) | NO129907B (de) |
| PL (1) | PL81368B1 (de) |
| SE (1) | SE363831B (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792129A (fr) * | 1971-12-06 | 1973-05-30 | Takeda Chemical Industries Ltd | Derives de pyrimido(4,5-d)pyridazine et leur procede de production |
| JPS5130077B2 (de) * | 1971-12-28 | 1976-08-30 | ||
| EP0112617B1 (de) * | 1982-11-04 | 1986-12-30 | Imperial Chemical Industries Plc | Verfahren zur Extraktion von Metallwerkstoffen und Metallextrahierern |
| US7977333B2 (en) * | 2000-04-20 | 2011-07-12 | Bayer Healthcare Llc | Substituted pyridines and pyridazines with angiogenesis inhibiting activity |
| WO2004111011A2 (en) * | 2003-05-30 | 2004-12-23 | Euro-Celtique S.A. | Synthesis of 2-aryl pyrimidine 4-carboxylic acid amides |
| EP2748166B1 (de) * | 2011-08-23 | 2018-07-11 | Asana BioSciences, LLC | Pyrimido-pyridazinon-verbindungen und ihre verwendung |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL87946C (de) * |
-
0
- BE BE756508D patent/BE756508A/xx unknown
-
1970
- 1970-03-12 GB GB1196273A patent/GB1325770A/en not_active Expired
- 1970-09-22 DE DE19702046577 patent/DE2046577A1/de active Pending
- 1970-09-23 PL PL1970143378A patent/PL81368B1/pl unknown
- 1970-09-23 NL NL707014065A patent/NL143932B/xx unknown
- 1970-09-23 HU HUTA1090A patent/HU164522B/hu unknown
- 1970-09-23 SE SE12956/70A patent/SE363831B/xx unknown
- 1970-09-23 NO NO03617/70A patent/NO129907B/no unknown
- 1970-09-23 FR FR7034490A patent/FR2070085B1/fr not_active Expired
- 1970-09-24 GB GB4552570A patent/GB1325769A/en not_active Expired
- 1970-09-24 CH CH1416570A patent/CH547298A/de not_active IP Right Cessation
- 1970-09-24 DK DK487970AA patent/DK125472B/da unknown
- 1970-09-24 AT AT863370A patent/AT299218B/de not_active IP Right Cessation
- 1970-09-24 US US00075294A patent/US3764598A/en not_active Expired - Lifetime
- 1970-09-24 CA CA094,012A patent/CA955941A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2046577A1 (de) | 1971-05-06 |
| GB1325770A (en) | 1973-08-08 |
| NL7014065A (de) | 1971-03-26 |
| CH547298A (de) | 1974-03-29 |
| FR2070085B1 (de) | 1975-06-06 |
| US3764598A (en) | 1973-10-09 |
| AT299218B (de) | 1972-06-12 |
| FR2070085A1 (de) | 1971-09-10 |
| DK125472B (da) | 1973-02-26 |
| SE363831B (de) | 1974-02-04 |
| CA955941A (en) | 1974-10-08 |
| BE756508A (fr) | 1971-03-01 |
| NL143932B (nl) | 1974-11-15 |
| PL81368B1 (de) | 1975-08-30 |
| GB1325769A (en) | 1973-08-08 |
| HU164522B (de) | 1974-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2895946A (en) | Polyesters modified with chain terminating and chain branching agents and process for producing same | |
| US3828010A (en) | Water-dissipatable polyesteramides | |
| NO133257B (de) | ||
| NO124868B (de) | ||
| US3936389A (en) | Bis glycol ester of sodium sulfo isophthalic acid from its dimethyl ester | |
| US3542737A (en) | Polymeric polyesters containing alkylor alkenylsuccinic acids | |
| NO129907B (de) | ||
| US3899470A (en) | Continuous process for preparation of basic dyeable polyester | |
| US3557055A (en) | Polyester-ethers | |
| NO132987B (de) | ||
| CA2582410A1 (en) | Process for producing polytrimethylene terephthalate | |
| US2777830A (en) | Dyeable polyesters | |
| US2739958A (en) | Dyeable nitrogen-containing polyesters | |
| US3007899A (en) | Polyurethane (ester glycol) compositions | |
| US3025266A (en) | Polyesters prepared from a mixture of | |
| US3313862A (en) | Modification of polyethylene terephthalate with polycarbonate | |
| US3238178A (en) | Elastomeric polymers stabilized with trialkylated phenol and thioor-ganic esters | |
| US3951915A (en) | Thermo-oxidative stable copolyesters | |
| US2831831A (en) | Copolyesters containing aromatic amino acid derivatives | |
| US3310532A (en) | Method for preparation of modified polyesters having fiber- and film-forming properties | |
| US3641111A (en) | Process for direct esterification of terephthalic acid with an alkylene glycol | |
| US2956974A (en) | Solutions of polyesters and process for making same | |
| US3684768A (en) | Thermally stable polyesters having improved dyeability | |
| US4042570A (en) | Terephthalic acid copolyesters which can be dyed in the absence of carriers | |
| US3639350A (en) | Esterification of terephthalic acid with an alkylene glycol in the presence of guanidine or an alkyl guanidine |