NO126692B - - Google Patents
Download PDFInfo
- Publication number
- NO126692B NO126692B NO01225/70*[A NO122570A NO126692B NO 126692 B NO126692 B NO 126692B NO 122570 A NO122570 A NO 122570A NO 126692 B NO126692 B NO 126692B
- Authority
- NO
- Norway
- Prior art keywords
- azamorphinan
- hydroxy
- reaction
- compound
- general formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 37
- -1 azamorphinan compound Chemical class 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 26
- 239000002253 acid Substances 0.000 claims description 18
- 238000006722 reduction reaction Methods 0.000 claims description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 11
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 10
- 239000011707 mineral Substances 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000002829 reductive effect Effects 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 238000006243 chemical reaction Methods 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 239000002904 solvent Substances 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 13
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000012280 lithium aluminium hydride Substances 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 235000010755 mineral Nutrition 0.000 description 9
- URQPUQKGGMPUDA-CABCVRRESA-N (1S,10R)-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol Chemical compound C1CCC[C@H]2N3CC4=CC=C(O)C=C4[C@]21CCN3 URQPUQKGGMPUDA-CABCVRRESA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 230000007306 turnover Effects 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000000862 absorption spectrum Methods 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- RYNJOOKJKCJBRX-PKTZIBPZSA-N (1S,10R)-17-(2-phenylethyl)-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol Chemical compound OC=1C=CC=2CN3[C@@H]4CCCC[C@@]4(C2C1)CCN3CCC3=CC=CC=C3 RYNJOOKJKCJBRX-PKTZIBPZSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- CHLYJEPCJMQYIM-NILFDRSVSA-N (1R,9R,10R)-6,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene Chemical class C1CCC[C@H]2[C@]3([H])NCC[C@@]21C1=CC=CN=C1C3 CHLYJEPCJMQYIM-NILFDRSVSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UEUNUJSTPIPDPS-YADHBBJMSA-N (1S,10R)-17-benzyl-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol Chemical compound C(C1=CC=CC=C1)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)O)CC1 UEUNUJSTPIPDPS-YADHBBJMSA-N 0.000 description 3
- ZSINQHQCWSFASO-UHFFFAOYSA-N 17-(cyclopropylmethyl)-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol Chemical compound C12=CC(O)=CC=C2CN2C3CCCCC31CCN2CC1CC1 ZSINQHQCWSFASO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- GFRCEYNGZREZPD-ZBINZKHDSA-N (1S,9R,10R)-6,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-14-one Chemical class O=C1[C@]23C=4C=CC=NC4C[C@H]([C@@H]2CCC1)NCC3 GFRCEYNGZREZPD-ZBINZKHDSA-N 0.000 description 2
- LOYZVRIHVZEDMW-UHFFFAOYSA-N 1-bromo-3-methylbut-2-ene Chemical compound CC(C)=CCBr LOYZVRIHVZEDMW-UHFFFAOYSA-N 0.000 description 2
- JSLHPNPQELVXDF-UHFFFAOYSA-N 2,4,4a,5,6,7,8,8a-octahydro-1H-cinnolin-3-one Chemical compound O=C1NNC2CCCCC2C1 JSLHPNPQELVXDF-UHFFFAOYSA-N 0.000 description 2
- CXUGAWWYKSOLEL-UHFFFAOYSA-N 2h-cinnolin-3-one Chemical compound C1=CC=C2N=NC(O)=CC2=C1 CXUGAWWYKSOLEL-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- SIDSCWYPRVSZSD-RFPXDPOKSA-N Br.OC=1C=CC=2CN3[C@@H]4CCCC[C@@]4(C2C1)CCN3CCC3=CC=CC=C3 Chemical compound Br.OC=1C=CC=2CN3[C@@H]4CCCC[C@@]4(C2C1)CCN3CCC3=CC=CC=C3 SIDSCWYPRVSZSD-RFPXDPOKSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- DETXZQGDWUJKMO-UHFFFAOYSA-N alpha-hydroxymethanesulfonic acid Natural products OCS(O)(=O)=O DETXZQGDWUJKMO-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- AFQHHWOTFMXJCF-IHLOFXLRSA-N (1S,10R)-17-(2-phenylethyl)-4-phenylmethoxy-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene Chemical compound C(C1=CC=CC=C1)OC=1C=CC=2CN3[C@@H]4CCCC[C@@]4(C2C1)CCN3CCC3=CC=CC=C3 AFQHHWOTFMXJCF-IHLOFXLRSA-N 0.000 description 1
- LMDNQTUVSQMZKG-RFPXDPOKSA-N (1S,10R)-17-(2-phenylethyl)-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol hydrochloride Chemical compound Cl.OC=1C=CC=2CN3[C@@H]4CCCC[C@@]4(C2C1)CCN3CCC3=CC=CC=C3 LMDNQTUVSQMZKG-RFPXDPOKSA-N 0.000 description 1
- ISCJWRJALWIKHT-CABCVRRESA-N (1S,10R)-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene Chemical compound C1=CC=CC=2[C@@]34CCCC[C@H]3N(CC12)NCC4 ISCJWRJALWIKHT-CABCVRRESA-N 0.000 description 1
- KKTTXXQCGRNEKZ-AEFFLSMTSA-N 1-[(1S,10R)-4-hydroxy-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]prop-2-en-1-one Chemical compound C(C=C)(=O)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)O)CC1 KKTTXXQCGRNEKZ-AEFFLSMTSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BNZFNZKJDIIHLF-UHFFFAOYSA-N 3-[1-(2-phenylethyl)-2,3,4,5,6,7,8,8a-octahydrocinnolin-4a-yl]phenol Chemical compound C1(=CC=CC=C1)CCN1NCCC2(CCCCC12)C1=CC(=CC=C1)O BNZFNZKJDIIHLF-UHFFFAOYSA-N 0.000 description 1
- ZMVXXNMTINBWIA-UHFFFAOYSA-N 3-[2-(cyclopropylmethyl)-1,3,4,5,6,7,8,8a-octahydrocinnolin-4a-yl]phenol Chemical compound C1(CC1)CN1NC2CCCCC2(CC1)C1=CC(=CC=C1)O ZMVXXNMTINBWIA-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- NFSUQMJPODKBMM-NSLUPJTDSA-N Cl.C(C1=CC=CC=C1)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)O)CC1 Chemical compound Cl.C(C1=CC=CC=C1)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)O)CC1 NFSUQMJPODKBMM-NSLUPJTDSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Chemical class 0.000 description 1
- RMUCZJUITONUFY-UHFFFAOYSA-N Phenelzine Chemical compound NNCCC1=CC=CC=C1 RMUCZJUITONUFY-UHFFFAOYSA-N 0.000 description 1
- 241000276498 Pollachius virens Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- MTURTMDPURLNFY-UHSQPCAPSA-N [(1S,10R)-17-benzoyl-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] benzoate Chemical compound C(C1=CC=CC=C1)(=O)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)OC(C2=CC=CC=C2)=O)CC1 MTURTMDPURLNFY-UHSQPCAPSA-N 0.000 description 1
- OUKVWERPTATLMC-IRLDBZIGSA-N [(1S,10R)-4-hydroxy-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]-phenylmethanone Chemical compound C(C1=CC=CC=C1)(=O)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)O)CC1 OUKVWERPTATLMC-IRLDBZIGSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- NHOWLEZFTHYCTP-UHFFFAOYSA-N benzylhydrazine Chemical compound NNCC1=CC=CC=C1 NHOWLEZFTHYCTP-UHFFFAOYSA-N 0.000 description 1
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
- CZSMQHLXRVLZRU-MJGOQNOKSA-N cyclopropyl-[(1S,10R)-4-hydroxy-9,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methanone Chemical compound C1(CC1)C(=O)N1N2[C@@H]3CCCC[C@@]3(C=3C=C(C=CC3C2)O)CC1 CZSMQHLXRVLZRU-MJGOQNOKSA-N 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004210 ether based solvent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 229960005195 morphine hydrochloride Drugs 0.000 description 1
- XELXKCKNPPSFNN-BJWPBXOKSA-N morphine hydrochloride trihydrate Chemical compound O.O.O.Cl.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O XELXKCKNPPSFNN-BJWPBXOKSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Chemical class 0.000 description 1
- 229960000482 pethidine Drugs 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960000964 phenelzine Drugs 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP44025204A JPS496320B1 (OSRAM) | 1969-04-03 | 1969-04-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126692B true NO126692B (OSRAM) | 1973-03-12 |
Family
ID=12159404
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO01225/70*[A NO126692B (OSRAM) | 1969-04-03 | 1970-04-02 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3728347A (OSRAM) |
| JP (1) | JPS496320B1 (OSRAM) |
| BE (1) | BE748442A (OSRAM) |
| CH (4) | CH539042A (OSRAM) |
| DK (1) | DK133781B (OSRAM) |
| ES (3) | ES378186A1 (OSRAM) |
| FI (1) | FI50243C (OSRAM) |
| FR (1) | FR2042305B1 (OSRAM) |
| GB (1) | GB1310731A (OSRAM) |
| HU (1) | HU162794B (OSRAM) |
| NL (3) | NL7004752A (OSRAM) |
| NO (1) | NO126692B (OSRAM) |
| SE (1) | SE365219B (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4024082A (en) * | 1975-08-19 | 1977-05-17 | Bristol-Myers Company | Analgesics |
| JPS5317280U (OSRAM) * | 1976-07-23 | 1978-02-14 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3300500A (en) * | 1962-04-09 | 1967-01-24 | Alkylmorphinan derivatives and production thereof | |
| US3332950A (en) * | 1963-03-23 | 1967-07-25 | Endo Lab | 14-hydroxydihydronormorphinone derivatives |
-
1969
- 1969-04-03 JP JP44025204A patent/JPS496320B1/ja active Pending
-
1970
- 1970-04-01 FI FI700909A patent/FI50243C/fi active
- 1970-04-01 DK DK162270AA patent/DK133781B/da unknown
- 1970-04-02 SE SE04534/70A patent/SE365219B/xx unknown
- 1970-04-02 NL NL7004752A patent/NL7004752A/xx unknown
- 1970-04-02 ES ES378186A patent/ES378186A1/es not_active Expired
- 1970-04-02 NO NO01225/70*[A patent/NO126692B/no unknown
- 1970-04-02 HU HUGE829A patent/HU162794B/hu unknown
- 1970-04-03 CH CH1419472A patent/CH539042A/de not_active IP Right Cessation
- 1970-04-03 CH CH1419372A patent/CH544759A/de not_active IP Right Cessation
- 1970-04-03 CH CH1419572A patent/CH544094A/de not_active IP Right Cessation
- 1970-04-03 BE BE748442D patent/BE748442A/xx unknown
- 1970-04-03 GB GB1582170A patent/GB1310731A/en not_active Expired
- 1970-04-03 CH CH499970A patent/CH530985A/de not_active IP Right Cessation
- 1970-04-03 FR FR7012188A patent/FR2042305B1/fr not_active Expired
- 1970-04-03 US US00025530A patent/US3728347A/en not_active Expired - Lifetime
- 1970-11-13 ES ES385522A patent/ES385522A1/es not_active Expired
- 1970-11-13 ES ES385521A patent/ES385521A1/es not_active Expired
-
1975
- 1975-04-24 NL NL7504889A patent/NL7504889A/xx not_active Application Discontinuation
- 1975-04-24 NL NL7504890A patent/NL7504890A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| US3728347A (en) | 1973-04-17 |
| DE2015731A1 (de) | 1970-10-15 |
| HU162794B (OSRAM) | 1973-04-28 |
| FI50243B (OSRAM) | 1975-09-30 |
| NL7504889A (nl) | 1975-08-29 |
| FI50243C (fi) | 1976-01-12 |
| NL7504890A (nl) | 1975-08-29 |
| CH544094A (de) | 1973-12-28 |
| ES378186A1 (es) | 1972-12-01 |
| DE2015731B2 (de) | 1977-05-26 |
| SE365219B (OSRAM) | 1974-03-18 |
| JPS496320B1 (OSRAM) | 1974-02-13 |
| GB1310731A (en) | 1973-03-21 |
| FR2042305A1 (OSRAM) | 1971-02-12 |
| NL7004752A (OSRAM) | 1970-10-06 |
| BE748442A (fr) | 1970-10-05 |
| FR2042305B1 (OSRAM) | 1974-10-11 |
| CH530985A (de) | 1972-11-30 |
| CH544759A (de) | 1974-01-15 |
| DK133781B (da) | 1976-07-19 |
| CH539042A (de) | 1973-08-31 |
| ES385521A1 (es) | 1973-10-01 |
| DK133781C (OSRAM) | 1976-12-06 |
| ES385522A1 (es) | 1973-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2097387A (en) | 3,4-dihydro-5h-2,3-benzodiazepine derivatives | |
| IE41610B1 (en) | Arylpiperidines and their preperation | |
| NZ202404A (en) | Acylmorphinan derivatives and pharmaceutical compositions containing such | |
| NO137091B (no) | Substituerte 2-benzyl-4-piperidoner for anvendelse som mellomprodukter ved fremstilling av terapeutisk virksomme 6,7-benzomorfaner | |
| EP0954521B1 (en) | 4- (thien-3-yl)methyl] imidazole derivatives having alpha2-adrenoceptor agonistic activity | |
| IE42978B1 (en) | Triaryl alkyl azabicyclo compounds | |
| IE45320B1 (en) | 2-benzylpyrolidines,process for their preparation and pharmaceutical compositions containing them | |
| EP0001601B1 (en) | Lactam compounds and methods for their preparation | |
| DE2264668A1 (de) | Propenylaminderivate und verfahren zu dereb herstellung | |
| IE46975B1 (en) | Pyrido-indole tranquilising agents | |
| JPS6139306B2 (OSRAM) | ||
| US5541217A (en) | 4-arylcyclopenta[c]pyrrole analgesics | |
| CA1148150A (en) | Phenylmorphans, intermediates and method of preparation | |
| EP0506903A1 (en) | 4-acetoxy-piperidine derivatives, process for their preparation and use as a muscarinic m3-receptor antagonist | |
| NO860048L (no) | Octahydroindolizin-forbindelser med analgetisk virkning. | |
| US20060019995A1 (en) | 2,3-dihydro-4(1H)-pyridone derivatives , method for production thereof and pharmaceutical composition comprising the same | |
| US3542778A (en) | 5-methylene-2-pyrrolidones and their use in a process for making beta,beta disubstituted pyrrolidines | |
| US3728347A (en) | Azamorphinan compounds | |
| DK141401B (da) | Analogifremgangsmåde til fremstilling af hexahydro-1H-azepinforbindelser eller syreadditions- eller kvaternære ammoniumsalte deraf. | |
| DE2349493A1 (de) | 2-(2-pyridyl)- omega-phenylalkylamine und verfahren zu ihrer herstellung | |
| EP0002512B1 (en) | Imino-bridged benzocycloheptapyridines, process for their preparation and pharmaceutical composition thereof | |
| CA1077040A (en) | Pharmaceutically active decahydroquinoline derivatives | |
| DE2245141A1 (de) | Neue n-(heteroarylmethyl)-desoxynormorphine und -norcodeine, deren saeureadditionssalze, verfahren zu deren herstellung sowie deren verwendung als arzneimittel | |
| US4002618A (en) | 2,2-Diphenyl-5-(4-substituted-piperidino)-3-trans-pentenenitriles | |
| GB1589792A (en) | F3-phenoxy-n-substituted morphinan derivatives their manufacture and pharmaceutical preparations containing them |