NO125656B - - Google Patents
Download PDFInfo
- Publication number
- NO125656B NO125656B NO4830/69A NO483069A NO125656B NO 125656 B NO125656 B NO 125656B NO 4830/69 A NO4830/69 A NO 4830/69A NO 483069 A NO483069 A NO 483069A NO 125656 B NO125656 B NO 125656B
- Authority
- NO
- Norway
- Prior art keywords
- amino
- parts
- indazole
- compounds
- general formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 47
- 230000008878 coupling Effects 0.000 claims description 22
- 238000010168 coupling process Methods 0.000 claims description 22
- 238000005859 coupling reaction Methods 0.000 claims description 22
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 18
- 239000000987 azo dye Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- 230000003647 oxidation Effects 0.000 claims description 10
- 238000007254 oxidation reaction Methods 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- -1 alkali metal hypochlorite Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims description 4
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000000975 dye Substances 0.000 claims description 4
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 4
- 230000002087 whitening effect Effects 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Substances ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 101100346764 Mus musculus Mtln gene Proteins 0.000 claims 1
- VUTSITSGGYCKFP-UHFFFAOYSA-J [C+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O Chemical compound [C+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O VUTSITSGGYCKFP-UHFFFAOYSA-J 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- ZURAKLKIKYCUJU-UHFFFAOYSA-N copper;azane Chemical compound N.[Cu+2] ZURAKLKIKYCUJU-UHFFFAOYSA-N 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- 239000000463 material Substances 0.000 description 24
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 description 20
- 239000007844 bleaching agent Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 18
- 230000003287 optical effect Effects 0.000 description 15
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 159000000000 sodium salts Chemical class 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000004753 textile Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 7
- 150000008049 diazo compounds Chemical class 0.000 description 7
- 239000001632 sodium acetate Substances 0.000 description 7
- 235000017281 sodium acetate Nutrition 0.000 description 7
- 235000010288 sodium nitrite Nutrition 0.000 description 7
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 229920002678 cellulose Polymers 0.000 description 6
- 239000001913 cellulose Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- KEJFADGISRFLFO-UHFFFAOYSA-N 1H-indazol-6-amine Chemical compound NC1=CC=C2C=NNC2=C1 KEJFADGISRFLFO-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 210000002268 wool Anatomy 0.000 description 5
- XBTOSRUBOXQWBO-UHFFFAOYSA-N 1h-indazol-5-amine Chemical compound NC1=CC=C2NN=CC2=C1 XBTOSRUBOXQWBO-UHFFFAOYSA-N 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 150000003852 triazoles Chemical class 0.000 description 4
- 238000004383 yellowing Methods 0.000 description 4
- QBHYFEWQILVXEN-UHFFFAOYSA-N 5-amino-2-(2-phenylethenyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=CC=C1 QBHYFEWQILVXEN-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 239000012459 cleaning agent Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 3
- YTKNUPJYGSOVLV-UHFFFAOYSA-N 1-methylindazol-6-amine Chemical compound C1=C(N)C=C2N(C)N=CC2=C1 YTKNUPJYGSOVLV-UHFFFAOYSA-N 0.000 description 2
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 2
- LQEJEARNIFDTMO-UHFFFAOYSA-N 5-amino-2-[2-(4-chlorophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(Cl)C=C1 LQEJEARNIFDTMO-UHFFFAOYSA-N 0.000 description 2
- YKAJHPIMPSKUJS-UHFFFAOYSA-N 5-amino-2-[2-(4-methoxyphenyl)ethenyl]benzenesulfonic acid Chemical compound C1=CC(OC)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O YKAJHPIMPSKUJS-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- VGABHBLCCIOEOZ-UHFFFAOYSA-N 1,3-dimethylindazol-6-amine Chemical compound NC1=CC=C2C(C)=NN(C)C2=C1 VGABHBLCCIOEOZ-UHFFFAOYSA-N 0.000 description 1
- HWSCSUHNTVVKSR-UHFFFAOYSA-N 3-methyl-2h-indazol-6-amine Chemical compound NC1=CC=C2C(C)=NNC2=C1 HWSCSUHNTVVKSR-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QBHYFEWQILVXEN-VOTSOKGWSA-N 5-amino-2-[(e)-2-phenylethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=CC=C1 QBHYFEWQILVXEN-VOTSOKGWSA-N 0.000 description 1
- BZJLIIBBRXMRPN-UHFFFAOYSA-N 5-amino-2-[2-(2-chlorophenyl)ethenyl]benzenesulfonic acid Chemical compound NC=1C=C(C(=CC1)C=CC1=C(C=CC=C1)Cl)S(=O)(=O)O BZJLIIBBRXMRPN-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- AWZACWPILWGEQL-UHFFFAOYSA-M azanium;copper(1+);sulfate Chemical compound [NH4+].[Cu+].[O-]S([O-])(=O)=O AWZACWPILWGEQL-UHFFFAOYSA-M 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical class C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61F—FILTERS IMPLANTABLE INTO BLOOD VESSELS; PROSTHESES; DEVICES PROVIDING PATENCY TO, OR PREVENTING COLLAPSING OF, TUBULAR STRUCTURES OF THE BODY, e.g. STENTS; ORTHOPAEDIC, NURSING OR CONTRACEPTIVE DEVICES; FOMENTATION; TREATMENT OR PROTECTION OF EYES OR EARS; BANDAGES, DRESSINGS OR ABSORBENT PADS; FIRST-AID KITS
- A61F5/00—Orthopaedic methods or devices for non-surgical treatment of bones or joints; Nursing devices; Anti-rape devices
- A61F5/01—Orthopaedic devices, e.g. splints, casts or braces
- A61F5/04—Devices for stretching or reducing fractured limbs; Devices for distractions; Splints
- A61F5/05—Devices for stretching or reducing fractured limbs; Devices for distractions; Splints for immobilising
- A61F5/058—Splints
- A61F5/05883—Splints for the neck or head
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Heart & Thoracic Surgery (AREA)
- Nursing (AREA)
- Otolaryngology (AREA)
- Vascular Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Orthopedics, Nursing, And Contraception (AREA)
- Plural Heterocyclic Compounds (AREA)
- Adornments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82253869A | 1969-05-07 | 1969-05-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125656B true NO125656B (xx) | 1972-10-16 |
Family
ID=25236319
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4830/69A NO125656B (xx) | 1969-05-07 | 1969-12-06 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3620211A (xx) |
| BE (1) | BE743663A (xx) |
| BR (1) | BR7016026D0 (xx) |
| CA (1) | CA920461A (xx) |
| CH (1) | CH504205A (xx) |
| DE (1) | DE2017126A1 (xx) |
| ES (1) | ES180170Y (xx) |
| FR (1) | FR2046059A5 (xx) |
| GB (1) | GB1274096A (xx) |
| IL (1) | IL33331A0 (xx) |
| LU (1) | LU60007A1 (xx) |
| NL (1) | NL6919046A (xx) |
| NO (1) | NO125656B (xx) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3696439A (en) * | 1971-04-01 | 1972-10-10 | Roger Owen Durham | Personal armor |
| CA1054888A (en) * | 1975-05-13 | 1979-05-22 | David Vincent | Spinal support |
| US4299211A (en) * | 1980-04-24 | 1981-11-10 | David Doynow | Extraction splint |
| US4422454A (en) * | 1982-06-07 | 1983-12-27 | Medical Specialties, Inc. | Emergency extrication appliance |
| US4658807A (en) * | 1982-10-25 | 1987-04-21 | International Positioning Systems, Ltd. | Method for supporting and positioning the human anatomy |
| US4643174A (en) * | 1983-10-01 | 1987-02-17 | Tohru Horiuchi | Adjustable cervical spine corset and truck corset |
| US4628913A (en) * | 1984-01-13 | 1986-12-16 | United States Manufacturing Co. | Cervical thoracic orthosis |
| US4589407A (en) * | 1984-05-09 | 1986-05-20 | National Medical Distributors | Spine immobilizer |
| US4708130A (en) * | 1985-02-15 | 1987-11-24 | Grudem Charles M | Lumbar dynamic splint |
| EP0219523B1 (en) * | 1985-04-18 | 1990-07-25 | AALVIK THUNE, Halldis | Supporting device for use in first aid to persons being injured in accidents of the like |
| US4841961A (en) * | 1986-11-17 | 1989-06-27 | Bonnie Burlage | Patient restraining device and temporary transport |
| US5058575A (en) * | 1991-01-04 | 1991-10-22 | Hartwell Medical Corporation | Splint device |
| US5199940A (en) * | 1991-09-12 | 1993-04-06 | Morris James B | Posture training and correcting device |
| US5211186A (en) * | 1991-11-13 | 1993-05-18 | Shoemaker Michael D | Patient immobilization harness and apparatus |
| US5269323A (en) * | 1992-12-03 | 1993-12-14 | Krouskop Thomas A | Body support |
| US5531669A (en) * | 1994-11-18 | 1996-07-02 | Center For Prosthetics Orthotics, Inc. | Cervical brace with interlock assembly |
| US5672127A (en) * | 1995-01-03 | 1997-09-30 | Danz; Lisa M. | Baseball glove training device |
| ATE227112T1 (de) * | 1997-07-18 | 2002-11-15 | George Guarany Philot | Formbare rohrförmige therapeutische vorrichtung |
| US6719640B1 (en) * | 2000-06-16 | 2004-04-13 | Balanced Health, Inc. | Posture training device and methods for using same |
| US6461256B1 (en) * | 2001-07-02 | 2002-10-08 | Raymond J. Popeck | Basketball shooting training device and method for applying the same |
| WO2007020481A1 (en) * | 2005-08-12 | 2007-02-22 | Vinko Tranfic | Corset to relieve the cervical spine |
| US9237963B2 (en) | 2012-03-29 | 2016-01-19 | Allen Carrier | Rapid extrication device |
| US10213331B1 (en) | 2013-05-31 | 2019-02-26 | Wolfgang Weiler | Posture enhancement device |
| US20160121192A1 (en) * | 2014-10-31 | 2016-05-05 | Raul Mendoza | Sports Posture Training Aid |
| US9669258B2 (en) * | 2016-03-28 | 2017-06-06 | Karl W Huebner | Spinal harness apparatus and method for conducting activities requiring a neutral spinal position and spinal rigidity |
| USD949349S1 (en) * | 2020-08-17 | 2022-04-19 | David A. Reinero | Back brace |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1301276A (en) * | 1917-06-11 | 1919-04-22 | Mary M Kroetz | Support for the correction of malpositions of the cervical vertebræ and the occiput. |
| US2506464A (en) * | 1948-09-07 | 1950-05-02 | John A Millheisler | Adjustable fingerstall |
| US3331367A (en) * | 1965-03-31 | 1967-07-18 | Thomas K Hastings | Orthopedic spinal brace |
-
1969
- 1969-05-07 US US822538A patent/US3620211A/en not_active Expired - Lifetime
- 1969-09-30 CA CA063921A patent/CA920461A/en not_active Expired
- 1969-11-09 IL IL33331A patent/IL33331A0/xx unknown
- 1969-11-17 GB GB56111/69A patent/GB1274096A/en not_active Expired
- 1969-11-27 ES ES1969180170U patent/ES180170Y/es not_active Expired
- 1969-11-27 FR FR6941024A patent/FR2046059A5/fr not_active Expired
- 1969-12-06 NO NO4830/69A patent/NO125656B/no unknown
- 1969-12-12 LU LU60007D patent/LU60007A1/xx unknown
- 1969-12-15 CH CH1859269A patent/CH504205A/de not_active IP Right Cessation
- 1969-12-18 NL NL6919046A patent/NL6919046A/xx unknown
- 1969-12-24 BE BE743663D patent/BE743663A/xx not_active Expired
-
1970
- 1970-01-14 BR BR216026/70A patent/BR7016026D0/pt unknown
- 1970-04-10 DE DE19702017126 patent/DE2017126A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2017126A1 (de) | 1970-11-19 |
| NL6919046A (xx) | 1970-11-10 |
| BE743663A (xx) | 1970-05-28 |
| LU60007A1 (xx) | 1970-02-12 |
| CH504205A (de) | 1971-03-15 |
| ES180170U (es) | 1973-02-01 |
| FR2046059A5 (xx) | 1971-03-05 |
| ES180170Y (es) | 1973-12-01 |
| CA920461A (en) | 1973-02-06 |
| US3620211A (en) | 1971-11-16 |
| GB1274096A (en) | 1972-05-10 |
| IL33331A0 (en) | 1970-06-17 |
| BR7016026D0 (pt) | 1973-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO125656B (xx) | ||
| US2784183A (en) | Fluorescent monotriazole compounds | |
| DE2704825B2 (de) | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien | |
| US2713057A (en) | Fluorescent benzgtriazqle compounds | |
| US2901476A (en) | Stilbene triazoles | |
| US2817659A (en) | Polyazo dyestuffs | |
| US2773869A (en) | Alkenyl bisimidazole optical bleaching agents | |
| US2928830A (en) | Pyrazolo-triazole optical brighteners | |
| US2865916A (en) | Triazole brighteners | |
| US3101333A (en) | Stilbyl-acenaphthenotriazole | |
| US2733165A (en) | Naoas | |
| US2817665A (en) | X c chi | |
| US3157644A (en) | Brightening agents | |
| US2762801A (en) | Bis-triazinylamino stilbene compounds | |
| US4271293A (en) | Benzofuranyl-benzimidazoles | |
| US3048584A (en) | Hydrophilic optical wmtening agents | |
| US2713055A (en) | Whitening agents for cellulosic fiber | |
| US2784197A (en) | Fluorescent stilbyl ditriazole | |
| US2713056A (en) | Fluorescent whitening agents | |
| US2700044A (en) | Compounds of the benzimidazolylphenyl-1, 2-naphthotriazole type, useful as whiteningagents | |
| US3200108A (en) | Basic azo dyes derived from indazole | |
| US2713054A (en) | Whitening agents for cellulosic fiber | |
| US2927866A (en) | Bis p, p(p.methoxy, meta-methyl benzotriazolyl) stilbene o, o'-disulfonic acid disodium salt | |
| US2773054A (en) | 6-alkylsulfonylbenzothiazole azo compounds | |
| US2715632A (en) | Whitening agents for cellulosic fiber |