NO124368B - - Google Patents
Info
- Publication number
- NO124368B NO124368B NO47569A NO47569A NO124368B NO 124368 B NO124368 B NO 124368B NO 47569 A NO47569 A NO 47569A NO 47569 A NO47569 A NO 47569A NO 124368 B NO124368 B NO 124368B
- Authority
- NO
- Norway
- Prior art keywords
- electrolyte
- plates
- separators
- cellulose
- accumulator
- Prior art date
Links
- 239000003792 electrolyte Substances 0.000 claims description 42
- 229920002678 cellulose Polymers 0.000 claims description 20
- 239000001913 cellulose Substances 0.000 claims description 20
- 239000000835 fiber Substances 0.000 claims description 18
- 229920003043 Cellulose fiber Polymers 0.000 claims description 11
- 239000011230 binding agent Substances 0.000 claims description 7
- 239000011149 active material Substances 0.000 claims description 5
- 230000008961 swelling Effects 0.000 claims description 4
- 230000002787 reinforcement Effects 0.000 claims description 3
- OJIJEKBXJYRIBZ-UHFFFAOYSA-N cadmium nickel Chemical compound [Ni].[Cd] OJIJEKBXJYRIBZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000002923 metal particle Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 229910052793 cadmium Inorganic materials 0.000 description 5
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000011810 insulating material Substances 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 229920000297 Rayon Polymers 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- SAXCKUIOAKKRAS-UHFFFAOYSA-N cobalt;hydrate Chemical compound O.[Co] SAXCKUIOAKKRAS-UHFFFAOYSA-N 0.000 description 3
- SPIFDSWFDKNERT-UHFFFAOYSA-N nickel;hydrate Chemical compound O.[Ni] SPIFDSWFDKNERT-UHFFFAOYSA-N 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 239000004627 regenerated cellulose Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229920002994 synthetic fiber Polymers 0.000 description 3
- HUKFCVYEXPZJJZ-UHFFFAOYSA-N cadmium;hydrate Chemical compound O.[Cd] HUKFCVYEXPZJJZ-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000007599 discharging Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- PTHCMJGKKRQCBF-UHFFFAOYSA-N Cellulose, microcrystalline Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC)C(CO)O1 PTHCMJGKKRQCBF-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009950 felting Methods 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- -1 superpolyamides Chemical compound 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
Landscapes
- Cell Separators (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO47569A NO124368B (OSRAM) | 1966-10-13 | 1969-02-07 |
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US58636466A | 1966-10-13 | 1966-10-13 | |
| US66023567A | 1967-08-14 | 1967-08-14 | |
| US66022467A | 1967-08-14 | 1967-08-14 | |
| US66023467A | 1967-08-14 | 1967-08-14 | |
| NO16995467 | 1967-10-02 | ||
| NO47569A NO124368B (OSRAM) | 1966-10-13 | 1969-02-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO124368B true NO124368B (OSRAM) | 1972-04-10 |
Family
ID=27555223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO47569A NO124368B (OSRAM) | 1966-10-13 | 1969-02-07 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO124368B (OSRAM) |
-
1969
- 1969-02-07 NO NO47569A patent/NO124368B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE204442C1 (OSRAM) | ||
| US4007059A (en) | Electrochemical cell electrode separator and method of making it and fuel cell containing same | |
| US3980497A (en) | Separators for alkaline batteries | |
| US2902530A (en) | Battery constituents | |
| GB682164A (en) | Improvements in or relating to electric accumulators | |
| US3003013A (en) | Electric battery | |
| US3592693A (en) | Consumable metal anode with dry electrolytic enclosed in envelope | |
| US3897266A (en) | Alkaline battery cell | |
| JPH07254431A (ja) | 保守不要の電解質水溶液を含む二次電池 | |
| NO146453B (no) | Elektrokjemisk celle | |
| US2994728A (en) | Alkaline storage batteries | |
| US2729694A (en) | Battery separator | |
| US2987567A (en) | Dry-charged negative electrode | |
| US3427203A (en) | Large surface area electrodes and a method for preparing them | |
| GB744726A (en) | Improvements in or relating to electric accumulators employing alkaline or neutral electrolytes | |
| US3476601A (en) | Battery including inorganic fibrous material | |
| US3364077A (en) | Battery separator and battery | |
| US2669594A (en) | Electrical accumulator | |
| NO124368B (OSRAM) | ||
| US3764387A (en) | Non treeing electrolyte wick | |
| US4804598A (en) | Separator systems for silver-iron batteries | |
| US4096317A (en) | Coated absorbent barrier protecting separator and battery embodying same | |
| US5468570A (en) | Lightweight zinc electrode | |
| JPH05303978A (ja) | 密閉形ニッケル亜鉛電池 | |
| US2640865A (en) | Storage battery |