NO122179B - - Google Patents
Download PDFInfo
- Publication number
- NO122179B NO122179B NO165889A NO16588966A NO122179B NO 122179 B NO122179 B NO 122179B NO 165889 A NO165889 A NO 165889A NO 16588966 A NO16588966 A NO 16588966A NO 122179 B NO122179 B NO 122179B
- Authority
- NO
- Norway
- Prior art keywords
- parts
- diol
- estrene
- hydrogen
- mixture
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- -1 aluminum alkoxide Chemical class 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- CMXKUJNZWYTFJN-KPTXJRLASA-N (8r,9s,10r,13s,14s)-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1CC[C@@H]2[C@H]3CC[C@](C)(C(CC4)O)[C@@H]4[C@@H]3CCC2=C1 CMXKUJNZWYTFJN-KPTXJRLASA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910000510 noble metal Inorganic materials 0.000 claims description 2
- MUCRYNWJQNHDJH-OADIDDRXSA-N Ursonic acid Chemical compound C1CC(=O)C(C)(C)[C@@H]2CC[C@@]3(C)[C@]4(C)CC[C@@]5(C(O)=O)CC[C@@H](C)[C@H](C)[C@H]5C4=CC[C@@H]3[C@]21C MUCRYNWJQNHDJH-OADIDDRXSA-N 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 claims 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 claims 1
- 230000001195 anabolic effect Effects 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000004678 hydrides Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 230000000737 periodic effect Effects 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 24
- 239000000203 mixture Substances 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- 239000000155 melt Substances 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 6
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 4
- 229960004719 nandrolone Drugs 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- NSUVCVKCWGOYPV-VXNCWWDNSA-N (8r,9s,13s,14s)-3-methoxy-13-methyl-4,6,7,8,9,11,12,14,15,16-decahydro-1h-cyclopenta[a]phenanthren-17-one Chemical compound C1C[C@@H]2C(CC=C(C3)OC)=C3CC[C@H]2[C@@H]2CCC(=O)[C@]21C NSUVCVKCWGOYPV-VXNCWWDNSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 238000003612 Meerwein-Ponndorf-Verley reduction reaction Methods 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000004042 decolorization Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 238000006317 isomerization reaction Methods 0.000 description 2
- NPAGDVCDWIYMMC-IZPLOLCNSA-N nandrolone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 NPAGDVCDWIYMMC-IZPLOLCNSA-N 0.000 description 2
- ZDHCJEIGTNNEMY-XGXHKTLJSA-N norethandrolone Chemical compound C1CC2=CC(=O)CC[C@@H]2[C@@H]2[C@@H]1[C@@H]1CC[C@](CC)(O)[C@@]1(C)CC2 ZDHCJEIGTNNEMY-XGXHKTLJSA-N 0.000 description 2
- VIKNJXKGJWUCNN-XGXHKTLJSA-N norethisterone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 VIKNJXKGJWUCNN-XGXHKTLJSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 2
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- NXGWVXNWOIYZLE-XUDSTZEESA-N (8r,9s,10r,13s,14s,17r)-17-hydroxy-13-methyl-17-prop-2-enyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)CC=C)[C@@H]4[C@@H]3CCC2=C1 NXGWVXNWOIYZLE-XUDSTZEESA-N 0.000 description 1
- 150000000319 19-nortestosterones Chemical class 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- 229940058020 2-amino-2-methyl-1-propanol Drugs 0.000 description 1
- RLMLQWBFNRHILI-UHFFFAOYSA-N 3-cyclopentylpropanoyl 3-cyclopentylpropanoate Chemical compound C1CCCC1CCC(=O)OC(=O)CCC1CCCC1 RLMLQWBFNRHILI-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 239000003263 anabolic agent Substances 0.000 description 1
- 229940124325 anabolic agent Drugs 0.000 description 1
- 239000003098 androgen Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001833 anti-estrogenic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- DQEUYIQDSMINEY-UHFFFAOYSA-M magnesium;prop-1-ene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C=C DQEUYIQDSMINEY-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N s-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06F—LAUNDERING, DRYING, IRONING, PRESSING OR FOLDING TEXTILE ARTICLES
- D06F13/00—Washing machines having receptacles, stationary for washing purposes, with agitators therein contacting the articles being washed
- D06F13/06—Washing machines having receptacles, stationary for washing purposes, with agitators therein contacting the articles being washed wherein the agitator has both rotary, e.g. oscillating rotary, motion and axial motion
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06F—LAUNDERING, DRYING, IRONING, PRESSING OR FOLDING TEXTILE ARTICLES
- D06F39/00—Details of washing machines not specific to a single type of machines covered by groups D06F9/00 - D06F27/00
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06F—LAUNDERING, DRYING, IRONING, PRESSING OR FOLDING TEXTILE ARTICLES
- D06F7/00—Washing devices adapted to be used independently of any particular receptacle, e.g. for removable mounting on wash-tubs, bath-tubs, or the like
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detail Structures Of Washing Machines And Dryers (AREA)
- Treatment Of Fiber Materials (AREA)
- Steroid Compounds (AREA)
- Accessory Of Washing/Drying Machine, Commercial Washing/Drying Machine, Other Washing/Drying Machine (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US51231065A | 1965-12-08 | 1965-12-08 | |
| US56311766A | 1966-07-06 | 1966-07-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122179B true NO122179B (OSRAM) | 1971-06-01 |
Family
ID=27057523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO165889A NO122179B (OSRAM) | 1965-12-08 | 1966-12-07 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3423965A (OSRAM) |
| AT (1) | AT285499B (OSRAM) |
| BE (1) | BE690803A (OSRAM) |
| CH (1) | CH493682A (OSRAM) |
| DE (1) | DE1585634A1 (OSRAM) |
| DK (1) | DK114195B (OSRAM) |
| ES (1) | ES334262A1 (OSRAM) |
| FI (1) | FI43303C (OSRAM) |
| FR (1) | FR1503358A (OSRAM) |
| GB (1) | GB1161812A (OSRAM) |
| NL (1) | NL6617207A (OSRAM) |
| NO (1) | NO122179B (OSRAM) |
| OA (1) | OA02282A (OSRAM) |
| SE (1) | SE314051B (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3534568A (en) * | 1966-07-22 | 1970-10-20 | Colgate Palmolive Co | Washing machine |
| US4785644A (en) * | 1986-11-18 | 1988-11-22 | Richard R. Walton | Clothes washing machine and the like |
| US4953738A (en) * | 1988-02-19 | 1990-09-04 | Stirbis James S | One piece can body with domed bottom |
| CN115012173B (zh) * | 2021-03-03 | 2024-07-02 | 惠而浦公司 | 可移除流体泵送和过滤设备 |
| US12043944B2 (en) | 2021-03-03 | 2024-07-23 | Whirlpool Corporation | Removable fluid pumping and filtration apparatus |
| CN120331000A (zh) * | 2024-01-17 | 2025-07-18 | 青岛海尔洗衣机有限公司 | 一种洗涤桶组件及洗涤设备的控制方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB189500879A (OSRAM) * | ||||
| DE566352C (de) * | 1932-12-17 | Gustav Frohne | Waeschestampfer | |
| US157812A (en) * | 1874-12-15 | Improvement in clothes-washing machines | ||
| US201926A (en) * | 1878-04-02 | Improvement in clothes-pounders | ||
| US764613A (en) * | 1903-09-05 | 1904-07-12 | Jesse I Moreland | Washing-machine. |
| US775126A (en) * | 1903-12-26 | 1904-11-15 | Oseline D Cloutier | Clothes-washing apparatus. |
| US901313A (en) * | 1907-07-05 | 1908-10-20 | Manuel J Baker | Apparatus for washing clothes. |
| GB191505410A (en) * | 1915-04-10 | 1915-12-09 | Percival Ellison | Improvements in Devices for use in the Washing or Cleansing of Clothes and the like. |
| FR519599A (fr) * | 1919-11-28 | 1921-06-11 | Paul Fisch | Système de pompe utilisant, pour l'aspiration et le refoulement, l'inertie d'un piston |
| US2497300A (en) * | 1947-01-29 | 1950-02-14 | Du Pont | Floating piston pump |
| DE827488C (de) * | 1950-12-05 | 1952-01-10 | Anny Schroll Geb Ramsteck | Waeschestampfer |
| US2721467A (en) * | 1953-05-13 | 1955-10-25 | Ami Ind Inc | Portable electric washing machine |
| FR1084099A (fr) * | 1953-09-29 | 1955-01-17 | Tech Ind Et Financiere Soc | Appareil à laver pneumatique à triple effet |
| US2770119A (en) * | 1955-01-12 | 1956-11-13 | Walton Washing Machine Corp | Washing device with means for injecting air bubbles in the washing liquid |
| US3091954A (en) * | 1961-12-26 | 1963-06-04 | Gen Motors Corp | Free-piston pump for washing apparatus |
-
1966
- 1966-07-06 US US563117A patent/US3423965A/en not_active Expired - Lifetime
- 1966-11-24 SE SE16112/66A patent/SE314051B/xx unknown
- 1966-12-03 DE DE19661585634 patent/DE1585634A1/de active Pending
- 1966-12-07 NO NO165889A patent/NO122179B/no unknown
- 1966-12-07 AT AT1128866A patent/AT285499B/de not_active IP Right Cessation
- 1966-12-07 CH CH1753366A patent/CH493682A/de not_active IP Right Cessation
- 1966-12-07 ES ES334262A patent/ES334262A1/es not_active Expired
- 1966-12-07 FI FI663234A patent/FI43303C/fi active
- 1966-12-07 NL NL6617207A patent/NL6617207A/xx unknown
- 1966-12-07 BE BE690803D patent/BE690803A/xx not_active IP Right Cessation
- 1966-12-07 DK DK634066AA patent/DK114195B/da not_active IP Right Cessation
- 1966-12-07 OA OA52684A patent/OA02282A/xx unknown
- 1966-12-07 FR FR86441A patent/FR1503358A/fr not_active Expired
- 1966-12-07 GB GB54709/66A patent/GB1161812A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI43303C (fi) | 1971-03-10 |
| US3423965A (en) | 1969-01-28 |
| NL6617207A (OSRAM) | 1967-06-09 |
| SE314051B (OSRAM) | 1969-09-01 |
| DK114195B (da) | 1969-06-09 |
| AT285499B (de) | 1970-10-27 |
| FR1503358A (fr) | 1967-11-24 |
| BE690803A (OSRAM) | 1967-05-16 |
| OA02282A (fr) | 1970-05-05 |
| GB1161812A (en) | 1969-08-20 |
| ES334262A1 (es) | 1968-01-16 |
| FI43303B (OSRAM) | 1970-11-30 |
| CH493682A (de) | 1970-07-15 |
| DE1585634A1 (de) | 1970-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO148662B (no) | Haarkondisjoneringssjampo. | |
| NO165753B (no) | Ceriumoksyd og fremgangsmaate for dets fremstilling. | |
| US2843608A (en) | 4-estrene-3, 17-diol, esters and 17-alkyl derivatives | |
| US2945852A (en) | 17-oxygenated 9alpha-substituted androstano [3, 2-c] pyrazoles and derivatives | |
| US3299107A (en) | 17-(unsaturated hydrocarbon-substituted)-3-hydroxyimino-5alpha-androstan-17beta-ols,alkyl and acyl derivatives thereof | |
| NO128152B (OSRAM) | ||
| NO122179B (OSRAM) | ||
| US3299108A (en) | 17alpha-alkynyl/alkenyl-13beta-alkyl-11-alkylgona-1, 3, 5 (10)-triene-3, 17beta-diols, ethers and esters thereof and intermediates thereto | |
| US2855413A (en) | 16-haloestradiol esters and ethers | |
| US2863862A (en) | 1-methyl steroid derivatives and method for the production thereof | |
| US3079408A (en) | Ig-bisoxygenated iy-haloestra- | |
| US3166578A (en) | (optionally 17-alkylated) 17-oxygenated 5alpha-androst-2-en-4-ones and intermediatesthereto | |
| US3014935A (en) | 5alpha-estrane-3alpha, 17beta-diols and esters thereof | |
| US3314977A (en) | Optionally 17alpha-alkylated 3-oxygenated 2alpha-dialkylaminomethyl-5alpha-androstan-17beta-ols and esters thereof | |
| US3058999A (en) | Method for the preparation of 16-keto steroids | |
| US2833792A (en) | 1, 3, 17-trioxygenated androstane derivatives | |
| US2891078A (en) | 6alpha, 17alpha-dialkyl-17-hydroxy-19-nor-4-androsten-3-ones | |
| US3210390A (en) | 17alpha-(2-alkynyl)estra-1, 3, 5(10)-triene-3, 17beta-diols and esters corresponding | |
| US3080399A (en) | Cyclopentanophenanthrene compounds and process | |
| US2783253A (en) | Cyclopentanophenanthrene derivatives and process for the production thereof | |
| US2733240A (en) | Process for preparation of ailqpreg- | |
| US3128292A (en) | Optionally 17-(hydrocarbon-substituted) 17-oxygenated-3alpha-alkoxy-5alpha-androstanes | |
| US2921064A (en) | 6, 7-dihydroxy estradiol and intermediates thereof | |
| US3449383A (en) | 17-oxygenated estra-1,3,5(10)-triene-3,11beta,16-triols,ethers and esters thereof | |
| US3080381A (en) | Optionally 6-methylated and optionally 17-alkanoyloxygenated 2-oxapregnane-3, 20-diones, a-homo compounds corresponding, and 4, 5-dehydro and 4, 5; 6, 7-bisdehydro derivatives thereof |