NO122175B - - Google Patents
Download PDFInfo
- Publication number
- NO122175B NO122175B NO168847A NO16884767A NO122175B NO 122175 B NO122175 B NO 122175B NO 168847 A NO168847 A NO 168847A NO 16884767 A NO16884767 A NO 16884767A NO 122175 B NO122175 B NO 122175B
- Authority
- NO
- Norway
- Prior art keywords
- sulfur trioxide
- gas stream
- water
- water vapor
- gas
- Prior art date
Links
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 119
- 239000007789 gas Substances 0.000 claims description 47
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 38
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 22
- 239000003595 mist Substances 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 239000003570 air Substances 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000011261 inert gas Substances 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000002191 fatty alcohols Chemical class 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- -1 arylalkyl hydrocarbons Chemical class 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 150000002989 phenols Chemical class 0.000 claims description 2
- 239000000047 product Substances 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000000243 solution Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 230000008901 benefit Effects 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 238000006277 sulfonation reaction Methods 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 4
- 238000002309 gasification Methods 0.000 description 4
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- KWKXNDCHNDYVRT-UHFFFAOYSA-N dodecylbenzene Chemical compound CCCCCCCCCCCCC1=CC=CC=C1 KWKXNDCHNDYVRT-UHFFFAOYSA-N 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229960000541 cetyl alcohol Drugs 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- AZLNHMGSTZDDIY-UHFFFAOYSA-N 1-nonylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCC)=CC=CC2=C1 AZLNHMGSTZDDIY-UHFFFAOYSA-N 0.000 description 1
- ONUJSMYYXFLULS-UHFFFAOYSA-N 2-nonylnaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(CCCCCCCCC)=CC=C21 ONUJSMYYXFLULS-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- NYMJSYRBFIRTAN-UHFFFAOYSA-N C(COCCOCCOCCOCCOCCO)O.C(CCCCCCCCCCC)C1=C(C=CC=C1)O Chemical class C(COCCOCCOCCOCCOCCO)O.C(CCCCCCCCCCC)C1=C(C=CC=C1)O NYMJSYRBFIRTAN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65D—CONTAINERS FOR STORAGE OR TRANSPORT OF ARTICLES OR MATERIALS, e.g. BAGS, BARRELS, BOTTLES, BOXES, CANS, CARTONS, CRATES, DRUMS, JARS, TANKS, HOPPERS, FORWARDING CONTAINERS; ACCESSORIES, CLOSURES, OR FITTINGS THEREFOR; PACKAGING ELEMENTS; PACKAGES
- B65D85/00—Containers, packaging elements or packages, specially adapted for particular articles or materials
- B65D85/30—Containers, packaging elements or packages, specially adapted for particular articles or materials for articles particularly sensitive to damage by shock or pressure
- B65D85/32—Containers, packaging elements or packages, specially adapted for particular articles or materials for articles particularly sensitive to damage by shock or pressure for eggs
- B65D85/324—Containers with compartments made of pressed material
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Packages (AREA)
- Packaging Frangible Articles (AREA)
- Packaging Of Annular Or Rod-Shaped Articles, Wearing Apparel, Cassettes, Or The Like (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US572719A US3362605A (en) | 1966-08-16 | 1966-08-16 | Cartons |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122175B true NO122175B (h) | 1971-05-24 |
Family
ID=24289066
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO168847A NO122175B (h) | 1966-08-16 | 1967-06-29 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3362605A (h) |
| BE (1) | BE699096A (h) |
| CH (1) | CH469610A (h) |
| DE (1) | DE1586583A1 (h) |
| DK (1) | DK120119B (h) |
| ES (1) | ES138694Y (h) |
| GB (1) | GB1182105A (h) |
| NL (2) | NL6711268A (h) |
| NO (1) | NO122175B (h) |
| SE (1) | SE333540B (h) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3486678A (en) * | 1968-02-26 | 1969-12-30 | Container Corp | Container for eggs or the like |
| US3506182A (en) * | 1968-09-20 | 1970-04-14 | United Ind Syndicate | Egg cartons |
| US3469764A (en) * | 1969-01-07 | 1969-09-30 | Sinclair Koppers Co | Foam plastic egg carton |
| US3623652A (en) * | 1969-10-09 | 1971-11-30 | United Ind Syndicate | Molded cartons |
| JPS4921448Y1 (h) * | 1970-02-23 | 1974-06-08 | ||
| US3647132A (en) * | 1970-04-17 | 1972-03-07 | Keyes Fibre Co | Egg carton with exterior windows |
| FR2105059B1 (h) * | 1970-09-21 | 1975-08-22 | Boursier Pierre | |
| GB1382044A (en) * | 1971-03-02 | 1975-01-29 | Autobar Vendabeka Ltd | Boxes or packs for containing eggs fruit or other articles |
| US3779370A (en) * | 1972-02-25 | 1973-12-18 | United Ind Syndicate | Egg carton |
| DE2245176C3 (de) * | 1972-09-14 | 1981-10-08 | Aktieselskabet Broedrene Hartmann, Lyngby | Verpackung für zerbrechliche Gegenstände, insbesondere Eier, in Gestalt eines Schaukartons |
| US3905542A (en) * | 1973-09-19 | 1975-09-16 | Hartmann As Brdr | Sight package for fragile objects |
| US3865299A (en) * | 1974-02-12 | 1975-02-11 | Keyes Fibre Co | Egg carton with flexible window well |
| USD244258S (en) | 1974-07-04 | 1977-05-10 | Aktieselskabet Brodrene Hartmann | Egg carton |
| US4025038A (en) * | 1975-08-29 | 1977-05-24 | Diamond International Corporation | Egg carton |
| GB1603854A (en) * | 1977-05-07 | 1981-12-02 | Univ Belfast | Egg containers |
| US4492331A (en) * | 1981-09-29 | 1985-01-08 | Packaging Corporation Of America | Multi-row egg cartons |
| US4448344A (en) * | 1982-09-01 | 1984-05-15 | Diamond International Corporation | Egg cell construction |
| US4480781A (en) * | 1983-03-16 | 1984-11-06 | Emery Roy W | Moulded egg carton with fingers for supporting the egg |
| US4513932A (en) * | 1983-06-30 | 1985-04-30 | Sinha Betty B | Rigid multi-cone kite |
| US4609141A (en) * | 1983-07-01 | 1986-09-02 | S. Eisenberg & Co., Div. Of Creative Industries, Inc. | Fragile article carton with top having resilient article engaging fingers |
| US4657173A (en) * | 1985-10-24 | 1987-04-14 | S. Eisenberg & Co. | Divided cell carton with resilient biasing members |
| US4699311A (en) * | 1986-11-17 | 1987-10-13 | Wallis Marvin E | Egg carton with overwrap |
| US5064398A (en) * | 1991-04-19 | 1991-11-12 | Lee Richardson | Carrying case for pea characters |
| US5335770A (en) * | 1992-08-06 | 1994-08-09 | Moulded Fibre Technology, Inc. | Molded pulp fiber interior package cushioning structures |
| US5656135A (en) * | 1993-02-16 | 1997-08-12 | Moulded Fibre Technology, Inc. | Molded product manufacturing apparatus and methods |
| US6276531B1 (en) | 2000-03-01 | 2001-08-21 | Pactiv Corporation | Molded fiber nestable egg tray packaging system |
| EP1354820A1 (en) * | 2002-04-17 | 2003-10-22 | Brodrene Hartmann A/S | Display package for articles such as eggs |
| USD632977S1 (en) * | 2009-10-29 | 2011-02-22 | Huhtamaki Nederland Bv | Egg carton |
| USD632975S1 (en) * | 2009-10-29 | 2011-02-22 | Huhtamaki Nederland Bv | Egg carton |
| USD632976S1 (en) * | 2009-10-29 | 2011-02-22 | Huhtamaki Nederland Bv | Egg carton |
| USD632974S1 (en) * | 2009-10-29 | 2011-02-22 | Huhtamaki Nederland Bv | Egg carton |
| US9340343B2 (en) * | 2011-08-26 | 2016-05-17 | Tekni-Plex, Inc. | Egg carton with mating cell and lid post structure |
| US9340349B2 (en) * | 2011-08-26 | 2016-05-17 | Tekni-Plex, Inc. | Standard footprint egg carton for holding up to jumbo size eggs |
| USD695137S1 (en) * | 2012-04-03 | 2013-12-10 | Brødrene Hartmann A/S | Carton |
| US9908690B2 (en) | 2012-04-26 | 2018-03-06 | Brødrene Hartmann A/S | Package for eggs |
| USD719849S1 (en) * | 2012-06-13 | 2014-12-23 | Brødrene Hartmann A/S | Carton |
| ES2601399T3 (es) * | 2012-07-17 | 2017-02-15 | Huhtamaki Molded Fiber Technology B.V. | Cartón de huevos con ventana |
| USD732401S1 (en) * | 2012-10-23 | 2015-06-23 | Pactiv Canada Inc | Sheet-formed container for frangible items |
| USD694126S1 (en) * | 2012-10-23 | 2013-11-26 | Interplast Inc. | Sheet-formed container for frangible items |
| USD689376S1 (en) * | 2013-01-30 | 2013-09-10 | Geoffrey Von der Ahe | Egg carton |
| USD735585S1 (en) | 2015-01-26 | 2015-08-04 | Global Plastics, Inc. | Egg carton |
| USD976715S1 (en) | 2016-12-06 | 2023-01-31 | Global Plastics, Inc. | Egg carton |
| USD891272S1 (en) | 2016-12-06 | 2020-07-28 | Global Plastics, Inc. | Egg carton |
| USD804324S1 (en) | 2016-12-06 | 2017-12-05 | Global Plastics, Inc. | Egg carton |
| USD851502S1 (en) | 2016-12-06 | 2019-06-18 | Global Plastics, Inc. | Egg carton |
| USD871926S1 (en) | 2016-12-06 | 2020-01-07 | Global Plastics, Inc. | Egg carton |
| USD875552S1 (en) | 2017-12-01 | 2020-02-18 | Global Plastics, Inc. | Egg carton lid |
| USD966904S1 (en) * | 2018-08-24 | 2022-10-18 | Tekni-Plex, Inc. | Egg carton with bubble cell pockets |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1991424A (en) * | 1931-07-10 | 1935-02-19 | Francis H Sherman | Package for fragile articles |
| US2009874A (en) * | 1934-05-25 | 1935-07-30 | Thomas P Cauley | Egg carton |
| US2061064A (en) * | 1936-02-04 | 1936-11-17 | Mapes Cons Mfg Co | Egg carton |
| US2560847A (en) * | 1947-06-03 | 1951-07-17 | Chaplin Corp | Molded fiber article |
| US2591446A (en) * | 1947-12-12 | 1952-04-01 | Shellmar Products Corp | Egg carton |
| BE557323A (h) * | 1956-05-09 | |||
| US2978162A (en) * | 1959-02-09 | 1961-04-04 | Packaging Corp America | Molded pulp carton |
| NL272985A (h) * | 1961-07-19 | |||
| DE1250340B (de) * | 1964-12-09 | 1967-09-14 | Aktieselskabet Brodrene Hart mann, Lyngby (Danemark) | Behalter fur leicht zerbrechliche Artikel, 'nsbesondere Eier |
-
0
- NL NL128763D patent/NL128763C/xx active
-
1966
- 1966-08-16 US US572719A patent/US3362605A/en not_active Expired - Lifetime
-
1967
- 1967-05-01 GB GB20056/67A patent/GB1182105A/en not_active Expired
- 1967-05-19 ES ES1967138694U patent/ES138694Y/es not_active Expired
- 1967-05-26 BE BE699096D patent/BE699096A/xx unknown
- 1967-06-29 NO NO168847A patent/NO122175B/no unknown
- 1967-06-30 SE SE10265/67*A patent/SE333540B/xx unknown
- 1967-07-27 DK DK384967AA patent/DK120119B/da unknown
- 1967-08-10 CH CH1129067A patent/CH469610A/de unknown
- 1967-08-16 DE DE19671586583 patent/DE1586583A1/de active Pending
- 1967-08-16 NL NL6711268A patent/NL6711268A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH469610A (de) | 1969-03-15 |
| NL128763C (h) | |
| DK120119B (da) | 1971-04-05 |
| ES138694Y (es) | 1969-05-16 |
| ES138694U (es) | 1968-10-16 |
| SE333540B (h) | 1971-03-15 |
| DE1586583A1 (de) | 1970-10-15 |
| GB1182105A (en) | 1970-02-25 |
| NL6711268A (h) | 1968-02-19 |
| BE699096A (h) | 1967-11-27 |
| US3362605A (en) | 1968-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO122175B (h) | ||
| US3428654A (en) | Alkene sulfonation process and products | |
| US3350428A (en) | Continuous sulfonation process | |
| US2187244A (en) | Sulphonation | |
| NO132959B (h) | ||
| US4144266A (en) | Sulfonation of crude oils to produce petroleum sulfonates | |
| US3506580A (en) | Heat-treatment of sulfonated olefin products | |
| GB1072711A (en) | Improvements in and relating to surface-active olefine sulphonates | |
| GB1063431A (en) | Improvements in and relating to the bleaching of sulphonation products | |
| GB991818A (en) | Improvements in or relating to the preparation of sultones | |
| NO169227B (no) | Peresterforbindelser | |
| US4874552A (en) | Process for simultaneous bleaching and neutralization of alpha-sulfofatty acid esters | |
| US2723990A (en) | Process for sulfonating detergent alkylates | |
| US3248413A (en) | Process of reacting organic compounds with sulfur trioxide | |
| GB851994A (en) | Process and apparatus for the conversion of hydrocarbons | |
| GB795763A (en) | Improved sulfonation process | |
| US3313839A (en) | Preparation of sulfate esters by the reaction of chlorosulfonic acid with alkoxylated alkyl phenols | |
| US2863912A (en) | Process of sulfonating alkyl aryl hydrocarbons | |
| US3313838A (en) | Reaction of chlorosulfonic acid with alkoxylated alkyl phenols | |
| GB449169A (en) | A process of preparing improved wetting agents and detergents, and products thereof | |
| GB793427A (en) | Process for the production of surface active agents | |
| NO751922L (h) | ||
| RU808496C (ru) | Способ получени сульфонатов | |
| US2872437A (en) | Production of oil-soluble sulfonates | |
| DE1079637B (de) | Verfahren zur Herstellung von als oberflaechenaktive Mittel geeigneten organischen Sulfonsaeuren und Schwefelsaeureestern |