NO121401B - - Google Patents
Download PDFInfo
- Publication number
- NO121401B NO121401B NO16866067A NO16866067A NO121401B NO 121401 B NO121401 B NO 121401B NO 16866067 A NO16866067 A NO 16866067A NO 16866067 A NO16866067 A NO 16866067A NO 121401 B NO121401 B NO 121401B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- group
- hydroxy
- water
- bis
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 12
- 208000003495 Coccidiosis Diseases 0.000 claims description 9
- 206010023076 Isosporiasis Diseases 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- -1 6,7-disubstituted 4-hydroxy-3-quinoline carboxylic acid Chemical class 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- 125000004494 ethyl ester group Chemical group 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000287828 Gallus gallus Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 235000013330 chicken meat Nutrition 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- CSEPFVXJYRWNMR-UHFFFAOYSA-N 6,7-bis(2-methylpropoxy)-4-oxo-1h-quinoline-3-carboxylic acid Chemical compound N1C=C(C(O)=O)C(=O)C2=C1C=C(OCC(C)C)C(OCC(C)C)=C2 CSEPFVXJYRWNMR-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- WKKRVARGMNGLFM-UHFFFAOYSA-N 1,2-bis(2-methylprop-2-enoxy)benzene Chemical compound CC(=C)COC1=CC=CC=C1OCC(C)=C WKKRVARGMNGLFM-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- GLFSLOASWYWFBB-UHFFFAOYSA-N 6,7-bis(2-methylpropoxy)-4-oxo-1H-quinoline-3-carbonyl chloride Chemical compound C(C(C)C)OC=1C=C2C(=C(C=NC2=CC1OCC(C)C)C(=O)Cl)O GLFSLOASWYWFBB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 241000224483 Coccidia Species 0.000 description 1
- 241000223931 Eimeria acervulina Species 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- 241000223932 Eimeria tenella Species 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000005741 alkyl alkenyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 235000013594 poultry meat Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000816 toxic dose Toxicity 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO16866067A NO121401B (enExample) | 1962-04-09 | 1967-06-20 |
Applications Claiming Priority (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18580662A | 1962-04-09 | 1962-04-09 | |
| US24293362A | 1962-12-07 | 1962-12-07 | |
| US27285863A | 1963-04-15 | 1963-04-15 | |
| US380058A US3267106A (en) | 1962-04-09 | 1964-07-02 | Lower alkyl esters of 6, 7-di (lower) alkoxy-4-hydroxy-3-quinolinecarboxylic acid |
| BE8546 | 1965-02-03 | ||
| BE659237A BE659237A (enExample) | 1962-04-09 | 1965-02-03 | |
| US440621A US3290315A (en) | 1962-04-09 | 1965-03-17 | Esters of 6, 7-di (lower) alkoxy-4-hydroxy-3-quinolinecarboxylic acid |
| US486583A US3316147A (en) | 1962-04-09 | 1965-07-27 | Coccidial compositions containing lower alkyl esters of 6, 7-di(lower) alkoxy-4-hydroxy-3-quinolinecarboxylic acid |
| US48658665A | 1965-08-23 | 1965-08-23 | |
| NO162114A NO119178B (enExample) | 1962-04-09 | 1966-03-15 | |
| NO16866067A NO121401B (enExample) | 1962-04-09 | 1967-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121401B true NO121401B (enExample) | 1971-02-22 |
Family
ID=27581385
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16866067A NO121401B (enExample) | 1962-04-09 | 1967-06-20 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO121401B (enExample) |
-
1967
- 1967-06-20 NO NO16866067A patent/NO121401B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3290315A (en) | Esters of 6, 7-di (lower) alkoxy-4-hydroxy-3-quinolinecarboxylic acid | |
| CA1087205A (en) | 2-amino-3-(5-and 6-)benzoylphenylacetic acids, esters and metal salts thereof | |
| ROBERTS | The Reaction of Diarylformamidines with Ethyl Malonate1 | |
| US3178348A (en) | Hypotensive quinolines | |
| CN111183129A (zh) | 新型邻氨基苯甲酸系化合物、使用了该化合物的Pin1抑制剂、炎症性疾病及癌症的治疗剂 | |
| US4526894A (en) | Pharmaceutically active 4-hydroxy-3-benzoyl-2-quinolone derivatives | |
| IL22818A (en) | 4-Alcohol Acetic Acetic Acids and their History, Processes for Preparation and Pharmaceutical Preparations Containing Them | |
| JPH01301661A (ja) | 新規ピリジル誘導体 | |
| DE1937477A1 (de) | Neue 1-Phenoxy-2-hydroxy-3-cycloalkylaminopropane und Verfahren zu ihrer Herstellung | |
| Elderfield et al. | Experiments on the Synthesis of 4-Hydroxy-and 4-Chloroquinolines from β-Anilinopropionic Acids1 | |
| Saxton | 685. The reaction between indole and acetic anhydride | |
| IL32889A (en) | Pyrido(4,3-b)indole derivatives,their preparation and pharmaceutical compositions containing them | |
| EP0055068B1 (en) | Quinolone derivatives and their use as pharmaceuticals | |
| JPH0153266B2 (enExample) | ||
| NO121401B (enExample) | ||
| Kenyon et al. | Chloroquine manufacture | |
| NO155056B (no) | Sprengstoff. | |
| US3325515A (en) | Coumarin derivatives and their preparation | |
| EP0024638A1 (en) | Substituted quinolinone-alkanecarboxylic acids, their preparation, and medicaments containing them | |
| US3542851A (en) | Novel acrylate,amines and ethers | |
| US3074939A (en) | 10-(2-morpholinoethoxyacetyl) pheno-thiazine and its preparation | |
| JPH0349908B2 (enExample) | ||
| US3979468A (en) | 4'-Chloro-4-ethynylbiphenyl and method of preparing same | |
| US3313687A (en) | Appetite-suppressing and weight reducing composition | |
| US3399203A (en) | 6-loweralkoxy-7-loweralkyl quinolates |