NO121220B - - Google Patents
Download PDFInfo
- Publication number
- NO121220B NO121220B NO169713A NO16971367A NO121220B NO 121220 B NO121220 B NO 121220B NO 169713 A NO169713 A NO 169713A NO 16971367 A NO16971367 A NO 16971367A NO 121220 B NO121220 B NO 121220B
- Authority
- NO
- Norway
- Prior art keywords
- lamp
- phosphorus
- temperature
- phosphide
- metal
- Prior art date
Links
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 17
- 239000000126 substance Substances 0.000 claims description 15
- 229910052698 phosphorus Inorganic materials 0.000 claims description 14
- 239000011574 phosphorus Substances 0.000 claims description 14
- 229910052751 metal Inorganic materials 0.000 claims description 13
- 239000002184 metal Substances 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000007789 gas Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052788 barium Inorganic materials 0.000 description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 3
- 229920003002 synthetic resin Polymers 0.000 description 3
- 239000000057 synthetic resin Substances 0.000 description 3
- IHGSAQHSAGRWNI-UHFFFAOYSA-N 1-(4-bromophenyl)-2,2,2-trifluoroethanone Chemical compound FC(F)(F)C(=O)C1=CC=C(Br)C=C1 IHGSAQHSAGRWNI-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 229920000193 polymethacrylate Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052845 zircon Inorganic materials 0.000 description 2
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241001621399 Lampris Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/52—Means for obtaining or maintaining the desired pressure within the vessel
- H01K1/54—Means for absorbing or absorbing gas, or for preventing or removing efflorescence, e.g. by gettering
- H01K1/56—Means for absorbing or absorbing gas, or for preventing or removing efflorescence, e.g. by gettering characterised by the material of the getter
Landscapes
- Discharge Lamp (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
- Luminescent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6613009A NL6613009A (enExample) | 1966-09-15 | 1966-09-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121220B true NO121220B (enExample) | 1971-02-01 |
Family
ID=19797678
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO169713A NO121220B (enExample) | 1966-09-15 | 1967-09-12 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3465193A (enExample) |
| AT (1) | AT272450B (enExample) |
| BE (1) | BE703848A (enExample) |
| DE (1) | DE1589261A1 (enExample) |
| ES (1) | ES345012A1 (enExample) |
| GB (1) | GB1130439A (enExample) |
| NL (1) | NL6613009A (enExample) |
| NO (1) | NO121220B (enExample) |
| SE (1) | SE314435B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3898500A (en) * | 1970-01-08 | 1975-08-05 | Thorn Electrical Ind Ltd | Halogen type filament lamp containing phosphorus and nitrogen |
| NL7108536A (enExample) * | 1971-06-21 | 1972-12-27 | ||
| US3712701A (en) * | 1971-08-27 | 1973-01-23 | British Lighting Ind Ltd | Electric incandescent lamps |
| US4415833A (en) * | 1981-09-29 | 1983-11-15 | Gte Products Corporation | Tungsten halogen lamp with coiled getter |
| US4727286A (en) * | 1981-11-16 | 1988-02-23 | Gte Products Corporation | Electric lamp including oxygen getter |
| CA1271513A (en) * | 1985-06-27 | 1990-07-10 | Thomas G. Weld | Tungsten halogen lamp fill mixture comprising a phosphorous-based compound and a carbon-containing compound |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1249978A (en) * | 1913-09-08 | 1917-12-11 | Gen Electric | Incandescent lamp. |
| US1989790A (en) * | 1929-11-27 | 1935-02-05 | Westinghouse Lamp Co | Getter for incandescent lamps |
| BE454637A (enExample) * | 1943-03-04 | |||
| US2393584A (en) * | 1943-05-31 | 1946-01-29 | Gen Electric | Protective device |
-
1966
- 1966-09-15 NL NL6613009A patent/NL6613009A/xx unknown
-
1967
- 1967-08-30 DE DE19671589261 patent/DE1589261A1/de active Pending
- 1967-09-12 AT AT833567A patent/AT272450B/de active
- 1967-09-12 SE SE12583/67A patent/SE314435B/xx unknown
- 1967-09-12 NO NO169713A patent/NO121220B/no unknown
- 1967-09-12 US US667189A patent/US3465193A/en not_active Expired - Lifetime
- 1967-09-13 GB GB41732/67A patent/GB1130439A/en not_active Expired
- 1967-09-13 BE BE703848D patent/BE703848A/xx unknown
- 1967-09-13 ES ES345012A patent/ES345012A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES345012A1 (es) | 1968-10-16 |
| GB1130439A (en) | 1968-10-16 |
| SE314435B (enExample) | 1969-09-08 |
| US3465193A (en) | 1969-09-02 |
| DE1589261A1 (de) | 1970-03-26 |
| BE703848A (enExample) | 1968-03-13 |
| AT272450B (de) | 1969-07-10 |
| NL6613009A (enExample) | 1968-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO121220B (enExample) | ||
| US2465229A (en) | Vacuum trap | |
| US5294867A (en) | Low pressure mercury vapor discharge lamp containing an amalgam | |
| ES471432A1 (es) | Lampara de descarga de arco | |
| GB1400976A (en) | High-pressure mercury vapour discharge lamp | |
| US1565579A (en) | Method of introducing getter materials into incandescent lamps | |
| US1269520A (en) | Manufacture of incandescent lamps. | |
| US2042261A (en) | Gaseous electric discharge device | |
| US1585803A (en) | Manufacture of electric lamps and the like | |
| US1648677A (en) | Incandescent electric lamp | |
| US1752747A (en) | Electron-discharge device and getter therefor | |
| NL8301447A (nl) | Lagedruk-alkalimetaaldamp-ontladingslamp. | |
| US2727830A (en) | Method of applying light-diffusing layer to a glass surface | |
| US1989790A (en) | Getter for incandescent lamps | |
| US2816406A (en) | Photoflash lamp | |
| US975040A (en) | Process for removing oxygen from vessels. | |
| US3826645A (en) | Material for producing a metallic coating on the inner surfaces of a cathode ray tube | |
| van Erk et al. | Effects and mechanism of sodium loss in quartz metal halide lamps | |
| US4048545A (en) | Cathode ray tube processing | |
| US1626639A (en) | Application of getters to electric incandescent lamps and the like | |
| US4898558A (en) | Getter for incandescent lamps | |
| AU5844400A (en) | Getter devices for calcium evaporation | |
| CN117600196A (zh) | 一种二次飞灰的易挥发重金属固定方法 | |
| DE376566C (de) | Elektrische Gluehlampe | |
| US1317492A (en) | Htjrger |