NO119797B - - Google Patents
Download PDFInfo
- Publication number
- NO119797B NO119797B NO15632865A NO15632865A NO119797B NO 119797 B NO119797 B NO 119797B NO 15632865 A NO15632865 A NO 15632865A NO 15632865 A NO15632865 A NO 15632865A NO 119797 B NO119797 B NO 119797B
- Authority
- NO
- Norway
- Prior art keywords
- phenyl
- benzodiazepine
- methyl
- hydrazine hydrate
- chloro
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 20
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 17
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004970 halomethyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 238000010992 reflux Methods 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- DHZYXWMZLAKTQV-UHFFFAOYSA-N diazepin-3-one Chemical class O=C1C=CC=CN=N1 DHZYXWMZLAKTQV-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- -1 cyclic ketimine Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- IKWQWOFXRCUIFT-UHFFFAOYSA-N benzene-1,2-dicarbohydrazide Chemical compound NNC(=O)C1=CC=CC=C1C(=O)NN IKWQWOFXRCUIFT-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- VEJJCRAVOYFKAU-UHFFFAOYSA-N n-(2-benzoylphenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide Chemical class O=C1C2=CC=CC=C2C(=O)N1CC(=O)NC1=CC=CC=C1C(=O)C1=CC=CC=C1 VEJJCRAVOYFKAU-UHFFFAOYSA-N 0.000 description 3
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RHZBRCQIKQUQHQ-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)acetyl chloride Chemical compound C1=CC=C2C(=O)N(CC(=O)Cl)C(=O)C2=C1 RHZBRCQIKQUQHQ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- SZZBOLKXOKEKAN-UHFFFAOYSA-N n-(2-benzoyl-4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide Chemical compound C=1C(Cl)=CC=C(NC(=O)CN2C(C3=CC=CC=C3C2=O)=O)C=1C(=O)C1=CC=CC=C1 SZZBOLKXOKEKAN-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- ABEVIHIQUUXDMS-UHFFFAOYSA-N (2-bromophenyl)-phenylmethanone Chemical compound BrC1=CC=CC=C1C(=O)C1=CC=CC=C1 ABEVIHIQUUXDMS-UHFFFAOYSA-N 0.000 description 1
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical compound C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 1
- IVLXQGJVBGMLRR-UHFFFAOYSA-N 2-aminoacetic acid;hydron;chloride Chemical compound Cl.NCC(O)=O IVLXQGJVBGMLRR-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- 229960001269 glycine hydrochloride Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- SSODIFRMVIJEQE-UHFFFAOYSA-N n-(2-benzoyl-4-bromophenyl)-2-(1,3-dioxoisoindol-2-yl)acetamide Chemical compound C=1C(Br)=CC=C(NC(=O)CN2C(C3=CC=CC=C3C2=O)=O)C=1C(=O)C1=CC=CC=C1 SSODIFRMVIJEQE-UHFFFAOYSA-N 0.000 description 1
- WGHYEZDVCKTDJE-UHFFFAOYSA-N n-(2-benzoyl-4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-n-methylacetamide Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC(=O)N(C)C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 WGHYEZDVCKTDJE-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 125000005543 phthalimide group Chemical class 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO16632167A NO122974B (xx) | 1964-01-14 | 1967-01-10 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB169364A GB1056289A (en) | 1964-01-14 | 1964-01-14 | 2-phthalimido acetamido benzophenones and their preparation |
| GB169264A GB1063891A (en) | 1964-01-14 | 1964-01-14 | Method for preparation of benzodiazepinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119797B true NO119797B (xx) | 1970-07-06 |
Family
ID=26236912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO15632865A NO119797B (xx) | 1964-01-14 | 1965-01-13 |
Country Status (12)
| Country | Link |
|---|---|
| CH (2) | CH459240A (xx) |
| CY (1) | CY532A (xx) |
| DE (1) | DE1545724B2 (xx) |
| DK (1) | DK138494B (xx) |
| ES (1) | ES308038A1 (xx) |
| FI (1) | FI47104C (xx) |
| GB (2) | GB1063891A (xx) |
| IL (1) | IL22679A (xx) |
| MY (1) | MY7000102A (xx) |
| NL (2) | NL6500446A (xx) |
| NO (1) | NO119797B (xx) |
| SE (2) | SE320377B (xx) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH602672A5 (xx) * | 1974-06-28 | 1978-07-31 | Hoffmann La Roche | |
| IT1087017B (it) * | 1977-10-18 | 1985-05-31 | Ravizza Spa | Processo per la preparazione di un 7-cloro-5-(2-clorofenil)-benzodiaze pinone |
| CA1332410C (en) * | 1984-06-26 | 1994-10-11 | Roger M. Freidinger | Benzodiazepine analogs |
| US5004741A (en) * | 1984-06-26 | 1991-04-02 | Merck & Co., Inc. | Methods of antagonizing CCK or gastrin with benzodiazepine analogs |
| US4820834A (en) * | 1984-06-26 | 1989-04-11 | Merck & Co., Inc. | Benzodiazepine analogs |
-
1964
- 1964-01-14 GB GB169264A patent/GB1063891A/en not_active Expired
- 1964-01-14 GB GB169364A patent/GB1056289A/en not_active Expired
- 1964-12-28 IL IL2267964A patent/IL22679A/xx unknown
-
1965
- 1965-01-12 ES ES0308038A patent/ES308038A1/es not_active Expired
- 1965-01-12 DK DK14365A patent/DK138494B/da unknown
- 1965-01-12 FI FI5765A patent/FI47104C/fi active
- 1965-01-13 NO NO15632865A patent/NO119797B/no unknown
- 1965-01-14 SE SE490/65A patent/SE320377B/xx unknown
- 1965-01-14 SE SE1695169A patent/SE363104B/xx unknown
- 1965-01-14 NL NL6500446A patent/NL6500446A/xx unknown
- 1965-01-14 CH CH396367A patent/CH459240A/fr unknown
- 1965-01-14 DE DE1965D0046248 patent/DE1545724B2/de active Granted
- 1965-01-14 CH CH48365A patent/CH450418A/fr unknown
-
1970
- 1970-03-23 CY CY53270A patent/CY532A/xx unknown
- 1970-12-09 NL NL7017982A patent/NL7017982A/xx unknown
- 1970-12-31 MY MY7000102A patent/MY7000102A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE320377B (xx) | 1970-02-09 |
| CH459240A (fr) | 1968-07-15 |
| NL7017982A (xx) | 1971-03-25 |
| DK138494B (da) | 1978-09-18 |
| NL6500446A (xx) | 1965-07-15 |
| GB1056289A (en) | 1967-01-25 |
| CY532A (en) | 1970-03-23 |
| DK138494C (xx) | 1979-02-26 |
| SE363104B (xx) | 1974-01-07 |
| FI47104C (fi) | 1973-09-10 |
| MY7000102A (en) | 1970-12-31 |
| DE1545724B2 (de) | 1977-02-10 |
| IL22679A (en) | 1968-09-26 |
| FI47104B (xx) | 1973-05-31 |
| ES308038A1 (es) | 1965-06-16 |
| GB1063891A (en) | 1967-04-05 |
| DE1545724A1 (de) | 1969-10-09 |
| CH450418A (fr) | 1968-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO156328B (no) | Konstruksjon med keramisk overflatebelegg samt fremgangsmaate til fremstilling av samme. | |
| KR850000891B1 (ko) | 삼-치환 이미다졸 유도체의 제조방법 | |
| DK1797037T3 (en) | PROCESS FOR THE PREPARATION OF 4- {4 - [({[4-chloro-3- (trifluoromethyl) phenyl] AMINO} CARBONYL) AMINO] PHENYOXY} N-methylpyridine-2-carboxamide | |
| JPH0314025B2 (xx) | ||
| HU178593B (en) | Process for producing 3-hydroxy-6-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazocine derivatives | |
| NO119797B (xx) | ||
| DK149230B (da) | Analogifremgangsmaade til fremstilling af 5-benzoyl-6-hydroxy-indan-1-carboxylsyrederivater eller farmaceutisk acceptable salte deraf | |
| EP0009384A1 (en) | Processes for the preparation of triazinones and condensed triazinones, and compounds so obtained | |
| Kiang et al. | 268. The action of acyl cyanides on 2-and 1: 2-substituted indoles. Part II. Derivatives of 2-o-aminophenylindole | |
| JPH05271200A (ja) | ６，７−ジクロロ−１，５−ジヒドロ−イミダゾ〔２，１−ｂ〕キナゾリン−２〔３Ｈ〕−オンの製造方法 | |
| US4743601A (en) | Dihydro-1,4-oxazino(2,3-C)quinolines | |
| US3304313A (en) | 2-(nu-phthalimidoacetyl-nu-cycloalkylmethyl)-aminobenzophenone derivatives | |
| US4634769A (en) | Process for the preparation of 8-halo-5,6-dialkoxyquinazoline-2,4-diones and their salts | |
| Peet et al. | Synthesis of 5H‐Tetrazolo [1, 5‐d][1, 4] benzodiazepin‐6 (7H) ones | |
| US3988347A (en) | Process for the preparation of substituted indazoles | |
| JPS5833877B2 (ja) | ユウキカゴウブツニカンスルカイリヨウ | |
| US4146713A (en) | Method of preparing 3-morpholino-2-cyanoacrylamide | |
| JP2021526531A (ja) | リフィテグラストの製造方法 | |
| US2650922A (en) | Disubstituxed derivatives of g-amino | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| US3179656A (en) | Azepine x-oxidss | |
| US4238622A (en) | D,L-2-Amino-4-(2-aminoethoxy)-trans-but-3-enoic acid derivatives | |
| US3472847A (en) | Conversion of pyrazinoylcyanamides to pyrazinoylguanidines | |
| SU465791A3 (ru) | Способ получени 5-арил-(или гетероарил)-3-окси-1н-1,5-бензодиазепин-2,4(3н,5н)-дионов | |
| US4421756A (en) | Quinolinoneimine carboxylic acid anti-inflammatory and analgesic composition containing the compound |