NO115681B - - Google Patents
Download PDFInfo
- Publication number
- NO115681B NO115681B NO164675A NO16467566A NO115681B NO 115681 B NO115681 B NO 115681B NO 164675 A NO164675 A NO 164675A NO 16467566 A NO16467566 A NO 16467566A NO 115681 B NO115681 B NO 115681B
- Authority
- NO
- Norway
- Prior art keywords
- copper
- hours
- polyamide
- relative viscosity
- compounds
- Prior art date
Links
- 239000004952 Polyamide Substances 0.000 claims description 27
- 229920002647 polyamide Polymers 0.000 claims description 27
- 239000003381 stabilizer Substances 0.000 claims description 15
- 239000010949 copper Substances 0.000 claims description 13
- 229910052802 copper Inorganic materials 0.000 claims description 12
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- 229940071870 hydroiodic acid Drugs 0.000 claims description 5
- 239000005749 Copper compound Substances 0.000 claims description 4
- 150000001880 copper compounds Chemical class 0.000 claims description 4
- 150000003003 phosphines Chemical class 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 3
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- RIRXDDRGHVUXNJ-UHFFFAOYSA-N [Cu].[P] Chemical compound [Cu].[P] RIRXDDRGHVUXNJ-UHFFFAOYSA-N 0.000 claims 1
- 230000006641 stabilisation Effects 0.000 claims 1
- 238000011105 stabilization Methods 0.000 claims 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 16
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 10
- 239000008187 granular material Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 229910052698 phosphorus Inorganic materials 0.000 description 7
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 6
- 150000001879 copper Chemical class 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- 229920002292 Nylon 6 Polymers 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 239000012467 final product Substances 0.000 description 5
- -1 threads Chemical class 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 150000003018 phosphorus compounds Chemical class 0.000 description 4
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 3
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- ROFNJLCLYMMXCT-UHFFFAOYSA-N 4-aminohexanoic acid Chemical compound CCC(N)CCC(O)=O ROFNJLCLYMMXCT-UHFFFAOYSA-N 0.000 description 2
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- OKIIEJOIXGHUKX-UHFFFAOYSA-L cadmium iodide Chemical compound [Cd+2].[I-].[I-] OKIIEJOIXGHUKX-UHFFFAOYSA-L 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 150000002696 manganese Chemical class 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 2
- IWPNEBZUNGZQQQ-UHFFFAOYSA-N tripentylphosphane Chemical compound CCCCCP(CCCCC)CCCCC IWPNEBZUNGZQQQ-UHFFFAOYSA-N 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 1
- QSVXMOKGHFNTEI-UHFFFAOYSA-N 2-bis[2-(dimethylamino)phenyl]phosphanyl-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1P(C=1C(=CC=CC=1)N(C)C)C1=CC=CC=C1N(C)C QSVXMOKGHFNTEI-UHFFFAOYSA-N 0.000 description 1
- IJUWZMWMWYYJSZ-UHFFFAOYSA-N 6-(dimethylamino)-N-dodecylhexanamide hydroiodide Chemical compound I.C(CCCCCCCCCCC)NC(CCCCCN(C)C)=O IJUWZMWMWYYJSZ-UHFFFAOYSA-N 0.000 description 1
- SWCSXNZBAVHUMT-UHFFFAOYSA-N 6-(dimethylamino)hexanoic acid Chemical compound CN(C)CCCCCC(O)=O SWCSXNZBAVHUMT-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- UNMYWSMUMWPJLR-UHFFFAOYSA-L Calcium iodide Chemical compound [Ca+2].[I-].[I-] UNMYWSMUMWPJLR-UHFFFAOYSA-L 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- JNKICIJSCVMYQF-UHFFFAOYSA-N I.C(C)NCC1=CC=CC=C1 Chemical compound I.C(C)NCC1=CC=CC=C1 JNKICIJSCVMYQF-UHFFFAOYSA-N 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- AQDOJAUQFWNAEP-UHFFFAOYSA-N N-methyloctadecan-1-amine hydroiodide Chemical compound I.CNCCCCCCCCCCCCCCCCCC AQDOJAUQFWNAEP-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- LRRJQNMXIDXNIM-UHFFFAOYSA-M benzyl(trimethyl)azanium;iodide Chemical compound [I-].C[N+](C)(C)CC1=CC=CC=C1 LRRJQNMXIDXNIM-UHFFFAOYSA-M 0.000 description 1
- QFZYCXMARBLKFS-UHFFFAOYSA-M benzyl-ethyl-dimethylazanium;iodide Chemical compound [I-].CC[N+](C)(C)CC1=CC=CC=C1 QFZYCXMARBLKFS-UHFFFAOYSA-M 0.000 description 1
- 229940075417 cadmium iodide Drugs 0.000 description 1
- 229910001640 calcium iodide Inorganic materials 0.000 description 1
- 229940046413 calcium iodide Drugs 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- PEVZEFCZINKUCG-UHFFFAOYSA-L copper;octadecanoate Chemical compound [Cu+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O PEVZEFCZINKUCG-UHFFFAOYSA-L 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- WGYRINYTHSORGH-UHFFFAOYSA-N cyclohexylazanium;iodide Chemical compound [I-].[NH3+]C1CCCCC1 WGYRINYTHSORGH-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KYTBWOMLGWBGOL-UHFFFAOYSA-N dimethyl(phenyl)azanium;iodide Chemical compound [I-].C[NH+](C)C1=CC=CC=C1 KYTBWOMLGWBGOL-UHFFFAOYSA-N 0.000 description 1
- HASCQPSFPAKVEK-UHFFFAOYSA-N dimethyl(phenyl)phosphine Chemical compound CP(C)C1=CC=CC=C1 HASCQPSFPAKVEK-UHFFFAOYSA-N 0.000 description 1
- ZJEXHTNOFNAXRQ-UHFFFAOYSA-N dodecyl(dimethyl)azanium;iodide Chemical compound [I-].CCCCCCCCCCCC[NH+](C)C ZJEXHTNOFNAXRQ-UHFFFAOYSA-N 0.000 description 1
- USEXUESVOVNRHP-UHFFFAOYSA-M dodecyl(triethyl)azanium;iodide Chemical compound [I-].CCCCCCCCCCCC[N+](CC)(CC)CC USEXUESVOVNRHP-UHFFFAOYSA-M 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- VVJDJWDRCWLWDI-UHFFFAOYSA-N hexadecylazanium;iodide Chemical compound [I-].CCCCCCCCCCCCCCCC[NH3+] VVJDJWDRCWLWDI-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- BLQJIBCZHWBKSL-UHFFFAOYSA-L magnesium iodide Chemical compound [Mg+2].[I-].[I-] BLQJIBCZHWBKSL-UHFFFAOYSA-L 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000004792 oxidative damage Effects 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- HBPSMMXRESDUSG-UHFFFAOYSA-N piperidine;hydroiodide Chemical compound I.C1CCNCC1 HBPSMMXRESDUSG-UHFFFAOYSA-N 0.000 description 1
- 229960004839 potassium iodide Drugs 0.000 description 1
- BJDYCCHRZIFCGN-UHFFFAOYSA-N pyridin-1-ium;iodide Chemical compound I.C1=CC=NC=C1 BJDYCCHRZIFCGN-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 239000012748 slip agent Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229940083599 sodium iodide Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- DHWBYAACHDUFAT-UHFFFAOYSA-N tricyclopentylphosphane Chemical compound C1CCCC1P(C1CCCC1)C1CCCC1 DHWBYAACHDUFAT-UHFFFAOYSA-N 0.000 description 1
- IGPQNRIFRBOQGE-UHFFFAOYSA-N trioctadecylazanium;iodide Chemical compound [I-].CCCCCCCCCCCCCCCCCC[NH+](CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC IGPQNRIFRBOQGE-UHFFFAOYSA-N 0.000 description 1
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 1
- MGMXGCZJYUCMGY-UHFFFAOYSA-N tris(4-nonylphenyl) phosphite Chemical compound C1=CC(CCCCCCCCC)=CC=C1OP(OC=1C=CC(CCCCCCCCC)=CC=1)OC1=CC=C(CCCCCCCCC)C=C1 MGMXGCZJYUCMGY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/16—Halogen-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/50—Phosphorus bound to carbon only
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyamides (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF47169A DE1237309B (de) | 1965-09-11 | 1965-09-11 | Verfahren zur Herstellung waermestabilisierter Polyamide |
| DEF48224A DE1245591B (de) | 1965-09-11 | 1966-01-21 | Verfahren zur Herstellung stabilisierter Polyamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO115681B true NO115681B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1968-11-11 |
Family
ID=25976979
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164675A NO115681B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1965-09-11 | 1966-09-10 |
Country Status (11)
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1276007A (en) * | 1969-04-15 | 1972-06-01 | Ici Ltd | Polyamides |
| US3666675A (en) * | 1970-01-21 | 1972-05-30 | Univ Temple | Method for producing luminescence using complex luminescent materials |
| US3806487A (en) * | 1972-07-03 | 1974-04-23 | Monsanto Co | Stabilization of pigmented nylon against actinic radiation |
| US4043972A (en) * | 1975-10-06 | 1977-08-23 | Phillips Fibers Corporation | Stabilizing polyamide antistatic compositions |
| DE3717218A1 (de) * | 1987-05-22 | 1989-03-23 | Bayer Ag | Glasfaserverstaerkte stabilisierte polyamidformmasse |
| DE3917294A1 (de) † | 1989-05-27 | 1990-11-29 | Huels Chemische Werke Ag | Mit laserlicht beschriftbare hochpolymere materialien |
| DE4020447A1 (de) * | 1990-06-27 | 1992-01-02 | Bayer Ag | Stabilisatorkombinationen und ihre verwendung zur herstellung von stabilisierten, schlagzaehmodifizierten polyamiden |
| DE19615484A1 (de) * | 1996-04-19 | 1997-10-23 | Basf Ag | Oxidationsstabilisierte Polyamidformmassen |
| US5686513A (en) * | 1996-09-09 | 1997-11-11 | Zimmer Aktiengesellschaft | Process for the production of stabilizer concentrate for polyamide |
| DE19847627A1 (de) * | 1998-10-15 | 2000-04-20 | Brueggemann L Kg | Mit Kupferkomplexen und organischen Halogenverbindungen stabilisierte Polyamidzusammensetzung |
| FR3049952B1 (fr) | 2016-04-08 | 2018-03-30 | Arkema France | Composition a base de polyamide pour des tuyaux contenant du petrole ou du gaz |
| FR3049953B1 (fr) | 2016-04-08 | 2020-04-24 | Arkema France | Composition de polymere thermoplastique et stabilisant a base de cuivre, sa preparation et ses utilisations |
| FR3067033B1 (fr) | 2017-06-02 | 2021-01-01 | Arkema France | Composition a base de polyamide pour des tuyaux de liquide de refroidissement |
| FR3097226B1 (fr) | 2019-06-11 | 2021-11-26 | Arkema France | Compositions de polyamide presentant un module eleve et une faible constante dielectrique et leur utilisation |
| FR3108615B1 (fr) | 2020-03-24 | 2022-12-02 | Arkema France | Compositions a mouler renforcees avec des fibres de verre ayant des proprietes choc ameliorees |
| FR3111351B1 (fr) | 2020-06-10 | 2022-09-09 | Arkema France | Compositions de polyamide presentant un module eleve et une faible constante dielectrique et leur utilisation |
| FR3124517B1 (fr) | 2021-06-28 | 2025-01-17 | Arkema France | Compositions de soufflage moulage a base de polyamides branches et leurs utilisations |
| FR3124516B1 (fr) | 2021-06-28 | 2025-05-02 | Arkema France | Compositions de soufflage moulage a base de polyamides branches et leurs utilisations |
| WO2023049161A1 (en) * | 2021-09-21 | 2023-03-30 | Ascend Performance Materials Operations Llc | Stabilizing component for polyamide resin composition |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2510777A (en) * | 1946-12-30 | 1950-06-06 | Du Pont | Polyamide treated with a hypophosphorous acid compound |
| US2705227A (en) * | 1954-03-15 | 1955-03-29 | Du Pont | Heat stabilization of polyamides |
| NL103099C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-04-11 | |||
| FR84140A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-07-18 | |||
| DE1152816B (de) * | 1962-01-27 | 1963-08-14 | Basf Ag | Verfahren zum Herstellen von stabilisierten Polyamiden |
| NL140268B (nl) * | 1965-02-02 | 1973-11-15 | Stamicarbon | Werkwijze voor het stabiliseren van polyamiden met een stabilisator, die voor, tijdens of na de polymerisatie wordt toegevoegd. |
-
1965
- 1965-09-11 DE DEF47169A patent/DE1237309B/de active Pending
-
1966
- 1966-01-21 DE DEF48224A patent/DE1245591B/de active Pending
- 1966-08-03 CH CH1119266A patent/CH472458A/de not_active IP Right Cessation
- 1966-08-18 GB GB37073/66A patent/GB1084699A/en not_active Expired
- 1966-08-22 AT AT795366A patent/AT259873B/de active
- 1966-08-29 SE SE11629/66A patent/SE301382B/xx unknown
- 1966-09-02 US US576831A patent/US3505285A/en not_active Expired - Lifetime
- 1966-09-08 DK DK461666AA patent/DK116244B/da unknown
- 1966-09-08 NL NL6612672A patent/NL6612672A/xx unknown
- 1966-09-09 BE BE686692D patent/BE686692A/xx unknown
- 1966-09-10 NO NO164675A patent/NO115681B/no unknown
- 1966-09-10 ES ES0331089A patent/ES331089A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE301382B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1968-06-04 |
| NL6612672A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-03-13 |
| DE1237309B (de) | 1967-03-23 |
| DK116244B (da) | 1969-12-22 |
| GB1084699A (en) | 1967-09-27 |
| DE1245591B (de) | 1967-07-27 |
| ES331089A1 (es) | 1967-09-16 |
| BE686692A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-02-15 |
| AT259873B (de) | 1968-02-12 |
| CH472458A (de) | 1969-05-15 |
| US3505285A (en) | 1970-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO115681B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| NO164675B (no) | Fremgangsmaate for aa bringe en utblaasning i en foret broennunder kontroll. | |
| US5837780A (en) | Poly (meth) acrylamides with improved color stability under thermal stress | |
| US3491042A (en) | Stabilized polyamide composition containing copper salts and metal cyanides | |
| US20100120961A1 (en) | Polyamide resin composition | |
| US2493597A (en) | Use of phosphite esters in the stabilization of linear polyamides | |
| KR20020002355A (ko) | 구리염과 유기 할로겐 화합물로 안정화된 폴리아미드 조성물 | |
| US3519595A (en) | Stabilized polyamides | |
| EP0122688A3 (en) | Crystalline copolyamides from terephthalic acid, isophthalic acid and c6 diamines | |
| DE2204495A1 (de) | Stabilisierte Polyamidzusammensetzungen | |
| US3384615A (en) | Stabilization of polyamides | |
| US3527730A (en) | Stabilization of polymers with alkali and alkaline earth metal salts | |
| US4208486A (en) | Stabilization of organic amide solvents and polymer solutions thereof | |
| US3553161A (en) | Polyamides stabilized against degradation with copper salts and phosphine halides | |
| US4377683A (en) | Transparent copolyamide from isophorone diamine and substituted undecane diamine | |
| US3477986A (en) | Polyamides stabilized with combination of a copper compound and a phosphonium halide | |
| US3507833A (en) | Stabilized polyamide composition containing copper and halogenated phosphite additives | |
| US4144213A (en) | Stabilization of organic amide solvents and polymer solutions thereof | |
| US5194576A (en) | Melt production of a thermoplastically processible aromatic polyamide with phosphorus compound catalyst and metal salt catalyst | |
| US3465037A (en) | Production of meso 2,3-dibromosuccinic acid | |
| US3492266A (en) | Polyamides stabilized with potassium or sodium cyanocuprates | |
| GB2006797A (en) | Transparent polyamides | |
| US4028314A (en) | Polylauryllactam having a low fisheye gel content | |
| US4891156A (en) | N-alkyl-benzenesulphonamide compositions | |
| US3997495A (en) | Organometallic stabilizers for vinyl chloride polymers |