NL7414134A - Werkwijze voor het bereiden van m-fenoxyfenyl- propionzuurderivaten. - Google Patents
Werkwijze voor het bereiden van m-fenoxyfenyl- propionzuurderivaten.Info
- Publication number
- NL7414134A NL7414134A NL7414134A NL7414134A NL7414134A NL 7414134 A NL7414134 A NL 7414134A NL 7414134 A NL7414134 A NL 7414134A NL 7414134 A NL7414134 A NL 7414134A NL 7414134 A NL7414134 A NL 7414134A
- Authority
- NL
- Netherlands
- Prior art keywords
- phenoxyphenyl
- preparing
- propionic acid
- acid derivatives
- derivatives
- Prior art date
Links
- RDJGLLICXDHJDY-UHFFFAOYSA-N fenoprofen Chemical class OC(=O)C(C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/48—Compounds containing oxirane rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/57—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom
- C07C45/58—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom in three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12073873A JPS5620293B2 (index.php) | 1973-10-29 | 1973-10-29 | |
| JP12073973A JPS5620294B2 (index.php) | 1973-10-29 | 1973-10-29 | |
| JP5389774A JPS5620295B2 (index.php) | 1974-05-16 | 1974-05-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL7414134A true NL7414134A (nl) | 1975-05-02 |
Family
ID=27295100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL7414134A NL7414134A (nl) | 1973-10-29 | 1974-10-29 | Werkwijze voor het bereiden van m-fenoxyfenyl- propionzuurderivaten. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3985779A (index.php) |
| CA (1) | CA1041531A (index.php) |
| CH (2) | CH613935A5 (index.php) |
| DE (1) | DE2451140A1 (index.php) |
| ES (2) | ES431425A1 (index.php) |
| FR (1) | FR2248832B1 (index.php) |
| GB (1) | GB1491498A (index.php) |
| NL (1) | NL7414134A (index.php) |
| SE (1) | SE419538B (index.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4145440A (en) * | 1977-08-18 | 1979-03-20 | The Upjohn Company | Liquid suspension of an aluminum salt of ibuprofen |
| DE2950608A1 (de) * | 1978-12-29 | 1980-07-10 | Chinoin Gyogyszer Es Vegyeszet | Verfahren zur herstellung von 2-(3-phenoxy-phenyl)-propionsaeure |
| US4361580A (en) * | 1980-06-20 | 1982-11-30 | The Upjohn Manufacturing Company | Aluminum ibuprofen pharmaceutical suspensions |
| HU181737B (en) * | 1980-07-10 | 1983-11-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing diphenyl-ether derivatives |
| IT1175941B (it) * | 1984-02-16 | 1987-08-12 | Stabil Bioterapico Farmachim | Sali d'alluminio mono, bi e trisostituiti degli acidi aril-alcanoici e composizioni farmaceutiche che li contengono |
| ES2163986B1 (es) * | 1999-07-13 | 2003-02-16 | Menarini Lab | Acidos-alfa-arilpropionicos y arilaceticos como inhibidores de la ciclooxigenasa-ii. |
| SE0301010D0 (sv) * | 2003-04-07 | 2003-04-07 | Astrazeneca Ab | Novel compounds |
| SA04250253B1 (ar) | 2003-08-21 | 2009-11-10 | استرازينيكا ايه بي | احماض فينوكسي اسيتيك مستبدلة باعتبارها مركبات صيدلانية لعلاج الامراض التنفسية مثل الربو ومرض الانسداد الرئوي المزمن |
| GB0415320D0 (en) * | 2004-07-08 | 2004-08-11 | Astrazeneca Ab | Novel compounds |
| GB0418830D0 (en) | 2004-08-24 | 2004-09-22 | Astrazeneca Ab | Novel compounds |
| UY29223A1 (es) * | 2004-11-23 | 2006-06-30 | Astrazeneca Ab | Ácidos fenoxiacéticos sustituidos, composiciones farmacéuticas que los contienen y procesos para su preparación |
| BRPI0615948A2 (pt) * | 2005-09-07 | 2011-05-31 | Plexxikon Inc | composto ativo de ppar, sua composição, seu kit e seu uso |
| EP1937632A1 (en) * | 2005-10-06 | 2008-07-02 | Astra Zeneca AB | Novel compounds |
| TW200745003A (en) | 2005-10-06 | 2007-12-16 | Astrazeneca Ab | Novel compounds |
| EP2305640A3 (en) * | 2005-12-15 | 2011-07-20 | AstraZeneca AB | Substituted diphenyl-ethers, -amines, -sulfides and -methanes for the treatment of respiratory diseases |
| CN103561732A (zh) * | 2011-04-11 | 2014-02-05 | 阿克西里亚药品公司 | 治疗化合物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB971700A (en) * | 1961-02-02 | 1964-09-30 | Boots Pure Drug Co Ltd | Anti-Inflammatory Agents |
| US3517051A (en) * | 1964-03-20 | 1970-06-23 | Merck & Co Inc | Phenoxy substituted phenylacetic acids |
| US3600437A (en) * | 1969-05-28 | 1971-08-17 | Lilly Co Eli | Substituted phenylalkanoic acids and derivatives thereof |
| US3649679A (en) * | 1968-08-15 | 1972-03-14 | Lilly Co Eli | Substituted phenylalkanoic acid derivatives ii |
| GB1308327A (en) * | 1970-04-14 | 1973-02-21 | Reckitt & Colmann Prod Ltd | Phenylalkane derivatives and processes for the preparation thereof |
-
1974
- 1974-10-28 DE DE19742451140 patent/DE2451140A1/de not_active Withdrawn
- 1974-10-28 SE SE7413548A patent/SE419538B/xx not_active IP Right Cessation
- 1974-10-28 CA CA212,389A patent/CA1041531A/en not_active Expired
- 1974-10-28 ES ES431425A patent/ES431425A1/es not_active Expired
- 1974-10-29 CH CH1449374A patent/CH613935A5/xx not_active IP Right Cessation
- 1974-10-29 CH CH1058379A patent/CH642938A5/de not_active IP Right Cessation
- 1974-10-29 GB GB46851/74A patent/GB1491498A/en not_active Expired
- 1974-10-29 NL NL7414134A patent/NL7414134A/xx unknown
- 1974-10-29 FR FR7436168A patent/FR2248832B1/fr not_active Expired
- 1974-10-29 US US05/518,935 patent/US3985779A/en not_active Expired - Lifetime
-
1976
- 1976-08-02 ES ES450391A patent/ES450391A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2451140A1 (de) | 1975-04-30 |
| CH613935A5 (index.php) | 1979-10-31 |
| US3985779A (en) | 1976-10-12 |
| FR2248832A1 (index.php) | 1975-05-23 |
| CH642938A5 (de) | 1984-05-15 |
| SE419538B (sv) | 1981-08-10 |
| FR2248832B1 (index.php) | 1978-07-21 |
| ES431425A1 (es) | 1977-01-16 |
| GB1491498A (en) | 1977-11-09 |
| SE7413548L (index.php) | 1975-04-30 |
| CA1041531A (en) | 1978-10-31 |
| ES450391A1 (es) | 1977-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL7411871A (nl) | Werkwijze voor het bereiden van entcopolymeren. | |
| NL7416432A (nl) | Werkwijze voor het bereiden van 2-acyl-4-oxo- -pyrazino-isochinolinederivaten. | |
| NL7416878A (nl) | Werkwijze voor het bereiden van methacrylzuur. | |
| NL176859C (nl) | Werkwijze voor het bereiden van polymaleinezuuranhydride. | |
| NL7414134A (nl) | Werkwijze voor het bereiden van m-fenoxyfenyl- propionzuurderivaten. | |
| NL7411105A (nl) | Werkwijze voor het bereiden van fenoxypropion- zuurderivaten. | |
| NL7411618A (nl) | Werkwijze voor het bereiden van gesubstitueerde aminobenzoezuurderivaten. | |
| NL7408862A (nl) | Werkwijze voor het bereiden van benzothiazool- derivaten. | |
| NL7410837A (nl) | Werkwijze voor het bereiden van cefalosporine- derivaten. | |
| NL7415870A (nl) | Werkwijze voor het bereiden van n.n-dialkyl- aminocarbamidezuuresters van gesubstitueerde oxy-pyridinederivaten. | |
| NL158166B (nl) | Werkwijze voor het bereiden van dimethyltereftalaat. | |
| NL7411868A (nl) | Werkwijze voor het bereiden van cefemderivaten. | |
| NL184897C (nl) | Werkwijze voor het bereiden van pregnaanzuurderivaten. | |
| NL182958C (nl) | Continue werkwijze voor het bereiden van maleinezuuranhydride. | |
| NL183188C (nl) | Werkwijze voor het bereiden van cyaanpyridinen. | |
| NL163263C (nl) | Werkwijze voor het bereiden van 6-aminopenicillanzuur. | |
| NL170729C (nl) | Werkwijze voor het bereiden van 1-aminoantrachinon. | |
| NL7505065A (nl) | Werkwijze voor het bereiden van d-wijnsteen- zuur. | |
| NL7416120A (nl) | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. | |
| NL7410775A (nl) | Werkwijze voor het bereiden van chinazolinon- derivaten. | |
| NL7416296A (nl) | Werkwijze voor het bereiden van isonicotine- zuurderivaten. | |
| NL7408798A (nl) | Werkwijze voor het bereiden van 2-fenylethyleen- fosfonzuur. | |
| NL183650C (nl) | Werkwijze voor het bereiden van 7-alkoxy-3-cefem-4-carbonzuurderivaten. | |
| NL7411002A (nl) | Werkwijze voor het bereiden van groter moleculige, alifatische monocarbonzuren. | |
| NL7411503A (nl) | Werkwijze voor het bereiden van 6-trichloor- aceetamidopenicillanzuurderivaten. |