NL159107B - Werkwijze ter bereiding van penicilline- en cefalosporinederivaten onder toepassing van silylerende verbinding. - Google Patents
Werkwijze ter bereiding van penicilline- en cefalosporinederivaten onder toepassing van silylerende verbinding.Info
- Publication number
- NL159107B NL159107B NL7402382.A NL159107DA NL159107B NL 159107 B NL159107 B NL 159107B NL 159107D A NL159107D A NL 159107DA NL 159107 B NL159107 B NL 159107B
- Authority
- NL
- Netherlands
- Prior art keywords
- cephalosporin derivatives
- preparing penicillin
- silylating compound
- silylating
- compound
- Prior art date
Links
- 229930186147 Cephalosporin Chemical class 0.000 title 1
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical class N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- 150000001780 cephalosporins Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N9/00—Details of colour television systems
- H04N9/12—Picture reproducers
- H04N9/16—Picture reproducers using cathode ray tubes
- H04N9/22—Picture reproducers using cathode ray tubes using the same beam for more than one primary colour information
- H04N9/26—Picture reproducers using cathode ray tubes using the same beam for more than one primary colour information using electron-optical colour selection means, e.g. line grid, deflection means in or near the gun or near the phosphor screen
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Cathode-Ray Tubes And Fluorescent Screens For Display (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US150732A US2739260A (en) | 1950-03-20 | 1950-03-20 | Cathode-ray tube for color television |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL159107B true NL159107B (nl) |
Family
ID=22535770
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL7402382.A NL159107B (nl) | 1950-03-20 | Werkwijze ter bereiding van penicilline- en cefalosporinederivaten onder toepassing van silylerende verbinding. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2739260A (OSRAM) |
| BE (1) | BE502013A (OSRAM) |
| DE (1) | DE914386C (OSRAM) |
| FR (1) | FR1033838A (OSRAM) |
| GB (1) | GB721199A (OSRAM) |
| NL (1) | NL159107B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2792522A (en) * | 1953-09-18 | 1957-05-14 | Westinghouse Electric Corp | Color television tube |
| US3202864A (en) * | 1961-05-26 | 1965-08-24 | Bell Telephone Labor Inc | Electron beam device having divergent emission electron gun |
| US4635107A (en) * | 1984-08-20 | 1987-01-06 | International Business Machines Corporation | Electron beam position control for color display |
| CN1459203A (zh) * | 2001-03-09 | 2003-11-26 | 皇家菲利浦电子有限公司 | 指示型图像显示器件 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB443896A (en) * | 1934-10-06 | 1936-03-10 | Gen Electric Co Ltd | Improvements in or relating to television |
| US2307188A (en) * | 1940-11-30 | 1943-01-05 | Rca Corp | Television system |
| US2461515A (en) * | 1945-07-16 | 1949-02-15 | Arthur B Bronwell | Color television system |
| US2529485A (en) * | 1945-10-09 | 1950-11-14 | Thornton W Chew | Color television |
| US2446249A (en) * | 1946-05-04 | 1948-08-03 | Rca Corp | Pickup tube for color television |
| US2446440A (en) * | 1947-01-28 | 1948-08-03 | Rca Corp | Color television tube |
| BE483461A (OSRAM) * | 1947-07-02 | |||
| US2518200A (en) * | 1947-10-03 | 1950-08-08 | Rca Corp | Television system |
| US2579705A (en) * | 1950-01-27 | 1951-12-25 | Rca Corp | Color television system |
| US2571991A (en) * | 1950-01-31 | 1951-10-16 | Rca Corp | Color television tube |
| US2635203A (en) * | 1951-01-02 | 1953-04-14 | Rauland Corp | Color television tube |
-
0
- NL NL7402382.A patent/NL159107B/xx unknown
- BE BE502013D patent/BE502013A/xx unknown
-
1950
- 1950-03-20 US US150732A patent/US2739260A/en not_active Expired - Lifetime
-
1951
- 1951-02-15 GB GB3645/51A patent/GB721199A/en not_active Expired
- 1951-03-12 FR FR1033838D patent/FR1033838A/fr not_active Expired
- 1951-03-20 DE DEC3949A patent/DE914386C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE914386C (de) | 1954-07-01 |
| US2739260A (en) | 1956-03-20 |
| FR1033838A (fr) | 1953-07-16 |
| BE502013A (OSRAM) | |
| GB721199A (en) | 1955-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL69786C (nl) | Werkwijze ter bereiding van.... | |
| NL143273B (nl) | Werkwijze voor het bereiden van een antibioticum. | |
| FR1026247A (fr) | Châssis de véhicule perfectionné | |
| NL159107B (nl) | Werkwijze ter bereiding van penicilline- en cefalosporinederivaten onder toepassing van silylerende verbinding. | |
| NL165997B (nl) | Werkwijze voor de bereiding van kiezelzuurgel. | |
| NL143274B (nl) | Werkwijze voor het bereiden van antibiotica. | |
| NL142399B (nl) | Werkwijze voor het bereiden van dibenzocyclohepteenderivaten. | |
| NL162932B (nl) | Werkwijze voor het bereiden van entcopolymeren. | |
| NL163486B (nl) | Werkwijze voor het bereiden van fosgeen. | |
| NL160877C (nl) | Werkwijze voor het bereiden van antibiotica. | |
| FR910704A (fr) | Contre-pointe tournante perfectionnée | |
| NL153959B (nl) | Werkwijze ter bereiding van appreteermiddelen. | |
| CA471146A (en) | Penicillin derivatives | |
| FR1014109A (fr) | Moyeux perfectionnés pour cycles | |
| CA479659A (en) | Methods for preparing sodium penicillin | |
| CA428759A (en) | Lactoflavin purifying method | |
| FI26934A (fi) | Menetelmä nitrofenyyli-aminodioli-johdannaisten valmistamiseksi | |
| NL171579B (nl) | Werkwijze ter bereiding van alfa-benzylacrylonitrile derivaten. | |
| NL173646B (nl) | Werkwijze ter bereiding van een cefalosporinederivaat. | |
| CA433940A (en) | Synchronizing device for rotating bodies | |
| CA435635A (en) | Sulphurization process | |
| CA433626A (en) | Disease preventing method for poultry | |
| FI26637A (fi) | Menetelmä 3-substituoitujen 4-oksi-kumariinien valmistamiseksi | |
| CA439545A (en) | Filter for inspirators | |
| CA435082A (en) | Brooder |