NL150424B - Werkwijze voor het bereiden van p-nitrofenol, p-nitro o-kresol of p-nitro m-kresol. - Google Patents
Werkwijze voor het bereiden van p-nitrofenol, p-nitro o-kresol of p-nitro m-kresol.Info
- Publication number
- NL150424B NL150424B NL686807046A NL6807046A NL150424B NL 150424 B NL150424 B NL 150424B NL 686807046 A NL686807046 A NL 686807046A NL 6807046 A NL6807046 A NL 6807046A NL 150424 B NL150424 B NL 150424B
- Authority
- NL
- Netherlands
- Prior art keywords
- kresol
- nitro
- nitrophenol
- preparing
- Prior art date
Links
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63928367A | 1967-05-18 | 1967-05-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NL6807046A NL6807046A (cg-RX-API-DMAC10.html) | 1968-11-19 |
| NL150424B true NL150424B (nl) | 1976-08-16 |
Family
ID=24563480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL686807046A NL150424B (nl) | 1967-05-18 | 1968-05-17 | Werkwijze voor het bereiden van p-nitrofenol, p-nitro o-kresol of p-nitro m-kresol. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3510527A (cg-RX-API-DMAC10.html) |
| BE (1) | BE715376A (cg-RX-API-DMAC10.html) |
| CH (1) | CH495321A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1768499B2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK119506B (cg-RX-API-DMAC10.html) |
| FR (1) | FR1570947A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1247381A (cg-RX-API-DMAC10.html) |
| NL (1) | NL150424B (cg-RX-API-DMAC10.html) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3668261A (en) * | 1965-11-24 | 1972-06-06 | American Cyanamid Co | Nitration process for phenolic compounds |
| US3761527A (en) * | 1970-06-03 | 1973-09-25 | Kerr Mc Gee Corp | Process for oxidation of 4-nitroso-m-cresol |
| US3917719A (en) * | 1970-06-03 | 1975-11-04 | Kerr Mc Gee Chem Corp | Process for the preparation of 4-nitro-m-cresol |
| US3980717A (en) * | 1971-06-30 | 1976-09-14 | Hercules Incorporated | Manufacture of para-nitro-meta-cresol from meta/para-cresol mixtures |
| CA964674A (en) * | 1971-06-30 | 1975-03-18 | Hercules Incorporated | Manufacture of nitrophenols |
| US3894096A (en) * | 1971-12-07 | 1975-07-08 | American Cyanamid Co | Separation of para-nitrated phenolic compounds from crude reaction mixtures containing ortho-and para-nitrated phenolic compounds |
| FR2185063A5 (cg-RX-API-DMAC10.html) * | 1972-05-15 | 1973-12-28 | Rhone Poulenc Sa | |
| US3929864A (en) * | 1973-08-27 | 1975-12-30 | Hoechst Ag | Process for preparing 4-hydroxy-3-nitrobenzoic acid alkyl esters |
| SE7712088L (sv) * | 1977-10-27 | 1979-04-28 | Bofors Ab | Metod for framstellning av nitrofenoler |
| US4232175A (en) * | 1977-12-08 | 1980-11-04 | The Dow Chemical Company | Nitrosation of aromatic compounds |
| FR2705672B1 (fr) * | 1993-05-26 | 1995-07-21 | Rhone Poulenc Chimie | Procédé de préparation de nitrophénols. |
| CN119912338B (zh) * | 2025-01-23 | 2025-11-25 | 扬州大学 | 一种硝基苯酚的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3221062A (en) * | 1964-06-19 | 1965-11-30 | Oscar L Wright | Nitration process |
-
1967
- 1967-05-18 US US639283A patent/US3510527A/en not_active Expired - Lifetime
-
1968
- 1968-04-23 DK DK180668AA patent/DK119506B/da unknown
- 1968-05-03 GB GB21195/68A patent/GB1247381A/en not_active Expired
- 1968-05-17 NL NL686807046A patent/NL150424B/xx not_active IP Right Cessation
- 1968-05-17 BE BE715376D patent/BE715376A/xx unknown
- 1968-05-17 CH CH731568A patent/CH495321A/fr not_active IP Right Cessation
- 1968-05-17 DE DE19681768499 patent/DE1768499B2/de not_active Ceased
- 1968-05-17 FR FR1570947D patent/FR1570947A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1570947A (cg-RX-API-DMAC10.html) | 1969-06-13 |
| DK119506B (da) | 1971-01-18 |
| CH495321A (fr) | 1970-08-31 |
| BE715376A (cg-RX-API-DMAC10.html) | 1968-11-18 |
| NL6807046A (cg-RX-API-DMAC10.html) | 1968-11-19 |
| GB1247381A (en) | 1971-09-22 |
| US3510527A (en) | 1970-05-05 |
| DE1768499B2 (de) | 1973-06-20 |
| DE1768499A1 (de) | 1972-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL163565C (nl) | Werkwijze voor het bereiden van ferrovanadium. | |
| NL158548B (nl) | Werkwijze voor het bereiden van maltose. | |
| NL150424B (nl) | Werkwijze voor het bereiden van p-nitrofenol, p-nitro o-kresol of p-nitro m-kresol. | |
| NL145876B (nl) | Werkwijze voor het bereiden van polysiloxanalcoholen. | |
| NL167701C (nl) | Werkwijze voor het bereiden van tris-hydroxymethylfosfienoxide. | |
| NL148041B (nl) | Werkwijze voor het bereiden van 1-nitroantrachinon. | |
| NL167951C (nl) | Werkwijze voor het bereiden van 7-hydroxydihydrocitronellal. | |
| NL142183B (nl) | Werkwijze voor het bereiden van polyamide-imiden. | |
| NL159947C (nl) | Werkwijze voor het bereiden van 2-methyl-3-butenol-2. | |
| NL167435C (nl) | Werkwijze voor het bereiden van 3-formylrifamycine-sv. | |
| NL161739C (nl) | Werkwijze voor het bereiden van 4-fluor-3-nitro-aniline. | |
| NL166695C (nl) | Werkwijze voor het bereiden van 17alfa-geoxygeneerde-20- -ketosteroiden. | |
| NL143229B (nl) | Werkwijze voor het bereiden van therapeutisch werkzame benzodiazepinederivaten. | |
| NL144927B (nl) | Werkwijze voor de bereiding van ureum. | |
| NL159379B (nl) | Werkwijze voor het bereiden van bis-halogeencarbonylaminen. | |
| NL159370B (nl) | Werkwijze voor het bereiden van bis-urethanen. | |
| NL155813B (nl) | Werkwijze voor het bereiden van trichlooretheen. | |
| NL142169B (nl) | Werkwijze voor het verknopen van tercopolymeren. | |
| NL142333B (nl) | Werkwijze voor het bereiden van injecteerbare oplossingen van 3alfa-hydroxypregnaan-11,20-dion. | |
| NL160705C (nl) | Werkwijze voor het bereiden van ureum bevattend veevoeder. | |
| NL153574B (nl) | Werkwijze voor het bereiden van oplossingen van polyacyloxamidrazonen. | |
| NL143230B (nl) | Werkwijze voor het bereiden van 2-amino-1,4-benzodiazepinen. | |
| NL142594B (nl) | Werkwijze voor het bereiden van benzodiazepinederivaten. | |
| NL167394C (nl) | Werkwijze voor het bereiden van chloorcyaan. | |
| NL140567B (nl) | Werkwijze voor het bereiden van 6-aminopenicillanzuur. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| V1 | Lapsed because of non-payment of the annual fee | ||
| NL80 | Information provided on patent owner name for an already discontinued patent |
Owner name: HERCULES |