DK119506B - Fremgangsmåde til fremstilling af p-nitrophenol, som eventuelt i o-eller m-stillingen til hydroxylgruppen er substitueret med en methylgruppe. - Google Patents
Fremgangsmåde til fremstilling af p-nitrophenol, som eventuelt i o-eller m-stillingen til hydroxylgruppen er substitueret med en methylgruppe.Info
- Publication number
- DK119506B DK119506B DK180668AA DK180668A DK119506B DK 119506 B DK119506 B DK 119506B DK 180668A A DK180668A A DK 180668AA DK 180668 A DK180668 A DK 180668A DK 119506 B DK119506 B DK 119506B
- Authority
- DK
- Denmark
- Prior art keywords
- nitrophenol
- preparation
- optionally substituted
- hydroxyl group
- methyl group
- Prior art date
Links
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 title 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 title 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63928367A | 1967-05-18 | 1967-05-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK119506B true DK119506B (da) | 1971-01-18 |
Family
ID=24563480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK180668AA DK119506B (da) | 1967-05-18 | 1968-04-23 | Fremgangsmåde til fremstilling af p-nitrophenol, som eventuelt i o-eller m-stillingen til hydroxylgruppen er substitueret med en methylgruppe. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3510527A (cg-RX-API-DMAC10.html) |
| BE (1) | BE715376A (cg-RX-API-DMAC10.html) |
| CH (1) | CH495321A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1768499B2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK119506B (cg-RX-API-DMAC10.html) |
| FR (1) | FR1570947A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1247381A (cg-RX-API-DMAC10.html) |
| NL (1) | NL150424B (cg-RX-API-DMAC10.html) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3668261A (en) * | 1965-11-24 | 1972-06-06 | American Cyanamid Co | Nitration process for phenolic compounds |
| US3761527A (en) * | 1970-06-03 | 1973-09-25 | Kerr Mc Gee Corp | Process for oxidation of 4-nitroso-m-cresol |
| US3917719A (en) * | 1970-06-03 | 1975-11-04 | Kerr Mc Gee Chem Corp | Process for the preparation of 4-nitro-m-cresol |
| US3980717A (en) * | 1971-06-30 | 1976-09-14 | Hercules Incorporated | Manufacture of para-nitro-meta-cresol from meta/para-cresol mixtures |
| CA964674A (en) * | 1971-06-30 | 1975-03-18 | Hercules Incorporated | Manufacture of nitrophenols |
| US3894096A (en) * | 1971-12-07 | 1975-07-08 | American Cyanamid Co | Separation of para-nitrated phenolic compounds from crude reaction mixtures containing ortho-and para-nitrated phenolic compounds |
| FR2185063A5 (cg-RX-API-DMAC10.html) * | 1972-05-15 | 1973-12-28 | Rhone Poulenc Sa | |
| US3929864A (en) * | 1973-08-27 | 1975-12-30 | Hoechst Ag | Process for preparing 4-hydroxy-3-nitrobenzoic acid alkyl esters |
| SE7712088L (sv) * | 1977-10-27 | 1979-04-28 | Bofors Ab | Metod for framstellning av nitrofenoler |
| US4232175A (en) * | 1977-12-08 | 1980-11-04 | The Dow Chemical Company | Nitrosation of aromatic compounds |
| FR2705672B1 (fr) * | 1993-05-26 | 1995-07-21 | Rhone Poulenc Chimie | Procédé de préparation de nitrophénols. |
| CN119912338B (zh) * | 2025-01-23 | 2025-11-25 | 扬州大学 | 一种硝基苯酚的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3221062A (en) * | 1964-06-19 | 1965-11-30 | Oscar L Wright | Nitration process |
-
1967
- 1967-05-18 US US639283A patent/US3510527A/en not_active Expired - Lifetime
-
1968
- 1968-04-23 DK DK180668AA patent/DK119506B/da unknown
- 1968-05-03 GB GB21195/68A patent/GB1247381A/en not_active Expired
- 1968-05-17 NL NL686807046A patent/NL150424B/xx not_active IP Right Cessation
- 1968-05-17 BE BE715376D patent/BE715376A/xx unknown
- 1968-05-17 CH CH731568A patent/CH495321A/fr not_active IP Right Cessation
- 1968-05-17 DE DE19681768499 patent/DE1768499B2/de not_active Ceased
- 1968-05-17 FR FR1570947D patent/FR1570947A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1570947A (cg-RX-API-DMAC10.html) | 1969-06-13 |
| CH495321A (fr) | 1970-08-31 |
| BE715376A (cg-RX-API-DMAC10.html) | 1968-11-18 |
| NL6807046A (cg-RX-API-DMAC10.html) | 1968-11-19 |
| GB1247381A (en) | 1971-09-22 |
| US3510527A (en) | 1970-05-05 |
| NL150424B (nl) | 1976-08-16 |
| DE1768499B2 (de) | 1973-06-20 |
| DE1768499A1 (de) | 1972-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK122222B (da) | Fremgangsmåde til fremstilling af alk-3-en-1-oler. | |
| DK119506B (da) | Fremgangsmåde til fremstilling af p-nitrophenol, som eventuelt i o-eller m-stillingen til hydroxylgruppen er substitueret med en methylgruppe. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK127581B (da) | Fremgangsmåde til fremstilling af en palladiumkatalysator. | |
| DK118301B (da) | Fremgangsmåde til fremstilling af antitussive præparater, som indeholder dextromethorphan eller et salt deraf. | |
| DK131936B (da) | Analogifremgangsmåde til fremstilling af 5-phenyl-1H-1,5-benzodiazepin-2,4-dioner. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK120598B (da) | Analogifremgangsmåde til fremstilling af furazanderivater. | |
| DK119559B (da) | Analogifremgangsmåde til fremstilling af 4-pyrimidyl-1,4-dihydropyridinderivater. | |
| DK135287B (da) | Analogifremgangsmåde til fremstilling af styrylthiazoliumsalte. | |
| DK119166B (da) | Fremgangsmåde til fremstilling af 1,4-bezodiazepinderivater. | |
| DK128811B (da) | Analogifremgangsmåde til fremstilling af 14α,17α-methylendioxypregnanderivater. | |
| DK125285B (da) | Analogifremgangsmåde til fremstilling af furazanderivater. | |
| DK119609B (da) | Analogifremgangsmåde til fremstilling af 2α,2β, 17α-trimethyl-13β-alkylgona-4,9,11-trien-17β-oler. | |
| DK135630B (da) | 4-oxasteroider til anvendelse som mellemprodukter til fremstilling af 4,5-seco-3,5-diketosteroider samt fremgangsmåde til fremstilling af de nævnte 4-oxasteroider. | |
| DK118291B (da) | Analogifremgangsmåde til fremstilling af 10α-alkoxy-9,10-dihydroergolinderivater. | |
| DK124205B (da) | Analogifremgangsmåde til fremstilling af 6-klor-4-metylamino-1H-2,3-benzoxazin. | |
| DK115116B (da) | Fremgangsmåde til fremstilling af 5H-dibenzo [a,d] cyclohepten-derivater. | |
| DK124882B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-11β-methyl-19-norpregn-4-en-3,20-dioner. | |
| DK126112B (da) | Analogifremgangsmåde til fremstilling af 22-amino-23,24-dinorkolanderivater eller salte deraf. | |
| DK120994B (da) | Analogifremgangsmåde til fremstilling af N,N-dimethylaminoætyl-14β-hydroksy-5β-pregn-20-en-21-karboksylater. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK119654B (da) | Fremgangsmåde til fremstilling af formaldehydopløsninger. |