MY7100115A - Prostanoic acid derivatives - Google Patents
Prostanoic acid derivativesInfo
- Publication number
- MY7100115A MY7100115A MY7100115A MY7100115A MY7100115A MY 7100115 A MY7100115 A MY 7100115A MY 7100115 A MY7100115 A MY 7100115A MY 7100115 A MY7100115 A MY 7100115A MY 7100115 A MY7100115 A MY 7100115A
- Authority
- MY
- Malaysia
- Prior art keywords
- acid derivatives
- prostanoic acid
- prostanoic
- derivatives
- acid
- Prior art date
Links
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Steroid Compounds (AREA)
- Insertion, Bundling And Securing Of Wires For Electric Apparatuses (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US48010765A | 1965-08-16 | 1965-08-16 | |
| US52087666A | 1966-01-17 | 1966-01-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY7100115A true MY7100115A (en) | 1971-12-31 |
Family
ID=27046471
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MY7100115A MY7100115A (en) | 1965-08-16 | 1971-12-31 | Prostanoic acid derivatives |
Country Status (12)
| Country | Link |
|---|---|
| BE (1) | BE685516A (en:Method) |
| BR (1) | BR6681957D0 (en:Method) |
| CH (2) | CH479522A (en:Method) |
| DE (1) | DE1593644B2 (en:Method) |
| FI (1) | FI49712C (en:Method) |
| FR (2) | FR6017M (en:Method) |
| GB (1) | GB1097533A (en:Method) |
| IL (1) | IL26275A (en:Method) |
| MY (1) | MY7100115A (en:Method) |
| NL (3) | NL6611478A (en:Method) |
| NO (1) | NO123281B (en:Method) |
| SE (2) | SE350253B (en:Method) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3671570A (en) * | 1970-07-30 | 1972-06-20 | Ayerst Mckenna & Harrison | Derivatives of 9-oxo-15-hydroxyprostanoic acid, homologs thereof and their preparation |
-
1966
- 1966-07-19 GB GB3233866A patent/GB1097533A/en not_active Expired
- 1966-07-22 CH CH430469A patent/CH479522A/de not_active IP Right Cessation
- 1966-07-22 CH CH1065166A patent/CH475936A/de not_active IP Right Cessation
- 1966-08-05 IL IL2627566A patent/IL26275A/xx unknown
- 1966-08-08 BR BR18195766A patent/BR6681957D0/pt unknown
- 1966-08-09 DE DE19661593644 patent/DE1593644B2/de active Granted
- 1966-08-15 SE SE1102766A patent/SE350253B/xx unknown
- 1966-08-15 NO NO16430266A patent/NO123281B/no unknown
- 1966-08-15 SE SE1154170A patent/SE369597B/xx unknown
- 1966-08-16 NL NL6611478A patent/NL6611478A/xx unknown
- 1966-08-16 FI FI214166A patent/FI49712C/fi active
- 1966-08-16 BE BE685516D patent/BE685516A/xx unknown
- 1966-11-10 FR FR83373A patent/FR6017M/fr not_active Expired
- 1966-11-10 FR FR83374A patent/FR6042M/fr not_active Expired
-
1971
- 1971-12-31 MY MY7100115A patent/MY7100115A/xx unknown
-
1977
- 1977-03-16 NL NL7702819A patent/NL7702819A/xx not_active Application Discontinuation
- 1977-03-16 NL NL7702818A patent/NL7702818A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE1593644C3 (en:Method) | 1974-03-14 |
| BR6681957D0 (pt) | 1973-10-25 |
| GB1097533A (en) | 1968-01-03 |
| FI49712B (en:Method) | 1975-06-02 |
| FR6017M (en:Method) | 1968-05-06 |
| DE1593644A1 (de) | 1972-07-27 |
| NO123281B (en:Method) | 1971-10-25 |
| DE1793690A1 (de) | 1972-10-26 |
| NL7702819A (nl) | 1977-06-30 |
| BE685516A (en:Method) | 1967-02-16 |
| SE350253B (en:Method) | 1972-10-23 |
| CH479522A (de) | 1969-10-15 |
| CH475936A (de) | 1969-07-31 |
| DE1793690B2 (de) | 1976-04-22 |
| NL6611478A (en:Method) | 1967-02-17 |
| IL26275A (en) | 1970-08-19 |
| NL7702818A (nl) | 1977-06-30 |
| FR6042M (en:Method) | 1968-05-20 |
| DE1593644B2 (de) | 1973-08-09 |
| SE369597B (en:Method) | 1974-09-09 |
| FI49712C (fi) | 1975-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CY697A (en) | New sulphamyl-benzoic acid derivatives | |
| IE32535L (en) | 4-aryl-3-hydroxybutyric acid derivatives | |
| IL26361A (en) | Dibenzothiepine derivatives | |
| IL31264A (en) | 12-halo-berbine derivatives | |
| MY7100223A (en) | Isoquinolinobenzodiazepine derivatives | |
| IE33874B1 (en) | New sulphamyl-benzoic acid derivatives | |
| IL23888A (en) | Aminoacyl-cytosamine derivatives | |
| MY7000053A (en) | Phentiazine derivatives | |
| MY7100115A (en) | Prostanoic acid derivatives | |
| IL26067A (en) | Derivatives of prostanoic acid | |
| IE29364L (en) | Fluorene-9-carboxylic acid derivatives | |
| IL32222A0 (en) | Prostanoic acid derivatives | |
| CA718431A (en) | 2-allyloxy-benzoic acid derivatives | |
| AU294165B2 (en) | Acid derivatives | |
| AU401754B2 (en) | Derivatives of prostanoic acid | |
| IE28942L (en) | Trans - 4 - aminomethylcyclohexane - 1 - carboxylic acid | |
| IE28863L (en) | Cinnamic acid derivatives | |
| IE29080L (en) | Arylhydroxybutyric acid derivatives. | |
| IE30146L (en) | N-phenylamino acid derivatives | |
| AU432290B2 (en) | Prostanoic acid derivatives | |
| IE28004L (en) | 7-aminocephalsporanic acid derivatives | |
| IE27252L (en) | Adamantylthio-carboxylic acid derivatives | |
| CA705898A (en) | Phenylbenzoylmethyleneiminobenzoic acid | |
| CA714586A (en) | 3-hydroxy-3-biphenylylheptanoic acid | |
| CA721317A (en) | Cyclododecanecarboxylic acid |