MD666G2 - Strong drink like brandy - Google Patents
Strong drink like brandyInfo
- Publication number
- MD666G2 MD666G2 MD96-0074A MD960074A MD666G2 MD 666 G2 MD666 G2 MD 666G2 MD 960074 A MD960074 A MD 960074A MD 666 G2 MD666 G2 MD 666G2
- Authority
- MD
- Moldova
- Prior art keywords
- brandy
- drink
- strong drink
- ethyl alcohol
- strong
- Prior art date
Links
- 235000013532 brandy Nutrition 0.000 title abstract 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 abstract 3
- 235000019441 ethanol Nutrition 0.000 abstract 2
- 235000009754 Vitis X bourquina Nutrition 0.000 abstract 1
- 235000012333 Vitis X labruscana Nutrition 0.000 abstract 1
- 240000006365 Vitis vinifera Species 0.000 abstract 1
- 235000014787 Vitis vinifera Nutrition 0.000 abstract 1
- 230000001476 alcoholic effect Effects 0.000 abstract 1
- 239000003205 fragrance Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 235000020374 simple syrup Nutrition 0.000 abstract 1
Landscapes
- Alcoholic Beverages (AREA)
Abstract
The invention relates to the alcoholic beverade industry, especially, to one of the strong drink's compositions like brandy.The strong drink comprises (in %) wine distillate old matured for 2-3 years, a/a -20,0-30,0, rectified ethyl alcohol or grape rectified ethyl alcohol, a,a - 70,0-80,0, oak extract, a/a - 3,0-5,0, sugar syrup, kg - 1,0-1,4, caramelized sugar, kg - 0,1-0,4, citric acid, kg - 0,29-0,31, softened water-the rest of.The technical result of the invention consists in creation of a new drink with a harmonions taste and fragrance.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| MD96-0074A MD666G2 (en) | 1996-02-05 | 1996-02-05 | Strong drink like brandy |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| MD96-0074A MD666G2 (en) | 1996-02-05 | 1996-02-05 | Strong drink like brandy |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| MD666F1 MD666F1 (en) | 1997-01-31 |
| MD666G2 true MD666G2 (en) | 1997-08-31 |
Family
ID=19738821
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MD96-0074A MD666G2 (en) | 1996-02-05 | 1996-02-05 | Strong drink like brandy |
Country Status (1)
| Country | Link |
|---|---|
| MD (1) | MD666G2 (en) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MD2039G2 (en) * | 2002-01-17 | 2003-05-31 | ОДАДЖИУ Штефан | Brandy strong drink |
| MD2242G2 (en) * | 2001-11-29 | 2004-02-29 | ОДАДЖИУ Штефан | Brandy |
| MD2038G2 (en) * | 2001-07-25 | 2004-12-31 | Серджиу БАБИЙ | Brandy-type drink |
| MD3127G2 (en) * | 2005-10-31 | 2007-07-31 | Национальный Институт Виноградарства И Винификации | Brandy |
| MD3432C2 (en) * | 2005-10-31 | 2008-06-30 | Национальный Институт Виноградарства И Винификации | Alcoholic brandy-type drink |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MD1619G2 (en) * | 2000-03-28 | 2001-08-31 | Серджиу БАБИЙ | Special vodka |
| MD2337C2 (en) * | 2001-03-01 | 2004-06-30 | Николае БОГАТЫЙ | Grape brandy |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BG32643A1 (en) * | 1981-02-09 | 1982-09-15 | Khadzhijjski | Method for production of natural higalcool drink <brandy> |
| SU1590478A1 (en) * | 1988-12-16 | 1990-09-07 | Комбинат Сувенирных Изделий | Method of producing brandy |
| MD145C2 (en) * | 1994-01-25 | 1995-09-30 | Duca Boris | Beverage of brandy-tipe "Botna" |
-
1996
- 1996-02-05 MD MD96-0074A patent/MD666G2/en not_active IP Right Cessation
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BG32643A1 (en) * | 1981-02-09 | 1982-09-15 | Khadzhijjski | Method for production of natural higalcool drink <brandy> |
| SU1590478A1 (en) * | 1988-12-16 | 1990-09-07 | Комбинат Сувенирных Изделий | Method of producing brandy |
| MD145C2 (en) * | 1994-01-25 | 1995-09-30 | Duca Boris | Beverage of brandy-tipe "Botna" |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MD2038G2 (en) * | 2001-07-25 | 2004-12-31 | Серджиу БАБИЙ | Brandy-type drink |
| MD2242G2 (en) * | 2001-11-29 | 2004-02-29 | ОДАДЖИУ Штефан | Brandy |
| MD2039G2 (en) * | 2002-01-17 | 2003-05-31 | ОДАДЖИУ Штефан | Brandy strong drink |
| MD3127G2 (en) * | 2005-10-31 | 2007-07-31 | Национальный Институт Виноградарства И Винификации | Brandy |
| MD3432C2 (en) * | 2005-10-31 | 2008-06-30 | Национальный Институт Виноградарства И Винификации | Alcoholic brandy-type drink |
Also Published As
| Publication number | Publication date |
|---|---|
| MD666F1 (en) | 1997-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MD666G2 (en) | Strong drink like brandy | |
| MD667G2 (en) | Vodka (variants) | |
| MD162G2 (en) | Strong drink "Rachiu Chirsova" | |
| MD145C2 (en) | Beverage of brandy-tipe "Botna" | |
| MD1494F1 (en) | Grape brandy | |
| MD1510G2 (en) | Process for production of mature alcoholic drink of brandy type | |
| UA49928C2 (en) | Special vodka | |
| UA29313A (en) | Composition of ingredients for “stremska krynytsia” vodka | |
| UA29340A (en) | “starka panska” bitter liqueur | |
| UA30020C2 (en) | “kozatska zabava” (cossacks amusement), special vodka | |
| MD1703G2 (en) | Special vodca | |
| MD1864F1 (en) | Liqueur | |
| MD2337C2 (en) | Grape brandy | |
| UA20161C2 (en) | "kryzhana" special vodka | |
| MD1619F1 (en) | Special vodka | |
| MD2038G2 (en) | Brandy-type drink | |
| UA50732C2 (en) | Liqueur bitters | |
| UA38351A (en) | "grand 2000" vodka | |
| UA31534A (en) | A bitter liqueur “lypova aromatna” | |
| UA29198A (en) | “rosiiska” vodka | |
| UA33008A (en) | The liqueur drink “viski deisi” | |
| UA18273C2 (en) | Ingredients composition for “chumatska” special vodka | |
| ES2169674A1 (en) | Composition for production of an alcoholic drink consists of drink alcohol blended with distilled water white sugar and lemon rind | |
| UA28239A (en) | A method for preparing of alcoholic beverages | |
| UA29205A (en) | “volodymyr velykyi” special vodka |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG3A | Granted patent for invention | ||
| IF99 | Valid patent on 19990615 |
Free format text: EXPIRES: 20160205 |
|
| KA4A | Patent for invention lapsed due to non-payment of fees (with right of restoration) | ||
| MM4A | Patent for invention definitely lapsed due to non-payment of fees |