KR20210132110A - 양수 세포-유래 ecm 상에서 심근세포 성숙을 위한 방법, 세포 구조, 및 약물 화합물의 심장 독성 및 전부정맥 스크리닝을 위한 용도 - Google Patents
양수 세포-유래 ecm 상에서 심근세포 성숙을 위한 방법, 세포 구조, 및 약물 화합물의 심장 독성 및 전부정맥 스크리닝을 위한 용도 Download PDFInfo
- Publication number
- KR20210132110A KR20210132110A KR1020217030159A KR20217030159A KR20210132110A KR 20210132110 A KR20210132110 A KR 20210132110A KR 1020217030159 A KR1020217030159 A KR 1020217030159A KR 20217030159 A KR20217030159 A KR 20217030159A KR 20210132110 A KR20210132110 A KR 20210132110A
- Authority
- KR
- South Korea
- Prior art keywords
- kda
- ecm
- homo sapiens
- afc
- cardiomyocytes
- Prior art date
Links
- 210000004027 cell Anatomy 0.000 title claims abstract description 346
- 210000004413 cardiac myocyte Anatomy 0.000 title claims abstract description 244
- 238000000034 method Methods 0.000 title claims abstract description 115
- 210000004381 amniotic fluid Anatomy 0.000 title claims abstract description 72
- 239000003814 drug Substances 0.000 title claims abstract description 60
- 229940079593 drug Drugs 0.000 title claims abstract description 59
- 150000001875 compounds Chemical class 0.000 title claims abstract description 39
- 230000035800 maturation Effects 0.000 title claims abstract description 31
- 206010048610 Cardiotoxicity Diseases 0.000 title claims abstract description 23
- 231100000259 cardiotoxicity Toxicity 0.000 title claims abstract description 23
- 230000007681 cardiovascular toxicity Effects 0.000 title abstract description 14
- 210000003462 vein Anatomy 0.000 title abstract description 11
- 238000012216 screening Methods 0.000 title description 6
- 241000282414 Homo sapiens Species 0.000 claims abstract description 343
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 claims abstract description 144
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 claims abstract description 144
- 210000002744 extracellular matrix Anatomy 0.000 claims abstract description 144
- 238000000338 in vitro Methods 0.000 claims abstract description 51
- 210000004263 induced pluripotent stem cell Anatomy 0.000 claims abstract description 46
- 239000002356 single layer Substances 0.000 claims abstract description 42
- 230000000694 effects Effects 0.000 claims abstract description 31
- 210000003850 cellular structure Anatomy 0.000 claims abstract description 26
- 108010029485 Protein Isoforms Proteins 0.000 claims description 151
- 102000001708 Protein Isoforms Human genes 0.000 claims description 151
- 239000000758 substrate Substances 0.000 claims description 40
- 210000002235 sarcomere Anatomy 0.000 claims description 35
- 238000012258 culturing Methods 0.000 claims description 25
- 230000008859 change Effects 0.000 claims description 23
- 230000036982 action potential Effects 0.000 claims description 21
- 239000001963 growth medium Substances 0.000 claims description 21
- 206010003119 arrhythmia Diseases 0.000 claims description 20
- 210000005003 heart tissue Anatomy 0.000 claims description 20
- 230000006793 arrhythmia Effects 0.000 claims description 16
- 102000008186 Collagen Human genes 0.000 claims description 14
- 108010035532 Collagen Proteins 0.000 claims description 14
- 231100000457 cardiotoxic Toxicity 0.000 claims description 14
- 230000001451 cardiotoxic effect Effects 0.000 claims description 14
- 229920001436 collagen Polymers 0.000 claims description 14
- 102100040026 Agrin Human genes 0.000 claims description 12
- 101000944277 Homo sapiens Inward rectifier potassium channel 2 Proteins 0.000 claims description 12
- 101150079978 AGRN gene Proteins 0.000 claims description 11
- 108700019743 Agrin Proteins 0.000 claims description 11
- 230000028161 membrane depolarization Effects 0.000 claims description 11
- 108010001463 Collagen Type XVIII Proteins 0.000 claims description 10
- 102000047200 Collagen Type XVIII Human genes 0.000 claims description 10
- 108010067306 Fibronectins Proteins 0.000 claims description 9
- 230000003111 delayed effect Effects 0.000 claims description 8
- 102100036597 Basement membrane-specific heparan sulfate proteoglycan core protein Human genes 0.000 claims description 7
- 108010085895 Laminin Proteins 0.000 claims description 7
- 102100035071 Vimentin Human genes 0.000 claims description 7
- 210000002469 basement membrane Anatomy 0.000 claims description 7
- 108010038082 heparin proteoglycan Proteins 0.000 claims description 7
- 238000007747 plating Methods 0.000 claims description 7
- 101710132601 Capsid protein Proteins 0.000 claims description 6
- 108010065472 Vimentin Proteins 0.000 claims description 6
- 210000005048 vimentin Anatomy 0.000 claims description 6
- 102000004237 Decorin Human genes 0.000 claims description 5
- 108090000738 Decorin Proteins 0.000 claims description 5
- 239000000835 fiber Substances 0.000 claims description 5
- 108010049224 perlecan Proteins 0.000 claims description 4
- 230000001536 pro-arrhythmogenic effect Effects 0.000 claims description 3
- 102000016359 Fibronectins Human genes 0.000 claims 1
- 238000007423 screening assay Methods 0.000 abstract description 5
- 101000598921 Homo sapiens Orexin Proteins 0.000 description 943
- 108090000623 proteins and genes Proteins 0.000 description 89
- 102000004169 proteins and genes Human genes 0.000 description 87
- 235000018102 proteins Nutrition 0.000 description 84
- 241000283690 Bos taurus Species 0.000 description 36
- 210000001778 pluripotent stem cell Anatomy 0.000 description 29
- 210000000130 stem cell Anatomy 0.000 description 29
- 230000002438 mitochondrial effect Effects 0.000 description 27
- 239000002609 medium Substances 0.000 description 25
- 210000001519 tissue Anatomy 0.000 description 25
- 239000011159 matrix material Substances 0.000 description 24
- 239000000203 mixture Substances 0.000 description 24
- 238000004113 cell culture Methods 0.000 description 20
- 238000010899 nucleation Methods 0.000 description 20
- 210000004940 nucleus Anatomy 0.000 description 20
- 210000004292 cytoskeleton Anatomy 0.000 description 19
- 102000004389 Ribonucleoproteins Human genes 0.000 description 17
- 108010081734 Ribonucleoproteins Proteins 0.000 description 17
- 239000012634 fragment Substances 0.000 description 17
- 210000003470 mitochondria Anatomy 0.000 description 17
- 102000016914 ras Proteins Human genes 0.000 description 17
- 108010014186 ras Proteins Proteins 0.000 description 17
- 108091005975 Myofilaments Proteins 0.000 description 14
- 208000018452 Torsade de pointes Diseases 0.000 description 14
- 208000002363 Torsades de Pointes Diseases 0.000 description 14
- 210000002798 bone marrow cell Anatomy 0.000 description 14
- 230000000747 cardiac effect Effects 0.000 description 14
- 210000003632 microfilament Anatomy 0.000 description 14
- 102100037362 Fibronectin Human genes 0.000 description 13
- 210000002901 mesenchymal stem cell Anatomy 0.000 description 13
- 238000001000 micrograph Methods 0.000 description 13
- 239000002243 precursor Substances 0.000 description 13
- 230000000670 limiting effect Effects 0.000 description 12
- 230000008569 process Effects 0.000 description 12
- 108010085238 Actins Proteins 0.000 description 11
- 102000007469 Actins Human genes 0.000 description 11
- 238000013459 approach Methods 0.000 description 10
- 239000004205 dimethyl polysiloxane Substances 0.000 description 10
- 230000009984 peri-natal effect Effects 0.000 description 10
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 10
- 210000003954 umbilical cord Anatomy 0.000 description 9
- 102000018472 Type I Keratins Human genes 0.000 description 8
- 108010091525 Type I Keratins Proteins 0.000 description 8
- 108010089374 Type II Keratins Proteins 0.000 description 8
- 102000007962 Type II Keratins Human genes 0.000 description 8
- 210000001671 embryonic stem cell Anatomy 0.000 description 8
- 230000006870 function Effects 0.000 description 8
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 8
- 230000035755 proliferation Effects 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 210000001691 amnion Anatomy 0.000 description 7
- 210000001185 bone marrow Anatomy 0.000 description 7
- 230000018109 developmental process Effects 0.000 description 7
- 230000009977 dual effect Effects 0.000 description 7
- 238000003125 immunofluorescent labeling Methods 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 210000004379 membrane Anatomy 0.000 description 7
- 239000012528 membrane Substances 0.000 description 7
- 230000006911 nucleation Effects 0.000 description 7
- 210000005059 placental tissue Anatomy 0.000 description 7
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 6
- FWBHETKCLVMNFS-UHFFFAOYSA-N 4',6-Diamino-2-phenylindol Chemical compound C1=CC(C(=N)N)=CC=C1C1=CC2=CC=C(C(N)=N)C=C2N1 FWBHETKCLVMNFS-UHFFFAOYSA-N 0.000 description 6
- TVEXGJYMHHTVKP-UHFFFAOYSA-N 6-oxabicyclo[3.2.1]oct-3-en-7-one Chemical compound C1C2C(=O)OC1C=CC2 TVEXGJYMHHTVKP-UHFFFAOYSA-N 0.000 description 6
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
- 108010042283 HSP40 Heat-Shock Proteins Proteins 0.000 description 6
- 102000004447 HSP40 Heat-Shock Proteins Human genes 0.000 description 6
- 206010049447 Tachyarrhythmia Diseases 0.000 description 6
- 208000001871 Tachycardia Diseases 0.000 description 6
- 210000000988 bone and bone Anatomy 0.000 description 6
- 230000001413 cellular effect Effects 0.000 description 6
- 238000011161 development Methods 0.000 description 6
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 6
- 210000001654 germ layer Anatomy 0.000 description 6
- 230000012010 growth Effects 0.000 description 6
- 210000003205 muscle Anatomy 0.000 description 6
- 239000002953 phosphate buffered saline Substances 0.000 description 6
- 230000002062 proliferating effect Effects 0.000 description 6
- 238000012800 visualization Methods 0.000 description 6
- 102000014914 Carrier Proteins Human genes 0.000 description 5
- 102100033632 Tropomyosin alpha-1 chain Human genes 0.000 description 5
- 102100036859 Troponin I, cardiac muscle Human genes 0.000 description 5
- 101710128251 Troponin I, cardiac muscle Proteins 0.000 description 5
- 108091008324 binding proteins Proteins 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 210000001136 chorion Anatomy 0.000 description 5
- 229940000406 drug candidate Drugs 0.000 description 5
- 238000002001 electrophysiology Methods 0.000 description 5
- 230000007831 electrophysiology Effects 0.000 description 5
- 210000004700 fetal blood Anatomy 0.000 description 5
- 230000006698 induction Effects 0.000 description 5
- 235000015110 jellies Nutrition 0.000 description 5
- 239000008274 jelly Substances 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 230000001105 regulatory effect Effects 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 102100024113 40S ribosomal protein S15a Human genes 0.000 description 4
- 102100027271 40S ribosomal protein SA Human genes 0.000 description 4
- 102100023247 60S ribosomal protein L23a Human genes 0.000 description 4
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- 102100029398 Calpain small subunit 1 Human genes 0.000 description 4
- 102100037579 D-3-phosphoglycerate dehydrogenase Human genes 0.000 description 4
- 108700041152 Endoplasmic Reticulum Chaperone BiP Proteins 0.000 description 4
- 102100021451 Endoplasmic reticulum chaperone BiP Human genes 0.000 description 4
- 102100037115 Eukaryotic translation initiation factor 3 subunit H Human genes 0.000 description 4
- 102000051366 Glycosyltransferases Human genes 0.000 description 4
- 108700023372 Glycosyltransferases Proteins 0.000 description 4
- 101000702560 Homo sapiens Probable global transcription activator SNF2L1 Proteins 0.000 description 4
- 108010050332 IQ motif containing GTPase activating protein 1 Proteins 0.000 description 4
- 102000004877 Insulin Human genes 0.000 description 4
- 108090001061 Insulin Proteins 0.000 description 4
- 102100039060 Interleukin enhancer-binding factor 2 Human genes 0.000 description 4
- 102100026639 MICOS complex subunit MIC60 Human genes 0.000 description 4
- 102000003505 Myosin Human genes 0.000 description 4
- 108060008487 Myosin Proteins 0.000 description 4
- 102100031031 Probable global transcription activator SNF2L1 Human genes 0.000 description 4
- 102100034419 Ras GTPase-activating-like protein IQGAP1 Human genes 0.000 description 4
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 4
- 102100038410 T-complex protein 1 subunit alpha Human genes 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 230000003915 cell function Effects 0.000 description 4
- 230000035606 childbirth Effects 0.000 description 4
- 210000000349 chromosome Anatomy 0.000 description 4
- 230000001086 cytosolic effect Effects 0.000 description 4
- 230000004069 differentiation Effects 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 239000011536 extraction buffer Substances 0.000 description 4
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 4
- 229940125396 insulin Drugs 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 210000004962 mammalian cell Anatomy 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229920001184 polypeptide Polymers 0.000 description 4
- 108090000765 processed proteins & peptides Proteins 0.000 description 4
- 102000004196 processed proteins & peptides Human genes 0.000 description 4
- 239000002966 varnish Substances 0.000 description 4
- 102100032303 26S proteasome non-ATPase regulatory subunit 2 Human genes 0.000 description 3
- 102100033828 26S proteasome regulatory subunit 10B Human genes 0.000 description 3
- 102100029510 26S proteasome regulatory subunit 6A Human genes 0.000 description 3
- 102100039769 39S ribosomal protein L28, mitochondrial Human genes 0.000 description 3
- 102100035322 60S ribosomal protein L24 Human genes 0.000 description 3
- 108010077544 Chromatin Proteins 0.000 description 3
- 102100040002 Eukaryotic translation initiation factor 6 Human genes 0.000 description 3
- 108060003393 Granulin Proteins 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 101000572820 Homo sapiens MICOS complex subunit MIC60 Proteins 0.000 description 3
- 101000801701 Homo sapiens Tropomyosin alpha-1 chain Proteins 0.000 description 3
- 102000004310 Ion Channels Human genes 0.000 description 3
- 108090000862 Ion Channels Proteins 0.000 description 3
- 102000011782 Keratins Human genes 0.000 description 3
- 108010076876 Keratins Proteins 0.000 description 3
- 239000002211 L-ascorbic acid Substances 0.000 description 3
- 235000000069 L-ascorbic acid Nutrition 0.000 description 3
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 3
- 229930182816 L-glutamine Natural products 0.000 description 3
- 102000007999 Nuclear Proteins Human genes 0.000 description 3
- 108010089610 Nuclear Proteins Proteins 0.000 description 3
- 102100037765 Periostin Human genes 0.000 description 3
- 102100030655 Platelet-activating factor acetylhydrolase IB subunit beta Human genes 0.000 description 3
- 102100026126 Proline-tRNA ligase Human genes 0.000 description 3
- 102100022985 Protein arginine N-methyltransferase 1 Human genes 0.000 description 3
- 108010009460 RNA Polymerase II Proteins 0.000 description 3
- 102000009572 RNA Polymerase II Human genes 0.000 description 3
- 102100038685 Small nuclear ribonucleoprotein Sm D2 Human genes 0.000 description 3
- 102100033080 Tropomyosin alpha-3 chain Human genes 0.000 description 3
- 102100025225 Tubulin beta-2A chain Human genes 0.000 description 3
- 102100034298 Tyrosine-tRNA ligase, cytoplasmic Human genes 0.000 description 3
- 102100035820 Unconventional myosin-Ie Human genes 0.000 description 3
- 230000002763 arrhythmic effect Effects 0.000 description 3
- 229960005070 ascorbic acid Drugs 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 230000008436 biogenesis Effects 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 230000021164 cell adhesion Effects 0.000 description 3
- 238000012832 cell culture technique Methods 0.000 description 3
- 230000003833 cell viability Effects 0.000 description 3
- 210000003483 chromatin Anatomy 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 210000003981 ectoderm Anatomy 0.000 description 3
- 210000001900 endoderm Anatomy 0.000 description 3
- 210000003743 erythrocyte Anatomy 0.000 description 3
- 239000012091 fetal bovine serum Substances 0.000 description 3
- 102000006602 glyceraldehyde-3-phosphate dehydrogenase Human genes 0.000 description 3
- 108020004445 glyceraldehyde-3-phosphate dehydrogenase Proteins 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 210000003716 mesoderm Anatomy 0.000 description 3
- 230000003278 mimic effect Effects 0.000 description 3
- 239000007758 minimum essential medium Substances 0.000 description 3
- 239000002547 new drug Substances 0.000 description 3
- -1 polydimethylsiloxane Polymers 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- 230000008439 repair process Effects 0.000 description 3
- 210000003705 ribosome Anatomy 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 230000002269 spontaneous effect Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 102100038028 1-phosphatidylinositol 3-phosphate 5-kinase Human genes 0.000 description 2
- 102100030388 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-3 Human genes 0.000 description 2
- 102100024341 10 kDa heat shock protein, mitochondrial Human genes 0.000 description 2
- 102100025007 14-3-3 protein epsilon Human genes 0.000 description 2
- 102100024682 14-3-3 protein eta Human genes 0.000 description 2
- 102100027832 14-3-3 protein gamma Human genes 0.000 description 2
- 102100027831 14-3-3 protein theta Human genes 0.000 description 2
- 102100040685 14-3-3 protein zeta/delta Human genes 0.000 description 2
- 102100026936 2-oxoglutarate dehydrogenase, mitochondrial Human genes 0.000 description 2
- 102100040973 26S proteasome non-ATPase regulatory subunit 1 Human genes 0.000 description 2
- 102100040961 26S proteasome non-ATPase regulatory subunit 12 Human genes 0.000 description 2
- 102100040962 26S proteasome non-ATPase regulatory subunit 13 Human genes 0.000 description 2
- 102100032282 26S proteasome non-ATPase regulatory subunit 14 Human genes 0.000 description 2
- 102100032301 26S proteasome non-ATPase regulatory subunit 3 Human genes 0.000 description 2
- 102100033453 26S proteasome non-ATPase regulatory subunit 5 Human genes 0.000 description 2
- 102100036657 26S proteasome non-ATPase regulatory subunit 7 Human genes 0.000 description 2
- 102100036652 26S proteasome non-ATPase regulatory subunit 8 Human genes 0.000 description 2
- 102100022644 26S proteasome regulatory subunit 4 Human genes 0.000 description 2
- 102100029511 26S proteasome regulatory subunit 6B Human genes 0.000 description 2
- 102100034682 26S proteasome regulatory subunit 7 Human genes 0.000 description 2
- 102100036563 26S proteasome regulatory subunit 8 Human genes 0.000 description 2
- 102100024385 28S ribosomal protein S35, mitochondrial Human genes 0.000 description 2
- 102100029103 3-ketoacyl-CoA thiolase Human genes 0.000 description 2
- 102100026105 3-ketoacyl-CoA thiolase, mitochondrial Human genes 0.000 description 2
- 102100020966 39S ribosomal protein L11, mitochondrial Human genes 0.000 description 2
- 102100020964 39S ribosomal protein L34, mitochondrial Human genes 0.000 description 2
- QHXIQBNUQFLDAB-UHFFFAOYSA-N 4-N,6-N-dimethyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine Chemical compound CNC1=NC(NC)=NC(NC(C)C)=N1 QHXIQBNUQFLDAB-UHFFFAOYSA-N 0.000 description 2
- 102100026744 40S ribosomal protein S10 Human genes 0.000 description 2
- 102100026726 40S ribosomal protein S11 Human genes 0.000 description 2
- 102100023912 40S ribosomal protein S12 Human genes 0.000 description 2
- 102100026357 40S ribosomal protein S13 Human genes 0.000 description 2
- 102100023216 40S ribosomal protein S15 Human genes 0.000 description 2
- 101710198769 40S ribosomal protein S15a Proteins 0.000 description 2
- 102100031571 40S ribosomal protein S16 Human genes 0.000 description 2
- 102100039882 40S ribosomal protein S17 Human genes 0.000 description 2
- 102100039980 40S ribosomal protein S18 Human genes 0.000 description 2
- 102100033051 40S ribosomal protein S19 Human genes 0.000 description 2
- 102100037563 40S ribosomal protein S2 Human genes 0.000 description 2
- 102100037513 40S ribosomal protein S23 Human genes 0.000 description 2
- 102100022721 40S ribosomal protein S25 Human genes 0.000 description 2
- 102100027337 40S ribosomal protein S26 Human genes 0.000 description 2
- 102100032500 40S ribosomal protein S27-like Human genes 0.000 description 2
- 102100023679 40S ribosomal protein S28 Human genes 0.000 description 2
- 102100031928 40S ribosomal protein S29 Human genes 0.000 description 2
- 102100033409 40S ribosomal protein S3 Human genes 0.000 description 2
- 102100022600 40S ribosomal protein S3a Human genes 0.000 description 2
- 102100034088 40S ribosomal protein S4, X isoform Human genes 0.000 description 2
- 102100028550 40S ribosomal protein S4, Y isoform 1 Human genes 0.000 description 2
- 102100023779 40S ribosomal protein S5 Human genes 0.000 description 2
- 102100033714 40S ribosomal protein S6 Human genes 0.000 description 2
- 102100024088 40S ribosomal protein S7 Human genes 0.000 description 2
- 102100037663 40S ribosomal protein S8 Human genes 0.000 description 2
- 102100033731 40S ribosomal protein S9 Human genes 0.000 description 2
- 108050007366 40S ribosomal protein SA Proteins 0.000 description 2
- 102100022464 5'-nucleotidase Human genes 0.000 description 2
- 102100038222 60 kDa heat shock protein, mitochondrial Human genes 0.000 description 2
- 102100021546 60S ribosomal protein L10 Human genes 0.000 description 2
- 102100022406 60S ribosomal protein L10a Human genes 0.000 description 2
- 102100035916 60S ribosomal protein L11 Human genes 0.000 description 2
- 102100025643 60S ribosomal protein L12 Human genes 0.000 description 2
- 102100024442 60S ribosomal protein L13 Human genes 0.000 description 2
- 102100022289 60S ribosomal protein L13a Human genes 0.000 description 2
- 102100031854 60S ribosomal protein L14 Human genes 0.000 description 2
- 102100024406 60S ribosomal protein L15 Human genes 0.000 description 2
- 102100032411 60S ribosomal protein L18 Human genes 0.000 description 2
- 102100021690 60S ribosomal protein L18a Human genes 0.000 description 2
- 102100021206 60S ribosomal protein L19 Human genes 0.000 description 2
- 102100037965 60S ribosomal protein L21 Human genes 0.000 description 2
- 102100037685 60S ribosomal protein L22 Human genes 0.000 description 2
- 102100021308 60S ribosomal protein L23 Human genes 0.000 description 2
- 101710154747 60S ribosomal protein L23a Proteins 0.000 description 2
- 102100025601 60S ribosomal protein L27 Human genes 0.000 description 2
- 102100021927 60S ribosomal protein L27a Human genes 0.000 description 2
- 102100021660 60S ribosomal protein L28 Human genes 0.000 description 2
- 102100021671 60S ribosomal protein L29 Human genes 0.000 description 2
- 102100040540 60S ribosomal protein L3 Human genes 0.000 description 2
- 102100023777 60S ribosomal protein L31 Human genes 0.000 description 2
- 102100040768 60S ribosomal protein L32 Human genes 0.000 description 2
- 102100040637 60S ribosomal protein L34 Human genes 0.000 description 2
- 102100036116 60S ribosomal protein L35 Human genes 0.000 description 2
- 102100022276 60S ribosomal protein L35a Human genes 0.000 description 2
- 102100022048 60S ribosomal protein L36 Human genes 0.000 description 2
- 102100036126 60S ribosomal protein L37a Human genes 0.000 description 2
- 102100030982 60S ribosomal protein L38 Human genes 0.000 description 2
- 102100026926 60S ribosomal protein L4 Human genes 0.000 description 2
- 102100026750 60S ribosomal protein L5 Human genes 0.000 description 2
- 102100040924 60S ribosomal protein L6 Human genes 0.000 description 2
- 102100035841 60S ribosomal protein L7 Human genes 0.000 description 2
- 102100036630 60S ribosomal protein L7a Human genes 0.000 description 2
- 102100035931 60S ribosomal protein L8 Human genes 0.000 description 2
- 102100041029 60S ribosomal protein L9 Human genes 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- 102100033824 A-kinase anchor protein 12 Human genes 0.000 description 2
- 108090000067 ADP-Ribosylation Factor 6 Proteins 0.000 description 2
- 102100029824 ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 2 Human genes 0.000 description 2
- 102100023818 ADP-ribosylation factor 3 Human genes 0.000 description 2
- 102100023826 ADP-ribosylation factor 4 Human genes 0.000 description 2
- 102100032533 ADP/ATP translocase 1 Human genes 0.000 description 2
- 102100026396 ADP/ATP translocase 2 Human genes 0.000 description 2
- 102100026397 ADP/ATP translocase 3 Human genes 0.000 description 2
- 102100037651 AP-2 complex subunit sigma Human genes 0.000 description 2
- 102100034580 AT-rich interactive domain-containing protein 1A Human genes 0.000 description 2
- 102100023619 ATP synthase F(0) complex subunit B1, mitochondrial Human genes 0.000 description 2
- 102100021870 ATP synthase subunit O, mitochondrial Human genes 0.000 description 2
- 102100027573 ATP synthase subunit alpha, mitochondrial Human genes 0.000 description 2
- 102100022890 ATP synthase subunit beta, mitochondrial Human genes 0.000 description 2
- 102100023622 ATP synthase subunit epsilon-like protein, mitochondrial Human genes 0.000 description 2
- 102100026564 ATP synthase subunit f, mitochondrial Human genes 0.000 description 2
- 102100027787 ATP synthase subunit g, mitochondrial Human genes 0.000 description 2
- 102100021503 ATP-binding cassette sub-family B member 6 Human genes 0.000 description 2
- 102100020973 ATP-binding cassette sub-family D member 3 Human genes 0.000 description 2
- 102100020979 ATP-binding cassette sub-family F member 1 Human genes 0.000 description 2
- 102100035623 ATP-citrate synthase Human genes 0.000 description 2
- 102100025514 ATP-dependent 6-phosphofructokinase, platelet type Human genes 0.000 description 2
- 102100027447 ATP-dependent DNA helicase Q1 Human genes 0.000 description 2
- 102100030088 ATP-dependent RNA helicase A Human genes 0.000 description 2
- 102100021405 ATP-dependent RNA helicase DDX1 Human genes 0.000 description 2
- 102100021407 ATP-dependent RNA helicase DDX18 Human genes 0.000 description 2
- 102100033391 ATP-dependent RNA helicase DDX3X Human genes 0.000 description 2
- 102100032787 ATPase family AAA domain-containing protein 3A Human genes 0.000 description 2
- 102100037768 Acetyl-CoA acetyltransferase, mitochondrial Human genes 0.000 description 2
- 102100036732 Actin, aortic smooth muscle Human genes 0.000 description 2
- 102100022454 Actin, gamma-enteric smooth muscle Human genes 0.000 description 2
- 102100034064 Actin-like protein 6A Human genes 0.000 description 2
- 108010063503 Actinin Proteins 0.000 description 2
- 102000010825 Actinin Human genes 0.000 description 2
- 102100022089 Acyl-[acyl-carrier-protein] hydrolase Human genes 0.000 description 2
- 102100020925 Adenosylhomocysteinase Human genes 0.000 description 2
- 102100037399 Alanine-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100039074 Aldehyde dehydrogenase X, mitochondrial Human genes 0.000 description 2
- 102100026448 Aldo-keto reductase family 1 member A1 Human genes 0.000 description 2
- 102100034163 Alpha-actinin-1 Human genes 0.000 description 2
- 102100032959 Alpha-actinin-4 Human genes 0.000 description 2
- 102100034320 Alpha-centractin Human genes 0.000 description 2
- 102100038910 Alpha-enolase Human genes 0.000 description 2
- 102100022417 Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Human genes 0.000 description 2
- 102100022749 Aminopeptidase N Human genes 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 102000045205 Angiopoietin-Like Protein 4 Human genes 0.000 description 2
- 102100034613 Annexin A2 Human genes 0.000 description 2
- 102100034612 Annexin A4 Human genes 0.000 description 2
- 102100034278 Annexin A6 Human genes 0.000 description 2
- 102100036131 Arginine-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100023245 Asparagine-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100028820 Aspartate-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100022108 Aspartyl/asparaginyl beta-hydroxylase Human genes 0.000 description 2
- 102100037151 Barrier-to-autointegration factor Human genes 0.000 description 2
- 102100026653 Beta-actin-like protein 2 Human genes 0.000 description 2
- 102100031109 Beta-catenin-like protein 1 Human genes 0.000 description 2
- 102100026189 Beta-galactosidase Human genes 0.000 description 2
- 102100030401 Biglycan Human genes 0.000 description 2
- 108090000654 Bone morphogenetic protein 1 Proteins 0.000 description 2
- 102100028252 Brain acid soluble protein 1 Human genes 0.000 description 2
- 102100031171 CCN family member 1 Human genes 0.000 description 2
- 102100031168 CCN family member 2 Human genes 0.000 description 2
- 108010049990 CD13 Antigens Proteins 0.000 description 2
- 102100027209 CD2-associated protein Human genes 0.000 description 2
- 102100022002 CD59 glycoprotein Human genes 0.000 description 2
- 102100021824 COP9 signalosome complex subunit 5 Human genes 0.000 description 2
- 102100039866 CTP synthase 1 Human genes 0.000 description 2
- 102100032216 Calcium and integrin-binding protein 1 Human genes 0.000 description 2
- 101710103933 Calcium and integrin-binding protein 1 Proteins 0.000 description 2
- 101710131373 Calpain small subunit 1 Proteins 0.000 description 2
- 102100025172 Calpain-1 catalytic subunit Human genes 0.000 description 2
- 102100032537 Calpain-2 catalytic subunit Human genes 0.000 description 2
- 102100033591 Calponin-2 Human genes 0.000 description 2
- 102100033592 Calponin-3 Human genes 0.000 description 2
- 102100029968 Calreticulin Human genes 0.000 description 2
- 102100029949 Caprin-1 Human genes 0.000 description 2
- 108090000007 Carboxypeptidase M Proteins 0.000 description 2
- 102100032936 Carboxypeptidase M Human genes 0.000 description 2
- 102100022067 Cardiomyopathy-associated protein 5 Human genes 0.000 description 2
- 102100040751 Casein kinase II subunit alpha Human genes 0.000 description 2
- 102100028003 Catenin alpha-1 Human genes 0.000 description 2
- 102100028914 Catenin beta-1 Human genes 0.000 description 2
- 102100028906 Catenin delta-1 Human genes 0.000 description 2
- 102100032230 Caveolae-associated protein 1 Human genes 0.000 description 2
- 102100024937 Caveolae-associated protein 3 Human genes 0.000 description 2
- 102100035888 Caveolin-1 Human genes 0.000 description 2
- 102100036568 Cell cycle and apoptosis regulator protein 2 Human genes 0.000 description 2
- 102100023126 Cell surface glycoprotein MUC18 Human genes 0.000 description 2
- 102100037623 Centromere protein V Human genes 0.000 description 2
- 102100034667 Chloride intracellular channel protein 1 Human genes 0.000 description 2
- 102100023508 Chloride intracellular channel protein 4 Human genes 0.000 description 2
- 102100023506 Chloride intracellular channel protein 6 Human genes 0.000 description 2
- 102100030871 Cleavage and polyadenylation specificity factor subunit 5 Human genes 0.000 description 2
- 102100031552 Coactosin-like protein Human genes 0.000 description 2
- 108090000996 Cofilin 1 Proteins 0.000 description 2
- 102100023667 Coiled-coil domain-containing protein 124 Human genes 0.000 description 2
- 102100032410 Coiled-coil domain-containing protein 30 Human genes 0.000 description 2
- 102100023694 Coiled-coil-helix-coiled-coil-helix domain-containing protein 1 Human genes 0.000 description 2
- 102100023774 Cold-inducible RNA-binding protein Human genes 0.000 description 2
- 102000001187 Collagen Type III Human genes 0.000 description 2
- 108010069502 Collagen Type III Proteins 0.000 description 2
- 102000012432 Collagen Type V Human genes 0.000 description 2
- 108010022514 Collagen Type V Proteins 0.000 description 2
- 108010043741 Collagen Type VI Proteins 0.000 description 2
- 102000002734 Collagen Type VI Human genes 0.000 description 2
- 102100033601 Collagen alpha-1(I) chain Human genes 0.000 description 2
- 102100030781 Collagen alpha-1(XXIII) chain Human genes 0.000 description 2
- 102100031544 Collagen alpha-1(XXVII) chain Human genes 0.000 description 2
- 102100033781 Collagen alpha-2(IV) chain Human genes 0.000 description 2
- 102100024334 Collagen alpha-6(VI) chain Human genes 0.000 description 2
- 102100039551 Collagen triple helix repeat-containing protein 1 Human genes 0.000 description 2
- 102100030670 Core histone macro-H2A.2 Human genes 0.000 description 2
- 102100041025 Coronin-1B Human genes 0.000 description 2
- 108050006400 Cyclin Proteins 0.000 description 2
- 102100031051 Cysteine and glycine-rich protein 1 Human genes 0.000 description 2
- 102100039924 Cytochrome b-c1 complex subunit 1, mitochondrial Human genes 0.000 description 2
- 102100030497 Cytochrome c Human genes 0.000 description 2
- 102100027456 Cytochrome c oxidase subunit 2 Human genes 0.000 description 2
- 102100022206 Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Human genes 0.000 description 2
- 102100025644 Cytochrome c oxidase subunit 7A2, mitochondrial Human genes 0.000 description 2
- 102100038417 Cytoplasmic FMR1-interacting protein 1 Human genes 0.000 description 2
- 102100031635 Cytoplasmic dynein 1 heavy chain 1 Human genes 0.000 description 2
- 102100037068 Cytoplasmic dynein 1 light intermediate chain 1 Human genes 0.000 description 2
- 102100037073 Cytoplasmic dynein 1 light intermediate chain 2 Human genes 0.000 description 2
- 102100031007 Cytosolic non-specific dipeptidase Human genes 0.000 description 2
- 102100037165 DBH-like monooxygenase protein 1 Human genes 0.000 description 2
- 102100024607 DNA topoisomerase 1 Human genes 0.000 description 2
- 102100022204 DNA-dependent protein kinase catalytic subunit Human genes 0.000 description 2
- 102100021429 DNA-directed RNA polymerase II subunit RPB1 Human genes 0.000 description 2
- 102100039303 DNA-directed RNA polymerase II subunit RPB2 Human genes 0.000 description 2
- 102100039301 DNA-directed RNA polymerase II subunit RPB3 Human genes 0.000 description 2
- 102100032260 DNA-directed RNA polymerase II subunit RPB4 Human genes 0.000 description 2
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 description 2
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 description 2
- 102100032254 DNA-directed RNA polymerases I, II, and III subunit RPABC1 Human genes 0.000 description 2
- 101100444936 Danio rerio eif3ha gene Proteins 0.000 description 2
- 102100038606 Death-associated protein kinase 3 Human genes 0.000 description 2
- 102100037802 Deoxyribose-phosphate aldolase Human genes 0.000 description 2
- 102100034579 Desmoglein-1 Human genes 0.000 description 2
- 102100034578 Desmoglein-2 Human genes 0.000 description 2
- 102100038199 Desmoplakin Human genes 0.000 description 2
- 102100034581 Dihydroorotase Human genes 0.000 description 2
- CTZNINKRTKCWGU-UHFFFAOYSA-N Dinactin Natural products CC1C(=O)OC(C)CC(O2)CCC2C(C)C(=O)OC(CC)CC(O2)CCC2C(C)C(=O)OC(CC)CC(O2)CCC2C(C)C(=O)OC(C)CC2CCC1O2 CTZNINKRTKCWGU-UHFFFAOYSA-N 0.000 description 2
- 102100037443 Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit STT3B Human genes 0.000 description 2
- 102100024749 Dynein light chain Tctex-type 1 Human genes 0.000 description 2
- 102100032249 Dystonin Human genes 0.000 description 2
- 102100034582 E3 ubiquitin/ISG15 ligase TRIM25 Human genes 0.000 description 2
- 102100032449 EGF-like repeat and discoidin I-like domain-containing protein 3 Human genes 0.000 description 2
- 102100032036 EH domain-containing protein 1 Human genes 0.000 description 2
- 102100032020 EH domain-containing protein 2 Human genes 0.000 description 2
- 102100032037 EH domain-containing protein 4 Human genes 0.000 description 2
- 108700015856 ELAV-Like Protein 1 Proteins 0.000 description 2
- 102100034235 ELAV-like protein 1 Human genes 0.000 description 2
- 102100021558 ER lumen protein-retaining receptor 3 Human genes 0.000 description 2
- 101150028132 Eif3h gene Proteins 0.000 description 2
- 102100033238 Elongation factor Tu, mitochondrial Human genes 0.000 description 2
- 102100039328 Endoplasmin Human genes 0.000 description 2
- 102100035218 Epidermal growth factor receptor kinase substrate 8-like protein 2 Human genes 0.000 description 2
- 102100036443 Epiplakin Human genes 0.000 description 2
- 102100025403 Epoxide hydrolase 1 Human genes 0.000 description 2
- 102100039950 Eukaryotic initiation factor 4A-I Human genes 0.000 description 2
- 102100022461 Eukaryotic initiation factor 4A-III Human genes 0.000 description 2
- 102100035549 Eukaryotic translation initiation factor 2 subunit 1 Human genes 0.000 description 2
- 102100027327 Eukaryotic translation initiation factor 2 subunit 2 Human genes 0.000 description 2
- 102100040015 Eukaryotic translation initiation factor 2 subunit 3 Human genes 0.000 description 2
- 102100035045 Eukaryotic translation initiation factor 3 subunit C Human genes 0.000 description 2
- 102100033132 Eukaryotic translation initiation factor 3 subunit E Human genes 0.000 description 2
- 102100034255 Eukaryotic translation initiation factor 3 subunit F Human genes 0.000 description 2
- 102100023236 Eukaryotic translation initiation factor 3 subunit G Human genes 0.000 description 2
- 101710109050 Eukaryotic translation initiation factor 3 subunit H Proteins 0.000 description 2
- 102100039737 Eukaryotic translation initiation factor 4 gamma 2 Human genes 0.000 description 2
- 102100039466 Eukaryotic translation initiation factor 5B Human genes 0.000 description 2
- 102100029095 Exportin-1 Human genes 0.000 description 2
- 102100026671 F-actin-capping protein subunit alpha-1 Human genes 0.000 description 2
- 102100025971 F-actin-capping protein subunit alpha-2 Human genes 0.000 description 2
- 102100025637 FACT complex subunit SPT16 Human genes 0.000 description 2
- 102100027867 FH2 domain-containing protein 1 Human genes 0.000 description 2
- 102100036123 Far upstream element-binding protein 2 Human genes 0.000 description 2
- 102100035111 Farnesyl pyrophosphate synthase Human genes 0.000 description 2
- 102100020760 Ferritin heavy chain Human genes 0.000 description 2
- 102100031509 Fibrillin-1 Human genes 0.000 description 2
- 102100031812 Fibulin-1 Human genes 0.000 description 2
- 102100028314 Filaggrin Human genes 0.000 description 2
- 102100037009 Filaggrin-2 Human genes 0.000 description 2
- 102100025413 Formyltetrahydrofolate synthetase Human genes 0.000 description 2
- 102000001267 GSK3 Human genes 0.000 description 2
- 108060006662 GSK3 Proteins 0.000 description 2
- 102100032174 GTP-binding protein SAR1a Human genes 0.000 description 2
- 108010001498 Galectin 1 Proteins 0.000 description 2
- 108010001517 Galectin 3 Proteins 0.000 description 2
- 102100021736 Galectin-1 Human genes 0.000 description 2
- 102100040510 Galectin-3-binding protein Human genes 0.000 description 2
- 102100039554 Galectin-8 Human genes 0.000 description 2
- 102100038073 General transcription factor II-I Human genes 0.000 description 2
- 102100034009 Glutamate dehydrogenase 1, mitochondrial Human genes 0.000 description 2
- 102100036424 Glutaredoxin-3 Human genes 0.000 description 2
- 102100033039 Glutathione peroxidase 1 Human genes 0.000 description 2
- 102100036589 Glycine-tRNA ligase Human genes 0.000 description 2
- 229920002527 Glycogen Polymers 0.000 description 2
- 102100023122 Glycylpeptide N-tetradecanoyltransferase 2 Human genes 0.000 description 2
- 102100021194 Glypican-6 Human genes 0.000 description 2
- 102100038367 Gremlin-1 Human genes 0.000 description 2
- 102100040896 Growth/differentiation factor 15 Human genes 0.000 description 2
- 102100035354 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Human genes 0.000 description 2
- 102100035341 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Human genes 0.000 description 2
- 102100034154 Guanine nucleotide-binding protein G(i) subunit alpha-2 Human genes 0.000 description 2
- 102100034264 Guanine nucleotide-binding protein G(i) subunit alpha-3 Human genes 0.000 description 2
- 102000049982 HMGA2 Human genes 0.000 description 2
- 108700039143 HMGA2 Proteins 0.000 description 2
- 101150112743 HSPA5 gene Proteins 0.000 description 2
- 102100040352 Heat shock 70 kDa protein 1A Human genes 0.000 description 2
- 102100028765 Heat shock 70 kDa protein 4 Human genes 0.000 description 2
- 102100027421 Heat shock cognate 71 kDa protein Human genes 0.000 description 2
- 102100032510 Heat shock protein HSP 90-beta Human genes 0.000 description 2
- 102100039165 Heat shock protein beta-1 Human genes 0.000 description 2
- 102100028515 Heat shock-related 70 kDa protein 2 Human genes 0.000 description 2
- 102100023925 Heparan sulfate glucosamine 3-O-sulfotransferase 6 Human genes 0.000 description 2
- 108010020382 Hepatocyte Nuclear Factor 1-alpha Proteins 0.000 description 2
- 102100022057 Hepatocyte nuclear factor 1-alpha Human genes 0.000 description 2
- 102100037848 Heterochromatin protein 1-binding protein 3 Human genes 0.000 description 2
- 102100024002 Heterogeneous nuclear ribonucleoprotein U Human genes 0.000 description 2
- 102100022130 High mobility group protein B3 Human genes 0.000 description 2
- 102100023917 Histone H1.10 Human genes 0.000 description 2
- 102100027369 Histone H1.4 Human genes 0.000 description 2
- 102100022653 Histone H1.5 Human genes 0.000 description 2
- 102100027363 Histone H2A type 2-C Human genes 0.000 description 2
- 102100030994 Histone H2A.J Human genes 0.000 description 2
- 102100030673 Histone H2A.V Human genes 0.000 description 2
- 102100034533 Histone H2AX Human genes 0.000 description 2
- 102100030689 Histone H2B type 1-D Human genes 0.000 description 2
- 102100034535 Histone H3.1 Human genes 0.000 description 2
- 102100033636 Histone H3.2 Human genes 0.000 description 2
- 101710195387 Histone H3.2 Proteins 0.000 description 2
- 102100039236 Histone H3.3 Human genes 0.000 description 2
- 102100034523 Histone H4 Human genes 0.000 description 2
- 102100025539 Histone deacetylase complex subunit SAP18 Human genes 0.000 description 2
- 108010033040 Histones Proteins 0.000 description 2
- 101000612655 Homo sapiens 26S proteasome non-ATPase regulatory subunit 1 Proteins 0.000 description 2
- 101000590272 Homo sapiens 26S proteasome non-ATPase regulatory subunit 2 Proteins 0.000 description 2
- 101001069718 Homo sapiens 26S proteasome regulatory subunit 10B Proteins 0.000 description 2
- 101001125540 Homo sapiens 26S proteasome regulatory subunit 6A Proteins 0.000 description 2
- 101001118566 Homo sapiens 40S ribosomal protein S15a Proteins 0.000 description 2
- 101000694288 Homo sapiens 40S ribosomal protein SA Proteins 0.000 description 2
- 101001117935 Homo sapiens 60S ribosomal protein L15 Proteins 0.000 description 2
- 101001115494 Homo sapiens 60S ribosomal protein L23a Proteins 0.000 description 2
- 101000677883 Homo sapiens ATP-binding cassette sub-family B member 6 Proteins 0.000 description 2
- 101000783770 Homo sapiens ATP-binding cassette sub-family D member 3 Proteins 0.000 description 2
- 101000783783 Homo sapiens ATP-binding cassette sub-family F member 1 Proteins 0.000 description 2
- 101001000001 Homo sapiens Basement membrane-specific heparan sulfate proteoglycan core protein Proteins 0.000 description 2
- 101000919194 Homo sapiens Calpain small subunit 1 Proteins 0.000 description 2
- 101000919690 Homo sapiens Cytosolic non-specific dipeptidase Proteins 0.000 description 2
- 101001088179 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC1 Proteins 0.000 description 2
- 101000879240 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit STT3B Proteins 0.000 description 2
- 101000959746 Homo sapiens Eukaryotic translation initiation factor 6 Proteins 0.000 description 2
- 101001029120 Homo sapiens Exosome RNA helicase MTR4 Proteins 0.000 description 2
- 101000608769 Homo sapiens Galectin-8 Proteins 0.000 description 2
- 101000997034 Homo sapiens Guanine nucleotide-binding protein G(i) subunit alpha-3 Proteins 0.000 description 2
- 101001037759 Homo sapiens Heat shock 70 kDa protein 1A Proteins 0.000 description 2
- 101001078692 Homo sapiens Heat shock 70 kDa protein 4 Proteins 0.000 description 2
- 101000905024 Homo sapiens Histone H1.10 Proteins 0.000 description 2
- 101001037191 Homo sapiens Hyaluronan synthase 1 Proteins 0.000 description 2
- 101001043772 Homo sapiens Inhibitor of nuclear factor kappa-B kinase-interacting protein Proteins 0.000 description 2
- 101000975502 Homo sapiens Keratin, type II cytoskeletal 7 Proteins 0.000 description 2
- 101000578920 Homo sapiens Microtubule-actin cross-linking factor 1, isoforms 1/2/3/5 Proteins 0.000 description 2
- 101000866795 Homo sapiens Non-histone chromosomal protein HMG-14 Proteins 0.000 description 2
- 101001095308 Homo sapiens Periostin Proteins 0.000 description 2
- 101001124867 Homo sapiens Peroxiredoxin-1 Proteins 0.000 description 2
- 101000619805 Homo sapiens Peroxiredoxin-5, mitochondrial Proteins 0.000 description 2
- 101000619708 Homo sapiens Peroxiredoxin-6 Proteins 0.000 description 2
- 101000600178 Homo sapiens Peroxisomal membrane protein PEX14 Proteins 0.000 description 2
- 101001087352 Homo sapiens Poly(U)-binding-splicing factor PUF60 Proteins 0.000 description 2
- 101000870728 Homo sapiens Probable ATP-dependent RNA helicase DDX27 Proteins 0.000 description 2
- 101000952113 Homo sapiens Probable ATP-dependent RNA helicase DDX5 Proteins 0.000 description 2
- 101001015936 Homo sapiens Probable rRNA-processing protein EBP2 Proteins 0.000 description 2
- 101000630284 Homo sapiens Proline-tRNA ligase Proteins 0.000 description 2
- 101000757216 Homo sapiens Protein arginine N-methyltransferase 1 Proteins 0.000 description 2
- 101001072202 Homo sapiens Protein disulfide-isomerase Proteins 0.000 description 2
- 101000620576 Homo sapiens Ras-related protein Rab-14 Proteins 0.000 description 2
- 101000803747 Homo sapiens Ribosome biogenesis protein WDR12 Proteins 0.000 description 2
- 101001099058 Homo sapiens Serine/threonine-protein phosphatase PGAM5, mitochondrial Proteins 0.000 description 2
- 101000665250 Homo sapiens Small nuclear ribonucleoprotein Sm D2 Proteins 0.000 description 2
- 101000704203 Homo sapiens Spectrin alpha chain, non-erythrocytic 1 Proteins 0.000 description 2
- 101000828537 Homo sapiens Synaptic functional regulator FMR1 Proteins 0.000 description 2
- 101000666730 Homo sapiens T-complex protein 1 subunit alpha Proteins 0.000 description 2
- 101000850794 Homo sapiens Tropomyosin alpha-3 chain Proteins 0.000 description 2
- 101000788517 Homo sapiens Tubulin beta-2A chain Proteins 0.000 description 2
- 101000971144 Homo sapiens Tyrosine-protein kinase BAZ1B Proteins 0.000 description 2
- 101000641003 Homo sapiens Tyrosine-tRNA ligase, cytoplasmic Proteins 0.000 description 2
- 101000590687 Homo sapiens U3 small nucleolar ribonucleoprotein protein MPP10 Proteins 0.000 description 2
- 101000854873 Homo sapiens V-type proton ATPase 116 kDa subunit a 4 Proteins 0.000 description 2
- 101000807820 Homo sapiens V-type proton ATPase subunit S1 Proteins 0.000 description 2
- 101000649979 Homo sapiens Vacuolar protein sorting-associated protein VTA1 homolog Proteins 0.000 description 2
- 101000868892 Homo sapiens pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Proteins 0.000 description 2
- 102100028627 Hornerin Human genes 0.000 description 2
- 102100027037 Hsc70-interacting protein Human genes 0.000 description 2
- 102100040203 Hyaluronan synthase 1 Human genes 0.000 description 2
- 206010021143 Hypoxia Diseases 0.000 description 2
- 102100033258 Importin subunit beta-1 Human genes 0.000 description 2
- 102100037961 Importin-9 Human genes 0.000 description 2
- 102100021595 Inhibitor of nuclear factor kappa-B kinase-interacting protein Human genes 0.000 description 2
- 102100020796 Inosine 5'-monophosphate cyclohydrolase Human genes 0.000 description 2
- 102100025891 Inosine-5'-monophosphate dehydrogenase 2 Human genes 0.000 description 2
- 102100037920 Insulin-like growth factor 2 mRNA-binding protein 3 Human genes 0.000 description 2
- 102100037877 Intercellular adhesion molecule 1 Human genes 0.000 description 2
- 101710107661 Interleukin enhancer-binding factor 2 Proteins 0.000 description 2
- 102100039905 Isocitrate dehydrogenase [NADP] cytoplasmic Human genes 0.000 description 2
- 102100036015 Isoleucine-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100037381 Keratin, type II cuticular Hb5 Human genes 0.000 description 2
- 102100023974 Keratin, type II cytoskeletal 7 Human genes 0.000 description 2
- 102100023422 Kinesin-1 heavy chain Human genes 0.000 description 2
- 102100022251 Kinesin-like protein KIFC2 Human genes 0.000 description 2
- 102000015335 Ku Autoantigen Human genes 0.000 description 2
- 108010025026 Ku Autoantigen Proteins 0.000 description 2
- 102100034671 L-lactate dehydrogenase A chain Human genes 0.000 description 2
- 102100024580 L-lactate dehydrogenase B chain Human genes 0.000 description 2
- 108010001831 LDL receptors Proteins 0.000 description 2
- 102100035118 LIM and SH3 domain protein 1 Human genes 0.000 description 2
- 102100026517 Lamin-B1 Human genes 0.000 description 2
- 102100026519 Lamin-B2 Human genes 0.000 description 2
- 102100027450 Laminin subunit alpha-5 Human genes 0.000 description 2
- 102100027448 Laminin subunit beta-1 Human genes 0.000 description 2
- 102100024629 Laminin subunit beta-3 Human genes 0.000 description 2
- 102100034710 Laminin subunit gamma-1 Human genes 0.000 description 2
- 102100027017 Latent-transforming growth factor beta-binding protein 2 Human genes 0.000 description 2
- 102100026915 Leucine zipper protein 1 Human genes 0.000 description 2
- 102100040589 Leucine-rich PPR motif-containing protein, mitochondrial Human genes 0.000 description 2
- 102100040690 Leucine-rich repeat-containing protein 17 Human genes 0.000 description 2
- 102100028206 Leucine-rich repeat-containing protein 59 Human genes 0.000 description 2
- 102100020872 Leucyl-cystinyl aminopeptidase Human genes 0.000 description 2
- 102100029107 Long chain 3-hydroxyacyl-CoA dehydrogenase Human genes 0.000 description 2
- 102100024640 Low-density lipoprotein receptor Human genes 0.000 description 2
- 102100038056 Lysophosphatidylserine lipase ABHD12 Human genes 0.000 description 2
- 102100040986 Lysophospholipid acyltransferase 7 Human genes 0.000 description 2
- 102100021948 Lysyl oxidase homolog 2 Human genes 0.000 description 2
- 102100032514 MARCKS-related protein Human genes 0.000 description 2
- 102100026626 MICOS complex subunit MIC19 Human genes 0.000 description 2
- 101700028140 MYO1D Proteins 0.000 description 2
- 102100021760 Magnesium transporter protein 1 Human genes 0.000 description 2
- 108010026217 Malate Dehydrogenase Proteins 0.000 description 2
- 102100038645 Matrin-3 Human genes 0.000 description 2
- 102100030216 Matrix metalloproteinase-14 Human genes 0.000 description 2
- 108010047230 Member 1 Subfamily B ATP Binding Cassette Transporter Proteins 0.000 description 2
- 102100037511 Metastasis-associated protein MTA2 Human genes 0.000 description 2
- 102100037206 Methionine-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100026741 Microsomal glutathione S-transferase 1 Human genes 0.000 description 2
- 102100026722 Microsomal glutathione S-transferase 3 Human genes 0.000 description 2
- 102100028322 Microtubule-actin cross-linking factor 1, isoforms 1/2/3/5 Human genes 0.000 description 2
- 108090001040 Microtubule-associated protein 1B Proteins 0.000 description 2
- 102000004866 Microtubule-associated protein 1B Human genes 0.000 description 2
- 102100021794 Microtubule-associated protein 4 Human genes 0.000 description 2
- 102100039560 Microtubule-associated protein RP/EB family member 1 Human genes 0.000 description 2
- 102100021769 Mitochondrial 2-oxoglutarate/malate carrier protein Human genes 0.000 description 2
- 102100023845 Mitochondrial fission 1 protein Human genes 0.000 description 2
- 102100027869 Moesin Human genes 0.000 description 2
- 102100023123 Mucin-16 Human genes 0.000 description 2
- 102100034257 Mucin-19 Human genes 0.000 description 2
- 101000744522 Mus musculus Ras-related protein Rab-22A Proteins 0.000 description 2
- 102100031790 Myelin expression factor 2 Human genes 0.000 description 2
- 102100035050 Myeloid-associated differentiation marker Human genes 0.000 description 2
- 102100031828 Myosin light chain 6B Human genes 0.000 description 2
- 102100036640 Myosin-10 Human genes 0.000 description 2
- 102100038938 Myosin-9 Human genes 0.000 description 2
- 102000015695 Myristoylated Alanine-Rich C Kinase Substrate Human genes 0.000 description 2
- 108010063737 Myristoylated Alanine-Rich C Kinase Substrate Proteins 0.000 description 2
- 102100038943 NAD(P) transhydrogenase, mitochondrial Human genes 0.000 description 2
- 102100022198 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Human genes 0.000 description 2
- 102100035383 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Human genes 0.000 description 2
- 102100032173 NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Human genes 0.000 description 2
- 108010057466 NF-kappa B Proteins 0.000 description 2
- 102000003945 NF-kappa B Human genes 0.000 description 2
- 102100026779 Nascent polypeptide-associated complex subunit alpha, muscle-specific form Human genes 0.000 description 2
- 102100024014 Nestin Human genes 0.000 description 2
- 102100034437 Neurabin-2 Human genes 0.000 description 2
- 102100031837 Neuroblast differentiation-associated protein AHNAK Human genes 0.000 description 2
- 102100036592 Neutral alpha-glucosidase AB Human genes 0.000 description 2
- 102100038951 Nicotinamide N-methyltransferase Human genes 0.000 description 2
- 102000015532 Nicotinamide phosphoribosyltransferase Human genes 0.000 description 2
- 108010064862 Nicotinamide phosphoribosyltransferase Proteins 0.000 description 2
- 102100037369 Nidogen-1 Human genes 0.000 description 2
- 102100028102 Non-POU domain-containing octamer-binding protein Human genes 0.000 description 2
- 102100031353 Non-histone chromosomal protein HMG-14 Human genes 0.000 description 2
- 108700031302 Nuclear Factor 45 Proteins 0.000 description 2
- 102100032226 Nuclear pore complex protein Nup205 Human genes 0.000 description 2
- 102100027585 Nuclear pore complex protein Nup93 Human genes 0.000 description 2
- 102100021858 Nuclear receptor-binding protein Human genes 0.000 description 2
- 102100022678 Nucleophosmin Human genes 0.000 description 2
- 102100022684 Nucleoplasmin-3 Human genes 0.000 description 2
- 102100039306 Nucleotide pyrophosphatase Human genes 0.000 description 2
- 102100027182 OCIA domain-containing protein 2 Human genes 0.000 description 2
- 102100035415 Obg-like ATPase 1 Human genes 0.000 description 2
- 102000004316 Oxidoreductases Human genes 0.000 description 2
- 108090000854 Oxidoreductases Proteins 0.000 description 2
- 102100036220 PC4 and SFRS1-interacting protein Human genes 0.000 description 2
- 102100034819 PDZ and LIM domain protein 1 Human genes 0.000 description 2
- 102100029178 PDZ and LIM domain protein 4 Human genes 0.000 description 2
- 102100029181 PDZ and LIM domain protein 5 Human genes 0.000 description 2
- 102100025653 PDZ domain-containing protein 4 Human genes 0.000 description 2
- 102100026456 POU domain, class 3, transcription factor 3 Human genes 0.000 description 2
- 102100029128 PR domain zinc finger protein 8 Human genes 0.000 description 2
- 102100038660 PRA1 family protein 3 Human genes 0.000 description 2
- 102100040853 PRKC apoptosis WT1 regulator protein Human genes 0.000 description 2
- 102100037499 Parkinson disease protein 7 Human genes 0.000 description 2
- 102100027351 Pentraxin-related protein PTX3 Human genes 0.000 description 2
- 102100034539 Peptidyl-prolyl cis-trans isomerase A Human genes 0.000 description 2
- 102100040283 Peptidyl-prolyl cis-trans isomerase B Human genes 0.000 description 2
- 102100040349 Peptidyl-prolyl cis-trans isomerase FKBP10 Human genes 0.000 description 2
- 102100023846 Peptidyl-prolyl cis-trans isomerase FKBP3 Human genes 0.000 description 2
- 102100037028 Periaxin Human genes 0.000 description 2
- 102100029139 Peroxiredoxin-1 Human genes 0.000 description 2
- 102100022078 Peroxiredoxin-5, mitochondrial Human genes 0.000 description 2
- 102100037389 Phosphoglycerate mutase 1 Human genes 0.000 description 2
- 102100030447 Phospholipid-transporting ATPase IB Human genes 0.000 description 2
- 108010089430 Phosphoproteins Proteins 0.000 description 2
- 102000007982 Phosphoproteins Human genes 0.000 description 2
- 102100027330 Phosphoribosylaminoimidazole carboxylase Human genes 0.000 description 2
- 102100038374 Pinin Human genes 0.000 description 2
- 102100023712 Poly [ADP-ribose] polymerase 1 Human genes 0.000 description 2
- 102100033008 Poly(U)-binding-splicing factor PUF60 Human genes 0.000 description 2
- 102100034960 Poly(rC)-binding protein 1 Human genes 0.000 description 2
- 102100034961 Poly(rC)-binding protein 2 Human genes 0.000 description 2
- 102100026090 Polyadenylate-binding protein 1 Human genes 0.000 description 2
- 102100024184 Polymerase delta-interacting protein 3 Human genes 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 102100030432 Polyubiquitin-B Human genes 0.000 description 2
- 102100029522 Pre-mRNA-processing factor 19 Human genes 0.000 description 2
- 102100021231 Pre-mRNA-processing-splicing factor 8 Human genes 0.000 description 2
- 102100032926 Prefoldin subunit 6 Human genes 0.000 description 2
- 102100026531 Prelamin-A/C Human genes 0.000 description 2
- 102100033405 Probable ATP-dependent RNA helicase DDX27 Human genes 0.000 description 2
- 102100037434 Probable ATP-dependent RNA helicase DDX5 Human genes 0.000 description 2
- 102100032223 Probable rRNA-processing protein EBP2 Human genes 0.000 description 2
- 102100022982 Procollagen galactosyltransferase 1 Human genes 0.000 description 2
- 102100035199 Procollagen glycosyltransferase Human genes 0.000 description 2
- 102100031156 Prohibitin-2 Human genes 0.000 description 2
- 102100036691 Proliferating cell nuclear antigen Human genes 0.000 description 2
- 102100034144 Prolyl 3-hydroxylase 1 Human genes 0.000 description 2
- 102100040478 Prolyl 4-hydroxylase subunit alpha-2 Human genes 0.000 description 2
- 102100031299 Proteasome activator complex subunit 2 Human genes 0.000 description 2
- 102100023080 Proteasome adapter and scaffold protein ECM29 Human genes 0.000 description 2
- 102100040364 Proteasome subunit alpha type-2 Human genes 0.000 description 2
- 102100028813 Proteasome subunit alpha type-4 Human genes 0.000 description 2
- 102100029270 Proteasome subunit alpha type-5 Human genes 0.000 description 2
- 102100034664 Proteasome subunit alpha type-6 Human genes 0.000 description 2
- 102100021201 Proteasome subunit alpha type-7 Human genes 0.000 description 2
- 102100031566 Proteasome subunit beta type-1 Human genes 0.000 description 2
- 102100040400 Proteasome subunit beta type-2 Human genes 0.000 description 2
- 102100033755 Proteasome subunit beta type-3 Human genes 0.000 description 2
- 101710094499 Proteasome subunit beta type-4 Proteins 0.000 description 2
- 102100033190 Proteasome subunit beta type-4 Human genes 0.000 description 2
- 102100036127 Proteasome subunit beta type-5 Human genes 0.000 description 2
- 102100036128 Proteasome subunit beta type-6 Human genes 0.000 description 2
- 102100035763 Proteasome subunit beta type-7 Human genes 0.000 description 2
- 102100026113 Protein DEK Human genes 0.000 description 2
- 102100026734 Protein FAM98A Human genes 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- 102100032133 Protein LYRIC Human genes 0.000 description 2
- 102100029796 Protein S100-A10 Human genes 0.000 description 2
- 102100029811 Protein S100-A11 Human genes 0.000 description 2
- 102100025670 Protein S100-A13 Human genes 0.000 description 2
- 102100032421 Protein S100-A6 Human genes 0.000 description 2
- 102100032420 Protein S100-A9 Human genes 0.000 description 2
- 102100036352 Protein disulfide-isomerase Human genes 0.000 description 2
- 102100034931 Protein mono-ADP-ribosyltransferase PARP4 Human genes 0.000 description 2
- 102100023365 Protein transport protein Sec23A Human genes 0.000 description 2
- 102100034271 Protein transport protein Sec61 subunit alpha isoform 1 Human genes 0.000 description 2
- 102100036308 Protein transport protein Sec61 subunit beta Human genes 0.000 description 2
- 102100038095 Protein-glutamine gamma-glutamyltransferase 2 Human genes 0.000 description 2
- 102100038094 Protein-glutamine gamma-glutamyltransferase E Human genes 0.000 description 2
- 102000016611 Proteoglycans Human genes 0.000 description 2
- 108010067787 Proteoglycans Proteins 0.000 description 2
- 102100033192 Puromycin-sensitive aminopeptidase Human genes 0.000 description 2
- 102100031269 Putative peripheral benzodiazepine receptor-related protein Human genes 0.000 description 2
- 102100039407 Pyrroline-5-carboxylate reductase 1, mitochondrial Human genes 0.000 description 2
- 102100034911 Pyruvate kinase PKM Human genes 0.000 description 2
- 108010078067 RNA Polymerase III Proteins 0.000 description 2
- 102000014450 RNA Polymerase III Human genes 0.000 description 2
- 102100027122 RNA transcription, translation and transport factor protein Human genes 0.000 description 2
- 102000044126 RNA-Binding Proteins Human genes 0.000 description 2
- 102100024939 RNA-binding motif protein, X chromosome Human genes 0.000 description 2
- 102100029250 RNA-binding protein 14 Human genes 0.000 description 2
- 102100025872 RNA-binding protein 28 Human genes 0.000 description 2
- 102100025902 RNA-binding protein 3 Human genes 0.000 description 2
- 102100025052 RNA-binding protein Raly Human genes 0.000 description 2
- 102100034328 Rab GDP dissociation inhibitor beta Human genes 0.000 description 2
- 102100040854 Ras GTPase-activating protein-binding protein 1 Human genes 0.000 description 2
- 102100040857 Ras GTPase-activating protein-binding protein 2 Human genes 0.000 description 2
- 102100030800 Ras suppressor protein 1 Human genes 0.000 description 2
- 102100022288 Ras-related protein Rab-14 Human genes 0.000 description 2
- 102100025234 Receptor of activated protein C kinase 1 Human genes 0.000 description 2
- 102100029771 Remodeling and spacing factor 1 Human genes 0.000 description 2
- 102100035525 Replication protein A 32 kDa subunit Human genes 0.000 description 2
- 102100035729 Replication protein A 70 kDa DNA-binding subunit Human genes 0.000 description 2
- 102100029831 Reticulon-4 Human genes 0.000 description 2
- 102100021433 Rho GTPase-activating protein 1 Human genes 0.000 description 2
- 102100027610 Rho-related GTP-binding protein RhoC Human genes 0.000 description 2
- 102100037968 Ribonuclease inhibitor Human genes 0.000 description 2
- 102100035066 Ribosomal L1 domain-containing protein 1 Human genes 0.000 description 2
- 102100035119 Ribosome biogenesis protein WDR12 Human genes 0.000 description 2
- 102100023542 Ribosome-binding protein 1 Human genes 0.000 description 2
- 102100027160 RuvB-like 1 Human genes 0.000 description 2
- 102100027092 RuvB-like 2 Human genes 0.000 description 2
- 102100023361 SAP domain-containing ribonucleoprotein Human genes 0.000 description 2
- 102100024868 SH3 domain-binding protein 1 Human genes 0.000 description 2
- 102100027242 SNW domain-containing protein 1 Human genes 0.000 description 2
- 102100025491 SRA stem-loop-interacting RNA-binding protein, mitochondrial Human genes 0.000 description 2
- 102100024793 SWI/SNF complex subunit SMARCC1 Human genes 0.000 description 2
- 101100501116 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) TUF1 gene Proteins 0.000 description 2
- 102100027732 Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Human genes 0.000 description 2
- 102100023840 Selenoprotein H Human genes 0.000 description 2
- 102100027980 Semaphorin-3C Human genes 0.000 description 2
- 102100027068 Septin-11 Human genes 0.000 description 2
- 102100038230 Serine beta-lactamase-like protein LACTB, mitochondrial Human genes 0.000 description 2
- 102100034606 Serine hydroxymethyltransferase, mitochondrial Human genes 0.000 description 2
- 102100033835 Serine protease 23 Human genes 0.000 description 2
- 102100021119 Serine protease HTRA1 Human genes 0.000 description 2
- 102100033197 Serine protease HTRA3 Human genes 0.000 description 2
- 102100037044 Serine/arginine-rich splicing factor 1 Human genes 0.000 description 2
- 102100036122 Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Human genes 0.000 description 2
- 102100034470 Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Human genes 0.000 description 2
- 102100038901 Serine/threonine-protein phosphatase PGAM5, mitochondrial Human genes 0.000 description 2
- 102100036033 Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Human genes 0.000 description 2
- 102100037764 Serine/threonine-protein phosphatase PP1-beta catalytic subunit Human genes 0.000 description 2
- 102100023789 Signal peptidase complex subunit 3 Human genes 0.000 description 2
- 102100037082 Signal recognition particle 14 kDa protein Human genes 0.000 description 2
- 101710089523 Signal recognition particle 14 kDa protein Proteins 0.000 description 2
- 101710131307 Signal recognition particle 9 kDa protein Proteins 0.000 description 2
- 102100022055 Signal recognition particle 9 kDa protein Human genes 0.000 description 2
- 102100027315 Signal recognition particle subunit SRP72 Human genes 0.000 description 2
- 101710132545 Signal recognition particle subunit SRP72 Proteins 0.000 description 2
- 102100029719 Single-stranded DNA-binding protein, mitochondrial Human genes 0.000 description 2
- 102000018674 Sodium Channels Human genes 0.000 description 2
- 108010052164 Sodium Channels Proteins 0.000 description 2
- 102100031874 Spectrin alpha chain, non-erythrocytic 1 Human genes 0.000 description 2
- 101710109667 Spectrin beta chain Proteins 0.000 description 2
- 102100022445 Spermatogenesis-associated serine-rich protein 2 Human genes 0.000 description 2
- 102100024239 Sphingosine-1-phosphate lyase 1 Human genes 0.000 description 2
- 102100031713 Splicing factor 3A subunit 1 Human genes 0.000 description 2
- 102100031711 Splicing factor 3B subunit 1 Human genes 0.000 description 2
- 102100031436 Splicing factor 3B subunit 2 Human genes 0.000 description 2
- 102100021815 Splicing factor 3B subunit 4 Human genes 0.000 description 2
- 102100035034 Splicing factor U2AF 26 kDa subunit Human genes 0.000 description 2
- 102100021996 Staphylococcal nuclease domain-containing protein 1 Human genes 0.000 description 2
- 102100024172 Stomatin-like protein 2, mitochondrial Human genes 0.000 description 2
- 102100022760 Stress-70 protein, mitochondrial Human genes 0.000 description 2
- 102100023532 Synaptic functional regulator FMR1 Human genes 0.000 description 2
- 102100030545 Synaptosomal-associated protein 23 Human genes 0.000 description 2
- 101710097837 T-complex protein 1 subunit alpha Proteins 0.000 description 2
- 102100028679 T-complex protein 1 subunit beta Human genes 0.000 description 2
- 102100029958 T-complex protein 1 subunit delta Human genes 0.000 description 2
- 102100029886 T-complex protein 1 subunit epsilon Human genes 0.000 description 2
- 102100036476 T-complex protein 1 subunit eta Human genes 0.000 description 2
- 102100036049 T-complex protein 1 subunit gamma Human genes 0.000 description 2
- 102100026311 T-complex protein 1 subunit theta Human genes 0.000 description 2
- 102100030664 T-complex protein 1 subunit zeta Human genes 0.000 description 2
- 102100040347 TAR DNA-binding protein 43 Human genes 0.000 description 2
- 102100040238 TBC1 domain family member 1 Human genes 0.000 description 2
- 102100036434 THO complex subunit 4 Human genes 0.000 description 2
- 102100036855 TRIO and F-actin-binding protein Human genes 0.000 description 2
- 101150026786 TUFM gene Proteins 0.000 description 2
- 102100023276 Tau-tubulin kinase 2 Human genes 0.000 description 2
- 102100031208 Thioredoxin reductase 1, cytoplasmic Human genes 0.000 description 2
- 102100039309 Thrombospondin type-1 domain-containing protein 4 Human genes 0.000 description 2
- 102100036034 Thrombospondin-1 Human genes 0.000 description 2
- 102100033523 Thy-1 membrane glycoprotein Human genes 0.000 description 2
- 102100029689 Thyroid hormone receptor-associated protein 3 Human genes 0.000 description 2
- 102100034686 Tight junction protein ZO-1 Human genes 0.000 description 2
- 102100026637 Tight junction protein ZO-2 Human genes 0.000 description 2
- 102100028601 Transaldolase Human genes 0.000 description 2
- 102100026155 Transcription factor A, mitochondrial Human genes 0.000 description 2
- 102100026043 Transcription factor BTF3 Human genes 0.000 description 2
- 102100024276 Transcription factor SOX-3 Human genes 0.000 description 2
- 102100022387 Transforming protein RhoA Human genes 0.000 description 2
- 102100031013 Transgelin Human genes 0.000 description 2
- 102100026231 Translocon-associated protein subunit alpha Human genes 0.000 description 2
- 102100026226 Translocon-associated protein subunit delta Human genes 0.000 description 2
- 102100024180 Transmembrane emp24 domain-containing protein 10 Human genes 0.000 description 2
- 102100036760 Transmembrane emp24 domain-containing protein 9 Human genes 0.000 description 2
- 102100025755 Transmembrane protein 165 Human genes 0.000 description 2
- 102100033530 Transmembrane protein 43 Human genes 0.000 description 2
- 102100036216 Tricarboxylate transport protein, mitochondrial Human genes 0.000 description 2
- 102100033598 Triosephosphate isomerase Human genes 0.000 description 2
- 108010039203 Tripeptidyl-Peptidase 1 Proteins 0.000 description 2
- 102100034197 Tripeptidyl-peptidase 1 Human genes 0.000 description 2
- 102100035287 Tropomodulin-3 Human genes 0.000 description 2
- 101710128188 Tropomyosin alpha-1 chain Proteins 0.000 description 2
- 102100024944 Tropomyosin alpha-4 chain Human genes 0.000 description 2
- 102100034300 Tryptophan-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100028969 Tubulin alpha-1B chain Human genes 0.000 description 2
- 102100028985 Tubulin alpha-1C chain Human genes 0.000 description 2
- 102100025239 Tubulin alpha-4A chain Human genes 0.000 description 2
- 102100036790 Tubulin beta-3 chain Human genes 0.000 description 2
- 102100036788 Tubulin beta-4A chain Human genes 0.000 description 2
- 102100036821 Tubulin beta-4B chain Human genes 0.000 description 2
- 102100030303 Tubulin beta-6 chain Human genes 0.000 description 2
- 102100033469 Tubulointerstitial nephritis antigen-like Human genes 0.000 description 2
- 102100021575 Tyrosine-protein kinase BAZ1B Human genes 0.000 description 2
- 102100022013 U1 small nuclear ribonucleoprotein A Human genes 0.000 description 2
- 102100034465 U2 small nuclear ribonucleoprotein A' Human genes 0.000 description 2
- 102100032497 U3 small nucleolar ribonucleoprotein protein MPP10 Human genes 0.000 description 2
- 102100036230 U5 small nuclear ribonucleoprotein 200 kDa helicase Human genes 0.000 description 2
- 102100037229 UAP56-interacting factor Human genes 0.000 description 2
- 102100029640 UDP-glucose 6-dehydrogenase Human genes 0.000 description 2
- 102100037176 Ubiquitin carboxyl-terminal hydrolase 24 Human genes 0.000 description 2
- 102100040461 Ubiquitin thioesterase OTUB1 Human genes 0.000 description 2
- 102100023341 Ubiquitin-40S ribosomal protein S27a Human genes 0.000 description 2
- 102100036638 Unconventional myosin-Id Human genes 0.000 description 2
- 102100031834 Unconventional myosin-VI Human genes 0.000 description 2
- 102100029836 Unconventional myosin-XV Human genes 0.000 description 2
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 2
- 102100020737 V-type proton ATPase 116 kDa subunit a 4 Human genes 0.000 description 2
- 102100033476 V-type proton ATPase subunit B, brain isoform Human genes 0.000 description 2
- 102100037090 V-type proton ATPase subunit S1 Human genes 0.000 description 2
- 102100036507 V-type proton ATPase subunit d 1 Human genes 0.000 description 2
- 102100028298 Vacuolar protein sorting-associated protein VTA1 homolog Human genes 0.000 description 2
- 102100025607 Valine-tRNA ligase Human genes 0.000 description 2
- 102100021164 Vasodilator-stimulated phosphoprotein Human genes 0.000 description 2
- 102100028437 Versican core protein Human genes 0.000 description 2
- 102100037438 Very-long-chain 3-oxoacyl-CoA reductase Human genes 0.000 description 2
- 102100028753 Vesicle-trafficking protein SEC22b Human genes 0.000 description 2
- 102100037814 Vigilin Human genes 0.000 description 2
- 102100037820 Voltage-dependent anion-selective channel protein 1 Human genes 0.000 description 2
- 102100036551 WD repeat-containing protein 1 Human genes 0.000 description 2
- 102100029449 WD repeat-containing protein 61 Human genes 0.000 description 2
- 102100029042 Zinc finger protein 469 Human genes 0.000 description 2
- 230000004075 alteration Effects 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 238000002669 amniocentesis Methods 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229940121375 antifungal agent Drugs 0.000 description 2
- 239000012472 biological sample Substances 0.000 description 2
- 238000000339 bright-field microscopy Methods 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 2
- ZBDGIMZKOJALMU-MVWQHRGOSA-N dinactin Chemical compound C[C@@H]([C@@H]1CC[C@@H](O1)C[C@@H](OC(=O)[C@@H](C)[C@H]1CC[C@H](O1)C[C@@H](C)OC(=O)[C@@H](C)[C@@H]1CC[C@@H](O1)C[C@H](CC)OC(=O)[C@H]1C)CC)C(=O)O[C@H](C)C[C@@H]2CC[C@H]1O2 ZBDGIMZKOJALMU-MVWQHRGOSA-N 0.000 description 2
- 238000007876 drug discovery Methods 0.000 description 2
- 102100030495 eIF-2-alpha kinase activator GCN1 Human genes 0.000 description 2
- 102100035859 eIF5-mimic protein 2 Human genes 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 108700002148 exportin 1 Proteins 0.000 description 2
- 230000001605 fetal effect Effects 0.000 description 2
- 210000003754 fetus Anatomy 0.000 description 2
- 239000012737 fresh medium Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 102000034356 gene-regulatory proteins Human genes 0.000 description 2
- 108091006104 gene-regulatory proteins Proteins 0.000 description 2
- 229940096919 glycogen Drugs 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 238000013537 high throughput screening Methods 0.000 description 2
- 229940099552 hyaluronan Drugs 0.000 description 2
- KIUKXJAPPMFGSW-MNSSHETKSA-N hyaluronan Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)C1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H](C(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-MNSSHETKSA-N 0.000 description 2
- 229920002674 hyaluronan Polymers 0.000 description 2
- 101150095658 ilf2 gene Proteins 0.000 description 2
- 238000012606 in vitro cell culture Methods 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 230000010354 integration Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 108010028309 kalinin Proteins 0.000 description 2
- 108010052219 lamin B2 Proteins 0.000 description 2
- 108010074917 microsomal glutathione S-transferase-I Proteins 0.000 description 2
- 210000004165 myocardium Anatomy 0.000 description 2
- NFVJNJQRWPQVOA-UHFFFAOYSA-N n-[2-chloro-5-(trifluoromethyl)phenyl]-2-[3-(4-ethyl-5-ethylsulfanyl-1,2,4-triazol-3-yl)piperidin-1-yl]acetamide Chemical compound CCN1C(SCC)=NN=C1C1CN(CC(=O)NC=2C(=CC=C(C=2)C(F)(F)F)Cl)CCC1 NFVJNJQRWPQVOA-UHFFFAOYSA-N 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 210000002826 placenta Anatomy 0.000 description 2
- 229920002791 poly-4-hydroxybutyrate Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 102100032318 pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Human genes 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- 230000000644 propagated effect Effects 0.000 description 2
- 230000001902 propagating effect Effects 0.000 description 2
- 239000012268 protein inhibitor Substances 0.000 description 2
- 229940121649 protein inhibitor Drugs 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- 238000011002 quantification Methods 0.000 description 2
- 102100029526 rRNA 2'-O-methyltransferase fibrillarin Human genes 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 108010039827 snRNP Core Proteins Proteins 0.000 description 2
- 239000008223 sterile water Substances 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000012876 topography Methods 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- 108010054220 vasodilator-stimulated phosphoprotein Proteins 0.000 description 2
- 238000001262 western blot Methods 0.000 description 2
- UJCHIZDEQZMODR-BYPYZUCNSA-N (2r)-2-acetamido-3-sulfanylpropanamide Chemical compound CC(=O)N[C@@H](CS)C(N)=O UJCHIZDEQZMODR-BYPYZUCNSA-N 0.000 description 1
- WMLBMYGMIFJTCS-HUROMRQRSA-N (2r,3s,5r)-2-[(9-phenylxanthen-9-yl)oxymethyl]-5-purin-9-yloxolan-3-ol Chemical compound C([C@H]1O[C@H](C[C@@H]1O)N1C2=NC=NC=C2N=C1)OC1(C2=CC=CC=C2OC2=CC=CC=C21)C1=CC=CC=C1 WMLBMYGMIFJTCS-HUROMRQRSA-N 0.000 description 1
- HONKEGXLWUDTCF-YFKPBYRVSA-N (2s)-2-amino-2-methyl-4-phosphonobutanoic acid Chemical compound OC(=O)[C@](N)(C)CCP(O)(O)=O HONKEGXLWUDTCF-YFKPBYRVSA-N 0.000 description 1
- KUBDPRSHRVANQQ-NSOVKSMOSA-N (2s,6s)-6-(4-tert-butylphenyl)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2h-pyridine-5-carboxylic acid Chemical compound C1=CC(C)=CC=C1[C@H]1N(S(=O)(=O)C=2C=CC(C)=CC=2)[C@@H](C=2C=CC(=CC=2)C(C)(C)C)C(C(O)=O)=CC1 KUBDPRSHRVANQQ-NSOVKSMOSA-N 0.000 description 1
- QYAPHLRPFNSDNH-MRFRVZCGSA-N (4s,4as,5as,6s,12ar)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O QYAPHLRPFNSDNH-MRFRVZCGSA-N 0.000 description 1
- PJOHVEQSYPOERL-SHEAVXILSA-N (e)-n-[(4r,4as,7ar,12br)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-yl]-3-(4-methylphenyl)prop-2-enamide Chemical compound C1=CC(C)=CC=C1\C=C\C(=O)N[C@]1(CCC(=O)[C@@H]2O3)[C@H]4CC5=CC=C(O)C3=C5[C@]12CCN4CC1CC1 PJOHVEQSYPOERL-SHEAVXILSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- 102000003925 1,4-alpha-Glucan Branching Enzyme Human genes 0.000 description 1
- 108090000344 1,4-alpha-Glucan Branching Enzyme Proteins 0.000 description 1
- 102100028734 1,4-alpha-glucan-branching enzyme Human genes 0.000 description 1
- 101710100728 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-3 Proteins 0.000 description 1
- 102100038366 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Human genes 0.000 description 1
- 102300057116 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 isoform 3 Human genes 0.000 description 1
- 108030003698 1-phosphatidylinositol-3-phosphate 5-kinases Proteins 0.000 description 1
- 101710122378 10 kDa heat shock protein, mitochondrial Proteins 0.000 description 1
- 102100039583 116 kDa U5 small nuclear ribonucleoprotein component Human genes 0.000 description 1
- 102300041190 116 kDa U5 small nuclear ribonucleoprotein component isoform 3 Human genes 0.000 description 1
- 102100021408 14-3-3 protein beta/alpha Human genes 0.000 description 1
- 102300043086 14-3-3 protein beta/alpha isoform Short Human genes 0.000 description 1
- 101710125124 14-3-3 protein epsilon Proteins 0.000 description 1
- 101710188276 14-3-3 protein eta Proteins 0.000 description 1
- 101710191812 14-3-3 protein gamma Proteins 0.000 description 1
- 101710108995 14-3-3 protein theta Proteins 0.000 description 1
- 101710183121 14-3-3 protein zeta/delta Proteins 0.000 description 1
- 102100021403 2,4-dienoyl-CoA reductase [(3E)-enoyl-CoA-producing], mitochondrial Human genes 0.000 description 1
- AQQSXKSWTNWXKR-UHFFFAOYSA-N 2-(2-phenylphenanthro[9,10-d]imidazol-3-yl)acetic acid Chemical compound C1(=CC=CC=C1)C1=NC2=C(N1CC(=O)O)C1=CC=CC=C1C=1C=CC=CC=12 AQQSXKSWTNWXKR-UHFFFAOYSA-N 0.000 description 1
- QZDDFQLIQRYMBV-UHFFFAOYSA-N 2-[3-nitro-2-(2-nitrophenyl)-4-oxochromen-8-yl]acetic acid Chemical compound OC(=O)CC1=CC=CC(C(C=2[N+]([O-])=O)=O)=C1OC=2C1=CC=CC=C1[N+]([O-])=O QZDDFQLIQRYMBV-UHFFFAOYSA-N 0.000 description 1
- 108010030844 2-methylcitrate synthase Proteins 0.000 description 1
- 101710104032 2-oxoglutarate dehydrogenase, mitochondrial Proteins 0.000 description 1
- 108050001383 26S Proteasome non-ATPase regulatory subunit 12 Proteins 0.000 description 1
- 108050001340 26S Proteasome regulatory subunit 4 Proteins 0.000 description 1
- 108050001326 26S Proteasome regulatory subunit 6A Proteins 0.000 description 1
- 108050001327 26S Proteasome regulatory subunit 6B Proteins 0.000 description 1
- 108050001342 26S Proteasome regulatory subunit 7 Proteins 0.000 description 1
- 101710198708 26S protease regulatory subunit 6A Proteins 0.000 description 1
- 102300061525 26S proteasome non-ATPase regulatory subunit 1 isoform 2 Human genes 0.000 description 1
- 102100040964 26S proteasome non-ATPase regulatory subunit 11 Human genes 0.000 description 1
- 102300061398 26S proteasome non-ATPase regulatory subunit 11 isoform 2 Human genes 0.000 description 1
- 108010027312 26S proteasome non-ATPase regulatory subunit 13 Proteins 0.000 description 1
- 101710113895 26S proteasome non-ATPase regulatory subunit 14 Proteins 0.000 description 1
- 101710091328 26S proteasome non-ATPase regulatory subunit 2 Proteins 0.000 description 1
- 101710091327 26S proteasome non-ATPase regulatory subunit 3 Proteins 0.000 description 1
- 101710091323 26S proteasome non-ATPase regulatory subunit 5 Proteins 0.000 description 1
- 102100033097 26S proteasome non-ATPase regulatory subunit 6 Human genes 0.000 description 1
- 102300060648 26S proteasome non-ATPase regulatory subunit 6 isoform 4 Human genes 0.000 description 1
- 101710091322 26S proteasome non-ATPase regulatory subunit 7 Proteins 0.000 description 1
- 101710091330 26S proteasome non-ATPase regulatory subunit 8 Proteins 0.000 description 1
- 108050001312 26S proteasome regulatory subunit 10B Proteins 0.000 description 1
- 108700036240 26S proteasome regulatory subunit 8 Proteins 0.000 description 1
- 102100029829 28S ribosomal protein S29, mitochondrial Human genes 0.000 description 1
- 102300061916 28S ribosomal protein S29, mitochondrial isoform 3 Human genes 0.000 description 1
- 102100024429 28S ribosomal protein S34, mitochondrial Human genes 0.000 description 1
- 101710083550 28S ribosomal protein S35, mitochondrial Proteins 0.000 description 1
- 108010046716 3-Methyl-2-Oxobutanoate Dehydrogenase (Lipoamide) Proteins 0.000 description 1
- 102100039358 3-hydroxyacyl-CoA dehydrogenase type-2 Human genes 0.000 description 1
- 102300052316 3-hydroxyacyl-CoA dehydrogenase type-2 isoform 2 Human genes 0.000 description 1
- 101710186512 3-ketoacyl-CoA thiolase Proteins 0.000 description 1
- 101710174731 3-ketoacyl-CoA thiolase, mitochondrial Proteins 0.000 description 1
- 101710107939 39S ribosomal protein L11, mitochondrial Proteins 0.000 description 1
- 101710195464 39S ribosomal protein L28, mitochondrial Proteins 0.000 description 1
- 101710172519 39S ribosomal protein L34, mitochondrial Proteins 0.000 description 1
- 102100040302 39S ribosomal protein L41, mitochondrial Human genes 0.000 description 1
- 101710131777 40S ribosomal protein S10 Proteins 0.000 description 1
- 101710131778 40S ribosomal protein S11 Proteins 0.000 description 1
- 101710131789 40S ribosomal protein S12 Proteins 0.000 description 1
- 101710131790 40S ribosomal protein S13 Proteins 0.000 description 1
- 102100030693 40S ribosomal protein S14 Human genes 0.000 description 1
- 101710131787 40S ribosomal protein S14 Proteins 0.000 description 1
- 101710131788 40S ribosomal protein S15 Proteins 0.000 description 1
- 101710131774 40S ribosomal protein S16 Proteins 0.000 description 1
- 101710131775 40S ribosomal protein S17 Proteins 0.000 description 1
- 101710131771 40S ribosomal protein S18 Proteins 0.000 description 1
- 101710131772 40S ribosomal protein S19 Proteins 0.000 description 1
- 101710107640 40S ribosomal protein S2 Proteins 0.000 description 1
- 102100023415 40S ribosomal protein S20 Human genes 0.000 description 1
- 102300033956 40S ribosomal protein S20 isoform 2 Human genes 0.000 description 1
- 101710131793 40S ribosomal protein S23 Proteins 0.000 description 1
- 102100033449 40S ribosomal protein S24 Human genes 0.000 description 1
- 102300054517 40S ribosomal protein S24 isoform 2 Human genes 0.000 description 1
- 101710131810 40S ribosomal protein S25 Proteins 0.000 description 1
- 101710131792 40S ribosomal protein S26 Proteins 0.000 description 1
- 101710170466 40S ribosomal protein S27-like Proteins 0.000 description 1
- 101710131798 40S ribosomal protein S28 Proteins 0.000 description 1
- 101710131796 40S ribosomal protein S29 Proteins 0.000 description 1
- 101710107637 40S ribosomal protein S3 Proteins 0.000 description 1
- 102400001328 40S ribosomal protein S30 Human genes 0.000 description 1
- 101710131923 40S ribosomal protein S30 Proteins 0.000 description 1
- 101710131943 40S ribosomal protein S3a Proteins 0.000 description 1
- 101710198924 40S ribosomal protein S4, X isoform Proteins 0.000 description 1
- 101710136698 40S ribosomal protein S4, Y isoform 1 Proteins 0.000 description 1
- 101710107635 40S ribosomal protein S5 Proteins 0.000 description 1
- 101710107638 40S ribosomal protein S6 Proteins 0.000 description 1
- 101710107649 40S ribosomal protein S7 Proteins 0.000 description 1
- 101710107648 40S ribosomal protein S8 Proteins 0.000 description 1
- 101710107647 40S ribosomal protein S9 Proteins 0.000 description 1
- 101710092702 47 kDa protein Proteins 0.000 description 1
- 102100033400 4F2 cell-surface antigen heavy chain Human genes 0.000 description 1
- 102300058014 4F2 cell-surface antigen heavy chain isoform 3 Human genes 0.000 description 1
- 102300039295 6-phosphogluconate dehydrogenase, decarboxylating isoform 2 Human genes 0.000 description 1
- 101710154868 60 kDa heat shock protein, mitochondrial Proteins 0.000 description 1
- 102100040881 60S acidic ribosomal protein P0 Human genes 0.000 description 1
- 102100033416 60S acidic ribosomal protein P1 Human genes 0.000 description 1
- 102100026112 60S acidic ribosomal protein P2 Human genes 0.000 description 1
- 101710187296 60S ribosomal protein L10 Proteins 0.000 description 1
- 101710155230 60S ribosomal protein L10a Proteins 0.000 description 1
- 101710187292 60S ribosomal protein L11 Proteins 0.000 description 1
- 101710187298 60S ribosomal protein L12 Proteins 0.000 description 1
- 101710187793 60S ribosomal protein L13 Proteins 0.000 description 1
- 101710152719 60S ribosomal protein L13a Proteins 0.000 description 1
- 101710187794 60S ribosomal protein L14 Proteins 0.000 description 1
- 101710187795 60S ribosomal protein L15 Proteins 0.000 description 1
- 102100023990 60S ribosomal protein L17 Human genes 0.000 description 1
- 102300036751 60S ribosomal protein L17 isoform 3 Human genes 0.000 description 1
- 101710187807 60S ribosomal protein L18 Proteins 0.000 description 1
- 101710152821 60S ribosomal protein L18-A Proteins 0.000 description 1
- 101710187808 60S ribosomal protein L19 Proteins 0.000 description 1
- 101710187789 60S ribosomal protein L21 Proteins 0.000 description 1
- 101710187788 60S ribosomal protein L22 Proteins 0.000 description 1
- 101710187798 60S ribosomal protein L23 Proteins 0.000 description 1
- 101710187893 60S ribosomal protein L24 Proteins 0.000 description 1
- 101710187892 60S ribosomal protein L27 Proteins 0.000 description 1
- 101710154451 60S ribosomal protein L27-A Proteins 0.000 description 1
- 101710187898 60S ribosomal protein L28 Proteins 0.000 description 1
- 101710187787 60S ribosomal protein L29 Proteins 0.000 description 1
- 101710117444 60S ribosomal protein L3 Proteins 0.000 description 1
- 101710187886 60S ribosomal protein L30 Proteins 0.000 description 1
- 102100038237 60S ribosomal protein L30 Human genes 0.000 description 1
- 101710187890 60S ribosomal protein L31 Proteins 0.000 description 1
- 101710187894 60S ribosomal protein L32 Proteins 0.000 description 1
- 101710187889 60S ribosomal protein L34 Proteins 0.000 description 1
- 108700037626 60S ribosomal protein L35 Proteins 0.000 description 1
- 101710155187 60S ribosomal protein L35a Proteins 0.000 description 1
- 101710187872 60S ribosomal protein L36 Proteins 0.000 description 1
- 101710155194 60S ribosomal protein L37a Proteins 0.000 description 1
- 101710187873 60S ribosomal protein L38 Proteins 0.000 description 1
- 101710117426 60S ribosomal protein L4 Proteins 0.000 description 1
- 102100040623 60S ribosomal protein L41 Human genes 0.000 description 1
- 101710117446 60S ribosomal protein L5 Proteins 0.000 description 1
- 101710117434 60S ribosomal protein L6 Proteins 0.000 description 1
- 101710117443 60S ribosomal protein L7 Proteins 0.000 description 1
- 101710187823 60S ribosomal protein L7a Proteins 0.000 description 1
- 101710117436 60S ribosomal protein L8 Proteins 0.000 description 1
- 101710117435 60S ribosomal protein L9 Proteins 0.000 description 1
- 102100027398 A disintegrin and metalloproteinase with thrombospondin motifs 1 Human genes 0.000 description 1
- 101710170216 A-kinase anchor protein 12 Proteins 0.000 description 1
- 102100024049 A-kinase anchor protein 13 Human genes 0.000 description 1
- 102300043140 A-kinase anchor protein 13 isoform 2 Human genes 0.000 description 1
- 108091005660 ADAMTS1 Proteins 0.000 description 1
- 101710148586 ADP,ATP carrier protein 1 Proteins 0.000 description 1
- 101710111394 ADP,ATP carrier protein 1, mitochondrial Proteins 0.000 description 1
- 101710148588 ADP,ATP carrier protein 2 Proteins 0.000 description 1
- 101710165307 ADP,ATP carrier protein 2, mitochondrial Proteins 0.000 description 1
- 101710148593 ADP,ATP carrier protein 3 Proteins 0.000 description 1
- 102000034257 ADP-Ribosylation Factor 6 Human genes 0.000 description 1
- 101710148652 ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 2 Proteins 0.000 description 1
- 101710139744 ADP-ribosylation factor 3 Proteins 0.000 description 1
- 101710139741 ADP-ribosylation factor 4 Proteins 0.000 description 1
- 102100039900 ADP-ribosylation factor 6 Human genes 0.000 description 1
- 101710102716 ADP/ATP translocase 1 Proteins 0.000 description 1
- 101710102718 ADP/ATP translocase 2 Proteins 0.000 description 1
- 101710102715 ADP/ATP translocase 3 Proteins 0.000 description 1
- 101150054149 ANGPTL4 gene Proteins 0.000 description 1
- 102100034482 AP-1 complex subunit beta-1 Human genes 0.000 description 1
- 102300049409 AP-1 complex subunit beta-1 isoform B Human genes 0.000 description 1
- 102100022974 AP-2 complex subunit alpha-2 Human genes 0.000 description 1
- 102300039048 AP-2 complex subunit alpha-2 isoform 2 Human genes 0.000 description 1
- 102100033347 AP-2 complex subunit beta Human genes 0.000 description 1
- 102300047263 AP-2 complex subunit beta isoform 2 Human genes 0.000 description 1
- 102100031315 AP-2 complex subunit mu Human genes 0.000 description 1
- 102300044793 AP-2 complex subunit mu isoform 2 Human genes 0.000 description 1
- 108050004816 AP-2 complex subunit sigma Proteins 0.000 description 1
- 102100033926 AP-3 complex subunit delta-1 Human genes 0.000 description 1
- 102300049310 AP-3 complex subunit delta-1 isoform 4 Human genes 0.000 description 1
- 101710081913 AT-rich interactive domain-containing protein 1A Proteins 0.000 description 1
- 108090000662 ATP citrate synthases Proteins 0.000 description 1
- 108010022579 ATP dependent 26S protease Proteins 0.000 description 1
- 101710201407 ATP synthase F(0) complex subunit B1, mitochondrial Proteins 0.000 description 1
- 101710117604 ATP synthase subunit O, mitochondrial Proteins 0.000 description 1
- 101710170662 ATP synthase subunit alpha, mitochondrial Proteins 0.000 description 1
- 101710134855 ATP synthase subunit beta, mitochondrial Proteins 0.000 description 1
- 101710095357 ATP synthase subunit epsilon-like protein, mitochondrial Proteins 0.000 description 1
- 101710152997 ATP synthase subunit f, mitochondrial Proteins 0.000 description 1
- 101710122337 ATP synthase subunit g, mitochondrial Proteins 0.000 description 1
- 102100032763 ATP synthase subunit gamma, mitochondrial Human genes 0.000 description 1
- 102300047145 ATP synthase subunit gamma, mitochondrial isoform Heart Human genes 0.000 description 1
- 101710125293 ATP-dependent 6-phosphofructokinase, platelet type Proteins 0.000 description 1
- 101710164022 ATP-dependent RNA helicase A Proteins 0.000 description 1
- 101710188756 ATP-dependent RNA helicase DDX1 Proteins 0.000 description 1
- 101710156115 ATP-dependent RNA helicase DDX18 Proteins 0.000 description 1
- 101710156069 ATP-dependent RNA helicase DDX3X Proteins 0.000 description 1
- 102100038266 ATP-dependent RNA helicase DDX54 Human genes 0.000 description 1
- 102300039691 ATP-dependent RNA helicase DDX54 isoform 2 Human genes 0.000 description 1
- 101710188757 ATP-dependent RNA helicase ddx6 Proteins 0.000 description 1
- 102100033350 ATP-dependent translocase ABCB1 Human genes 0.000 description 1
- 102100035972 ATPase GET3 Human genes 0.000 description 1
- 101710092669 ATPase asna-1 Proteins 0.000 description 1
- 101710086606 ATPase family AAA domain-containing protein 3A Proteins 0.000 description 1
- 101710101868 Acetyl-CoA acetyltransferase, mitochondrial Proteins 0.000 description 1
- 101710159080 Aconitate hydratase A Proteins 0.000 description 1
- 101710159078 Aconitate hydratase B Proteins 0.000 description 1
- 101710192004 Actin, aortic smooth muscle Proteins 0.000 description 1
- 102100022900 Actin, cytoplasmic 1 Human genes 0.000 description 1
- 101710119043 Actin, cytoplasmic 1 Proteins 0.000 description 1
- 101710184997 Actin, gamma-enteric smooth muscle Proteins 0.000 description 1
- 101710165903 Actin-like protein 6A Proteins 0.000 description 1
- 102100021581 Actin-related protein 10 Human genes 0.000 description 1
- 102000004373 Actin-related protein 2 Human genes 0.000 description 1
- 108090000963 Actin-related protein 2 Proteins 0.000 description 1
- 102100038820 Actin-related protein 2/3 complex subunit 1B Human genes 0.000 description 1
- 102100021636 Actin-related protein 2/3 complex subunit 2 Human genes 0.000 description 1
- 102100033889 Actin-related protein 2/3 complex subunit 3 Human genes 0.000 description 1
- 102100033888 Actin-related protein 2/3 complex subunit 4 Human genes 0.000 description 1
- 102100033892 Actin-related protein 2/3 complex subunit 5 Human genes 0.000 description 1
- 102100026401 Actin-related protein 2/3 complex subunit 5-like protein Human genes 0.000 description 1
- 102000003741 Actin-related protein 3 Human genes 0.000 description 1
- 108090000104 Actin-related protein 3 Proteins 0.000 description 1
- 102100021031 Activating signal cointegrator 1 complex subunit 2 Human genes 0.000 description 1
- 102000057234 Acyl transferases Human genes 0.000 description 1
- 108700016155 Acyl transferases Proteins 0.000 description 1
- 108010001058 Acyl-CoA Dehydrogenase Proteins 0.000 description 1
- 102000002735 Acyl-CoA Dehydrogenase Human genes 0.000 description 1
- 108090001079 Adenine Nucleotide Translocator 1 Proteins 0.000 description 1
- 108020002202 Adenosylhomocysteinase Proteins 0.000 description 1
- 102100023809 Adipocyte plasma membrane-associated protein Human genes 0.000 description 1
- 102300046624 Adipocyte plasma membrane-associated protein isoform 2 Human genes 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 102300045971 Agrin isoform 6 Human genes 0.000 description 1
- 101710087087 Alanine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101710150218 Aldehyde dehydrogenase X, mitochondrial Proteins 0.000 description 1
- 102100024948 Aldehyde dehydrogenase family 16 member A1 Human genes 0.000 description 1
- 102300060486 Aldehyde dehydrogenase family 16 member A1 isoform 3 Human genes 0.000 description 1
- 102100033326 Alpha-1B-glycoprotein Human genes 0.000 description 1
- 101710104910 Alpha-1B-glycoprotein Proteins 0.000 description 1
- 102100033312 Alpha-2-macroglobulin Human genes 0.000 description 1
- 101710115082 Alpha-actinin-1 Proteins 0.000 description 1
- 101710115256 Alpha-actinin-4 Proteins 0.000 description 1
- 102100034033 Alpha-adducin Human genes 0.000 description 1
- 102000006589 Alpha-ketoglutarate dehydrogenase Human genes 0.000 description 1
- 108020004306 Alpha-ketoglutarate dehydrogenase Proteins 0.000 description 1
- 101710102450 Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Proteins 0.000 description 1
- APKFDSVGJQXUKY-KKGHZKTASA-N Amphotericin-B Natural products O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1C=CC=CC=CC=CC=CC=CC=C[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 APKFDSVGJQXUKY-KKGHZKTASA-N 0.000 description 1
- 108700042530 Angiopoietin-Like Protein 4 Proteins 0.000 description 1
- 101710085845 Angiopoietin-related protein 4 Proteins 0.000 description 1
- 102100038471 Ankycorbin Human genes 0.000 description 1
- 102100034609 Ankyrin repeat domain-containing protein 17 Human genes 0.000 description 1
- 102300048686 Ankyrin repeat domain-containing protein 17 isoform 2 Human genes 0.000 description 1
- 102000000412 Annexin Human genes 0.000 description 1
- 108050008874 Annexin Proteins 0.000 description 1
- 102000004145 Annexin A1 Human genes 0.000 description 1
- 102100040006 Annexin A1 Human genes 0.000 description 1
- 108090000663 Annexin A1 Proteins 0.000 description 1
- 108090000668 Annexin A2 Proteins 0.000 description 1
- 102000004120 Annexin A3 Human genes 0.000 description 1
- 102100034618 Annexin A3 Human genes 0.000 description 1
- 108090000670 Annexin A3 Proteins 0.000 description 1
- 108090000669 Annexin A4 Proteins 0.000 description 1
- 108090000672 Annexin A5 Proteins 0.000 description 1
- 102000004121 Annexin A5 Human genes 0.000 description 1
- 102100034283 Annexin A5 Human genes 0.000 description 1
- 108090000656 Annexin A6 Proteins 0.000 description 1
- 102000004411 Antithrombin III Human genes 0.000 description 1
- 108090000935 Antithrombin III Proteins 0.000 description 1
- 108010002084 Apoferritins Proteins 0.000 description 1
- 102000005666 Apolipoprotein A-I Human genes 0.000 description 1
- 108010059886 Apolipoprotein A-I Proteins 0.000 description 1
- 102100039986 Apoptosis inhibitor 5 Human genes 0.000 description 1
- 102300042982 Apoptosis inhibitor 5 isoform 1 Human genes 0.000 description 1
- 102100021569 Apoptosis regulator Bcl-2 Human genes 0.000 description 1
- 102100040124 Apoptosis-inducing factor 1, mitochondrial Human genes 0.000 description 1
- 102300054495 Apoptosis-inducing factor 1, mitochondrial isoform 3 Human genes 0.000 description 1
- 101000693933 Arabidopsis thaliana Fructose-bisphosphate aldolase 8, cytosolic Proteins 0.000 description 1
- 101100339431 Arabidopsis thaliana HMGB2 gene Proteins 0.000 description 1
- 101100523940 Arabidopsis thaliana RAD23A gene Proteins 0.000 description 1
- 101100523944 Arabidopsis thaliana RAD23B gene Proteins 0.000 description 1
- 101100194005 Arabidopsis thaliana RAD23C gene Proteins 0.000 description 1
- 101100194006 Arabidopsis thaliana RAD23D gene Proteins 0.000 description 1
- 102100033648 Arf-GAP with Rho-GAP domain, ANK repeat and PH domain-containing protein 3 Human genes 0.000 description 1
- 101710093031 Arginine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101710160288 Asparagine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 102000004625 Aspartate Aminotransferases Human genes 0.000 description 1
- 108010003415 Aspartate Aminotransferases Proteins 0.000 description 1
- 102100034193 Aspartate aminotransferase, mitochondrial Human genes 0.000 description 1
- 101710156826 Aspartate-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101710140787 Aspartyl/asparaginyl beta-hydroxylase Proteins 0.000 description 1
- 102100035730 B-cell receptor-associated protein 31 Human genes 0.000 description 1
- 102300038643 B-cell receptor-associated protein 31 isoform 2 Human genes 0.000 description 1
- 101710118343 Barrier-to-autointegration factor Proteins 0.000 description 1
- 101710151712 Basement membrane-specific heparan sulfate proteoglycan core protein Proteins 0.000 description 1
- 102100032423 Bcl-2-associated transcription factor 1 Human genes 0.000 description 1
- 101710195555 Beta-actin-like protein 2 Proteins 0.000 description 1
- 101710164563 Beta-catenin-like protein 1 Proteins 0.000 description 1
- 108090001138 Biglycan Proteins 0.000 description 1
- 102100035754 Biorientation of chromosomes in cell division protein 1-like 1 Human genes 0.000 description 1
- 102100028728 Bone morphogenetic protein 1 Human genes 0.000 description 1
- 102000004152 Bone morphogenetic protein 1 Human genes 0.000 description 1
- 108030001720 Bontoxilysin Proteins 0.000 description 1
- 101001042041 Bos taurus Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Proteins 0.000 description 1
- 101710087660 Brain acid soluble protein 1 Proteins 0.000 description 1
- 101150060120 C1qbp gene Proteins 0.000 description 1
- 108010008629 CA-125 Antigen Proteins 0.000 description 1
- 108010077333 CAP1-6D Proteins 0.000 description 1
- 101710137355 CCN family member 1 Proteins 0.000 description 1
- 102100037917 CD109 antigen Human genes 0.000 description 1
- 102300046446 CD109 antigen isoform 4 Human genes 0.000 description 1
- 108010070745 CD2-associated protein Proteins 0.000 description 1
- 102100032912 CD44 antigen Human genes 0.000 description 1
- 102300038203 CD44 antigen isoform 10 Human genes 0.000 description 1
- 101710176679 CD59 glycoprotein Proteins 0.000 description 1
- 102000014572 CHFR Human genes 0.000 description 1
- 101710154059 COP9 signalosome complex subunit 5 Proteins 0.000 description 1
- 101710155776 CTP synthase 1 Proteins 0.000 description 1
- 102000000905 Cadherin Human genes 0.000 description 1
- 108050007957 Cadherin Proteins 0.000 description 1
- 102100024154 Cadherin-13 Human genes 0.000 description 1
- 102100036364 Cadherin-2 Human genes 0.000 description 1
- 101000928995 Caenorhabditis elegans Putative deoxyribose-phosphate aldolase Proteins 0.000 description 1
- 101000743841 Caenorhabditis elegans Ras-related protein Rab-10 Proteins 0.000 description 1
- 101710136616 Calcium-binding mitochondrial carrier protein Proteins 0.000 description 1
- 102100034279 Calcium-binding mitochondrial carrier protein Aralar2 Human genes 0.000 description 1
- 102100036290 Calcium-binding mitochondrial carrier protein SCaMC-1 Human genes 0.000 description 1
- 102300033516 Calcium-binding mitochondrial carrier protein SCaMC-1 isoform 2 Human genes 0.000 description 1
- 102100025228 Calcium/calmodulin-dependent protein kinase type II subunit delta Human genes 0.000 description 1
- 102300051029 Calcium/calmodulin-dependent protein kinase type II subunit delta isoform Delta 10 Human genes 0.000 description 1
- 102100024436 Caldesmon Human genes 0.000 description 1
- 102300048301 Caldesmon isoform 4 Human genes 0.000 description 1
- 102000000584 Calmodulin Human genes 0.000 description 1
- 108010041952 Calmodulin Proteins 0.000 description 1
- 102100025580 Calmodulin-1 Human genes 0.000 description 1
- 102100021868 Calnexin Human genes 0.000 description 1
- 102300055921 Calnexin isoform 2 Human genes 0.000 description 1
- 101710124171 Calpain-1 catalytic subunit Proteins 0.000 description 1
- 101710153737 Calpain-2 catalytic subunit Proteins 0.000 description 1
- 102300041536 Calpastatin isoform 10 Human genes 0.000 description 1
- 102100033620 Calponin-1 Human genes 0.000 description 1
- 102300049565 Calponin-1 isoform 2 Human genes 0.000 description 1
- 108050006169 Calponin-2 Proteins 0.000 description 1
- 101710092114 Calponin-3 Proteins 0.000 description 1
- 108090000549 Calreticulin Proteins 0.000 description 1
- 102300055975 Calumenin isoform 3 Human genes 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 101710072528 Caprin-1 Proteins 0.000 description 1
- 101150042805 Caprin1 gene Proteins 0.000 description 1
- 101710145118 Cardiomyopathy-associated protein 5 Proteins 0.000 description 1
- 101710099573 Casein kinase II subunit alpha Proteins 0.000 description 1
- 101710106615 Catenin alpha-1 Proteins 0.000 description 1
- 101710174494 Catenin beta-1 Proteins 0.000 description 1
- 108090000712 Cathepsin B Proteins 0.000 description 1
- 102000004225 Cathepsin B Human genes 0.000 description 1
- 102100021633 Cathepsin B Human genes 0.000 description 1
- 102000003908 Cathepsin D Human genes 0.000 description 1
- 102100032219 Cathepsin D Human genes 0.000 description 1
- 108090000258 Cathepsin D Proteins 0.000 description 1
- 108050005260 Caveolae-associated protein 1 Proteins 0.000 description 1
- 108050007101 Caveolae-associated protein 3 Proteins 0.000 description 1
- 108090000026 Caveolin 1 Proteins 0.000 description 1
- 102000011068 Cdc42 Human genes 0.000 description 1
- 108050007205 Cell cycle and apoptosis regulator protein 2 Proteins 0.000 description 1
- 102100032860 Cell division cycle 5-like protein Human genes 0.000 description 1
- 101710144787 Cell surface glycoprotein MUC18 Proteins 0.000 description 1
- 108010091675 Cellular Apoptosis Susceptibility Protein Proteins 0.000 description 1
- 101710084078 Centromere protein V Proteins 0.000 description 1
- 101000845237 Cereibacter sphaeroides Tryptophan-rich sensory protein Proteins 0.000 description 1
- 101000986346 Chironomus tentans High mobility group protein I Proteins 0.000 description 1
- 108050001549 Chloride intracellular channel protein 1 Proteins 0.000 description 1
- 101710185644 Chloride intracellular channel protein 4 Proteins 0.000 description 1
- 101710185645 Chloride intracellular channel protein 6 Proteins 0.000 description 1
- 108010009685 Cholinergic Receptors Proteins 0.000 description 1
- 102100034330 Chromaffin granule amine transporter Human genes 0.000 description 1
- 101710137716 Chromaffin granule amine transporter Proteins 0.000 description 1
- 102100036956 Chromatin target of PRMT1 protein Human genes 0.000 description 1
- 102100032919 Chromobox protein homolog 1 Human genes 0.000 description 1
- 102100031668 Chromodomain Y-like protein Human genes 0.000 description 1
- 102300041910 Chromodomain Y-like protein isoform 2 Human genes 0.000 description 1
- 102100038214 Chromodomain-helicase-DNA-binding protein 4 Human genes 0.000 description 1
- 102300051922 Chromodomain-helicase-DNA-binding protein 4 isoform 2 Human genes 0.000 description 1
- 108010071536 Citrate (Si)-synthase Proteins 0.000 description 1
- 102000006732 Citrate synthase Human genes 0.000 description 1
- 102100026127 Clathrin heavy chain 1 Human genes 0.000 description 1
- 102100034467 Clathrin light chain A Human genes 0.000 description 1
- 102300045033 Clathrin light chain A isoform Non-brain Human genes 0.000 description 1
- 101710087051 Cleavage and polyadenylation specificity factor subunit 5 Proteins 0.000 description 1
- 101710105549 Coactosin-like protein Proteins 0.000 description 1
- 102100030972 Coatomer subunit beta Human genes 0.000 description 1
- 102100022589 Coatomer subunit beta' Human genes 0.000 description 1
- 102100028289 Coatomer subunit delta Human genes 0.000 description 1
- 102100037290 Coatomer subunit gamma-1 Human genes 0.000 description 1
- ACTIUHUUMQJHFO-UHFFFAOYSA-N Coenzym Q10 Natural products COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UHFFFAOYSA-N 0.000 description 1
- 102000004360 Cofilin 1 Human genes 0.000 description 1
- 102100027466 Cofilin-1 Human genes 0.000 description 1
- 101710155599 Coiled-coil domain-containing protein 124 Proteins 0.000 description 1
- 101710149407 Coiled-coil domain-containing protein 30 Proteins 0.000 description 1
- 101710194161 Coiled-coil-helix-coiled-coil-helix domain-containing protein 1 Proteins 0.000 description 1
- 101710164904 Cold-inducible RNA-binding protein Proteins 0.000 description 1
- 102000012422 Collagen Type I Human genes 0.000 description 1
- 108010022452 Collagen Type I Proteins 0.000 description 1
- 102000000503 Collagen Type II Human genes 0.000 description 1
- 108010041390 Collagen Type II Proteins 0.000 description 1
- 108010042086 Collagen Type IV Proteins 0.000 description 1
- 102000004266 Collagen Type IV Human genes 0.000 description 1
- 108010042106 Collagen Type IX Proteins 0.000 description 1
- 102000004427 Collagen Type IX Human genes 0.000 description 1
- 108010017377 Collagen Type VII Proteins 0.000 description 1
- 102000004510 Collagen Type VII Human genes 0.000 description 1
- 108010069526 Collagen Type VIII Proteins 0.000 description 1
- 102000001191 Collagen Type VIII Human genes 0.000 description 1
- 108010022510 Collagen Type X Proteins 0.000 description 1
- 102000030746 Collagen Type X Human genes 0.000 description 1
- 102000009736 Collagen Type XI Human genes 0.000 description 1
- 108010034789 Collagen Type XI Proteins 0.000 description 1
- 108010039001 Collagen Type XII Proteins 0.000 description 1
- 102000014870 Collagen Type XII Human genes 0.000 description 1
- 102100029136 Collagen alpha-1(II) chain Human genes 0.000 description 1
- 102100031611 Collagen alpha-1(III) chain Human genes 0.000 description 1
- 102100022145 Collagen alpha-1(IV) chain Human genes 0.000 description 1
- 102100031457 Collagen alpha-1(V) chain Human genes 0.000 description 1
- 102100031519 Collagen alpha-1(VI) chain Human genes 0.000 description 1
- 102100024335 Collagen alpha-1(VII) chain Human genes 0.000 description 1
- 102100024337 Collagen alpha-1(VIII) chain Human genes 0.000 description 1
- 102100036217 Collagen alpha-1(X) chain Human genes 0.000 description 1
- 102100033825 Collagen alpha-1(XI) chain Human genes 0.000 description 1
- 102100027442 Collagen alpha-1(XII) chain Human genes 0.000 description 1
- 102100031162 Collagen alpha-1(XVIII) chain Human genes 0.000 description 1
- 102100037296 Collagen alpha-1(XXII) chain Human genes 0.000 description 1
- 101710105266 Collagen alpha-1(XXIII) chain Proteins 0.000 description 1
- 101710161374 Collagen alpha-1(XXVII) chain Proteins 0.000 description 1
- 102100036213 Collagen alpha-2(I) chain Human genes 0.000 description 1
- 101710179387 Collagen alpha-2(IV) chain Proteins 0.000 description 1
- 102100030976 Collagen alpha-2(IX) chain Human genes 0.000 description 1
- 102100031502 Collagen alpha-2(V) chain Human genes 0.000 description 1
- 102100024338 Collagen alpha-3(VI) chain Human genes 0.000 description 1
- 102100033773 Collagen alpha-6(IV) chain Human genes 0.000 description 1
- 101710142738 Collagen alpha-6(VI) chain Proteins 0.000 description 1
- 101710193823 Collagen triple helix repeat-containing protein 1 Proteins 0.000 description 1
- 102000014447 Complement C1q Human genes 0.000 description 1
- 108010078043 Complement C1q Proteins 0.000 description 1
- 108010028780 Complement C3 Proteins 0.000 description 1
- 102000016918 Complement C3 Human genes 0.000 description 1
- 102100033772 Complement C4-A Human genes 0.000 description 1
- 108010077773 Complement C4a Proteins 0.000 description 1
- 102100037078 Complement component 1 Q subcomponent-binding protein, mitochondrial Human genes 0.000 description 1
- 108010039419 Connective Tissue Growth Factor Proteins 0.000 description 1
- 241000761389 Copa Species 0.000 description 1
- 102100032636 Copine-1 Human genes 0.000 description 1
- 102100032648 Copine-3 Human genes 0.000 description 1
- 102100034528 Core histone macro-H2A.1 Human genes 0.000 description 1
- 102300052466 Core histone macro-H2A.1 isoform 1 Human genes 0.000 description 1
- 101710185000 Core histone macro-H2A.2 Proteins 0.000 description 1
- 108050006296 Coronin 1B Proteins 0.000 description 1
- 102100041022 Coronin-1C Human genes 0.000 description 1
- 102300062460 Coronin-1C isoform 2 Human genes 0.000 description 1
- 102100039195 Cullin-1 Human genes 0.000 description 1
- 102300048340 Cyclin-Y isoform 2 Human genes 0.000 description 1
- 108010072220 Cyclophilin A Proteins 0.000 description 1
- 101710185487 Cysteine and glycine-rich protein 1 Proteins 0.000 description 1
- 108010019961 Cysteine-Rich Protein 61 Proteins 0.000 description 1
- 102100032757 Cysteine-rich protein 2 Human genes 0.000 description 1
- 102300044432 Cysteine-rich protein 2 isoform 2 Human genes 0.000 description 1
- 108091000069 Cystinyl Aminopeptidase Proteins 0.000 description 1
- 101710171534 Cytochrome b-c1 complex subunit 1, mitochondrial Proteins 0.000 description 1
- 102100039441 Cytochrome b-c1 complex subunit 2, mitochondrial Human genes 0.000 description 1
- 102400000011 Cytochrome b-c1 complex subunit 9 Human genes 0.000 description 1
- 102100028005 Cytochrome b-c1 complex subunit 9 Human genes 0.000 description 1
- 101710147952 Cytochrome b-c1 complex subunit 9 Proteins 0.000 description 1
- 101710091264 Cytochrome c oxidase subunit 2 Proteins 0.000 description 1
- 101710114487 Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Proteins 0.000 description 1
- 101710115864 Cytochrome c oxidase subunit 7A2, mitochondrial Proteins 0.000 description 1
- 102100028991 Cytochrome c1, heme protein, mitochondrial Human genes 0.000 description 1
- 101710085999 Cytochrome c1, heme protein, mitochondrial Proteins 0.000 description 1
- 108010052832 Cytochromes Proteins 0.000 description 1
- 102000018832 Cytochromes Human genes 0.000 description 1
- 108010075031 Cytochromes c Proteins 0.000 description 1
- 101710181791 Cytoplasmic FMR1-interacting protein 1 Proteins 0.000 description 1
- 102100039868 Cytoplasmic aconitate hydratase Human genes 0.000 description 1
- 101710194502 Cytoplasmic aconitate hydratase Proteins 0.000 description 1
- 101710204897 Cytoplasmic dynein 1 heavy chain 1 Proteins 0.000 description 1
- 102100028523 Cytoplasmic dynein 1 intermediate chain 2 Human genes 0.000 description 1
- 101710108456 Cytoplasmic dynein 1 light intermediate chain 1 Proteins 0.000 description 1
- 101710108459 Cytoplasmic dynein 1 light intermediate chain 2 Proteins 0.000 description 1
- 102100028629 Cytoskeleton-associated protein 4 Human genes 0.000 description 1
- 102100028624 Cytoskeleton-associated protein 5 Human genes 0.000 description 1
- 102300044240 Cytoskeleton-associated protein 5 isoform 3 Human genes 0.000 description 1
- 108050004857 DBH-like monooxygenase protein 1 Proteins 0.000 description 1
- 102000012698 DDB1 Human genes 0.000 description 1
- 102100038268 DDRGK domain-containing protein 1 Human genes 0.000 description 1
- 102000012694 DDRGK1 Human genes 0.000 description 1
- 101150011286 DDRGK1 gene Proteins 0.000 description 1
- 102100036674 DNA damage-binding protein 1 Human genes 0.000 description 1
- 102100039116 DNA repair protein RAD50 Human genes 0.000 description 1
- 102300060287 DNA repair protein RAD50 isoform 2 Human genes 0.000 description 1
- 101710119265 DNA topoisomerase 1 Proteins 0.000 description 1
- 102100033589 DNA topoisomerase 2-beta Human genes 0.000 description 1
- 102300063577 DNA topoisomerase 2-beta isoform Beta-1 Human genes 0.000 description 1
- 102100037373 DNA-(apurinic or apyrimidinic site) endonuclease Human genes 0.000 description 1
- 101710116895 DNA-binding protein H-NS Proteins 0.000 description 1
- 101710157074 DNA-dependent protein kinase catalytic subunit Proteins 0.000 description 1
- 101710165893 DNA-directed RNA polymerase II subunit RPB1 Proteins 0.000 description 1
- 101710165888 DNA-directed RNA polymerase II subunit RPB3 Proteins 0.000 description 1
- 101710165889 DNA-directed RNA polymerase II subunit RPB4 Proteins 0.000 description 1
- 101710165879 DNA-directed RNA polymerase II subunit rpb2 Proteins 0.000 description 1
- 102100023349 DNA-directed RNA polymerases I, II, and III subunit RPABC3 Human genes 0.000 description 1
- 101000839780 Danio rerio Homeobox protein Hox-B3a Proteins 0.000 description 1
- 108010031042 Death-Associated Protein Kinases Proteins 0.000 description 1
- 101710088194 Dehydrogenase Proteins 0.000 description 1
- 108700016241 Deoxyribose-phosphate aldolases Proteins 0.000 description 1
- 108010045579 Desmoglein 1 Proteins 0.000 description 1
- 108010045583 Desmoglein 2 Proteins 0.000 description 1
- 108091000074 Desmoplakin Proteins 0.000 description 1
- 102000003668 Destrin Human genes 0.000 description 1
- 108090000082 Destrin Proteins 0.000 description 1
- 101100086373 Dictyostelium discoideum rcbA gene Proteins 0.000 description 1
- 101100170004 Dictyostelium discoideum repE gene Proteins 0.000 description 1
- 102100027152 Dihydrolipoyllysine-residue acetyltransferase component of pyruvate dehydrogenase complex, mitochondrial Human genes 0.000 description 1
- 102100031920 Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Human genes 0.000 description 1
- 108091000126 Dihydroorotase Proteins 0.000 description 1
- 102100024426 Dihydropyrimidinase-related protein 2 Human genes 0.000 description 1
- 102100024425 Dihydropyrimidinase-related protein 3 Human genes 0.000 description 1
- 102100020750 Dipeptidyl peptidase 3 Human genes 0.000 description 1
- 102300065279 Dipeptidyl peptidase 3 isoform 4 Human genes 0.000 description 1
- 101800001224 Disintegrin Proteins 0.000 description 1
- 102100035966 DnaJ homolog subfamily A member 2 Human genes 0.000 description 1
- 102100029716 DnaJ homolog subfamily A member 3, mitochondrial Human genes 0.000 description 1
- 102100037927 DnaJ homolog subfamily B member 11 Human genes 0.000 description 1
- 102100035425 DnaJ homolog subfamily B member 6 Human genes 0.000 description 1
- 102100023317 DnaJ homolog subfamily C member 10 Human genes 0.000 description 1
- 102100023283 DnaJ homolog subfamily C member 11 Human genes 0.000 description 1
- 102100020746 Dolichol-phosphate mannosyltransferase subunit 1 Human genes 0.000 description 1
- 102100031477 Dolichyl-diphosphooligosaccharide-protein glycosyltransferase 48 kDa subunit Human genes 0.000 description 1
- 241001669680 Dormitator maculatus Species 0.000 description 1
- 102100037070 Doublecortin domain-containing protein 2 Human genes 0.000 description 1
- 102100028952 Drebrin Human genes 0.000 description 1
- 102300063121 Drebrin isoform 3 Human genes 0.000 description 1
- 101100170005 Drosophila melanogaster pic gene Proteins 0.000 description 1
- 206010013710 Drug interaction Diseases 0.000 description 1
- 102100036654 Dynactin subunit 1 Human genes 0.000 description 1
- 102100021076 Dynactin subunit 2 Human genes 0.000 description 1
- 108010044191 Dynamin II Proteins 0.000 description 1
- 102100024827 Dynamin-1-like protein Human genes 0.000 description 1
- 102300051588 Dynamin-1-like protein isoform 4 Human genes 0.000 description 1
- 102100021238 Dynamin-2 Human genes 0.000 description 1
- 102300064233 Dynamin-2 isoform 4 Human genes 0.000 description 1
- 102100032299 Dynein axonemal heavy chain 10 Human genes 0.000 description 1
- 101710150629 Dynein light chain Tctex-type 1 Proteins 0.000 description 1
- 108010013976 Dystonin Proteins 0.000 description 1
- 102100038913 E1A-binding protein p400 Human genes 0.000 description 1
- 102300046401 E1A-binding protein p400 isoform 5 Human genes 0.000 description 1
- 102300049142 E3 ubiquitin-protein ligase CHFR isoform 3 Human genes 0.000 description 1
- 102100034893 E3 ubiquitin-protein ligase HUWE1 Human genes 0.000 description 1
- 102300042234 E3 ubiquitin-protein ligase HUWE1 isoform 3 Human genes 0.000 description 1
- 102100027418 E3 ubiquitin-protein ligase RNF213 Human genes 0.000 description 1
- 102300055019 E3 ubiquitin-protein ligase RNF213 isoform 2 Human genes 0.000 description 1
- 102300041001 E3 ubiquitin-protein ligase UBR4 isoform 2 Human genes 0.000 description 1
- 101710183057 E3 ubiquitin/ISG15 ligase TRIM25 Proteins 0.000 description 1
- 101150115146 EEF2 gene Proteins 0.000 description 1
- 101710166164 EGF-like repeat and discoidin I-like domain-containing protein 3 Proteins 0.000 description 1
- 101710085392 EH domain-containing protein 1 Proteins 0.000 description 1
- 101710085394 EH domain-containing protein 2 Proteins 0.000 description 1
- 101710085332 EH domain-containing protein 4 Proteins 0.000 description 1
- 101150039757 EIF3E gene Proteins 0.000 description 1
- 101150100259 EIF3L gene Proteins 0.000 description 1
- 101150015614 EIF3M gene Proteins 0.000 description 1
- 102100039371 ER lumen protein-retaining receptor 1 Human genes 0.000 description 1
- 101710117321 ER lumen protein-retaining receptor 3 Proteins 0.000 description 1
- 101150107333 Eif3g gene Proteins 0.000 description 1
- 101150011861 Elavl1 gene Proteins 0.000 description 1
- 102100030695 Electron transfer flavoprotein subunit alpha, mitochondrial Human genes 0.000 description 1
- 102300065010 Electron transfer flavoprotein subunit alpha, mitochondrial isoform 2 Human genes 0.000 description 1
- 101710120810 Elongation factor 1-alpha 1 Proteins 0.000 description 1
- 102100030801 Elongation factor 1-alpha 1 Human genes 0.000 description 1
- 102100030808 Elongation factor 1-delta Human genes 0.000 description 1
- 102100023362 Elongation factor 1-gamma Human genes 0.000 description 1
- 102100031334 Elongation factor 2 Human genes 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 102100021805 Enhancer of mRNA-decapping protein 4 Human genes 0.000 description 1
- 102100021823 Enoyl-CoA delta isomerase 2 Human genes 0.000 description 1
- 102100021822 Enoyl-CoA hydratase, mitochondrial Human genes 0.000 description 1
- 101710180035 Enoyl-CoA hydratase, mitochondrial Proteins 0.000 description 1
- 101710123351 Epidermal growth factor receptor kinase substrate 8-like protein 2 Proteins 0.000 description 1
- 101710171298 Epiplakin Proteins 0.000 description 1
- 101710167546 Epoxide hydrolase 1 Proteins 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 102100029987 Erbin Human genes 0.000 description 1
- 101700035123 Erbin Proteins 0.000 description 1
- 102300031852 Erbin isoform 3 Human genes 0.000 description 1
- 102100039607 Erlin-1 Human genes 0.000 description 1
- 101710044856 Erlin-1 Proteins 0.000 description 1
- 102100036823 Erlin-2 Human genes 0.000 description 1
- 101710044846 Erlin-2 Proteins 0.000 description 1
- 101710145855 Eukaryotic initiation factor 4A-I Proteins 0.000 description 1
- 101710129990 Eukaryotic initiation factor 4A-III Proteins 0.000 description 1
- 102100030667 Eukaryotic peptide chain release factor subunit 1 Human genes 0.000 description 1
- 102300052929 Eukaryotic peptide chain release factor subunit 1 isoform 2 Human genes 0.000 description 1
- 102100021381 Eukaryotic translation elongation factor 1 epsilon-1 Human genes 0.000 description 1
- 101710151743 Eukaryotic translation initiation factor 2 subunit 1 Proteins 0.000 description 1
- 101710151740 Eukaryotic translation initiation factor 2 subunit 2 Proteins 0.000 description 1
- 101710151744 Eukaryotic translation initiation factor 2 subunit 3 Proteins 0.000 description 1
- 102300051097 Eukaryotic translation initiation factor 3 subunit A isoform 2 Human genes 0.000 description 1
- 102100021699 Eukaryotic translation initiation factor 3 subunit B Human genes 0.000 description 1
- 102300041127 Eukaryotic translation initiation factor 3 subunit B isoform 2 Human genes 0.000 description 1
- 101710109030 Eukaryotic translation initiation factor 3 subunit C Proteins 0.000 description 1
- 102100029776 Eukaryotic translation initiation factor 3 subunit D Human genes 0.000 description 1
- 102300057541 Eukaryotic translation initiation factor 3 subunit D isoform 2 Human genes 0.000 description 1
- 101710109031 Eukaryotic translation initiation factor 3 subunit E Proteins 0.000 description 1
- 101710109032 Eukaryotic translation initiation factor 3 subunit F Proteins 0.000 description 1
- 101710109055 Eukaryotic translation initiation factor 3 subunit G Proteins 0.000 description 1
- 102100038085 Eukaryotic translation initiation factor 3 subunit L Human genes 0.000 description 1
- 102300064202 Eukaryotic translation initiation factor 3 subunit L isoform 2 Human genes 0.000 description 1
- 102000050082 Eukaryotic translation initiation factor 3 subunit M Human genes 0.000 description 1
- 108700039175 Eukaryotic translation initiation factor 3 subunit M Proteins 0.000 description 1
- 102100029777 Eukaryotic translation initiation factor 3 subunit M Human genes 0.000 description 1
- 102100039735 Eukaryotic translation initiation factor 4 gamma 1 Human genes 0.000 description 1
- 102300056860 Eukaryotic translation initiation factor 4 gamma 1 isoform D Human genes 0.000 description 1
- 101710190709 Eukaryotic translation initiation factor 4 gamma 2 Proteins 0.000 description 1
- 102100026765 Eukaryotic translation initiation factor 4H Human genes 0.000 description 1
- 102300052162 Eukaryotic translation initiation factor 4H isoform Short Human genes 0.000 description 1
- 102100026761 Eukaryotic translation initiation factor 5A-1 Human genes 0.000 description 1
- 102300052369 Eukaryotic translation initiation factor 5A-1 isoform 2 Human genes 0.000 description 1
- 101710092084 Eukaryotic translation initiation factor 5B Proteins 0.000 description 1
- 101710204615 Eukaryotic translation initiation factor 6 Proteins 0.000 description 1
- 102100037123 Exosome RNA helicase MTR4 Human genes 0.000 description 1
- 102100029091 Exportin-2 Human genes 0.000 description 1
- 102300052700 Exportin-2 isoform 3 Human genes 0.000 description 1
- 102100036763 Extended synaptotagmin-1 Human genes 0.000 description 1
- 102300064786 Extended synaptotagmin-1 isoform 2 Human genes 0.000 description 1
- 102100020903 Ezrin Human genes 0.000 description 1
- 101710087984 F-actin-capping protein subunit alpha-1 Proteins 0.000 description 1
- 101710087975 F-actin-capping protein subunit alpha-2 Proteins 0.000 description 1
- 102100029956 F-actin-capping protein subunit beta Human genes 0.000 description 1
- 102300047606 F-actin-capping protein subunit beta isoform 2 Human genes 0.000 description 1
- 101710104971 FACT complex subunit SPT16 Proteins 0.000 description 1
- 102100034003 FAU ubiquitin-like and ribosomal protein S30 Human genes 0.000 description 1
- 101710143195 FH2 domain-containing protein 1 Proteins 0.000 description 1
- 102100035264 FYVE and coiled-coil domain-containing protein 1 Human genes 0.000 description 1
- 102300034179 FYVE and coiled-coil domain-containing protein 1 isoform 4 Human genes 0.000 description 1
- 102100036118 Far upstream element-binding protein 1 Human genes 0.000 description 1
- 101710133942 Far upstream element-binding protein 2 Proteins 0.000 description 1
- 101710125754 Farnesyl pyrophosphate synthase Proteins 0.000 description 1
- 102100036089 Fascin Human genes 0.000 description 1
- 108010039731 Fatty Acid Synthases Proteins 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 102100040684 Fermitin family homolog 2 Human genes 0.000 description 1
- 108010030229 Fibrillin-1 Proteins 0.000 description 1
- 102000003974 Fibroblast growth factor 2 Human genes 0.000 description 1
- 108090000379 Fibroblast growth factor 2 Proteins 0.000 description 1
- 102300048282 Fibroblast growth factor 2 isoform 2 Human genes 0.000 description 1
- 102300034160 Fibronectin isoform 10 Human genes 0.000 description 1
- 102300034157 Fibronectin isoform 14 Human genes 0.000 description 1
- 102300034052 Fibronectin isoform 3 Human genes 0.000 description 1
- 102300034048 Fibronectin isoform 7 Human genes 0.000 description 1
- 102100027625 Fibrous sheath-interacting protein 2 Human genes 0.000 description 1
- 101710170731 Fibulin-1 Proteins 0.000 description 1
- 102300051691 Fibulin-1 isoform C Human genes 0.000 description 1
- 102100031813 Fibulin-2 Human genes 0.000 description 1
- 102300051713 Fibulin-2 isoform 2 Human genes 0.000 description 1
- 101710088660 Filaggrin Proteins 0.000 description 1
- 101710095953 Filaggrin-2 Proteins 0.000 description 1
- 102100026561 Filamin-A Human genes 0.000 description 1
- 102100026559 Filamin-B Human genes 0.000 description 1
- 101001067614 Flaveria pringlei Serine hydroxymethyltransferase 2, mitochondrial Proteins 0.000 description 1
- 102100032790 Flotillin-1 Human genes 0.000 description 1
- 102100023513 Flotillin-2 Human genes 0.000 description 1
- 102100036334 Fragile X mental retardation syndrome-related protein 1 Human genes 0.000 description 1
- 102100022277 Fructose-bisphosphate aldolase A Human genes 0.000 description 1
- 102300038797 Fructose-bisphosphate aldolase A isoform 2 Human genes 0.000 description 1
- 108010036781 Fumarate Hydratase Proteins 0.000 description 1
- 102100036160 Fumarate hydratase, mitochondrial Human genes 0.000 description 1
- 102100033423 GDNF family receptor alpha-1 Human genes 0.000 description 1
- 102300043378 GDNF family receptor alpha-1 isoform 2 Human genes 0.000 description 1
- 102100040196 GRB10-interacting GYF protein 2 Human genes 0.000 description 1
- 102300052828 GRB10-interacting GYF protein 2 isoform 3 Human genes 0.000 description 1
- 102000016251 GREB1 Human genes 0.000 description 1
- 108050004787 GREB1 Proteins 0.000 description 1
- 102100022887 GTP-binding nuclear protein Ran Human genes 0.000 description 1
- 101710084647 GTP-binding nuclear protein Ran Proteins 0.000 description 1
- 102100023448 GTP-binding protein 1 Human genes 0.000 description 1
- 101710102121 GTP-binding protein 1 Proteins 0.000 description 1
- 102100023745 GTP-binding protein 4 Human genes 0.000 description 1
- 101710172131 GTP-binding protein SAR1a Proteins 0.000 description 1
- 102000000802 Galectin 3 Human genes 0.000 description 1
- 102100039558 Galectin-3 Human genes 0.000 description 1
- 101710197901 Galectin-3-binding protein Proteins 0.000 description 1
- 102100034004 Gamma-adducin Human genes 0.000 description 1
- 102100028953 Gelsolin Human genes 0.000 description 1
- 102300052622 Gelsolin isoform 2 Human genes 0.000 description 1
- 101710144827 General transcription factor II-I Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 102100022624 Glucoamylase Human genes 0.000 description 1
- 108091052347 Glucose transporter family Proteins 0.000 description 1
- 102000042092 Glucose transporter family Human genes 0.000 description 1
- 102100031132 Glucose-6-phosphate isomerase Human genes 0.000 description 1
- 108010070600 Glucose-6-phosphate isomerase Proteins 0.000 description 1
- 102300048353 Glucose-6-phosphate isomerase isoform 2 Human genes 0.000 description 1
- 102100021223 Glucosidase 2 subunit beta Human genes 0.000 description 1
- 102300052851 Glucosidase 2 subunit beta isoform 2 Human genes 0.000 description 1
- 108010056771 Glucosidases Proteins 0.000 description 1
- 102000004366 Glucosidases Human genes 0.000 description 1
- 101710180993 Glutamate dehydrogenase 1, mitochondrial Proteins 0.000 description 1
- 108010073324 Glutaminase Proteins 0.000 description 1
- 102000009127 Glutaminase Human genes 0.000 description 1
- 102100033429 Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 Human genes 0.000 description 1
- 102300043213 Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 isoform 2 Human genes 0.000 description 1
- 102300037770 Glutamine-tRNA ligase isoform 2 Human genes 0.000 description 1
- 108050005205 Glutaredoxin Proteins 0.000 description 1
- 102100030943 Glutathione S-transferase P Human genes 0.000 description 1
- 102000005720 Glutathione transferase Human genes 0.000 description 1
- 108010070675 Glutathione transferase Proteins 0.000 description 1
- 108010051724 Glycine-tRNA Ligase Proteins 0.000 description 1
- 102100040094 Glycogen phosphorylase, brain form Human genes 0.000 description 1
- 102100029481 Glycogen phosphorylase, liver form Human genes 0.000 description 1
- 101710081889 Glycylpeptide N-tetradecanoyltransferase 2 Proteins 0.000 description 1
- 108050009385 Glypican-6 Proteins 0.000 description 1
- 102100034223 Golgi apparatus protein 1 Human genes 0.000 description 1
- 102300054188 Golgi apparatus protein 1 isoform 2 Human genes 0.000 description 1
- 102100031488 Golgi-associated plant pathogenesis-related protein 1 Human genes 0.000 description 1
- 102100041032 Golgin subfamily A member 5 Human genes 0.000 description 1
- 101710169781 Gremlin-1 Proteins 0.000 description 1
- 101710194460 Growth/differentiation factor 15 Proteins 0.000 description 1
- 101710170071 Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-12 Proteins 0.000 description 1
- 102100033300 Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-12 Human genes 0.000 description 1
- 101710197496 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Proteins 0.000 description 1
- 101710197495 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Proteins 0.000 description 1
- 101710184082 Guanine nucleotide-binding protein G(i) subunit alpha-2 Proteins 0.000 description 1
- 102100021185 Guanine nucleotide-binding protein-like 3 Human genes 0.000 description 1
- 102300052873 Guanine nucleotide-binding protein-like 3 isoform 2 Human genes 0.000 description 1
- 101710110781 Guanylate-binding protein 1 Proteins 0.000 description 1
- 102100021385 H/ACA ribonucleoprotein complex subunit 1 Human genes 0.000 description 1
- 102300048838 H/ACA ribonucleoprotein complex subunit 1 isoform 2 Human genes 0.000 description 1
- 102100031249 H/ACA ribonucleoprotein complex subunit DKC1 Human genes 0.000 description 1
- 102300062234 H/ACA ribonucleoprotein complex subunit DKC1 isoform 3 Human genes 0.000 description 1
- 108091059596 H3F3A Proteins 0.000 description 1
- 102100028972 HLA class I histocompatibility antigen, A alpha chain Human genes 0.000 description 1
- 108010075704 HLA-A Antigens Proteins 0.000 description 1
- 108010036972 HLA-A11 Antigen Proteins 0.000 description 1
- 108700010013 HMGB1 Proteins 0.000 description 1
- 101150021904 HMGB1 gene Proteins 0.000 description 1
- 108010045100 HSP27 Heat-Shock Proteins Proteins 0.000 description 1
- 108010055039 HSP47 Heat-Shock Proteins Proteins 0.000 description 1
- 101150096895 HSPB1 gene Proteins 0.000 description 1
- 239000012981 Hank's balanced salt solution Substances 0.000 description 1
- 101710104933 Heat shock cognate 71 kDa protein Proteins 0.000 description 1
- 102100034051 Heat shock protein HSP 90-alpha Human genes 0.000 description 1
- 102300042222 Heat shock protein HSP 90-alpha isoform 2 Human genes 0.000 description 1
- 101710163596 Heat shock protein HSP 90-beta Proteins 0.000 description 1
- 101710191109 Heat shock-related 70 kDa protein 2 Proteins 0.000 description 1
- 102100031880 Helicase SRCAP Human genes 0.000 description 1
- 102300043955 Helicase SRCAP isoform 2 Human genes 0.000 description 1
- 102100028887 Hemicentin-2 Human genes 0.000 description 1
- 108091005902 Hemoglobin subunit alpha Proteins 0.000 description 1
- 102100027685 Hemoglobin subunit alpha Human genes 0.000 description 1
- 102100021519 Hemoglobin subunit beta Human genes 0.000 description 1
- 108091005904 Hemoglobin subunit beta Proteins 0.000 description 1
- 101710202732 Heparan sulfate glucosamine 3-O-sulfotransferase 6 Proteins 0.000 description 1
- 101710164044 Heterochromatin protein 1-binding protein 3 Proteins 0.000 description 1
- 102100035617 Heterogeneous nuclear ribonucleoprotein A/B Human genes 0.000 description 1
- 102100023434 Heterogeneous nuclear ribonucleoprotein A0 Human genes 0.000 description 1
- 102100035621 Heterogeneous nuclear ribonucleoprotein A1 Human genes 0.000 description 1
- 102100035669 Heterogeneous nuclear ribonucleoprotein A3 Human genes 0.000 description 1
- 102100027706 Heterogeneous nuclear ribonucleoprotein D-like Human genes 0.000 description 1
- 102100033985 Heterogeneous nuclear ribonucleoprotein D0 Human genes 0.000 description 1
- 102100027738 Heterogeneous nuclear ribonucleoprotein H Human genes 0.000 description 1
- 102100027703 Heterogeneous nuclear ribonucleoprotein H2 Human genes 0.000 description 1
- 102100033997 Heterogeneous nuclear ribonucleoprotein H3 Human genes 0.000 description 1
- 102100028909 Heterogeneous nuclear ribonucleoprotein K Human genes 0.000 description 1
- 102100028818 Heterogeneous nuclear ribonucleoprotein L Human genes 0.000 description 1
- 102100028895 Heterogeneous nuclear ribonucleoprotein M Human genes 0.000 description 1
- 102100028896 Heterogeneous nuclear ribonucleoprotein Q Human genes 0.000 description 1
- 102100023999 Heterogeneous nuclear ribonucleoprotein R Human genes 0.000 description 1
- 102100033999 Heterogeneous nuclear ribonucleoprotein U-like protein 2 Human genes 0.000 description 1
- 102100035616 Heterogeneous nuclear ribonucleoproteins A2/B1 Human genes 0.000 description 1
- 102100033994 Heterogeneous nuclear ribonucleoproteins C1/C2 Human genes 0.000 description 1
- 108010085697 Heterogeneous-Nuclear Ribonucleoprotein U Proteins 0.000 description 1
- 102100030338 Hexokinase-1 Human genes 0.000 description 1
- 102300051352 Hexokinase-1 isoform 2 Human genes 0.000 description 1
- 102100037907 High mobility group protein B1 Human genes 0.000 description 1
- 101710168572 High mobility group protein B3 Proteins 0.000 description 1
- 102100029009 High mobility group protein HMG-I/HMG-Y Human genes 0.000 description 1
- 108010026751 High-Temperature Requirement A Serine Peptidase 1 Proteins 0.000 description 1
- 102100031004 Histidine-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102300047698 Histidine-tRNA ligase, cytoplasmic isoform 2 Human genes 0.000 description 1
- 102100037487 Histone H1.0 Human genes 0.000 description 1
- 102300056742 Histone H1.0 isoform 2 Human genes 0.000 description 1
- 101710192078 Histone H1.4 Proteins 0.000 description 1
- 101710192088 Histone H1.5 Proteins 0.000 description 1
- 101710132524 Histone H2A type 2-C Proteins 0.000 description 1
- 101710090917 Histone H2A.J Proteins 0.000 description 1
- 101710090643 Histone H2A.V Proteins 0.000 description 1
- 101710195517 Histone H2AX Proteins 0.000 description 1
- 101710160680 Histone H2B type 1-D Proteins 0.000 description 1
- 101710195388 Histone H3.1 Proteins 0.000 description 1
- 101710195400 Histone H3.3 Proteins 0.000 description 1
- 102100039999 Histone deacetylase 2 Human genes 0.000 description 1
- 102300034863 Histone deacetylase 2 isoform 2 Human genes 0.000 description 1
- 108700036103 Histone deacetylase complex subunit SAP18 Proteins 0.000 description 1
- 108010016918 Histone-Lysine N-Methyltransferase Proteins 0.000 description 1
- 102100025190 Histone-binding protein RBBP4 Human genes 0.000 description 1
- 102300056347 Histone-binding protein RBBP4 isoform 2 Human genes 0.000 description 1
- 102100027768 Histone-lysine N-methyltransferase 2D Human genes 0.000 description 1
- 102300034464 Histone-lysine N-methyltransferase 2D isoform 3 Human genes 0.000 description 1
- 102100029239 Histone-lysine N-methyltransferase, H3 lysine-36 specific Human genes 0.000 description 1
- 101150073387 Hmga2 gene Proteins 0.000 description 1
- 102100028411 Homeobox protein Hox-B3 Human genes 0.000 description 1
- 101001058479 Homo sapiens 1,4-alpha-glucan-branching enzyme Proteins 0.000 description 1
- 101000583069 Homo sapiens 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-3 Proteins 0.000 description 1
- 101000605565 Homo sapiens 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Proteins 0.000 description 1
- 101000980303 Homo sapiens 10 kDa heat shock protein, mitochondrial Proteins 0.000 description 1
- 101000608799 Homo sapiens 116 kDa U5 small nuclear ribonucleoprotein component Proteins 0.000 description 1
- 101000818893 Homo sapiens 14-3-3 protein beta/alpha Proteins 0.000 description 1
- 101000760079 Homo sapiens 14-3-3 protein epsilon Proteins 0.000 description 1
- 101000760084 Homo sapiens 14-3-3 protein eta Proteins 0.000 description 1
- 101000723517 Homo sapiens 14-3-3 protein gamma Proteins 0.000 description 1
- 101000723543 Homo sapiens 14-3-3 protein theta Proteins 0.000 description 1
- 101000964898 Homo sapiens 14-3-3 protein zeta/delta Proteins 0.000 description 1
- 101001041661 Homo sapiens 2,4-dienoyl-CoA reductase [(3E)-enoyl-CoA-producing], mitochondrial Proteins 0.000 description 1
- 101000982656 Homo sapiens 2-oxoglutarate dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101000612519 Homo sapiens 26S proteasome non-ATPase regulatory subunit 11 Proteins 0.000 description 1
- 101000612528 Homo sapiens 26S proteasome non-ATPase regulatory subunit 12 Proteins 0.000 description 1
- 101000612536 Homo sapiens 26S proteasome non-ATPase regulatory subunit 13 Proteins 0.000 description 1
- 101000590281 Homo sapiens 26S proteasome non-ATPase regulatory subunit 14 Proteins 0.000 description 1
- 101000590224 Homo sapiens 26S proteasome non-ATPase regulatory subunit 3 Proteins 0.000 description 1
- 101001135226 Homo sapiens 26S proteasome non-ATPase regulatory subunit 5 Proteins 0.000 description 1
- 101001135306 Homo sapiens 26S proteasome non-ATPase regulatory subunit 6 Proteins 0.000 description 1
- 101001136696 Homo sapiens 26S proteasome non-ATPase regulatory subunit 7 Proteins 0.000 description 1
- 101001136717 Homo sapiens 26S proteasome non-ATPase regulatory subunit 8 Proteins 0.000 description 1
- 101000619137 Homo sapiens 26S proteasome regulatory subunit 4 Proteins 0.000 description 1
- 101001125524 Homo sapiens 26S proteasome regulatory subunit 6B Proteins 0.000 description 1
- 101001090865 Homo sapiens 26S proteasome regulatory subunit 7 Proteins 0.000 description 1
- 101001136753 Homo sapiens 26S proteasome regulatory subunit 8 Proteins 0.000 description 1
- 101000639726 Homo sapiens 28S ribosomal protein S12, mitochondrial Proteins 0.000 description 1
- 101000727483 Homo sapiens 28S ribosomal protein S28, mitochondrial Proteins 0.000 description 1
- 101000727490 Homo sapiens 28S ribosomal protein S29, mitochondrial Proteins 0.000 description 1
- 101000689829 Homo sapiens 28S ribosomal protein S34, mitochondrial Proteins 0.000 description 1
- 101000689823 Homo sapiens 28S ribosomal protein S35, mitochondrial Proteins 0.000 description 1
- 101001035740 Homo sapiens 3-hydroxyacyl-CoA dehydrogenase type-2 Proteins 0.000 description 1
- 101000841262 Homo sapiens 3-ketoacyl-CoA thiolase Proteins 0.000 description 1
- 101000835276 Homo sapiens 3-ketoacyl-CoA thiolase, mitochondrial Proteins 0.000 description 1
- 101000854451 Homo sapiens 39S ribosomal protein L11, mitochondrial Proteins 0.000 description 1
- 101000691550 Homo sapiens 39S ribosomal protein L13, mitochondrial Proteins 0.000 description 1
- 101000667524 Homo sapiens 39S ribosomal protein L28, mitochondrial Proteins 0.000 description 1
- 101000854465 Homo sapiens 39S ribosomal protein L34, mitochondrial Proteins 0.000 description 1
- 101001104225 Homo sapiens 39S ribosomal protein L41, mitochondrial Proteins 0.000 description 1
- 101001119189 Homo sapiens 40S ribosomal protein S10 Proteins 0.000 description 1
- 101001119215 Homo sapiens 40S ribosomal protein S11 Proteins 0.000 description 1
- 101000682687 Homo sapiens 40S ribosomal protein S12 Proteins 0.000 description 1
- 101000718313 Homo sapiens 40S ribosomal protein S13 Proteins 0.000 description 1
- 101000623543 Homo sapiens 40S ribosomal protein S15 Proteins 0.000 description 1
- 101000706746 Homo sapiens 40S ribosomal protein S16 Proteins 0.000 description 1
- 101000812077 Homo sapiens 40S ribosomal protein S17 Proteins 0.000 description 1
- 101000811259 Homo sapiens 40S ribosomal protein S18 Proteins 0.000 description 1
- 101000733040 Homo sapiens 40S ribosomal protein S19 Proteins 0.000 description 1
- 101001098029 Homo sapiens 40S ribosomal protein S2 Proteins 0.000 description 1
- 101001114932 Homo sapiens 40S ribosomal protein S20 Proteins 0.000 description 1
- 101001097953 Homo sapiens 40S ribosomal protein S23 Proteins 0.000 description 1
- 101000656669 Homo sapiens 40S ribosomal protein S24 Proteins 0.000 description 1
- 101000678929 Homo sapiens 40S ribosomal protein S25 Proteins 0.000 description 1
- 101000862491 Homo sapiens 40S ribosomal protein S26 Proteins 0.000 description 1
- 101000731896 Homo sapiens 40S ribosomal protein S27-like Proteins 0.000 description 1
- 101000623076 Homo sapiens 40S ribosomal protein S28 Proteins 0.000 description 1
- 101000704060 Homo sapiens 40S ribosomal protein S29 Proteins 0.000 description 1
- 101000656561 Homo sapiens 40S ribosomal protein S3 Proteins 0.000 description 1
- 101000679249 Homo sapiens 40S ribosomal protein S3a Proteins 0.000 description 1
- 101000732165 Homo sapiens 40S ribosomal protein S4, X isoform Proteins 0.000 description 1
- 101000696103 Homo sapiens 40S ribosomal protein S4, Y isoform 1 Proteins 0.000 description 1
- 101000622644 Homo sapiens 40S ribosomal protein S5 Proteins 0.000 description 1
- 101000656896 Homo sapiens 40S ribosomal protein S6 Proteins 0.000 description 1
- 101000690200 Homo sapiens 40S ribosomal protein S7 Proteins 0.000 description 1
- 101001097439 Homo sapiens 40S ribosomal protein S8 Proteins 0.000 description 1
- 101000657066 Homo sapiens 40S ribosomal protein S9 Proteins 0.000 description 1
- 101000678236 Homo sapiens 5'-nucleotidase Proteins 0.000 description 1
- 101000883686 Homo sapiens 60 kDa heat shock protein, mitochondrial Proteins 0.000 description 1
- 101000673456 Homo sapiens 60S acidic ribosomal protein P0 Proteins 0.000 description 1
- 101000712357 Homo sapiens 60S acidic ribosomal protein P1 Proteins 0.000 description 1
- 101000691878 Homo sapiens 60S acidic ribosomal protein P2 Proteins 0.000 description 1
- 101001108634 Homo sapiens 60S ribosomal protein L10 Proteins 0.000 description 1
- 101000755323 Homo sapiens 60S ribosomal protein L10a Proteins 0.000 description 1
- 101001073740 Homo sapiens 60S ribosomal protein L11 Proteins 0.000 description 1
- 101000575173 Homo sapiens 60S ribosomal protein L12 Proteins 0.000 description 1
- 101001118201 Homo sapiens 60S ribosomal protein L13 Proteins 0.000 description 1
- 101000681240 Homo sapiens 60S ribosomal protein L13a Proteins 0.000 description 1
- 101000704267 Homo sapiens 60S ribosomal protein L14 Proteins 0.000 description 1
- 101000682512 Homo sapiens 60S ribosomal protein L17 Proteins 0.000 description 1
- 101001087985 Homo sapiens 60S ribosomal protein L18 Proteins 0.000 description 1
- 101000752293 Homo sapiens 60S ribosomal protein L18a Proteins 0.000 description 1
- 101001105789 Homo sapiens 60S ribosomal protein L19 Proteins 0.000 description 1
- 101000661708 Homo sapiens 60S ribosomal protein L21 Proteins 0.000 description 1
- 101001097555 Homo sapiens 60S ribosomal protein L22 Proteins 0.000 description 1
- 101000675833 Homo sapiens 60S ribosomal protein L23 Proteins 0.000 description 1
- 101000660926 Homo sapiens 60S ribosomal protein L24 Proteins 0.000 description 1
- 101000719728 Homo sapiens 60S ribosomal protein L27 Proteins 0.000 description 1
- 101000753696 Homo sapiens 60S ribosomal protein L27a Proteins 0.000 description 1
- 101000676271 Homo sapiens 60S ribosomal protein L28 Proteins 0.000 description 1
- 101000676246 Homo sapiens 60S ribosomal protein L29 Proteins 0.000 description 1
- 101000673985 Homo sapiens 60S ribosomal protein L3 Proteins 0.000 description 1
- 101001101319 Homo sapiens 60S ribosomal protein L30 Proteins 0.000 description 1
- 101001113162 Homo sapiens 60S ribosomal protein L31 Proteins 0.000 description 1
- 101000672453 Homo sapiens 60S ribosomal protein L32 Proteins 0.000 description 1
- 101000672659 Homo sapiens 60S ribosomal protein L34 Proteins 0.000 description 1
- 101000715818 Homo sapiens 60S ribosomal protein L35 Proteins 0.000 description 1
- 101001110988 Homo sapiens 60S ribosomal protein L35a Proteins 0.000 description 1
- 101001110263 Homo sapiens 60S ribosomal protein L36 Proteins 0.000 description 1
- 101001092424 Homo sapiens 60S ribosomal protein L37a Proteins 0.000 description 1
- 101001127039 Homo sapiens 60S ribosomal protein L38 Proteins 0.000 description 1
- 101000691203 Homo sapiens 60S ribosomal protein L4 Proteins 0.000 description 1
- 101000674326 Homo sapiens 60S ribosomal protein L41 Proteins 0.000 description 1
- 101000691083 Homo sapiens 60S ribosomal protein L5 Proteins 0.000 description 1
- 101000673524 Homo sapiens 60S ribosomal protein L6 Proteins 0.000 description 1
- 101000853617 Homo sapiens 60S ribosomal protein L7 Proteins 0.000 description 1
- 101000853243 Homo sapiens 60S ribosomal protein L7a Proteins 0.000 description 1
- 101000853659 Homo sapiens 60S ribosomal protein L8 Proteins 0.000 description 1
- 101000672886 Homo sapiens 60S ribosomal protein L9 Proteins 0.000 description 1
- 101000779382 Homo sapiens A-kinase anchor protein 12 Proteins 0.000 description 1
- 101000833679 Homo sapiens A-kinase anchor protein 13 Proteins 0.000 description 1
- 101000794082 Homo sapiens ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 2 Proteins 0.000 description 1
- 101000684275 Homo sapiens ADP-ribosylation factor 3 Proteins 0.000 description 1
- 101000684189 Homo sapiens ADP-ribosylation factor 4 Proteins 0.000 description 1
- 101000779222 Homo sapiens AP-1 complex subunit beta-1 Proteins 0.000 description 1
- 101000757394 Homo sapiens AP-2 complex subunit alpha-2 Proteins 0.000 description 1
- 101000732341 Homo sapiens AP-2 complex subunit beta Proteins 0.000 description 1
- 101000796047 Homo sapiens AP-2 complex subunit mu Proteins 0.000 description 1
- 101000806914 Homo sapiens AP-2 complex subunit sigma Proteins 0.000 description 1
- 101000779252 Homo sapiens AP-3 complex subunit delta-1 Proteins 0.000 description 1
- 101000924266 Homo sapiens AT-rich interactive domain-containing protein 1A Proteins 0.000 description 1
- 101000792933 Homo sapiens AT-rich interactive domain-containing protein 4A Proteins 0.000 description 1
- 101000905623 Homo sapiens ATP synthase F(0) complex subunit B1, mitochondrial Proteins 0.000 description 1
- 101000970995 Homo sapiens ATP synthase subunit O, mitochondrial Proteins 0.000 description 1
- 101000936262 Homo sapiens ATP synthase subunit alpha, mitochondrial Proteins 0.000 description 1
- 101000903027 Homo sapiens ATP synthase subunit beta, mitochondrial Proteins 0.000 description 1
- 101000905627 Homo sapiens ATP synthase subunit epsilon-like protein, mitochondrial Proteins 0.000 description 1
- 101000765664 Homo sapiens ATP synthase subunit f, mitochondrial Proteins 0.000 description 1
- 101000936950 Homo sapiens ATP synthase subunit g, mitochondrial Proteins 0.000 description 1
- 101000730170 Homo sapiens ATP synthase subunit gamma, mitochondrial Proteins 0.000 description 1
- 101000782969 Homo sapiens ATP-citrate synthase Proteins 0.000 description 1
- 101000693765 Homo sapiens ATP-dependent 6-phosphofructokinase, platelet type Proteins 0.000 description 1
- 101000580659 Homo sapiens ATP-dependent DNA helicase Q1 Proteins 0.000 description 1
- 101000864670 Homo sapiens ATP-dependent RNA helicase A Proteins 0.000 description 1
- 101001041697 Homo sapiens ATP-dependent RNA helicase DDX1 Proteins 0.000 description 1
- 101001041703 Homo sapiens ATP-dependent RNA helicase DDX18 Proteins 0.000 description 1
- 101000870662 Homo sapiens ATP-dependent RNA helicase DDX3X Proteins 0.000 description 1
- 101000883804 Homo sapiens ATP-dependent RNA helicase DDX54 Proteins 0.000 description 1
- 101001074983 Homo sapiens ATPase GET3 Proteins 0.000 description 1
- 101000923360 Homo sapiens ATPase family AAA domain-containing protein 3A Proteins 0.000 description 1
- 101000598552 Homo sapiens Acetyl-CoA acetyltransferase, mitochondrial Proteins 0.000 description 1
- 101000929319 Homo sapiens Actin, aortic smooth muscle Proteins 0.000 description 1
- 101000678433 Homo sapiens Actin, gamma-enteric smooth muscle Proteins 0.000 description 1
- 101000798882 Homo sapiens Actin-like protein 6A Proteins 0.000 description 1
- 101000754209 Homo sapiens Actin-related protein 10 Proteins 0.000 description 1
- 101000809459 Homo sapiens Actin-related protein 2/3 complex subunit 1B Proteins 0.000 description 1
- 101000754220 Homo sapiens Actin-related protein 2/3 complex subunit 2 Proteins 0.000 description 1
- 101000925574 Homo sapiens Actin-related protein 2/3 complex subunit 3 Proteins 0.000 description 1
- 101000925566 Homo sapiens Actin-related protein 2/3 complex subunit 4 Proteins 0.000 description 1
- 101000925555 Homo sapiens Actin-related protein 2/3 complex subunit 5 Proteins 0.000 description 1
- 101000785745 Homo sapiens Actin-related protein 2/3 complex subunit 5-like protein Proteins 0.000 description 1
- 101000784204 Homo sapiens Activating signal cointegrator 1 complex subunit 2 Proteins 0.000 description 1
- 101000824278 Homo sapiens Acyl-[acyl-carrier-protein] hydrolase Proteins 0.000 description 1
- 101000716952 Homo sapiens Adenosylhomocysteinase Proteins 0.000 description 1
- 101000684373 Homo sapiens Adipocyte plasma membrane-associated protein Proteins 0.000 description 1
- 101000959594 Homo sapiens Agrin Proteins 0.000 description 1
- 101000879354 Homo sapiens Alanine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000959038 Homo sapiens Aldehyde dehydrogenase X, mitochondrial Proteins 0.000 description 1
- 101000761405 Homo sapiens Aldehyde dehydrogenase family 16 member A1 Proteins 0.000 description 1
- 101000718007 Homo sapiens Aldo-keto reductase family 1 member A1 Proteins 0.000 description 1
- 101000799406 Homo sapiens Alpha-actinin-1 Proteins 0.000 description 1
- 101000797282 Homo sapiens Alpha-actinin-4 Proteins 0.000 description 1
- 101000799076 Homo sapiens Alpha-adducin Proteins 0.000 description 1
- 101000780227 Homo sapiens Alpha-centractin Proteins 0.000 description 1
- 101000882335 Homo sapiens Alpha-enolase Proteins 0.000 description 1
- 101000755758 Homo sapiens Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Proteins 0.000 description 1
- 101001099918 Homo sapiens Ankycorbin Proteins 0.000 description 1
- 101000924481 Homo sapiens Ankyrin repeat domain-containing protein 17 Proteins 0.000 description 1
- 101000959738 Homo sapiens Annexin A1 Proteins 0.000 description 1
- 101000924474 Homo sapiens Annexin A2 Proteins 0.000 description 1
- 101000924454 Homo sapiens Annexin A3 Proteins 0.000 description 1
- 101000924461 Homo sapiens Annexin A4 Proteins 0.000 description 1
- 101000780122 Homo sapiens Annexin A5 Proteins 0.000 description 1
- 101000780137 Homo sapiens Annexin A6 Proteins 0.000 description 1
- 101000959871 Homo sapiens Apoptosis inhibitor 5 Proteins 0.000 description 1
- 101000971171 Homo sapiens Apoptosis regulator Bcl-2 Proteins 0.000 description 1
- 101000890622 Homo sapiens Apoptosis-inducing factor 1, mitochondrial Proteins 0.000 description 1
- 101000733571 Homo sapiens Arf-GAP with Rho-GAP domain, ANK repeat and PH domain-containing protein 3 Proteins 0.000 description 1
- 101000624939 Homo sapiens Asparagine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000799549 Homo sapiens Aspartate aminotransferase, mitochondrial Proteins 0.000 description 1
- 101000696909 Homo sapiens Aspartate-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000901030 Homo sapiens Aspartyl/asparaginyl beta-hydroxylase Proteins 0.000 description 1
- 101000874270 Homo sapiens B-cell receptor-associated protein 31 Proteins 0.000 description 1
- 101000740067 Homo sapiens Barrier-to-autointegration factor Proteins 0.000 description 1
- 101000798490 Homo sapiens Bcl-2-associated transcription factor 1 Proteins 0.000 description 1
- 101000834261 Homo sapiens Beta-actin-like protein 2 Proteins 0.000 description 1
- 101000922061 Homo sapiens Beta-catenin-like protein 1 Proteins 0.000 description 1
- 101000765010 Homo sapiens Beta-galactosidase Proteins 0.000 description 1
- 101000874052 Homo sapiens Biorientation of chromosomes in cell division protein 1-like 1 Proteins 0.000 description 1
- 101000935689 Homo sapiens Brain acid soluble protein 1 Proteins 0.000 description 1
- 101000984916 Homo sapiens Butyrophilin subfamily 3 member A3 Proteins 0.000 description 1
- 101000777550 Homo sapiens CCN family member 2 Proteins 0.000 description 1
- 101000738399 Homo sapiens CD109 antigen Proteins 0.000 description 1
- 101000914499 Homo sapiens CD2-associated protein Proteins 0.000 description 1
- 101000868273 Homo sapiens CD44 antigen Proteins 0.000 description 1
- 101000897400 Homo sapiens CD59 glycoprotein Proteins 0.000 description 1
- 101000896048 Homo sapiens COP9 signalosome complex subunit 5 Proteins 0.000 description 1
- 101001101919 Homo sapiens CTP synthase 1 Proteins 0.000 description 1
- 101000762243 Homo sapiens Cadherin-13 Proteins 0.000 description 1
- 101000714537 Homo sapiens Cadherin-2 Proteins 0.000 description 1
- 101001077338 Homo sapiens Calcium/calmodulin-dependent protein kinase type II subunit delta Proteins 0.000 description 1
- 101000910297 Homo sapiens Caldesmon Proteins 0.000 description 1
- 101000984164 Homo sapiens Calmodulin-1 Proteins 0.000 description 1
- 101000898052 Homo sapiens Calnexin Proteins 0.000 description 1
- 101000934069 Homo sapiens Calpain-1 catalytic subunit Proteins 0.000 description 1
- 101000867692 Homo sapiens Calpain-2 catalytic subunit Proteins 0.000 description 1
- 101000793666 Homo sapiens Calpain-5 Proteins 0.000 description 1
- 101000945318 Homo sapiens Calponin-1 Proteins 0.000 description 1
- 101000945403 Homo sapiens Calponin-2 Proteins 0.000 description 1
- 101000945410 Homo sapiens Calponin-3 Proteins 0.000 description 1
- 101000793651 Homo sapiens Calreticulin Proteins 0.000 description 1
- 101000900758 Homo sapiens Cardiomyopathy-associated protein 5 Proteins 0.000 description 1
- 101000892026 Homo sapiens Casein kinase II subunit alpha Proteins 0.000 description 1
- 101000892015 Homo sapiens Casein kinase II subunit alpha' Proteins 0.000 description 1
- 101000859063 Homo sapiens Catenin alpha-1 Proteins 0.000 description 1
- 101000916173 Homo sapiens Catenin beta-1 Proteins 0.000 description 1
- 101000916264 Homo sapiens Catenin delta-1 Proteins 0.000 description 1
- 101000898449 Homo sapiens Cathepsin B Proteins 0.000 description 1
- 101000869010 Homo sapiens Cathepsin D Proteins 0.000 description 1
- 101000869049 Homo sapiens Caveolae-associated protein 1 Proteins 0.000 description 1
- 101000761506 Homo sapiens Caveolae-associated protein 3 Proteins 0.000 description 1
- 101000715467 Homo sapiens Caveolin-1 Proteins 0.000 description 1
- 101000715194 Homo sapiens Cell cycle and apoptosis regulator protein 2 Proteins 0.000 description 1
- 101000868318 Homo sapiens Cell division cycle 5-like protein Proteins 0.000 description 1
- 101000623903 Homo sapiens Cell surface glycoprotein MUC18 Proteins 0.000 description 1
- 101000880492 Homo sapiens Centromere protein V Proteins 0.000 description 1
- 101000946430 Homo sapiens Chloride intracellular channel protein 1 Proteins 0.000 description 1
- 101000906636 Homo sapiens Chloride intracellular channel protein 4 Proteins 0.000 description 1
- 101000906631 Homo sapiens Chloride intracellular channel protein 6 Proteins 0.000 description 1
- 101000737958 Homo sapiens Chromatin target of PRMT1 protein Proteins 0.000 description 1
- 101000797584 Homo sapiens Chromobox protein homolog 1 Proteins 0.000 description 1
- 101000777795 Homo sapiens Chromodomain Y-like protein Proteins 0.000 description 1
- 101000883749 Homo sapiens Chromodomain-helicase-DNA-binding protein 4 Proteins 0.000 description 1
- 101000912851 Homo sapiens Clathrin heavy chain 1 Proteins 0.000 description 1
- 101000710244 Homo sapiens Clathrin light chain A Proteins 0.000 description 1
- 101000727072 Homo sapiens Cleavage and polyadenylation specificity factor subunit 5 Proteins 0.000 description 1
- 101000940352 Homo sapiens Coactosin-like protein Proteins 0.000 description 1
- 101000919970 Homo sapiens Coatomer subunit beta Proteins 0.000 description 1
- 101000899916 Homo sapiens Coatomer subunit beta' Proteins 0.000 description 1
- 101000860881 Homo sapiens Coatomer subunit delta Proteins 0.000 description 1
- 101000952964 Homo sapiens Coatomer subunit gamma-1 Proteins 0.000 description 1
- 101000978248 Homo sapiens Coiled-coil domain-containing protein 124 Proteins 0.000 description 1
- 101000868780 Homo sapiens Coiled-coil domain-containing protein 30 Proteins 0.000 description 1
- 101000907003 Homo sapiens Coiled-coil-helix-coiled-coil-helix domain-containing protein 1 Proteins 0.000 description 1
- 101000906744 Homo sapiens Cold-inducible RNA-binding protein Proteins 0.000 description 1
- 101000771163 Homo sapiens Collagen alpha-1(II) chain Proteins 0.000 description 1
- 101000993285 Homo sapiens Collagen alpha-1(III) chain Proteins 0.000 description 1
- 101000901150 Homo sapiens Collagen alpha-1(IV) chain Proteins 0.000 description 1
- 101000941708 Homo sapiens Collagen alpha-1(V) chain Proteins 0.000 description 1
- 101000941581 Homo sapiens Collagen alpha-1(VI) chain Proteins 0.000 description 1
- 101000909498 Homo sapiens Collagen alpha-1(VII) chain Proteins 0.000 description 1
- 101000909492 Homo sapiens Collagen alpha-1(VIII) chain Proteins 0.000 description 1
- 101000875027 Homo sapiens Collagen alpha-1(X) chain Proteins 0.000 description 1
- 101000710623 Homo sapiens Collagen alpha-1(XI) chain Proteins 0.000 description 1
- 101000861874 Homo sapiens Collagen alpha-1(XII) chain Proteins 0.000 description 1
- 101000940068 Homo sapiens Collagen alpha-1(XVIII) chain Proteins 0.000 description 1
- 101000952998 Homo sapiens Collagen alpha-1(XXII) chain Proteins 0.000 description 1
- 101000920176 Homo sapiens Collagen alpha-1(XXIII) chain Proteins 0.000 description 1
- 101000940372 Homo sapiens Collagen alpha-1(XXVII) chain Proteins 0.000 description 1
- 101000875067 Homo sapiens Collagen alpha-2(I) chain Proteins 0.000 description 1
- 101000710876 Homo sapiens Collagen alpha-2(IV) chain Proteins 0.000 description 1
- 101000919645 Homo sapiens Collagen alpha-2(IX) chain Proteins 0.000 description 1
- 101000941594 Homo sapiens Collagen alpha-2(V) chain Proteins 0.000 description 1
- 101000909506 Homo sapiens Collagen alpha-3(VI) chain Proteins 0.000 description 1
- 101000710885 Homo sapiens Collagen alpha-6(IV) chain Proteins 0.000 description 1
- 101000909495 Homo sapiens Collagen alpha-6(VI) chain Proteins 0.000 description 1
- 101000746121 Homo sapiens Collagen triple helix repeat-containing protein 1 Proteins 0.000 description 1
- 101000941754 Homo sapiens Copine-1 Proteins 0.000 description 1
- 101000941769 Homo sapiens Copine-3 Proteins 0.000 description 1
- 101001067929 Homo sapiens Core histone macro-H2A.1 Proteins 0.000 description 1
- 101001084697 Homo sapiens Core histone macro-H2A.2 Proteins 0.000 description 1
- 101000748846 Homo sapiens Coronin-1B Proteins 0.000 description 1
- 101000748856 Homo sapiens Coronin-1C Proteins 0.000 description 1
- 101000746063 Homo sapiens Cullin-1 Proteins 0.000 description 1
- 101000771075 Homo sapiens Cyclic nucleotide-gated cation channel beta-1 Proteins 0.000 description 1
- 101000922020 Homo sapiens Cysteine and glycine-rich protein 1 Proteins 0.000 description 1
- 101000942088 Homo sapiens Cysteine-rich protein 2 Proteins 0.000 description 1
- 101000607486 Homo sapiens Cytochrome b-c1 complex subunit 1, mitochondrial Proteins 0.000 description 1
- 101000746756 Homo sapiens Cytochrome b-c1 complex subunit 2, mitochondrial Proteins 0.000 description 1
- 101001079630 Homo sapiens Cytochrome b-c1 complex subunit 9 Proteins 0.000 description 1
- 101000726355 Homo sapiens Cytochrome c Proteins 0.000 description 1
- 101000725401 Homo sapiens Cytochrome c oxidase subunit 2 Proteins 0.000 description 1
- 101000900394 Homo sapiens Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Proteins 0.000 description 1
- 101000856741 Homo sapiens Cytochrome c oxidase subunit 7A2, mitochondrial Proteins 0.000 description 1
- 101000956872 Homo sapiens Cytoplasmic FMR1-interacting protein 1 Proteins 0.000 description 1
- 101000866326 Homo sapiens Cytoplasmic dynein 1 heavy chain 1 Proteins 0.000 description 1
- 101000915292 Homo sapiens Cytoplasmic dynein 1 intermediate chain 2 Proteins 0.000 description 1
- 101000954692 Homo sapiens Cytoplasmic dynein 1 light intermediate chain 1 Proteins 0.000 description 1
- 101000954691 Homo sapiens Cytoplasmic dynein 1 light intermediate chain 2 Proteins 0.000 description 1
- 101000766853 Homo sapiens Cytoskeleton-associated protein 4 Proteins 0.000 description 1
- 101000766864 Homo sapiens Cytoskeleton-associated protein 5 Proteins 0.000 description 1
- 101000739890 Homo sapiens D-3-phosphoglycerate dehydrogenase Proteins 0.000 description 1
- 101001028766 Homo sapiens DBH-like monooxygenase protein 1 Proteins 0.000 description 1
- 101000743929 Homo sapiens DNA repair protein RAD50 Proteins 0.000 description 1
- 101000830681 Homo sapiens DNA topoisomerase 1 Proteins 0.000 description 1
- 101000806846 Homo sapiens DNA-(apurinic or apyrimidinic site) endonuclease Proteins 0.000 description 1
- 101000619536 Homo sapiens DNA-dependent protein kinase catalytic subunit Proteins 0.000 description 1
- 101000729474 Homo sapiens DNA-directed RNA polymerase I subunit RPA1 Proteins 0.000 description 1
- 101000650600 Homo sapiens DNA-directed RNA polymerase I subunit RPA2 Proteins 0.000 description 1
- 101001106401 Homo sapiens DNA-directed RNA polymerase II subunit RPB1 Proteins 0.000 description 1
- 101000669831 Homo sapiens DNA-directed RNA polymerase II subunit RPB2 Proteins 0.000 description 1
- 101000669859 Homo sapiens DNA-directed RNA polymerase II subunit RPB3 Proteins 0.000 description 1
- 101001088177 Homo sapiens DNA-directed RNA polymerase II subunit RPB4 Proteins 0.000 description 1
- 101000686022 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC3 Proteins 0.000 description 1
- 101000956149 Homo sapiens Death-associated protein kinase 3 Proteins 0.000 description 1
- 101000924316 Homo sapiens Desmoglein-1 Proteins 0.000 description 1
- 101000924314 Homo sapiens Desmoglein-2 Proteins 0.000 description 1
- 101001122360 Homo sapiens Dihydrolipoyllysine-residue acetyltransferase component of pyruvate dehydrogenase complex, mitochondrial Proteins 0.000 description 1
- 101000992065 Homo sapiens Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Proteins 0.000 description 1
- 101001053503 Homo sapiens Dihydropyrimidinase-related protein 2 Proteins 0.000 description 1
- 101001053501 Homo sapiens Dihydropyrimidinase-related protein 3 Proteins 0.000 description 1
- 101000931862 Homo sapiens Dipeptidyl peptidase 3 Proteins 0.000 description 1
- 101000844774 Homo sapiens Disks large-associated protein 3 Proteins 0.000 description 1
- 101000931210 Homo sapiens DnaJ homolog subfamily A member 2 Proteins 0.000 description 1
- 101000866012 Homo sapiens DnaJ homolog subfamily A member 3, mitochondrial Proteins 0.000 description 1
- 101000805858 Homo sapiens DnaJ homolog subfamily B member 11 Proteins 0.000 description 1
- 101000804112 Homo sapiens DnaJ homolog subfamily B member 6 Proteins 0.000 description 1
- 101000908042 Homo sapiens DnaJ homolog subfamily C member 10 Proteins 0.000 description 1
- 101000908069 Homo sapiens DnaJ homolog subfamily C member 11 Proteins 0.000 description 1
- 101000932202 Homo sapiens Dolichol-phosphate mannosyltransferase subunit 1 Proteins 0.000 description 1
- 101001130785 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase 48 kDa subunit Proteins 0.000 description 1
- 101000848781 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit 1 Proteins 0.000 description 1
- 101000670093 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit 2 Proteins 0.000 description 1
- 101000954709 Homo sapiens Doublecortin domain-containing protein 2 Proteins 0.000 description 1
- 101000838600 Homo sapiens Drebrin Proteins 0.000 description 1
- 101000929626 Homo sapiens Dynactin subunit 1 Proteins 0.000 description 1
- 101001041190 Homo sapiens Dynactin subunit 2 Proteins 0.000 description 1
- 101000909218 Homo sapiens Dynamin-1-like protein Proteins 0.000 description 1
- 101001016205 Homo sapiens Dynein axonemal heavy chain 10 Proteins 0.000 description 1
- 101000908688 Homo sapiens Dynein light chain Tctex-type 1 Proteins 0.000 description 1
- 101000942970 Homo sapiens E3 ubiquitin-protein ligase CHFR Proteins 0.000 description 1
- 101001019732 Homo sapiens E3 ubiquitin-protein ligase HUWE1 Proteins 0.000 description 1
- 101000650316 Homo sapiens E3 ubiquitin-protein ligase RNF213 Proteins 0.000 description 1
- 101000807547 Homo sapiens E3 ubiquitin-protein ligase UBR4 Proteins 0.000 description 1
- 101000848655 Homo sapiens E3 ubiquitin/ISG15 ligase TRIM25 Proteins 0.000 description 1
- 101001016381 Homo sapiens EGF-like repeat and discoidin I-like domain-containing protein 3 Proteins 0.000 description 1
- 101000921221 Homo sapiens EH domain-containing protein 1 Proteins 0.000 description 1
- 101000921226 Homo sapiens EH domain-containing protein 2 Proteins 0.000 description 1
- 101000921218 Homo sapiens EH domain-containing protein 4 Proteins 0.000 description 1
- 101000812437 Homo sapiens ER lumen protein-retaining receptor 1 Proteins 0.000 description 1
- 101000898776 Homo sapiens ER lumen protein-retaining receptor 3 Proteins 0.000 description 1
- 101001010541 Homo sapiens Electron transfer flavoprotein subunit alpha, mitochondrial Proteins 0.000 description 1
- 101000920078 Homo sapiens Elongation factor 1-alpha 1 Proteins 0.000 description 1
- 101000920062 Homo sapiens Elongation factor 1-delta Proteins 0.000 description 1
- 101001050451 Homo sapiens Elongation factor 1-gamma Proteins 0.000 description 1
- 101000812663 Homo sapiens Endoplasmin Proteins 0.000 description 1
- 101000895665 Homo sapiens Enhancer of mRNA-decapping protein 4 Proteins 0.000 description 1
- 101000896042 Homo sapiens Enoyl-CoA delta isomerase 2 Proteins 0.000 description 1
- 101000876686 Homo sapiens Epidermal growth factor receptor kinase substrate 8-like protein 2 Proteins 0.000 description 1
- 101000851943 Homo sapiens Epiplakin Proteins 0.000 description 1
- 101001077852 Homo sapiens Epoxide hydrolase 1 Proteins 0.000 description 1
- 101000959666 Homo sapiens Eukaryotic initiation factor 4A-I Proteins 0.000 description 1
- 101001044466 Homo sapiens Eukaryotic initiation factor 4A-III Proteins 0.000 description 1
- 101000938790 Homo sapiens Eukaryotic peptide chain release factor subunit 1 Proteins 0.000 description 1
- 101000615221 Homo sapiens Eukaryotic translation elongation factor 1 epsilon-1 Proteins 0.000 description 1
- 101001020112 Homo sapiens Eukaryotic translation initiation factor 2 subunit 1 Proteins 0.000 description 1
- 101001081893 Homo sapiens Eukaryotic translation initiation factor 2 subunit 2 Proteins 0.000 description 1
- 101000959829 Homo sapiens Eukaryotic translation initiation factor 2 subunit 3 Proteins 0.000 description 1
- 101001034825 Homo sapiens Eukaryotic translation initiation factor 4 gamma 1 Proteins 0.000 description 1
- 101001034811 Homo sapiens Eukaryotic translation initiation factor 4 gamma 2 Proteins 0.000 description 1
- 101001054360 Homo sapiens Eukaryotic translation initiation factor 4H Proteins 0.000 description 1
- 101001054354 Homo sapiens Eukaryotic translation initiation factor 5A-1 Proteins 0.000 description 1
- 101001036496 Homo sapiens Eukaryotic translation initiation factor 5B Proteins 0.000 description 1
- 101000851525 Homo sapiens Extended synaptotagmin-1 Proteins 0.000 description 1
- 101000910965 Homo sapiens F-actin-capping protein subunit alpha-1 Proteins 0.000 description 1
- 101000933166 Homo sapiens F-actin-capping protein subunit alpha-2 Proteins 0.000 description 1
- 101000793778 Homo sapiens F-actin-capping protein subunit beta Proteins 0.000 description 1
- 101000836111 Homo sapiens FACT complex subunit SPT16 Proteins 0.000 description 1
- 101001060553 Homo sapiens FH2 domain-containing protein 1 Proteins 0.000 description 1
- 101001022168 Homo sapiens FYVE and coiled-coil domain-containing protein 1 Proteins 0.000 description 1
- 101000930770 Homo sapiens Far upstream element-binding protein 1 Proteins 0.000 description 1
- 101000930766 Homo sapiens Far upstream element-binding protein 2 Proteins 0.000 description 1
- 101001023007 Homo sapiens Farnesyl pyrophosphate synthase Proteins 0.000 description 1
- 101001021925 Homo sapiens Fascin Proteins 0.000 description 1
- 101000892677 Homo sapiens Fermitin family homolog 2 Proteins 0.000 description 1
- 101001002987 Homo sapiens Ferritin heavy chain Proteins 0.000 description 1
- 101000846893 Homo sapiens Fibrillin-1 Proteins 0.000 description 1
- 101000862369 Homo sapiens Fibrous sheath-interacting protein 2 Proteins 0.000 description 1
- 101001065276 Homo sapiens Fibulin-1 Proteins 0.000 description 1
- 101001065274 Homo sapiens Fibulin-2 Proteins 0.000 description 1
- 101000878281 Homo sapiens Filaggrin-2 Proteins 0.000 description 1
- 101000913549 Homo sapiens Filamin-A Proteins 0.000 description 1
- 101000913551 Homo sapiens Filamin-B Proteins 0.000 description 1
- 101000847538 Homo sapiens Flotillin-1 Proteins 0.000 description 1
- 101000828609 Homo sapiens Flotillin-2 Proteins 0.000 description 1
- 101000930945 Homo sapiens Fragile X mental retardation syndrome-related protein 1 Proteins 0.000 description 1
- 101000755879 Homo sapiens Fructose-bisphosphate aldolase A Proteins 0.000 description 1
- 101000997961 Homo sapiens GDNF family receptor alpha-1 Proteins 0.000 description 1
- 101001099051 Homo sapiens GPI inositol-deacylase Proteins 0.000 description 1
- 101001037074 Homo sapiens GRB10-interacting GYF protein 2 Proteins 0.000 description 1
- 101000828886 Homo sapiens GTP-binding protein 4 Proteins 0.000 description 1
- 101000637622 Homo sapiens GTP-binding protein SAR1a Proteins 0.000 description 1
- 101000967904 Homo sapiens Galectin-3-binding protein Proteins 0.000 description 1
- 101000799011 Homo sapiens Gamma-adducin Proteins 0.000 description 1
- 101001032427 Homo sapiens General transcription factor II-I Proteins 0.000 description 1
- 101000972925 Homo sapiens Glucoamylase Proteins 0.000 description 1
- 101001040875 Homo sapiens Glucosidase 2 subunit beta Proteins 0.000 description 1
- 101000870042 Homo sapiens Glutamate dehydrogenase 1, mitochondrial Proteins 0.000 description 1
- 101000997929 Homo sapiens Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 Proteins 0.000 description 1
- 101000625192 Homo sapiens Glutamine-tRNA ligase Proteins 0.000 description 1
- 101001071851 Homo sapiens Glutaredoxin-3 Proteins 0.000 description 1
- 101001010139 Homo sapiens Glutathione S-transferase P Proteins 0.000 description 1
- 101001014936 Homo sapiens Glutathione peroxidase 1 Proteins 0.000 description 1
- 101000748183 Homo sapiens Glycogen phosphorylase, brain form Proteins 0.000 description 1
- 101000700616 Homo sapiens Glycogen phosphorylase, liver form Proteins 0.000 description 1
- 101000979544 Homo sapiens Glycylpeptide N-tetradecanoyltransferase 2 Proteins 0.000 description 1
- 101001040704 Homo sapiens Glypican-6 Proteins 0.000 description 1
- 101001069963 Homo sapiens Golgi apparatus protein 1 Proteins 0.000 description 1
- 101000922994 Homo sapiens Golgi-associated plant pathogenesis-related protein 1 Proteins 0.000 description 1
- 101001039330 Homo sapiens Golgin subfamily A member 5 Proteins 0.000 description 1
- 101001032872 Homo sapiens Gremlin-1 Proteins 0.000 description 1
- 101000893549 Homo sapiens Growth/differentiation factor 15 Proteins 0.000 description 1
- 101000926823 Homo sapiens Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-12 Proteins 0.000 description 1
- 101001024316 Homo sapiens Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Proteins 0.000 description 1
- 101001024278 Homo sapiens Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Proteins 0.000 description 1
- 101001070508 Homo sapiens Guanine nucleotide-binding protein G(i) subunit alpha-2 Proteins 0.000 description 1
- 101001040748 Homo sapiens Guanine nucleotide-binding protein-like 3 Proteins 0.000 description 1
- 101000819109 Homo sapiens H/ACA ribonucleoprotein complex subunit 1 Proteins 0.000 description 1
- 101000844866 Homo sapiens H/ACA ribonucleoprotein complex subunit DKC1 Proteins 0.000 description 1
- 101001080568 Homo sapiens Heat shock cognate 71 kDa protein Proteins 0.000 description 1
- 101001016865 Homo sapiens Heat shock protein HSP 90-alpha Proteins 0.000 description 1
- 101001016856 Homo sapiens Heat shock protein HSP 90-beta Proteins 0.000 description 1
- 101000985806 Homo sapiens Heat shock-related 70 kDa protein 2 Proteins 0.000 description 1
- 101000704158 Homo sapiens Helicase SRCAP Proteins 0.000 description 1
- 101000839056 Homo sapiens Hemicentin-2 Proteins 0.000 description 1
- 101001048116 Homo sapiens Heparan sulfate glucosamine 3-O-sulfotransferase 6 Proteins 0.000 description 1
- 101001025546 Homo sapiens Heterochromatin protein 1-binding protein 3 Proteins 0.000 description 1
- 101000854036 Homo sapiens Heterogeneous nuclear ribonucleoprotein A/B Proteins 0.000 description 1
- 101000685879 Homo sapiens Heterogeneous nuclear ribonucleoprotein A0 Proteins 0.000 description 1
- 101000854014 Homo sapiens Heterogeneous nuclear ribonucleoprotein A1 Proteins 0.000 description 1
- 101000854041 Homo sapiens Heterogeneous nuclear ribonucleoprotein A3 Proteins 0.000 description 1
- 101001081145 Homo sapiens Heterogeneous nuclear ribonucleoprotein D-like Proteins 0.000 description 1
- 101001017535 Homo sapiens Heterogeneous nuclear ribonucleoprotein D0 Proteins 0.000 description 1
- 101001081149 Homo sapiens Heterogeneous nuclear ribonucleoprotein H Proteins 0.000 description 1
- 101001081143 Homo sapiens Heterogeneous nuclear ribonucleoprotein H2 Proteins 0.000 description 1
- 101001017561 Homo sapiens Heterogeneous nuclear ribonucleoprotein H3 Proteins 0.000 description 1
- 101000838964 Homo sapiens Heterogeneous nuclear ribonucleoprotein K Proteins 0.000 description 1
- 101000839078 Homo sapiens Heterogeneous nuclear ribonucleoprotein L Proteins 0.000 description 1
- 101000839073 Homo sapiens Heterogeneous nuclear ribonucleoprotein M Proteins 0.000 description 1
- 101000839069 Homo sapiens Heterogeneous nuclear ribonucleoprotein Q Proteins 0.000 description 1
- 101001047853 Homo sapiens Heterogeneous nuclear ribonucleoprotein R Proteins 0.000 description 1
- 101001047854 Homo sapiens Heterogeneous nuclear ribonucleoprotein U Proteins 0.000 description 1
- 101001017570 Homo sapiens Heterogeneous nuclear ribonucleoprotein U-like protein 2 Proteins 0.000 description 1
- 101000854026 Homo sapiens Heterogeneous nuclear ribonucleoproteins A2/B1 Proteins 0.000 description 1
- 101001017574 Homo sapiens Heterogeneous nuclear ribonucleoproteins C1/C2 Proteins 0.000 description 1
- 101001045794 Homo sapiens High mobility group protein B3 Proteins 0.000 description 1
- 101000986380 Homo sapiens High mobility group protein HMG-I/HMG-Y Proteins 0.000 description 1
- 101000843187 Homo sapiens Histidine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101001026554 Homo sapiens Histone H1.0 Proteins 0.000 description 1
- 101001009443 Homo sapiens Histone H1.4 Proteins 0.000 description 1
- 101000899879 Homo sapiens Histone H1.5 Proteins 0.000 description 1
- 101001009465 Homo sapiens Histone H2A type 2-C Proteins 0.000 description 1
- 101000843302 Homo sapiens Histone H2A.J Proteins 0.000 description 1
- 101001084711 Homo sapiens Histone H2A.V Proteins 0.000 description 1
- 101001067891 Homo sapiens Histone H2AX Proteins 0.000 description 1
- 101001084684 Homo sapiens Histone H2B type 1-D Proteins 0.000 description 1
- 101001067844 Homo sapiens Histone H3.1 Proteins 0.000 description 1
- 101000871895 Homo sapiens Histone H3.2 Proteins 0.000 description 1
- 101001067880 Homo sapiens Histone H4 Proteins 0.000 description 1
- 101001035011 Homo sapiens Histone deacetylase 2 Proteins 0.000 description 1
- 101000693664 Homo sapiens Histone deacetylase complex subunit SAP18 Proteins 0.000 description 1
- 101001008894 Homo sapiens Histone-lysine N-methyltransferase 2D Proteins 0.000 description 1
- 101000634050 Homo sapiens Histone-lysine N-methyltransferase, H3 lysine-36 specific Proteins 0.000 description 1
- 101000839775 Homo sapiens Homeobox protein Hox-B3 Proteins 0.000 description 1
- 101000985261 Homo sapiens Hornerin Proteins 0.000 description 1
- 101000911772 Homo sapiens Hsc70-interacting protein Proteins 0.000 description 1
- 101001079904 Homo sapiens Hyaluronan and proteoglycan link protein 1 Proteins 0.000 description 1
- 101001078431 Homo sapiens Hyaluronan and proteoglycan link protein 3 Proteins 0.000 description 1
- 101001037204 Homo sapiens Hydrocephalus-inducing protein homolog Proteins 0.000 description 1
- 101001003102 Homo sapiens Hypoxia up-regulated protein 1 Proteins 0.000 description 1
- 101001076297 Homo sapiens IGF-like family receptor 1 Proteins 0.000 description 1
- 101100125778 Homo sapiens IGHM gene Proteins 0.000 description 1
- 101001053564 Homo sapiens IQ domain-containing protein N Proteins 0.000 description 1
- 101001076305 Homo sapiens Immunoglobulin-like and fibronectin type III domain-containing protein 1 Proteins 0.000 description 1
- 101000998629 Homo sapiens Importin subunit beta-1 Proteins 0.000 description 1
- 101000852543 Homo sapiens Importin-4 Proteins 0.000 description 1
- 101000852539 Homo sapiens Importin-5 Proteins 0.000 description 1
- 101000599445 Homo sapiens Importin-7 Proteins 0.000 description 1
- 101000599453 Homo sapiens Importin-9 Proteins 0.000 description 1
- 101001138523 Homo sapiens Inosine 5'-monophosphate cyclohydrolase Proteins 0.000 description 1
- 101001076642 Homo sapiens Inosine-5'-monophosphate dehydrogenase 2 Proteins 0.000 description 1
- 101000599779 Homo sapiens Insulin-like growth factor 2 mRNA-binding protein 2 Proteins 0.000 description 1
- 101000599782 Homo sapiens Insulin-like growth factor 2 mRNA-binding protein 3 Proteins 0.000 description 1
- 101000840577 Homo sapiens Insulin-like growth factor-binding protein 7 Proteins 0.000 description 1
- 101000994378 Homo sapiens Integrin alpha-3 Proteins 0.000 description 1
- 101001046677 Homo sapiens Integrin alpha-V Proteins 0.000 description 1
- 101000935043 Homo sapiens Integrin beta-1 Proteins 0.000 description 1
- 101001015004 Homo sapiens Integrin beta-3 Proteins 0.000 description 1
- 101000609406 Homo sapiens Inter-alpha-trypsin inhibitor heavy chain H3 Proteins 0.000 description 1
- 101000599852 Homo sapiens Intercellular adhesion molecule 1 Proteins 0.000 description 1
- 101000926535 Homo sapiens Interferon-induced, double-stranded RNA-activated protein kinase Proteins 0.000 description 1
- 101001125123 Homo sapiens Interferon-inducible double-stranded RNA-dependent protein kinase activator A Proteins 0.000 description 1
- 101000998711 Homo sapiens Inversin Proteins 0.000 description 1
- 101001012154 Homo sapiens Inverted formin-2 Proteins 0.000 description 1
- 101000960234 Homo sapiens Isocitrate dehydrogenase [NADP] cytoplasmic Proteins 0.000 description 1
- 101000599886 Homo sapiens Isocitrate dehydrogenase [NADP], mitochondrial Proteins 0.000 description 1
- 101000875582 Homo sapiens Isoleucine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101001050616 Homo sapiens KH domain-containing, RNA-binding, signal transduction-associated protein 1 Proteins 0.000 description 1
- 101001050607 Homo sapiens KH domain-containing, RNA-binding, signal transduction-associated protein 3 Proteins 0.000 description 1
- 101000975474 Homo sapiens Keratin, type I cytoskeletal 10 Proteins 0.000 description 1
- 101000614436 Homo sapiens Keratin, type I cytoskeletal 14 Proteins 0.000 description 1
- 101000614442 Homo sapiens Keratin, type I cytoskeletal 16 Proteins 0.000 description 1
- 101000998020 Homo sapiens Keratin, type I cytoskeletal 18 Proteins 0.000 description 1
- 101000998011 Homo sapiens Keratin, type I cytoskeletal 19 Proteins 0.000 description 1
- 101001050274 Homo sapiens Keratin, type I cytoskeletal 9 Proteins 0.000 description 1
- 101001026973 Homo sapiens Keratin, type II cuticular Hb4 Proteins 0.000 description 1
- 101001026979 Homo sapiens Keratin, type II cuticular Hb5 Proteins 0.000 description 1
- 101001046960 Homo sapiens Keratin, type II cytoskeletal 1 Proteins 0.000 description 1
- 101001046936 Homo sapiens Keratin, type II cytoskeletal 2 epidermal Proteins 0.000 description 1
- 101001056473 Homo sapiens Keratin, type II cytoskeletal 5 Proteins 0.000 description 1
- 101001056445 Homo sapiens Keratin, type II cytoskeletal 6B Proteins 0.000 description 1
- 101000975496 Homo sapiens Keratin, type II cytoskeletal 8 Proteins 0.000 description 1
- 101001090172 Homo sapiens Kinectin Proteins 0.000 description 1
- 101000605496 Homo sapiens Kinesin light chain 1 Proteins 0.000 description 1
- 101001050559 Homo sapiens Kinesin-1 heavy chain Proteins 0.000 description 1
- 101000605741 Homo sapiens Kinesin-like protein KIF24 Proteins 0.000 description 1
- 101001046537 Homo sapiens Kinesin-like protein KIFC2 Proteins 0.000 description 1
- 101001121408 Homo sapiens L-amino-acid oxidase Proteins 0.000 description 1
- 101001090713 Homo sapiens L-lactate dehydrogenase A chain Proteins 0.000 description 1
- 101001051207 Homo sapiens L-lactate dehydrogenase B chain Proteins 0.000 description 1
- 101001023330 Homo sapiens LIM and SH3 domain protein 1 Proteins 0.000 description 1
- 101001134694 Homo sapiens LIM domain and actin-binding protein 1 Proteins 0.000 description 1
- 101001135088 Homo sapiens LIM domain only protein 7 Proteins 0.000 description 1
- 101001034314 Homo sapiens Lactadherin Proteins 0.000 description 1
- 101001003581 Homo sapiens Lamin-B1 Proteins 0.000 description 1
- 101001047746 Homo sapiens Lamina-associated polypeptide 2, isoform alpha Proteins 0.000 description 1
- 101001047731 Homo sapiens Lamina-associated polypeptide 2, isoforms beta/gamma Proteins 0.000 description 1
- 101001008527 Homo sapiens Laminin subunit alpha-5 Proteins 0.000 description 1
- 101001008568 Homo sapiens Laminin subunit beta-1 Proteins 0.000 description 1
- 101001023271 Homo sapiens Laminin subunit gamma-2 Proteins 0.000 description 1
- 101001054659 Homo sapiens Latent-transforming growth factor beta-binding protein 1 Proteins 0.000 description 1
- 101001054649 Homo sapiens Latent-transforming growth factor beta-binding protein 2 Proteins 0.000 description 1
- 101001054646 Homo sapiens Latent-transforming growth factor beta-binding protein 3 Proteins 0.000 description 1
- 101000978212 Homo sapiens Latent-transforming growth factor beta-binding protein 4 Proteins 0.000 description 1
- 101001054848 Homo sapiens Leucine zipper protein 1 Proteins 0.000 description 1
- 101000966742 Homo sapiens Leucine-rich PPR motif-containing protein, mitochondrial Proteins 0.000 description 1
- 101001017828 Homo sapiens Leucine-rich repeat flightless-interacting protein 1 Proteins 0.000 description 1
- 101001039189 Homo sapiens Leucine-rich repeat-containing protein 17 Proteins 0.000 description 1
- 101000579789 Homo sapiens Leucine-rich repeat-containing protein 59 Proteins 0.000 description 1
- 101001137975 Homo sapiens Leucyl-cystinyl aminopeptidase Proteins 0.000 description 1
- 101001064870 Homo sapiens Lon protease homolog, mitochondrial Proteins 0.000 description 1
- 101000841267 Homo sapiens Long chain 3-hydroxyacyl-CoA dehydrogenase Proteins 0.000 description 1
- 101000984620 Homo sapiens Low-density lipoprotein receptor-related protein 1B Proteins 0.000 description 1
- 101001043562 Homo sapiens Low-density lipoprotein receptor-related protein 2 Proteins 0.000 description 1
- 101000742901 Homo sapiens Lysophosphatidylserine lipase ABHD12 Proteins 0.000 description 1
- 101001039696 Homo sapiens Lysophospholipid acyltransferase 7 Proteins 0.000 description 1
- 101001122938 Homo sapiens Lysosomal protective protein Proteins 0.000 description 1
- 101001043321 Homo sapiens Lysyl oxidase homolog 1 Proteins 0.000 description 1
- 101001043352 Homo sapiens Lysyl oxidase homolog 2 Proteins 0.000 description 1
- 101001014572 Homo sapiens MARCKS-related protein Proteins 0.000 description 1
- 101001121072 Homo sapiens MICOS complex subunit MIC19 Proteins 0.000 description 1
- 101001120854 Homo sapiens MKI67 FHA domain-interacting nucleolar phosphoprotein Proteins 0.000 description 1
- 101000977270 Homo sapiens MMS19 nucleotide excision repair protein homolog Proteins 0.000 description 1
- 101000760817 Homo sapiens Macrophage-capping protein Proteins 0.000 description 1
- 101001056308 Homo sapiens Malate dehydrogenase, cytoplasmic Proteins 0.000 description 1
- 101001033820 Homo sapiens Malate dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101000957559 Homo sapiens Matrin-3 Proteins 0.000 description 1
- 101001011906 Homo sapiens Matrix metalloproteinase-14 Proteins 0.000 description 1
- 101000629400 Homo sapiens Mesoderm-specific transcript homolog protein Proteins 0.000 description 1
- 101001028019 Homo sapiens Metastasis-associated protein MTA2 Proteins 0.000 description 1
- 101000578830 Homo sapiens Methionine aminopeptidase 1 Proteins 0.000 description 1
- 101000628785 Homo sapiens Microsomal glutathione S-transferase 3 Proteins 0.000 description 1
- 101001057324 Homo sapiens Microtubule-associated protein 1A Proteins 0.000 description 1
- 101000616438 Homo sapiens Microtubule-associated protein 4 Proteins 0.000 description 1
- 101000962664 Homo sapiens Microtubule-associated protein RP/EB family member 1 Proteins 0.000 description 1
- 101000623667 Homo sapiens Mitochondrial carrier homolog 1 Proteins 0.000 description 1
- 101001013994 Homo sapiens Mitochondrial carrier homolog 2 Proteins 0.000 description 1
- 101000827338 Homo sapiens Mitochondrial fission 1 protein Proteins 0.000 description 1
- 101000764216 Homo sapiens Mitochondrial import receptor subunit TOM40 homolog Proteins 0.000 description 1
- 101000623901 Homo sapiens Mucin-16 Proteins 0.000 description 1
- 101001133059 Homo sapiens Mucin-19 Proteins 0.000 description 1
- 101001017254 Homo sapiens Myb-binding protein 1A Proteins 0.000 description 1
- 101001128429 Homo sapiens Myelin expression factor 2 Proteins 0.000 description 1
- 101001022726 Homo sapiens Myeloid-associated differentiation marker Proteins 0.000 description 1
- 101001023037 Homo sapiens Myoferlin Proteins 0.000 description 1
- 101001128464 Homo sapiens Myosin light chain 6B Proteins 0.000 description 1
- 101001128460 Homo sapiens Myosin light polypeptide 6 Proteins 0.000 description 1
- 101001028827 Homo sapiens Myosin phosphatase Rho-interacting protein Proteins 0.000 description 1
- 101000990986 Homo sapiens Myosin regulatory light chain 12A Proteins 0.000 description 1
- 101000990985 Homo sapiens Myosin regulatory light chain 12B Proteins 0.000 description 1
- 101001128456 Homo sapiens Myosin regulatory light polypeptide 9 Proteins 0.000 description 1
- 101001000109 Homo sapiens Myosin-10 Proteins 0.000 description 1
- 101001000104 Homo sapiens Myosin-11 Proteins 0.000 description 1
- 101000588964 Homo sapiens Myosin-14 Proteins 0.000 description 1
- 101000958744 Homo sapiens Myosin-7B Proteins 0.000 description 1
- 101001030232 Homo sapiens Myosin-9 Proteins 0.000 description 1
- 101001023507 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Proteins 0.000 description 1
- 101000973461 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Proteins 0.000 description 1
- 101000636665 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Proteins 0.000 description 1
- 101001023513 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Proteins 0.000 description 1
- 101001128608 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Proteins 0.000 description 1
- 101000573300 Homo sapiens NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Proteins 0.000 description 1
- 101001128687 Homo sapiens NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Proteins 0.000 description 1
- 101000998623 Homo sapiens NADH-cytochrome b5 reductase 3 Proteins 0.000 description 1
- 101000624956 Homo sapiens Nesprin-2 Proteins 0.000 description 1
- 101000995200 Homo sapiens Neurabin-2 Proteins 0.000 description 1
- 101000962041 Homo sapiens Neurobeachin Proteins 0.000 description 1
- 101000775053 Homo sapiens Neuroblast differentiation-associated protein AHNAK Proteins 0.000 description 1
- 101001072765 Homo sapiens Neutral alpha-glucosidase AB Proteins 0.000 description 1
- 101001128911 Homo sapiens Neutral cholesterol ester hydrolase 1 Proteins 0.000 description 1
- 101000637249 Homo sapiens Nexilin Proteins 0.000 description 1
- 101000603202 Homo sapiens Nicotinamide N-methyltransferase Proteins 0.000 description 1
- 101000583239 Homo sapiens Nicotinate-nucleotide pyrophosphorylase [carboxylating] Proteins 0.000 description 1
- 101000601047 Homo sapiens Nidogen-1 Proteins 0.000 description 1
- 101000601048 Homo sapiens Nidogen-2 Proteins 0.000 description 1
- 101000578353 Homo sapiens Nodal modulator 2 Proteins 0.000 description 1
- 101000578287 Homo sapiens Non-POU domain-containing octamer-binding protein Proteins 0.000 description 1
- 101000598160 Homo sapiens Nuclear mitotic apparatus protein 1 Proteins 0.000 description 1
- 101000896414 Homo sapiens Nuclear nucleic acid-binding protein C1D Proteins 0.000 description 1
- 101001107586 Homo sapiens Nuclear pore complex protein Nup107 Proteins 0.000 description 1
- 101000589749 Homo sapiens Nuclear pore complex protein Nup205 Proteins 0.000 description 1
- 101000996563 Homo sapiens Nuclear pore complex protein Nup214 Proteins 0.000 description 1
- 101001007909 Homo sapiens Nuclear pore complex protein Nup93 Proteins 0.000 description 1
- 101000974340 Homo sapiens Nuclear receptor corepressor 1 Proteins 0.000 description 1
- 101001108314 Homo sapiens Nuclear receptor-binding protein Proteins 0.000 description 1
- 101000912678 Homo sapiens Nucleolar RNA helicase 2 Proteins 0.000 description 1
- 101001109620 Homo sapiens Nucleolar and coiled-body phosphoprotein 1 Proteins 0.000 description 1
- 101000634707 Homo sapiens Nucleolar complex protein 3 homolog Proteins 0.000 description 1
- 101000578361 Homo sapiens Nucleolar complex protein 4 homolog Proteins 0.000 description 1
- 101000973966 Homo sapiens Nucleolar protein 11 Proteins 0.000 description 1
- 101000603068 Homo sapiens Nucleolar protein 56 Proteins 0.000 description 1
- 101000995932 Homo sapiens Nucleolar protein 58 Proteins 0.000 description 1
- 101000809045 Homo sapiens Nucleolar transcription factor 1 Proteins 0.000 description 1
- 101001109719 Homo sapiens Nucleophosmin Proteins 0.000 description 1
- 101001109512 Homo sapiens Nucleoplasmin-3 Proteins 0.000 description 1
- 101000979623 Homo sapiens Nucleoside diphosphate kinase B Proteins 0.000 description 1
- 101000974015 Homo sapiens Nucleosome assembly protein 1-like 1 Proteins 0.000 description 1
- 101000973997 Homo sapiens Nucleosome assembly protein 1-like 4 Proteins 0.000 description 1
- 101000812677 Homo sapiens Nucleotide pyrophosphatase Proteins 0.000 description 1
- 101001121958 Homo sapiens OCIA domain-containing protein 2 Proteins 0.000 description 1
- 101000597499 Homo sapiens Obg-like ATPase 1 Proteins 0.000 description 1
- 101000585675 Homo sapiens Obscurin Proteins 0.000 description 1
- 101000736088 Homo sapiens PC4 and SFRS1-interacting protein Proteins 0.000 description 1
- 101000734351 Homo sapiens PDZ and LIM domain protein 1 Proteins 0.000 description 1
- 101000988395 Homo sapiens PDZ and LIM domain protein 4 Proteins 0.000 description 1
- 101000988394 Homo sapiens PDZ and LIM domain protein 5 Proteins 0.000 description 1
- 101001134647 Homo sapiens PDZ and LIM domain protein 7 Proteins 0.000 description 1
- 101000693234 Homo sapiens PDZ domain-containing protein 4 Proteins 0.000 description 1
- 101100174573 Homo sapiens PIKFYVE gene Proteins 0.000 description 1
- 101000572989 Homo sapiens POU domain, class 3, transcription factor 3 Proteins 0.000 description 1
- 101001124900 Homo sapiens PR domain zinc finger protein 8 Proteins 0.000 description 1
- 101000741956 Homo sapiens PRA1 family protein 3 Proteins 0.000 description 1
- 101000613565 Homo sapiens PRKC apoptosis WT1 regulator protein Proteins 0.000 description 1
- 101000735213 Homo sapiens Palladin Proteins 0.000 description 1
- 101001091425 Homo sapiens Papilin Proteins 0.000 description 1
- 101001082142 Homo sapiens Pentraxin-related protein PTX3 Proteins 0.000 description 1
- 101001067833 Homo sapiens Peptidyl-prolyl cis-trans isomerase A Proteins 0.000 description 1
- 101000611202 Homo sapiens Peptidyl-prolyl cis-trans isomerase B Proteins 0.000 description 1
- 101000891031 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP10 Proteins 0.000 description 1
- 101000827313 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP3 Proteins 0.000 description 1
- 101001131990 Homo sapiens Peroxidasin homolog Proteins 0.000 description 1
- 101001090065 Homo sapiens Peroxiredoxin-2 Proteins 0.000 description 1
- 101001045218 Homo sapiens Peroxisomal multifunctional enzyme type 2 Proteins 0.000 description 1
- 101001073193 Homo sapiens Pescadillo homolog Proteins 0.000 description 1
- 101000876782 Homo sapiens Phenylalanine-tRNA ligase alpha subunit Proteins 0.000 description 1
- 101000583474 Homo sapiens Phosphatidylinositol-binding clathrin assembly protein Proteins 0.000 description 1
- 101000579123 Homo sapiens Phosphoglycerate kinase 1 Proteins 0.000 description 1
- 101000600387 Homo sapiens Phosphoglycerate mutase 1 Proteins 0.000 description 1
- 101000701366 Homo sapiens Phospholipid-transporting ATPase IB Proteins 0.000 description 1
- 101001081953 Homo sapiens Phosphoribosylaminoimidazole carboxylase Proteins 0.000 description 1
- 101000615933 Homo sapiens Phosphoserine aminotransferase Proteins 0.000 description 1
- 101000595669 Homo sapiens Pituitary homeobox 2 Proteins 0.000 description 1
- 101001133656 Homo sapiens Plasminogen activator inhibitor 1 RNA-binding protein Proteins 0.000 description 1
- 101000596119 Homo sapiens Plastin-3 Proteins 0.000 description 1
- 101000609360 Homo sapiens Platelet-activating factor acetylhydrolase IB subunit alpha2 Proteins 0.000 description 1
- 101001064282 Homo sapiens Platelet-activating factor acetylhydrolase IB subunit beta Proteins 0.000 description 1
- 101001126471 Homo sapiens Plectin Proteins 0.000 description 1
- 101000595198 Homo sapiens Podocalyxin Proteins 0.000 description 1
- 101000735354 Homo sapiens Poly(rC)-binding protein 1 Proteins 0.000 description 1
- 101000735358 Homo sapiens Poly(rC)-binding protein 2 Proteins 0.000 description 1
- 101000609211 Homo sapiens Polyadenylate-binding protein 2 Proteins 0.000 description 1
- 101001117219 Homo sapiens Polymerase delta-interacting protein 3 Proteins 0.000 description 1
- 101001135344 Homo sapiens Polypyrimidine tract-binding protein 1 Proteins 0.000 description 1
- 101000705615 Homo sapiens Polypyrimidine tract-binding protein 3 Proteins 0.000 description 1
- 101001125496 Homo sapiens Pre-mRNA-processing factor 19 Proteins 0.000 description 1
- 101001105683 Homo sapiens Pre-mRNA-processing-splicing factor 8 Proteins 0.000 description 1
- 101000662112 Homo sapiens Pre-mRNA-splicing factor SYF2 Proteins 0.000 description 1
- 101000730802 Homo sapiens Prefoldin subunit 6 Proteins 0.000 description 1
- 101001003584 Homo sapiens Prelamin-A/C Proteins 0.000 description 1
- 101000973947 Homo sapiens Probable 28S rRNA (cytosine(4447)-C(5))-methyltransferase Proteins 0.000 description 1
- 101001041721 Homo sapiens Probable ATP-dependent RNA helicase DDX17 Proteins 0.000 description 1
- 101000919019 Homo sapiens Probable ATP-dependent RNA helicase DDX6 Proteins 0.000 description 1
- 101000600395 Homo sapiens Probable phosphoglycerate mutase 4 Proteins 0.000 description 1
- 101000711369 Homo sapiens Probable ribosome biogenesis protein RLP24 Proteins 0.000 description 1
- 101000903686 Homo sapiens Procollagen galactosyltransferase 1 Proteins 0.000 description 1
- 101000595913 Homo sapiens Procollagen glycosyltransferase Proteins 0.000 description 1
- 101000595904 Homo sapiens Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Proteins 0.000 description 1
- 101000595907 Homo sapiens Procollagen-lysine,2-oxoglutarate 5-dioxygenase 2 Proteins 0.000 description 1
- 101000577619 Homo sapiens Profilin-1 Proteins 0.000 description 1
- 101001134621 Homo sapiens Programmed cell death 6-interacting protein Proteins 0.000 description 1
- 101001129654 Homo sapiens Prohibitin-2 Proteins 0.000 description 1
- 101000945496 Homo sapiens Proliferation marker protein Ki-67 Proteins 0.000 description 1
- 101000983170 Homo sapiens Proliferation-associated protein 2G4 Proteins 0.000 description 1
- 101001043564 Homo sapiens Prolow-density lipoprotein receptor-related protein 1 Proteins 0.000 description 1
- 101001133941 Homo sapiens Prolyl 3-hydroxylase 1 Proteins 0.000 description 1
- 101000614347 Homo sapiens Prolyl 4-hydroxylase subunit alpha-2 Proteins 0.000 description 1
- 101000705759 Homo sapiens Proteasome activator complex subunit 2 Proteins 0.000 description 1
- 101001050220 Homo sapiens Proteasome adapter and scaffold protein ECM29 Proteins 0.000 description 1
- 101000736929 Homo sapiens Proteasome subunit alpha type-1 Proteins 0.000 description 1
- 101000610781 Homo sapiens Proteasome subunit alpha type-2 Proteins 0.000 description 1
- 101001136888 Homo sapiens Proteasome subunit alpha type-3 Proteins 0.000 description 1
- 101000577424 Homo sapiens Proteasome subunit alpha type-4 Proteins 0.000 description 1
- 101001124667 Homo sapiens Proteasome subunit alpha type-5 Proteins 0.000 description 1
- 101001090813 Homo sapiens Proteasome subunit alpha type-6 Proteins 0.000 description 1
- 101001105486 Homo sapiens Proteasome subunit alpha type-7 Proteins 0.000 description 1
- 101000706678 Homo sapiens Proteasome subunit beta type-1 Proteins 0.000 description 1
- 101000611053 Homo sapiens Proteasome subunit beta type-2 Proteins 0.000 description 1
- 101001089120 Homo sapiens Proteasome subunit beta type-3 Proteins 0.000 description 1
- 101000592466 Homo sapiens Proteasome subunit beta type-4 Proteins 0.000 description 1
- 101000735881 Homo sapiens Proteasome subunit beta type-5 Proteins 0.000 description 1
- 101000735893 Homo sapiens Proteasome subunit beta type-6 Proteins 0.000 description 1
- 101001136954 Homo sapiens Proteasome subunit beta type-7 Proteins 0.000 description 1
- 101000775052 Homo sapiens Protein AHNAK2 Proteins 0.000 description 1
- 101000845685 Homo sapiens Protein Dok-7 Proteins 0.000 description 1
- 101000881752 Homo sapiens Protein ELYS Proteins 0.000 description 1
- 101000911388 Homo sapiens Protein FAM98A Proteins 0.000 description 1
- 101000823407 Homo sapiens Protein FAM98B Proteins 0.000 description 1
- 101001065541 Homo sapiens Protein LYRIC Proteins 0.000 description 1
- 101001059604 Homo sapiens Protein MAK16 homolog Proteins 0.000 description 1
- 101000653788 Homo sapiens Protein S100-A11 Proteins 0.000 description 1
- 101000693054 Homo sapiens Protein S100-A13 Proteins 0.000 description 1
- 101000617296 Homo sapiens Protein SEC13 homolog Proteins 0.000 description 1
- 101000739214 Homo sapiens Protein SGT1 homolog Proteins 0.000 description 1
- 101000928406 Homo sapiens Protein diaphanous homolog 3 Proteins 0.000 description 1
- 101001098802 Homo sapiens Protein disulfide-isomerase A3 Proteins 0.000 description 1
- 101001098824 Homo sapiens Protein disulfide-isomerase A4 Proteins 0.000 description 1
- 101001098769 Homo sapiens Protein disulfide-isomerase A6 Proteins 0.000 description 1
- 101000877404 Homo sapiens Protein enabled homolog Proteins 0.000 description 1
- 101000893493 Homo sapiens Protein flightless-1 homolog Proteins 0.000 description 1
- 101000628776 Homo sapiens Protein mago nashi homolog Proteins 0.000 description 1
- 101000735463 Homo sapiens Protein mono-ADP-ribosyltransferase PARP4 Proteins 0.000 description 1
- 101001000061 Homo sapiens Protein phosphatase 1 regulatory subunit 12A Proteins 0.000 description 1
- 101000654448 Homo sapiens Protein transport protein Sec16A Proteins 0.000 description 1
- 101000685918 Homo sapiens Protein transport protein Sec23A Proteins 0.000 description 1
- 101000822459 Homo sapiens Protein transport protein Sec31A Proteins 0.000 description 1
- 101000641111 Homo sapiens Protein transport protein Sec61 subunit alpha isoform 1 Proteins 0.000 description 1
- 101001093116 Homo sapiens Protein transport protein Sec61 subunit beta Proteins 0.000 description 1
- 101000666873 Homo sapiens Protein virilizer homolog Proteins 0.000 description 1
- 101000666171 Homo sapiens Protein-glutamine gamma-glutamyltransferase 2 Proteins 0.000 description 1
- 101000666172 Homo sapiens Protein-glutamine gamma-glutamyltransferase E Proteins 0.000 description 1
- 101001082131 Homo sapiens Pumilio homolog 3 Proteins 0.000 description 1
- 101000592517 Homo sapiens Puromycin-sensitive aminopeptidase Proteins 0.000 description 1
- 101000996935 Homo sapiens Putative oxidoreductase GLYR1 Proteins 0.000 description 1
- 101000845206 Homo sapiens Putative peripheral benzodiazepine receptor-related protein Proteins 0.000 description 1
- 101000609335 Homo sapiens Pyrroline-5-carboxylate reductase 1, mitochondrial Proteins 0.000 description 1
- 101001137451 Homo sapiens Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Proteins 0.000 description 1
- 101000694402 Homo sapiens RNA transcription, translation and transport factor protein Proteins 0.000 description 1
- 101000687317 Homo sapiens RNA-binding motif protein, X chromosome Proteins 0.000 description 1
- 101001062098 Homo sapiens RNA-binding protein 14 Proteins 0.000 description 1
- 101001076724 Homo sapiens RNA-binding protein 28 Proteins 0.000 description 1
- 101001076867 Homo sapiens RNA-binding protein 3 Proteins 0.000 description 1
- 101001076715 Homo sapiens RNA-binding protein 39 Proteins 0.000 description 1
- 101000668140 Homo sapiens RNA-binding protein 8A Proteins 0.000 description 1
- 101001077488 Homo sapiens RNA-binding protein Raly Proteins 0.000 description 1
- 101000669667 Homo sapiens RNA-binding protein with serine-rich domain 1 Proteins 0.000 description 1
- 101000657350 Homo sapiens RNA-splicing ligase RtcB homolog Proteins 0.000 description 1
- 101000926083 Homo sapiens Rab GDP dissociation inhibitor beta Proteins 0.000 description 1
- 101000579758 Homo sapiens Raftlin Proteins 0.000 description 1
- 101000893689 Homo sapiens Ras GTPase-activating protein-binding protein 1 Proteins 0.000 description 1
- 101000893674 Homo sapiens Ras GTPase-activating protein-binding protein 2 Proteins 0.000 description 1
- 101000636109 Homo sapiens Ras suppressor protein 1 Proteins 0.000 description 1
- 101000686246 Homo sapiens Ras-related protein R-Ras Proteins 0.000 description 1
- 101000743845 Homo sapiens Ras-related protein Rab-10 Proteins 0.000 description 1
- 101001130576 Homo sapiens Ras-related protein Rab-11B Proteins 0.000 description 1
- 101000584908 Homo sapiens Ras-related protein Rab-1B Proteins 0.000 description 1
- 101001132279 Homo sapiens Ras-related protein Rab-2A Proteins 0.000 description 1
- 101000620559 Homo sapiens Ras-related protein Rab-3B Proteins 0.000 description 1
- 101001099877 Homo sapiens Ras-related protein Rab-43 Proteins 0.000 description 1
- 101001077405 Homo sapiens Ras-related protein Rab-5C Proteins 0.000 description 1
- 101000584785 Homo sapiens Ras-related protein Rab-7a Proteins 0.000 description 1
- 101001130465 Homo sapiens Ras-related protein Ral-A Proteins 0.000 description 1
- 101000584600 Homo sapiens Ras-related protein Rap-1b Proteins 0.000 description 1
- 101000849744 Homo sapiens Regulation of nuclear pre-mRNA domain-containing protein 1B Proteins 0.000 description 1
- 101000668416 Homo sapiens Regulator of chromosome condensation Proteins 0.000 description 1
- 101000727979 Homo sapiens Remodeling and spacing factor 1 Proteins 0.000 description 1
- 101001092206 Homo sapiens Replication protein A 32 kDa subunit Proteins 0.000 description 1
- 101001092125 Homo sapiens Replication protein A 70 kDa DNA-binding subunit Proteins 0.000 description 1
- 101001078093 Homo sapiens Reticulocalbin-1 Proteins 0.000 description 1
- 101000727472 Homo sapiens Reticulon-4 Proteins 0.000 description 1
- 101001100101 Homo sapiens Retinoic acid-induced protein 3 Proteins 0.000 description 1
- 101000756373 Homo sapiens Retinol-binding protein 1 Proteins 0.000 description 1
- 101000856728 Homo sapiens Rho GDP-dissociation inhibitor 1 Proteins 0.000 description 1
- 101001106406 Homo sapiens Rho GTPase-activating protein 1 Proteins 0.000 description 1
- 101000581118 Homo sapiens Rho-related GTP-binding protein RhoC Proteins 0.000 description 1
- 101001095807 Homo sapiens Ribonuclease inhibitor Proteins 0.000 description 1
- 101000659995 Homo sapiens Ribosomal L1 domain-containing protein 1 Proteins 0.000 description 1
- 101000794048 Homo sapiens Ribosome biogenesis protein BRX1 homolog Proteins 0.000 description 1
- 101000682954 Homo sapiens Ribosome biogenesis regulatory protein homolog Proteins 0.000 description 1
- 101000650528 Homo sapiens Ribosome production factor 2 homolog Proteins 0.000 description 1
- 101000683584 Homo sapiens Ribosome-binding protein 1 Proteins 0.000 description 1
- 101000694338 Homo sapiens RuvB-like 2 Proteins 0.000 description 1
- 101000685956 Homo sapiens SAP domain-containing ribonucleoprotein Proteins 0.000 description 1
- 101000651709 Homo sapiens SCO-spondin Proteins 0.000 description 1
- 101000761651 Homo sapiens SH3 domain-binding protein 1 Proteins 0.000 description 1
- 101000688582 Homo sapiens SH3 domain-containing kinase-binding protein 1 Proteins 0.000 description 1
- 101000836279 Homo sapiens SNW domain-containing protein 1 Proteins 0.000 description 1
- 101000835998 Homo sapiens SRA stem-loop-interacting RNA-binding protein, mitochondrial Proteins 0.000 description 1
- 101000706551 Homo sapiens SUN domain-containing protein 2 Proteins 0.000 description 1
- 101000687718 Homo sapiens SWI/SNF complex subunit SMARCC1 Proteins 0.000 description 1
- 101000687720 Homo sapiens SWI/SNF complex subunit SMARCC2 Proteins 0.000 description 1
- 101000702544 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A member 5 Proteins 0.000 description 1
- 101000702542 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1 Proteins 0.000 description 1
- 101000936922 Homo sapiens Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Proteins 0.000 description 1
- 101000655528 Homo sapiens Scaffold attachment factor B1 Proteins 0.000 description 1
- 101000684160 Homo sapiens Selenoprotein H Proteins 0.000 description 1
- 101000632266 Homo sapiens Semaphorin-3C Proteins 0.000 description 1
- 101000739767 Homo sapiens Semaphorin-7A Proteins 0.000 description 1
- 101000836557 Homo sapiens Septin-11 Proteins 0.000 description 1
- 101000654668 Homo sapiens Septin-2 Proteins 0.000 description 1
- 101000632314 Homo sapiens Septin-6 Proteins 0.000 description 1
- 101000632319 Homo sapiens Septin-7 Proteins 0.000 description 1
- 101000632054 Homo sapiens Septin-8 Proteins 0.000 description 1
- 101000632056 Homo sapiens Septin-9 Proteins 0.000 description 1
- 101000604981 Homo sapiens Serine beta-lactamase-like protein LACTB, mitochondrial Proteins 0.000 description 1
- 101001067604 Homo sapiens Serine hydroxymethyltransferase, mitochondrial Proteins 0.000 description 1
- 101001069710 Homo sapiens Serine protease 23 Proteins 0.000 description 1
- 101001041393 Homo sapiens Serine protease HTRA1 Proteins 0.000 description 1
- 101000998897 Homo sapiens Serine protease HTRA3 Proteins 0.000 description 1
- 101000663222 Homo sapiens Serine/arginine-rich splicing factor 1 Proteins 0.000 description 1
- 101000587430 Homo sapiens Serine/arginine-rich splicing factor 2 Proteins 0.000 description 1
- 101000587434 Homo sapiens Serine/arginine-rich splicing factor 3 Proteins 0.000 description 1
- 101000783404 Homo sapiens Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Proteins 0.000 description 1
- 101001068019 Homo sapiens Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Proteins 0.000 description 1
- 101000595252 Homo sapiens Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Proteins 0.000 description 1
- 101001095320 Homo sapiens Serine/threonine-protein phosphatase PP1-beta catalytic subunit Proteins 0.000 description 1
- 101000632480 Homo sapiens Sideroflexin-1 Proteins 0.000 description 1
- 101000688667 Homo sapiens Sideroflexin-3 Proteins 0.000 description 1
- 101001093098 Homo sapiens Signal peptidase complex catalytic subunit SEC11A Proteins 0.000 description 1
- 101000701936 Homo sapiens Signal peptidase complex subunit 1 Proteins 0.000 description 1
- 101000828971 Homo sapiens Signal peptidase complex subunit 3 Proteins 0.000 description 1
- 101000629635 Homo sapiens Signal recognition particle receptor subunit alpha Proteins 0.000 description 1
- 101000654495 Homo sapiens Signal-induced proliferation-associated 1-like protein 1 Proteins 0.000 description 1
- 101000654500 Homo sapiens Signal-induced proliferation-associated 1-like protein 2 Proteins 0.000 description 1
- 101000587455 Homo sapiens Single-stranded DNA-binding protein, mitochondrial Proteins 0.000 description 1
- 101000665150 Homo sapiens Small nuclear ribonucleoprotein Sm D1 Proteins 0.000 description 1
- 101000825914 Homo sapiens Small nuclear ribonucleoprotein Sm D3 Proteins 0.000 description 1
- 101000873843 Homo sapiens Sorting and assembly machinery component 50 homolog Proteins 0.000 description 1
- 101000687666 Homo sapiens Sorting nexin-27 Proteins 0.000 description 1
- 101000881247 Homo sapiens Spectrin beta chain, erythrocytic Proteins 0.000 description 1
- 101000881252 Homo sapiens Spectrin beta chain, non-erythrocytic 1 Proteins 0.000 description 1
- 101000824992 Homo sapiens Spermatogenesis-associated serine-rich protein 2 Proteins 0.000 description 1
- 101000688561 Homo sapiens Sphingosine-1-phosphate lyase 1 Proteins 0.000 description 1
- 101000908580 Homo sapiens Spliceosome RNA helicase DDX39B Proteins 0.000 description 1
- 101000707546 Homo sapiens Splicing factor 3A subunit 1 Proteins 0.000 description 1
- 101000707567 Homo sapiens Splicing factor 3B subunit 1 Proteins 0.000 description 1
- 101000707770 Homo sapiens Splicing factor 3B subunit 2 Proteins 0.000 description 1
- 101000616167 Homo sapiens Splicing factor 3B subunit 4 Proteins 0.000 description 1
- 101000658075 Homo sapiens Splicing factor U2AF 26 kDa subunit Proteins 0.000 description 1
- 101000658071 Homo sapiens Splicing factor U2AF 65 kDa subunit Proteins 0.000 description 1
- 101000829367 Homo sapiens Src substrate cortactin Proteins 0.000 description 1
- 101000617805 Homo sapiens Staphylococcal nuclease domain-containing protein 1 Proteins 0.000 description 1
- 101000831940 Homo sapiens Stathmin Proteins 0.000 description 1
- 101000617830 Homo sapiens Sterol O-acyltransferase 1 Proteins 0.000 description 1
- 101000820460 Homo sapiens Stomatin Proteins 0.000 description 1
- 101000831927 Homo sapiens Stomatin-like protein 2, mitochondrial Proteins 0.000 description 1
- 101000903318 Homo sapiens Stress-70 protein, mitochondrial Proteins 0.000 description 1
- 101000633429 Homo sapiens Structural maintenance of chromosomes protein 1A Proteins 0.000 description 1
- 101000708766 Homo sapiens Structural maintenance of chromosomes protein 3 Proteins 0.000 description 1
- 101000630720 Homo sapiens Supervillin Proteins 0.000 description 1
- 101000630717 Homo sapiens Surfeit locus protein 4 Proteins 0.000 description 1
- 101000652300 Homo sapiens Synaptosomal-associated protein 23 Proteins 0.000 description 1
- 101000740523 Homo sapiens Syntenin-1 Proteins 0.000 description 1
- 101000837443 Homo sapiens T-complex protein 1 subunit beta Proteins 0.000 description 1
- 101000653567 Homo sapiens T-complex protein 1 subunit delta Proteins 0.000 description 1
- 101000653663 Homo sapiens T-complex protein 1 subunit epsilon Proteins 0.000 description 1
- 101000713879 Homo sapiens T-complex protein 1 subunit eta Proteins 0.000 description 1
- 101000595467 Homo sapiens T-complex protein 1 subunit gamma Proteins 0.000 description 1
- 101000835696 Homo sapiens T-complex protein 1 subunit theta Proteins 0.000 description 1
- 101000653469 Homo sapiens T-complex protein 1 subunit zeta Proteins 0.000 description 1
- 101000891092 Homo sapiens TAR DNA-binding protein 43 Proteins 0.000 description 1
- 101000891620 Homo sapiens TBC1 domain family member 1 Proteins 0.000 description 1
- 101000852214 Homo sapiens THO complex subunit 4 Proteins 0.000 description 1
- 101000713234 Homo sapiens TRIO and F-actin-binding protein Proteins 0.000 description 1
- 101000598025 Homo sapiens Talin-1 Proteins 0.000 description 1
- 101000598030 Homo sapiens Talin-2 Proteins 0.000 description 1
- 101000759318 Homo sapiens Tau-tubulin kinase 2 Proteins 0.000 description 1
- 101000889886 Homo sapiens Testis-expressed protein 10 Proteins 0.000 description 1
- 101000844686 Homo sapiens Thioredoxin reductase 1, cytoplasmic Proteins 0.000 description 1
- 101000669970 Homo sapiens Thrombospondin type-1 domain-containing protein 4 Proteins 0.000 description 1
- 101000659879 Homo sapiens Thrombospondin-1 Proteins 0.000 description 1
- 101000800116 Homo sapiens Thy-1 membrane glycoprotein Proteins 0.000 description 1
- 101000795185 Homo sapiens Thyroid hormone receptor-associated protein 3 Proteins 0.000 description 1
- 101000802356 Homo sapiens Tight junction protein ZO-1 Proteins 0.000 description 1
- 101000785523 Homo sapiens Tight junction protein ZO-2 Proteins 0.000 description 1
- 101000835083 Homo sapiens Tissue factor pathway inhibitor 2 Proteins 0.000 description 1
- 101000679875 Homo sapiens Torsin-1A-interacting protein 1 Proteins 0.000 description 1
- 101000838086 Homo sapiens Transaldolase Proteins 0.000 description 1
- 101000835023 Homo sapiens Transcription factor A, mitochondrial Proteins 0.000 description 1
- 101000933542 Homo sapiens Transcription factor BTF3 Proteins 0.000 description 1
- 101000687911 Homo sapiens Transcription factor SOX-3 Proteins 0.000 description 1
- 101000635958 Homo sapiens Transforming growth factor beta-2 proprotein Proteins 0.000 description 1
- 101000894525 Homo sapiens Transforming growth factor-beta-induced protein ig-h3 Proteins 0.000 description 1
- 101000652736 Homo sapiens Transgelin Proteins 0.000 description 1
- 101000652726 Homo sapiens Transgelin-2 Proteins 0.000 description 1
- 101000653679 Homo sapiens Translationally-controlled tumor protein Proteins 0.000 description 1
- 101000649115 Homo sapiens Translocating chain-associated membrane protein 1 Proteins 0.000 description 1
- 101000845233 Homo sapiens Translocator protein Proteins 0.000 description 1
- 101000629937 Homo sapiens Translocon-associated protein subunit alpha Proteins 0.000 description 1
- 101000629921 Homo sapiens Translocon-associated protein subunit delta Proteins 0.000 description 1
- 101000831851 Homo sapiens Transmembrane emp24 domain-containing protein 10 Proteins 0.000 description 1
- 101000851544 Homo sapiens Transmembrane emp24 domain-containing protein 9 Proteins 0.000 description 1
- 101000645421 Homo sapiens Transmembrane protein 165 Proteins 0.000 description 1
- 101000801308 Homo sapiens Transmembrane protein 43 Proteins 0.000 description 1
- 101000648497 Homo sapiens Transportin-3 Proteins 0.000 description 1
- 101000891326 Homo sapiens Treacle protein Proteins 0.000 description 1
- 101000801742 Homo sapiens Triosephosphate isomerase Proteins 0.000 description 1
- 101000597778 Homo sapiens Tropomodulin-3 Proteins 0.000 description 1
- 101000830781 Homo sapiens Tropomyosin alpha-4 chain Proteins 0.000 description 1
- 101000851892 Homo sapiens Tropomyosin beta chain Proteins 0.000 description 1
- 101000772169 Homo sapiens Tubby-related protein 2 Proteins 0.000 description 1
- 101000838463 Homo sapiens Tubulin alpha-1A chain Proteins 0.000 description 1
- 101000838456 Homo sapiens Tubulin alpha-1B chain Proteins 0.000 description 1
- 101000838350 Homo sapiens Tubulin alpha-1C chain Proteins 0.000 description 1
- 101000788548 Homo sapiens Tubulin alpha-4A chain Proteins 0.000 description 1
- 101000713575 Homo sapiens Tubulin beta-3 chain Proteins 0.000 description 1
- 101000713585 Homo sapiens Tubulin beta-4A chain Proteins 0.000 description 1
- 101000713613 Homo sapiens Tubulin beta-4B chain Proteins 0.000 description 1
- 101000652472 Homo sapiens Tubulin beta-6 chain Proteins 0.000 description 1
- 101000800287 Homo sapiens Tubulointerstitial nephritis antigen-like Proteins 0.000 description 1
- 101000659324 Homo sapiens Twinfilin-1 Proteins 0.000 description 1
- 101000820294 Homo sapiens Tyrosine-protein kinase Yes Proteins 0.000 description 1
- 101000617779 Homo sapiens U1 small nuclear ribonucleoprotein A Proteins 0.000 description 1
- 101000639792 Homo sapiens U2 small nuclear ribonucleoprotein A' Proteins 0.000 description 1
- 101000671653 Homo sapiens U3 small nucleolar RNA-associated protein 14 homolog A Proteins 0.000 description 1
- 101000836268 Homo sapiens U4/U6.U5 tri-snRNP-associated protein 1 Proteins 0.000 description 1
- 101000659545 Homo sapiens U5 small nuclear ribonucleoprotein 200 kDa helicase Proteins 0.000 description 1
- 101000807631 Homo sapiens UAP56-interacting factor Proteins 0.000 description 1
- 101000939529 Homo sapiens UDP-glucose 6-dehydrogenase Proteins 0.000 description 1
- 101000672024 Homo sapiens UDP-glucose:glycoprotein glucosyltransferase 1 Proteins 0.000 description 1
- 101000809490 Homo sapiens UTP-glucose-1-phosphate uridylyltransferase Proteins 0.000 description 1
- 101000717424 Homo sapiens UV excision repair protein RAD23 homolog B Proteins 0.000 description 1
- 101000807541 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 24 Proteins 0.000 description 1
- 101000614277 Homo sapiens Ubiquitin thioesterase OTUB1 Proteins 0.000 description 1
- 101001115218 Homo sapiens Ubiquitin-40S ribosomal protein S27a Proteins 0.000 description 1
- 101000939460 Homo sapiens Ubiquitin-associated protein 2-like Proteins 0.000 description 1
- 101000807306 Homo sapiens Ubiquitin-like modifier-activating enzyme 1 Proteins 0.000 description 1
- 101000982054 Homo sapiens Unconventional myosin-Ib Proteins 0.000 description 1
- 101001000122 Homo sapiens Unconventional myosin-Ie Proteins 0.000 description 1
- 101000585635 Homo sapiens Unconventional myosin-XV Proteins 0.000 description 1
- 101000805729 Homo sapiens V-type proton ATPase 116 kDa subunit a 1 Proteins 0.000 description 1
- 101000854875 Homo sapiens V-type proton ATPase 116 kDa subunit a 3 Proteins 0.000 description 1
- 101000806601 Homo sapiens V-type proton ATPase catalytic subunit A Proteins 0.000 description 1
- 101000850434 Homo sapiens V-type proton ATPase subunit B, brain isoform Proteins 0.000 description 1
- 101000852150 Homo sapiens V-type proton ATPase subunit d 1 Proteins 0.000 description 1
- 101000743587 Homo sapiens Vacuolar protein sorting-associated protein 26A Proteins 0.000 description 1
- 101000854862 Homo sapiens Vacuolar protein sorting-associated protein 35 Proteins 0.000 description 1
- 101000860430 Homo sapiens Versican core protein Proteins 0.000 description 1
- 101000806266 Homo sapiens Very-long-chain 3-oxoacyl-CoA reductase Proteins 0.000 description 1
- 101000653426 Homo sapiens Very-long-chain enoyl-CoA reductase Proteins 0.000 description 1
- 101000766771 Homo sapiens Vesicle-associated membrane protein-associated protein A Proteins 0.000 description 1
- 101000631907 Homo sapiens Vesicle-trafficking protein SEC22b Proteins 0.000 description 1
- 101000805481 Homo sapiens Vigilin Proteins 0.000 description 1
- 101000850658 Homo sapiens Voltage-dependent anion-selective channel protein 3 Proteins 0.000 description 1
- 101000740755 Homo sapiens Voltage-dependent calcium channel subunit alpha-2/delta-1 Proteins 0.000 description 1
- 101000954957 Homo sapiens WASH complex subunit 2C Proteins 0.000 description 1
- 101000782180 Homo sapiens WD repeat-containing protein 1 Proteins 0.000 description 1
- 101000771607 Homo sapiens WD repeat-containing protein 61 Proteins 0.000 description 1
- 101000823782 Homo sapiens Y-box-binding protein 3 Proteins 0.000 description 1
- 101000744897 Homo sapiens Zinc finger homeobox protein 4 Proteins 0.000 description 1
- 101000915642 Homo sapiens Zinc finger protein 469 Proteins 0.000 description 1
- 101000614798 Homo sapiens cAMP-dependent protein kinase type II-alpha regulatory subunit Proteins 0.000 description 1
- 101000862627 Homo sapiens eIF-2-alpha kinase activator GCN1 Proteins 0.000 description 1
- 101000802734 Homo sapiens eIF5-mimic protein 2 Proteins 0.000 description 1
- 101000667353 Homo sapiens von Willebrand factor A domain-containing protein 1 Proteins 0.000 description 1
- 101710100096 Hornerin Proteins 0.000 description 1
- 101710109065 Hsc70-interacting protein Proteins 0.000 description 1
- 102100028084 Hyaluronan and proteoglycan link protein 1 Human genes 0.000 description 1
- 102100025260 Hyaluronan and proteoglycan link protein 3 Human genes 0.000 description 1
- 102100040204 Hydrocephalus-inducing protein homolog Human genes 0.000 description 1
- 102100020755 Hypoxia up-regulated protein 1 Human genes 0.000 description 1
- 108010007666 IMP cyclohydrolase Proteins 0.000 description 1
- 102100024427 IQ domain-containing protein N Human genes 0.000 description 1
- 102300056012 IQ domain-containing protein N isoform 4 Human genes 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 102100039352 Immunoglobulin heavy constant mu Human genes 0.000 description 1
- 102100025959 Immunoglobulin-like and fibronectin type III domain-containing protein 1 Human genes 0.000 description 1
- 102300051467 Immunoglobulin-like and fibronectin type III domain-containing protein 1 isoform 5 Human genes 0.000 description 1
- 101710145060 Importin subunit beta-1 Proteins 0.000 description 1
- 102100036341 Importin-4 Human genes 0.000 description 1
- 102300051769 Importin-4 isoform 2 Human genes 0.000 description 1
- 102100036340 Importin-5 Human genes 0.000 description 1
- 102100037963 Importin-7 Human genes 0.000 description 1
- 101710125765 Importin-9 Proteins 0.000 description 1
- 101710172331 Inosine-5'-monophosphate dehydrogenase 2 Proteins 0.000 description 1
- 102100037919 Insulin-like growth factor 2 mRNA-binding protein 2 Human genes 0.000 description 1
- 102300055675 Insulin-like growth factor 2 mRNA-binding protein 2 isoform 2 Human genes 0.000 description 1
- 101710126182 Insulin-like growth factor 2 mRNA-binding protein 3 Proteins 0.000 description 1
- 102100029228 Insulin-like growth factor-binding protein 7 Human genes 0.000 description 1
- 102300047388 Insulin-like growth factor-binding protein 7 isoform 2 Human genes 0.000 description 1
- 102100032819 Integrin alpha-3 Human genes 0.000 description 1
- 102100022337 Integrin alpha-V Human genes 0.000 description 1
- 102300053150 Integrin alpha-V isoform 3 Human genes 0.000 description 1
- 108010041357 Integrin alpha3 Proteins 0.000 description 1
- 102000000510 Integrin alpha3 Human genes 0.000 description 1
- 102100025304 Integrin beta-1 Human genes 0.000 description 1
- 102100032999 Integrin beta-3 Human genes 0.000 description 1
- 102300045707 Integrin beta-3 isoform Beta-3B Human genes 0.000 description 1
- 102000012355 Integrin beta1 Human genes 0.000 description 1
- 108010022222 Integrin beta1 Proteins 0.000 description 1
- 102100020944 Integrin-linked protein kinase Human genes 0.000 description 1
- 102300063991 Integrin-linked protein kinase isoform 3 Human genes 0.000 description 1
- 102100039460 Inter-alpha-trypsin inhibitor heavy chain H3 Human genes 0.000 description 1
- 108010064593 Intercellular Adhesion Molecule-1 Proteins 0.000 description 1
- 102100034170 Interferon-induced, double-stranded RNA-activated protein kinase Human genes 0.000 description 1
- 102300049732 Interferon-induced, double-stranded RNA-activated protein kinase isoform 2 Human genes 0.000 description 1
- 102100029408 Interferon-inducible double-stranded RNA-dependent protein kinase activator A Human genes 0.000 description 1
- 102300060552 Interferon-inducible double-stranded RNA-dependent protein kinase activator A isoform 2 Human genes 0.000 description 1
- 102300057077 Interleukin enhancer-binding factor 3 isoform 7 Human genes 0.000 description 1
- 102100033257 Inversin Human genes 0.000 description 1
- 102100030075 Inverted formin-2 Human genes 0.000 description 1
- 102300041625 Inverted formin-2 isoform 2 Human genes 0.000 description 1
- 102000004901 Iron regulatory protein 1 Human genes 0.000 description 1
- 108090001025 Iron regulatory protein 1 Proteins 0.000 description 1
- 101710102690 Isocitrate dehydrogenase [NADP] cytoplasmic Proteins 0.000 description 1
- 102100037845 Isocitrate dehydrogenase [NADP], mitochondrial Human genes 0.000 description 1
- 102300055693 Isocitrate dehydrogenase [NADP], mitochondrial isoform 2 Human genes 0.000 description 1
- 101710176147 Isoleucine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 102000004195 Isomerases Human genes 0.000 description 1
- 108090000769 Isomerases Proteins 0.000 description 1
- 102100023408 KH domain-containing, RNA-binding, signal transduction-associated protein 1 Human genes 0.000 description 1
- 102100023428 KH domain-containing, RNA-binding, signal transduction-associated protein 3 Human genes 0.000 description 1
- 102300055802 KH domain-containing, RNA-binding, signal transduction-associated protein 3 isoform 2 Human genes 0.000 description 1
- 101150058971 KRT10 gene Proteins 0.000 description 1
- 101150095385 KRT13 gene Proteins 0.000 description 1
- 101150017156 KRT17 gene Proteins 0.000 description 1
- 101150051350 KRT77 gene Proteins 0.000 description 1
- 102100023970 Keratin, type I cytoskeletal 10 Human genes 0.000 description 1
- 102100040445 Keratin, type I cytoskeletal 14 Human genes 0.000 description 1
- 102100040441 Keratin, type I cytoskeletal 16 Human genes 0.000 description 1
- 102100033421 Keratin, type I cytoskeletal 18 Human genes 0.000 description 1
- 102100033420 Keratin, type I cytoskeletal 19 Human genes 0.000 description 1
- 102100023129 Keratin, type I cytoskeletal 9 Human genes 0.000 description 1
- 102100037370 Keratin, type II cuticular Hb4 Human genes 0.000 description 1
- 101710115522 Keratin, type II cuticular Hb5 Proteins 0.000 description 1
- 102100022905 Keratin, type II cytoskeletal 1 Human genes 0.000 description 1
- 102100022854 Keratin, type II cytoskeletal 2 epidermal Human genes 0.000 description 1
- 102100025756 Keratin, type II cytoskeletal 5 Human genes 0.000 description 1
- 102100025655 Keratin, type II cytoskeletal 6B Human genes 0.000 description 1
- 102100025381 Keratin, type II cytoskeletal 73 Human genes 0.000 description 1
- 101710083589 Keratin, type II cytoskeletal 73 Proteins 0.000 description 1
- 102100023972 Keratin, type II cytoskeletal 8 Human genes 0.000 description 1
- 102100034751 Kinectin Human genes 0.000 description 1
- 102300053015 Kinectin isoform 2 Human genes 0.000 description 1
- 102100038306 Kinesin light chain 1 Human genes 0.000 description 1
- 102300056752 Kinesin light chain 1 isoform K Human genes 0.000 description 1
- 101710174459 Kinesin-1 heavy chain Proteins 0.000 description 1
- 102100038403 Kinesin-like protein KIF24 Human genes 0.000 description 1
- 102300056777 Kinesin-like protein KIF24 isoform 4 Human genes 0.000 description 1
- 101710134602 Kinesin-like protein KIFC2 Proteins 0.000 description 1
- 102100035792 Kininogen-1 Human genes 0.000 description 1
- 101710111227 Kininogen-1 Proteins 0.000 description 1
- 101150118703 Krt2 gene Proteins 0.000 description 1
- 101150082851 Krt20 gene Proteins 0.000 description 1
- 101150042912 Krt7 gene Proteins 0.000 description 1
- 101150010626 Krt73 gene Proteins 0.000 description 1
- 102100026388 L-amino-acid oxidase Human genes 0.000 description 1
- 102300061249 L-amino-acid oxidase isoform 2 Human genes 0.000 description 1
- 101710115390 L-lactate dehydrogenase A chain Proteins 0.000 description 1
- 101710133532 L-lactate dehydrogenase B chain Proteins 0.000 description 1
- 101710162163 LIM and SH3 domain protein 1 Proteins 0.000 description 1
- 102100033339 LIM domain and actin-binding protein 1 Human genes 0.000 description 1
- 102300036379 LIM domain and actin-binding protein 1 isoform 4 Human genes 0.000 description 1
- 102100033515 LIM domain only protein 7 Human genes 0.000 description 1
- 102300035446 LIM domain only protein 7 isoform 5 Human genes 0.000 description 1
- 102100039648 Lactadherin Human genes 0.000 description 1
- 102100023981 Lamina-associated polypeptide 2, isoform alpha Human genes 0.000 description 1
- 101710200521 Laminin subunit alpha-5 Proteins 0.000 description 1
- 101710186246 Laminin subunit beta-1 Proteins 0.000 description 1
- 101710186340 Laminin subunit beta-3 Proteins 0.000 description 1
- 101710095658 Laminin subunit gamma-1 Proteins 0.000 description 1
- 102100035159 Laminin subunit gamma-2 Human genes 0.000 description 1
- 102300045140 Laminin subunit gamma-2 isoform Short Human genes 0.000 description 1
- 102100027000 Latent-transforming growth factor beta-binding protein 1 Human genes 0.000 description 1
- 102300054395 Latent-transforming growth factor beta-binding protein 1 isoform 4 Human genes 0.000 description 1
- 101710178974 Latent-transforming growth factor beta-binding protein 2 Proteins 0.000 description 1
- 102100023757 Latent-transforming growth factor beta-binding protein 4 Human genes 0.000 description 1
- 102300052333 Latent-transforming growth factor beta-binding protein 4 isoform 3 Human genes 0.000 description 1
- 101710192798 Leucine zipper protein 1 Proteins 0.000 description 1
- 101710099853 Leucine-rich PPR motif-containing protein, mitochondrial Proteins 0.000 description 1
- 102100033303 Leucine-rich repeat flightless-interacting protein 1 Human genes 0.000 description 1
- 101710084835 Leucine-rich repeat-containing protein 17 Proteins 0.000 description 1
- 101710084201 Leucine-rich repeat-containing protein 59 Proteins 0.000 description 1
- 102000043856 Leucine-tRNA ligase Human genes 0.000 description 1
- 108010071170 Leucine-tRNA ligase Proteins 0.000 description 1
- 102000004895 Lipoproteins Human genes 0.000 description 1
- 108090001030 Lipoproteins Proteins 0.000 description 1
- 102100031955 Lon protease homolog, mitochondrial Human genes 0.000 description 1
- 102000015930 Lon proteases Human genes 0.000 description 1
- 108010051910 Long-chain-3-hydroxyacyl-CoA dehydrogenase Proteins 0.000 description 1
- 102100027121 Low-density lipoprotein receptor-related protein 1B Human genes 0.000 description 1
- 102100021922 Low-density lipoprotein receptor-related protein 2 Human genes 0.000 description 1
- 102000004317 Lyases Human genes 0.000 description 1
- 108090000856 Lyases Proteins 0.000 description 1
- 102100035529 Lysine-tRNA ligase Human genes 0.000 description 1
- 102300036017 Lysine-tRNA ligase isoform Mitochondrial Human genes 0.000 description 1
- 101710143774 Lysophosphatidylserine lipase ABHD12 Proteins 0.000 description 1
- 101710163761 Lysophospholipid acyltransferase 7 Proteins 0.000 description 1
- 102100028524 Lysosomal protective protein Human genes 0.000 description 1
- 102300060507 Lysosomal protective protein isoform 2 Human genes 0.000 description 1
- 108010009491 Lysosomal-Associated Membrane Protein 2 Proteins 0.000 description 1
- 102100020983 Lysosome membrane protein 2 Human genes 0.000 description 1
- 102000014944 Lysosome-Associated Membrane Glycoproteins Human genes 0.000 description 1
- 108010064171 Lysosome-Associated Membrane Glycoproteins Proteins 0.000 description 1
- 102100038225 Lysosome-associated membrane glycoprotein 2 Human genes 0.000 description 1
- 102300056587 Lysosome-associated membrane glycoprotein 2 isoform LAMP-2B Human genes 0.000 description 1
- 102100021958 Lysyl oxidase homolog 1 Human genes 0.000 description 1
- 101710183215 Lysyl oxidase homolog 2 Proteins 0.000 description 1
- 101710136868 MARCKS-related protein Proteins 0.000 description 1
- 101150083522 MECP2 gene Proteins 0.000 description 1
- 101710125131 MICOS complex subunit MIC19 Proteins 0.000 description 1
- 101710128942 MICOS complex subunit MIC60 Proteins 0.000 description 1
- 102100026050 MKI67 FHA domain-interacting nucleolar phosphoprotein Human genes 0.000 description 1
- 102100023474 MMS19 nucleotide excision repair protein homolog Human genes 0.000 description 1
- 102300058066 MMS19 nucleotide excision repair protein homolog isoform 6 Human genes 0.000 description 1
- 101700049202 MYO1C Proteins 0.000 description 1
- 102100024573 Macrophage-capping protein Human genes 0.000 description 1
- 102300041417 Macrophage-capping protein isoform 2 Human genes 0.000 description 1
- 101150017238 Magt1 gene Proteins 0.000 description 1
- 102100026475 Malate dehydrogenase, cytoplasmic Human genes 0.000 description 1
- 102100039742 Malate dehydrogenase, mitochondrial Human genes 0.000 description 1
- 102100024295 Maltase-glucoamylase Human genes 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 108010087568 Mannosyltransferases Proteins 0.000 description 1
- 102000006722 Mannosyltransferases Human genes 0.000 description 1
- 108010072582 Matrilin Proteins Proteins 0.000 description 1
- 102100033669 Matrilin-2 Human genes 0.000 description 1
- 101710146614 Matrin-3 Proteins 0.000 description 1
- 108010076557 Matrix Metalloproteinase 14 Proteins 0.000 description 1
- PKVZBNCYEICAQP-UHFFFAOYSA-N Mecamylamine hydrochloride Chemical compound Cl.C1CC2C(C)(C)C(NC)(C)C1C2 PKVZBNCYEICAQP-UHFFFAOYSA-N 0.000 description 1
- 239000007757 Media 199 Substances 0.000 description 1
- 102000018697 Membrane Proteins Human genes 0.000 description 1
- 108010052285 Membrane Proteins Proteins 0.000 description 1
- 208000036626 Mental retardation Diseases 0.000 description 1
- 102100026821 Mesoderm-specific transcript homolog protein Human genes 0.000 description 1
- 102300058143 Mesoderm-specific transcript homolog protein isoform 2 Human genes 0.000 description 1
- 102000005741 Metalloproteases Human genes 0.000 description 1
- 108010006035 Metalloproteases Proteins 0.000 description 1
- 108050002932 Metastasis-associated protein MTA2 Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 101710116586 Methionine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 102100039124 Methyl-CpG-binding protein 2 Human genes 0.000 description 1
- 102300056659 Methyl-CpG-binding protein 2 isoform B Human genes 0.000 description 1
- 108060004795 Methyltransferase Proteins 0.000 description 1
- 101710082050 Microsomal glutathione S-transferase 3 Proteins 0.000 description 1
- 102100027180 Microtubule-associated protein 1A Human genes 0.000 description 1
- 102300059817 Microtubule-associated protein 1A isoform 2 Human genes 0.000 description 1
- 101710093519 Microtubule-associated protein 4 Proteins 0.000 description 1
- 101710099411 Microtubule-associated protein RP/EB family member 1 Proteins 0.000 description 1
- 102100030335 Midkine Human genes 0.000 description 1
- 102300051036 Midkine isoform 2 Human genes 0.000 description 1
- 101710142211 Mitochondrial 2-oxoglutarate/malate carrier protein Proteins 0.000 description 1
- 101710133312 Mitochondrial GTPase 1 Proteins 0.000 description 1
- 102100023198 Mitochondrial carrier homolog 1 Human genes 0.000 description 1
- 102100031332 Mitochondrial carrier homolog 2 Human genes 0.000 description 1
- 101710081788 Mitochondrial fission 1 protein Proteins 0.000 description 1
- 102100026905 Mitochondrial import receptor subunit TOM40 homolog Human genes 0.000 description 1
- 101710157233 Mitochondrial import receptor subunit tom40 Proteins 0.000 description 1
- 101710113644 Mitochondrial ribosome-associated GTPase 1 Proteins 0.000 description 1
- 102100033815 Mitochondrial ribosome-associated GTPase 1 Human genes 0.000 description 1
- 101710159910 Movement protein Proteins 0.000 description 1
- 101710155103 Mucin-19 Proteins 0.000 description 1
- 102000011279 Multidrug resistance protein 1 Human genes 0.000 description 1
- 108010047290 Multifunctional Enzymes Proteins 0.000 description 1
- 102000006833 Multifunctional Enzymes Human genes 0.000 description 1
- 102100034005 Myb-binding protein 1A Human genes 0.000 description 1
- 102300058993 Myb-binding protein 1A isoform 2 Human genes 0.000 description 1
- 101001033610 Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) Inosine-5'-monophosphate dehydrogenase Proteins 0.000 description 1
- 101710107751 Myelin expression factor 2 Proteins 0.000 description 1
- 101710154183 Myeloid-associated differentiation marker Proteins 0.000 description 1
- 102100035083 Myoferlin Human genes 0.000 description 1
- 101710082631 Myosin light chain 6B Proteins 0.000 description 1
- 102100031829 Myosin light polypeptide 6 Human genes 0.000 description 1
- 102100037183 Myosin phosphatase Rho-interacting protein Human genes 0.000 description 1
- 102300058890 Myosin phosphatase Rho-interacting protein isoform 2 Human genes 0.000 description 1
- 102100030329 Myosin regulatory light chain 12A Human genes 0.000 description 1
- 102100030330 Myosin regulatory light chain 12B Human genes 0.000 description 1
- 102100031787 Myosin regulatory light polypeptide 9 Human genes 0.000 description 1
- 101710115163 Myosin-10 Proteins 0.000 description 1
- 102100036639 Myosin-11 Human genes 0.000 description 1
- 102300051190 Myosin-11 isoform 2 Human genes 0.000 description 1
- 102100032972 Myosin-14 Human genes 0.000 description 1
- 102300065465 Myosin-14 isoform 2 Human genes 0.000 description 1
- 101710204108 Myosin-9 Proteins 0.000 description 1
- 102100028903 Myristoylated alanine-rich C-kinase substrate Human genes 0.000 description 1
- ZBZXYUYUUDZCNB-UHFFFAOYSA-N N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-[4-[4-(N-[4-[4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline Chemical compound C1=CCCC(N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ZBZXYUYUUDZCNB-UHFFFAOYSA-N 0.000 description 1
- 101710134114 NAD(P) transhydrogenase, mitochondrial Proteins 0.000 description 1
- 108010086428 NADH Dehydrogenase Proteins 0.000 description 1
- 102000006746 NADH Dehydrogenase Human genes 0.000 description 1
- 101710149200 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10 Proteins 0.000 description 1
- 102100035390 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Human genes 0.000 description 1
- 101710149291 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Proteins 0.000 description 1
- 102100031924 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Human genes 0.000 description 1
- 101710185438 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Proteins 0.000 description 1
- 102100032205 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Human genes 0.000 description 1
- 102300034002 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 isoform 2 Human genes 0.000 description 1
- 102100026360 NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Human genes 0.000 description 1
- 102300059690 NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial isoform 2 Human genes 0.000 description 1
- 101710126846 NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Proteins 0.000 description 1
- 102100033153 NADH-cytochrome b5 reductase 3 Human genes 0.000 description 1
- 102300050549 NADH-cytochrome b5 reductase 3 isoform 2 Human genes 0.000 description 1
- 101710103564 Nascent polypeptide-associated complex subunit alpha Proteins 0.000 description 1
- 102100023305 Nesprin-2 Human genes 0.000 description 1
- 102300037952 Nesprin-2 isoform 2 Human genes 0.000 description 1
- 108010088225 Nestin Proteins 0.000 description 1
- 108091014434 Neurabin-2 Proteins 0.000 description 1
- 102100039234 Neurobeachin Human genes 0.000 description 1
- 101710154564 Neuroblast differentiation-associated protein AHNAK Proteins 0.000 description 1
- 102100035107 Neurotrimin Human genes 0.000 description 1
- 102300040815 Neurotrimin isoform 2 Human genes 0.000 description 1
- 101710140639 Neutral alpha-glucosidase AB Proteins 0.000 description 1
- 102100032087 Neutral cholesterol ester hydrolase 1 Human genes 0.000 description 1
- 102300034007 Neutral cholesterol ester hydrolase 1 isoform 2 Human genes 0.000 description 1
- 102100031801 Nexilin Human genes 0.000 description 1
- 108010088865 Nicotinamide N-Methyltransferase Proteins 0.000 description 1
- 102100030830 Nicotinate-nucleotide pyrophosphorylase [carboxylating] Human genes 0.000 description 1
- 102100037371 Nidogen-2 Human genes 0.000 description 1
- 102300065302 Nidogen-2 isoform 2 Human genes 0.000 description 1
- 102100027967 Nodal modulator 2 Human genes 0.000 description 1
- 102300059488 Nodal modulator 2 isoform 2 Human genes 0.000 description 1
- 108010077641 Nogo Proteins Proteins 0.000 description 1
- 101710097259 Non-POU domain-containing octamer-binding protein Proteins 0.000 description 1
- 102000015863 Nuclear Factor 90 Proteins Human genes 0.000 description 1
- 108010010424 Nuclear Factor 90 Proteins Proteins 0.000 description 1
- 102000043141 Nuclear RNA Human genes 0.000 description 1
- 108020003217 Nuclear RNA Proteins 0.000 description 1
- 102100036961 Nuclear mitotic apparatus protein 1 Human genes 0.000 description 1
- 102100021713 Nuclear nucleic acid-binding protein C1D Human genes 0.000 description 1
- 102100021976 Nuclear pore complex protein Nup107 Human genes 0.000 description 1
- 102300061301 Nuclear pore complex protein Nup107 isoform 2 Human genes 0.000 description 1
- 101710171042 Nuclear pore complex protein Nup205 Proteins 0.000 description 1
- 102100033819 Nuclear pore complex protein Nup214 Human genes 0.000 description 1
- 102300050615 Nuclear pore complex protein Nup214 isoform 2 Human genes 0.000 description 1
- 101710202983 Nuclear pore complex protein Nup93 Proteins 0.000 description 1
- 102100022935 Nuclear receptor corepressor 1 Human genes 0.000 description 1
- 102300053447 Nuclear receptor corepressor 1 isoform 2 Human genes 0.000 description 1
- 101710127265 Nuclear receptor-binding protein Proteins 0.000 description 1
- 102100026100 Nucleolar RNA helicase 2 Human genes 0.000 description 1
- 102100022726 Nucleolar and coiled-body phosphoprotein 1 Human genes 0.000 description 1
- 102100029099 Nucleolar complex protein 3 homolog Human genes 0.000 description 1
- 102100027986 Nucleolar complex protein 4 homolog Human genes 0.000 description 1
- 102100022402 Nucleolar protein 11 Human genes 0.000 description 1
- 102100037052 Nucleolar protein 56 Human genes 0.000 description 1
- 102100034532 Nucleolar protein 58 Human genes 0.000 description 1
- 102100038485 Nucleolar transcription factor 1 Human genes 0.000 description 1
- 102100021010 Nucleolin Human genes 0.000 description 1
- 108010025568 Nucleophosmin Proteins 0.000 description 1
- 101710188544 Nucleoplasmin-3 Proteins 0.000 description 1
- 102100023258 Nucleoside diphosphate kinase B Human genes 0.000 description 1
- 102300058031 Nucleoside diphosphate kinase B isoform 3 Human genes 0.000 description 1
- 102100022389 Nucleosome assembly protein 1-like 1 Human genes 0.000 description 1
- 102300053459 Nucleosome assembly protein 1-like 1 isoform 2 Human genes 0.000 description 1
- 102100022396 Nucleosome assembly protein 1-like 4 Human genes 0.000 description 1
- 102300053465 Nucleosome assembly protein 1-like 4 isoform 2 Human genes 0.000 description 1
- TYBWABJIIOVYOR-UHFFFAOYSA-N OCC(C(O)=O)OP(=O)=O Chemical compound OCC(C(O)=O)OP(=O)=O TYBWABJIIOVYOR-UHFFFAOYSA-N 0.000 description 1
- 101710197116 OCIA domain-containing protein 2 Proteins 0.000 description 1
- 101710134054 Obg-like ATPase 1 Proteins 0.000 description 1
- 102100030127 Obscurin Human genes 0.000 description 1
- 102300059055 Obscurin isoform 5 Human genes 0.000 description 1
- 108010061952 Orosomucoid Proteins 0.000 description 1
- 102000012404 Orosomucoid Human genes 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 101001027323 Oryctolagus cuniculus Permeability factor 2 Proteins 0.000 description 1
- 101000921214 Oryza sativa subsp. japonica Protein EARLY HEADING DATE 2 Proteins 0.000 description 1
- 101710103337 PC4 and SFRS1-interacting protein Proteins 0.000 description 1
- 101710121673 PDZ and LIM domain protein 1 Proteins 0.000 description 1
- 101710121661 PDZ and LIM domain protein 4 Proteins 0.000 description 1
- 101710121657 PDZ and LIM domain protein 5 Proteins 0.000 description 1
- 102100033337 PDZ and LIM domain protein 7 Human genes 0.000 description 1
- 102300033481 PDZ and LIM domain protein 7 isoform 2 Human genes 0.000 description 1
- 101710201639 PDZ domain-containing protein 4 Proteins 0.000 description 1
- KJWZYMMLVHIVSU-IYCNHOCDSA-N PGK1 Chemical compound CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](CCCCCCC(O)=O)C(=O)CC1=O KJWZYMMLVHIVSU-IYCNHOCDSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 101710133393 POU domain, class 3, transcription factor 3 Proteins 0.000 description 1
- 101710117737 PR domain zinc finger protein 8 Proteins 0.000 description 1
- 101710133990 PRA1 family protein 3 Proteins 0.000 description 1
- 101710162991 PRKC apoptosis WT1 regulator protein Proteins 0.000 description 1
- 108010047613 PTB-Associated Splicing Factor Proteins 0.000 description 1
- 101700020768 PWP1 Proteins 0.000 description 1
- 102100035031 Palladin Human genes 0.000 description 1
- 102100034934 Papilin Human genes 0.000 description 1
- 101710097645 Parkinson disease protein 7 homolog Proteins 0.000 description 1
- BFHAYPLBUQVNNJ-UHFFFAOYSA-N Pectenotoxin 3 Natural products OC1C(C)CCOC1(O)C1OC2C=CC(C)=CC(C)CC(C)(O3)CCC3C(O3)(O4)CCC3(C=O)CC4C(O3)C(=O)CC3(C)C(O)C(O3)CCC3(O3)CCCC3C(C)C(=O)OC2C1 BFHAYPLBUQVNNJ-UHFFFAOYSA-N 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 101710192097 Pentraxin-related protein PTX3 Proteins 0.000 description 1
- 102000008880 Peptidase C12, ubiquitin carboxyl-terminal hydrolases Human genes 0.000 description 1
- 108050000823 Peptidase C12, ubiquitin carboxyl-terminal hydrolases Proteins 0.000 description 1
- 101710111764 Peptidyl-prolyl cis-trans isomerase FKBP10 Proteins 0.000 description 1
- 101710147149 Peptidyl-prolyl cis-trans isomerase FKBP3 Proteins 0.000 description 1
- 102100037895 Perilipin-3 Human genes 0.000 description 1
- 108010068633 Perilipin-3 Proteins 0.000 description 1
- 102300056932 Perilipin-3 isoform 3 Human genes 0.000 description 1
- 101710125431 Periodic tryptophan protein 1 Proteins 0.000 description 1
- 102100029734 Periodic tryptophan protein 1 homolog Human genes 0.000 description 1
- 101710199268 Periostin Proteins 0.000 description 1
- 102300057093 Periostin isoform 2 Human genes 0.000 description 1
- 102100034601 Peroxidasin homolog Human genes 0.000 description 1
- 102100034763 Peroxiredoxin-2 Human genes 0.000 description 1
- 102100037476 Peroxisomal membrane protein PEX14 Human genes 0.000 description 1
- 102100022587 Peroxisomal multifunctional enzyme type 2 Human genes 0.000 description 1
- 101710189656 Pescadillo Proteins 0.000 description 1
- 102100035816 Pescadillo homolog Human genes 0.000 description 1
- 102100035215 Phenylalanine-tRNA ligase alpha subunit Human genes 0.000 description 1
- 102300052766 Phenylalanine-tRNA ligase alpha subunit isoform 2 Human genes 0.000 description 1
- 102100037170 Phosphate carrier protein, mitochondrial Human genes 0.000 description 1
- 102300058896 Phosphate carrier protein, mitochondrial isoform B Human genes 0.000 description 1
- 102100031014 Phosphatidylinositol-binding clathrin assembly protein Human genes 0.000 description 1
- 102300034441 Phosphatidylinositol-binding clathrin assembly protein isoform 5 Human genes 0.000 description 1
- 108010038555 Phosphoglycerate dehydrogenase Proteins 0.000 description 1
- 102100028251 Phosphoglycerate kinase 1 Human genes 0.000 description 1
- 108050006040 Phosphoglycerate mutase 1 Proteins 0.000 description 1
- 101710135629 Phospholipid-transporting ATPase IB Proteins 0.000 description 1
- 108010022181 Phosphopyruvate Hydratase Proteins 0.000 description 1
- 102100021768 Phosphoserine aminotransferase Human genes 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 101710173952 Pinin Proteins 0.000 description 1
- 102100036090 Pituitary homeobox 2 Human genes 0.000 description 1
- 102100038124 Plasminogen Human genes 0.000 description 1
- 108010051456 Plasminogen Proteins 0.000 description 1
- 108010022233 Plasminogen Activator Inhibitor 1 Proteins 0.000 description 1
- 102100039418 Plasminogen activator inhibitor 1 Human genes 0.000 description 1
- 102100034055 Plasminogen activator inhibitor 1 RNA-binding protein Human genes 0.000 description 1
- 102300034596 Plasminogen activator inhibitor 1 RNA-binding protein isoform 3 Human genes 0.000 description 1
- 102100035220 Plastin-3 Human genes 0.000 description 1
- 102300060291 Plastin-3 isoform 2 Human genes 0.000 description 1
- 102000004211 Platelet factor 4 Human genes 0.000 description 1
- 108090000778 Platelet factor 4 Proteins 0.000 description 1
- 101710097756 Platelet-activating factor acetylhydrolase IB subunit alpha Proteins 0.000 description 1
- 102100039449 Platelet-activating factor acetylhydrolase IB subunit alpha2 Human genes 0.000 description 1
- 101710164131 Platelet-activating factor acetylhydrolase IB subunit beta Proteins 0.000 description 1
- 102100040990 Platelet-derived growth factor subunit B Human genes 0.000 description 1
- 102300040352 Platelet-derived growth factor subunit B isoform 2 Human genes 0.000 description 1
- 102100030477 Plectin Human genes 0.000 description 1
- 102300039648 Plectin isoform 4 Human genes 0.000 description 1
- 102100036031 Podocalyxin Human genes 0.000 description 1
- 108010064218 Poly (ADP-Ribose) Polymerase-1 Proteins 0.000 description 1
- 101710144588 Poly [ADP-ribose] polymerase 1 Proteins 0.000 description 1
- 108010012887 Poly(A)-Binding Protein I Proteins 0.000 description 1
- 101710089655 Poly(rC)-binding protein 1 Proteins 0.000 description 1
- 101710089647 Poly(rC)-binding protein 2 Proteins 0.000 description 1
- 101710139643 Polyadenylate-binding protein 1 Proteins 0.000 description 1
- 102100039427 Polyadenylate-binding protein 2 Human genes 0.000 description 1
- 102300057419 Polyadenylate-binding protein 2 isoform 2 Human genes 0.000 description 1
- 229920000331 Polyhydroxybutyrate Polymers 0.000 description 1
- 101710142722 Polymerase delta-interacting protein 3 Proteins 0.000 description 1
- 102100033073 Polypyrimidine tract-binding protein 1 Human genes 0.000 description 1
- 102100031243 Polypyrimidine tract-binding protein 3 Human genes 0.000 description 1
- 102300043814 Polypyrimidine tract-binding protein 3 isoform 1 Human genes 0.000 description 1
- 101710125959 Polyubiquitin-B Proteins 0.000 description 1
- 101710124492 Pre-mRNA-processing factor 19 Proteins 0.000 description 1
- 101710107104 Pre-mRNA-processing-splicing factor 8 Proteins 0.000 description 1
- 102100037901 Pre-mRNA-splicing factor SYF2 Human genes 0.000 description 1
- 102300059731 Pre-mRNA-splicing factor SYF2 isoform 2 Human genes 0.000 description 1
- 101710137807 Prefoldin subunit 6 Proteins 0.000 description 1
- 108010015078 Pregnancy-Associated alpha 2-Macroglobulins Proteins 0.000 description 1
- 101710205254 Prelamin-A/C Proteins 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- 102100022407 Probable 28S rRNA (cytosine(4447)-C(5))-methyltransferase Human genes 0.000 description 1
- 102100021409 Probable ATP-dependent RNA helicase DDX17 Human genes 0.000 description 1
- 102300052491 Probable ATP-dependent RNA helicase DDX17 isoform 2 Human genes 0.000 description 1
- 102100029480 Probable ATP-dependent RNA helicase DDX6 Human genes 0.000 description 1
- 101710153898 Procollagen galactosyltransferase 1 Proteins 0.000 description 1
- 101710102040 Procollagen glycosyltransferase Proteins 0.000 description 1
- 102100035202 Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Human genes 0.000 description 1
- 102300060294 Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 isoform 2 Human genes 0.000 description 1
- 102100035198 Procollagen-lysine,2-oxoglutarate 5-dioxygenase 2 Human genes 0.000 description 1
- 102300060296 Procollagen-lysine,2-oxoglutarate 5-dioxygenase 2 isoform 2 Human genes 0.000 description 1
- 102100028857 Profilin-1 Human genes 0.000 description 1
- 102100033344 Programmed cell death 6-interacting protein Human genes 0.000 description 1
- 101710098058 Prohibitin-2 Proteins 0.000 description 1
- 102100034836 Proliferation marker protein Ki-67 Human genes 0.000 description 1
- 102100026899 Proliferation-associated protein 2G4 Human genes 0.000 description 1
- 101710115782 Proline-tRNA ligase Proteins 0.000 description 1
- 108050008031 Prolyl 3-hydroxylase 1 Proteins 0.000 description 1
- 102100034014 Prolyl 3-hydroxylase 3 Human genes 0.000 description 1
- 108050008029 Prolyl 3-hydroxylase 3 Proteins 0.000 description 1
- 101710084318 Prolyl 4-hydroxylase subunit alpha-2 Proteins 0.000 description 1
- 108010023294 Protease La Proteins 0.000 description 1
- 101710103684 Proteasome activator complex subunit 2 Proteins 0.000 description 1
- 101710201657 Proteasome adapter and scaffold protein ECM29 Proteins 0.000 description 1
- 102100036042 Proteasome subunit alpha type-1 Human genes 0.000 description 1
- 102300061097 Proteasome subunit alpha type-1 isoform Long Human genes 0.000 description 1
- 101710186654 Proteasome subunit alpha type-2 Proteins 0.000 description 1
- 102100035908 Proteasome subunit alpha type-3 Human genes 0.000 description 1
- 102300041412 Proteasome subunit alpha type-3 isoform 2 Human genes 0.000 description 1
- 101710186661 Proteasome subunit alpha type-4 Proteins 0.000 description 1
- 101710186649 Proteasome subunit alpha type-5 Proteins 0.000 description 1
- 101710186646 Proteasome subunit alpha type-6 Proteins 0.000 description 1
- 101710186664 Proteasome subunit alpha type-7 Proteins 0.000 description 1
- 101710094495 Proteasome subunit beta type-1 Proteins 0.000 description 1
- 101710094498 Proteasome subunit beta type-2 Proteins 0.000 description 1
- 101710094500 Proteasome subunit beta type-3 Proteins 0.000 description 1
- 101710094502 Proteasome subunit beta type-5 Proteins 0.000 description 1
- 101710094501 Proteasome subunit beta type-6 Proteins 0.000 description 1
- 101710094473 Proteasome subunit beta type-7 Proteins 0.000 description 1
- 101800001072 Protein 1A Proteins 0.000 description 1
- 102100031838 Protein AHNAK2 Human genes 0.000 description 1
- 102300060450 Protein AHNAK2 isoform 3 Human genes 0.000 description 1
- 101710132617 Protein B1 Proteins 0.000 description 1
- 101710173050 Protein DEK Proteins 0.000 description 1
- 108010032428 Protein Deglycase DJ-1 Proteins 0.000 description 1
- 102100031135 Protein Dok-7 Human genes 0.000 description 1
- 102300064746 Protein Dok-7 isoform 2 Human genes 0.000 description 1
- 102100037113 Protein ELYS Human genes 0.000 description 1
- 102300044437 Protein ELYS isoform 2 Human genes 0.000 description 1
- 101710156634 Protein FAM98A Proteins 0.000 description 1
- 102100022569 Protein FAM98B Human genes 0.000 description 1
- 102300063347 Protein FAM98B isoform 2 Human genes 0.000 description 1
- 102100036828 Protein GREB1 Human genes 0.000 description 1
- 101710112198 Protein GREB1 Proteins 0.000 description 1
- 108700039882 Protein Glutamine gamma Glutamyltransferase 2 Proteins 0.000 description 1
- 101710130519 Protein LYRIC Proteins 0.000 description 1
- 101710087740 Protein MAK16 Proteins 0.000 description 1
- 102100028815 Protein MAK16 homolog Human genes 0.000 description 1
- 101710110950 Protein S100-A10 Proteins 0.000 description 1
- 101710110945 Protein S100-A11 Proteins 0.000 description 1
- 101710110946 Protein S100-A13 Proteins 0.000 description 1
- 101710156983 Protein S100-A6 Proteins 0.000 description 1
- 101710156990 Protein S100-A9 Proteins 0.000 description 1
- 102100021725 Protein SEC13 homolog Human genes 0.000 description 1
- 102300042158 Protein SET isoform 2 Human genes 0.000 description 1
- 101710189470 Protein SGT1 Proteins 0.000 description 1
- 102100037337 Protein SGT1 homolog Human genes 0.000 description 1
- 102000008966 Protein Sec13 Human genes 0.000 description 1
- 108050000940 Protein Sec13 Proteins 0.000 description 1
- 102100033661 Protein TFG Human genes 0.000 description 1
- 102300045082 Protein TFG isoform 2 Human genes 0.000 description 1
- 101710084434 Protein arginine N-methyltransferase 1 Proteins 0.000 description 1
- 102100036468 Protein diaphanous homolog 3 Human genes 0.000 description 1
- 102100037097 Protein disulfide-isomerase A3 Human genes 0.000 description 1
- 102100037089 Protein disulfide-isomerase A4 Human genes 0.000 description 1
- 102100037061 Protein disulfide-isomerase A6 Human genes 0.000 description 1
- 101710196377 Protein enabled Proteins 0.000 description 1
- 102100035093 Protein enabled homolog Human genes 0.000 description 1
- 102100040923 Protein flightless-1 homolog Human genes 0.000 description 1
- 101710126683 Protein mago nashi Proteins 0.000 description 1
- 102100026740 Protein mago nashi homolog Human genes 0.000 description 1
- 101710204725 Protein mono-ADP-ribosyltransferase PARP4 Proteins 0.000 description 1
- 102100036547 Protein phosphatase 1 regulatory subunit 12A Human genes 0.000 description 1
- 102300051219 Protein phosphatase 1 regulatory subunit 12A isoform 4 Human genes 0.000 description 1
- 102100031479 Protein transport protein Sec16A Human genes 0.000 description 1
- 102300058157 Protein transport protein Sec16A isoform 2 Human genes 0.000 description 1
- 101710198442 Protein transport protein Sec23A Proteins 0.000 description 1
- 102100022484 Protein transport protein Sec31A Human genes 0.000 description 1
- 102300042589 Protein transport protein Sec31A isoform 9 Human genes 0.000 description 1
- 101710203458 Protein transport protein Sec61 subunit alpha isoform 1 Proteins 0.000 description 1
- 101710148865 Protein transport protein Sec61 subunit beta Proteins 0.000 description 1
- 101710129043 Protein virilizer Proteins 0.000 description 1
- 102100038288 Protein virilizer homolog Human genes 0.000 description 1
- 108010003894 Protein-Lysine 6-Oxidase Proteins 0.000 description 1
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 1
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 1
- 101710182788 Protein-glutamine gamma-glutamyltransferase E Proteins 0.000 description 1
- 102100026858 Protein-lysine 6-oxidase Human genes 0.000 description 1
- 101710142458 Protein/nucleic acid deglycase DJ-1 Proteins 0.000 description 1
- 108010019674 Proto-Oncogene Proteins c-sis Proteins 0.000 description 1
- 102100027358 Pumilio homolog 3 Human genes 0.000 description 1
- 102100033301 Putative guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-14 Human genes 0.000 description 1
- 102100034301 Putative oxidoreductase GLYR1 Human genes 0.000 description 1
- 102300043036 Putative oxidoreductase GLYR1 isoform 3 Human genes 0.000 description 1
- 101710142338 Pyrroline-5-carboxylate reductase 1 Proteins 0.000 description 1
- 108010090051 Pyruvate Dehydrogenase Complex Proteins 0.000 description 1
- 102000012751 Pyruvate Dehydrogenase Complex Human genes 0.000 description 1
- 102100035711 Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Human genes 0.000 description 1
- 102300033601 Pyruvate dehydrogenase E1 component subunit beta, mitochondrial isoform 2 Human genes 0.000 description 1
- 101710152724 Pyruvate kinase PKM Proteins 0.000 description 1
- 101150105148 RAD23 gene Proteins 0.000 description 1
- 101150111584 RHOA gene Proteins 0.000 description 1
- 102000015097 RNA Splicing Factors Human genes 0.000 description 1
- 108010039259 RNA Splicing Factors Proteins 0.000 description 1
- 101710160251 RNA transcription, translation and transport factor protein Proteins 0.000 description 1
- 108700020471 RNA-Binding Proteins Proteins 0.000 description 1
- 230000004570 RNA-binding Effects 0.000 description 1
- 101710176041 RNA-binding motif protein, X chromosome Proteins 0.000 description 1
- 101710105008 RNA-binding protein Proteins 0.000 description 1
- 101710203307 RNA-binding protein 14 Proteins 0.000 description 1
- 101710206014 RNA-binding protein 28 Proteins 0.000 description 1
- 101710133263 RNA-binding protein 3 Proteins 0.000 description 1
- 102100025858 RNA-binding protein 39 Human genes 0.000 description 1
- 102300056290 RNA-binding protein 39 isoform 2 Human genes 0.000 description 1
- 102100039691 RNA-binding protein 8A Human genes 0.000 description 1
- 102300035327 RNA-binding protein 8A isoform 2 Human genes 0.000 description 1
- 102000004229 RNA-binding protein EWS Human genes 0.000 description 1
- 108090000740 RNA-binding protein EWS Proteins 0.000 description 1
- 102300052973 RNA-binding protein EWS isoform 6 Human genes 0.000 description 1
- 108090000292 RNA-binding protein FUS Proteins 0.000 description 1
- 102000003890 RNA-binding protein FUS Human genes 0.000 description 1
- 102300053655 RNA-binding protein FUS isoform Short Human genes 0.000 description 1
- 101710160077 RNA-binding protein Raly Proteins 0.000 description 1
- 102100039323 RNA-binding protein with serine-rich domain 1 Human genes 0.000 description 1
- 102100034776 RNA-splicing ligase RtcB homolog Human genes 0.000 description 1
- 239000012979 RPMI medium Substances 0.000 description 1
- 108060007240 RYR1 Proteins 0.000 description 1
- 102000004913 RYR1 Human genes 0.000 description 1
- 101710193720 Rab GDP dissociation inhibitor beta Proteins 0.000 description 1
- 102100028208 Raftlin Human genes 0.000 description 1
- 102100033975 Ran-binding protein 3 Human genes 0.000 description 1
- 101150020444 Ranbp3 gene Proteins 0.000 description 1
- 108050003637 Ras GTPase-activating protein-binding protein 1 Proteins 0.000 description 1
- 108050003639 Ras GTPase-activating protein-binding protein 2 Proteins 0.000 description 1
- 101710102668 Ras suppressor protein 1 Proteins 0.000 description 1
- 102100022122 Ras-related C3 botulinum toxin substrate 1 Human genes 0.000 description 1
- 102100024683 Ras-related protein R-Ras Human genes 0.000 description 1
- 102100039103 Ras-related protein Rab-10 Human genes 0.000 description 1
- 102100031379 Ras-related protein Rab-11B Human genes 0.000 description 1
- 102100028191 Ras-related protein Rab-1A Human genes 0.000 description 1
- 102100029979 Ras-related protein Rab-1B Human genes 0.000 description 1
- 102100034485 Ras-related protein Rab-2A Human genes 0.000 description 1
- 102100022306 Ras-related protein Rab-3B Human genes 0.000 description 1
- 102100025138 Ras-related protein Rab-5C Human genes 0.000 description 1
- 102100030019 Ras-related protein Rab-7a Human genes 0.000 description 1
- 102100031424 Ras-related protein Ral-A Human genes 0.000 description 1
- 102100030705 Ras-related protein Rap-1b Human genes 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 101100140980 Rattus norvegicus Dlc1 gene Proteins 0.000 description 1
- 101000629598 Rattus norvegicus Sterol regulatory element-binding protein 1 Proteins 0.000 description 1
- 108010012737 RecQ Helicases Proteins 0.000 description 1
- 101710089526 Receptor of activated protein C kinase 1 Proteins 0.000 description 1
- 108010044157 Receptors for Activated C Kinase Proteins 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 102100033796 Regulation of nuclear pre-mRNA domain-containing protein 1B Human genes 0.000 description 1
- 102100039977 Regulator of chromosome condensation Human genes 0.000 description 1
- 101710201736 Remodeling and spacing factor 1 Proteins 0.000 description 1
- 101710166754 Replication protein A 32 kDa subunit Proteins 0.000 description 1
- 101710176758 Replication protein A 70 kDa DNA-binding subunit Proteins 0.000 description 1
- 102100025335 Reticulocalbin-1 Human genes 0.000 description 1
- 108010071034 Retinoblastoma-Binding Protein 4 Proteins 0.000 description 1
- 102100038453 Retinoic acid-induced protein 3 Human genes 0.000 description 1
- 102100022941 Retinol-binding protein 1 Human genes 0.000 description 1
- 102300044349 Retinol-binding protein 1 isoform 2 Human genes 0.000 description 1
- 102100025642 Rho GDP-dissociation inhibitor 1 Human genes 0.000 description 1
- 101710116876 Rho GTPase-activating protein 1 Proteins 0.000 description 1
- 101710199530 Rho-related GTP-binding protein RhoC Proteins 0.000 description 1
- 101710141795 Ribonuclease inhibitor Proteins 0.000 description 1
- 229940122208 Ribonuclease inhibitor Drugs 0.000 description 1
- 101710170630 Ribonucleoside-diphosphate reductase 1 subunit alpha Proteins 0.000 description 1
- 101710158139 Ribosomal L1 domain-containing protein 1 Proteins 0.000 description 1
- 102000002278 Ribosomal Proteins Human genes 0.000 description 1
- 108010000605 Ribosomal Proteins Proteins 0.000 description 1
- 102000050114 Ribosomal protein P2 Human genes 0.000 description 1
- 102100029834 Ribosome biogenesis protein BRX1 homolog Human genes 0.000 description 1
- 102100023902 Ribosome biogenesis regulatory protein homolog Human genes 0.000 description 1
- 102100027486 Ribosome production factor 2 homolog Human genes 0.000 description 1
- 101710132192 Ribosome-binding protein 1 Proteins 0.000 description 1
- 101150093156 Rras gene Proteins 0.000 description 1
- 101710111834 RuvB-like 1 Proteins 0.000 description 1
- 101710111831 RuvB-like 2 Proteins 0.000 description 1
- 101710169742 RuvB-like protein 1 Proteins 0.000 description 1
- 108010005260 S100 Calcium Binding Protein A6 Proteins 0.000 description 1
- 108010015695 S100 calcium binding protein A10 Proteins 0.000 description 1
- 101710083248 SAP domain-containing ribonucleoprotein Proteins 0.000 description 1
- 108091005488 SCARB2 Proteins 0.000 description 1
- 102100027296 SCO-spondin Human genes 0.000 description 1
- 102300034955 SCO-spondin isoform 2 Human genes 0.000 description 1
- 101710161467 SH3 domain-binding protein 1 Proteins 0.000 description 1
- 102100024244 SH3 domain-containing kinase-binding protein 1 Human genes 0.000 description 1
- 102300038297 SH3 domain-containing kinase-binding protein 1 isoform 2 Human genes 0.000 description 1
- 108091006207 SLC-Transporter Proteins 0.000 description 1
- 102000037054 SLC-Transporter Human genes 0.000 description 1
- 108091006703 SLC25A1 Proteins 0.000 description 1
- 108091006417 SLC25A11 Proteins 0.000 description 1
- 108091006418 SLC25A13 Proteins 0.000 description 1
- 108091006463 SLC25A24 Proteins 0.000 description 1
- 108091006710 SLC25A3 Proteins 0.000 description 1
- 108091006716 SLC25A4 Proteins 0.000 description 1
- 108091006715 SLC25A5 Proteins 0.000 description 1
- 108091006495 SLC25A6 Proteins 0.000 description 1
- 108091006296 SLC2A1 Proteins 0.000 description 1
- 108091006313 SLC3A2 Proteins 0.000 description 1
- 108091007602 SLC58A1 Proteins 0.000 description 1
- 108091007406 SLC64A1 Proteins 0.000 description 1
- 101710138291 SNW domain-containing protein 1 Proteins 0.000 description 1
- 101710104831 SRA stem-loop-interacting RNA-binding protein, mitochondrial Proteins 0.000 description 1
- 108010044012 STAT1 Transcription Factor Proteins 0.000 description 1
- 102100031131 SUN domain-containing protein 2 Human genes 0.000 description 1
- 102300038195 SUN domain-containing protein 2 isoform 3 Human genes 0.000 description 1
- 101710169053 SWI/SNF complex subunit SMARCC1 Proteins 0.000 description 1
- 102100024790 SWI/SNF complex subunit SMARCC2 Human genes 0.000 description 1
- 102300038403 SWI/SNF complex subunit SMARCC2 isoform 2 Human genes 0.000 description 1
- 102100031028 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A member 5 Human genes 0.000 description 1
- 102100031029 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1 Human genes 0.000 description 1
- 101100485284 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CRM1 gene Proteins 0.000 description 1
- 101000857460 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) RuvB-like protein 2 Proteins 0.000 description 1
- 101710109123 Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Proteins 0.000 description 1
- 102100032357 Scaffold attachment factor B1 Human genes 0.000 description 1
- 101100279491 Schizosaccharomyces pombe (strain 972 / ATCC 24843) int6 gene Proteins 0.000 description 1
- 101100501193 Schizosaccharomyces pombe (strain 972 / ATCC 24843) moe1 gene Proteins 0.000 description 1
- 101100225588 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nip1 gene Proteins 0.000 description 1
- 101100444985 Schizosaccharomyces pombe (strain 972 / ATCC 24843) tif35 gene Proteins 0.000 description 1
- 101710095008 Selenoprotein H Proteins 0.000 description 1
- 101710199433 Semaphorin-3C Proteins 0.000 description 1
- 102100037545 Semaphorin-7A Human genes 0.000 description 1
- 102300061600 Semaphorin-7A isoform 2 Human genes 0.000 description 1
- 241000252141 Semionotiformes Species 0.000 description 1
- 101710005686 Septin-11 Proteins 0.000 description 1
- 102100032764 Septin-2 Human genes 0.000 description 1
- 102300005757 Septin-2 isoform 3 Human genes 0.000 description 1
- 102100027981 Septin-7 Human genes 0.000 description 1
- 102300026258 Septin-7 isoform 2 Human genes 0.000 description 1
- 102100028025 Septin-8 Human genes 0.000 description 1
- 102300022311 Septin-8 isoform 2 Human genes 0.000 description 1
- 102100028024 Septin-9 Human genes 0.000 description 1
- 102300022327 Septin-9 isoform 5 Human genes 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 101710101462 Serine beta-lactamase-like protein LACTB, mitochondrial Proteins 0.000 description 1
- 101710087362 Serine hydroxymethyltransferase, mitochondrial Proteins 0.000 description 1
- 101710197466 Serine protease 23 Proteins 0.000 description 1
- 101710160140 Serine protease HTRA3 Proteins 0.000 description 1
- 108010030161 Serine-tRNA ligase Proteins 0.000 description 1
- 101710123510 Serine/arginine-rich splicing factor 1 Proteins 0.000 description 1
- 102100029666 Serine/arginine-rich splicing factor 2 Human genes 0.000 description 1
- 102300038104 Serine/arginine-rich splicing factor 2 isoform 2 Human genes 0.000 description 1
- 102100029665 Serine/arginine-rich splicing factor 3 Human genes 0.000 description 1
- 102300038105 Serine/arginine-rich splicing factor 3 isoform 2 Human genes 0.000 description 1
- 101710189648 Serine/threonine-protein phosphatase Proteins 0.000 description 1
- 101710116475 Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Proteins 0.000 description 1
- 101710198351 Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Proteins 0.000 description 1
- 101710150094 Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Proteins 0.000 description 1
- 101710096205 Serine/threonine-protein phosphatase PP1-beta catalytic subunit Proteins 0.000 description 1
- 101710083934 Serpin A3-7 Proteins 0.000 description 1
- 102100036383 Serpin B3 Human genes 0.000 description 1
- 101710156166 Serpin B3 Proteins 0.000 description 1
- 102100027287 Serpin H1 Human genes 0.000 description 1
- 102100027843 Sideroflexin-1 Human genes 0.000 description 1
- 102100024226 Sideroflexin-3 Human genes 0.000 description 1
- 102100036268 Signal peptidase complex catalytic subunit SEC11A Human genes 0.000 description 1
- 102300033701 Signal peptidase complex catalytic subunit SEC11A isoform 3 Human genes 0.000 description 1
- 102000052427 Signal peptidase complex subunit 1 Human genes 0.000 description 1
- 108700038062 Signal peptidase complex subunit 1 Proteins 0.000 description 1
- 102100030313 Signal peptidase complex subunit 1 Human genes 0.000 description 1
- 101710164604 Signal peptidase complex subunit 3 Proteins 0.000 description 1
- 102100026900 Signal recognition particle receptor subunit alpha Human genes 0.000 description 1
- 102300037723 Signal recognition particle receptor subunit alpha isoform 2 Human genes 0.000 description 1
- 102100027318 Signal recognition particle subunit SRP68 Human genes 0.000 description 1
- 102300034949 Signal recognition particle subunit SRP68 isoform 2 Human genes 0.000 description 1
- 101710132566 Signal recognition particle subunit srp68 Proteins 0.000 description 1
- 102100029904 Signal transducer and activator of transcription 1-alpha/beta Human genes 0.000 description 1
- 102100031444 Signal-induced proliferation-associated 1-like protein 1 Human genes 0.000 description 1
- 102100031451 Signal-induced proliferation-associated 1-like protein 2 Human genes 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 101710200105 Single-stranded DNA-binding protein, mitochondrial Proteins 0.000 description 1
- 102000039471 Small Nuclear RNA Human genes 0.000 description 1
- 108010003165 Small Nuclear Ribonucleoproteins Proteins 0.000 description 1
- 102000004598 Small Nuclear Ribonucleoproteins Human genes 0.000 description 1
- 102100038707 Small nuclear ribonucleoprotein Sm D1 Human genes 0.000 description 1
- 102100022775 Small nuclear ribonucleoprotein Sm D3 Human genes 0.000 description 1
- 102300061714 Small nuclear ribonucleoprotein Sm D3 isoform 2 Human genes 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 102100023536 Solute carrier family 2, facilitated glucose transporter member 1 Human genes 0.000 description 1
- 102100035853 Sorting and assembly machinery component 50 homolog Human genes 0.000 description 1
- 102100024807 Sorting nexin-27 Human genes 0.000 description 1
- 101710090563 Spectrin alpha chain Proteins 0.000 description 1
- 102300043897 Spectrin alpha chain, non-erythrocytic 1 isoform 3 Human genes 0.000 description 1
- 102100037613 Spectrin beta chain, erythrocytic Human genes 0.000 description 1
- 102100037612 Spectrin beta chain, non-erythrocytic 1 Human genes 0.000 description 1
- 101710151120 Spermatogenesis-associated serine-rich protein 2 Proteins 0.000 description 1
- 101710122496 Sphingosine-1-phosphate lyase 1 Proteins 0.000 description 1
- 102100024690 Spliceosome RNA helicase DDX39B Human genes 0.000 description 1
- 102300051023 Spliceosome RNA helicase DDX39B isoform 2 Human genes 0.000 description 1
- 101710168341 Splicing factor 3A subunit 1 Proteins 0.000 description 1
- 101710190353 Splicing factor 3B subunit 1 Proteins 0.000 description 1
- 101710190354 Splicing factor 3B subunit 2 Proteins 0.000 description 1
- 101710190372 Splicing factor 3B subunit 4 Proteins 0.000 description 1
- 101710181531 Splicing factor U2AF 26 kDa subunit Proteins 0.000 description 1
- 102100035040 Splicing factor U2AF 65 kDa subunit Human genes 0.000 description 1
- 102300061197 Splicing factor U2AF 65 kDa subunit isoform 2 Human genes 0.000 description 1
- 102100027780 Splicing factor, proline- and glutamine-rich Human genes 0.000 description 1
- 101000836452 Sporidiobolus salmonicolor Aldehyde reductase 1 Proteins 0.000 description 1
- 102100023719 Src substrate cortactin Human genes 0.000 description 1
- 101710171257 Staphylococcal nuclease domain-containing protein 1 Proteins 0.000 description 1
- 102100024237 Stathmin Human genes 0.000 description 1
- 102100021685 Stomatin Human genes 0.000 description 1
- 101710196524 Stomatin-like protein 2, mitochondrial Proteins 0.000 description 1
- 101710111177 Stress-70 protein, mitochondrial Proteins 0.000 description 1
- 102100029538 Structural maintenance of chromosomes protein 1A Human genes 0.000 description 1
- 102100032723 Structural maintenance of chromosomes protein 3 Human genes 0.000 description 1
- 206010049418 Sudden Cardiac Death Diseases 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 102100026344 Supervillin Human genes 0.000 description 1
- 102100026355 Surfeit locus protein 4 Human genes 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 229940100514 Syk tyrosine kinase inhibitor Drugs 0.000 description 1
- 101710110790 Synaptic vesicle membrane protein VAT-1 Proteins 0.000 description 1
- 101710189545 Synaptosomal-associated protein 23 Proteins 0.000 description 1
- 108090000054 Syndecan-2 Proteins 0.000 description 1
- 102000003711 Syndecan-2 Human genes 0.000 description 1
- 102100037219 Syntenin-1 Human genes 0.000 description 1
- 101710085986 T-complex protein 1 subunit beta Proteins 0.000 description 1
- 101710179457 T-complex protein 1 subunit delta Proteins 0.000 description 1
- 101710186197 T-complex protein 1 subunit epsilon Proteins 0.000 description 1
- 101710139556 T-complex protein 1 subunit eta Proteins 0.000 description 1
- 101710136137 T-complex protein 1 subunit gamma Proteins 0.000 description 1
- 101710114584 T-complex protein 1 subunit theta Proteins 0.000 description 1
- 101710147017 T-complex protein 1 subunit zeta Proteins 0.000 description 1
- 101710150875 TAR DNA-binding protein 43 Proteins 0.000 description 1
- 101710107477 TBC1 domain family member 1 Proteins 0.000 description 1
- 101710139420 THO complex subunit 4 Proteins 0.000 description 1
- 102100033082 TNF receptor-associated factor 3 Human genes 0.000 description 1
- 102100034107 TP53-binding protein 1 Human genes 0.000 description 1
- 102300039834 TP53-binding protein 1 isoform 2 Human genes 0.000 description 1
- 101710158845 TRIO and F-actin-binding protein Proteins 0.000 description 1
- 102100036977 Talin-1 Human genes 0.000 description 1
- 102100036980 Talin-2 Human genes 0.000 description 1
- 102100040174 Testis-expressed protein 10 Human genes 0.000 description 1
- 102300052696 Testis-expressed protein 10 isoform 2 Human genes 0.000 description 1
- 101710143208 Thioredoxin reductase 1, cytoplasmic Proteins 0.000 description 1
- 101710169525 Threonine-tRNA ligase 1, cytoplasmic Proteins 0.000 description 1
- 101710098226 Threonine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 102000002938 Thrombospondin Human genes 0.000 description 1
- 108060008245 Thrombospondin Proteins 0.000 description 1
- 108010046722 Thrombospondin 1 Proteins 0.000 description 1
- 101710136118 Thrombospondin type-1 domain-containing protein 4 Proteins 0.000 description 1
- 101710094130 Thy-1 membrane glycoprotein Proteins 0.000 description 1
- 108050009589 Thyroid hormone receptor-associated protein 3 Proteins 0.000 description 1
- 108050001370 Tight junction protein ZO-1 Proteins 0.000 description 1
- 108050001368 Tight junction protein ZO-2 Proteins 0.000 description 1
- 102100026134 Tissue factor pathway inhibitor 2 Human genes 0.000 description 1
- 102300036986 Tissue factor pathway inhibitor 2 isoform 2 Human genes 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 102100022147 Torsin-1A-interacting protein 1 Human genes 0.000 description 1
- 108020004530 Transaldolase Proteins 0.000 description 1
- 101710106416 Transcription factor A, mitochondrial Proteins 0.000 description 1
- 108700037027 Transcription factor SOX-3 Proteins 0.000 description 1
- 102100022012 Transcription intermediary factor 1-beta Human genes 0.000 description 1
- 101710177718 Transcription intermediary factor 1-beta Proteins 0.000 description 1
- 102000004338 Transferrin Human genes 0.000 description 1
- 108090000901 Transferrin Proteins 0.000 description 1
- 108090001012 Transforming Growth Factor beta Proteins 0.000 description 1
- 102000004887 Transforming Growth Factor beta Human genes 0.000 description 1
- 102100030737 Transforming growth factor beta-2 proprotein Human genes 0.000 description 1
- 108050009436 Transforming growth factor beta-2 proproteins Proteins 0.000 description 1
- 102100021398 Transforming growth factor-beta-induced protein ig-h3 Human genes 0.000 description 1
- 101710124052 Transforming protein RhoA Proteins 0.000 description 1
- 108090000333 Transgelin Proteins 0.000 description 1
- 102100031016 Transgelin-2 Human genes 0.000 description 1
- 102300058710 Transgelin-2 isoform 2 Human genes 0.000 description 1
- 102100026145 Transitional endoplasmic reticulum ATPase Human genes 0.000 description 1
- 101710132062 Transitional endoplasmic reticulum ATPase Proteins 0.000 description 1
- 102100033055 Transketolase Human genes 0.000 description 1
- 102300039762 Transketolase isoform 2 Human genes 0.000 description 1
- 102100029887 Translationally-controlled tumor protein Human genes 0.000 description 1
- 102100027965 Translocating chain-associated membrane protein 1 Human genes 0.000 description 1
- 102300061516 Translocating chain-associated membrane protein 1 isoform 2 Human genes 0.000 description 1
- 108050000091 Translocator proteins Proteins 0.000 description 1
- 101710112880 Translocon-associated protein subunit alpha Proteins 0.000 description 1
- 101710203523 Translocon-associated protein subunit delta Proteins 0.000 description 1
- 101710188425 Transmembrane emp24 domain-containing protein 10 Proteins 0.000 description 1
- 101710093811 Transmembrane emp24 domain-containing protein 9 Proteins 0.000 description 1
- 101710106890 Transmembrane protein 43 Proteins 0.000 description 1
- 102100028746 Transportin-3 Human genes 0.000 description 1
- 102300058557 Transportin-3 isoform 3 Human genes 0.000 description 1
- 102100027172 Transposon Hsmar1 transposase Human genes 0.000 description 1
- 102100040421 Treacle protein Human genes 0.000 description 1
- 102300052677 Treacle protein isoform 6 Human genes 0.000 description 1
- 101710128947 Tricarboxylate transport protein, mitochondrial Proteins 0.000 description 1
- 108700015934 Triose-phosphate isomerases Proteins 0.000 description 1
- 108050000002 Tropomodulin-3 Proteins 0.000 description 1
- 102300063587 Tropomyosin alpha-1 chain isoform 3 Human genes 0.000 description 1
- 101710091952 Tropomyosin alpha-3 chain Proteins 0.000 description 1
- 102300063773 Tropomyosin alpha-3 chain isoform 2 Human genes 0.000 description 1
- 101710193115 Tropomyosin alpha-4 chain Proteins 0.000 description 1
- 102100036471 Tropomyosin beta chain Human genes 0.000 description 1
- 102300063760 Tropomyosin beta chain isoform 2 Human genes 0.000 description 1
- 102000013394 Troponin I Human genes 0.000 description 1
- 108010065729 Troponin I Proteins 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 101710175382 Tryptophan-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 102100029294 Tubby-related protein 2 Human genes 0.000 description 1
- 102100028968 Tubulin alpha-1A chain Human genes 0.000 description 1
- 102300063884 Tubulin alpha-1A chain isoform 2 Human genes 0.000 description 1
- 101710112367 Tubulin alpha-1B chain Proteins 0.000 description 1
- 101710106373 Tubulin alpha-1C chain Proteins 0.000 description 1
- 101710117197 Tubulin alpha-4A chain Proteins 0.000 description 1
- 102100024717 Tubulin beta chain Human genes 0.000 description 1
- 101710201428 Tubulin beta chain Proteins 0.000 description 1
- 101710125725 Tubulin beta-2A chain Proteins 0.000 description 1
- 101710202239 Tubulin beta-3 chain Proteins 0.000 description 1
- 101710153628 Tubulin beta-4A chain Proteins 0.000 description 1
- 101710161045 Tubulin beta-4B chain Proteins 0.000 description 1
- 101710085358 Tubulin beta-6 chain Proteins 0.000 description 1
- 101710159742 Tubulointerstitial nephritis antigen-like Proteins 0.000 description 1
- 108010041385 Tumor Suppressor p53-Binding Protein 1 Proteins 0.000 description 1
- 102100036223 Twinfilin-1 Human genes 0.000 description 1
- 108010046308 Type II DNA Topoisomerases Proteins 0.000 description 1
- 102100021788 Tyrosine-protein kinase Yes Human genes 0.000 description 1
- 102000018378 Tyrosine-tRNA ligase Human genes 0.000 description 1
- 101710140931 Tyrosine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 108700024145 Tyrosine-tRNA ligases Proteins 0.000 description 1
- 102100024121 U1 small nuclear ribonucleoprotein 70 kDa Human genes 0.000 description 1
- 102300042495 U1 small nuclear ribonucleoprotein 70 kDa isoform 2 Human genes 0.000 description 1
- 101710106597 U1 small nuclear ribonucleoprotein A Proteins 0.000 description 1
- 101710123035 U2 small nuclear ribonucleoprotein A' Proteins 0.000 description 1
- 102100040099 U3 small nucleolar RNA-associated protein 14 homolog A Human genes 0.000 description 1
- 102100027244 U4/U6.U5 tri-snRNP-associated protein 1 Human genes 0.000 description 1
- 101710119213 U5 small nuclear ribonucleoprotein 200 kDa helicase Proteins 0.000 description 1
- 101710099003 UAP56-interacting factor Proteins 0.000 description 1
- 102000003442 UBR4 Human genes 0.000 description 1
- 108030001662 UDP-glucose 6-dehydrogenases Proteins 0.000 description 1
- 108010082433 UDP-glucose-hexose-1-phosphate uridylyltransferase Proteins 0.000 description 1
- 102100040363 UDP-glucose:glycoprotein glucosyltransferase 1 Human genes 0.000 description 1
- 102300064817 UDP-glucose:glycoprotein glucosyltransferase 1 isoform 2 Human genes 0.000 description 1
- 102100040198 UDP-glucuronosyltransferase 1-6 Human genes 0.000 description 1
- 102300061448 UDP-glucuronosyltransferase 1-6 isoform 2 Human genes 0.000 description 1
- 101710008381 UGT1A6 Proteins 0.000 description 1
- 102100038834 UTP-glucose-1-phosphate uridylyltransferase Human genes 0.000 description 1
- 102100020779 UV excision repair protein RAD23 homolog B Human genes 0.000 description 1
- 108010005656 Ubiquitin Thiolesterase Proteins 0.000 description 1
- 102000005918 Ubiquitin Thiolesterase Human genes 0.000 description 1
- 101710091123 Ubiquitin carboxyl-terminal hydrolase 24 Proteins 0.000 description 1
- 108050001601 Ubiquitin thioesterase OTUB1 Proteins 0.000 description 1
- 101710087921 Ubiquitin-40S ribosomal protein S27a Proteins 0.000 description 1
- 102100029817 Ubiquitin-associated protein 2-like Human genes 0.000 description 1
- 102300063496 Ubiquitin-associated protein 2-like isoform 3 Human genes 0.000 description 1
- 102100037160 Ubiquitin-like modifier-activating enzyme 1 Human genes 0.000 description 1
- 102300038915 Ubiquitin-like modifier-activating enzyme 1 isoform 2 Human genes 0.000 description 1
- 102100026776 Unconventional myosin-Ib Human genes 0.000 description 1
- 102300057749 Unconventional myosin-Ib isoform 2 Human genes 0.000 description 1
- 102300057851 Unconventional myosin-Ic isoform 3 Human genes 0.000 description 1
- 101710135392 Unconventional myosin-Ie Proteins 0.000 description 1
- 101710135144 Unconventional myosin-VI Proteins 0.000 description 1
- 101710135185 Unconventional myosin-XV Proteins 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 102100037979 V-type proton ATPase 116 kDa subunit a 1 Human genes 0.000 description 1
- 102100020738 V-type proton ATPase 116 kDa subunit a 3 Human genes 0.000 description 1
- 102100037466 V-type proton ATPase catalytic subunit A Human genes 0.000 description 1
- 101710179573 V-type proton ATPase catalytic subunit A isoform 2 Proteins 0.000 description 1
- 102300062790 V-type proton ATPase catalytic subunit A isoform 2 Human genes 0.000 description 1
- 101710127339 V-type proton ATPase subunit B, brain isoform Proteins 0.000 description 1
- 101710192368 V-type proton ATPase subunit d1 Proteins 0.000 description 1
- 102100038398 Vacuolar protein sorting-associated protein 26A Human genes 0.000 description 1
- 102100020822 Vacuolar protein sorting-associated protein 35 Human genes 0.000 description 1
- 108700015935 Valine-tRNA ligases Proteins 0.000 description 1
- 101710200894 Versican core protein Proteins 0.000 description 1
- 102100031041 Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Human genes 0.000 description 1
- 101710141117 Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Proteins 0.000 description 1
- 108030006062 Very-long-chain 3-oxoacyl-CoA reductases Proteins 0.000 description 1
- 102100030747 Very-long-chain enoyl-CoA reductase Human genes 0.000 description 1
- 102100028641 Vesicle-associated membrane protein-associated protein A Human genes 0.000 description 1
- 102300045816 Vesicle-associated membrane protein-associated protein A isoform 2 Human genes 0.000 description 1
- 101710194274 Vesicle-trafficking protein SEC22b Proteins 0.000 description 1
- 102100023486 Vinculin Human genes 0.000 description 1
- 102300041331 Vinculin isoform 1 Human genes 0.000 description 1
- 102100038611 Vitamin D-binding protein Human genes 0.000 description 1
- 101710179590 Vitamin D-binding protein Proteins 0.000 description 1
- 102100035140 Vitronectin Human genes 0.000 description 1
- 108010031318 Vitronectin Proteins 0.000 description 1
- 108010022133 Voltage-Dependent Anion Channel 1 Proteins 0.000 description 1
- 108010022109 Voltage-Dependent Anion Channel 2 Proteins 0.000 description 1
- 108050001627 Voltage-dependent anion-selective channel protein 1 Proteins 0.000 description 1
- 102100037803 Voltage-dependent anion-selective channel protein 2 Human genes 0.000 description 1
- 102300062644 Voltage-dependent anion-selective channel protein 2 isoform 1 Human genes 0.000 description 1
- 102100033099 Voltage-dependent anion-selective channel protein 3 Human genes 0.000 description 1
- 102300040056 Voltage-dependent anion-selective channel protein 3 isoform 2 Human genes 0.000 description 1
- 102100037059 Voltage-dependent calcium channel subunit alpha-2/delta-1 Human genes 0.000 description 1
- 102300046850 Voltage-dependent calcium channel subunit alpha-2/delta-1 isoform 2 Human genes 0.000 description 1
- 102100037107 WASH complex subunit 2C Human genes 0.000 description 1
- 102300063684 WASH complex subunit 2C isoform 4 Human genes 0.000 description 1
- 101710083179 WD repeat-containing protein 1 Proteins 0.000 description 1
- 101710093149 WD repeat-containing protein 61 Proteins 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 101150094313 XPO1 gene Proteins 0.000 description 1
- 101100445056 Xenopus laevis elavl1-a gene Proteins 0.000 description 1
- 101100445057 Xenopus laevis elavl1-b gene Proteins 0.000 description 1
- 108010048626 Y-Box-Binding Protein 1 Proteins 0.000 description 1
- 102100022224 Y-box-binding protein 1 Human genes 0.000 description 1
- 102100022221 Y-box-binding protein 3 Human genes 0.000 description 1
- 102000033021 YBX1 Human genes 0.000 description 1
- 108091002437 YBX1 Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 102100039968 Zinc finger homeobox protein 4 Human genes 0.000 description 1
- 101710143702 Zinc finger protein 469 Proteins 0.000 description 1
- ZUPXXZAVUHFCNV-UHFFFAOYSA-N [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-(3-carbamoyl-4h-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;potassium Chemical compound [K].C1=CCC(C(=O)N)=CN1C1C(O)C(O)C(COP(O)(=O)OP(O)(=O)OCC2C(C(O)C(O2)N2C3=NC=NC(N)=C3N=C2)O)O1 ZUPXXZAVUHFCNV-UHFFFAOYSA-N 0.000 description 1
- 102000034337 acetylcholine receptors Human genes 0.000 description 1
- 102000005421 acetyltransferase Human genes 0.000 description 1
- 108020002494 acetyltransferase Proteins 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 108010029483 alpha 1 Chain Collagen Type I Proteins 0.000 description 1
- 102000015395 alpha 1-Antitrypsin Human genes 0.000 description 1
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 description 1
- 108010075843 alpha-2-HS-Glycoprotein Proteins 0.000 description 1
- 102000012005 alpha-2-HS-Glycoprotein Human genes 0.000 description 1
- 108010026331 alpha-Fetoproteins Proteins 0.000 description 1
- 102000013529 alpha-Fetoproteins Human genes 0.000 description 1
- 108010028144 alpha-Glucosidases Proteins 0.000 description 1
- APKFDSVGJQXUKY-INPOYWNPSA-N amphotericin B Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 APKFDSVGJQXUKY-INPOYWNPSA-N 0.000 description 1
- 229960003942 amphotericin b Drugs 0.000 description 1
- 210000003484 anatomy Anatomy 0.000 description 1
- CLRLXEFRRVACNF-UHFFFAOYSA-N ancistrocladisine Natural products COc1cc2CC(C)N=C(C)c2c(OC)c1c3c(O)cc(OC)c4c(OC)cccc34 CLRLXEFRRVACNF-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 229960005348 antithrombin iii Drugs 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000000089 atomic force micrograph Methods 0.000 description 1
- 238000004630 atomic force microscopy Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- 108010005774 beta-Galactosidase Proteins 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000003592 biomimetic effect Effects 0.000 description 1
- 230000033558 biomineral tissue development Effects 0.000 description 1
- 210000004271 bone marrow stromal cell Anatomy 0.000 description 1
- 229940053031 botulinum toxin Drugs 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 102100021204 cAMP-dependent protein kinase type II-alpha regulatory subunit Human genes 0.000 description 1
- 102300055540 cAMP-dependent protein kinase type II-alpha regulatory subunit isoform 2 Human genes 0.000 description 1
- 108010051348 cdc42 GTP-Binding Protein Proteins 0.000 description 1
- 239000006143 cell culture medium Substances 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 108010022011 centractin Proteins 0.000 description 1
- 150000005829 chemical entities Chemical class 0.000 description 1
- 102000014907 clathrin heavy chain Human genes 0.000 description 1
- 108060001643 clathrin heavy chain Proteins 0.000 description 1
- 230000003081 coactivator Effects 0.000 description 1
- 235000017471 coenzyme Q10 Nutrition 0.000 description 1
- ACTIUHUUMQJHFO-UPTCCGCDSA-N coenzyme Q10 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UPTCCGCDSA-N 0.000 description 1
- 210000003092 coiled body Anatomy 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 229940104302 cytosine Drugs 0.000 description 1
- 230000003436 cytoskeletal effect Effects 0.000 description 1
- 231100000135 cytotoxicity Toxicity 0.000 description 1
- 230000003013 cytotoxicity Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 101150077768 ddb1 gene Proteins 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 108010031971 delta catenin Proteins 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 101710157028 eIF-2-alpha kinase activator GCN1 Proteins 0.000 description 1
- 101150093313 eIF3c gene Proteins 0.000 description 1
- 101710123723 eIF5-mimic protein 2 Proteins 0.000 description 1
- 101150112638 eif3b gene Proteins 0.000 description 1
- 101150001367 eif3d gene Proteins 0.000 description 1
- 101150081549 eif3f gene Proteins 0.000 description 1
- 108010022937 endoplasmin Proteins 0.000 description 1
- 230000003511 endothelial effect Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 108010005324 enkephalin degrading enzyme Proteins 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- VLMZMRDOMOGGFA-WDBKCZKBSA-N festuclavine Chemical compound C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C)=C3C2=CNC3=C1 VLMZMRDOMOGGFA-WDBKCZKBSA-N 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 108010022790 formyl-methenyl-methylenetetrahydrofolate synthetase Proteins 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 229950010772 glucose-1-phosphate Drugs 0.000 description 1
- 229960002743 glutamine Drugs 0.000 description 1
- 108010086596 glutathione peroxidase GPX1 Proteins 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 210000002064 heart cell Anatomy 0.000 description 1
- 230000004217 heart function Effects 0.000 description 1
- 108010092427 high density lipoprotein binding protein Proteins 0.000 description 1
- 230000007954 hypoxia Effects 0.000 description 1
- 230000001146 hypoxic effect Effects 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 238000011532 immunohistochemical staining Methods 0.000 description 1
- 238000002847 impedance measurement Methods 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 238000010874 in vitro model Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 108010093564 inter-alpha-inhibitor Proteins 0.000 description 1
- 230000008611 intercellular interaction Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 108010052263 lamin B1 Proteins 0.000 description 1
- 108010090909 laminin gamma 1 Proteins 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 210000004901 leucine-rich repeat Anatomy 0.000 description 1
- FCCDDURTIIUXBY-UHFFFAOYSA-N lipoamide Chemical compound NC(=O)CCCCC1CCSS1 FCCDDURTIIUXBY-UHFFFAOYSA-N 0.000 description 1
- 230000002934 lysing effect Effects 0.000 description 1
- 238000002826 magnetic-activated cell sorting Methods 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 238000000386 microscopy Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- IKEOZQLIVHGQLJ-UHFFFAOYSA-M mitoTracker Red Chemical compound [Cl-].C1=CC(CCl)=CC=C1C(C1=CC=2CCCN3CCCC(C=23)=C1O1)=C2C1=C(CCC1)C3=[N+]1CCCC3=C2 IKEOZQLIVHGQLJ-UHFFFAOYSA-M 0.000 description 1
- 210000000479 mitotic spindle apparatus Anatomy 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 108010071525 moesin Proteins 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 210000002161 motor neuron Anatomy 0.000 description 1
- 108010049787 myosin VI Proteins 0.000 description 1
- NJHLGKJQFKUSEA-UHFFFAOYSA-N n-[2-(4-hydroxyphenyl)ethyl]-n-methylnitrous amide Chemical compound O=NN(C)CCC1=CC=C(O)C=C1 NJHLGKJQFKUSEA-UHFFFAOYSA-N 0.000 description 1
- 210000005055 nestin Anatomy 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- JOUIQRNQJGXQDC-ZYUZMQFOSA-L nicotinate D-ribonucleotide(2-) Chemical compound O1[C@H](COP([O-])([O-])=O)[C@@H](O)[C@@H](O)[C@@H]1[N+]1=CC=CC(C([O-])=O)=C1 JOUIQRNQJGXQDC-ZYUZMQFOSA-L 0.000 description 1
- 108010008217 nidogen Proteins 0.000 description 1
- 108010044762 nucleolin Proteins 0.000 description 1
- 108010067588 nucleotide pyrophosphatase Proteins 0.000 description 1
- 229920001542 oligosaccharide Polymers 0.000 description 1
- 102000027450 oncoproteins Human genes 0.000 description 1
- 108091008819 oncoproteins Proteins 0.000 description 1
- 238000000399 optical microscopy Methods 0.000 description 1
- 210000000963 osteoblast Anatomy 0.000 description 1
- 230000002188 osteogenic effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 108010044156 peptidyl-prolyl cis-trans isomerase b Proteins 0.000 description 1
- 108010003218 periaxin Proteins 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 108010035774 phosphoribosylaminoimidazole carboxylase Proteins 0.000 description 1
- 102000030592 phosphoserine aminotransferase Human genes 0.000 description 1
- 108010088694 phosphoserine aminotransferase Proteins 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 210000005152 placental membrane Anatomy 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 230000003334 potential effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 102000016670 prohibitin Human genes 0.000 description 1
- 108010028138 prohibitin Proteins 0.000 description 1
- 108010031970 prostasin Proteins 0.000 description 1
- 108010043671 prostatic acid phosphatase Proteins 0.000 description 1
- 230000025220 protein targeting to vacuole Effects 0.000 description 1
- 101710134316 rRNA 2'-O-methyltransferase fibrillarin Proteins 0.000 description 1
- 108010054067 rab1 GTP-Binding Proteins Proteins 0.000 description 1
- 108010062302 rac1 GTP Binding Protein Proteins 0.000 description 1
- 108010087304 ral GTP-Binding Proteins Proteins 0.000 description 1
- 102000006688 ral GTP-Binding Proteins Human genes 0.000 description 1
- 238000011536 re-plating Methods 0.000 description 1
- NPCOQXAVBJJZBQ-UHFFFAOYSA-N reduced coenzyme Q9 Natural products COC1=C(O)C(C)=C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(O)=C1OC NPCOQXAVBJJZBQ-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 239000003161 ribonuclease inhibitor Substances 0.000 description 1
- 108020004418 ribosomal RNA Proteins 0.000 description 1
- 108010008790 ribosomal phosphoprotein P1 Proteins 0.000 description 1
- 108010055738 ribosomal phosphoprotein P2 Proteins 0.000 description 1
- 108010034467 ribosomal protein P0 Proteins 0.000 description 1
- 102000004314 ribosomal protein S14 Human genes 0.000 description 1
- 108090000850 ribosomal protein S14 Proteins 0.000 description 1
- 101150033305 rtcB gene Proteins 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 108091029842 small nuclear ribonucleic acid Proteins 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 210000001057 smooth muscle myoblast Anatomy 0.000 description 1
- 101150083938 snrnp70 gene Proteins 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- PFNFFQXMRSDOHW-UHFFFAOYSA-N spermine Chemical compound NCCCNCCCCNCCCN PFNFFQXMRSDOHW-UHFFFAOYSA-N 0.000 description 1
- 238000012430 stability testing Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 101150075118 sub1 gene Proteins 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 230000000946 synaptic effect Effects 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 108010058826 tRNA splicing ligase Proteins 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- 108010077917 tau-tubulin kinase Proteins 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 108010013500 transcription factor BTF3 Proteins 0.000 description 1
- 108091006106 transcriptional activators Proteins 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 239000012581 transferrin Substances 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 229940035936 ubiquinone Drugs 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 210000002229 urogenital system Anatomy 0.000 description 1
- 210000003934 vacuole Anatomy 0.000 description 1
- 238000007794 visualization technique Methods 0.000 description 1
- 230000002747 voluntary effect Effects 0.000 description 1
- 108010047303 von Willebrand Factor Proteins 0.000 description 1
- 102100036537 von Willebrand factor Human genes 0.000 description 1
- 102100039759 von Willebrand factor A domain-containing protein 1 Human genes 0.000 description 1
- 229960001134 von willebrand factor Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N5/00—Undifferentiated human, animal or plant cells, e.g. cell lines; Tissues; Cultivation or maintenance thereof; Culture media therefor
- C12N5/06—Animal cells or tissues; Human cells or tissues
- C12N5/0602—Vertebrate cells
- C12N5/0652—Cells of skeletal and connective tissues; Mesenchyme
- C12N5/0657—Cardiomyocytes; Heart cells
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N33/00—Investigating or analysing materials by specific methods not covered by groups G01N1/00 - G01N31/00
- G01N33/48—Biological material, e.g. blood, urine; Haemocytometers
- G01N33/50—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing
- G01N33/5005—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing involving human or animal cells
- G01N33/5008—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing involving human or animal cells for testing or evaluating the effect of chemical or biological compounds, e.g. drugs, cosmetics
- G01N33/5044—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing involving human or animal cells for testing or evaluating the effect of chemical or biological compounds, e.g. drugs, cosmetics involving specific cell types
- G01N33/5061—Muscle cells
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2503/00—Use of cells in diagnostics
- C12N2503/02—Drug screening
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2506/00—Differentiation of animal cells from one lineage to another; Differentiation of pluripotent cells
- C12N2506/45—Differentiation of animal cells from one lineage to another; Differentiation of pluripotent cells from artificially induced pluripotent stem cells
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2533/00—Supports or coatings for cell culture, characterised by material
- C12N2533/50—Proteins
- C12N2533/52—Fibronectin; Laminin
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2533/00—Supports or coatings for cell culture, characterised by material
- C12N2533/50—Proteins
- C12N2533/54—Collagen; Gelatin
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2533/00—Supports or coatings for cell culture, characterised by material
- C12N2533/90—Substrates of biological origin, e.g. extracellular matrix, decellularised tissue
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2533/00—Supports or coatings for cell culture, characterised by material
- C12N2533/90—Substrates of biological origin, e.g. extracellular matrix, decellularised tissue
- C12N2533/92—Amnion; Decellularised dermis or mucosa
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Chemical & Material Sciences (AREA)
- Cell Biology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biotechnology (AREA)
- Immunology (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- General Health & Medical Sciences (AREA)
- Microbiology (AREA)
- Biochemistry (AREA)
- Hematology (AREA)
- Urology & Nephrology (AREA)
- Molecular Biology (AREA)
- General Engineering & Computer Science (AREA)
- Cardiology (AREA)
- Rheumatology (AREA)
- Tropical Medicine & Parasitology (AREA)
- Pathology (AREA)
- General Physics & Mathematics (AREA)
- Analytical Chemistry (AREA)
- Physics & Mathematics (AREA)
- Medicinal Chemistry (AREA)
- Food Science & Technology (AREA)
- Toxicology (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Apparatus Associated With Microorganisms And Enzymes (AREA)
Abstract
성숙 심근세포를 형성하기 위하여 배양에서 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)의 성숙을 위하여 양수로부터 분리된 세포로부터 인-비트로 유래된 세포-유래 세포외 기질(AFC-ECM)을 이용하는 방법이 본원에 개시된다. 약물 화합물의 심장 독성 및/또는 전부정맥 스크리닝 애새이에 유용한 AFC-ECM 상의 이러한 성숙 심근세포의 단일층을 포함하는 세포 구조 또한 본원에 개시된다. 이러한 세포 구조를 이용하여 약물 화합물의 심장 독성 및/또는 전부정맥 효과를 인 비트로 결정하는 방법 또한 본원에 개시된다.
Description
본 출원은 2019년 2월 21일 출원된 미국 가특허출원 62/808,690의 이익을 주장하며, 전체로서 본원에 참조로 포함된다.
본 개시는 일반적으로 세포-유래된 세포외 기질(cell-derived extracellular matrix) 상에서 인간 줄기 세포(human stem cell)로부터 유래된 심근세포(cardiomyocyte)의 세포 구조의 용도, 상기 구조의 제작 방법 및 상기 구조를 이용하여 약물 화합물의 심장 독성(cardiotoxicity) 및 전부정맥(proarrhythmic) 스크리닝(screening) 애새이(assay) 방법에 관한 것이다.
심장 독성, 또는 심장 독성으로 잠재적으로 인지될 수 있는 것은 새로운 약의 조사 및 선택 과정에서 독성 관련 약물 소모의 주된 원인이다. 선도 약물 후보가 되기 위한 새로운 화학적 엔티티(entity)의 심장 안정 테스트는 약물 발견 및 개발 파이프라인(pipeline)의 중요한 측면이다. 심장 및 비심장 약물의 많은 심장 부작용은 하나 또는 그 초과의 심장 이온 채널과 약물의 상호작용으로 인해 발생한다. 심장 이온 채널은 세포의 흥분성(excitability), 수축성(contractility) 및 전체적인 심장 기능을 조절하며, 심장 이온 채널 기능의 변경은 심장 돌연사로 이어질 수 있다. 이는 International Conference on Harmonization(ICH)에서 약물 후보 테스트 가이드라인을 발행하는데 기여했다.
IHC(ICH S7A 및 S7B-약리학 연구)의 현재 전임상(preclinical) 약물 후보 테스트 가이드라인은 유전적으로 변형된 이종 조직(heterologous) 세포 및 인 비보(in vivo) 동물 모델에 의존한다. hERG 애새이 또는 QT 연장 연구(QT prolongation studies)와 같은 이러한 연구는 인간에 대한 심장 독성 및 전부정맥 위험을 정확하게 예측하지 못한다는 것이 점차 인식되어 왔다. 2005년 이래로, 약물 화합물의 심장 안정성은 거의 전적으로 그것의 효과 또는 심전도(electrocardiogram; ECG)의 QT 간격 또는 활동 전위 지속 시간(action potential duration; APD)에 대한 잠재적 효과 및 Torsades de Pointes(TdP)라고 불리는 생명을 위협하는 부정맥을 유발하는 잠재성에 의해 결정되어 왔다. 그러나, QT를 연장하는 약물들이 언제나 TdP를 유발하는 것이 아니므로, QT 연장은 TdP의 이상적인 지표가 아니다. 이제는 QT 연장 파라미터(parameter)는 전부정맥(proarrhythmia)에 대한 대리 표지자(surrogate marker)에 불과하다는 것이 인식되었다. 전임상 및 임상 실험으로부터의 데이터는 QT 연장의 정도와 TdP와 같은 치명적인 부정맥의 발전 위험 사이에는 고정된 관계가 없다는 것을 보여주었다.
따라서, 미국 식품 의약국(Food and Drug Administration; FDA) 및 약물 발견에 관한 다른 이해당사자들은 전임상에서의 심장 독성 테스트에 관한 진화를 요구해왔다. 제안된 새로운 패러다임은 Comprehensive In-Vitro Proarrhythmia Assay(CiPA)라고 불린다. CiPA 이니셔티브(CiPA Initiative; http://cipaproject.org/)의 통합 부분에는 심장 독성 및 전부정맥 애새이를 위해 인간 줄기 세포 유래 심근세포로부터 수집된 데이터의 통합이 포함된다. 이러한 새로운 제안된 가이드라인의 전반적인 목적은 새로운 약물의 위험을 더욱 정확하게 평가할 수 있는 더 정확하고 포괄적인 기계 기반 전부정맥 잠재성 평가법을 제공하는 것이다. 제안된 CiPA 이니셔티브의 가이드라인을 검토하면서 FDA는 인간 심근세포가 새로운 이니셔티브에 통합될 수 있기 전에 이루어져야 할 두 가지 진보를 정의했다. 첫째, 인간 줄기 세포 유래 심근세포의 성장 및 성숙 상태는 성체 인간 심근세포의 구조 및 기능과 더욱 근접하게 유사하도록 진보될 필요가 있다. 둘째, 이러한 세포를 이용하는 신뢰할만한 고처리량(high throughput) 스크리닝 플랫폼(screening platform)이 개발되어야 한다.
일반적으로 인 비트로(in vitro) 심근세포의 전기 생리학(electrophysiology)을 평가하기 위해 현재 사용되는 시스템에는 세가지 유형이 있다: 1) 패치 클램핑 시스템(Patch clamping system); 2) 마이크로-전극 어래이(micro-electrode array; MEA) 시스템; 3) 전압 민감성 염료(voltage sensitive dye; VSD) 가시화 방법. 수동 패치 클램핑 시스템은 각각의 세포의 전기 생리학을 평가하기 위한 매우 초기의 연구에서 가장 일반적으로 이용된다. 이 장치들은 정확하고 민감한 이온 전류 측정을 제공함에도 불구하고, 심장 조직의 세포-세포 상호작용을 더욱 가깝게 모방하는 인 비트로 세포 시스템에 사용될 수 없다. MEA 시스템은 세포 배양 웰(well)을 가로지르는 전류의 측정을 가능하게 하는 상기 세포 배양 웰에 통합된 전극이 포함되어 있다. 인 비트로 세포 시스템에서 높은 처리량 분석 및 임피던스 측정 능력을 제공함에도 불구하고, 이러한 시스템은 낮은 공간 해상도를 제공하여 활동 전위 모양에 대한 데이터를 제공할 수 없고 세포의 직접적인 시각화나 심장 조직 아키텍쳐(architecture)를 더욱 가깝게 모방하는 3-D 배양 시스템의 평가 능력을 저해한다. VSD 시스템은 다음과 같은 기능을 포함하여 상기 기재된 현재 기술의 많은 단점을 해결하여 관심을 얻고 있다: 1) 높은 처리량 분석을 허용; 2) 높은 공간 해상도를 제공; 3) 배양 접시를 가로지르는 임펄스 전파(impulse propagation)의 시각화를 허용; 및 4) 더욱 자연스러운 테스트 환경을 유도하는 세포외 기질의 첨가를 포함하는 배양 조건 변경을 허용.
유도만능줄기세포와 같은 인간 줄기 세포로부터 유래한 심근세포의 사용은 현재까지 심장 독성 및 전부정맥 애새이 스크리닝에 있어서 제한된 성공만을 해왔다. 유도만능줄기세포로부터 유래한 심근세포(Cardiomyocytes derived from induced human pluripotent stem cells; hiPSC-CMs)는 상업적으로 이용 가능하며, 여러 회사로부터 해동(thaw) 및 단일층(monolayer)으로 단층(plate)될 수 있는 냉동보존된(cryopreserved) 바이알로 구매할 수 있다. 이러한 hiPSC-CM은 인 비트로 대규모로 만들 수 있다. 또한, hiPSC-CM는 특정 개인을 위해 환자별 hiPSC로부터 얻을 수 있다. 그러나, hiPSC-CM를 상기 새로운 CiPA 이니셔티브 패러다임의 의미있는 부분으로 만들기 위해서 여전히 극복해야 할 장애물들이 있다. 1) hiPSC-CM 구조와 기능의 성숙이 진보되어야 한다. 특히, Kir2.1 포타슘 채널(Kir2.1 potassium channel)은 현재 사용 가능한 hiPSC-CM에는 존재하지 않으며, 소듐 채널(sodium channel)의 발현(expression)은 낮다. 현재 가능한 hiPSC-CM은 기능적 및 구조적으로 매우 미성숙하다. 현재 사용되는 hiPSC-CM 기반 전부정맥 스크리닝 애새이의 대다수는 성체 심근세포의 기능의 구조와 유사하지 않은 미성숙하고, 태아-유사(fetal-like) 세포에 의존한다. 2) 고처리량 전기 생리학적 플랫폼에서의 hiPSC-CM 단일층의 전기적 페이싱이 필요하다. 현재 hiPSC-CM 기반 전부정맥 스크린의 대다수는 TdP 유도를 위한 대리 표지자로서 필드 전위 지속 시간(field potential duration, MEA 기술) 또는 활동 전위 지속 시간 연장(action potential duration prolongation, VSD 기술)에 전적으로 의존한다. 이것은 모든 활동 전위(QT 간격)을 연장하는 모든 약물이 치명적인 TdP 부정맥을 유발하지는 않으므로 한계가 있다. 비록 미성숙 hiPSC-CM의 특정 성숙 상태가 배양에 있어서 Matrigel™ ECM 및 본-매로우 세포-유도 ECM(bone-marrow cell-derived ECM)을 사용하여 달성되었지만, 전부정맥 스크리닝 애새이에서 이러한 hiPSC-CM의 사용은 특히 저위험 약물과 고위험 약물 사이에서 인간의 TdP 사례에서 발생하는 것으로 알려진 것과 일치하는 부정맥 활성화 패턴의 관찰에서 일관된 결과를 생성하지 못했다.
따라서, 새로운 약물 후보의 정확하고, 신뢰성 있으며 효율적인 개발을 위한 약물 화합물의 심장 안전성 책임(liability)의 정확한 평가 및 스크리닝을 위한 개선된 물질 및 새로운 방법이 필요하다.
본 개시는 약물 후보의 심장 안전성 책임의 평가 및 스크리닝과 관련된 기술 분야에서 전술한 한계 및 결점 중 적어도 일부에 대한 해결책을 제공한다. 상기 솔루션은 인간 줄기 세포 유래 심근세포의 성숙에 이용될 수 있는 양수로부터 분리된 세포로부터 유래된 세포외 기질(extracellular matrix derived from cells isolated from amniotic fluid; AFC-ECM)의 발견을 전제로 한다. 그렇다면 이러한 성숙 심근세포는 약물의 심장 독성 및 전부정맥 테스트를 위한 AFC-ECM과 함께 세포 구조에 사용될 수 있다.
일 측면에서, 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포의 성술을 위한 방법이 개시되며, 상기 방법은: (a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)을 제공하는 것; (b) 양수(amniotic fluid)로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 미성숙 hiPSC-CM을 상기 AFC-ECM와 접촉하는 것; 및 (d) 상기 미성숙 hiPSC-CM의 성숙을 유도하도록 상기 미성숙 hiPSC-CM를 상기 AFC-ECM와 배양 배지(culture media)에서 배양함으로써 성숙 심근세포를 형성하는 것;을 포함하고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절(sarcomere) 구조를 가지는 로드(rod) 형상 세포인 것을 특징으로 한다. 일부 구체예에서, 상기 성숙 심근세포는 도 6 내지 14 중 어느 하나에 묘사된 바와 유사하거나 동일한 형태학(morphology)을 갖는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 AFC-ECM 상에 플레이트 된다(plated). 일부 구체예에서, 상기 성숙 심근세포는 상기 AFC-ECM 상의 단일층으로써 형성되고, 이로써 상기 AFC-ECM 상의 성숙 심근 세포의 단일층을 포함하는 세포 구조를 형성하며, 상기 성숙 심근 세포는 상기 AFC-ECM 상에 배열된다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 내향-정류기 포타슘 채널(inward-rectifier potassium channel) Kir2.1을 발현하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가진 로드 형상 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아(mitochondria)를 가지고/거나, 조직화되지 않은(disorganized) 미오필라멘트(myofilament)를 가지고/거나, 원형 형상을 가지고/거나 단일한 핵을 가짐을 특징으로 할 수 있다. 일부 구체예에서, 상기 성숙 심근세포는 상기 미성숙 hiPSC-CM보다 많은 미토콘드리아 양을 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가짐을 더 특징으로 할 수 있다.
또 다른 구체예에서, 양수으로부터 인 비트로 분리된 세포로부터 유래한 세포외 기질(AFC-ECM) 상의 성숙 심근세포의 단일층을 포함하는 세포 구조를 개시하며, 상기 성숙 심근세포는 인간 유도만능줄기세포(hiPSC-CM)로부터 유래한 AFC-ECM 배양 심근세포이고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다. 일부 구체예에서, 상기 성숙 심근세포는 도 6 내지 14 중 어느 하나에 묘사된 바와 유사하거나 동일한 형태학을 갖는다. 일부 측면에서, 성숙 심근세포는 내향-정류기 Kir2.1 포타슘 채널을 포함하고/거나 내향-정류기 포타슘 채널 Kir2.1을 발현한다. 특정 측면에서, 성숙 심근세포는 AFC-ECM 상의 배양으로 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)으로부터 성숙되고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조(줄무늬(striped) 외형)를 가지는 로드 형상 세포인 것을 특징으로 한다. 일부 구체예에서 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다. 일부 구체예에서 섬유 트랙(track)이 상기 구조 상에 존재한다. 일부 구체예에서 상기 AFC-ECM은 라미닌(laminin), 콜라겐 알파-1(collagen alpha-1) (ⅩⅤⅢ), 베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질(basement membrane-specific heparan sulfate proteoglycan core protein), 아그린(agrin), 비멘틴(vimentin) 및 콜라겐 알파-2(collagen alpha-2) (Ⅳ) 및/또는 이들의 아이소폼(isoform)을 포함한다. 일부 구체예에서, 상기 아그린의 아이소폼은 아이소폼 6이다. 일부 구체예에서 상기 AFC-ECM은 피브로넥틴(fibronectin) 및/또는 이의 아이소폼을 더 포함한다. 일부 구체예에서, 상기 AFC-ECM은 데코린(decorin), 퍼레칸(perlecan) 및/또는 콜라겐 (Ⅲ)을 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아를 가지고/거나 조직화되지 않은 미오필라멘트를 가지고/거나, 원형 형상을 가지고/거나, 단일한 핵을 가짐을 특징으로 할 수 있다. 일부 구체예에서, 상기 성숙 심근세포는 미성숙 hiPSC-CM보다 많은 양의 미토콘드리아를 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가짐을 더 특징으로 할 수 있다.
또 다른 측면에서, 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질 상의 성숙 심근세포의 세포 구조를 형성하는 방법이 개시되고, 상기 방법은 다음을 포함하며: (a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것; (b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 AFC-ECM 상에 상기 미성숙 hiPSC-CM을 플레이팅(plating)하는 것; 및 (d) 성숙 심근세포 내에 상기 미성숙 hiPSC-CM의 성숙을 유도하고 상기 AFC-ECM 상에 상기 성숙 심근세포의 단일층을 형성하도록 배양 배지 내의 상기 AFC-ECM 상에 상기 플레이트 된 미성숙 hiPSC-CM를 배양함으로써 상기 세포 구조를 형성하는 것; 을 포함하고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다. 일부 구체예에서, 성숙 심근세포의 단일층은 도 6 내지 14 중 어느 하나에 묘사된 바와 유사하거나 동일한 형태학을 갖는다. 일부 구체예에서, 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다. 일부 구체예에서, 섬유 트랙이 상기 세포 구조 상에 존재한다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아를 가지고/거나 조직화되지 않은 미오필라멘트를 가지고/거나, 원형 형상을 가지고/거나, 단일한 핵을 가짐을 특징으로 할 수 있다. 일부 구체예에서, 상기 성숙 심근세포는 미성숙 hiPSC-CM보다 많은 양의 미토콘드리아를 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가짐을 더 특징으로 할 수 있다.
또 다른 측면에서, 약물 화합물의 심장 독성 및/또는 전부정맥 효과를 인 비트로 결정하는 방법이 개시되고, 상기 방법은 본 명세서에 걸쳐서 개시되는 세포 구조 중 어느 하나의 성숙 심근세포에 상기 약물 화합물을 접촉하는 것, 및 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과가 있는지 확인하기 위하여 상기 성숙 심근세포의 전기 생리학적 변화를 관찰하는 것을 포함한다. 상기 성숙 심근세포의 전기 생리학적 변화는 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가지는지 확인한다. 상기 성숙 심근세포의 전기 생리학적 변화는 APD 연장, APD 연장 플러스 로터 및/또는 빈박성 부정맥(tachyarrhythmia; TA), 정지(quiescence; Q), 지연 후탈분극(delayed afterdepolarization; DAD) 및/또는 조기 후탈분극(early afterdepolarization; EAD)과 같은 다양한 유형의 부정맥을 포함하나, 이에 제한되지 않는다. 관찰에는 또한, 세포 생존력(cell viability), 세포 밀도(cell density) 및/또는 세포의 형태학(morphology of the cell)이 포함될 수 있다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 활동 전위 지속 시간(action potential duration; APD)의 연장이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 조기 후탈분극(early after depolarization; EAD)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 지연 후탈분극(delayed after depolarization; DAD)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 활동 전위 지속시간 연장(APD prolongation) 플러스 로터(plus rotor)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 부정맥이다. 일부 측면에서, 상기 세포 구조는 다음을 포함하는 과정을 통해 준비될 수 있고: (a) 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것; (b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 미성숙 hiPSC-CM를 상기 AFC-ECM 상에 플레이팅 하는 것; 및 (d) 상기 미성숙 hiPSC-CM의 성숙 심근세포로의 성숙을 유도하고 상기 성숙 심근세포를 상기 AFC-ECM 상에 단일 층으로 형성하도록 배양 배지(culture media) 내에 상기 AFC-ECM 상에 상기 플레이팅 된 미성숙 hiPSC-CM를 배양하고, 이로써 세포 구조를 형성하며, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 포함하는 로드 형상 세포임을 특징으로 한다. 일부 구체예에서, 상기 성숙 심근세포는 도 6 내지 14 중 어느 하나에 묘사된 바와 유사하거나 동일한 형태학을 갖는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 내향-정류기 포타슘 채널 Kir2.1을 발현하지 않는다. 또 다른 구체예에서, 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다. 또 다른 구체예에서, 섬유 트랙은 상기 세포 구조 상에 존재한다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상의 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아를 가지고/거나 조직화되지 않은 미오필라멘트를 가지고/거나, 원형 형상을 가지고/거나, 단일한 핵을 가짐을 특징으로 할 수 있다. 일부 구체예에서, 상기 성숙 심근세포는 미성숙 hiPSC-CM보다 많은 양의 미토콘드리아를 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가짐을 더 특징으로 할 수 있다.
또한, 본 발명의 맥락에서 하기 하기 구체예 1 내지 20이 개시된다:
구체예 1은 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포의 성숙을 위한 방법으로써, 상기 발명은 다음을 포함하고:
(a) 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)을 제공하는 것;
(b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것;
(c) 상기 미성숙 hiPSC-CM을 상기 AFC-ECM에 접촉하는 것; 및
(d) 상기 미성숙 hiPSC-CM의 성숙을 유도하도록 상기 미성숙 hiPSC-CM를 상기 AFC-ECM와 배양 배지에서 배양함으로써 성숙 심근세포를 형성하는 것;
상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다.
구체예 2는 구체예 1의 방법으로써, 상기 미성숙 hiPSC-CM은 상기 AFC-ECM 상에 플레이트 되는(plated) 것이다.
구체예 3은 구체예 1 또는 2 중 어느 하나의 방법으로써, 상기 성숙 심근세포는 상기 AFC-ECM 상에 단일층으로 형성됨으로써, 상기 AFC-ECM 상에 성숙 심근세포의 단일층을 포함하는 세포 구조를 형성하고, 상기 성숙 심근세포는 상기 AFC-ECM 상에 배열된다.
구체예 4는 구체예 1 내지 3 중 어느 하나의 방법으로써, 상기 미성숙 hiPSC-CM는 내향-정류기 포타슘 채널 Kir2.1을 발현하지 않는다.
구체예 5는 양수로부터 인 비트로 분리된 세포로부터 유래된 세포외 기질(AFC-ECM) 상의 성숙 심근세포의 단일층을 포함하는 세포 구조로서, 상기 성숙 심근세포는 인간 유도만능줄기세포으로부터 유래된 AFC-ECM 배양 심근세포(hiPSC-CM)이고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다.
구체예 6은 구체예 5의 세포 구조로써, 상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다.
구체예 7은 구체예 5 또는 6 중 어느 하나의 세포 구조로써, 섬유 트랙이 상기 구조 상에 존재한다.
구체예 8은 구체예 5 내지 7 중 어느 하나의 세포 구조로써, 상기 AFC-ECM은 라미닌(laminin), 콜라겐 알파-1(collagen alpha-1) (ⅩⅤⅢ), 베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질(basement membrane-specific heparan sulfate proteoglycan core protein), 아그린(agrin), 비멘틴(vimentin), 콜라겐 알파-2(collagen alpha-2) (Ⅳ) 및/또는 이들의 아이소폼(isoform)을 포함한다.
구체예 9는 구체예 8에 따른 세포 구조로써, 상기 콜라겐 알파-1 (ⅩⅤⅢ)의 아이소폼은 아이소폼 2 이고/거나 상기 아그린의 아이소폼은 아이소폼 6 이다.
구체예 10은 구체예 8 도는 9 중 어느 하나의 세포 구조로써, 상기 AFC-ECM은 피브로넥틴(fibronectin) 및/또는 그것의 아이소폼을 더 포함한다.
구체예 11은 구체예 5 내지 10 중 어느 하나의 세포 구조로써, 상기 AFC-ECM은 데코린(decorin), 퍼레칸(perlecan) 및/또는 콜라겐 (Ⅲ)을 포함하지 않는다.
구체예 12는 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM) 상에 성숙 심근세포의 세포 구조를 형성하는 방법으로서, 상기 방법은 다음을 포함하고:
(a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것;
(b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것;
(c) 상기 AFC-ECM 상에 상기 미성숙 hiPSC-CM을 플레이팅(plating)하는 것;
(d) 성숙 심근세포 내에 상기 미성숙 hiPSC-CM의 성숙을 유도하고 상기 AFC-ECM 상에 상기 성숙 심근세포의 단일층을 형성하도록 배양 배지 내의 상기 AFC-ECM 상에 상기 플레이트 된 미성숙 hiPSC-CM를 배양함으로써 상기 세포 구조를 형성하는 것;
상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다.
구체예 13은 구체예 12의 방법으로써, 상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다.
구체예 14는 구체예 12 또는 13 중 어느 하나의 방법으로써, 섬유 트랙이 상기 세포 구조 상에 존재한다.
구체예 15는 약물 화합물의 심장 독성(cardiotoxicity) 및/또는 전부정맥 효과(proarrhythmic effect)를 인 비트로 결정하는 방법으로서, 상기 방법은, 구체예 5 내지 11의 세포 구조 중 어느 하나의 성숙 심근세포에 상기 약물 화합물을 접촉하는 것; 및 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과가 있는지 확인하기 위하여 상기 성숙 심근세포의 전기 생리학적 변화를 관찰하는 것; 을 포함한다.
구체예 16은 구체예 15의 방법으로써, 상기 성숙 심근세포의 상기 전기 생리학적 변화는 활동 전위 지속시간(action potential duration; APD)의 연장이고, APD의 연장은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인한다.
구체예 17은 구체예 15의 방법으로써, 상기 성숙 심근세포의 상기 전기 생리학적 변화는 조기 후탈분극(early after depolarization; EAD)이고, 상기 조기 후탈분극(EAD)은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인한다.
구체예 18은 구체예 15의 방법으로써, 상기 성숙 심근세포의 상기 전기 생리학적 변화는 지연 후탈분극(delayed after depolarization)이고, 상기 지연 후탈분극(delayed after depolarization; DAD)은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인한다.
구체예 19는 구체예 15의 방법으로써, 상기 성숙 심근세포의 상기 전기 생리학적 변화는 활동 전위 지속시간(action potential duration; APD) 플러스 로터(plus rotor)이고, APD 플러스 로터의 연장은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인한다.
구체예 20은 구체예 15의 방법으로써, 상기 성숙 심근세포의 상기 전기 생리학적 변화는 부정맥(arrhythmia)이고, 상기 부정맥은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인한다.
"약(about)" 또는 "대략(approximately)"라는 용어는 해당 기술 분야의 통상의 기술자가 이해하는 바에 가까운 것으로 정의되고, 하나의 비제한적인 구체예에서 상기 용어는 10% 이내, 바람직하게는 5% 이내, 더 바람직하게는 1% 이내, 가장 바람직하게는 0.5% 이내로 정의된다.
"실질적으로(substantially)"라는 용어 및 그 파생어는 10% 이내, 5% 이내, 1% 이내 또는 0.5% 이내의 범위를 포함하는 것으로 정의된다.
본원에서 사용될 때, "% w/w" 또는 "중량%(wt.%)"라는 용어는 성분을 포함하는 물질(예컨대 조성물)의 총중량에 대해 상기 성분의 중량 퍼센테이지(percentage)를 지칭한다. 비제한적인 예시에서, 100 그램의 조성물 중 10 그램의 성분은 조성물의 총중량에서 그 성분의 10% w/w이다. 본원에서 사용될 때, "% v/v" 또는 "부피%"라는 용어는 성분을 포함하는 물질(예컨대 조성물)의 총부피에 대해 상기 성분의 부피 퍼센테이지를 지칭한다. 비제한적인 예시에서, 100 mL의 조성물 중 10 mL의 성분은 조성물의 총부피에서 그 성분의 10% v/v이다. 본원에서 사용될 때, "% w/v" 라는 용어는 성분을 포함하는 물질(예컨대 조성물)의 총부피에 대해 상기 성분의 중량 퍼센테이지를 지칭한다. 비제한적인 예시에서, 100 mL의 조성물 중 10 g의 성분은 조성물의 총부피에서 그 성분의 10% w/v이다. 본원에서 사용될 때, "% v/w" 라는 용어는 성분을 포함하는 물질(예컨대 조성물)의 총중량에 대해 상기 성분의 부피 퍼센테이지를 지칭한다. 비제한적인 예시에서, 100 g의 조성물 중 10 mL의 성분은 조성물의 총부피에서 그 성분의 10% v/w이다.
"저해하는(inhibiting)" 또는 "감소하는(reducing)" 또는 "방지하는(preventing)" 또는 "회피하는(avoiding)" 또는 이러한 용어들의 임의의 파생어와 같은 용어들은, 본 청구범위 및/또는 본 명세서에 사용될 때 원하는 효과를 달성하기 위한 임의의 측정 가능한 감소 또는 완전한 억제를 포함한다.
"효과적인(effective)"이라는 용어는 본 명세서 및/또는 청구범위에서 사용되는 용어로써, 원하거나, 기대되거나, 의도된 결과를 달성하기에 적합한 것을 의미한다.
"포함하는(comprising)"(및 "포함하다(comprise 및 comprises)"와 같은 포함하는(comprising)의 임의의 형태), "갖는(having)"(및 "갖다(have 및 has)"와 같은 갖는(having)의 임의의 형태), "포함시키는(including)"(및 "포함시키다(includes 및 include)"와 같은 포함시키는(including)의 임의의 형태) 또는 "함유하는(containing)"(및 "함유하다(contains 및 contain)"와 같은 함유하는(containing)의 임의의 형태)는 포괄적이거나 개방적이며 부가적이고 인용되지 않은 구성 또는 방법 단계를 배제하지 않는다.
"포함하는(comprising)", "갖는(having)", "포함시키는(including)" 또는 "함유하는(containing)"이라는 용어(및 이들 단어의 임의의 파생어)와 함께 사용될 때 "하나의(a 또는 an)"라는 단어는 "하나"를 의미하지만 "하나 또는 그 초과", "적어도 하나" 및 "하나 또는 하나 보다 많은"의 의미와도 일치한다.
이들의 사용을 위한 조성물 및 방법은 본 명세서에 걸쳐 개시되는 임의의 재료 또는 단계 중 어느 하나를 "포함하거나(comprise)", "필수적으로 구성되거나(consist essentially of)" 또는 "구성될(consist of)" 수 있다. "필수적으로 구성되거나(consist essentially of)"라는 전환부(transitional phrase)와 관련하여, 하나의 비제한적인 측면에서, 본원에 개시된 세포 구조의 기본적이고 신규한 특성은 줄기 세포로부터 유래한 심근세포를 성숙 원형(native) 성체 심근세포 및 원형(native) 심장 조직과 유사한 성숙 상태로 성숙시키는 그들의 능력에 기인한 약물 화합물의 심장 독성 및/또는 전부정맥 스크리닝 테스트에의 그들의 사용이다.
본 명세서에서 논의되는 임의의 실시예는 본 발명의 임의의 방법 또는 조성물과 관련하여 구현될 수 있는 것이 고려되며, 그 반대도 마찬가지이다. 더욱이, 본 발명의 조성물은 본 발명의 방법을 달성하도록 사용될 수 있다.
본 발명의 다른 목적, 특징 및 이점은 하기 상세한 설명으로부터 자명해질 것이다. 그러나, 상세한 설명으로부터 해당 기술 분야의 기술자로부터 본 발명의 목적과 범위 내에서 다양한 변화와 수정이 명백해지므로, 상세한 설명 및 특정 실시예는, 본 발명의 특정 구체예를 지칭하면서, 단지 예시의 방법으로만 주어지는 것으로 이해되어야 한다.
도 1: 10x 대물 렌즈를 사용한 100x 배율 양수 세포-유래 ECM의 명시야(brightfield) 상 현미경 사진(photomicrograph).
도 2: 토포그래피(topography), 어드헤션(adhesion) 및 스티프니스(stiffness)를 보여주는 양수 세포-유래 ECM 및 골수(bone marrow)-유래 ECM의 3개 대표 40 x 40um 섹션의 원자력(atomic force) 현미경 사진.
도 3: 골수- 및 양수- 세포-유래 ECM의 어드헤션 및 스티프니스(탄력 모듈러스(modulus))의 정량을 보여주는 스캐터 플롯(scatter plot). 각 지점은 독립적인 측정 포인트를 나타냄.
도 4: 양수 세포 유래 ECM 및 골수 세포-유래 ECM 상 iPSC의 데이(day) 0 및 데이 2 배양을 보여주는 현미경 사진.
도 5: 양수 세포-유래 ECM 및 골수 세포-유래 ECM의 존재하에 배양된 iPSC의 성장 곡선 플롯(plot).
도 6: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 3.13 mm2
도 7: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 2.15 mm2
도 8: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 1.46 mm2
도 9: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 10: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 11: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 12: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 13: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.13 mm2
도 14: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.04 mm2
도 15: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 3.13 mm2
도 16: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 2.15 mm2
도 17: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 1.46 mm2
도 18: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 0.54 mm2
도 19: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 0.13 mm2
도 20: 단일 웰 내 BM-ECM 상의 성숙 심근세포의 현미경 사진 - 2.15 mm2
도 21: 단일 웰 내 BM-ECM 상의 성숙 심근세포의 현미경 사진 - 1.46 mm2
도 22: 멀티-웰 플레이트 내 AFC-ECM 상의 성숙 심근세포를 이용한 활동 전위 또는 칼슘 과도 측정(calcium transient measurement)을 기록하기 위한 기기의 구성의 개략도.
도 23: Matrigel™ ECM, BM-ECM, 및 AFC-ECM 상에서 배양된 심근세포로부터 기록된 자발적 활동 전위(spontaneous action potential)의 기록, 베이스라인 및 약물 E4031 이후.
도 24: 약물 E4031 와의 접촉 후 Matrigel™ ECM, BM-ECM, 및 AFC-ECM 상에서 배양된 심근세포로부터의 스테이블 로터(Stable Rotor; TdP 유사 부정맥)의 수의 막대 그래프.
도 25: 다양한 약물에 대해 AFC-ECM 상에서 배양된 성숙 심근세포로부터 기록된 자발적 활동 전위의 기록.
도 26: 나열된 각 약물의 모든 도즈로부터 기록된 전체 부정맥의 막대 그래프.
도 27: 나열된 각 약물의 유효 치료 혈장 농도(effective therapeutic plasma concentration; ETPC)의 @10X 에서 부정맥을 포함하는 웰의 % 막대 그래프.
도 28: 나열된 각 약물의 시간(ms)에 따른 활동 전위 삼각측량(action potential triangulation; APD90-APD30)의 막대 그래프.
도 29: Matrigel™ ECM에 대해서 AFC-ECM(SBS-AF Matrix) 상의 심근세포의 심근세포 성능을 비교하는 각 나열된 약물의 시간(ms)에 따른 활동 전위 삼각측량(APD90-APD30)의 막대 그래프.
도 30: 나열된 각 약물의 임의의 농도에서 Cellular Dynamics(속이 빈 원)의 iCell® hiPSC-CM 대 Ncardia(어두운 원)의 Cor.4U® hiPSC-CM의 심근세포 성능을 비교하는 각 나열된 약물의 최대 약물-유도 활동 전위 삼각측량의 막대 그래프. Blinova et al, 2018, Cell Reports의 그림.
도 31: 핵을 표지(mark)하기 위해 DAPI를 사용하여 트로포닌(Troponin)Ⅰ에 대한 면역형광 염색(immunofluorescent staining)으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 32: 핵을 표지하기 위해 DAPI를 사용하여 α-액티닌(α-actinin)에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 33: 핵을 표지하기 위해 DAPI를 사용하여 cTnT 및 N 카데린(N Cadherin)에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 34: 핵을 표지하기 위해 DAPI를 사용하여 cTnT에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 35: 핵을 표지하기 위해 DAPI를 사용하여 α-액티닌에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 단일 hiPSC-CM 세포의 현미경 사진.
도 36: 도 35에 도시된 단일 세포들의 세포 원형도(circularity)의 비교 그래프.
도 37: 핵을 표지하기 위해 DAPI를 사용하여 cTnI 발현에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 38: cTnI 발현 및 GADPH에 대한 Matrigel™ ECM 및 AFC-ECM 상의 hiPSC-CM의 웨스턴 블로팅(Western blotting).
도 39: Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM의 GAPDH에 관계된 cTnI 발현의 그래프.
도 40: MitoTracker Red로 미토콘드리아에 대해 염색된 Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM의 현미경 사진.
도 41: Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM에 대한 MitoTraker™ Red 형광강도/심근세포를 보여주는 그래프.
도 42: 미세전극 어래이(microelectrode array; MEA) 플레이트 상에 코팅된 Matrigel™ ECM 및 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진(투과광).
도 2: 토포그래피(topography), 어드헤션(adhesion) 및 스티프니스(stiffness)를 보여주는 양수 세포-유래 ECM 및 골수(bone marrow)-유래 ECM의 3개 대표 40 x 40um 섹션의 원자력(atomic force) 현미경 사진.
도 3: 골수- 및 양수- 세포-유래 ECM의 어드헤션 및 스티프니스(탄력 모듈러스(modulus))의 정량을 보여주는 스캐터 플롯(scatter plot). 각 지점은 독립적인 측정 포인트를 나타냄.
도 4: 양수 세포 유래 ECM 및 골수 세포-유래 ECM 상 iPSC의 데이(day) 0 및 데이 2 배양을 보여주는 현미경 사진.
도 5: 양수 세포-유래 ECM 및 골수 세포-유래 ECM의 존재하에 배양된 iPSC의 성장 곡선 플롯(plot).
도 6: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 3.13 mm2
도 7: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 2.15 mm2
도 8: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 1.46 mm2
도 9: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 10: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 11: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 12: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.54 mm2
도 13: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.13 mm2
도 14: 단일 웰 내 AFC-ECM 상의 성숙 심근세포의 현미경 사진 - 0.04 mm2
도 15: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 3.13 mm2
도 16: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 2.15 mm2
도 17: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 1.46 mm2
도 18: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 0.54 mm2
도 19: 단일 웰 내 표준 Matrigel™ ECM 상의 심근세포의 현미경 사진 - 0.13 mm2
도 20: 단일 웰 내 BM-ECM 상의 성숙 심근세포의 현미경 사진 - 2.15 mm2
도 21: 단일 웰 내 BM-ECM 상의 성숙 심근세포의 현미경 사진 - 1.46 mm2
도 22: 멀티-웰 플레이트 내 AFC-ECM 상의 성숙 심근세포를 이용한 활동 전위 또는 칼슘 과도 측정(calcium transient measurement)을 기록하기 위한 기기의 구성의 개략도.
도 23: Matrigel™ ECM, BM-ECM, 및 AFC-ECM 상에서 배양된 심근세포로부터 기록된 자발적 활동 전위(spontaneous action potential)의 기록, 베이스라인 및 약물 E4031 이후.
도 24: 약물 E4031 와의 접촉 후 Matrigel™ ECM, BM-ECM, 및 AFC-ECM 상에서 배양된 심근세포로부터의 스테이블 로터(Stable Rotor; TdP 유사 부정맥)의 수의 막대 그래프.
도 25: 다양한 약물에 대해 AFC-ECM 상에서 배양된 성숙 심근세포로부터 기록된 자발적 활동 전위의 기록.
도 26: 나열된 각 약물의 모든 도즈로부터 기록된 전체 부정맥의 막대 그래프.
도 27: 나열된 각 약물의 유효 치료 혈장 농도(effective therapeutic plasma concentration; ETPC)의 @10X 에서 부정맥을 포함하는 웰의 % 막대 그래프.
도 28: 나열된 각 약물의 시간(ms)에 따른 활동 전위 삼각측량(action potential triangulation; APD90-APD30)의 막대 그래프.
도 29: Matrigel™ ECM에 대해서 AFC-ECM(SBS-AF Matrix) 상의 심근세포의 심근세포 성능을 비교하는 각 나열된 약물의 시간(ms)에 따른 활동 전위 삼각측량(APD90-APD30)의 막대 그래프.
도 30: 나열된 각 약물의 임의의 농도에서 Cellular Dynamics(속이 빈 원)의 iCell® hiPSC-CM 대 Ncardia(어두운 원)의 Cor.4U® hiPSC-CM의 심근세포 성능을 비교하는 각 나열된 약물의 최대 약물-유도 활동 전위 삼각측량의 막대 그래프. Blinova et al, 2018, Cell Reports의 그림.
도 31: 핵을 표지(mark)하기 위해 DAPI를 사용하여 트로포닌(Troponin)Ⅰ에 대한 면역형광 염색(immunofluorescent staining)으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 32: 핵을 표지하기 위해 DAPI를 사용하여 α-액티닌(α-actinin)에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 33: 핵을 표지하기 위해 DAPI를 사용하여 cTnT 및 N 카데린(N Cadherin)에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 34: 핵을 표지하기 위해 DAPI를 사용하여 cTnT에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 35: 핵을 표지하기 위해 DAPI를 사용하여 α-액티닌에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 단일 hiPSC-CM 세포의 현미경 사진.
도 36: 도 35에 도시된 단일 세포들의 세포 원형도(circularity)의 비교 그래프.
도 37: 핵을 표지하기 위해 DAPI를 사용하여 cTnI 발현에 대한 면역형광 염색으로 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진.
도 38: cTnI 발현 및 GADPH에 대한 Matrigel™ ECM 및 AFC-ECM 상의 hiPSC-CM의 웨스턴 블로팅(Western blotting).
도 39: Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM의 GAPDH에 관계된 cTnI 발현의 그래프.
도 40: MitoTracker Red로 미토콘드리아에 대해 염색된 Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM의 현미경 사진.
도 41: Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM에 대한 MitoTraker™ Red 형광강도/심근세포를 보여주는 그래프.
도 42: 미세전극 어래이(microelectrode array; MEA) 플레이트 상에 코팅된 Matrigel™ ECM 및 AFC-ECM 상에서 배양된 hiPSC-CM의 현미경 사진(투과광).
양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM) 상의 배양으로 성숙된 인간 유도만능줄기세포(hiPSC-CM)로부터 유래된 것과 같은 인간 줄기세포 유래 심근세포가 Matrigel™ ECM 및 골수 세포-유래 ECM과 같은 다른 ECM 상에서 성숙된 미성숙 hiPSC-CM 또는 hiPSC-CM보다 더 우수하고 일관된 심장 독성 및 전부정맥 애새이 결과를 나타낸다. AFC-ECM 상에서 성숙된 hiPSC-CM은, 정상적인 성체 인간 심장 조직의 심근세포에서 찾을 수 있는 그들의 세포 형태학 및 근절 구조에서 보여지듯이, 놀랍게도 Matrigel™ ECM과 같은 다른 ECM 및 심지어 골수 세포-유래 ECM과 같은 다른 자연적인 세포 유래 ECM 상에서 성숙된 hiPSC-CM보다 더 높은 상태의 성숙을 나타낸다. 더욱이, 웨스턴 브로팅 기술에 의해 나타난 바와 같이, Matrigel™ ECM 상에서 배양된 hiPSC-CM보다 AFC-ECM 상에서 배양된 hiPSC-CM에서 cTnI(cardiac troponin I)의 더욱 강력한 발현이 확인되었다. 또한, AFC-ECM 상에서 배양된 hiPSC-CM은 Matrigel™ ECM 상에서 배양된 hiPSC-CM보다 더 많은 미토콘드리아 및 더 극성화된 내막 전위를 가지는 미토콘드리아를 갖는다. 따라서, 상기 AFC-EMC는 hiPSC-CM에서 미토콘드리아의 생합성, 성숙 및 기능을 자극할 수 있다. 정상적인 성체 또는 성숙 인간 심장 인간 조직은 근절 구조(줄무늬 외형)을 가진 로드 형상의 세포를 특징으로 한다. 심근세포의 형태학 및 근절 구조는 현미경(투과광 또는 면역형광 염색에 의해)에 의해 시각적으로 확인될 수 있다. 비제한적인 예시로, AFC-ECM 상에서 성숙된 심근 세포의 형태학 및 근절 구조는 도 14의 현미경 사진 내 화살표에 의해 확인되는 줄무늬 외형을 가지는 로드 형상 세포의 존재로부터 분명하게 보여진다. 추가적으로, 이러한 결과를 얻기 위해 PDMS와 같은 실리콘 기판의 사용은 불필요하다. 놀랍게도, AFC-ECM 및 AFC-ECM 상에서 배양된 미성숙 hiPSC-CM으로부터 성숙된 성숙 심근세포의 단일층을 포함하는 세포 구조는, 예를 들어 고처리량 인 비트로 스크리닝 애새이에서 Torsades de Pointes(TdP)와 같은 약물 유도 부정맥의 일관된 시각화를 허용함으로써 유용한 것으로 보인다. 이러한 "디쉬(dish) 내 TdP" 기술은 약물 유도 TdP에 대한 대리 표지자로써 필드 전위 지속시간(MEA 기술) 또는 활동 전위 지속 시간 연장에 대한 의존을 넘어서는 주요한 진보이다. 따라서, 본원에 개시되는 세포 구조 및 방법은 전부정맥의 간접적인 인디케이터(indicator)인 단순한 분극 및 탈분극 이벤트보다 인 비트로 모델에서 부정맥 이벤트의 시각화를 허용하는 더 포괄적이고 예측 가능한 인 비트로 부정맥 애새이를 개발함으로써 현재 CiPA 이니셔티브의 가이드라인을 넘어선다. 본 개시에 요약된 세포 구조 및 방법은 부정맥 이벤트가 인 비트로 인간 심장 단일층 모델 시스템에서 전파되고 시각화되도록 한다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아를 가지고/거나, 조직화되지 않은 미오필라멘트를 가지고/거나, 원형 형상을 가지고/거나, 단일한 핵을 가짐을 특징으로 할 수 있다. 일부 구체예에서, 상기 성숙 심근세포는 분명한 근절 구조(줄무늬 외형)을 가지는 로드 형상 세포를 가지는 것을 특징으로 할 수 있다. 일부 구체예에서, 성숙한 심근세포는 미성숙 hiPSC-CM보다 더 많은 양의 미토콘드리아를 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가지는 것을 더 특징으로 할 수 있다.
본원에서, 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)를 성숙 심근세포(성숙 hiPSC-CM)를 형성하는 배양을 통한 성숙을 위한 양수로부터 분리된 세포로부터 인-비트로 유래된 세포-유래 세포외 기질(AFC-ECM)을 사용하는 방법이 개시된다. 또한 본원에서 약물 화합물의 심장 독성 및/또는 전부정맥 스크리닝 애새이에 유용한 이러한 AFC-ECM 상의 성숙 심근세포의 단일층을 포함하는 세포 구조가 개시된다. 또한, 이러한 세포 구조를 이용하여 약물 화합물의 심장 독성 및/또는 전부정맥 효과를 인 비트로 결정하는 방법이 개시된다.
A. 양수 세포-유래 세포외 기질(AFC-ECM)
주산기(perinatal) 세포는 세 그룹으로 나눌 수 있다: 양수로부터의 세포; 태반(placenta)으로부터의 세포; 및 탯줄(umbilical cord)로부터의 세포. 양수는 태아의 양막(amnion membrane), 피부 및 영양, 호흡 및 비뇨생식기에서 벗겨진 발달 중의 태아로부터 유래한 세포를 포함하는 다양한 세포의 공급원을 가진다. 태반은 또한 막 시트(양막(amnion) 및 융모막(chorion)), 융모(villi) 및 혈액을 포함하는 다양한 세포 공급원을 가진다. 탯줄 세포는 일반적으로 제대혈(cord blood) 및 와튼 젤리(Wharton's jelly)라는 두 공급원으로부터 유래한다. 이러한 세가지 주산기 공급원으로부터의 세포는 줄기 세포를 포함할 수 있다. 본 발명의 양수 세포-유래 ECM을 생성하기 위해 사용되는 세포는 인간(호모 사피엔스), 쥐, 토끼, 고양이, 개, 돼지, 말 또는 영장류를 비제한적으로 포함하는 포유류의 양수로부터 얻어진다. 바람직한 구체예에서, 상기 세포는 인간의 양수로부터 유래한다. 상기 양수는 만삭기(약 37주 잉태 연령(gestational age) 초과) 또는 조산기(약 37주 잉태 연령 미만)의 인간으로부터 공급될 수 있다. 조산기는 후기 조산기(약 33 내지 약 37주 잉태 연령), 중등도 조산기(약 29 내지 약 33주 잉태 연령) 및 극도 조산기(약 23 내지 약 29주 잉태 연령)을 포함한다. 양수는 양수가 존재하는 모든 잉태 연령에서 출산에 앞서 인간으로부터 공급될 수 있으며, 출산으로부터의 양수의 공급원과 조합될 수 있다. 일반적으로 출산 전에 양수는 양수천자(amniocentesis) 과정을 통해 수집된다. 일부 구체예에서 양수는 만삭기, 조산기, 후기 조산기, 중등도 조산기, 극도 조산기 또는 출산 전 또는 이들의 조합으로부터 공급된다. 일부 구체예에서, 양수는 출산 전에 공급되고, 약 10주 잉태 연령 내지 출산시 또는 약 10 내지 약 23주 잉태 연령 또는 약 10 내지 약 16주 잉태 연령 또는 약 12주 잉태 연령 내지 출산시 또는 약 12 내지 약 23주 잉태 연령 또는 약 12 내지 약 16주 잉태 연령으로부터 수집된다. 일부 구체예에서, 양수는 양수천자 과정으로부터 출산 전에 수집되어 공급된다. 상기 세포는 Murphy et. al., Amniotic fluid Stem Cells, Perinatal Stem Cells, Second Ed. 2013에 개시된 기술과 같은 기술 분야에서 알려진 기술에 의해 양수로부터 얻어지고 분리될 수 있다.
양수는 자발적으로 또는 특정 성장 인자 또는 기술 분야의 기술자에게 알려진 성장 인자의 조합으로 처리 결과로써 모든 세가지 배아 생식 층(embryonic germ layer; 외배엽(ectoderm), 내배엽(endoderm), 중배엽(mesoderm))으로부터 유래된 세포 유형으로 분화할 수 있는 능력을 가진 세포를 포함한다. 즉, 단일한 세포가 상기 세가지 생식 층 중 어느 하나에 특이적인 발현 유전자를 유도할 수 있는 능력을 가진다. 양수는 또한 태아의 양막, 피부 및 영양, 호흡 및 비뇨생식기에서 벗겨진 발달 중의 태아로부터 유래한 세포를 포함하는 다양한 세포의 혼합물을 포함한다. 양수 및 태반막(placental membrane)의 기원으로 인해, 이들 세포는 고도의 다분화능 분화 잠재력을 유지할 수 있고 세 가지 생식층 모두의 세포를 포함하는 세포 포퓰레이션(population)을 포함할 수 있다. 일부 구체예에서, 상기 양수 세포는 분리된 줄기세포이다. 일부 구체예에서, 상기 양수 세포는 세가지 배아 생식 층(외배엽, 내배엽, 중배엽) 모두로부터 유래한 세포 유형으로 분화할 수 있는 능력을 가진 줄기 세포 및/또는 다분화능 줄기 세포 및/또는 만능줄기세포를 포함한다.
본우너에 개시되는 양수 세포-유래 ECM은 다양한 단백질을 포함할 수 있다. 상기 ECM의 단백질은 기술 분야에서 알려진 기술로 확인될 수 있고, 이는 질량 분석기 및 면역조직화학적 염색(immunohistochemical staining)을 포함한다. 상기 ECM은 표 2(하기 실시예 1 참조)에 나열된 구성물 및 임의의 변이체(variant), 유도체(유도체) 또는 이들의 아이소폼을 비제한적으로 포함할 수 있다. 양수-세포 유래 ECM은 표 2로부터의 조성물 및 임의의 변이체, 유도체 또는 이들의 아이소폼 중 어느 것의 임의의 조합을 포함할 수 있다. 일부 구체예에서, 조합은 라미닌(laminin), 콜라겐 알파-1(ⅩⅤⅢ)(collagen alpha-1(ⅩⅤⅢ)), 베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질(basement membrane-specific heparan sulfate proteoglycan core protein), 아그린(agrin), 비멘틴(vimentin) 및 콜라겐 알파-2(Ⅳ)(collagen alpha-2(Ⅳ)) 및/또는 이들의 아이소폼을 포함하거나, 필수적으로 이루어지거나, 이루어질 수 있다. 일부 구체예에서, 상기 아그린의 아이소폼은 아이소폼 6이다. 일부 구체예에서, 상기 세포-유래 ECM은 피브로넥틴 및 또는 이의 아이소폼을 더 포함하거나, 필수적으로 이루어지거나, 이루어질 수 있다. 일부 구체예에서, 상기 양수 세포-유래 ECM은 데코린(decorin), 펄레칸(perlecan), 및 콜라겐(Ⅲ)(collagen(Ⅲ)) 중 어느 하나 또는 모두를 포함하지 않는다. 본 발명의 양수 세포-유래 ECM과 골수 세포-유래 기질의 단백질에 있어서의 몇 가지 주목할만한 차이점은 표 1에 기술된다.
단백질/유전자 코드 | AFC-기질 및 BM-기질의 차이 | 생리학적 관련성 |
라미닌 | AFC 기질에서 5개 서브-유닛(sub-unit)이 풍부함; BM-기질에서 낮은 발현 | 라미닌은 만능세포의 부착 및 확장을 지원하는 것으로 알려짐. |
콜라겐ⅩⅤⅢ | AFC 기질에서 풍부함; BM-기질에서 부재 |
안구 발달(ocular development)에 중요 |
아그린 | AFC 기질에서 존재; BM-기질에서 부재 |
아세틸콜린 수용체(acetylcholine receptor)의 응집을 유도하도록 운동뉴런(motoneuron)에 의해 생성 |
비글리칸 | AFC 기질에서 풍부함; BM-기질에서 낮은 발현 |
뼈와 근육 발달 조절 |
콜라겐Ⅰ | AFC 기질과 비교하여 BM-기질에서 과발현(overexpressed) | 원섬유(fibrillar) 단백질의 핵심; 뼈에 매우 풍부 |
페리오스틴 | BM-기질에서 존재; AFC 기질에서 부재 |
광화 작용(mineralization)을 조절; 심장 내 비심근세포 계통 세포(noncardiomyocyte lineage cell)의 표지자 |
상기 양수 세포-유래 ECM은 하기 공정에 의해 생산될 수 있다:
(a) 양수로부터 세포를 분리하는 것;
(b) 분리된 세포를 세포 배양 용기 상 또는 기질로 코팅된 세포 배양 용기 상에 시딩(seeding)하는 것;
(c) 상기 세포 배양 용기에 배양 배지를 첨가하는 것; 및
(d) 세포를 배양함으로써 세포-유래 ECM을 형성하는 것; 및
(e) 선택적으로 상기 세포-유래 ECM을 탈세포화(decellularizing)하는 것.
세포가 융합성(confluent) 단일층을 즉시 또는 배양 시간적 기간 후에 형성하도록하는 임의의 세포 시딩 밀도가 사용될 수 있다. 일부 구체예에서, 상기 시딩 밀도는 약 10 내지 약 100,000 세포/cm2 또는 약 100 내지 약 75,000 세포/cm2 또는 약 500 내지 약 50,000 세포/cm2 또는 약 500 내지 약 10,000 세포/cm2 또는 약 500 내지 약 5,000 세포/cm2 또는 약 500 내지 약 2,500 세포/cm2 또는 약 1,000 내지 약 25,000 세포/cm2 또는 약 2,000 내지 약 10,000 세포/cm2 또는 약 3,000 내지 약 5,000 세포/cm2 이다.
세포의 배양에 적합한 임의의 유형의 용기가 본 발명에서 사용될 수 있다. 예시는 세포 배양 플라스크(cell culture flask), T-플라스크(T-flask), 교반 플라스크(stirred flask), 스피너 플라스크(spinner flask), 발효기(fermenter) 및 바이오리액터(bioreactor)를 비제한적으로 포함한다. 라킹 보틀(Rocking bottle), 쉐이킹 플라스크(shaking flask), 튜브(tube) 및 기타 용기도 라킹 플랫폼(rocking platform) 또는 쉐이커(shaker) 상에 위치할 때 적합한 용기다. 상기 세포 배양 용기는 보다 나은 세포 부착을 허영하기 위해 기질로 코팅될 수 있다. 상기 세포 용기를 코팅하기 위해 적합한 기질의 비제한적인 예시는 피브로넥틴이다.
다양한 상업적으로 가능한 세포 배양 배지, 예를 들어 alpha Minimum Essential Mediaα-MEM) 배양 배지(Thermo Fisher Scientific, Grand Island, NY)가 양수 세포의 배양에 적합하다. 상업적으로 이용 가능한 배양 배지는 소듐 바이카보네이트(sodium bicarbonate), L-글루타민(L-glutamine), 페니실린(penicillin), 스트렙토마이신(streptomycin), 암포테리신 B(Amphotericin B) 및/또는 세럼(serum)과 같은 다양한 보조 물질(supplemental substance)을 배지에 첨가하여 수정될 수 있다. 상기 세럼은 소 태아 세럼일 수 있다. 상기 배지는 또한 세럼 프리(serum free)일 수 있다. 추가적으로, L-아스코르브산(L-ascorbic acid)과 같은 물질이 ECM의 세포 생산을 유도하도록 상기 배지 또는 수정된 배지에 첨가될 수 있다.
상기 초기 배양 배지는 배양 과정 동안 다양한 시간에서 변경되고/거나 다른 배지로 교체될 수 있다. 예를 들면, 상기 초기 배지는 "완전 배지(complete media)"일 수 있고, 그 후 배양 과정 동안 "유도 배지(inducing media)"로 교체될 수 있다. "완전 배지"의 비제한적인 예시는 α-MEM 더하기 2mM L-글루타민 더하기 항생제-항진균제 더하기 15% 소 태아 세럼을 포함한다. "유도 배지"의 비제한적인 예시는 "완전 배지" 더하기 50mL L-아스코르브산을 포함한다.
양수 세포의 배양은 37℃, 5% CO2 및 90% 습도 조건의 인큐베이터(incubator)에서 일어날 수 있다. 배양은 다양한 환경 조건에서 일어날 수 있고, 예를 들어 20 내지 21%의 대기 중 산소 또는 저산소 조건을 비제한적으로 포함한다.
상기 양수 세포의 양수 세포-유래 ECM의 탈세포화는 생존 가능한(viable) 양수 세포를 제거하거나 양수 세포를 생존 불가능하게(non-viable) 만드는 것을 포함할 수 있다. 상기 양수 세포는 기술 분야에 알려진 방법을 이용하여 상기 ECM으로부터 탈세포화될 수 있고, 상기 기술은 상기 양수 세포를 용해(lysing)한 후 세척을 통해 상기 용해된 양수 세포를 제거하는 것을 비제한적으로 포함한다. 다양한 물질은 상기 ECM으로부터 상기 양수 세포를 제거하기 위해 사용될 수 있다. 비제한적인 예시는 PBS 버퍼(PBS buffer) 내의 TRITON X-100 및 암모늄 수산화물(ammonium hydroxide)을 포함하는 "추출 버퍼(Extraction Buffer)"를 포함한다. 상기 ECM이 양수 세포로부터 탈세포화된 후, 도출된 ECM은 그에 의해 필수적으로 세포가 없는 상태(cell-free)이거나 생존 가능한 양수 세포가 없는 상태(free of viable amniotic fluid cells)이다. 피더 세포(feeder cell)가 사용된다면, 상기 탈세포화 방법은 상기 ECM 상에 존재하는 임의의 생존 가능한 피더 세포에 또한 적용되고, 그로써 상기 ECM 내에 생존 가능한 어떠한 피더 세포도 필수적으로 없거나 없는 결과를 도출한다. 상기 탈세포화 방법은 상기 ECM 상에 존재하는 임의의 생존 가능한 세포에도 또한 적용되고, 그로써 상기 ECM 내에 생존 가능한 어떠한 세포도 필수적으로 없거나 없는 결과를 도출한다. 따라서, 탈세포화된 ECM은 ECM이 무세포(acellular)임을 의미하며, 상기 ECM에 어떠한 생존 가능한 세포도 없음을 의미한다.
일부 구체예에서, 상기 양수 세포-유래 ECM(AFC-ECM)은 삼차원(3D) ECM이다.
상기 기재된 방법은 또한 제대혈 및 와튼 젤리를 포함하는 탯줄로부터의 세포와 같은 다른 주산기 세포; 및 막 시트(양막 및 융모막), 융모 및 혈액을 포함하는 태반 조직으로부터의 세포로부터 세포-유래된 ECM을 생산하는데 적용될 수 있다.
일 구체예에서, 주산기 세포-유래 ECM은 하기 공정에 의해 생성된다:
(a) 탯줄로부터 세포를 분리하는 것;
(b) 분리된 세포를 세포 배양 용기 상 또는 기질로 코팅된 세포 배양 용기 상에 시딩하는 것;
(c) 상기 세포 배양 용기에 배양 배지를 첨가하는 것; 및
(d) 세포를 배양함으로써 세포-유래 ECM을 형성하는 것; 및
(e) 선택적으로 상기 세포-유래 ECM을 탈세포화하는 것.
일부 구체예에서, 상기 탯줄로부터 분리된 세포는 제대혈 및/또는 와튼 젤리로부터 유래한다.
또 다른 구체예에서, 주산기 세포-유래 ECM은 하기 공정에 의해 생성된다:
(a) 태반 조직으로부터 세포를 분리하는 것;
(b) 분리된 세포를 세포 배양 용기 상 또는 기질로 코팅된 세포 배양 용기 상에 시딩하는 것;
(c) 상기 세포 배양 용기에 배양 배지를 첨가하는 것; 및
(d) 세포를 배양함으로써 세포-유래 ECM을 형성하는 것; 및
(e) 선택적으로 상기 세포-유래 ECM을 탈세포화하는 것.
일부 구체예에서, 상기 태반 조직으로부터 분리된 세포는 막 시트(양막 및/또는 융모막), 융모 및/또는 혈액으로부터 유래된다.
한 측면에서, 탯줄로부터 분리된 세포로부터 인 비트로 유래된 세포-유래 세포외 기질(ECM)이 개시된다. 일부 구체예에서, 상기 탯줄로부터 분리된 세포는 제대혈 및 와튼 젤리로부터 유래한다.
또 다른 측면에서, 태반 조직으로부터 분리된 세포로부터 인 비트로 유래된 세포-유래 세포외 기질(ECM)이 개시된다. 일부 구체예에서, 상기 태반 조직으로부터 분리된 세포는 막 시트(양막 및/또는 융모막), 융모 및/또는 혈액으로부터 유래된다.
B. 미성숙 hiPSC-CM의 성숙을 위한 세포 구조 및 방법
인간 유도만능줄기세포로부터 유래된 미성숙 심근세포의 성숙을 위한 방법이 본원에 개시되며, 상기 방법은 다음을 포함하고: (a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것; (b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 미성숙 hiPSC-CM를 상기 AFC-ECM과 접촉하는 것; 및 (d) 상기 미성숙 hiPSC-CM의 성숙을 유도하도록 상기 미성숙 hiPSC-CM를 상기 AFC-ECM와 배양 배지에서 배양함으로써 성숙 심근세포(성숙 hiPSC-CM)를 형성하는 것; 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다. 정상적인 성체 인간 심장 인간 조직은 근절 구조(줄무늬 외형)을 가지는 로드 형상 세포인 것을 특징으로 한다. 상기 심근세포의 형태학과 근절 구조는 현미경에 의해 시각적으로 확인할 수 있다. 비제한적인 예시로써, AFC-ECM 상에서 성숙된 상기 심근세포의 형태학 및 근절 구조는 도 14의 현미경 사진 속 화살표로 확인되는 줄무늬 외형을 가지는 로드 형상 세포의 존재로부터 분명하게 보여진다.
또한 양수로부터 인 비트로 분리된 세포로부터 유래된 세포외 기질(AFC-ECM) 상에서 성숙 심근세포의 단일층을 포함하는 세포 구조가 본원에 개시된고, 상기 성숙 심근세포는 성체 인간 심장 세포와 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다. 특정 측면에서, 상기 성숙 심근세포는 상기 AFC-ECM 상에서의 배양에서 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)로부터 성숙될 수 있고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다. 일부 측면에서, 상기 성숙 심근세포는 내향-정류기 Kir2.1 포타슘 채널을 포함하고/거나 내향-정류기 포타슘 채널 Kir2.1을 발현한다. 일부 구체예에서, 상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다. 일부 구체예에서, 섬유 트랙이 상기 구조 상에 존재한다. 일부 구체예에서, 상기 AFC-ECM은 라미닌, 콜라겐 알파-1(ⅩⅤⅢ), 베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질, 아그린, 비멘틴 및 콜라겐 알파-2(Ⅳ) 및/또는 이들의 아이소폼을 포함한다. 일부 구체예에서, 상기 콜라겐 알파-1(ⅩⅤⅢ)의 아이소폼은 아이소폼 2 이고/거나 상기 아그린의 아이소폼은 아이소폼 6이다. 일부 구체예에서, 상기 AFC-ECM은 피브로넥틴 및/또는 이의 아이소폼을 더 포함한다. 일부 구체예에서, 상기 AFC-ECM은 데코린, 퍼레칸 및/또는 콜라겐(Ⅲ)을 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아를 가지고/거나 조직화되지 않은 미오필라멘트를 가지고/거나, 원형 형상을 가지고/거나, 단일한 핵을 가짐을 특징으로 할 수 있다. 일부 구체예에서, 상기 성숙 심근세포는 미성숙 hiPSC-CM보다 많은 양의 미토콘드리아를 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가짐을 더 특징으로 할 수 있다.
또한 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM) 상의 성숙 심근세포를 포함하는 세포 구조를 준비하는 방법이 본원에 개시되고, 상기 방법은 (a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것; (b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 AFC-ECM 상에 상기 미성숙 hiPSC-CM을 플레이팅(plating)하는 것; 및 (d) 성숙 심근세포 내에 상기 미성숙 hiPSC-CM의 성숙을 유도하고 상기 AFC-ECM 상에 상기 성숙 심근세포의 단일층을 형성하도록 배양 배지 내의 상기 AFC-ECM 상에 상기 플레이트 된 미성숙 hiPSC-CM를 배양함으로써 상기 세포 구조를 형성하는 것; 을 포함하고, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 한다. 일부 구체예에서, 상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다. 일부 구체예에서, 섬유 트랙이 상기 구조 상에 존재한다.
미성숙 hiPSC-CM은 상표명 iCell® 하의 Cellular Dynamics International-FUJI 및 상표명 Cellartis® 하의 Takara Bio와 같은 상업적 공급원으로부터 얻을 수 있다. iCell® Cardiomyocytes, iCell® Cardiomyocytes2 및 Cellartis® Cardiomyocytes는 바이알 내에서 사용할 수 있는 인간 유도만능줄기세포(hiPSC)로부터 유래한 냉동보존된 생존 가능한 심근세포이다. 미성숙 hiPSC-CM는 또한 특정 개인을 위해 실험실 세팅(setting)에서 환자 특이적 hiPSC를 생성할 수 있다. 이 경우에, 상기 hiPSC의 분화는 7일 분화 기간 동안 다양한 날짜에 GSK3 저해제(GSK3 inhibitor), RPMI/B27 마이너스 인슐린(RPMI/B27 minus insulin), Wnt 저해제(Wnt Inhibitor) 및 RPMI/B27 플러스 인슐린(RPMI/B27 plus insulin)를 사용하여 8 내지 10일 째에 박동하는(beating) 심근세포를 얻도록 작은 분자 프로토콜(small molecule protocol)을 사용하여 달성될 수 있다. 미성숙 hiPSC-CM을 생성하기 위한 방법의 적합한 비제한적인 예시는 본원에 참조되어 통합되는 미 공보(US publication) 2015/0329825에 개시된다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 내향-정류기 포타슘 채널 Kir2.1을 발현하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상 세포를 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 성숙 심근세포보다 적은 미토콘드리아를 가지고/거나 조직화되지 않은 미오필라멘트를 가지고/거나, 원형 형상을 가지고/거나, 단일한 핵을 가짐을 특징으로 할 수 있다.
상기 AFC-ECM은 본원에 개시된 제조 방법을 이용하여 수득될 수 있고, 본 개시에 묘사된 특징을 가질 수 있다. 일부 구체예에서, 상기 AFC-ECM은 상기 미성숙 hiPSC-CM과 접촉하기에 앞서 탈세포화된다.
상기 미성숙 hiPSC-CM은 상기 AFC-ECM과 접촉할 때 현탁액 내에 존재할 수 있으며 상기 세포는 적절한 세포 배양 용기 내에 또는 상에 또는 멀티-웰 플레이트(multi-well plate) 내에 있는 AFC-ECM 상에 직접 플레이팅 될 수 있다. 적합한 멀티-웰 플레이트의 비제한적인 예시는 6-, 12-, 24-, 48-, 96- 및 384-웰 플레이트를 포함한다. 일부 구체예에서, 상기 세포 배양 용기 또는 멀티-웰 플레이트의 접촉 표면은 상기 AFC-ECM을 형성하기에 앞서 폴리디메틸실록세인(polydimethylsiloxane; PDMS)으로 코팅된다. 일부 구체예에서, 상기 세포 배양 용기 또는 멀티-웰 플레이트의 접촉 표면은 상기 AFC-ECM을 형성하기에 앞서 PDMS으로 코팅되지 않는다. 미성숙 hiPSC-CM의 임의의 세포 시딩 밀도가 사용된다. 일부 구체예에서, 상기 세포가 즉시 또는 배양 시간적 기간 후에 융합성 단층을 형성하도록 하는 미성숙 hiPSC-CM의 세포 시딩 밀도가 사용된다. 세포 밀도는 단일층 형성을 개선하기를 원함에 따라 수정될 수 있다. 멀티-웰 플레이트에서, 상기 미성숙 hiPSC-CM 세포는 각 웰의 중앙에 위치한다. 다양한 멀티-웰 플레이트 내 미성숙 hiPSC-CM의 세포 시딩 밀도의 비제한적인 예시는 하기와 같다: 6-웰 플레이트에서, 약 200,000개 세포가 웰 당 플레이팅될 수 있다; 12-웰 플레이트에서, 약 150,000개 세포가 웰 당 플레이팅될 수 있다; 24-웰 플레이트에서, 약 175,000개 세포가 웰 당 플레이팅될 수 있다; 48-웰 플레이트에서, 약 100,000개 세포가 웰 당 플레이팅될 수 있다; 96-웰 플레이트에서, 약 50,000개 세포가 웰 당 플레이팅될 수 있다; 384-웰 플레이트에서, 약 15,000개 세포가 웰 당 플레이팅될 수 있다. 일부 구체예에서, 상기 미성숙 hiPSC-CM의 세포 시딩 밀도는 96-웰 플레이트에서 웰 당 약 50,000개 세포이다. 일부 구체예에서, 상기 세포 시딩 밀도는 6-웰 플레이트에서 웰당 약 200,000개 세포이다. 상기 밋어숙 hiPSC-CM의 성숙을 유도하기 위해, RPMO 배지 또는 Media 199 배지와 같은 적합한 배양 배지가 상기 AFC-ECM과 접촉하는 미성숙 hiPSC-CM에 첨가되고, 원형(native) 성체 심근세포와 유사한 형태학을 가지는 성숙 심근세포로 상기 세포가 성숙할 때 까지, 일반적으로 7일 시간의 기간동안 표준 세포 배양 기술을 이용하여 상기 세포가 상기 AFC-ECM과 함께 배양된다. 초기 3 내지 4일 동안, 상기 미성숙 hiPCS-CM은 접착하여 연속적인 단일층을 형성하고, 성숙 과정을 시작한다. 놀랍게도, 다른 기질로는 더 많은 시간적 기간 예를 들어 100일 까지 소요되는 것이 전형적인 반면, 상기 심근세포의 성숙을 위한 시간적 기간은 7일 또는 그 미만으로 소요된다. 이러한 성숙 심근세포의 형태학은 기존의 광학 현미경 기술을 이용하여 시각화 될 수 있었던 근육의 기본적인 수축(contractile) 단위인 분명한 근절 구조(줄무늬 외형)을 가지는 로드 형상 세포인 것을 특징으로 한다. 일부 구체예에서, 상기 성숙 심근세포는 상기 미성숙 hiPSC-CM보다 많은 미토콘드리아 양을 가지고/거나, 조직화되고 조밀한 미오필라멘트를 가지고/거나 2개의 핵(이중 핵형성)을 가짐을 더 특징으로 할 수 있다. 또한, 상기 AFC-ECM은 성숙한 심근세포가 따라가는 섬유 트랙을 자연적으로 생성할 수 있다. 이것은 원형(native) 심장을 더욱 유사하게 모방하는 단일층의 비등방도(degree of anisotropy)를 형성한다. 따라서, 상기 심근세포는 상기 AFC-ECM의 형성 동안 양수 세포에 의해 자연적인 비등방성(anisotropic) 배열 내에 배치되는 상기 AFC-ECM의 배열을 따라 상기 AFC-ECM 상에 자연적으로 배열될 수 있다. 다양한 구체예에서, 상기 미성숙 hiPSC-CM가 배양 내에서 성숙하기 위한 시간적 기간은 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 20, 25, 30, 40, 50, 60, 70, 80, 90, 100, 110 또는 120일 수 있다. 바람직하게는, 상기 심근세포의 성숙을 위한 시간적 기간은 14일, 또는 더욱 바람직하게는 10일, 또는 더욱 더 바람직하게는 7일이다. 일부 구체예에서, 상기 미성숙 hiPSC-CM가 배양에서 성숙하기 위한 시간적 기간은 7일이다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 상기 AFC-ECM 상에 플레이팅된다. 일부 구체예에서, 상기 성숙 심근세포는 배양 동안 상기 AFC-ECM 상에서 융합성 단일층으로 형성됨으로써 상기 AFC-ECM 상에서 성숙 심근세포의 단일층을 포함하는 세포 구조를 형성한다. 일부 구체예에서, 상기 성숙 심근세포는 상기 AFC-ECM 상에 배열된다. 일부 구체예에서, 상기 미성숙 hiPSC-CM는 멀티-웰 플레이트 내에서 상기 AFC-ECM 상에 플레이팅 된다. 일부 구체예에서, 상기 멀티-웰 플레이트는 폴리디메틸실록세인(polydimethylsiloxane; PDMS)의 삽입물을 포함한다. 일부 구체예에서, 상기 멀티-웰 플레이트는 PDMS의 삽입물을 포함하지 않는다.
C. 약물 화합물의 심장 독성 및/또는 전부정맥 효과를 결정하는 방법
약물 화합물의 심장 독성 및/또는 전부정맥 효과를 인 비트로 결정하는 방법이 본원에 개시되고, 상기 방법은 본 명세서에 걸쳐서 개시되는 세포 구조 중 임의의 하나의 성숙 심근세포와 상기 약물 화합물을 접촉시키는 것 및 상기 약물 화합물이 상기 성숙 심근 세포에 심장 독성 및/또는 전부정맥 효과가 있는지 확인하기 위해 상기 성숙 심근세포의 하나 또는 그 초과의 전기 생리학적 변화를 관찰하는 것을 포함한다. 상기 성숙 심근세포의 하나 또는 그 초과의 전기 생리학적 변화는 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 지시하고 확인한다. 성숙 심근세포의 하나 또는 그 초과의 전기 생리학적 변화는 APD 연장, APD 연장 플러스 로터 및/또는 빈박성 부정맥(tachyarrhythmia; TA), 정지(quiescence; Q), 지연 후탈분극(delayed afterdepolarization; DAD) 및/또는 조기 후탈분극(early afterdepolarization; EAD)과 같은 다양한 유형의 부정맥을 포함하나, 이에 제한되지 않는다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 활동 전위 지속 시간(action potential duration; APD)의 연장이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 조기 후탈분극(early after depolarization; EAD)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 지연 후탈분극(delayed after depolarization; DAD)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 활동 전위 지속시간 연장(APD prolongation) 플러스 로터(plus rotor)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 부정맥이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 빈박성 부정맥(tachyarrhythmia; TA)이다. 일부 구체예에서, 상기 성숙 심근세포의 전기 생리학적 변화는 정지(quiescence; Q)이다. 관찰은 또한 세포 생존성(viability), 세포 밀도 및/또는 상기 세포의 형태학을 포함할 수 있다. 일부 측면에서, 상기 세포 구조는 다음을 포함하는 과정에 의해 준비되고: (a) 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것; (b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 미성숙 hiPSC-CM를 상기 AFC-ECM 상에 플레이팅 하는 것; 및 (d) 상기 미성숙 hiPSC-CM의 성숙 심근세포로의 성숙을 유도하고 상기 성숙 심근세포를 상기 AFC-ECM 상에 단일 층으로 형성하도록 배양 배지 내에 상기 AFC-ECM 상에 상기 플레이팅 된 미성숙 hiPSC-CM를 배양하는 것; 이로써 세포 구조를 형성하며, 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 포함하는 로드 형상 세포임을 특징으로 한다. 다른 측면에서, 상기 방법은 본 명세서에 걸쳐 개시되는 세포 구조 중 임의의 하나와 상기 약물 화합물을 접촉시키고 심장 독성 및/또는 전부정맥 이벤트를 관찰하는 것을 포함한다. 일 특정 예에서, 상기 방법은 다음을 포함하고: (a) 인간 유도만능줄기세포로부터 유래한 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것; (b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것; (c) 상기 미성숙 hiPSC-CM를 상기 AFC-ECM 상에 플레이팅 하는 것; 및 (d) 상기 미성숙 hiPSC-CM의 성숙 심근세포로의 성숙을 유도하고 상기 성숙 심근세포를 상기 AFC-ECM 상에 단일 층으로 형성하도록 배양 배지 내에 상기 AFC-ECM 상에 상기 플레이팅 된 미성숙 hiPSC-CM를 배양하는 것; (e) 상기 구조의 상기 성숙 심근세포의 단일층에 상기 약물 화합물을 접촉시키는 것; (f) 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가지는지 확인하기 위하여 상기 성숙 심근세포의 전기 생리학적 변화를 관찰하는 것; 상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 포함하는 로드 형상 세포인 것을 특징으로 한다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 멀티-웰 플레이트에서 상기 AFC-ECM 상에 플레이팅된다. 일부 구체예에서, 상기 멀티-웰 플레이트는 폴리디메틸실록세인(polydimethylsiloxane; PDMS)의 삽입물을 포함한다. 일부 구체예에서, 상기 멀티-웰 플레이트는 PDMS의 삽입물을 포함하지 않는다. 일부 구체예에서, 상기 미성숙 hiPSC-CM은 내향-정류기 포타슘 채널 Kir2.1을 발현하지 않는다. 일부 구체예에서, 상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된다. 일부 구체예에서, 섬유 트랙이 상기 세포 구조 상에 존재한다.
심장 독성 및/또는 전부정맥 테스트는 이러한 활성을 측정하기에 적합한 임의의 유형의 장비를 사용하여 수행될 수 있다. 일부 구체예에서, AFC-ECM 상의 석숙 심근세포의 단일층의 세포 구조는 상기 기재된 바와 같이 준비된다. 상기 성숙 과정 이후(일반적으로 7일 또는 그 미만), 각 웰의 전기 생리학이 플레이트 리더(plate reader)를 이용하여 관찰된다. 적합한 전압 민감성 또는 칼슘 민감성 형광 염료가 각 웰에 로드된다. 비제한적인 전압 민감성 염료는 ThermoFisher로부터 상업적으로 이용 가능한 FluoVolt™을 포함한다. 일부 구체예에서, 상기 플레이트 리더는 각 염료를 여기(excite)시키는 적절한 파장의 적합한 라이팅(lighting), 예컨대 발광 다이오드(light emitting diode; LED)와 결합된 적합한 높은 시공간적(spatiotemporal) CCD 카메라에 의존할 수 있다. 이러한 높은 시공간적 CCD 카메라는 SciMeasure로부터 상업적으로 이용 가능하다. 일부 구체예에서, 상기 카메라 상 획득 속도는 초당 150 프레임보다 크거나 같다. 일부 구체예에서, 상기 카메라 및 렌즈 조합은 활동 전위 및 칼슘 파장 전파를 관찰하기에 충분한 해상도로 멀티-웰 플레이트의 모든 웰을 동시에 시각화하는 것을 가능하게 하도록 디자인 된다. 각 플레이트는 카메라 시스템 하에 배열되고, 라이팅이 켜지고, 카메라 획득시 개시되며, 전기 생리학적 활동이 기록된다. 실험은 약 37℃에서 수행된다. 베이스라인 판독이 이루어진 후, 테스트 될 약물이 상기 웰에 추가되고 그 효과가 기록된다. 자발적인 활동은 상을 얻기에 충분한 시간적 기간, 예컨대 최소 10초간 기록된다. 상기 상은 컴퓨터에 저장될 수 있다. 상을 분석하고 이미지 분석 소프트웨어를 이용하여 활동 전위 지속 시간, 전도 속도, 박동률 및 활성화 패턴이 정량화 될 수 있다. 전기적 파장 패턴(electrical wave pattern)의 시각화는 잠재적으로 치명적인 부정맥, 예컨대 Torsades de Pointes(TdP)을 발생하는 약물 화합물의 효과를 결정하는데 중요하다. 따라서, 자발적 활동 전위 지속 시간에 대한 화합물의 효과에 관한 정보를 제공하는 것에 더하여, 본원에 개시된 방법은 사용된 장비의 유형에 따라 임펄스(impulse) 전도 속도 및 활성화 패턴에 관한 정보 또한 제공할 수 있다.
D. 포유류 줄기 세포를 확장/증식하는 방법
포유동물의 세포의 분리, 유지 및 확장/증식을 위해 양수로부터 분리된 세포로부터 인 비트로 유래된 세포-유래 세포외 기질(AFC-ECM)을 이용한 방법 또한 본원에 개시된다. 인 비트로 세포 배양은 재생 의학(regenerative medicine) 및 조직 공학(tissue engineering)의 발전하는 분야 뿐만 아니라 모든 세포 생물학적 측면에서 아마 가장 보편적이고, 중요하며, 열악하게 이해된 것입니다. 첫째, 세포 거동의 관찰을 허용하여 세포 기능의 다양한 측면이 자세하게 연구될 수 있도록 합니다. 둘째, 특정 세포 군의 수를 증가할 수 있게 합니다. 기초 연구 뿐만 아니라 많은 임상적 적용을 위해서, 작은 생물학적 샘플로부터 상대적으로 희귀한 세포를 대량 얻을 수 있는 방법이 필요하다. 인-비트로 세포 배양은 적은 수의 세포가 신체 외부로 확장되어 보다 적절한 수를 달성할 수 있게 한다. 마지막으로, 사후 이용을 위한 세포 저장을 가능하게 한다. 인-비트로 세포의 수를 확장하고 사후 이용을 위해 생존 가능한 세포를 냉동함으로써, 상대적으로 작은 생물학적 샘플은 며칠, 몇 달 또는 심지어 몇 년에 걸쳐 여러 실험을 위한 세포를 생성할 수 있다.
세포 배양의 편재성(omnipresence)에도 불구하고, 인 비트로 배양이 세포의 원형(native) 특성에 미치는 영향은 여전히 상대적으로 열악하게 이해되고 있다. 현재의 많은 실행(practice)은 의도적인 사고, 계획 및 실험이 아니라 그 대신 우연한 관찰로부터 비롯되었다. 포유류 세포 배양은 1911년 Alexis Carrel 및 Montrose Burrows가 포유류 조직의 인 비트로 배양에 관한 학술 논문을 처음 발행하여 1900년대 초기부터 시작되었다. 그들은 포유류 조직의 일부를 자르고 그것을 현미경 슬라이드 상에 배치함으로써 조직의 생리학과 해부학을 연구하였다. 그들은 그 후 일부 세포가 상기 슬라이드 상에서 조직 밖으로 이동한다는 것을 알아냈다. 그들은 세포를 영구적으로(in perpetuity) 배양하기 위한 기술을 묘사하기 위해 계속했다. 현재는 그들의 관찰 중 일부가 유효하지 않은 것으로 보이지만, 그들의 작업은 현대 세포 배양의 길을 닦았다.
조혈모세포(hematopoietic stem cells; HSC)의 발견 이후, 전 세계에 걸친 그룹들이 HSC를 연구했다. 그들의 배양(현탁 상태에서)동안, 골수 세포의 하위-포퓰레이션(dub-population)이 플라스틱 플라스크의 바닥에 부착되어 증식하기 시작하는 것이 관찰되었다. 이러한 세포는 나중에 HSC와 구별되는 것으로 인식되어, 종국에는 중간엽 줄기세포(mesenchymal stem cell; MSC)라는 별명으로 불렸다. 이러한 MSC의 발견으로 이끈 우연한 발견 때문에, 플라스틱 부착성은 여전히 MSC 및 많은 다른 포유류 세포 유형의 정의 특성(defining attribute)로써 널리 사용된다.
플라스틱 기판 상에서 세포를 배양하는 실행은 세포 기능을 조절함에 있어서 미세 환경의 중요한 역할을 보여주는 실질적인 증거가 있기 때문에 문제가 될 수 있는데, 이는 현재 문헌을 통해 널리 받아들여진다. 상기 미세 환경은 줄기 및 전구(progenitor) 세포의 분화를 지시하고 성숙 세포 유형의 거동을 조절하는데 도움이 되는 것으로 보여진다.
세포가 인-비트로 확장되기 위해 그들의 원형(native) 환경에서 제거될 때, 그들은 그들 주위의 조성 및 상태에 관련된 중요한 정보를 상기 세포에 전달하는 그들 주변의 세포외 기질 또는 미세 환경으로부터의 중요한 큐(cue)를 상실할 수 있다. 세포의 미세환경에서의 변화는 해당 세포의 거동에 중대한 영향을 미칠 수 있다. 대부분의 부착성 세포의 인 비트로 분리 및 확장을 위한 현재의 표준은 폴리스타이렌(polystylene; 플라스틱)을 포함하는 배양 베슬(vessel) 내에 상기 세포를 배치하는 것이다. 상기 폴리스타이렌은 세포 부착 및 성장을 촉진하기 위하여 어떠한 방법으로 처리될 수 있으나, 대부분의 경우에 그 표면은 상기 세포에 완전히 이질적(foriegn)이다. 다른 경우에는 표면이 개별 기질 단백질(예컨대 피브로넥틴 또는 콜라겐) 또는 단백질의 어떠한 조합으로 코팅될 수 있다. 이러한 단순한 기질은 정상적인 세포 기능에 있어서 미세환경의 중요한 역할 뿐만 아니라 원형(native) 미세환경의 복잡성을 무시한다. 상기 세포는 세포가 그것의 원형(native) 환경에 있을 때와 훨씬 다른 방법으로 이러한 이질적 환경에 즉각 반응하기 시작한다.
플라스틱 기질 상에서 세포를 배양하는 이러한 문제를 해결하기 위하여 현재 다섯가지 주요한 접근법이 적용된다:
1. 문제를 무시하기 - 인 비보(in vivo) 예상되는 것과 일치하는 원하는 기능을 달성하기 위하는 시도를 하는 것 대신, 적절한 매트릭스 기질(matrix substrate) 없이 특정 원하는 기능을 보여줄 수 있는 세포를 찾기 위하여 다양한 배지에서 여러가지 세포 유형을 테스트 해 볼 수 있다. 이러한 접근 방식은 세련되지 않으며 변수의 복잡한 상호작용 및 세포와 상기 세포외 기질 간의 상호작용의 광범위함 때문에 원하는 결과를 도출하는 것에 종종 실패한다.
2. 주요한 구성요소를 식별하기 - 많은 학술적 실험실 및 여러 회사에서 세포가 분리되는 조직을 고려하여 세포 기능에 중요할 수 있는 그 조직의 특이한 요소를 찾는 접근법을 시도한다. 이후 세포는 단지 하나 또는 몇 가지 기질 구성 요소로 이루어진 단순한 기질 상에서 배양된다. 이러한 접근법은 기질이 일부 경우에 1백개가 넘는 다양한 단백질을 포함하는 자연적으로 매우 복잡한 환경이기 때문에 종종 실패한다. 세포는 그들이 필요로 하는 신호에 관하여 강력하게 반응하고, 그들이 필요하지 않지만 수신하는 신호에 관하여는 수신에 실패한다.
3. 샷건 접근법 - MATRIGEL™과 같은 단백질 겔의 사용은 일종의 샷건 접근법을 도입한다. 많은 다양한 세포 유형을 위해 필요한 바인딩 모티프(binding motif)를 포함할 수 있다는 희망을 가지고 많은 다양한 기질 단백질을 포함하는 겔이 생성된다. 이러한 접근법은 세포를 특정 방향으로 밀어내는 큐를 제공하거나 세포가 기대하는 모든 큐를 제공하는 것에 실패함으로써 실패할 수 있다.
4. 조직-유래 기질 - 이것은 유전학적으로 유사한 동물로부터 관심 대상 조직을 분리하고, 용액이나 균질한 현탁액을 얻기 위하여 물리적으로 파괴하거나 화학적으로 소화하며, 그 후 탈구조화 된 조직으로 배양 베슬을 코팅하는 것을 전형적으로 포함하는 생체모방적 접근방식이다. 예를 들면, 위성 세포(satellite cell)을 배양하려는 사람은 근육을 수집하고, 상기 조직을 균질화(homogenize)한 후, 상기 세포를 시딩함에 앞서 균질화 된 근육으로 배양 베슬을 코팅한다. 이러한 방법은 몇 가지 이유로 종종 실패한다. 첫째, 비록 특정 조직 유형 내에서지만, 상기 줅리 세포/전구 세포 니쉬(niche)는 상기 조직의 나머지 부분과 구별될 수 있다. 단순히 근육을 균질화하는 것은 적절한 니쉬가 형성될 것을 보장하지 못한다. 둘때로, 상기 니쉬는 생화학적 큐에 더하여 구조적 및 물리적 큐로 구성된다. 많은/대부분의 생화학적 큐가 조직 균질물 내에 존재한다고 하더라도, 상기 구조는 파괴되었고, 세포는 매우 다른 기계적 큐를 감지할 수도 있다. 마지막으로, 조직 유래 기질의 제조가능성(manufacturability)이 조직의 사용 가능성(availability)에 의존한다. 이는 가능한 세포 배양의 총량에 영향을 주며 로트-투-로트(lot-to-lot) 변동성에 기여한다.
5. 세포-유래 기질 - 배양 중인 세포는 그것들의 배양 베슬 내에서 기질을 분비하도록 유도될 수 있다. 이러한 기질은 인 비보 니쉬에서 사용 가능한 가장 최고의 근사법이며, 인 비트로 제조될 수 있다. 세포는 기질을 정교화하기(elaborate) 위하여 인 비트로 유도될 수 있고 그 후 상기 세포는 상기 기질의 구조 및 화학을 유지하기 위하여 예컨대 비-이온화 세재를 사용함으로써 상기 기질로부터 연속적으로 제거될 수 있다. 이러한 접근법은 몇가지 중요한 이점을 가진다. (1) 상기 기질 구조는 재현될 수 있고 그대로 둘 수 있다(left undisturbed). (2) 상기 기질은 관심 대상 조직/세포 유형에 기초하여 커스터마이징(customizing)될 수 있다. (3) 상기 기질은 줄기 및 전구 세포 니쉬에 특이적일 수 있다. (4) 상기 기질은 대량으로 제조될 수 있다.
세포-유래 기질과 관련하여, 모든 세포 유형이 임의의 주어진 세포-유래 기질에서 효율적으로 분리되고 확장될 수 있는 것은 아니다. 사실, 만능줄기세포(PSC)는 다른 유형의 세포보다 지지 성장 기질(supportive growth substrate)에 대해 매우 다른 요구사항을 가지는 것으로 보인다. 기질을 생성하는 데 사용되는 특정 세포 유형은 상기 기질의 조성에 영향을 미치고, 그러므로 해당 기질에 대한 다양한 세포 유형의 반응에도 영향을 미치는 것으로 알려졌다(Marinkovic, M. et al., One size does not fit all: developing a cell-specific niche for in vitro study of cell behavior. Matrix Biol. 54?55, 426?441 (2016) 참조). US 8,084,023에 개시된 선행 작업은 골수 기조직(stromal) 또는 간충직(mesenchymal) 줄기 세포에 의해 생성된 세포외 기질의 생성 및 조성을 기재한다(Chen, X. et al., Extracellular Matrix Made by Bone Marrow Cells Facilitates Expansion of Marrow-Derived Mesenchymal Progenitor Cells and Prevents Their Differentiation into Osteoblasts. Journal of Bone and Mineral Research 22, 1943-1956 (2007) 및 Lai, Y. et al., Reconstitution of marrow-derived extracellular matrix ex vivo: a robust culture system for expanding large-scale highly functional human mesenchymal stem cells. Stem cells and development 19, 1095-107 (2010) 참조). 이러한 골수 세포 유래 기질은 다른 MSC의 확장을 지지하는 것으로 보여졌지만 다른 유형의 줄기 세포, 특히 유도만능줄기세포(iPSC)의 부착 및 성장에는 효과적이지 않았다. iPSC는 MSC보다 훨씬 더 광범위한 카테고리에서 세포와 조직을 형성하는 확장된 잠재력을 보여주었다. 이는 표준 배양 조건에서 iPSC의 융합성 단일층의 성장의 어려움이 iPSC로부터 세포-유래 기질을 생산하는 것을 비실용적으로 만들기 때문에 특히 흥미로운 도전을 나타낸다. 종래 세포-유래 기질의 주요 한계는 조직-특이적 기질(예컨대 골수 MSC로부터의 골수 기질, 지방질(adipose) MSC로부터의 지방질 기질 또는 hUVEC으로부터의 내피(endothelial)기질)을 만들기 위해서는 세포의 타겟 포퓰레이션(target population)이 시작 기질에 이미 부착이 가능함을 필요로 한다는 것이다. iPSC, 배아줄기세포(ES) 및 많은 다른 세포 유형에서의 어려움은 그것들이 단순한 기질에는 쉽게 부착되지 않는다는 것이다.
본 개시는 만능줄기세포(PSC)의 분리, 확장 및 증식을 지원하기 위한 세포-유래 세포외 기질(ECM)과 관련된 기술에 있어서 전술한 한계와 결핍 중 적어도 일부에 대한 해결책을 제공하며, 상기 만능줄기세포에는 유도만능줄기세포(iPSC) 및 배아줄기세포(ES)를 포함하나, 이에 제한되지 않는다. 상기 해결책은 양수 세포-유래 세포외 기질의 사용을 전제로 한다. 양수에서 발견되는 언커미티드(uncommitted)하고, 쉽게 부착되며, 고도로 증식하는 주산기 세포의 사용은 놀랍게도 이러한 PSC의 부착, 분리, 확장 및 증식을 지원하는 세포외 기질(ECM)의 창조를 가능케 한다. 이러한 기술적 성취는 선행 기술의 세포-유래 ECM으로는 가능하지 않았다.
포유 동물 세포의 기능은 주로 그들이 거주하는 환경, 예컨대 세포외 기질에 의해 결정된다. 그들은 그들의 환경에 존재하는 신호(양성 신호) 및 그들이 필요로 하지만 존재하지 않는 신호(음성 신호)에 반응한다. 언커미티드한 줄기 세포는 줄기 세포의 생존력 및 줄기성(stemness)를 유지하는 데 필요한 니쉬 모티프(niche motif)를 포함하는 기질을 생설할 수 있지만, 더 성숙한 분비하여 줄기 세포를 특정 운명으로 밀어낼 수 있는 많은 계통 특이적 신호가 부족한 듯 하다. 이론에 국한되려는 것은 아니나, 예를 들어 주산기 세포 또는 주산기 줄기 세포와 같은 덜 성숙한 세포는 기술 분야에서 종래 개시된 ECM, 예컨대 골수 기조직 세포-유래 ECM과 같은 ECM과 다른 ECM을 생성하고, 만능줄기세포(PSC)와 같은 간엽줄기세포(mesenchymal stem cell; MSC)보다 더 높은 가능성을 가지는 줄기 세포의 더 나은 분리 및 확장/증식을 가능케 할 수 있다는 것이 제안되었다. 질량 분석은 종래 알려진 세포-유래 ECM과 비교하여, 본 발명의 양수 세포-유래 ECM은 세가지 생식 층 모두에서 발견되는 기질 단백질을 포함하고, 골형성(osteogenic) 계통과 강하게 관련된 특정 단백질은 결여했다는 것을 보여준다. 더욱이, 본 개시의 ECM은 만능 세포 부착 및 확장을 촉진하는 것으로 알려진 라미닌과 같은 특정 모티프를 포함한다.
만능줄기세포(PSC)는 자가-재생(self-renew)할 수 있고 세가지 생식 층 중 어떠한 것으로도 분화할 수 있다: 모든 조직 및 기관이 발달하는 외배엽, 내배엽 및 중배엽. 배아줄기세포(ES)는 현재 유일하게 알려진 자연(natural) 만능줄리세포이다. 유도만능줄기세포(iPSC) 역시 PSC이다. iPSC는 성체 조직 또는 성체 세포로부터 일반적으로 채취되어 배아줄기세포 단계로 리프로그램(reprogram) 된 세포로부터 유래한다. iPSC를 생성하는 방법은 기술 분야에서 공지되었다.
만능줄기세포(PSC)를 확장/증식하는 방법은 PSC를 얻고 이를 본 발명의 양수 세포-유래 ECM의 존재 하에 배양하는 것을 포함한다. 상기 PSC는 iPSC 또는 ES일 수 있다. 세포가 즉시 또는 배양에서 시간적 기간 후에 융합성 단일층을 형성하도록 하는 임의의 시딩 밀도가 사용될 수 있다. 일부 구체예에서, 상기 시딩 밀도는 약 10 내지 약 100,000 세포/cm2 또는 약 100 내지 약 75,000 세포/cm2 또는 약 500 내지 약 50,000 세포/cm2 또는 약 500 내지 약 10,000 세포/cm2 또는 약 500 내지 약 5,000 세포/cm2 또는 약 500 내지 약 2,500 세포/cm2 또는 약 1,000 내지 약 25,000 세포/cm2 또는 약 2,000 내지 약 10,000 세포/cm2 또는 약 3,000 내지 약 5,000 세포/cm2 이다.
일부 구체예에서, PSC는 미분화 상태로 유지되고 줄기성(stemness)를 유지한다. 배양에서 PSC의 증식에 적합한 세포 배양 기술은 기술 분야에서 공지되었다. 줄기 세포 증식을 위한 적합하고 상업적으로 이용가능한 배양 배지는 Miltenyl Biotec에서 이용 가능한 StemMACS™ iPS-Brew XF를 포함하나 이에 제한되지 않는다. 일부 구체예에서, Rock 저해제는 사용되지 않는다. 세포가 일단 융합성에 접근하기 시작할 때(예컨대 명시야 현미경을 통해 결정된 바), 큰 콜로니(colony)를 작은 콜로니를 절단하고 그것을 디쉬로부터 물리적으로 리프트 오프(lift off) 하고 그것을 양수 세포-유래 ECM이 있는 새로운 플레이트에 배치함으로써 리플레이팅함으로써 세포들은 수동적으로 계대(passaged) 배양될 수 있다. 이러한 절차는 무제한적으로 반복될 수 있다. 일부 구체예에서, 배양에서 만능줄기세포(PSC)를 증식하는 방법이 개시되고, 상기 방법은 배양 배지 내에서 세포-유래 세포외 기질(ECM)의 존재 하에 PSC를 배양함으로써 PSC를 증식하는 것을 포함하고, 상기 세포-유래 ECM은 양수로부터 분리된 세포로부터 인 비트로 유래된다.
상기 기재된 PSC를 확장/증식시키는 방법은 다른 주산기 세포-유래 ECM의 존재 하 배양에서 확장/증식 PSC의 사용에도 또한 적용된다. 일부 구체예에서, 배양에서 만능줄기세포(PSC)를 증식시키는 방법이 개시되고, 상기 방법은 상기 PSC를 배양 배지내에서 세포-유래 세포외 기질(ECM)의 존재 하에 배양함으로써 PSC를 증식시키는 것을 포함하고, 상기 세포-유래 ECM은 탯줄 또는 태반 조직으로부터 분리된 세포로부터 인-비트로 유래된다. 일부 구체예에서, 탯줄로부터 분리된 세포는 제대혈 및/또는 와튼 젤리로부터 유래한다. 다른 구체예에서, 태반 조직으로부터 분리된 세포는 막 시트(양막 및/또는 융모막), 융모 및/또는 혈액으로부터 유래한다.
실시예
하기 실시예는 본 발명의 특정 비제한적 측면을 보여주기 위하여 포함된다. 후술할 실시예에 개시된 기술이 본 발명의 실제에서 잘 기능하기 위하여 출원인에 의해 발견된 기술을 나타낸다는 것이 기술 분야의 기술자에 의해 이해되어야 한다. 그러나, 기술 분야의 기술자는, 본 개시에 비추어, 개시되는 특정 구체예에서 많은 변화를 가할 수 있고 본 발명의 사상 및 범위를 벗어나지 않고 유사한 결과를 얻을 수 있음을 이해해야 한다.
실시예 1- 양수 세포-유래 ECM(AFC-ECM)의 생산
4 개의 양수 세포-유래 ECM(기질 A, 기질 B, 기질 C 및 기질 D)가 하기 절차를 이용하여 제조되었다: 4명의 공여자로부터 만삭기에(37주 초과 잉태 연령) 수집된 양수로부터 무균상태로 분리된 세포가 피브로넥틴 코팅되어 조직-배양 처리된 플라스크 상에 시딩되고 인큐베이터 내에서 37°C, 5% CO2 및 90% 상대 습도에서 완전 배지 내에서 배양되었다. 상기 완전 배지는 알파 최소 필수 배지(alpha Minimum Essential Media; aMEM) 더하기 2mM L-글루타민 더하기 항생제-항진균제 더하기 15% 소 태아 세럼이었다.
3 내지 4일째, 상기 완전 배지의 절반을 상기 플라스크로부터 흡입(aspirate)하고 새로운 완전 배지의 절반으로 교체되었다. 상기 플라스크는 상술된 바와 동일한 조건에서 상기 인큐베이터에 다시 배치되었다.
7 내지 8일 째, 상기 완전 배지를 배양 플라스크로부터 흡입하고 유도 배지로 보충하였다. 상기 플라스크는 상술된 바와 동일한 조건에서 상기 인큐베이터에 다시 배치되었다. 상기 유도 배지는 완전 배지 더하기 50mM L-아스코르브산이었다.
10 내지 11일 째, 상기 유도 배지를 배양 플라스크로부터 흡인하고 상기 플라스크 내부에 형성된 ECM을 포스페이트 완충 살린(phosphate buffered saline; PBS)으로 세척하였다. 그 후 상기 PBS는 상기 플라스크로부터 흡입되었다. 추출 버퍼(extraction buffe)가 상기 플라스크에 첨가되고 각 ECM을 탈세포화 하기 위하여 상온에서 7 내지 10분 배양되었고, 그 후 상기 추출 버퍼는 상기 플라스크로부터 흡입되었다. 상기 추출 버퍼는 0.5% (v/v) TRITON-X100 및 20mM 암모늄수산화물(NH4OH)를 포함하는 PBS 이었다.
상기 플라스크 내 각 탈세포화된 ECM은 PBS로 3회 세척한 후 멸균수로 1회 세척되고, 그 후 상기 멸균수는 상기 플라스크로부터 흡입되었다. 상기 플라스크 내 4개의 탈세포화 된 ECM을 실온에서 건조시킨 후 4℃에서 보관하였다.
10x 대물 렌즈를 사용한 100x 배율 양수 세포-유래 ECM(기질 B)의 명시야 상 현미경 사진이 도 1에 도시되었다. 토포그래피(topography), 어드헤션(adhesion) 및 스티프니스(stiffness)를 보여주는 양수 세포-유래 ECM(기질 B) 및 골수-유래 ECM의 3개 대표 40 x 40um 섹션의 원자력(atomic force) 현미경 사진이 도 2에 도시되었다. 상기 골수- 및 양수- 세포-유래 ECM은 구조적 및 물리적으로 구별된다. 골수- 및 양수- 세포-유래 ECM의 어드헤션 및 스티프니스(탄성 모듈러스)의 정량화는 도 3a(어드헤션) 및 도 3b(스티프니스)의 스캐터 플롯에 보여지는 바와 같이 골수 ECM이 양수 ECM에 비하여 10배 스티프(stiff)하고, 3배 덜 어드헤시브(adhesive)하다는 것을 보여주며, 여기서 BM = 골수 세포-유래 ECM,AD = 양수 세포-유래 ECM(기질 B)이다. 각 점은 독립적인 측정 포인트를 나타낸다.
실시예 2- 양수 세포-유래 ECM의 조성
실시예 1에서 생성된 각 양수 세포-유래 ECM의 조성은 질량 분석법에 의해 결정되었다. 스펙트럼 수와 분자량을 포함하는 구성이 표 2에 나열된다.
단백질 |
분자량
(MW) |
전체 스펙트럼 수 | |||
기질 A | 기질 B | 기질 C | 기질 D | ||
피브로넥틴 아이소폼 7 OS=Homo sapiens OX=9606 GN=FN1 | 269 kDa | 817 | 13965 | 1143 | 794 |
피브로넥틴 아이소폼 3 OS=Homo sapiens OX=9606 GN=FN1 | 259 kDa | 807 | 13836 | 1150 | 790 |
피브로넥틴 OS=Homo sapiens OX=9606 GN=FN1 PE=1 SV=4 | 263 kDa | 802 | 13851 | 1138 | 781 |
피브로넥틴 아이소폼 14 OS=Homo sapiens OX=9606 GN=FN1 | 249 kDa | 770 | 12625 | 1103 | 763 |
피브로넥틴 아이소폼 10 OS=Homo sapiens OX=9606 GN=FN1 | 240 kDa | 758 | 12506 | 1082 | 746 |
미오신-9 OS=Homo sapiens OX=9606 GN=MYH9 PE=1 SV=4 | 227 kDa | 564 | 3923 | 295 | 340 |
SWISS-PROT:P60712 (Bos taurus) 액틴, 사이토플라즈믹 1 | 42 kDa | 293 | 2496 | 450 | 395 |
비멘틴 OS=Homo sapiens OX=9606 GN=VIM PE=1 SV=4 | 54 kDa | 263 | 1179 | 178 | 338 |
신경모세포(neuroblast) 분화-관련 단백질 AHNAK OS=Homo sapiens OX=9606 GN=AHNAK PE=1 SV=2 | 629 kDa | 250 | 803 | 17 | 184 |
히스톤 H2B 타입 1-D OS=Homo sapiens OX=9606 GN=HIST1H2BD PE=1 SV=2 | 14 kDa | 212 | 1121 | 176 | 187 |
필라민-A 아이소폼 2 OS=Homo sapiens OX=9606 GN=FLNA | 280 kDa | 212 | 342 | 12 | 143 |
베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질 OS=Homo sapiens OX=9606 GN=HSPG2 PE=1 SV=4 | 469 kDa | 202 | 0 | 402 | 338 |
플렉틴 아이소폼 4 OS=Homo sapiens OX=9606 GN=PLEC | 516 kDa | 185 | 337 | 10 | 83 |
SWISS-PROT:P02769 (Bos taurus) Bovine 세럼 알부민 전구체 | 69 kDa | 122 | 112 | 53 | 72 |
튜불린 베타 체인 OS=Homo sapiens OX=9606 GN=TUBB PE=1 SV=2 | 50 kDa | 117 | 0 | 36 | 92 |
스펙트린 알파 체인, 논-적혈구성(논-적혈구) 1 OS=Homo sapiens OX=9606 GN=SPTAN1 PE=1 SV=3 | 285 kDa | 107 | 342 | 10 | 78 |
튜불린 베타-4B 체인 OS=Homo sapiens OX=9606 GN=TUBB4B PE=1 SV=1 | 50 kDa | 107 | 0 | 34 | 84 |
스펙트린 알파 체인, 논-적혈구성 1 아이소폼 3 OS=Homo sapiens GN=SPTAN1 | 282 kDa | 106 | 345 | 0 | 77 |
히스톤 H4 OS=Homo sapiens OX=9606 GN=HIST1H4A PE=1 SV=2 | 11 kDa | 100 | 1257 | 91 | 96 |
튜불린 베타-4A 체인 OS=Homo sapiens OX=9606 GN=TUBB4A PE=1 SV=2 | 50 kDa | 99 | 0 | 31 | 76 |
단백질-글루타민 감마-글루타밀전달효소 2 OS=Homo sapiens OX=9606 GN=TGM2 PE=1 SV=2 | 77 kDa | 94 | 188 | 73 | 25 |
SWISS-PROT:P00761|TRYP_PIG 트립신 - Sus scrofa (돼지). | 24 kDa | 94 | 362 | 121 | 96 |
튜불린 알파-1B 체인 OS=Homo sapiens OX=9606 GN=TUBA1B PE=1 SV=1 | 50 kDa | 93 | 295 | 37 | 86 |
클라트린 헤비 체인 아이소폼 2 1 OS=Homo sapiens OX=9606 GN=CLTC | 188 kDa | 92 | 97 | 1 | 15 |
튜불린 베타-2A 체인 OS=Homo sapiens OX=9606 GN=TUBB2A PE=1 SV=1 | 50 kDa | 92 | 0 | 32 | 73 |
늘임 인자(Elongation factor) 1-알파 1 OS=Homo sapiens OX=9606 GN=EEF1A1 PE=1 SV=1 | 50 kDa | 89 | 132 | 14 | 70 |
튜불린 알파-1A 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=TUBA1A | 46 kDa | 88 | 305 | 34 | 82 |
탈린-1 OS=Homo sapiens OX=9606 GN=TLN1 PE=1 SV=3 | 270 kDa | 88 | 109 | 4 | 41 |
미오신-10 OS=Homo sapiens GN=MYH10 PE=1 SV=3 | 229 kDa | 84 | 417 | 56 | 46 |
스펙트린 베타 체인, 논-적혈구성 1 OS=Homo sapiens OX=9606 GN=SPTBN1 PE=1 SV=2 | 275 kDa | 84 | 260 | 7 | 61 |
피루브산 키나아제 PKM OS=Homo sapiens OX=9606 GN=PKM PE=1 SV=4 | 58 kDa | 83 | 73 | 21 | 46 |
튜불린 알파-1C 체인 OS=Homo sapiens OX=9606 GN=TUBA1C PE=1 SV=1 | 50 kDa | 83 | 0 | 0 | 78 |
주요 볼트 단백질 OS=Homo sapiens OX=9606 GN=MVP PE=1 SV=4 | 99 kDa | 82 | 360 | 68 | 108 |
액틴, 대동맥(aortic) 평활근(smooth 근육) OS=Homo sapiens OX=9606 GN=ACTA2 PE=1 SV=1 | 42 kDa | 78 | 0 | 126 | 77 |
액틴, 감마-장(enteric) 평활근 OS=Homo sapiens OX=9606 GN=ACTG2 PE=1 SV=1 | 42 kDa | 76 | 313 | 122 | 73 |
알파-액티닌-4 OS=Homo sapiens OX=9606 GN=ACTN4 PE=1 SV=2 | 105 kDa | 75 | 199 | 11 | 76 |
필라민-B 아이소폼 8 OS=Homo sapiens OX=9606 GN=FLNB | 282 kDa | 75 | 123 | 2 | 94 |
튜불린 알파-4A 체인 OS=Homo sapiens OX=9606 GN=TUBA4A PE=1 SV=1 | 50 kDa | 73 | 262 | 0 | 65 |
글리세르알데히드-3-포스페이트 탈수소효소(dehydrogenase) OS=Homo sapiens OX=9606 GN=GAPDH PE=1 SV=3 | 36 kDa | 71 | 145 | 24 | 66 |
사이토플라즈믹 디네인 1 헤비 체인 1 OS=Homo sapiens OX=9606 GN=DYNC1H1 PE=1 SV=5 | 532 kDa | 65 | 49 | 0 | 5 |
히스톤 H2A.J OS=Homo sapiens OX=9606 GN=H2AFJ PE=1 SV=1 | 14 kDa | 65 | 216 | 62 | 79 |
세르핀 H1 OS=Homo sapiens OX=9606 GN=세르핀H1 PE=1 SV=2 | 46 kDa | 64 | 731 | 128 | 97 |
히스톤 H2A 타입 2-C OS=Homo sapiens OX=9606 GN=HIST2H2AC PE=1 SV=4 | 14 kDa | 63 | 0 | 61 | 82 |
알파-액티닌-1 OS=Homo sapiens GN=ACTN1 PE=1 SV=2 | 103 kDa | 62 | 217 | 19 | 77 |
히스톤 H2AX OS=Homo sapiens OX=9606 GN=H2AFX PE=1 SV=2 | 15 kDa | 61 | 0 | 69 | 75 |
튜불린 베타-3 체인 OS=Homo sapiens OX=9606 GN=TUBB3 PE=1 SV=2 | 50 kDa | 58 | 194 | 28 | 53 |
소포체(Endoplasmic reticulum) 샤프롱(chaperone) BiP OS=Homo sapiens OX=9606 GN=HSPA5 PE=1 SV=2 | 72 kDa | 57 | 0 | 35 | 46 |
미오신 조절 라이트 체인 12A OS=Homo sapiens OX=9606 GN=MYL12A PE=1 SV=1 | 20 kDa | 57 | 0 | 244 | 153 |
미오신 조절 라이트 체인 12B OS=Homo sapiens OX=9606 GN=MYL12B PE=1 SV=2 | 20 kDa | 57 | 0 | 240 | 149 |
늘임 인자 2 OS=Homo sapiens OX=9606 GN=EEF2 PE=1 SV=4 | 95 kDa | 53 | 72 | 3 | 45 |
필라민-C OS=Homo sapiens OX=9606 GN=FLNC PE=1 SV=3 | 291 kDa | 53 | 62 | 3 | 63 |
히스톤 H3.1 OS=Homo sapiens OX=9606 GN=HIST1H3A PE=1 SV=2 | 15 kDa | 53 | 0 | 24 | 33 |
60 kDa 히트 쇼크(heat shock) 단백질, 미토콘드리아(mitochondrial) OS=Homo sapiens OX=9606 GN=HSPD1 PE=1 SV=2 | 61 kDa | 52 | 58 | 14 | 58 |
튜불린 베타-6 체인 OS=Homo sapiens OX=9606 GN=TUBB6 PE=1 SV=1 | 50 kDa | 52 | 0 | 23 | 52 |
콜라겐 알파-1(XII) 체인 아이소폼 4 OS=Homo sapiens OX=9606 GN=COL12A1 | 325 kDa | 51 | 35 | 36 | 27 |
뉴클레오포스민(Nucleophosmin) OS=Homo sapiens OX=9606 GN=NPM1 PE=1 SV=2 | 33 kDa | 48 | 103 | 15 | 43 |
프리라민(Prelamin)-A/C OS=Homo sapiens OX=9606 GN=LMNA PE=1 SV=1 | 74 kDa | 48 | 149 | 20 | 39 |
히트 쇼크 단백질 HSP 90-베타 OS=Homo sapiens OX=9606 GN=HSP90AB1 PE=1 SV=4 | 83 kDa | 47 | 0 | 3 | 31 |
라스(Ras) GTP아제-활성화-유사 단백질 IQGAP1 OS=Homo sapiens OX=9606 GN=IQGAP1 PE=1 SV=1 | 189 kDa | 47 | 0 | 11 | 36 |
히트 쇼크 동계(cognate) 71 kDa 단백질 OS=Homo sapiens OX=9606 GN=HSPA8 PE=1 SV=1 | 71 kDa | 46 | 130 | 28 | 56 |
아넥신 A2 OS=Homo sapiens OX=9606 GN=ANXA2 PE=1 SV=2 | 39 kDa | 43 | 111 | 5 | 40 |
콜라겐 알파-1(XVIII) 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=COL18A1 | 154 kDa | 42 | 575 | 77 | 61 |
미오신 조절 라이트 폴리펩티드 9 OS=Homo sapiens OX=9606 GN=MYL9 PE=1 SV=4 | 20 kDa | 42 | 380 | 131 | 81 |
아그린 아이소폼 6 OS=Homo sapiens OX=9606 GN=AGRN | 215 kDa | 41 | 168 | 42 | 70 |
히스톤 H3.2 OS=Homo sapiens OX=9606 GN=HIST2H3A PE=1 SV=3 | 15 kDa | 40 | 0 | 17 | 25 |
코어 히스톤 매크로-H2A.1 아이소폼 1 OS=Homo sapiens OX=9606 GN=H2AFY | 39 kDa | 40 | 450 | 43 | 49 |
ATP 신타아제 서브유닛 베타, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ATP5F1B PE=1 SV=3 | 57 kDa | 39 | 94 | 14 | 45 |
T-컴플렉스 단백질 1 서브유닛 알파 OS=Homo sapiens OX=9606 GN=TCP1 PE=1 SV=1 | 60 kDa | 39 | 0 | 25 | 36 |
히트 쇼크 단백질 HSP 90-알파 아이소폼 2 OS=Homo sapiens GN=HSP90AA1 | 98 kDa | 38 | 80 | 1 | 20 |
이행형(transitional)소포체 ATP아제 OS=Homo sapiens OX=9606 GN=VCP PE=1 SV=4 | 89 kDa | 38 | 86 | 1 | 37 |
TREMBL:Q3KNV1;Q96GE1 Tax_Id=9606 Gene_Symbol=KRT7 케라틴 7 | 51 kDa | 38 | 334 | 58 | 133 |
알파-2-매크로글로불린 아이소폼 1 유사 (Bos taurus) | 164 kDa | 37 | 14 | 9 | 13 |
이종성(Heterogeneous) 핵 리보핵단백질 U OS=Homo sapiens OX=9606 GN=HNRNPU PE=1 SV=6 | 91 kDa | 35 | 64 | 12 | 29 |
히스톤 H3.3 OS=Homo sapiens OX=9606 GN=H3F3A PE=1 SV=2 | 15 kDa | 35 | 0 | 17 | 43 |
마이크로튜불-관련 단백질 4 OS=Homo sapiens OX=9606 GN=MAP4 PE=1 SV=3 | 121 kDa | 35 | 73 | 8 | 26 |
베타-액틴-유사 단백질 2 OS=Homo sapiens OX=9606 GN=ACTBL2 PE=1 SV=2 | 42 kDa | 34 | 147 | 42 | 31 |
케라틴, 타입 I 세포골격 10 OS=Homo sapiens OX=9606 GN=KRT10 PE=1 SV=6 | 59 kDa | 34 | 464 | 32 | 37 |
리보솜-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=RRBP1 PE=1 SV=5 | 152 kDa | 34 | 80 | 17 | 22 |
세포골격-관련 단백질 4 OS=Homo sapiens OX=9606 GN=CKAP4 PE=1 SV=2 | 66 kDa | 33 | 139 | 30 | 35 |
DNA-의존 단백질 키나아제 촉매성 서브유닛 OS=Homo sapiens OX=9606 GN=PRKDC PE=1 SV=3 | 469 kDa | 33 | 10 | 0 | 5 |
아데닐릴 시클라아제-관련 단백질 1 OS=Homo sapiens OX=9606 GN=CAP1 PE=1 SV=5 | 52 kDa | 32 | 33 | 2 | 37 |
케라틴, 타입 I 세포골격 9 OS=Homo sapiens OX=9606 GN=KRT9 PE=1 SV=3 | 62 kDa | 31 | 643 | 61 | 50 |
라미닌 서브유닛 알파-5 OS=Homo sapiens OX=9606 GN=LAMA5 PE=1 SV=8 | 400 kDa | 31 | 50 | 7 | 13 |
피불린-1 C 아이소폼 1유사 (Bos taurus) | 77 kDa | 30 | 71 | 40 | 18 |
60S 리보솜 단백질 L4 OS=Homo sapiens OX=9606 GN=RPL4 PE=1 SV=5 | 48 kDa | 30 | 75 | 26 | 25 |
알파-에놀라제 OS=Homo sapiens OX=9606 GN=ENO1 PE=1 SV=2 | 47 kDa | 30 | 61 | 3 | 26 |
ATP 신타아제 서브유닛 알파, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ATP5F1A PE=1 SV=1 | 60 kDa | 30 | 52 | 12 | 34 |
이종성 핵 리보핵단백질 M OS=Homo sapiens OX=9606 GN=HNRNPM PE=1 SV=3 | 78 kDa | 30 | 114 | 12 | 30 |
히스톤 H2A.V OS=Homo sapiens OX=9606 GN=H2AFV PE=1 SV=3 | 14 kDa | 30 | 131 | 23 | 34 |
리실 옥시다아제 동족체(homolog) 2 OS=Homo sapiens OX=9606 GN=LOXL2 PE=1 SV=1 | 87 kDa | 30 | 320 | 94 | 52 |
MICOS 컴플렉스 서브유닛 MIC60 OS=Homo sapiens OX=9606 GN=IMMT PE=1 SV=1 | 84 kDa | 30 | 98 | 20 | 36 |
SWISS-PROT:P12763 (Bos taurus) 알파-2-HS-당단백질 전구체 | 38 kDa | 30 | 42 | 18 | 19 |
엔도플라스민 OS=Homo sapiens OX=9606 GN=HSP90B1 PE=1 SV=1 | 92 kDa | 29 | 71 | 3 | 22 |
TREMBL:Q0IIK2 (Bos taurus) 트랜스퍼린 | 78 kDa | 29 | 15 | 2 | 16 |
라미닌 서브유닛 베타-1 OS=Homo sapiens OX=9606 GN=LAMB1 PE=1 SV=2 | 198 kDa | 28 | 30 | 4 | 11 |
T-컴플렉스 단백질 1 서브유닛 베타 OS=Homo sapiens OX=9606 GN=CCT2 PE=1 SV=4 | 57 kDa | 27 | 117 | 19 | 31 |
T-컴플렉스 단백질 1 서브유닛 델타 OS=Homo sapiens OX=9606 GN=CCT4 PE=1 SV=4 | 58 kDa | 27 | 73 | 19 | 26 |
이종성 핵 리보핵단백질 K OS=Homo sapiens OX=9606 GN=HNRNPK PE=1 SV=1 | 51 kDa | 26 | 28 | 3 | 26 |
이기능성 글루타메이트/프롤린--tRNA 리가아제 OS=Homo sapiens OX=9606 GN=EPRS PE=1 SV=5 | 171 kDa | 25 | 20 | 0 | 1 |
빈쿨린 아이소폼 1 OS=Homo sapiens OX=9606 GN=VCL | 117 kDa | 25 | 25 | 1 | 26 |
MICOS 컴플렉스 서브유닛 아이소폼 2 MIC60 OS=Homo sapiens OX=9606 GN=IMMT | 83 kDa | 25 | 99 | 17 | 34 |
T-컴플렉스 단백질 1 서브유닛 세타 OS=Homo sapiens OX=9606 GN=CCT8 PE=1 SV=4 | 60 kDa | 25 | 100 | 21 | 30 |
디히드로피리미디나제-관련 단백질 3 아이소폼 LCRMP-4 OS=Homo sapiens OX=9606 GN=DPYSL3 | 74 kDa | 24 | 11 | 4 | 40 |
트롬보스폰딘-1 OS=Homo sapiens OX=9606 GN=THBS1 PE=1 SV=2 | 129 kDa | 24 | 103 | 3 | 1 |
14-3-3 단백질 베타/알파 아이소폼 Short OS=Homo sapiens OX=9606 GN=YWHAB | 28 kDa | 23 | 18 | 2 | 14 |
미오신 라이트 폴리펩티드 6 아이소폼 평활근 OS=Homo sapiens OX=9606 GN=MYL6 | 17 kDa | 23 | 204 | 37 | 28 |
케라틴, 타입 I 세포골격 18 OS=Homo sapiens OX=9606 GN=KRT18 PE=1 SV=2 | 48 kDa | 23 | 376 | 99 | 120 |
케라틴, 타입 II 세포골격 8 OS=Homo sapiens OX=9606 GN=KRT8 PE=1 SV=7 | 54 kDa | 23 | 1404 | 107 | 155 |
라민-B1 OS=Homo sapiens OX=9606 GN=LMNB1 PE=1 SV=2 | 66 kDa | 23 | 67 | 7 | 21 |
L-젖산 탈수소효소 A 체인 OS=Homo sapiens GN=LDHA PE=1 SV=2 | 37 kDa | 23 | 18 | 2 | 10 |
프로필린-1 OS=Homo sapiens OX=9606 GN=PFN1 PE=1 SV=2 | 15 kDa | 23 | 0 | 6 | 17 |
단백질 디설파이트-아이소머라아제 OS=Homo sapiens OX=9606 GN=P4HB PE=1 SV=3 | 57 kDa | 23 | 0 | 6 | 19 |
T-컴플렉스 단백질 1 서브유닛 감마 OS=Homo sapiens GN=CCT3 PE=1 SV=4 | 61 kDa | 23 | 72 | 17 | 26 |
40S 리보솜 단백질 S15 OS=Homo sapiens OX=9606 GN=RPS15 PE=1 SV=2 | 17 kDa | 22 | 0 | 26 | 38 |
ATP-구연산염 신타아제 OS=Homo sapiens OX=9606 GN=ACLY PE=1 SV=3 | 121 kDa | 22 | 20 | 2 | 18 |
트랜스젤린-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=TAGLN2 | 24 kDa | 22 | 47 | 1 | 20 |
베르시칸 코어 단백질 OS=Homo sapiens OX=9606 GN=VCAN PE=1 SV=3 | 373 kDa | 22 | 188 | 33 | 27 |
60S 산성 리보솜 단백질 P0 OS=Homo sapiens OX=9606 GN=RPLP0 PE=1 SV=1 | 34 kDa | 21 | 56 | 14 | 19 |
히스톤 H1.5 OS=Homo sapiens OX=9606 GN=HIST1H1B PE=1 SV=3 | 23 kDa | 21 | 53 | 11 | 20 |
임포틴 서브유닛 베타-1 OS=Homo sapiens OX=9606 GN=KPNB1 PE=1 SV=2 | 97 kDa | 21 | 19 | 1 | 6 |
과당-비스포스페이트 알돌라아제 A 아이소폼 2 OS=Homo sapiens OX=9606 GN=ALDOA | 45 kDa | 21 | 37 | 0 | 21 |
마이크로튜불-관련 단백질 1B OS=Homo sapiens OX=9606 GN=MAP1B PE=1 SV=2 | 271 kDa | 21 | 104 | 0 | 22 |
HBG 단백질 유사 TREMBL:Q3SX09 (Bos taurus) | 22 kDa | 21 | 26 | 11 | 9 |
5'-뉴클레오티다아제 OS=Homo sapiens OX=9606 GN=NT5E PE=1 SV=1 | 63 kDa | 20 | 129 | 21 | 17 |
60S 리보솜 단백질 L3 OS=Homo sapiens OX=9606 GN=RPL3 PE=1 SV=2 | 46 kDa | 20 | 65 | 15 | 24 |
60S 리보솜 단백질 L6 OS=Homo sapiens OX=9606 GN=RPL6 PE=1 SV=3 | 33 kDa | 20 | 0 | 19 | 25 |
ATP-의존 6-포스포프룩토키나아제, 혈소판 타입 OS=Homo sapiens OX=9606 GN=PFKP PE=1 SV=2 | 86 kDa | 20 | 9 | 0 | 18 |
콜라겐 알파-1(I) 체인 OS=Homo sapiens OX=9606 GN=COL1A1 PE=1 SV=5 | 139 kDa | 20 | 41 | 43 | 27 |
T-컴플렉스 단백질 1 서브유닛 에타 OS=Homo sapiens OX=9606 GN=CCT7 PE=1 SV=2 | 59 kDa | 20 | 72 | 15 | 22 |
삼기능 효소 서브유닛 알파, 미토콘드리아 OS=Homo sapiens OX=9606 GN=HADHA PE=1 SV=2 | 83 kDa | 20 | 78 | 16 | 13 |
40S 리보솜 단백질 S7 OS=Homo sapiens OX=9606 GN=RPS7 PE=1 SV=1 | 22 kDa | 19 | 104 | 25 | 28 |
60S 리보솜 단백질 L9 OS=Homo sapiens OX=9606 GN=RPL9 PE=1 SV=1 | 22 kDa | 19 | 0 | 14 | 21 |
액틴-관련 단백질 3 OS=Homo sapiens OX=9606 GN=ACTR3 PE=1 SV=3 | 47 kDa | 19 | 0 | 16 | 18 |
아넥신 A5 OS=Homo sapiens OX=9606 GN=ANXA5 PE=1 SV=2 | 36 kDa | 19 | 0 | 0 | 15 |
칼페인-2 촉매성 서브유닛 OS=Homo sapiens OX=9606 GN=CAPN2 PE=1 SV=6 | 80 kDa | 19 | 4 | 0 | 8 |
이종성 핵 리보핵단백질 A1 OS=Homo sapiens OX=9606 GN=HNRNPA1 PE=1 SV=5 | 39 kDa | 19 | 55 | 10 | 23 |
인테그린 베타-1 OS=Homo sapiens OX=9606 GN=ITGB1 PE=1 SV=2 | 88 kDa | 19 | 16 | 4 | 18 |
인터류킨 인헨서-바인딩 인자 2 OS=Homo sapiens OX=9606 GN=ILF2 PE=1 SV=2 | 43 kDa | 19 | 0 | 4 | 15 |
니도겐-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=NID2 | 141 kDa | 19 | 55 | 0 | 3 |
마트린-3 OS=Homo sapiens OX=9606 GN=MATR3 PE=1 SV=2 | 95 kDa | 19 | 46 | 5 | 20 |
T-컴플렉스 단백질 1 서브유닛 제타 OS=Homo sapiens OX=9606 GN=CCT6A PE=1 SV=3 | 58 kDa | 19 | 64 | 23 | 28 |
40S 리보솜 단백질 S2 OS=Homo sapiens OX=9606 GN=RPS2 PE=1 SV=2 | 31 kDa | 18 | 0 | 14 | 17 |
40S 리보솜 단백질 S3 OS=Homo sapiens OX=9606 GN=RPS3 PE=1 SV=2 | 27 kDa | 18 | 82 | 19 | 20 |
콜라겐 알파-2(IV) 체인 OS=Homo sapiens OX=9606 GN=COL4A2 PE=1 SV=4 | 168 kDa | 18 | 209 | 44 | 33 |
에피플라킨 OS=Homo sapiens OX=9606 GN=EPPK1 PE=1 SV=3 | 556 kDa | 18 | 22 | 1 | 39 |
히트 쇼크 70 kDa 단백질 1A OS=Homo sapiens OX=9606 GN=HSPA1A PE=1 SV=1 | 70 kDa | 18 | 31 | 0 | 23 |
이종성 핵 리보핵단백질 C1/C2 OS=Homo sapiens OX=9606 GN=HNRNPC PE=1 SV=4 | 34 kDa | 18 | 52 | 6 | 22 |
겔솔린 아이소폼 2 OS=Homo sapiens OX=9606 GN=GSN | 81 kDa | 18 | 87 | 36 | 24 |
셉틴-9 아이소폼 5 OS=Homo sapiens OX=9606 GN=SEPT9 | 65 kDa | 18 | 42 | 1 | 16 |
라미닌 서브유닛 감마-1 OS=Homo sapiens OX=9606 GN=LAMC1 PE=1 SV=3 | 178 kDa | 18 | 48 | 0 | 6 |
뉴클레오린 OS=Homo sapiens OX=9606 GN=NCL PE=1 SV=3 | 77 kDa | 18 | 58 | 8 | 16 |
전압-의존 음이온-선택적 채널 단백질 1 OS=Homo sapiens OX=9606 GN=VDAC1 PE=1 SV=2 | 31 kDa | 18 | 50 | 4 | 19 |
X-선 리페어 교차-보완 단백질 6 OS=Homo sapiens OX=9606 GN=XRCC6 PE=1 SV=2 | 70 kDa | 18 | 33 | 2 | 14 |
액틴-관련 단백질 2 OS=Homo sapiens OX=9606 GN=ACTR2 PE=1 SV=1 | 45 kDa | 17 | 43 | 17 | 28 |
히트 쇼크 단백질 베타-1 OS=Homo sapiens OX=9606 GN=HSPB1 PE=1 SV=2 | 23 kDa | 17 | 0 | 9 | 35 |
히스톤 H1.4 OS=Homo sapiens OX=9606 GN=HIST1H1E PE=1 SV=2 | 22 kDa | 17 | 14 | 10 | 13 |
AP-2 컴플렉스 서브유닛 베타 아이소폼 2 OS=Homo sapiens OX=9606 GN=AP2B1 | 106 kDa | 17 | 33 | 1 | 15 |
칼넥신 아이소폼 2 OS=Homo sapiens OX=9606 GN=CANX | 72 kDa | 17 | 21 | 1 | 19 |
돌리킬-디포스포올리고사카라이드--단백질 글리코실트랜스퍼라제 서브유닛 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=RPN2 | 68 kDa | 17 | 35 | 8 | 25 |
모에신 OS=Homo sapiens OX=9606 GN=MSN PE=1 SV=3 | 68 kDa | 17 | 61 | 3 | 15 |
단백질 디설파이트-아이소머라아제 A3 OS=Homo sapiens OX=9606 GN=PDIA3 PE=1 SV=4 | 57 kDa | 17 | 26 | 0 | 14 |
스트레스-70 단백질, 미토콘드리아 OS=Homo sapiens OX=9606 GN=HSPA9 PE=1 SV=2 | 74 kDa | 17 | 33 | 0 | 10 |
SWISS-PROT:P34955 (Bos taurus) 알파-1-항단백질분해효소 전구체 | 46 kDa | 17 | 66 | 19 | 16 |
T-컴플렉스 단백질 1 서브유닛 엡실론 OS=Homo sapiens OX=9606 GN=CCT5 PE=1 SV=1 | 60 kDa | 17 | 110 | 18 | 22 |
14-3-3 단백질 제타/델타 OS=Homo sapiens OX=9606 GN=YWHAZ PE=1 SV=1 | 28 kDa | 16 | 35 | 4 | 19 |
40S 리보솜 단백질 S4, X 아이소폼 OS=Homo sapiens OX=9606 GN=RPS4X PE=1 SV=2 | 30 kDa | 16 | 77 | 20 | 20 |
60S 리보솜 단백질 L10 OS=Homo sapiens OX=9606 GN=RPL10 PE=1 SV=4 | 25 kDa | 16 | 27 | 7 | 12 |
에즈린 OS=Homo sapiens OX=9606 GN=EZR PE=1 SV=4 | 69 kDa | 16 | 43 | 4 | 23 |
고유동성 그룹 단백질 HMG-I/HMG-Y OS=Homo sapiens OX=9606 GN=HMGA1 PE=1 SV=3 | 12 kDa | 16 | 52 | 7 | 11 |
저산소증 상향-조절 단백질 1 OS=Homo sapiens OX=9606 GN=HYOU1 PE=1 SV=1 | 111 kDa | 16 | 37 | 0 | 18 |
유비퀴틴-유사 모디파이어-활성화 효소 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=UBA1 | 114 kDa | 16 | 21 | 0 | 5 |
이종성 핵 리보핵단백질 Q 아이소폼 3 OS=Homo sapiens OX=9606 GN=SYNCRIP | 63 kDa | 16 | 37 | 5 | 20 |
니도겐-1 OS=Homo sapiens OX=9606 GN=NID1 PE=1 SV=3 | 136 kDa | 16 | 56 | 1 | 7 |
14-3-3 단백질 엡실론 OS=Homo sapiens OX=9606 GN=YWHAE PE=1 SV=1 | 29 kDa | 15 | 26 | 3 | 16 |
40S 리보솜 단백질 S5 OS=Homo sapiens OX=9606 GN=RPS5 PE=1 SV=4 | 23 kDa | 15 | 0 | 10 | 12 |
60S 리보솜 단백질 L5 OS=Homo sapiens OX=9606 GN=RPL5 PE=1 SV=3 | 34 kDa | 15 | 0 | 16 | 16 |
60S 리보솜 단백질 L7 OS=Homo sapiens OX=9606 GN=RPL7 PE=1 SV=1 | 29 kDa | 15 | 61 | 14 | 14 |
카프린-1 OS=Homo sapiens OX=9606 GN=카프린1 PE=1 SV=2 | 78 kDa | 15 | 18 | 0 | 14 |
카테닌 알파-1 OS=Homo sapiens OX=9606 GN=CTNNA1 PE=1 SV=1 | 100 kDa | 15 | 13 | 0 | 12 |
진핵성 개시 인자 4A-I OS=Homo sapiens OX=9606 GN=EIF4A1 PE=1 SV=1 | 46 kDa | 15 | 28 | 2 | 8 |
이종성 핵 리보핵단백질 A2/B1 OS=Homo sapiens OX=9606 GN=HNRNPA2B1 PE=1 SV=2 | 37 kDa | 15 | 58 | 6 | 20 |
코토머 서브유닛 알파 아이소폼 2 OS=Homo sapiens OX=9606 GN=COPA | 139 kDa | 15 | 8 | 0 | 0 |
단백질 디설파이트-아이소머라아제 A6 아이소폼 2 OS=Homo sapiens OX=9606 GN=PDIA6 | 54 kDa | 15 | 23 | 0 | 15 |
셉틴-2 아이소폼 3 OS=Homo sapiens OX=9606 GN=SEPT2 | 43 kDa | 15 | 55 | 6 | 16 |
포도구균 뉴클레아제 도메인-함유 단백질 1 OS=Homo sapiens OX=9606 GN=SND1 PE=1 SV=1 | 102 kDa | 15 | 33 | 0 | 6 |
트리오즈포스페이트 아이소머라아제 OS=Homo sapiens OX=9606 GN=TPI1 PE=1 SV=3 | 31 kDa | 15 | 15 | 0 | 11 |
UDP-글루코오즈 6-탈수소효소 OS=Homo sapiens OX=9606 GN=UGDH PE=1 SV=1 | 55 kDa | 15 | 24 | 2 | 15 |
ADP/ATP 트랜스로카아제 2 OS=Homo sapiens OX=9606 GN=SLC25A5 PE=1 SV=7 | 33 kDa | 14 | 27 | 9 | 17 |
ATP-의존 RNA 헬리카아제 A OS=Homo sapiens OX=9606 GN=DHX9 PE=1 SV=4 | 141 kDa | 14 | 25 | 1 | 9 |
코필린-1 OS=Homo sapiens OX=9606 GN=CFL1 PE=1 SV=3 | 19 kDa | 14 | 0 | 4 | 11 |
eIF-2-알파 키나아제 활성자 GCN1 OS=Homo sapiens OX=9606 GN=GCN1 PE=1 SV=6 | 293 kDa | 14 | 0 | 0 | 6 |
키넥틴 아이소폼 2 OS=Homo sapiens OX=9606 GN=KTN1 | 150 kDa | 14 | 62 | 1 | 8 |
스플라이세오솜 RNA 헬리카아제 DDX39B 아이소폼 2 OS=Homo sapiens OX=9606 GN=DDX39B | 51 kDa | 14 | 25 | 1 | 12 |
이소류신--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=IARS PE=1 SV=2 | 145 kDa | 14 | 0 | 0 | 0 |
케라틴, 타입 II 세포골격 2 표피 OS=Homo sapiens OX=9606 GN=KRT2 PE=1 SV=2 | 65 kDa | 14 | 123 | 28 | 21 |
리보뉴클레아제 저해제 OS=Homo sapiens OX=9606 GN=RNH1 PE=1 SV=2 | 50 kDa | 14 | 0 | 1 | 8 |
SWISS-PROT:P02070 (Bos taurus) 헤모글로빈 서브유닛 베타 | 16 kDa | 14 | 0 | 0 | 0 |
SWISS-PROT:Q9DCV7 Tax_Id=10090 Gene_Symbol=Krt7 케라틴, 타입 II 세포골격 7 | 51 kDa | 14 | 0 | 14 | 18 |
세뇨관간질성 신염 항원-유사 OS=Homo sapiens OX=9606 GN=TINAGL1 PE=1 SV=1 | 52 kDa | 14 | 173 | 78 | 38 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 2 OS=Homo sapiens OX=9606 GN=PSMD2 PE=1 SV=3 | 100 kDa | 13 | 18 | 0 | 10 |
40S 리보솜 단백질 S8 OS=Homo sapiens OX=9606 GN=RPS8 PE=1 SV=2 | 24 kDa | 13 | 0 | 9 | 15 |
60S 리보솜 단백질 L23 OS=Homo sapiens OX=9606 GN=RPL23 PE=1 SV=1 | 15 kDa | 13 | 0 | 14 | 10 |
60S 리보솜 단백질 L7a OS=Homo sapiens OX=9606 GN=RPL7A PE=1 SV=2 | 30 kDa | 13 | 68 | 12 | 14 |
ADP/ATP 트랜스로카아제 3 OS=Homo sapiens OX=9606 GN=SLC25A6 PE=1 SV=4 | 33 kDa | 13 | 0 | 8 | 18 |
아르기닌--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=RARS PE=1 SV=2 | 75 kDa | 13 | 33 | 0 | 5 |
칼페인 스몰 서브유닛 1 OS=Homo sapiens OX=9606 GN=CAPNS1 PE=1 SV=1 | 28 kDa | 13 | 0 | 0 | 22 |
글리신--tRNA 리가아제 OS=Homo sapiens OX=9606 GN=GARS PE=1 SV=3 | 83 kDa | 13 | 0 | 1 | 6 |
확장된 시냅토타그민-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=ESYT1 | 124 kDa | 13 | 21 | 1 | 17 |
핵 미토틱(mitotic) 기구(apparatus) 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=NUMA1 | 237 kDa | 13 | 18 | 0 | 2 |
트로포미오신 베타 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=TPM2 | 33 kDa | 13 | 122 | 33 | 24 |
인터류킨 인헨서-바인딩 인자 3 아이소폼 7 OS=Homo sapiens GN=ILF3 | 96 kDa | 13 | 31 | 0 | 13 |
DNA 토포아이소머라아제 2-베타 아이소폼 베타-1 OS=Homo sapiens OX=9606 GN=TOP2B | 183 kDa | 13 | 97 | 3 | 3 |
라민-B2 OS=Homo sapiens OX=9606 GN=LMNB2 PE=1 SV=4 | 70 kDa | 13 | 53 | 8 | 19 |
L-젖산 탈수소효소 B 체인 OS=Homo sapiens OX=9606 GN=LDHB PE=1 SV=2 | 37 kDa | 13 | 0 | 0 | 6 |
핵단백질 TPR OS=Homo sapiens OX=9606 GN=TPR PE=1 SV=3 | 267 kDa | 13 | 15 | 1 | 3 |
활성화된 단백질 C 키나아제 1의 수용체 OS=Homo sapiens OX=9606 GN=RACK1 PE=1 SV=3 | 35 kDa | 13 | 0 | 1 | 12 |
세린 프로테아제 HTRA1 OS=Homo sapiens OX=9606 GN=HTRA1 PE=1 SV=1 | 51 kDa | 13 | 0 | 15 | 1 |
세린/쓰레오닌-단백질 포스파타제 2A 65 kDa 조절 서브유닛 A 알파 아이소폼 OS=Homo sapiens OX=9606 GN=PPP2R1A PE=1 SV=4 | 65 kDa | 13 | 0 | 0 | 10 |
X-선 리페어 교차-보완 단백질 5 OS=Homo sapiens OX=9606 GN=XRCC5 PE=1 SV=3 | 83 kDa | 13 | 0 | 2 | 15 |
14-3-3 단백질 세타 OS=Homo sapiens OX=9606 GN=YWHAQ PE=1 SV=1 | 28 kDa | 12 | 0 | 2 | 12 |
40S 리보솜 단백질 S12 OS=Homo sapiens OX=9606 GN=RPS12 PE=1 SV=3 | 15 kDa | 12 | 0 | 1 | 9 |
사이토플라즈믹 디네인 1 라이트 인터미디에이트 체인 2 OS=Homo sapiens OX=9606 GN=DYNC1LI2 PE=1 SV=1 | 54 kDa | 12 | 12 | 3 | 19 |
글루타치온 S-트랜스퍼라아제 P OS=Homo sapiens OX=9606 GN=GSTP1 PE=1 SV=2 | 23 kDa | 12 | 0 | 2 | 13 |
셉틴-7 아이소폼 2 OS=Homo sapiens OX=9606 GN=SEPT7 | 51 kDa | 12 | 31 | 0 | 12 |
언컨벤셔널 미오신-Ic 아이소폼 3 OS=Homo sapiens OX=9606 GN=MYO1C | 120 kDa | 12 | 64 | 9 | 8 |
펩티딜-프롤릴 시스-트랜스 아이소머라아제 A OS=Homo sapiens OX=9606 GN=PPIA PE=1 SV=2 | 18 kDa | 12 | 36 | 3 | 11 |
폴리아데닐레이트-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=PABPC1 PE=1 SV=2 | 71 kDa | 12 | 22 | 0 | 15 |
Rho-관련 GTP-바인딩 단백질 RhoC OS=Homo sapiens OX=9606 GN=RHOC PE=1 SV=1 | 22 kDa | 12 | 0 | 5 | 12 |
리보솜 L1 도메인-함유 단백질 1 OS=Homo sapiens OX=9606 GN=RSL1D1 PE=1 SV=3 | 55 kDa | 12 | 18 | 8 | 12 |
트랜스젤린 OS=Homo sapiens OX=9606 GN=TAGLN PE=1 SV=4 | 23 kDa | 12 | 41 | 10 | 23 |
14-3-3 단백질 감마 OS=Homo sapiens OX=9606 GN=YWHAG PE=1 SV=2 | 28 kDa | 11 | 0 | 1 | 14 |
26S 프로테아좀 조절 서브유닛 6A OS=Homo sapiens OX=9606 GN=PSMC3 PE=1 SV=1 | 47 kDa | 11 | 0 | 0 | 17 |
40S 리보솜 단백질 S17 OS=Homo sapiens OX=9606 GN=RPS17 PE=1 SV=2 | 16 kDa | 11 | 67 | 20 | 16 |
60S 리보솜 단백질 L10a OS=Homo sapiens OX=9606 GN=RPL10A PE=1 SV=2 | 25 kDa | 11 | 0 | 11 | 17 |
60S 리보솜 단백질 L12 OS=Homo sapiens OX=9606 GN=RPL12 PE=1 SV=1 | 18 kDa | 11 | 36 | 10 | 9 |
ADP-리보실레이션 인자 4 OS=Homo sapiens OX=9606 GN=ARF4 PE=1 SV=3 | 21 kDa | 11 | 0 | 8 | 14 |
아넥신 A6 OS=Homo sapiens OX=9606 GN=ANXA6 PE=1 SV=3 | 76 kDa | 11 | 15 | 0 | 9 |
ATP 신타아제 서브유닛 O, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ATP5PO PE=1 SV=1 | 23 kDa | 11 | 0 | 5 | 10 |
코어 히스톤 매크로-H2A.2 OS=Homo sapiens OX=9606 GN=H2AFY2 PE=1 SV=3 | 40 kDa | 11 | 226 | 28 | 21 |
돌리킬-디포스포올리고사카라이드--단백질 글리코실트랜스퍼라제 서브유닛 1 OS=Homo sapiens OX=9606 GN=RPN1 PE=1 SV=1 | 69 kDa | 11 | 43 | 7 | 18 |
늘임 인자 1-감마 OS=Homo sapiens OX=9606 GN=EEF1G PE=1 SV=3 | 50 kDa | 11 | 29 | 0 | 8 |
구아닌 뉴클레오티드-바인딩 단백질 G(i) 서브유닛 알파-2 OS=Homo sapiens OX=9606 GN=GNAI2 PE=1 SV=3 | 40 kDa | 11 | 45 | 6 | 8 |
이종성 핵 리보핵단백질 R OS=Homo sapiens OX=9606 GN=HNRNPR PE=1 SV=1 | 71 kDa | 11 | 17 | 4 | 12 |
프로버블(Probable) ATP-의존 RNA 헬리카아제 DDX17 아이소폼 2 OS=Homo sapiens OX=9606 GN=DDX17 | 72 kDa | 11 | 17 | 0 | 9 |
트로포미오신 알파-1 체인 아이소폼 3 OS=Homo sapiens OX=9606 GN=TPM1 | 33 kDa | 11 | 181 | 46 | 37 |
칼데스몬 아이소폼 4 OS=Homo sapiens OX=9606 GN=CALD1 | 63 kDa | 11 | 51 | 10 | 32 |
류신--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens GN=LARS PE=1 SV=2 | 134 kDa | 11 | 3 | 0 | 0 |
포스포글리세르산 키나아제 1 OS=Homo sapiens OX=9606 GN=PGK1 PE=1 SV=3 | 45 kDa | 11 | 10 | 0 | 7 |
폴리피리미딘 구역-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=PTBP1 PE=1 SV=1 | 57 kDa | 11 | 33 | 1 | 20 |
Rab GDP 디소시에이션(dissociation) 저해제 베타 OS=Homo sapiens OX=9606 GN=GDI2 PE=1 SV=2 | 51 kDa | 11 | 17 | 0 | 10 |
레티큘론-4 OS=Homo sapiens GN=RTN4 PE=1 SV=2 | 130 kDa | 11 | 15 | 0 | 9 |
세린 하이드록시메틸트랜스퍼라아제, 미토콘드리아 OS=Homo sapiens GN=SHMT2 PE=1 SV=3 | 56 kDa | 11 | 6 | 0 | 3 |
세린/쓰레오닌-단백질 포스파타제 PP1-알파 촉매성 서브유닛 OS=Homo sapiens OX=9606 GN=PPP1CA PE=1 SV=1 | 38 kDa | 11 | 23 | 3 | 10 |
스플라이싱(Splicing) 인자, 프롤린- 및 글루타민-풍부 OS=Homo sapiens OX=9606 GN=SFPQ PE=1 SV=2 | 76 kDa | 11 | 43 | 5 | 18 |
SWISS-PROT:Q3MHN5 (Bos taurus) 비타민 D-바인딩 단백질 전구체 | 53 kDa | 11 | 15 | 2 | 4 |
테나신 OS=Homo sapiens GN=TNC PE=1 SV=3 | 241 kDa | 11 | 409 | 60 | 72 |
쓰레오닌--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=TARS PE=1 SV=3 | 83 kDa | 11 | 10 | 0 | 3 |
트로포미오신 알파-4 체인 OS=Homo sapiens OX=9606 GN=TPM4 PE=1 SV=3 | 29 kDa | 11 | 89 | 21 | 20 |
14-3-3 단백질 에타 OS=Homo sapiens OX=9606 GN=YWHAH PE=1 SV=4 | 28 kDa | 10 | 0 | 1 | 10 |
26S 프로테아좀 조절 서브유닛 6B OS=Homo sapiens OX=9606 GN=PSMC4 PE=1 SV=2 | 47 kDa | 10 | 13 | 3 | 10 |
60S 리보솜 단백질 L18 OS=Homo sapiens GN=RPL18 PE=1 SV=1 | 19 kDa | 10 | 26 | 7 | 9 |
액틴-관련 단백질 2/3 컴플렉스 서브유닛 2 OS=Homo sapiens OX=9606 GN=ARPC2 PE=1 SV=1 | 34 kDa | 10 | 53 | 14 | 11 |
A-키나아제 앵커 단백질 12 OS=Homo sapiens OX=9606 GN=AKAP12 PE=1 SV=4 | 191 kDa | 10 | 46 | 0 | 5 |
아스파라긴--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=NARS PE=1 SV=1 | 63 kDa | 10 | 10 | 0 | 1 |
아스파르트산염--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=DARS PE=1 SV=2 | 57 kDa | 10 | 22 | 3 | 9 |
돌리킬-디포스포올리고사카라이드--단백질 글리코실트랜스퍼라제 48 kDa 서브유닛 OS=Homo sapiens OX=9606 GN=DDOST PE=1 SV=4 | 51 kDa | 10 | 13 | 6 | 17 |
에를린-2 OS=Homo sapiens OX=9606 GN=에를린2 PE=1 SV=1 | 38 kDa | 10 | 39 | 4 | 11 |
지방산 신타아제 OS=Homo sapiens OX=9606 GN=FASN PE=1 SV=3 | 273 kDa | 10 | 0 | 0 | 2 |
이종성 핵 리보핵단백질 A3 OS=Homo sapiens OX=9606 GN=HNRNPA3 PE=1 SV=2 | 40 kDa | 10 | 25 | 7 | 8 |
엑스포틴-2 아이소폼 3 OS=Homo sapiens OX=9606 GN=CSE1L | 108 kDa | 10 | 2 | 2 | 3 |
AP-1 컴플렉스 서브유닛 베타-1 아이소폼 B OS=Homo sapiens OX=9606 GN=AP1B1 | 104 kDa | 10 | 0 | 0 | 11 |
류신-풍부 PPR 모티프-함유 단백질, 미토콘드리아 OS=Homo sapiens OX=9606 GN=LRPPRC PE=1 SV=3 | 158 kDa | 10 | 5 | 0 | 0 |
논-POU 도메인-함유 옥타머-바인딩 단백질 OS=Homo sapiens OX=9606 GN=NONO PE=1 SV=4 | 54 kDa | 10 | 44 | 3 | 20 |
핵 단백질 56 OS=Homo sapiens OX=9606 GN=NOP56 PE=1 SV=4 | 66 kDa | 10 | 18 | 1 | 2 |
퍼옥시다신 동족체 OS=Homo sapiens OX=9606 GN=PXDN PE=1 SV=2 | 165 kDa | 10 | 146 | 36 | 28 |
스토마틴-유사 단백질 2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=STOML2 PE=1 SV=1 | 39 kDa | 10 | 18 | 3 | 10 |
SWISS-PROT:P01966 (Bos taurus) 헤모글로빈 서브유닛 알파 | 15 kDa | 10 | 34 | 12 | 10 |
SWISS-PROT:Q3SZ57 (Bos taurus) 알파-페토단백질 전구체 | 69 kDa | 10 | 11 | 6 | 7 |
트랜스포밍(transforming) 단백질 RhoA OS=Homo sapiens OX=9606 GN=RHOA PE=1 SV=1 | 22 kDa | 10 | 0 | 4 | 10 |
40S 리보솜 단백질 SA OS=Homo sapiens OX=9606 GN=RPSA PE=1 SV=1 | 33 kDa | 9 | 0 | 1 | 10 |
60S 리보솜 단백질 L13 OS=Homo sapiens OX=9606 GN=RPL13 PE=1 SV=4 | 24 kDa | 9 | 32 | 12 | 12 |
60S 리보솜 단백질 L8 OS=Homo sapiens OX=9606 GN=RPL8 PE=1 SV=2 | 28 kDa | 9 | 0 | 7 | 9 |
알데히드 탈수소효소 X, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ALDH1B1 PE=1 SV=3 | 57 kDa | 9 | 14 | 4 | 11 |
ATP-의존 RNA 헬리카아제 DDX3X OS=Homo sapiens OX=9606 GN=DDX3X PE=1 SV=3 | 73 kDa | 9 | 18 | 5 | 11 |
칼레티쿨린 OS=Homo sapiens OX=9606 GN=CALR PE=1 SV=1 | 48 kDa | 9 | 44 | 4 | 11 |
D-3-포스포글리세르산 탈수소효소 OS=Homo sapiens OX=9606 GN=PHGDH PE=1 SV=4 | 57 kDa | 9 | 0 | 0 | 2 |
F-액틴-캐핑 단백질 서브유닛 알파-1 OS=Homo sapiens OX=9606 GN=CAPZA1 PE=1 SV=3 | 33 kDa | 9 | 0 | 18 | 15 |
갈렉틴-1 OS=Homo sapiens OX=9606 GN=LGALS1 PE=1 SV=2 | 15 kDa | 9 | 0 | 3 | 6 |
GTP-바인딩 핵 단백질 Ran OS=Homo sapiens OX=9606 GN=RAN PE=1 SV=3 | 24 kDa | 9 | 0 | 6 | 11 |
이질염색질(Hetero염색질) 단백질 1-바인딩 단백질 3 OS=Homo sapiens OX=9606 GN=HP1BP3 PE=1 SV=1 | 61 kDa | 9 | 24 | 4 | 7 |
전압-의존 음이온-선택적 채널 단백질 2 아이소폼 1 OS=Homo sapiens OX=9606 GN=VDAC2 | 33 kDa | 9 | 19 | 1 | 5 |
진핵성 번역 개시 인자 3 서브유닛 A 아이소폼 2 OS=Homo sapiens OX=9606 GN=EIF3A | 163 kDa | 9 | 10 | 0 | 11 |
글루타민--tRNA 리가아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=QARS | 87 kDa | 9 | 16 | 0 | 4 |
트로포미오신 알파-3 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=TPM3 | 29 kDa | 9 | 99 | 16 | 17 |
단백질 AHNAK2 아이소폼 3 OS=Homo sapiens OX=9606 GN=AHNAK2 | 606 kDa | 9 | 0 | 0 | 1 |
진핵성 번역 개시 인자 4 감마 1 아이소폼 D OS=Homo sapiens OX=9606 GN=EIF4G1 | 159 kDa | 9 | 7 | 0 | 0 |
KH 도메인-함유, RNA-바인딩, 시그널 형질도입(transduction)-관련 단백질 1 OS=Homo sapiens OX=9606 GN=KHDRBS1 PE=1 SV=1 | 48 kDa | 9 | 24 | 5 | 9 |
메티오닌--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=MARS PE=1 SV=2 | 101 kDa | 9 | 1 | 0 | 0 |
골수(Myeloid)-관련 분화 마커 OS=Homo sapiens OX=9606 GN=MYADM PE=1 SV=2 | 35 kDa | 9 | 0 | 16 | 12 |
뉴트럴 알파-글루코시다아제 AB OS=Homo sapiens OX=9606 GN=GANAB PE=1 SV=3 | 107 kDa | 9 | 21 | 0 | 13 |
퍼옥시레독신-5, 미토콘드리아 OS=Homo sapiens OX=9606 GN=PRDX5 PE=1 SV=4 | 22 kDa | 9 | 6 | 0 | 5 |
세린--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=SARS PE=1 SV=3 | 59 kDa | 9 | 0 | 0 | 9 |
트립토판--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=WARS PE=1 SV=2 | 53 kDa | 9 | 6 | 1 | 7 |
액포(Vacuolar) 단백질 분류(sorting)-관련 단백질 35 OS=Homo sapiens OX=9606 GN=VPS35 PE=1 SV=2 | 92 kDa | 9 | 5 | 0 | 4 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 3 OS=Homo sapiens OX=9606 GN=PSMD3 PE=1 SV=2 | 61 kDa | 8 | 21 | 0 | 6 |
40S 리보솜 단백질 S16 OS=Homo sapiens OX=9606 GN=RPS16 PE=1 SV=2 | 16 kDa | 8 | 0 | 9 | 7 |
40S 리보솜 단백질 S6 OS=Homo sapiens OX=9606 GN=RPS6 PE=1 SV=1 | 29 kDa | 8 | 0 | 5 | 11 |
40S 리보솜 단백질 S9 OS=Homo sapiens OX=9606 GN=RPS9 PE=1 SV=3 | 23 kDa | 8 | 54 | 11 | 10 |
ADP/ATP 트랜스로카아제 1 OS=Homo sapiens OX=9606 GN=SLC25A4 PE=1 SV=4 | 33 kDa | 8 | 0 | 0 | 12 |
아넥신 A1 OS=Homo sapiens OX=9606 GN=ANXA1 PE=1 SV=2 | 39 kDa | 8 | 0 | 0 | 8 |
ATP-의존 RNA 헬리카아제 DDX1 OS=Homo sapiens OX=9606 GN=DDX1 PE=1 SV=2 | 82 kDa | 8 | 15 | 2 | 10 |
코토머 서브유닛 감마-1 OS=Homo sapiens OX=9606 GN=COPG1 PE=1 SV=1 | 98 kDa | 8 | 9 | 1 | 6 |
늘임 인자 Tu, 미토콘드리아 OS=Homo sapiens OX=9606 GN=TUFM PE=1 SV=2 | 50 kDa | 8 | 0 | 0 | 0 |
적혈구 밴드 7 인테그럴 막 단백질 OS=Homo sapiens OX=9606 GN=STOM PE=1 SV=3 | 32 kDa | 8 | 6 | 2 | 3 |
진핵성 번역 개시 인자 2 서브유닛 3 OS=Homo sapiens OX=9606 GN=EIF2S3 PE=1 SV=3 | 51 kDa | 8 | 0 | 3 | 12 |
플로틸린-1 OS=Homo sapiens OX=9606 GN=FLOT1 PE=1 SV=3 | 47 kDa | 8 | 25 | 1 | 4 |
이종성 핵 리보핵단백질 L OS=Homo sapiens OX=9606 GN=HNRNPL PE=1 SV=2 | 64 kDa | 8 | 11 | 0 | 5 |
안키코르빈 아이소폼 2 OS=Homo sapiens OX=9606 GN=RAI14 | 110 kDa | 8 | 38 | 2 | 5 |
이기능성 퓨린 생합성 단백질 PURH 아이소폼 2 OS=Homo sapiens OX=9606 GN=ATIC | 65 kDa | 8 | 5 | 0 | 4 |
진핵성 번역 개시 인자 5A-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=EIF5A | 20 kDa | 8 | 14 | 1 | 7 |
골지 기구 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=GLG1 | 137 kDa | 8 | 4 | 9 | 1 |
폴리(rC)-바인딩 단백질 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=PCBP2 | 39 kDa | 8 | 4 | 0 | 4 |
이종성 핵 리보핵단백질 D0 아이소폼 3 OS=Homo sapiens OX=9606 GN=HNRNPD | 33 kDa | 8 | 20 | 6 | 11 |
포스페이트 캐리어 단백질, 미토콘드리아 아이소폼 B OS=Homo sapiens OX=9606 GN=SLC25A3 | 40 kDa | 8 | 7 | 5 | 8 |
키네신-1 헤비 체인 OS=Homo sapiens OX=9606 GN=KIF5B PE=1 SV=1 | 110 kDa | 8 | 5 | 0 | 3 |
말레이트(Malate) 탈수소효소, 미토콘드리아 OS=Homo sapiens OX=9606 GN=MDH2 PE=1 SV=3 | 36 kDa | 8 | 17 | 0 | 13 |
미토콘드리아 캐리어 동족체 2 OS=Homo sapiens OX=9606 GN=MTCH2 PE=1 SV=1 | 33 kDa | 8 | 0 | 2 | 4 |
프리-mRNA-프로세싱 인자 19 OS=Homo sapiens OX=9606 GN=PRPF19 PE=1 SV=1 | 55 kDa | 8 | 0 | 0 | 14 |
프로히비틴 OS=Homo sapiens OX=9606 GN=PHB PE=1 SV=1 | 30 kDa | 8 | 14 | 2 | 15 |
단백질 트랜스포트 단백질 Sec23A OS=Homo sapiens OX=9606 GN=SEC23A PE=1 SV=2 | 86 kDa | 8 | 9 | 1 | 10 |
단백질 트랜스포트 단백질 Sec61 서브유닛 알파 아이소폼 1 OS=Homo sapiens OX=9606 GN=SEC61A1 PE=1 SV=2 | 52 kDa | 8 | 2 | 1 | 5 |
셉틴-11 OS=Homo sapiens OX=9606 GN=SEPT11 PE=1 SV=3 | 49 kDa | 8 | 27 | 0 | 9 |
스몰 핵 리보핵단백질 Sm D1 OS=Homo sapiens OX=9606 GN=SNRPD1 PE=1 SV=1 | 13 kDa | 8 | 0 | 6 | 7 |
SWISS-PROT:P15497 (Bos taurus) 아포리포단백질 A-I 전구체 | 30 kDa | 8 | 21 | 6 | 4 |
THO 컴플렉스 서브유닛 4 OS=Homo sapiens OX=9606 GN=ALYREF PE=1 SV=3 | 27 kDa | 8 | 37 | 7 | 11 |
TREMBL:Q3ZBS7 (Bos taurus) 비트로넥틴 | 54 kDa | 8 | 26 | 12 | 11 |
유비퀴틴-40S 리보솜 단백질 S27a OS=Homo sapiens OX=9606 GN=RPS27A PE=1 SV=2 | 18 kDa | 8 | 0 | 13 | 10 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 12 OS=Homo sapiens OX=9606 GN=PSMD12 PE=1 SV=3 | 53 kDa | 7 | 6 | 0 | 2 |
26S 프로테아좀 조절 서브유닛 8 OS=Homo sapiens OX=9606 GN=PSMC5 PE=1 SV=1 | 46 kDa | 7 | 6 | 0 | 12 |
40S 리보솜 단백질 S14 OS=Homo sapiens OX=9606 GN=RPS14 PE=1 SV=3 | 16 kDa | 7 | 40 | 13 | 9 |
40S 리보솜 단백질 S19 OS=Homo sapiens OX=9606 GN=RPS19 PE=1 SV=2 | 16 kDa | 7 | 0 | 12 | 15 |
40S 리보솜 단백질 S23 OS=Homo sapiens OX=9606 GN=RPS23 PE=1 SV=3 | 16 kDa | 7 | 0 | 4 | 12 |
60S 리보솜 단백질 L30 OS=Homo sapiens OX=9606 GN=RPL30 PE=1 SV=2 | 13 kDa | 7 | 0 | 8 | 8 |
ADP-리보실레이션 인자 3 OS=Homo sapiens OX=9606 GN=ARF3 PE=1 SV=2 | 21 kDa | 7 | 11 | 7 | 7 |
아미노아실 tRNA 신타아제 컴플렉스-인터랙팅 다기능성 단백질 2 OS=Homo sapiens OX=9606 GN=AIMP2 PE=1 SV=2 | 35 kDa | 7 | 0 | 0 | 6 |
CAD 단백질 OS=Homo sapiens OX=9606 GN=CAD PE=1 SV=3 | 243 kDa | 7 | 0 | 0 | 0 |
카테닌 베타-1 OS=Homo sapiens OX=9606 GN=CTNNB1 PE=1 SV=1 | 85 kDa | 7 | 3 | 0 | 6 |
세포 구획 조절 단백질 42 동족체 OS=Homo sapiens OX=9606 GN=CDC42 PE=1 SV=2 | 21 kDa | 7 | 0 | 2 | 11 |
클로라이드 세포내 채널 단백질 1 OS=Homo sapiens OX=9606 GN=CLIC1 PE=1 SV=4 | 27 kDa | 7 | 0 | 0 | 5 |
코토머 서브유닛 베타 OS=Homo sapiens OX=9606 GN=COPB1 PE=1 SV=3 | 107 kDa | 7 | 5 | 0 | 1 |
진핵성 개시 인자 4A-III OS=Homo sapiens OX=9606 GN=EIF4A3 PE=1 SV=4 | 47 kDa | 7 | 20 | 4 | 8 |
이종성 핵 리보핵단백질 H OS=Homo sapiens OX=9606 GN=HNRNPH1 PE=1 SV=1 | 51 kDa | 7 | 23 | 1 | 9 |
임포틴-5 OS=Homo sapiens OX=9606 GN=IPO5 PE=1 SV=4 | 124 kDa | 7 | 5 | 0 | 3 |
핵 인자 카파-B 키나아제-인터랙팅 단백질 저해제 OS=Homo sapiens OX=9606 GN=IKBIP PE=1 SV=1 | 39 kDa | 7 | 7 | 6 | 7 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 11 아이소폼 2 OS=Homo sapiens OX=9606 GN=PSMD11 | 48 kDa | 7 | 12 | 0 | 5 |
F-액틴-캐핑 단백질 서브유닛 베타 아이소폼 2 OS=Homo sapiens OX=9606 GN=CAPZB | 31 kDa | 7 | 46 | 10 | 5 |
이종성 핵 리보핵단백질 D-유사 아이소폼 2 OS=Homo sapiens OX=9606 GN=HNRNPDL | 34 kDa | 7 | 8 | 0 | 7 |
인테그린 알파-3 아이소폼 2 OS=Homo sapiens OX=9606 GN=ITGA3 | 119 kDa | 7 | 2 | 0 | 5 |
핵 RNA 헬리카아제 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=DDX21 | 80 kDa | 7 | 16 | 2 | 7 |
PDZ 및 LIM 도메인 단백질 7 아이소폼 2 OS=Homo sapiens OX=9606 GN=PDLIM7 | 47 kDa | 7 | 13 | 0 | 5 |
스퍼민 신타아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=SMS | 35 kDa | 7 | 2 | 0 | 6 |
트랜스케톨라제 아이소폼 2 OS=Homo sapiens OX=9606 GN=TKT | 69 kDa | 7 | 29 | 0 | 9 |
116 kDa U5 스몰 핵 리보핵단백질 컴포넌트 아이소폼 3 OS=Homo sapiens OX=9606 GN=EFTUD2 | 108 kDa | 7 | 6 | 0 | 9 |
60S 리보솜 단백질 L17 아이소폼 3 OS=Homo sapiens OX=9606 GN=RPL17 | 26 kDa | 7 | 54 | 5 | 8 |
인테그린 알파-V 아이소폼 3 OS=Homo sapiens OX=9606 GN=ITGAV | 111 kDa | 7 | 22 | 2 | 12 |
슈퍼빌린 아이소폼 SV3 OS=Homo sapiens OX=9606 GN=SVIL | 245 kDa | 7 | 46 | 0 | 1 |
NADH 탈수소효소 [유비퀴논] 1 알파 서브컴플렉스 서브유닛 9, 미토콘드리아 OS=Homo sapiens OX=9606 GN=NDUFA9 PE=1 SV=2 | 43 kDa | 7 | 12 | 1 | 7 |
퍼옥시레독신-1 OS=Homo sapiens OX=9606 GN=PRDX1 PE=1 SV=1 | 22 kDa | 7 | 0 | 0 | 7 |
폴리(rC)-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=PCBP1 PE=1 SV=2 | 37 kDa | 7 | 0 | 0 | 2 |
프리-mRNA-프로세싱-스플라이싱 인자 8 OS=Homo sapiens OX=9606 GN=PRPF8 PE=1 SV=2 | 274 kDa | 7 | 6 | 1 | 3 |
프로버블 ATP-의존 RNA 헬리카아제 DDX5 OS=Homo sapiens OX=9606 GN=DDX5 PE=1 SV=1 | 69 kDa | 7 | 25 | 7 | 19 |
프로히비틴-2 OS=Homo sapiens OX=9606 GN=PHB2 PE=1 SV=2 | 33 kDa | 7 | 25 | 5 | 12 |
단백질 디설파이트-아이소머라아제 A4 OS=Homo sapiens OX=9606 GN=PDIA4 PE=1 SV=2 | 73 kDa | 7 | 4 | 0 | 4 |
라스 GTP아제-활성화 단백질-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=G3BP1 PE=1 SV=1 | 52 kDa | 7 | 19 | 2 | 8 |
라스-관련 단백질 Rab-1B OS=Homo sapiens OX=9606 GN=RAB1B PE=1 SV=1 | 22 kDa | 7 | 0 | 0 | 8 |
RNA-바인딩 모티프 단백질, X 크로모좀 OS=Homo sapiens OX=9606 GN=RBMX PE=1 SV=3 | 42 kDa | 7 | 22 | 5 | 13 |
스플라이싱 인자 3B 서브유닛 1 OS=Homo sapiens OX=9606 GN=SF3B1 PE=1 SV=3 | 146 kDa | 7 | 16 | 1 | 3 |
SWISS-PROT:P02535-1 Tax_Id=10090 Gene_Symbol=Krt10 케라틴 아이소폼 1, 타입 I 세포골격 10 | 58 kDa | 7 | 39 | 7 | 0 |
SWISS-PROT:P08730-1 Tax_Id=10090 Gene_Symbol=Krt13 케라틴 아이소폼 1, 타입 I 세포골격 13 | 48 kDa | 7 | 451 | 17 | 31 |
SWISS-PROT:Q6IFZ6 Tax_Id=10090 Gene_Symbol=Krt77 케라틴, 타입 II 세포골격 1b | 61 kDa | 7 | 32 | 10 | 5 |
탈린-2 OS=Homo sapiens OX=9606 GN=TLN2 PE=1 SV=4 | 272 kDa | 7 | 0 | 0 | 1 |
전사 중개 인자 1-베타 OS=Homo sapiens OX=9606 GN=TRIM28 PE=1 SV=5 | 89 kDa | 7 | 5 | 0 | 0 |
인터-알파-트립신 저해제 헤비 체인2 유사 TREMBL:Q9TRI1 (Bos taurus) | 106 kDa | 7 | 57 | 7 | 8 |
U5 스몰 핵 리보핵단백질 200 kDa 헬리카아제 OS=Homo sapiens OX=9606 GN=SNRNP200 PE=1 SV=2 | 245 kDa | 7 | 1 | 0 | 0 |
발린--tRNA 리가아제 OS=Homo sapiens OX=9606 GN=VARS PE=1 SV=4 | 140 kDa | 7 | 8 | 0 | 4 |
26S 프로테아좀 조절 서브유닛 4 OS=Homo sapiens OX=9606 GN=PSMC1 PE=1 SV=1 | 49 kDa | 6 | 25 | 1 | 6 |
40S 리보솜 단백질 S26 OS=Homo sapiens OX=9606 GN=RPS26 PE=1 SV=3 | 13 kDa | 6 | 0 | 6 | 6 |
60S 리보솜 단백질 L24 OS=Homo sapiens OX=9606 GN=RPL24 PE=1 SV=1 | 18 kDa | 6 | 0 | 5 | 6 |
60S 리보솜 단백질 L27a OS=Homo sapiens OX=9606 GN=RPL27A PE=1 SV=2 | 17 kDa | 6 | 0 | 6 | 4 |
알파-centr액틴 OS=Homo sapiens OX=9606 GN=ACTR1A PE=1 SV=1 | 43 kDa | 6 | 26 | 3 | 11 |
ATP-의존 RNA 헬리카아제 DDX18 OS=Homo sapiens OX=9606 GN=DDX18 PE=1 SV=2 | 75 kDa | 6 | 5 | 3 | 8 |
콜라겐 알파-1(IV) 체인 OS=Homo sapiens OX=9606 GN=COL4A1 PE=1 SV=4 | 161 kDa | 6 | 69 | 21 | 7 |
콜라겐 알파-1(VIII) 체인 OS=Homo sapiens OX=9606 GN=COL8A1 PE=1 SV=2 | 73 kDa | 6 | 0 | 29 | 22 |
쿨린-관련 NEDD8-해리된 단백질 1 OS=Homo sapiens GN=C및1 PE=1 SV=2 | 136 kDa | 6 | 0 | 0 | 3 |
2-옥소글루타레이트 탈수소효소 컴플렉스 디히드로리포일리신-잔류물 숙시닐트랜스퍼라아제 컴포넌트, 미토콘드리아 OS=Homo sapiens OX=9606 GN=DLST PE=1 SV=4 | 49 kDa | 6 | 17 | 0 | 8 |
디히드로피리미디나제-관련 단백질 2 OS=Homo sapiens OX=9606 GN=DPYSL2 PE=1 SV=1 | 62 kDa | 6 | 3 | 0 | 5 |
진핵성 번역 개시 인자 3 서브유닛 M OS=Homo sapiens OX=9606 GN=EIF3M PE=1 SV=1 | 43 kDa | 6 | 11 | 0 | 5 |
엑스포틴-1 OS=Homo sapiens OX=9606 GN=XPO1 PE=1 SV=1 | 123 kDa | 6 | 0 | 0 | 0 |
F-액틴-캐핑 단백질 서브유닛 알파-2 OS=Homo sapiens OX=9606 GN=CAPZA2 PE=1 SV=3 | 33 kDa | 6 | 33 | 8 | 9 |
글리코젠 인산화효소, 뇌 형성 OS=Homo sapiens OX=9606 GN=PYGB PE=1 SV=5 | 97 kDa | 6 | 0 | 0 | 1 |
임포틴-7 OS=Homo sapiens OX=9606 GN=IPO7 PE=1 SV=1 | 120 kDa | 6 | 0 | 0 | 0 |
6-포스포글루코네이트 탈수소효소, 탈탄산(decarboxylating) 아이소폼 2 OS=Homo sapiens OX=9606 GN=PGD | 52 kDa | 6 | 4 | 0 | 3 |
코토머 서브유닛 베타' 아이소폼 2 OS=Homo sapiens OX=9606 GN=COPB2 | 99 kDa | 6 | 10 | 0 | 4 |
코로닌-1C 아이소폼 2 OS=Homo sapiens OX=9606 GN=CORO1C | 54 kDa | 6 | 36 | 5 | 7 |
늘임 인자 1-델타 아이소폼 2 OS=Homo sapiens OX=9606 GN=EEF1D | 71 kDa | 6 | 32 | 3 | 4 |
인버티드 포르민-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=INF2 | 135 kDa | 6 | 4 | 0 | 1 |
프로그램된 세포 자살 6-인터랙팅 단백질 아이소폼 2 OS=Homo sapiens OX=9606 GN=PDCD6IP | 97 kDa | 6 | 3 | 0 | 4 |
서페이트 로커스(Surfeit locus) 단백질 4 아이소폼 2 OS=Homo sapiens OX=9606 GN=SURF4 | 18 kDa | 6 | 10 | 3 | 7 |
플라스미노겐 활성자 저해제 1 RNA-바인딩 단백질 아이소폼 3 OS=Homo sapiens OX=9606 GN=SERBP1 | 43 kDa | 6 | 11 | 6 | 7 |
포스파티딜이노시톨-바인딩 클라트린 조립 단백질 아이소폼 5 OS=Homo sapiens GN=PICALM | 70 kDa | 6 | 5 | 0 | 7 |
정션 플라코글로빈 OS=Homo sapiens OX=9606 GN=JUP PE=1 SV=3 | 82 kDa | 6 | 38 | 0 | 6 |
라민a-관련 폴리펩티드 2, 아이소폼 베타/감마 OS=Homo sapiens OX=9606 GN=TMPO PE=1 SV=2 | 51 kDa | 6 | 26 | 7 | 7 |
류신-풍부 리피트-함유 단백질 59 OS=Homo sapiens OX=9606 GN=LRRC59 PE=1 SV=1 | 35 kDa | 6 | 0 | 7 | 10 |
다기능성 단백질 ADE2 OS=Homo sapiens OX=9606 GN=PAICS PE=1 SV=3 | 47 kDa | 6 | 3 | 0 | 2 |
니코틴아마이드 N-메틸트랜스퍼라아제 OS=Homo sapiens OX=9606 GN=NNMT PE=1 SV=1 | 30 kDa | 6 | 0 | 0 | 1 |
폴리 [ADP-리보오스] 폴리머라아제 4 OS=Homo sapiens OX=9606 GN=PARP4 PE=1 SV=3 | 193 kDa | 6 | 19 | 0 | 5 |
단백질 S100-A6 OS=Homo sapiens OX=9606 GN=S100A6 PE=1 SV=1 | 10 kDa | 6 | 0 | 1 | 4 |
RuvB-유사 2 OS=Homo sapiens OX=9606 GN=RUVBL2 PE=1 SV=3 | 51 kDa | 6 | 19 | 0 | 5 |
근형질(Sarcoplasmic)/소포체 칼슘 ATP아제 2 OS=Homo sapiens GN=ATP2A2 PE=1 SV=1 | 115 kDa | 6 | 6 | 0 | 0 |
전사 1-알파/베타 시그널 트랜스듀서 및 활성자 OS=Homo sapiens OX=9606 GN=STAT1 PE=1 SV=2 | 87 kDa | 6 | 15 | 1 | 5 |
시냅틱 소낭 막 단백질 VAT-1 동족체 OS=Homo sapiens OX=9606 GN=VAT1 PE=1 SV=2 | 42 kDa | 6 | 6 | 0 | 7 |
유비퀴틴 카복실-말단하이드로라제 OS=Homo sapiens OX=9606 GN=UCHL1 PE=1 SV=1 | 27 kDa | 6 | 0 | 0 | 4 |
매우-긴-체인 3-옥소아실-CoA 리덕타아제 OS=Homo sapiens OX=9606 GN=HSD17B12 PE=1 SV=2 | 34 kDa | 6 | 0 | 2 | 6 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 13 OS=Homo sapiens OX=9606 GN=PSMD13 PE=1 SV=2 | 43 kDa | 5 | 9 | 0 | 4 |
26S 프로테아좀 조절 서브유닛 10B OS=Homo sapiens OX=9606 GN=PSMC6 PE=1 SV=1 | 44 kDa | 5 | 0 | 0 | 5 |
40S 리보솜 단백질 S10 OS=Homo sapiens OX=9606 GN=RPS10 PE=1 SV=1 | 19 kDa | 5 | 38 | 13 | 12 |
40S 리보솜 단백질 S11 OS=Homo sapiens OX=9606 GN=RPS11 PE=1 SV=3 | 18 kDa | 5 | 26 | 3 | 7 |
60S 리보솜 단백질 L21 OS=Homo sapiens OX=9606 GN=RPL21 PE=1 SV=2 | 19 kDa | 5 | 34 | 8 | 7 |
60S 리보솜 단백질 L22 OS=Homo sapiens OX=9606 GN=RPL22 PE=1 SV=2 | 15 kDa | 5 | 0 | 6 | 8 |
60S 리보솜 단백질 L23a (프래그먼트) OS=Homo sapiens OX=9606 GN=RPL23A PE=1 SV=1 | 19 kDa | 5 | 0 | 9 | 9 |
60S 리보솜 단백질 L27 OS=Homo sapiens OX=9606 GN=RPL27 PE=1 SV=2 | 16 kDa | 5 | 0 | 6 | 11 |
60S 리보솜 단백질 L28 OS=Homo sapiens OX=9606 GN=RPL28 PE=1 SV=3 | 16 kDa | 5 | 13 | 4 | 4 |
60S 리보솜 단백질 L31 OS=Homo sapiens OX=9606 GN=RPL31 PE=1 SV=1 | 14 kDa | 5 | 33 | 8 | 6 |
60S 리보솜 단백질 L36 OS=Homo sapiens OX=9606 GN=RPL36 PE=1 SV=3 | 12 kDa | 5 | 0 | 7 | 7 |
액틴-관련 단백질 2/3 컴플렉스 서브유닛 3 OS=Homo sapiens OX=9606 GN=ARPC3 PE=1 SV=3 | 21 kDa | 5 | 0 | 4 | 7 |
액틴-관련 단백질 2/3 컴플렉스 서브유닛 4 OS=Homo sapiens OX=9606 GN=ARPC4 PE=1 SV=3 | 20 kDa | 5 | 19 | 2 | 6 |
칼페인-1 촉매성 서브유닛 OS=Homo sapiens OX=9606 GN=CAPN1 PE=1 SV=1 | 82 kDa | 5 | 27 | 0 | 6 |
칼포닌-2 OS=Homo sapiens OX=9606 GN=CNN2 PE=1 SV=4 | 34 kDa | 5 | 5 | 1 | 6 |
카텝신 D OS=Homo sapiens OX=9606 GN=CTSD PE=1 SV=1 | 45 kDa | 5 | 0 | 0 | 3 |
클리비지(Cleavage) 및 폴리아데닐화 특이성 인자 서브유닛 5 OS=Homo sapiens OX=9606 GN=NUDT21 PE=1 SV=1 | 26 kDa | 5 | 0 | 0 | 6 |
코토머 서브유닛 엡실론 OS=Homo sapiens GN=COPE PE=1 SV=3 | 34 kDa | 5 | 14 | 2 | 8 |
코핀-3 OS=Homo sapiens OX=9606 GN=CPNE3 PE=1 SV=1 | 60 kDa | 5 | 0 | 0 | 1 |
사이토크롬 c 옥시다아제 서브유닛 2 OS=Homo sapiens OX=9606 GN=MT-CO2 PE=1 SV=1 | 26 kDa | 5 | 0 | 0 | 6 |
DNA-(아퓨린산 또는 아피리미딘 자리) 리아제 OS=Homo sapiens OX=9606 GN=APEX1 PE=1 SV=2 | 36 kDa | 5 | 8 | 0 | 3 |
에를린-1 OS=Homo sapiens OX=9606 GN=에를린1 PE=1 SV=1 | 39 kDa | 5 | 0 | 0 | 4 |
진핵성 번역 늘임 인자 1 엡실론-1 OS=Homo sapiens GN=EEF1E1 PE=1 SV=1 | 20 kDa | 5 | 7 | 2 | 7 |
진핵성 번역 개시 인자 2 서브유닛 1 OS=Homo sapiens OX=9606 GN=EIF2S1 PE=1 SV=3 | 36 kDa | 5 | 9 | 1 | 7 |
진핵성 번역 개시 인자 3 서브유닛 H OS=Homo sapiens OX=9606 GN=EIF3H PE=1 SV=1 | 42 kDa | 5 | 0 | 0 | 3 |
히트 쇼크 70 kDa 단백질 4 OS=Homo sapiens OX=9606 GN=HSPA4 PE=1 SV=4 | 94 kDa | 5 | 4 | 0 | 1 |
고유동성 그룹 단백질 B1 OS=Homo sapiens OX=9606 GN=HMGB1 PE=1 SV=3 | 25 kDa | 5 | 0 | 0 | 3 |
임포틴-9 OS=Homo sapiens OX=9606 GN=IPO9 PE=1 SV=3 | 116 kDa | 5 | 0 | 0 | 4 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=PSMD1 | 102 kDa | 5 | 10 | 0 | 3 |
칼슘-바인딩 미토콘드리아 캐리어 단백질 아라라2 아이소폼 2 OS=Homo sapiens OX=9606 GN=SLC25A13 | 74 kDa | 5 | 10 | 0 | 9 |
콜라겐 알파-3(VI) 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=COL6A3 | 321 kDa | 5 | 0 | 1 | 1 |
진핵성 번역 개시 인자 3 서브유닛 B 아이소폼 2 OS=Homo sapiens OX=9606 GN=EIF3B | 99 kDa | 5 | 5 | 0 | 6 |
글루코오즈-6-포스페이트 아이소머라아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=GPI | 64 kDa | 5 | 4 | 0 | 2 |
HLA 클래스 I 조직 적합성 항원, A-11 알파 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=HLA-A | 41 kDa | 5 | 3 | 0 | 3 |
Myb-바인딩 단백질 1A 아이소폼 2 OS=Homo sapiens OX=9606 GN=MYBBP1A | 149 kDa | 5 | 1 | 0 | 0 |
세린/아르기닌-풍부 스플라이싱 인자 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=SRSF2 | 24 kDa | 5 | 2 | 0 | 2 |
U1 스몰 핵 리보핵단백질 70 kDa 아이소폼 2 OS=Homo sapiens OX=9606 GN=SNRNP70 | 51 kDa | 5 | 0 | 0 | 5 |
글루타미나아제 키드니 아이소폼, 미토콘드리아 아이소폼 3 OS=Homo sapiens OX=9606 GN=GLS | 65 kDa | 5 | 7 | 0 | 3 |
AP-3 컴플렉스 서브유닛 델타-1 아이소폼 4 OS=Homo sapiens GN=AP3D1 | 115 kDa | 5 | 5 | 0 | 2 |
단백질 포스파타제 1 조절 서브유닛 12A 아이소폼 4 OS=Homo sapiens OX=9606 GN=PPP1R12A | 109 kDa | 5 | 10 | 3 | 7 |
진핵성 번역 개시 인자 4H 아이소폼 Short OS=Homo sapiens OX=9606 GN=EIF4H | 25 kDa | 5 | 5 | 1 | 4 |
론 프로테아제 동족체, 미토콘드리아 OS=Homo sapiens GN=LONP1 PE=1 SV=2 | 106 kDa | 5 | 0 | 0 | 6 |
마노실-올리고사카라이드 글루코시다아제 OS=Homo sapiens GN=MOGS PE=1 SV=5 | 92 kDa | 5 | 22 | 4 | 11 |
프롤릴 3-하이드록실라아제 1 OS=Homo sapiens OX=9606 GN=P3H1 PE=1 SV=2 | 83 kDa | 5 | 6 | 0 | 3 |
프로테아좀 서브유닛 알파 타입-4 OS=Homo sapiens OX=9606 GN=PSMA4 PE=1 SV=1 | 29 kDa | 5 | 0 | 0 | 7 |
단백질 LYRIC OS=Homo sapiens OX=9606 GN=MTDH PE=1 SV=2 | 64 kDa | 5 | 10 | 6 | 9 |
단백질/핵산 디글리카아제 DJ-1 OS=Homo sapiens OX=9606 GN=PARK7 PE=1 SV=2 | 20 kDa | 5 | 0 | 0 | 3 |
라스-관련 단백질 Rab-1A OS=Homo sapiens OX=9606 GN=RAB1A PE=1 SV=3 | 23 kDa | 5 | 13 | 2 | 8 |
라스-관련 단백질 Rab-3B OS=Homo sapiens OX=9606 GN=RAB3B PE=1 SV=2 | 25 kDa | 5 | 0 | 2 | 7 |
Rho GDP-디소시에이션 저해제 1 OS=Homo sapiens OX=9606 GN=ARHGDIA PE=1 SV=3 | 23 kDa | 5 | 0 | 0 | 4 |
시그널 인식 파티클 서브유닛 SRP72 OS=Homo sapiens OX=9606 GN=SRP72 PE=1 SV=3 | 75 kDa | 5 | 8 | 1 | 8 |
스몰 핵 리보핵단백질 Sm D2 OS=Homo sapiens OX=9606 GN=SNRPD2 PE=1 SV=1 | 14 kDa | 5 | 11 | 0 | 5 |
분류 및 조립 머시너리 컴포넌트 50 동족체 OS=Homo sapiens OX=9606 GN=SAMM50 PE=1 SV=3 | 52 kDa | 5 | 19 | 4 | 12 |
Src 기질 코택틴 OS=Homo sapiens OX=9606 GN=CTTN PE=1 SV=2 | 62 kDa | 5 | 38 | 12 | 8 |
SWI/SNF 컴플렉스 서브유닛 SMARCC1 OS=Homo sapiens OX=9606 GN=SMARCC1 PE=1 SV=3 | 123 kDa | 5 | 0 | 0 | 2 |
전사 인자 BTF3 OS=Homo sapiens OX=9606 GN=BTF3 PE=1 SV=1 | 22 kDa | 5 | 8 | 0 | 7 |
트랜스로콘-관련 단백질 서브유닛 델타 OS=Homo sapiens OX=9606 GN=SSR4 PE=1 SV=1 | 19 kDa | 5 | 0 | 2 | 4 |
TREMBL:Q1RMK2 (Bos taurus) IGHM 단백질 | 65 kDa | 5 | 0 | 0 | 0 |
WD 리피트-함유 단백질 1 OS=Homo sapiens OX=9606 GN=WDR1 PE=1 SV=4 | 66 kDa | 5 | 11 | 0 | 5 |
자이신 OS=Homo sapiens OX=9606 GN=ZYX PE=1 SV=1 | 61 kDa | 5 | 13 | 0 | 4 |
2-옥소글루타레이트 탈수소효소, 미토콘드리아 OS=Homo sapiens OX=9606 GN=OGDH PE=1 SV=3 | 116 kDa | 4 | 2 | 0 | 6 |
40S 리보솜 단백질 S27-유사 OS=Homo sapiens OX=9606 GN=RPS27L PE=1 SV=3 | 9 kDa | 4 | 0 | 1 | 1 |
아데노실호모시스테이나아제 OS=Homo sapiens OX=9606 GN=AHCY PE=1 SV=4 | 48 kDa | 4 | 4 | 0 | 2 |
ADP-리보실레이션 인자 6 OS=Homo sapiens OX=9606 GN=ARF6 PE=1 SV=2 | 20 kDa | 4 | 0 | 0 | 2 |
알라닌--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=AARS PE=1 SV=2 | 107 kDa | 4 | 0 | 0 | 2 |
ATP아제 패밀리 AAA 도메인-함유 단백질 3A OS=Homo sapiens OX=9606 GN=ATAD3A PE=1 SV=2 | 71 kDa | 4 | 22 | 5 | 9 |
코토머 서브유닛 델타 OS=Homo sapiens OX=9606 GN=ARCN1 PE=1 SV=1 | 57 kDa | 4 | 10 | 0 | 5 |
저온-유도성 RNA-바인딩 단백질 OS=Homo sapiens GN=CIRBP PE=1 SV=1 | 19 kDa | 4 | 3 | 0 | 4 |
코핀-1 OS=Homo sapiens OX=9606 GN=CPNE1 PE=1 SV=1 | 59 kDa | 4 | 0 | 0 | 2 |
사이토크롬 b-c1 컴플렉스 서브유닛 2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=UQCRC2 PE=1 SV=3 | 48 kDa | 4 | 0 | 0 | 8 |
DBH-유사 모노옥시게나아제 단백질 1 OS=Homo sapiens OX=9606 GN=MOXD1 PE=1 SV=1 | 70 kDa | 4 | 17 | 5 | 4 |
EH 도메인-함유 단백질 1 OS=Homo sapiens OX=9606 GN=EHD1 PE=1 SV=2 | 61 kDa | 4 | 11 | 0 | 9 |
진핵성 번역 개시 인자 3 서브유닛 C OS=Homo sapiens OX=9606 GN=EIF3C PE=1 SV=1 | 105 kDa | 4 | 4 | 0 | 5 |
진핵성 번역 개시 인자 4 감마 2 OS=Homo sapiens GN=EIF4G2 PE=1 SV=1 | 102 kDa | 4 | 8 | 1 | 3 |
진핵성 번역 개시 인자 6 OS=Homo sapiens OX=9606 GN=EIF6 PE=1 SV=1 | 27 kDa | 4 | 10 | 2 | 5 |
구아닌 뉴클레오티드-바인딩 단백질 G(I)/G(S)/G(T) 서브유닛 베타-1 OS=Homo sapiens OX=9606 GN=GNB1 PE=1 SV=3 | 37 kDa | 4 | 12 | 3 | 4 |
칼파스타틴 아이소폼 10 OS=Homo sapiens OX=9606 GN=CAST | 82 kDa | 4 | 4 | 0 | 1 |
40S 리보솜 단백질 S24 아이소폼 2 OS=Homo sapiens OX=9606 GN=RPS24 | 15 kDa | 4 | 46 | 10 | 8 |
크로모도메인-헬리카아제-DNA-바인딩 단백질 4 아이소폼 2 OS=Homo sapiens GN=CHD4 | 221 kDa | 4 | 5 | 0 | 1 |
진핵성 번역 개시 인자 3 서브유닛 L 아이소폼 2 OS=Homo sapiens OX=9606 GN=EIF3L | 61 kDa | 4 | 5 | 0 | 6 |
글루코시다아제 2 서브유닛 베타 아이소폼 2 OS=Homo sapiens OX=9606 GN=PRKCSH | 59 kDa | 4 | 5 | 0 | 4 |
헥소키나아제-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=HK1 | 102 kDa | 4 | 3 | 0 | 1 |
이소구연산염 탈수소효소 [NADP], 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=IDH2 | 45 kDa | 4 | 19 | 1 | 4 |
노달(nodal) 모듈레이터(modulator) 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=NOMO2 | 134 kDa | 4 | 4 | 0 | 3 |
플라스틴-3 아이소폼 2 OS=Homo sapiens OX=9606 GN=PLS3 | 69 kDa | 4 | 0 | 0 | 1 |
프로테아좀 서브유닛 알파 타입-3 아이소폼 2 OS=Homo sapiens OX=9606 GN=PSMA3 | 28 kDa | 4 | 6 | 0 | 4 |
단백질 SET 아이소폼 2 OS=Homo sapiens GN=SET | 32 kDa | 4 | 7 | 0 | 4 |
스플라이싱 인자 U2AF 65 kDa 서브유닛 아이소폼 2 OS=Homo sapiens OX=9606 GN=U2AF2 | 53 kDa | 4 | 1 | 0 | 5 |
SWI/SNF 컴플렉스 서브유닛 SMARCC2 아이소폼 2 OS=Homo sapiens OX=9606 GN=SMARCC2 | 125 kDa | 4 | 9 | 0 | 3 |
언컨벤셔널 미오신-Ib 아이소폼 2 OS=Homo sapiens OX=9606 GN=MYO1B | 125 kDa | 4 | 16 | 0 | 0 |
디낵틴 서브유닛 1 아이소폼 3 OS=Homo sapiens OX=9606 GN=DCTN1 | 137 kDa | 4 | 8 | 0 | 2 |
이종성 핵 리보핵단백질 A/B 아이소폼 3 OS=Homo sapiens GN=HNRNPAB | 31 kDa | 4 | 10 | 2 | 6 |
미오페를린 아이소폼 3 OS=Homo sapiens OX=9606 GN=MYOF | 233 kDa | 4 | 6 | 0 | 1 |
핵 및 코일드-바디 포스포단백질 1 아이소폼 3 OS=Homo sapiens OX=9606 GN=NOLC1 | 74 kDa | 4 | 7 | 1 | 3 |
핵 인자 카파-B 키나아제-인터랙팅 단백질 저해제 아이소폼 4 OS=Homo sapiens OX=9606 GN=IKBIP | 43 kDa | 4 | 11 | 2 | 5 |
MMS19 뉴클레오티드 엑시시전(excision) 리페어 단백질 동족체 아이소폼 6 OS=Homo sapiens GN=MMS19 | 108 kDa | 4 | 0 | 0 | 1 |
RNA-바인딩 단백질 FUS 아이소폼 Short OS=Homo sapiens OX=9606 GN=FUS | 53 kDa | 4 | 9 | 0 | 4 |
마이크로튜불-액틴 가교결합 인자 1, 아이소폼 1/2/3/5 OS=Homo sapiens OX=9606 GN=MACF1 PE=1 SV=4 | 838 kDa | 4 | 2 | 0 | 0 |
미토콘드리아 캐리어 동족체 1 (프래그먼트) OS=Homo sapiens OX=9606 GN=MTCH1 PE=1 SV=1 | 43 kDa | 4 | 0 | 0 | 5 |
뉴클레아제-민감성 엘리먼트-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=YBX1 PE=1 SV=3 | 36 kDa | 4 | 0 | 7 | 9 |
핵 GTP-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=GTPBP4 PE=1 SV=3 | 74 kDa | 4 | 5 | 0 | 1 |
OCIA 도메인-함유 단백질 2 OS=Homo sapiens OX=9606 GN=OCIAD2 PE=1 SV=1 | 17 kDa | 4 | 0 | 0 | 0 |
프록시소말 다기능성 효소 타입 2 OS=Homo sapiens GN=HSD17B4 PE=1 SV=3 | 80 kDa | 4 | 10 | 0 | 9 |
프로버블 ATP-의존 RNA 헬리카아제 DDX6 OS=Homo sapiens OX=9606 GN=DDX6 PE=1 SV=2 | 54 kDa | 4 | 4 | 0 | 2 |
프로테아좀 서브유닛 알파 타입-2 OS=Homo sapiens OX=9606 GN=PSMA2 PE=1 SV=2 | 26 kDa | 4 | 0 | 0 | 8 |
프로테아좀 서브유닛 베타 타입-1 OS=Homo sapiens OX=9606 GN=PSMB1 PE=1 SV=2 | 26 kDa | 4 | 0 | 0 | 6 |
프로테아좀 서브유닛 베타 타입-3 OS=Homo sapiens OX=9606 GN=PSMB3 PE=1 SV=2 | 23 kDa | 4 | 0 | 0 | 6 |
프로테아좀 서브유닛 베타 타입-7 OS=Homo sapiens OX=9606 GN=PSMB7 PE=1 SV=1 | 30 kDa | 4 | 0 | 0 | 6 |
단백질 아르기닌 N-메틸트랜스퍼라아제 1 OS=Homo sapiens GN=PRMT1 PE=1 SV=2 | 42 kDa | 4 | 3 | 0 | 1 |
라스 GTP아제-활성화 단백질-바인딩 단백질 2 OS=Homo sapiens OX=9606 GN=G3BP2 PE=1 SV=2 | 54 kDa | 4 | 14 | 2 | 5 |
라스 서프레서(suppressor) 단백질 1 OS=Homo sapiens OX=9606 GN=RSU1 PE=1 SV=3 | 32 kDa | 4 | 16 | 1 | 8 |
RNA-바인딩 단백질 Raly OS=Homo sapiens OX=9606 GN=RALY PE=1 SV=1 | 32 kDa | 4 | 14 | 2 | 7 |
시데로플렉신-1 OS=Homo sapiens OX=9606 GN=SFXN1 PE=1 SV=4 | 36 kDa | 4 | 3 | 1 | 4 |
시데로플렉신-3 OS=Homo sapiens OX=9606 GN=SFXN3 PE=1 SV=3 | 36 kDa | 4 | 0 | 0 | 4 |
시그널 인식 파티클 9 kDa 단백질 OS=Homo sapiens OX=9606 GN=SRP9 PE=1 SV=2 | 10 kDa | 4 | 7 | 1 | 3 |
스플라이싱 인자 3A 서브유닛 1 OS=Homo sapiens OX=9606 GN=SF3A1 PE=1 SV=1 | 89 kDa | 4 | 6 | 0 | 5 |
SWISS-PROT:Q9TTE1 (Bos taurus) 엔도핀-1 전구체 | 46 kDa | 4 | 4 | 2 | 1 |
Thy-1 막 당단백질 OS=Homo sapiens OX=9606 GN=THY1 PE=1 SV=2 | 18 kDa | 4 | 0 | 6 | 3 |
트랜스막 단백질 43 OS=Homo sapiens OX=9606 GN=TMEM43 PE=1 SV=1 | 45 kDa | 4 | 0 | 5 | 6 |
컴플리먼트 컴포넌트 C5 유사 TREMBL:Q1A7A4 (Bos taurus) | 189 kDa | 4 | 0 | 0 | 0 |
트리카복실레이트 트랜스포트 단백질, 미토콘드리아 OS=Homo sapiens OX=9606 GN=SLC25A1 PE=1 SV=2 | 34 kDa | 4 | 2 | 0 | 3 |
U2 스몰 핵 리보핵단백질 A' OS=Homo sapiens OX=9606 GN=SNRPA1 PE=1 SV=2 | 28 kDa | 4 | 0 | 0 | 4 |
혈관확장-스티뮬레이티드 포스포단백질 OS=Homo sapiens OX=9606 GN=VASP PE=1 SV=3 | 40 kDa | 4 | 10 | 0 | 10 |
(Bos taurus) 47 kDa 단백질 | 47 kDa | 3 | 0 | 0 | 0 |
컴플리먼트 C4-A 전구체 유사 (Bos taurus) | 193 kDa | 3 | 7 | 4 | 4 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 5 OS=Homo sapiens OX=9606 GN=PSMD5 PE=1 SV=3 | 56 kDa | 3 | 4 | 0 | 1 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 7 OS=Homo sapiens OX=9606 GN=PSMD7 PE=1 SV=2 | 37 kDa | 3 | 10 | 0 | 6 |
26S 프로테아좀 조절 서브유닛 7 OS=Homo sapiens OX=9606 GN=PSMC2 PE=1 SV=3 | 49 kDa | 3 | 4 | 0 | 4 |
39S 리보솜 단백질 L28, 미토콘드리아 OS=Homo sapiens OX=9606 GN=MRPL28 PE=1 SV=4 | 30 kDa | 3 | 0 | 0 | 1 |
40S 리보솜 단백질 S15a OS=Homo sapiens OX=9606 GN=RPS15A PE=1 SV=2 | 15 kDa | 3 | 0 | 2 | 3 |
60S 리보솜 단백질 L15 OS=Homo sapiens OX=9606 GN=RPL15 PE=1 SV=2 | 24 kDa | 3 | 27 | 3 | 11 |
아세틸-CoA 아세틸트랜스퍼라아제, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ACAT1 PE=1 SV=1 | 45 kDa | 3 | 11 | 0 | 5 |
ATP 신타아제 F(0) 컴플렉스 서브유닛 B1, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ATP5PB PE=1 SV=2 | 29 kDa | 3 | 0 | 0 | 2 |
ATP-바인딩 카세트 서브-패밀리 D 멤버 3 OS=Homo sapiens OX=9606 GN=ABCD3 PE=1 SV=1 | 75 kDa | 3 | 8 | 2 | 2 |
칼포닌-3 OS=Homo sapiens OX=9606 GN=CNN3 PE=1 SV=1 | 36 kDa | 3 | 4 | 1 | 6 |
세포 표면 당단백질 MUC18 OS=Homo sapiens OX=9606 GN=MCAM PE=1 SV=2 | 72 kDa | 3 | 3 | 0 | 6 |
CTP 신타아제 1 OS=Homo sapiens OX=9606 GN=CTPS1 PE=1 SV=2 | 67 kDa | 3 | 0 | 0 | 0 |
사이토플라즈믹 디네인 1 라이트 인터미디에이트 체인 1 OS=Homo sapiens OX=9606 GN=DYNC1LI1 PE=1 SV=3 | 57 kDa | 3 | 11 | 0 | 4 |
사이토플라즈믹 FMR1-인터랙팅 단백질 1 OS=Homo sapiens OX=9606 GN=CYFIP1 PE=1 SV=1 | 145 kDa | 3 | 2 | 0 | 0 |
데스모글레인-2 OS=Homo sapiens OX=9606 GN=DSG2 PE=1 SV=2 | 122 kDa | 3 | 17 | 5 | 7 |
데스모플라킨 OS=Homo sapiens OX=9606 GN=DSP PE=1 SV=3 | 332 kDa | 3 | 35 | 0 | 0 |
피루베이트 탈수소효소 콤플렉스 디히드로리포일리신-잔류물 아세틸트랜스퍼라아제 컴포넌트, 미토콘드리아 OS=Homo sapiens OX=9606 GN=DLAT PE=1 SV=3 | 69 kDa | 3 | 0 | 2 | 10 |
DnaJ 동족체 서브패밀리 A 멤버 2 OS=Homo sapiens OX=9606 GN=DNAJA2 PE=1 SV=1 | 46 kDa | 3 | 0 | 1 | 6 |
디네인 라이트 체인 Tctex-타입 1 OS=Homo sapiens OX=9606 GN=DYNLT1 PE=1 SV=1 | 12 kDa | 3 | 13 | 3 | 5 |
E3 유비퀴틴/ISG15 리가아제 TRIM25 OS=Homo sapiens OX=9606 GN=TRIM25 PE=1 SV=2 | 71 kDa | 3 | 0 | 0 | 1 |
EGF-유사 리피트 및 디스코이딘 I-유사 도메인-함유 단백질 3 OS=Homo sapiens OX=9606 GN=EDIL3 PE=1 SV=1 | 54 kDa | 3 | 26 | 1 | 7 |
이노일-CoA 하이드라타아제, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ECHS1 PE=1 SV=4 | 31 kDa | 3 | 0 | 0 | 2 |
표피 성장 인자 수용체 키나아제 기질 8-유사 단백질 2 OS=Homo sapiens OX=9606 GN=EPS8L2 PE=1 SV=2 | 81 kDa | 3 | 4 | 0 | 5 |
ER 루멘 단백질-유지 수용체 1 OS=Homo sapiens OX=9606 GN=KDELR1 PE=1 SV=1 | 25 kDa | 3 | 0 | 2 | 1 |
진핵성 번역 개시 인자 2 서브유닛 2 OS=Homo sapiens OX=9606 GN=EIF2S2 PE=1 SV=2 | 38 kDa | 3 | 0 | 7 | 10 |
일반 전사 인자 II-I OS=Homo sapiens OX=9606 GN=GTF2I PE=1 SV=2 | 112 kDa | 3 | 27 | 3 | 3 |
고유동성 그룹 단백질 HMGI-C OS=Homo sapiens GN=HMGA2 PE=1 SV=1 | 12 kDa | 3 | 48 | 3 | 0 |
이노신-5'-모노포스페이트 탈수소효소 2 OS=Homo sapiens OX=9606 GN=IMPDH2 PE=1 SV=2 | 56 kDa | 3 | 0 | 0 | 2 |
세포자살 저해제 5 아이소폼 1 OS=Homo sapiens OX=9606 GN=API5 | 49 kDa | 3 | 5 | 0 | 3 |
타이틴 아이소폼 12 OS=Homo sapiens OX=9606 GN=TTN | 3994 kDa | 3 | 1 | 3 | 3 |
3-하이드록시아실-CoA 탈수소효소 타입-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=HSD17B10 | 26 kDa | 3 | 2 | 0 | 1 |
ATP-의존 RNA 헬리카아제 DDX54 아이소폼 2 OS=Homo sapiens OX=9606 GN=DDX54 | 99 kDa | 3 | 1 | 0 | 3 |
B-세포 수용체-관련 단백질 31 아이소폼 2 OS=Homo sapiens OX=9606 GN=BCAP31 | 35 kDa | 3 | 1 | 4 | 7 |
칼슘-바인딩 미토콘드리아 캐리어 단백질 SCaMC-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=SLC25A24 | 51 kDa | 3 | 1 | 0 | 5 |
콜라겐 알파-1(V) 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=COL5A1 | 184 kDa | 3 | 0 | 13 | 6 |
E3 유비퀴틴-단백질 리가아제 UBR4 아이소폼 2 OS=Homo sapiens OX=9606 GN=UBR4 | 576 kDa | 3 | 0 | 0 | 1 |
임포틴-4 아이소폼 2 OS=Homo sapiens GN=IPO4 | 119 kDa | 3 | 0 | 0 | 0 |
인슐린-유사 성장 인자 2 mRNA-바인딩 단백질 2 아이소폼 2 OS=Homo sapiens GN=IGF2BP2 | 62 kDa | 3 | 19 | 2 | 5 |
NADH 탈수소효소 [유비퀴논] 1 알파 서브컴플렉스 서브유닛 10 아이소폼 2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=NDUFA10 | 49 kDa | 3 | 0 | 0 | 2 |
NADH-사이토크롬 b5 리덕타아제 3 아이소폼 2 OS=Homo sapiens OX=9606 GN=CYB5R3 | 32 kDa | 3 | 6 | 0 | 3 |
핵 포어 컴플렉스 단백질 Nup107 아이소폼 2 OS=Homo sapiens OX=9606 GN=NUP107 | 103 kDa | 3 | 1 | 0 | 0 |
단백질 Dok-7 아이소폼 2 OS=Homo sapiens OX=9606 GN=DOK7 | 37 kDa | 3 | 0 | 2 | 5 |
단백질 FAM98B 아이소폼 2 OS=Homo sapiens OX=9606 GN=FAM98B | 46 kDa | 3 | 9 | 0 | 4 |
색신 아이소폼 2 OS=Homo sapiens OX=9606 GN=SACS | 437 kDa | 3 | 0 | 0 | 0 |
세린/아르기닌-풍부 스플라이싱 인자 3 아이소폼 2 OS=Homo sapiens OX=9606 GN=SRSF3 | 14 kDa | 3 | 8 | 0 | 4 |
스몰 핵 리보핵단백질 Sm D3 아이소폼 2 OS=Homo sapiens OX=9606 GN=SNRPD3 | 13 kDa | 3 | 10 | 2 | 3 |
스타스민 아이소폼 2 OS=Homo sapiens OX=9606 GN=STMN1 | 20 kDa | 3 | 0 | 0 | 3 |
TP53-바인딩 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=TP53BP1 | 214 kDa | 3 | 4 | 0 | 0 |
매우 긴-체인 특이적 아실-CoA 탈수소효소 아이소폼 2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ACADVL | 68 kDa | 3 | 10 | 0 | 5 |
전압-의존 음이온-선택적 채널 단백질 3 아이소폼 2 OS=Homo sapiens OX=9606 GN=VDAC3 | 31 kDa | 3 | 15 | 0 | 5 |
V-타입 프로톤 ATP아제 촉매성 서브유닛 A 아이소폼 2 OS=Homo sapiens OX=9606 GN=ATP6V1A | 65 kDa | 3 | 15 | 1 | 2 |
4F2 세포-표면 항원 헤비 체인 아이소폼 3 OS=Homo sapiens GN=SLC3A2 | 62 kDa | 3 | 1 | 1 | 1 |
알데히드 탈수소효소 패밀리 16 멤버 A1 아이소폼 3 OS=Homo sapiens OX=9606 GN=ALDH16A1 | 80 kDa | 3 | 0 | 0 | 1 |
드레브린 아이소폼 3 OS=Homo sapiens GN=DBN1 | 76 kDa | 3 | 31 | 4 | 3 |
얼빈 아이소폼 3 OS=Homo sapiens OX=9606 GN=Erbin | 153 kDa | 3 | 0 | 0 | 0 |
뉴클레오사이드 디포스페이트 키나아제 B 아이소폼 3 OS=Homo sapiens GN=NME2 | 30 kDa | 3 | 12 | 0 | 7 |
페릴리핀-3 아이소폼 3 OS=Homo sapiens OX=9606 GN=PLIN3 | 47 kDa | 3 | 1 | 0 | 3 |
SUN 도메인-함유 단백질 2 아이소폼 3 OS=Homo sapiens OX=9606 GN=SUN2 | 80 kDa | 3 | 15 | 4 | 12 |
트랜스포틴-3 아이소폼 3 OS=Homo sapiens OX=9606 GN=TNPO3 | 103 kDa | 3 | 0 | 0 | 0 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 6 아이소폼 4 OS=Homo sapiens OX=9606 GN=PSMD6 | 52 kDa | 3 | 17 | 0 | 2 |
단백질 트랜스포트 단백질 Sec31A 아이소폼 9 OS=Homo sapiens GN=SEC31A | 131 kDa | 3 | 3 | 0 | 1 |
키네신 라이트 체인 1 아이소폼 K OS=Homo sapiens OX=9606 GN=KLC1 | 70 kDa | 3 | 2 | 0 | 2 |
MICOS 컴플렉스 서브유닛 MIC19 OS=Homo sapiens OX=9606 GN=CHCHD3 PE=1 SV=1 | 26 kDa | 3 | 0 | 3 | 6 |
핵 포어 컴플렉스 단백질 Nup205 OS=Homo sapiens OX=9606 GN=NUP205 PE=1 SV=3 | 228 kDa | 3 | 0 | 0 | 0 |
핵 포어 컴플렉스 단백질 Nup93 OS=Homo sapiens OX=9606 GN=NUP93 PE=1 SV=2 | 93 kDa | 3 | 6 | 0 | 3 |
PC4 및 SFRS1-인터랙팅 단백질 OS=Homo sapiens OX=9606 GN=PSIP1 PE=1 SV=1 | 60 kDa | 3 | 16 | 1 | 5 |
퍼옥시레독신-6 OS=Homo sapiens OX=9606 GN=PRDX6 PE=1 SV=3 | 25 kDa | 3 | 0 | 0 | 0 |
PRA1 패밀리 단백질 3 OS=Homo sapiens OX=9606 GN=ARL6IP5 PE=1 SV=1 | 22 kDa | 3 | 7 | 1 | 4 |
증식 세포 핵 항원 OS=Homo sapiens OX=9606 GN=PCNA PE=1 SV=1 | 29 kDa | 3 | 0 | 0 | 0 |
증식-관련 단백질 2G4 OS=Homo sapiens OX=9606 GN=PA2G4 PE=1 SV=3 | 44 kDa | 3 | 16 | 0 | 6 |
프로테아좀 어댑터 및 스캐폴드 단백질 ECM29 OS=Homo sapiens OX=9606 GN=ECPAS PE=1 SV=2 | 204 kDa | 3 | 0 | 0 | 2 |
프로테아좀 서브유닛 베타 타입-4 OS=Homo sapiens OX=9606 GN=PSMB4 PE=1 SV=4 | 29 kDa | 3 | 0 | 0 | 4 |
프로테아좀 서브유닛 베타 타입-6 OS=Homo sapiens OX=9606 GN=PSMB6 PE=1 SV=4 | 25 kDa | 3 | 0 | 0 | 3 |
단백질 DEK OS=Homo sapiens OX=9606 GN=DEK PE=1 SV=1 | 43 kDa | 3 | 2 | 0 | 2 |
단백질 S100-A11 OS=Homo sapiens OX=9606 GN=S100A11 PE=1 SV=2 | 12 kDa | 3 | 0 | 0 | 2 |
단백질 트랜스포트 단백질 Sec61 서브유닛 베타 OS=Homo sapiens OX=9606 GN=SEC61B PE=1 SV=2 | 10 kDa | 3 | 1 | 2 | 2 |
퓨로미신-민감성 아미노펩티다아제 OS=Homo sapiens GN=NPEPPS PE=1 SV=2 | 103 kDa | 3 | 0 | 0 | 2 |
라스-관련 단백질 Rab-11B OS=Homo sapiens OX=9606 GN=RAB11B PE=1 SV=4 | 24 kDa | 3 | 9 | 1 | 6 |
라스-관련 단백질 Rab-14 OS=Homo sapiens OX=9606 GN=RAB14 PE=1 SV=4 | 24 kDa | 3 | 0 | 0 | 6 |
라스-관련 단백질 Rap-1b OS=Homo sapiens OX=9606 GN=RAP1B PE=1 SV=1 | 21 kDa | 3 | 7 | 2 | 3 |
라스-관련 단백질 R-라스 OS=Homo sapiens OX=9606 GN=RRas PE=1 SV=1 | 23 kDa | 3 | 0 | 0 | 2 |
RNA 전사, 번역 및 트랜스포트 인자 단백질 OS=Homo sapiens OX=9606 GN=RTRAF PE=1 SV=1 | 28 kDa | 3 | 0 | 4 | 6 |
SAP 도메인-함유 리보핵단백질 OS=Homo sapiens OX=9606 GN=SARNP PE=1 SV=3 | 24 kDa | 3 | 0 | 0 | 2 |
SWISS-PROT:P06868 (Bos taurus) 플라스미노겐 전구체 | 91 kDa | 3 | 1 | 5 | 0 |
SWISS-PROT:P41361 (Bos taurus) 안티트롬빈-III 전구체 | 52 kDa | 3 | 3 | 0 | 0 |
TAR DNA-바인딩 단백질 43 OS=Homo sapiens OX=9606 GN=TARDBP PE=1 SV=1 | 45 kDa | 3 | 2 | 0 | 3 |
티오레독신 리덕타아제 1, 사이토플라즈믹 OS=Homo sapiens GN=TXNRD1 PE=1 SV=3 | 71 kDa | 3 | 0 | 0 | 1 |
트롬보스폰딘 타입-1 도메인-함유 단백질 4 OS=Homo sapiens OX=9606 GN=THSD4 PE=2 SV=2 | 112 kDa | 3 | 22 | 10 | 1 |
TREMBL:Q2KJF1 (Bos taurus) 알파-1-B 당단백질 | 54 kDa | 3 | 11 | 1 | 3 |
tRNA-스플라이싱 리가아제 RtcB 동족체 OS=Homo sapiens OX=9606 GN=RTCB PE=1 SV=1 | 55 kDa | 3 | 19 | 3 | 9 |
티로신--tRNA 리가아제, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=YARS PE=1 SV=4 | 59 kDa | 3 | 0 | 0 | 2 |
유비퀴틴 티오에스테라아제 OTUB1 OS=Homo sapiens OX=9606 GN=OTUB1 PE=1 SV=2 | 31 kDa | 3 | 0 | 0 | 1 |
비질린 OS=Homo sapiens OX=9606 GN=HDLBP PE=1 SV=2 | 141 kDa | 3 | 9 | 0 | 2 |
V-타입 프로톤 ATP아제 116 kDa 서브유닛 a 아이소폼 3 OS=Homo sapiens OX=9606 GN=TCIRG1 PE=1 SV=3 | 93 kDa | 3 | 16 | 1 | 2 |
WD 리피트-함유 단백질 61 OS=Homo sapiens OX=9606 GN=WDR61 PE=1 SV=1 | 34 kDa | 3 | 0 | 1 | 4 |
39S 리보솜 단백질 L41, 미토콘드리아 OS=Homo sapiens OX=9606 GN=MRPL41 PE=1 SV=1 | 15 kDa | 2 | 0 | 0 | 5 |
40S 리보솜 단백질 S25 OS=Homo sapiens OX=9606 GN=RPS25 PE=1 SV=1 | 14 kDa | 2 | 0 | 8 | 7 |
60S 산성 리보솜 단백질 P1 OS=Homo sapiens OX=9606 GN=RPLP1 PE=1 SV=1 | 12 kDa | 2 | 13 | 3 | 5 |
액틴-유사 단백질 6A OS=Homo sapiens OX=9606 GN=ACTL6A PE=1 SV=1 | 47 kDa | 2 | 12 | 0 | 2 |
액틴-관련 단백질 2/3 컴플렉스 서브유닛 5 OS=Homo sapiens OX=9606 GN=ARPC5 PE=1 SV=3 | 16 kDa | 2 | 15 | 5 | 7 |
액틴-관련 단백질 2/3 컴플렉스 서브유닛 5-유사 단백질 OS=Homo sapiens OX=9606 GN=ARPC5L PE=1 SV=1 | 17 kDa | 2 | 0 | 6 | 5 |
액티베이티드 RNA 폴리머라아제 II 전사 공활성자 p15 OS=Homo sapiens OX=9606 GN=서브1 PE=1 SV=3 | 14 kDa | 2 | 1 | 0 | 2 |
알코올 탈수소효소 [NADP(+)] OS=Homo sapiens OX=9606 GN=AKR1A1 PE=1 SV=3 | 37 kDa | 2 | 0 | 0 | 1 |
아스파틸/아스파라기닐 베타-하이드록실라아제 OS=Homo sapiens OX=9606 GN=ASPH PE=1 SV=3 | 86 kDa | 2 | 4 | 1 | 3 |
ATP 신타아제 서브유닛 f, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ATP5MF PE=1 SV=1 | 11 kDa | 2 | 0 | 2 | 2 |
ATP-바인딩 카세트 서브-패밀리 B 멤버 6, 미토콘드리아 (프래그먼트) OS=Homo sapiens OX=9606 GN=ABCB6 PE=1 SV=1 | 78 kDa | 2 | 0 | 0 | 0 |
카테닌 델타-1 OS=Homo sapiens OX=9606 GN=CTNND1 PE=1 SV=1 | 108 kDa | 2 | 13 | 0 | 1 |
카텝신 B OS=Homo sapiens OX=9606 GN=CTSB PE=1 SV=3 | 38 kDa | 2 | 0 | 0 | 0 |
카베올린-1 OS=Homo sapiens OX=9606 GN=CAV1 PE=1 SV=4 | 20 kDa | 2 | 11 | 2 | 4 |
세포 주기 및 세포자살 조절자 단백질 2 OS=Homo sapiens GN=CCAR2 PE=1 SV=2 | 103 kDa | 2 | 1 | 0 | 4 |
센트로미어 단백질 V OS=Homo sapiens OX=9606 GN=CENPV PE=1 SV=1 | 30 kDa | 2 | 3 | 0 | 1 |
구연산염 신타아제 OS=Homo sapiens OX=9606 GN=CS PE=1 SV=1 | 50 kDa | 2 | 0 | 0 | 3 |
사이토크롬 b-c1 컴플렉스 서브유닛 1, 미토콘드리아 OS=Homo sapiens OX=9606 GN=UQCRC1 PE=1 SV=3 | 53 kDa | 2 | 0 | 0 | 1 |
사이토크롬 c 옥시다아제 서브유닛 7A2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=COX7A2 PE=1 SV=1 | 9 kDa | 2 | 0 | 0 | 1 |
디스토닌 OS=Homo sapiens OX=9606 GN=DST PE=1 SV=4 | 861 kDa | 2 | 0 | 0 | 0 |
EH 도메인-함유 단백질 2 OS=Homo sapiens OX=9606 GN=EHD2 PE=1 SV=2 | 61 kDa | 2 | 2 | 0 | 3 |
mRNA-디캐핑 단백질 4 인헨서 OS=Homo sapiens GN=EDC4 PE=1 SV=1 | 152 kDa | 2 | 0 | 0 | 0 |
진핵성 번역 개시 인자 5B OS=Homo sapiens OX=9606 GN=EIF5B PE=1 SV=4 | 139 kDa | 2 | 0 | 0 | 2 |
엑소좀 RNA 헬리카아제 MTR4 OS=Homo sapiens OX=9606 GN=MTREX PE=1 SV=3 | 118 kDa | 2 | 0 | 0 | 1 |
파 업스트림(Far upstream) 엘리먼트-바인딩 단백질 2 OS=Homo sapiens OX=9606 GN=KHSRP PE=1 SV=4 | 73 kDa | 2 | 0 | 0 | 0 |
페리틴 헤비 체인 OS=Homo sapiens OX=9606 GN=FTH1 PE=1 SV=2 | 21 kDa | 2 | 0 | 0 | 1 |
FH2 도메인-함유 단백질 1 OS=Homo sapiens OX=9606 GN=FHDC1 PE=1 SV=2 | 125 kDa | 2 | 0 | 0 | 0 |
글루타레독신-3 OS=Homo sapiens OX=9606 GN=GLRX3 PE=1 SV=2 | 37 kDa | 2 | 0 | 0 | 0 |
GTP-바인딩 단백질 SAR1a OS=Homo sapiens OX=9606 GN=SAR1A PE=1 SV=1 | 22 kDa | 2 | 0 | 0 | 3 |
구아닌 뉴클레오티드-바인딩 단백질 G(I)/G(S)/G(T) 서브유닛 베타-2 OS=Homo sapiens OX=9606 GN=GNB2 PE=1 SV=3 | 37 kDa | 2 | 14 | 0 | 0 |
이종성 핵 리보핵단백질 U-유사 단백질 2 OS=Homo sapiens OX=9606 GN=HNRNPUL2 PE=1 SV=1 | 85 kDa | 2 | 8 | 0 | 2 |
고유동성 그룹 단백질 B3 OS=Homo sapiens OX=9606 GN=HMGB3 PE=1 SV=4 | 23 kDa | 2 | 0 | 0 | 3 |
인버신 OS=Homo sapiens OX=9606 GN=INVS PE=1 SV=2 | 118 kDa | 2 | 0 | 0 | 0 |
CD44 항원 아이소폼 10 OS=Homo sapiens OX=9606 GN=CD44 | 53 kDa | 2 | 27 | 5 | 2 |
40S 리보솜 단백질 S20 아이소폼 2 OS=Homo sapiens OX=9606 GN=RPS20 | 16 kDa | 2 | 7 | 1 | 3 |
AP-2 컴플렉스 서브유닛 알파-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=AP2A2 | 104 kDa | 2 | 8 | 0 | 3 |
ATP-바인딩 카세트 서브-패밀리 F 멤버 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=ABCF1 | 92 kDa | 2 | 6 | 2 | 2 |
cAMP-의존 단백질 키나아제 타입 II-알파 조절 서브유닛 아이소폼 2 OS=Homo sapiens OX=9606 GN=PRKAR2A | 43 kDa | 2 | 11 | 0 | 3 |
PRMT1 단백질 염색질 타겟 아이소폼 2 OS=Homo sapiens OX=9606 GN=CHTOP | 27 kDa | 2 | 4 | 2 | 2 |
콜라겐 알파-1(XXII) 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=COL22A1 | 159 kDa | 2 | 0 | 0 | 1 |
DNA 리페어 단백질 RAD50 아이소폼 2 OS=Homo sapiens OX=9606 GN=RAD50 | 155 kDa | 2 | 0 | 0 | 1 |
E3 유비퀴틴-단백질 리가아제 RNF213 아이소폼 2 OS=Homo sapiens OX=9606 GN=RNF213 | 596 kDa | 2 | 0 | 0 | 1 |
전자 트랜스퍼 플라보단백질 서브유닛 알파, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=ETFA | 30 kDa | 2 | 1 | 0 | 5 |
이노일-CoA 델타 아이소머라아제 2, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=ECI2 | 40 kDa | 2 | 0 | 0 | 0 |
진핵성 펩타이드 체인 릴리즈 인자 서브유닛 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=ETF1 | 45 kDa | 2 | 2 | 0 | 2 |
진핵성 번역 개시 인자 3 서브유닛 D 아이소폼 2 OS=Homo sapiens OX=9606 GN=EIF3D | 58 kDa | 2 | 2 | 0 | 0 |
퍼미틴 패밀리 동족체 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=FERMT2 | 72 kDa | 2 | 0 | 0 | 6 |
글루타민--과당-6-포스페이트 아미노트랜스퍼라아제 [아이소머라이징] 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=GFPT1 | 77 kDa | 2 | 5 | 0 | 1 |
구아닌 뉴클레오티드-바인딩 단백질-유사 3 아이소폼 2 OS=Homo sapiens OX=9606 GN=GNL3 | 61 kDa | 2 | 3 | 0 | 0 |
히스티딘--tRNA 리가아제, 사이토플라즈믹 아이소폼 2 OS=Homo sapiens OX=9606 GN=HARS | 53 kDa | 2 | 3 | 0 | 4 |
히스톤 H1.0 아이소폼 2 OS=Homo sapiens OX=9606 GN=H1F0 | 19 kDa | 2 | 1 | 3 | 3 |
인터페론-유도, 더블-스트랜디드 RNA-활성화된 단백질 키나아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=EIF2AK2 | 57 kDa | 2 | 1 | 0 | 1 |
뉴로트리민 아이소폼 2 OS=Homo sapiens OX=9606 GN=NTM | 38 kDa | 2 | 0 | 0 | 0 |
뉴트럴 콜레스테롤 에스터 하이드로라제 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=NCEH1 | 47 kDa | 2 | 1 | 0 | 3 |
뉴클레오좀 조립 단백질 1-유사 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=NAP1L1 | 43 kDa | 2 | 10 | 1 | 3 |
뉴클레오좀 조립 단백질 1-유사 4 아이소폼 2 OS=Homo sapiens OX=9606 GN=NAP1L4 | 44 kDa | 2 | 0 | 0 | 3 |
폴리아데닐레이트-바인딩 단백질 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=PABPN1 | 31 kDa | 2 | 7 | 0 | 2 |
프리-mRNA-스플라이싱 인자 SYF2 아이소폼 2 OS=Homo sapiens OX=9606 GN=SYF2 | 24 kDa | 2 | 0 | 0 | 3 |
프로콜라겐-리신,2-옥소글루타레이트 5-디옥시게나아제 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=PLOD1 | 88 kDa | 2 | 12 | 0 | 1 |
프로콜라겐-리신,2-옥소글루타레이트 5-디옥시게나아제 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=PLOD2 | 87 kDa | 2 | 2 | 0 | 0 |
단백질 이네이블드 동족체 아이소폼 2 OS=Homo sapiens OX=9606 GN=ENAH | 64 kDa | 2 | 26 | 1 | 18 |
단백질 SGT1 동족체 아이소폼 2 OS=Homo sapiens OX=9606 GN=SUGT1 | 38 kDa | 2 | 0 | 0 | 0 |
단백질 트랜스포트 단백질 Sec16A 아이소폼 2 OS=Homo sapiens OX=9606 GN=SEC16A | 229 kDa | 2 | 0 | 0 | 1 |
세린-풍부 도메인 1 함유 RNA-바인딩 단백질 아이소폼 2 OS=Homo sapiens OX=9606 GN=RNPS1 | 32 kDa | 2 | 3 | 1 | 2 |
시그널 인식 파티클 서브유닛 SRP68 아이소폼 2 OS=Homo sapiens OX=9606 GN=SRP68 | 67 kDa | 2 | 9 | 0 | 0 |
신테닌-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=SDCBP | 32 kDa | 2 | 6 | 0 | 0 |
트랜스로케이팅 체인-관련 막 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=TRAM1 | 40 kDa | 2 | 6 | 4 | 5 |
삼기능 효소 서브유닛 베타, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=HADHB | 49 kDa | 2 | 51 | 9 | 10 |
UDP-글루코오즈:당단백질 글루코실트랜스퍼라제 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=UGGT1 | 175 kDa | 2 | 2 | 0 | 1 |
28S 리보솜 단백질 S29, 미토콘드리아 아이소폼 3 OS=Homo sapiens GN=DAP3 | 42 kDa | 2 | 5 | 2 | 1 |
베이직 류신 지퍼 및 W2 도메인-함유 단백질 1 아이소폼 3 OS=Homo sapiens OX=9606 GN=BZW1 | 51 kDa | 2 | 1 | 0 | 4 |
E3 유비퀴틴-단백질 리가아제 HUWE1 아이소폼 3 OS=Homo sapiens GN=HUWE1 | 481 kDa | 2 | 4 | 0 | 0 |
이종성 핵 리보핵단백질 H3 아이소폼 3 OS=Homo sapiens GN=HNRNPH3 | 32 kDa | 2 | 8 | 0 | 3 |
인테그린-링크드 단백질 키나아제 아이소폼 3 OS=Homo sapiens OX=9606 GN=ILK | 36 kDa | 2 | 0 | 0 | 2 |
단백질 비릴라이저(virilizer) 동족체 아이소폼 3 OS=Homo sapiens OX=9606 GN=VIRMA | 201 kDa | 2 | 0 | 0 | 0 |
유비퀴틴-관련 단백질 2-유사 아이소폼 3 OS=Homo sapiens OX=9606 GN=UBAP2L | 113 kDa | 2 | 7 | 0 | 7 |
LIM 도메인 및 액틴-바인딩 단백질 1 아이소폼 4 OS=Homo sapiens OX=9606 GN=LIMA1 | 85 kDa | 2 | 49 | 6 | 4 |
WASH 컴플렉스 서브유닛 2C 아이소폼 4 OS=Homo sapiens OX=9606 GN=WASHC2C | 145 kDa | 2 | 0 | 0 | 0 |
칼슘/칼모듈린-의존 단백질 키나아제 타입 II 서브유닛 델타 아이소폼 델타 10 OS=Homo sapiens OX=9606 GN=CAMK2D | 56 kDa | 2 | 5 | 0 | 0 |
라이소좀-관련 막 당단백질 2 아이소폼 LAMP-2B OS=Homo sapiens OX=9606 GN=LAMP2 | 45 kDa | 2 | 0 | 0 | 2 |
류신-풍부 리피트 플라이트리스-인터랙팅 단백질 1 OS=Homo sapiens OX=9606 GN=LRRFIP1 PE=1 SV=2 | 89 kDa | 2 | 0 | 0 | 1 |
라이소포스포리피드 아실트랜스퍼라아제 7 OS=Homo sapiens GN=MBOAT7 PE=1 SV=2 | 53 kDa | 2 | 2 | 0 | 0 |
마이크로소멀 글루타치온 S-트랜스퍼라아제 3 OS=Homo sapiens OX=9606 GN=MGST3 PE=1 SV=1 | 17 kDa | 2 | 1 | 1 | 2 |
미토콘드리아 임포트 수용체 서브유닛 TOM40 동족체 OS=Homo sapiens OX=9606 GN=TOMM40 PE=1 SV=1 | 38 kDa | 2 | 0 | 0 | 0 |
뮤신-19 OS=Homo sapiens OX=9606 GN=MUC19 PE=1 SV=3 | 805 kDa | 2 | 0 | 0 | 0 |
NADH 탈수소효소 [유비퀴논] 철-황 단백질 3, 미토콘드리아 OS=Homo sapiens OX=9606 GN=NDUFS3 PE=1 SV=1 | 30 kDa | 2 | 4 | 0 | 4 |
발생기(nascent) 폴리펩티드-관련 컴플렉스 서브유닛 알파, 근육-특이적 폼 OS=Homo sapiens OX=9606 GN=NACA PE=1 SV=1 | 205 kDa | 2 | 6 | 0 | 4 |
니코틴아마이드 포스포리보실트랜스퍼라아제 OS=Homo sapiens OX=9606 GN=NAMPT PE=1 SV=1 | 56 kDa | 2 | 2 | 0 | 3 |
논-히스톤 크로모조멀 단백질 HMG-14 OS=Homo sapiens OX=9606 GN=HMGN1 PE=1 SV=1 | 12 kDa | 2 | 11 | 3 | 6 |
핵 단백질 11 OS=Homo sapiens OX=9606 GN=NOL11 PE=1 SV=1 | 81 kDa | 2 | 0 | 0 | 0 |
Obg-유사 ATP아제 1 OS=Homo sapiens OX=9606 GN=OLA1 PE=1 SV=2 | 45 kDa | 2 | 4 | 0 | 3 |
PDZ 및 LIM 도메인 단백질 5 OS=Homo sapiens GN=PDLIM5 PE=1 SV=5 | 64 kDa | 2 | 3 | 0 | 2 |
퍼옥시레독신-2 OS=Homo sapiens OX=9606 GN=PRDX2 PE=1 SV=5 | 22 kDa | 2 | 7 | 0 | 1 |
포스포리피드-트랜스포팅 ATP아제 IB OS=Homo sapiens OX=9606 GN=ATP8A2 PE=1 SV=3 | 129 kDa | 2 | 0 | 2 | 0 |
포스포세린 아미노트랜스퍼라아제 OS=Homo sapiens OX=9606 GN=PSAT1 PE=1 SV=2 | 40 kDa | 2 | 0 | 0 | 0 |
플라스미노겐 활성자 저해제 1 OS=Homo sapiens OX=9606 GN=세르핀E1 PE=1 SV=1 | 45 kDa | 2 | 90 | 41 | 29 |
프리-rRNA 프로세싱 단백질 FTSJ3 OS=Homo sapiens OX=9606 GN=FTSJ3 PE=1 SV=2 | 97 kDa | 2 | 3 | 0 | 1 |
PRKC 세포자살 WT1 조절자 단백질 OS=Homo sapiens OX=9606 GN=PAWR PE=1 SV=1 | 37 kDa | 2 | 0 | 1 | 6 |
프로테아좀 활성자 컴플렉스 서브유닛 2 OS=Homo sapiens OX=9606 GN=PSME2 PE=1 SV=4 | 27 kDa | 2 | 0 | 0 | 2 |
프로테아좀 서브유닛 알파 타입-5 OS=Homo sapiens OX=9606 GN=PSMA5 PE=1 SV=3 | 26 kDa | 2 | 2 | 0 | 2 |
프로테아좀 서브유닛 알파 타입-7 OS=Homo sapiens OX=9606 GN=PSMA7 PE=1 SV=1 | 28 kDa | 2 | 7 | 0 | 2 |
프로테아좀 서브유닛 베타 타입-2 OS=Homo sapiens OX=9606 GN=PSMB2 PE=1 SV=1 | 23 kDa | 2 | 0 | 0 | 4 |
단백질 플라이트리스-1 동족체 OS=Homo sapiens OX=9606 GN=FLII PE=1 SV=2 | 145 kDa | 2 | 0 | 0 | 1 |
단백질 SEC13 동족체 OS=Homo sapiens OX=9606 GN=SEC13 PE=1 SV=3 | 36 kDa | 2 | 4 | 0 | 4 |
라스-관련 단백질 Rab-5C OS=Homo sapiens OX=9606 GN=RAB5C PE=1 SV=2 | 23 kDa | 2 | 7 | 0 | 3 |
라스-관련 단백질 Rab-7a OS=Homo sapiens OX=9606 GN=RAB7A PE=1 SV=1 | 23 kDa | 2 | 0 | 0 | 2 |
리모델링 및 스페이싱 인자 1 OS=Homo sapiens GN=RSF1 PE=1 SV=2 | 164 kDa | 2 | 9 | 0 | 0 |
세린 베타-락타마아제-유사 단백질 LACTB, 미토콘드리아 OS=Homo sapiens OX=9606 GN=LACTB PE=1 SV=2 | 61 kDa | 2 | 13 | 5 | 3 |
세린/아르기닌-풍부 스플라이싱 인자 1 OS=Homo sapiens GN=SRSF1 PE=1 SV=2 | 28 kDa | 2 | 7 | 0 | 2 |
크로모좀 단백질 1A 구조 유지 OS=Homo sapiens OX=9606 GN=SMC1A PE=1 SV=2 | 143 kDa | 2 | 7 | 0 | 0 |
혈소판 인자 4 유사 SWISS-PROT:P02777 (Bos taurus) | 24 kDa | 2 | 3 | 3 | 3 |
SWISS-PROT:Q2UVX4 (Bos taurus) 컴플리먼트 C3 전구체 | 187 kDa | 2 | 7 | 6 | 4 |
SWISS-PROT:Q95121 (Bos taurus) 피그먼트 에피세륨-유래 인자 전구체 | 46 kDa | 2 | 0 | 3 | 3 |
트랜스알돌라아제 OS=Homo sapiens OX=9606 GN=TALDO1 PE=1 SV=2 | 38 kDa | 2 | 0 | 0 | 3 |
번역-조절된 종양 단백질 OS=Homo sapiens OX=9606 GN=TPT1 PE=1 SV=1 | 20 kDa | 2 | 0 | 0 | 2 |
트랜스로콘-관련 단백질 서브유닛 알파 OS=Homo sapiens OX=9606 GN=SSR1 PE=1 SV=3 | 32 kDa | 2 | 5 | 3 | 5 |
트랜스막 emp24 도메인-함유 단백질 10 OS=Homo sapiens OX=9606 GN=TMED10 PE=1 SV=2 | 25 kDa | 2 | 0 | 6 | 8 |
트랜스막 emp24 도메인-함유 단백질 9 OS=Homo sapiens OX=9606 GN=TMED9 PE=1 SV=2 | 27 kDa | 2 | 0 | 1 | 2 |
이뮤노글로불린 람다-유사 폴리펩티드 1 유사 TREMBL:Q1RMN8 (Bos taurus) | 25 kDa | 2 | 0 | 0 | 0 |
트리펩티딜-펩티다아제 1 OS=Homo sapiens GN=TPP1 PE=1 SV=2 | 61 kDa | 2 | 0 | 2 | 3 |
1,4-알파-글루칸-브랜칭 효소 OS=Homo sapiens OX=9606 GN=GBE1 PE=1 SV=3 | 80 kDa | 1 | 0 | 0 | 3 |
1-포스파티딜이노시톨 4,5-비스포스페이트 포스포디에스터라아제 베타-3 OS=Homo sapiens GN=PLCB3 PE=1 SV=2 | 139 kDa | 1 | 0 | 0 | 2 |
28S 리보솜 단백질 S35, 미토콘드리아 OS=Homo sapiens GN=MRPS35 PE=1 SV=1 | 37 kDa | 1 | 2 | 0 | 2 |
40S 리보솜 단백질 S30 OS=Homo sapiens OX=9606 GN=FAU PE=1 SV=1 | 7 kDa | 1 | 0 | 3 | 2 |
60S 리보솜 단백질 L11 OS=Homo sapiens OX=9606 GN=RPL11 PE=1 SV=2 | 20 kDa | 1 | 18 | 1 | 3 |
60S 리보솜 단백질 L35a OS=Homo sapiens OX=9606 GN=RPL35A PE=1 SV=2 | 13 kDa | 1 | 0 | 2 | 2 |
60S 리보솜 단백질 L37a OS=Homo sapiens OX=9606 GN=RPL37A PE=1 SV=2 | 10 kDa | 1 | 0 | 5 | 5 |
알파-파빈 OS=Homo sapiens OX=9606 GN=PARVA PE=1 SV=1 | 42 kDa | 1 | 3 | 0 | 4 |
AT-풍부 인터랙티브 도메인-함유 단백질 1A OS=Homo sapiens OX=9606 GN=ARID1A PE=1 SV=3 | 242 kDa | 1 | 3 | 0 | 0 |
바시진 OS=Homo sapiens OX=9606 GN=BSG PE=1 SV=2 | 42 kDa | 1 | 3 | 0 | 1 |
크로모좀 in 세포 구획 단백질 1-유사 1 바이오리엔테이션 OS=Homo sapiens OX=9606 GN=BOD1L1 PE=1 SV=2 | 330 kDa | 1 | 0 | 0 | 3 |
세포 구획 사이클 5-유사 단백질 OS=Homo sapiens OX=9606 GN=CDC5L PE=1 SV=2 | 92 kDa | 1 | 3 | 0 | 4 |
코액토신-유사 단백질 OS=Homo sapiens OX=9606 GN=COTL1 PE=1 SV=3 | 16 kDa | 1 | 0 | 0 | 2 |
콜라겐 알파-1(III) 체인 OS=Homo sapiens OX=9606 GN=COL3A1 PE=1 SV=4 | 139 kDa | 1 | 2 | 0 | 1 |
콜라겐 알파-2(I) 체인 OS=Homo sapiens OX=9606 GN=COL1A2 PE=1 SV=7 | 129 kDa | 1 | 12 | 7 | 3 |
콜라겐 알파-2(V) 체인 OS=Homo sapiens OX=9606 GN=COL5A2 PE=1 SV=3 | 145 kDa | 1 | 0 | 15 | 6 |
콜라겐 알파-6(VI) 체인 OS=Homo sapiens OX=9606 GN=COL6A6 PE=1 SV=2 | 247 kDa | 1 | 0 | 3 | 2 |
컴플리먼트 컴포넌트 1 Q 서브컴포넌트-바인딩 단백질, 미토콘드리아 OS=Homo sapiens OX=9606 GN=C1QBP PE=1 SV=1 | 31 kDa | 1 | 0 | 0 | 4 |
시스테인 및 글리신-풍부 단백질 1 OS=Homo sapiens OX=9606 GN=CSRP1 PE=1 SV=3 | 21 kDa | 1 | 0 | 0 | 2 |
사이토크롬 b-c1 컴플렉스 서브유닛 9 OS=Homo sapiens OX=9606 GN=UQCR10 PE=1 SV=3 | 7 kDa | 1 | 2 | 0 | 2 |
사이토크롬 c1, 헴 단백질, 미토콘드리아 OS=Homo sapiens OX=9606 GN=CYC1 PE=1 SV=3 | 35 kDa | 1 | 0 | 0 | 3 |
DDRGK 도메인-함유 단백질 1 OS=Homo sapiens OX=9606 GN=DDRGK1 PE=1 SV=2 | 36 kDa | 1 | 0 | 1 | 2 |
데스트린 OS=Homo sapiens OX=9606 GN=DSTN PE=1 SV=3 | 19 kDa | 1 | 3 | 0 | 6 |
디하이드로리포일 탈수소효소, 미토콘드리아 OS=Homo sapiens OX=9606 GN=DLD PE=1 SV=2 | 54 kDa | 1 | 8 | 0 | 2 |
DNA-다이렉티드 RNA 폴리머라아제 I, II, 및 III 서브유닛 RPABC1 OS=Homo sapiens OX=9606 GN=POLR2E PE=1 SV=4 | 25 kDa | 1 | 0 | 5 | 1 |
ELAV-유사 단백질 1 OS=Homo sapiens OX=9606 GN=ELAVL1 PE=1 SV=2 | 36 kDa | 1 | 3 | 0 | 1 |
진핵성 번역 개시 인자 3 서브유닛 G OS=Homo sapiens OX=9606 GN=EIF3G PE=1 SV=2 | 36 kDa | 1 | 0 | 0 | 3 |
파네실 파이로포스페이트 신타아제 OS=Homo sapiens OX=9606 GN=FDPS PE=1 SV=4 | 48 kDa | 1 | 3 | 0 | 1 |
피브릴린-1 OS=Homo sapiens OX=9606 GN=FBN1 PE=1 SV=3 | 312 kDa | 1 | 0 | 2 | 0 |
퓨마레이트 하이드라타아제, 미토콘드리아 OS=Homo sapiens GN=FH PE=1 SV=3 | 55 kDa | 1 | 0 | 0 | 2 |
성장/분화 인자 15 OS=Homo sapiens OX=9606 GN=GDF15 PE=1 SV=3 | 34 kDa | 1 | 0 | 7 | 6 |
히스톤 디아세틸라아제 컴플렉스 서브유닛 SAP18 OS=Homo sapiens OX=9606 GN=SAP18 PE=1 SV=1 | 20 kDa | 1 | 0 | 0 | 2 |
히스톤 H1x OS=Homo sapiens OX=9606 GN=H1FX PE=1 SV=1 | 22 kDa | 1 | 0 | 0 | 2 |
하이드로시팔러스-유도 단백질 동족체 OS=Homo sapiens OX=9606 GN=HYDIN PE=1 SV=3 | 576 kDa | 1 | 0 | 1 | 0 |
인슐린-유사 성장 인자 2 mRNA-바인딩 단백질 3 OS=Homo sapiens GN=IGF2BP3 PE=1 SV=2 | 64 kDa | 1 | 18 | 2 | 0 |
아디포사이트 플라스마 막-관련 단백질 아이소폼 2 OS=Homo sapiens OX=9606 GN=APMAP | 32 kDa | 1 | 0 | 0 | 3 |
아스파르트산염 아미노트랜스퍼라아제, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=GOT2 | 43 kDa | 1 | 0 | 0 | 3 |
BH3-인터랙팅 도메인 데스 어고니스트 아이소폼 2 OS=Homo sapiens OX=9606 GN=BID | 27 kDa | 1 | 4 | 0 | 0 |
DnaJ 동족체 서브패밀리 A 멤버 3, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=DNAJA3 | 50 kDa | 1 | 0 | 0 | 3 |
글리아-유래 넥신 아이소폼 2 OS=Homo sapiens OX=9606 GN=세르핀E2 | 44 kDa | 1 | 8 | 0 | 0 |
히스톤 디아세틸라아제 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=HDAC2 | 52 kDa | 1 | 4 | 0 | 1 |
라이소소멀 보호 단백질 아이소폼 2 OS=Homo sapiens OX=9606 GN=CTSA | 52 kDa | 1 | 1 | 0 | 2 |
라이소좀 막 단백질 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=SCARB2 | 38 kDa | 1 | 4 | 0 | 0 |
미오신 포스파타제 Rho-인터랙팅 단백질 아이소폼 2 OS=Homo sapiens OX=9606 GN=MPRIP | 118 kDa | 1 | 13 | 0 | 0 |
NADH 탈수소효소 [유비퀴논] 1 알파 서브컴플렉스 서브유닛 13 아이소폼 2 OS=Homo sapiens OX=9606 GN=NDUFA13 | 25 kDa | 1 | 13 | 1 | 3 |
NADH 탈수소효소 [유비퀴논] 철-황 단백질 2, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=NDUFS2 | 52 kDa | 1 | 5 | 0 | 1 |
네스프린-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=SYNE2 | 799 kDa | 1 | 12 | 1 | 0 |
핵 포어 컴플렉스 단백질 Nup214 아이소폼 2 OS=Homo sapiens OX=9606 GN=NUP214 | 213 kDa | 1 | 0 | 0 | 3 |
페닐알라닌--tRNA 리가아제 알파 서브유닛 아이소폼 2 OS=Homo sapiens OX=9606 GN=FARSA | 54 kDa | 1 | 7 | 1 | 4 |
프로버블 28S rRNA (시토신(4447)-C(5))-메틸트랜스퍼라아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=NOP2 | 89 kDa | 1 | 6 | 0 | 6 |
단백질 FAM98A 아이소폼 2 OS=Homo sapiens OX=9606 GN=FAM98A | 55 kDa | 1 | 2 | 0 | 3 |
단백질 TFG 아이소폼 2 OS=Homo sapiens OX=9606 GN=TFG | 43 kDa | 1 | 4 | 0 | 4 |
피루베이트 탈수소효소 E1 컴포넌트 서브유닛 베타, 미토콘드리아 아이소폼 2 OS=Homo sapiens OX=9606 GN=PDHB | 37 kDa | 1 | 7 | 0 | 3 |
UTP--글루코오즈-1-포스페이트 유리딜일트랜스퍼라아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=UGP2 | 56 kDa | 1 | 3 | 0 | 7 |
V-타입 프로톤 ATP아제 116 kDa 서브유닛 a 아이소폼 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=ATP6V0A1 | 96 kDa | 1 | 11 | 0 | 3 |
사이토플라즈믹 디네인 1 인터미디에이트 체인 2 아이소폼 2B OS=Homo sapiens OX=9606 GN=DYNC1I2 | 71 kDa | 1 | 16 | 1 | 3 |
활성화 시그널 코인테그레이터 1 컴플렉스 서브유닛 2 아이소폼 3 OS=Homo sapiens OX=9606 GN=ASCC2 | 77 kDa | 1 | 6 | 0 | 1 |
세포자살-유도 인자 1, 미토콘드리아 아이소폼 3 OS=Homo sapiens OX=9606 GN=AIFM1 | 66 kDa | 1 | 3 | 0 | 4 |
칼루메닌 아이소폼 3 OS=Homo sapiens OX=9606 GN=CALU | 38 kDa | 1 | 1 | 0 | 2 |
프래자일 X 멘탈 리타데이션 신드롬-관련 단백질 1 아이소폼 3 OS=Homo sapiens OX=9606 GN=FXR1 | 60 kDa | 1 | 4 | 0 | 1 |
GRB10-인터랙팅 GYF 단백질 2 아이소폼 3 OS=Homo sapiens OX=9606 GN=GIGYF2 | 149 kDa | 1 | 0 | 0 | 0 |
피롤린-5-카복실레이트 리덕타아제 1 아이소폼 3, 미토콘드리아 OS=Homo sapiens OX=9606 GN=PYCR1 | 36 kDa | 1 | 8 | 0 | 0 |
라스-관련 단백질 R-라스2 아이소폼 3 OS=Homo sapiens GN=R라스2 | 20 kDa | 1 | 5 | 0 | 1 |
시그널 펩티다아제 컴플렉스 촉매성 서브유닛 SEC11A 아이소폼 3 OS=Homo sapiens OX=9606 GN=SEC11A | 21 kDa | 1 | 2 | 1 | 3 |
카데린-13 아이소폼 4 OS=Homo sapiens OX=9606 GN=CDH13 | 83 kDa | 1 | 23 | 6 | 2 |
디펩티딜 펩티다아제 3 아이소폼 4 OS=Homo sapiens OX=9606 GN=DPP3 | 79 kDa | 1 | 0 | 0 | 2 |
다이나민-1-유사 단백질 아이소폼 4 OS=Homo sapiens OX=9606 GN=DNM1L | 81 kDa | 1 | 2 | 0 | 2 |
다이나민-2 아이소폼 4 OS=Homo sapiens OX=9606 GN=DNM2 | 98 kDa | 1 | 13 | 0 | 6 |
넥실린 아이소폼 4 OS=Homo sapiens OX=9606 GN=NEXN | 73 kDa | 1 | 28 | 12 | 7 |
옵스큐린 아이소폼 5 OS=Homo sapiens OX=9606 GN=OBSCN | 925 kDa | 1 | 0 | 0 | 1 |
RNA-바인딩 단백질 EWS 아이소폼 6 OS=Homo sapiens OX=9606 GN=EWSR1 | 63 kDa | 1 | 6 | 0 | 6 |
ATP 신타아제 서브유닛 감마, 미토콘드리아 아이소폼 Heart OS=Homo sapiens OX=9606 GN=ATP5F1C | 33 kDa | 1 | 6 | 0 | 4 |
리신--tRNA 리가아제 아이소폼 미토콘드리아 OS=Homo sapiens OX=9606 GN=KARS | 71 kDa | 1 | 4 | 0 | 1 |
류신-풍부 리피트-함유 단백질 17 OS=Homo sapiens OX=9606 GN=LRRC17 PE=2 SV=1 | 52 kDa | 1 | 11 | 9 | 4 |
류실-사이스티닐 아미노펩티다아제 OS=Homo sapiens OX=9606 GN=LNPEP PE=1 SV=3 | 117 kDa | 1 | 4 | 3 | 2 |
LIM 및 SH3 도메인 단백질 1 OS=Homo sapiens OX=9606 GN=LASP1 PE=1 SV=2 | 30 kDa | 1 | 1 | 0 | 3 |
매트릭스 메탈로프로테이나아제-14 OS=Homo sapiens OX=9606 GN=MMP14 PE=1 SV=3 | 66 kDa | 1 | 0 | 0 | 2 |
마이크로튜불-관련 단백질 RP/EB 패밀리 멤버 1 OS=Homo sapiens OX=9606 GN=MAPRE1 PE=1 SV=3 | 30 kDa | 1 | 4 | 0 | 4 |
미토콘드리아 2-옥소글루타레이트/말레이트 캐리어 단백질 OS=Homo sapiens OX=9606 GN=SLC25A11 PE=1 SV=3 | 34 kDa | 1 | 7 | 0 | 1 |
미토콘드리아 피젼(fission) 1 단백질 OS=Homo sapiens OX=9606 GN=FIS1 PE=1 SV=2 | 17 kDa | 1 | 0 | 0 | 3 |
NADH 탈수소효소 [유비퀴논] 1 알파 서브컴플렉스 서브유닛 12 OS=Homo sapiens OX=9606 GN=NDUFA12 PE=1 SV=1 | 17 kDa | 1 | 6 | 1 | 2 |
PDZ 도메인-함유 단백질 4 OS=Homo sapiens OX=9606 GN=PDZD4 PE=1 SV=1 | 86 kDa | 1 | 0 | 0 | 0 |
프록시소말 막 단백질 PEX14 OS=Homo sapiens OX=9606 GN=PEX14 PE=1 SV=1 | 41 kDa | 1 | 3 | 0 | 2 |
혈소판-활성화 인자 아세틸하이드로라제 IB 서브유닛 베타 OS=Homo sapiens GN=PAFAH1B2 PE=1 SV=1 | 26 kDa | 1 | 6 | 0 | 1 |
포도칼리신 OS=Homo sapiens GN=PODXL PE=1 SV=2 | 59 kDa | 1 | 0 | 0 | 2 |
프롤릴 3-하이드록실라아제 3 OS=Homo sapiens OX=9606 GN=P3H3 PE=1 SV=1 | 82 kDa | 1 | 0 | 0 | 2 |
프롤릴 4-하이드록실라아제 서브유닛 알파-2 OS=Homo sapiens OX=9606 GN=P4HA2 PE=1 SV=1 | 61 kDa | 1 | 2 | 0 | 0 |
프로테아좀 서브유닛 알파 타입-6 OS=Homo sapiens OX=9606 GN=PSMA6 PE=1 SV=1 | 27 kDa | 1 | 8 | 0 | 1 |
프로테아좀 서브유닛 베타 타입-5 OS=Homo sapiens GN=PSMB5 PE=1 SV=3 | 28 kDa | 1 | 2 | 0 | 0 |
단백질 CYR61 OS=Homo sapiens OX=9606 GN=CYR61 PE=1 SV=1 | 42 kDa | 1 | 0 | 27 | 24 |
단백질 마고 나시(mago nashi) 동족체 OS=Homo sapiens OX=9606 GN=MAGOH PE=1 SV=1 | 17 kDa | 1 | 7 | 0 | 0 |
RNA-바인딩 단백질 14 OS=Homo sapiens OX=9606 GN=RBM14 PE=1 SV=2 | 69 kDa | 1 | 18 | 2 | 5 |
RuvB-유사 1 OS=Homo sapiens OX=9606 GN=RUVBL1 PE=1 SV=1 | 50 kDa | 1 | 18 | 0 | 2 |
스플라이싱 인자 3B 서브유닛 4 OS=Homo sapiens OX=9606 GN=SF3B4 PE=1 SV=1 | 44 kDa | 1 | 0 | 0 | 2 |
스플라이싱 인자 U2AF 26 kDa 서브유닛 OS=Homo sapiens OX=9606 GN=U2AF1L4 PE=4 SV=1 | 4 kDa | 1 | 0 | 2 | 1 |
콜라겐 알파 1(III) 체인 유사 SWISS-PROT:P04258 (Bos taurus) | 138 kDa | 1 | 9 | 0 | 0 |
TREMBL:A2I7N3;Q27984 (Bos taurus) 세르핀A3-7 | 47 kDa | 1 | 5 | 1 | 1 |
언컨벤셔널 미오신-Ie OS=Homo sapiens OX=9606 GN=MYO1E PE=1 SV=2 | 127 kDa | 1 | 20 | 5 | 4 |
액포 단백질 분류-관련 단백질 VTA1 동족체 OS=Homo sapiens OX=9606 GN=VTA1 PE=1 SV=1 | 34 kDa | 1 | 0 | 0 | 2 |
매우-긴-체인 (3R)-3-하이드록시아실-CoA 디하이드라타아제 3 OS=Homo sapiens GN=HACD3 PE=1 SV=2 | 43 kDa | 1 | 8 | 1 | 2 |
von Willebr및 인자 A 도메인-함유 단백질 1 OS=Homo sapiens OX=9606 GN=VWA1 PE=1 SV=1 | 47 kDa | 1 | 7 | 0 | 0 |
(Bos taurus) 63 kDa 단백질 | 63 kDa | 0 | 55 | 0 | 0 |
10 kDa 히트 쇼크 단백질, 미토콘드리아 OS=Homo sapiens GN=HSPE1 PE=1 SV=2 | 11 kDa | 0 | 6 | 0 | 0 |
1-포스파티딜이노시톨 3-포스페이트 5-키나아제 OS=Homo sapiens OX=9606 GN=PIKFYVE PE=1 SV=3 | 237 kDa | 0 | 0 | 0 | 2 |
26S 프로테아제 조절 서브유닛 10B OS=Homo sapiens GN=PSMC6 PE=1 SV=1 | 46 kDa | 0 | 9 | 0 | 0 |
26S 프로테아제 조절 서브유닛 6A OS=Homo sapiens GN=PSMC3 PE=1 SV=3 | 49 kDa | 0 | 30 | 0 | 0 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 14 OS=Homo sapiens GN=PSMD14 PE=1 SV=1 | 35 kDa | 0 | 17 | 0 | 0 |
26S 프로테아좀 논-ATP아제 조절 서브유닛 8 OS=Homo sapiens GN=PSMD8 PE=1 SV=1 | 33 kDa | 0 | 3 | 0 | 0 |
28S 리보솜 단백질 S34, 미토콘드리아 OS=Homo sapiens GN=MRPS34 PE=1 SV=2 | 26 kDa | 0 | 2 | 0 | 0 |
39S 리보솜 단백질 L11, 미토콘드리아 OS=Homo sapiens GN=MRPL11 PE=1 SV=1 | 21 kDa | 0 | 7 | 0 | 1 |
39S 리보솜 단백질 L34, 미토콘드리아 OS=Homo sapiens GN=MRPL34 PE=1 SV=1 | 20 kDa | 0 | 8 | 0 | 0 |
3-케토아실-CoA 티올라아제, 미토콘드리아 OS=Homo sapiens OX=9606 GN=ACAA2 PE=1 SV=2 | 42 kDa | 0 | 0 | 0 | 2 |
40S 리보솜 단백질 S13 OS=Homo sapiens OX=9606 GN=RPS13 PE=1 SV=2 | 17 kDa | 0 | 85 | 19 | 19 |
40S 리보솜 단백질 S15a OS=Homo sapiens GN=RPS15A PE=1 SV=1 | 11 kDa | 0 | 25 | 0 | 0 |
40S 리보솜 단백질 S18 OS=Homo sapiens GN=RPS18 PE=1 SV=3 | 18 kDa | 0 | 51 | 0 | 0 |
40S 리보솜 단백질 S28 OS=Homo sapiens GN=RPS28 PE=1 SV=1 | 8 kDa | 0 | 6 | 0 | 0 |
40S 리보솜 단백질 S29 OS=Homo sapiens OX=9606 GN=RPS29 PE=1 SV=2 | 7 kDa | 0 | 16 | 1 | 1 |
40S 리보솜 단백질 S3a OS=Homo sapiens GN=RPS3A PE=1 SV=2 | 30 kDa | 0 | 53 | 0 | 0 |
40S 리보솜 단백질 S4, Y 아이소폼 1 OS=Homo sapiens OX=9606 GN=RPS4Y1 PE=1 SV=2 | 29 kDa | 0 | 0 | 0 | 9 |
40S 리보솜 단백질 SA (프래그먼트) OS=Homo sapiens GN=RPSA PE=1 SV=8 | 29 kDa | 0 | 8 | 0 | 0 |
60S 산성 리보솜 단백질 P2 OS=Homo sapiens GN=RPLP2 PE=1 SV=1 | 12 kDa | 0 | 50 | 0 | 0 |
60S 리보솜 단백질 L13a OS=Homo sapiens GN=RPL13A PE=1 SV=2 | 24 kDa | 0 | 33 | 0 | 0 |
60S 리보솜 단백질 L14 OS=Homo sapiens GN=RPL14 PE=1 SV=4 | 23 kDa | 0 | 34 | 0 | 0 |
60S 리보솜 단백질 L18a OS=Homo sapiens GN=RPL18A PE=1 SV=2 | 21 kDa | 0 | 31 | 0 | 0 |
60S 리보솜 단백질 L23a (프래그먼트) OS=Homo sapiens GN=RPL23A PE=1 SV=1 | 18 kDa | 0 | 32 | 0 | 0 |
60S 리보솜 단백질 L29 OS=Homo sapiens GN=RPL29 PE=1 SV=2 | 18 kDa | 0 | 6 | 0 | 0 |
60S 리보솜 단백질 L32 (프래그먼트) OS=Homo sapiens GN=RPL32 PE=1 SV=1 | 16 kDa | 0 | 20 | 0 | 0 |
60S 리보솜 단백질 L34 OS=Homo sapiens OX=9606 GN=RPL34 PE=1 SV=3 | 13 kDa | 0 | 0 | 3 | 3 |
60S 리보솜 단백질 L35 OS=Homo sapiens GN=RPL35 PE=1 SV=2 | 15 kDa | 0 | 24 | 0 | 0 |
60S 리보솜 단백질 L38 OS=Homo sapiens OX=9606 GN=RPL38 PE=1 SV=2 | 8 kDa | 0 | 0 | 5 | 4 |
78 kDa 글루코오즈-조절된 단백질 OS=Homo sapiens GN=HSPA5 PE=1 SV=2 | 72 kDa | 0 | 188 | 0 | 0 |
A 디스인테그린 및 트롬보스폰딘 모티프 1 함유 메탈로프로테이나아제 OS=Homo sapiens OX=9606 GN=ADAMTS1 PE=1 SV=4 | 105 kDa | 0 | 12 | 3 | 0 |
액틴-관련 단백질 10 OS=Homo sapiens GN=ACTR10 PE=1 SV=1 | 46 kDa | 0 | 3 | 0 | 0 |
액틴-관련 단백질 2/3 컴플렉스 서브유닛 1B OS=Homo sapiens GN=ARPC1B PE=1 SV=3 | 41 kDa | 0 | 28 | 0 | 0 |
ADP-리보실 시클라아제/고리형 ADP-리보오스 하이드로라제 2 OS=Homo sapiens OX=9606 GN=BST1 PE=1 SV=2 | 36 kDa | 0 | 3 | 5 | 2 |
아미노펩티다아제 N OS=Homo sapiens GN=ANPEP PE=1 SV=4 | 110 kDa | 0 | 194 | 0 | 0 |
안지오포이에틴-관련 단백질 4 OS=Homo sapiens OX=9606 GN=ANGPTL4 PE=1 SV=2 | 45 kDa | 0 | 1 | 3 | 0 |
아넥신 A3 OS=Homo sapiens OX=9606 GN=ANXA3 PE=1 SV=3 | 36 kDa | 0 | 0 | 0 | 3 |
아넥신 A4 OS=Homo sapiens OX=9606 GN=ANXA4 PE=1 SV=4 | 36 kDa | 0 | 0 | 0 | 2 |
AP-2 컴플렉스 서브유닛 시그마 OS=Homo sapiens GN=AP2S1 PE=1 SV=1 | 19 kDa | 0 | 3 | 0 | 0 |
Rho-GAP 도메인 함유 Arf-GAP, ANK 리피트 및 PH 도메인-함유 단백질 3 OS=Homo sapiens OX=9606 GN=ARAP3 PE=1 SV=1 | 170 kDa | 0 | 0 | 0 | 2 |
ATP 신타아제 서브유닛 엡실론-유사 단백질, 미토콘드리아 OS=Homo sapiens GN=ATP5EP2 PE=3 SV=1 | 6 kDa | 0 | 3 | 0 | 0 |
ATP 신타아제 서브유닛 g, 미토콘드리아 OS=Homo sapiens GN=ATP5L PE=1 SV=3 | 11 kDa | 0 | 6 | 0 | 0 |
ATP아제 ASNA1 OS=Homo sapiens GN=ASNA1 PE=1 SV=2 | 39 kDa | 0 | 2 | 0 | 0 |
ATP아제, H+ 트랜스포팅, 라이소소멀 액세서리 단백질 1, 아이소폼 CRA_c OS=Homo sapiens GN=ATP6AP1 PE=1 SV=1 | 32 kDa | 0 | 7 | 0 | 0 |
ATP-의존 DNA 헬리카아제 Q1 OS=Homo sapiens GN=RECQL PE=1 SV=3 | 73 kDa | 0 | 2 | 0 | 0 |
배리어-투-오토인테그레이션 인자 OS=Homo sapiens GN=BANF1 PE=1 SV=1 | 10 kDa | 0 | 24 | 0 | 0 |
베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질 OS=Homo sapiens GN=HSPG2 PE=1 SV=4 | 469 kDa | 0 | 4914 | 0 | 0 |
베타-카테닌-유사 단백질 1 OS=Homo sapiens GN=CTNNBL1 PE=1 SV=1 | 65 kDa | 0 | 2 | 0 | 0 |
베타-갈락토시다아제 OS=Homo sapiens GN=GLB1 PE=1 SV=2 | 76 kDa | 0 | 3 | 0 | 0 |
바이글리칸 OS=Homo sapiens OX=9606 GN=BGN PE=1 SV=2 | 42 kDa | 0 | 0 | 23 | 0 |
뼈 형성 단백질 1 OS=Homo sapiens OX=9606 GN=BMP1 PE=1 SV=2 | 111 kDa | 0 | 14 | 3 | 0 |
뇌 산 용해성 단백질 1 OS=Homo sapiens GN=BASP1 PE=1 SV=2 | 23 kDa | 0 | 10 | 0 | 0 |
C-1-테트라하이드로폴레이트 신타아제, 사이토플라즈믹 OS=Homo sapiens GN=MTHFD1 PE=1 SV=3 | 102 kDa | 0 | 2 | 0 | 0 |
칼모듈린 OS=Homo sapiens GN=CALM1 PE=1 SV=2 | 17 kDa | 0 | 24 | 0 | 0 |
칼페인 스몰 서브유닛 1 OS=Homo sapiens GN=CAPNS1 PE=1 SV=1 | 34 kDa | 0 | 34 | 0 | 0 |
카복시펩티다아제 M OS=Homo sapiens GN=CPM PE=1 SV=2 | 51 kDa | 0 | 5 | 0 | 0 |
Cardiomyopathy-관련 단백질 5 OS=Homo sapiens GN=CMYA5 PE=1 SV=3 | 449 kDa | 0 | 2 | 0 | 0 |
카세인 키나아제 II 서브유닛 알파 OS=Homo sapiens OX=9606 GN=CSNK2A1 PE=1 SV=1 | 45 kDa | 0 | 10 | 1 | 1 |
CD2-관련 단백질 OS=Homo sapiens GN=CD2AP PE=1 SV=1 | 71 kDa | 0 | 9 | 0 | 0 |
CD59 당단백질 OS=Homo sapiens OX=9606 GN=CD59 PE=1 SV=1 | 14 kDa | 0 | 0 | 3 | 0 |
클로라이드 세포내 채널 단백질 4 OS=Homo sapiens GN=CLIC4 PE=1 SV=4 | 29 kDa | 0 | 2 | 0 | 0 |
클로라이드 세포내 채널 단백질 6 OS=Homo sapiens GN=CLIC6 PE=2 SV=3 | 73 kDa | 0 | 2 | 0 | 0 |
크로모복스 단백질 동족체 1 (프래그먼트) OS=Homo sapiens GN=CBX1 PE=1 SV=1 | 19 kDa | 0 | 5 | 0 | 0 |
코일드-코일 도메인-함유 단백질 124 OS=Homo sapiens GN=CCDC124 PE=1 SV=1 | 26 kDa | 0 | 6 | 0 | 0 |
코일드-코일 도메인-함유 단백질 30 OS=Homo sapiens GN=CCDC30 PE=2 SV=1 | 91 kDa | 0 | 2 | 0 | 0 |
코일드-코일-헬릭스-코일드-코일-헬릭스 도메인-함유 단백질 1 OS=Homo sapiens GN=CHCHD1 PE=1 SV=1 | 13 kDa | 0 | 2 | 0 | 0 |
콜라겐 알파-1(II) 체인 OS=Homo sapiens OX=9606 GN=COL2A1 PE=1 SV=3 | 142 kDa | 0 | 2 | 1 | 1 |
콜라겐 알파-1(VI) 체인 OS=Homo sapiens GN=COL6A1 PE=1 SV=1 | 108 kDa | 0 | 3 | 0 | 0 |
콜라겐 알파-1(X) 체인 OS=Homo sapiens GN=COL10A1 PE=1 SV=2 | 66 kDa | 0 | 3 | 0 | 0 |
콜라겐 알파-1(XXIII) 체인 OS=Homo sapiens GN=COL23A1 PE=1 SV=1 | 52 kDa | 0 | 2 | 0 | 0 |
콜라겐 알파-1(XXVII) 체인 OS=Homo sapiens OX=9606 GN=COL27A1 PE=1 SV=1 | 187 kDa | 0 | 1 | 0 | 2 |
콜라겐 알파-2(IX) 체인 OS=Homo sapiens OX=9606 GN=COL9A2 PE=1 SV=2 | 65 kDa | 0 | 0 | 0 | 0 |
콜라겐 트리플 헬릭스 리피트-함유 단백질 1 OS=Homo sapiens OX=9606 GN=CTHRC1 PE=1 SV=1 | 26 kDa | 0 | 3 | 1 | 1 |
커넥티브 조직 성장 인자 OS=Homo sapiens OX=9606 GN=CTGF PE=1 SV=2 | 38 kDa | 0 | 4 | 6 | 2 |
COP9 시그널로좀컴플렉스 서브유닛 5 OS=Homo sapiens GN=COPS5 PE=1 SV=4 | 38 kDa | 0 | 2 | 0 | 0 |
코로닌-1B OS=Homo sapiens GN=CORO1B PE=1 SV=1 | 54 kDa | 0 | 9 | 0 | 0 |
쿨린-1 OS=Homo sapiens GN=CUL1 PE=1 SV=2 | 90 kDa | 0 | 3 | 0 | 0 |
사이토크롬 c (프래그먼트) OS=Homo sapiens GN=CYCS PE=1 SV=1 | 11 kDa | 0 | 3 | 0 | 0 |
사이토크롬 c 옥시다아제 서브유닛 4 아이소폼 1, 미토콘드리아 OS=Homo sapiens GN=COX4I1 PE=1 SV=1 | 20 kDa | 0 | 5 | 0 | 0 |
사이토플라즈믹 아코니테이트 하이드라타아제 OS=Homo sapiens OX=9606 GN=ACO1 PE=1 SV=3 | 98 kDa | 0 | 0 | 0 | 2 |
사이토졸릭 논-특이적 디펩티다아제 OS=Homo sapiens OX=9606 GN=CNDP2 PE=1 SV=2 | 53 kDa | 0 | 10 | 0 | 8 |
데스-관련 단백질 키나아제 3 OS=Homo sapiens OX=9606 GN=DAPK3 PE=1 SV=1 | 53 kDa | 0 | 6 | 0 | 0 |
디옥시리보오즈-포스페이트 알돌라아제 OS=Homo sapiens OX=9606 GN=DERA PE=1 SV=2 | 35 kDa | 0 | 0 | 0 | 3 |
데스모글레인-1 OS=Homo sapiens GN=DSG1 PE=1 SV=2 | 114 kDa | 0 | 6 | 0 | 0 |
DNA 손상-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=DDB1 PE=1 SV=1 | 127 kDa | 0 | 14 | 0 | 3 |
DNA 토포아이소머라아제 1 OS=Homo sapiens GN=TOP1 PE=1 SV=2 | 91 kDa | 0 | 10 | 0 | 0 |
DNA-다이렉티드 RNA 폴리머라아제 II 서브유닛 RPB1 OS=Homo sapiens OX=9606 GN=POLR2A PE=1 SV=2 | 217 kDa | 0 | 11 | 0 | 0 |
DNA-다이렉티드 RNA 폴리머라아제 II 서브유닛 RPB2 OS=Homo sapiens GN=POLR2B PE=1 SV=1 | 134 kDa | 0 | 14 | 0 | 0 |
DNA-다이렉티드 RNA 폴리머라아제 II 서브유닛 RPB3 OS=Homo sapiens GN=POLR2C PE=1 SV=2 | 31 kDa | 0 | 9 | 0 | 0 |
DNA-다이렉티드 RNA 폴리머라아제 II 서브유닛 RPB4 OS=Homo sapiens GN=POLR2D PE=1 SV=1 | 13 kDa | 0 | 6 | 0 | 0 |
DNA-다이렉티드 RNA 폴리머라아제 I, II, 및 III 서브유닛 RPABC3 OS=Homo sapiens OX=9606 GN=POLR2H PE=1 SV=4 | 17 kDa | 0 | 2 | 3 | 0 |
DnaJ 동족체 서브패밀리 B 멤버 11 OS=Homo sapiens OX=9606 GN=DNAJB11 PE=1 SV=1 | 41 kDa | 0 | 0 | 0 | 4 |
돌리콜-포스페이트 만노실트랜스퍼라제 서브유닛 1 OS=Homo sapiens GN=DPM1 PE=1 SV=1 | 30 kDa | 0 | 2 | 0 | 0 |
돌리킬-디포스포올리고사카라이드--단백질 글리코실트랜스퍼라제 서브유닛 STT3B OS=Homo sapiens GN=STT3B PE=1 SV=1 | 94 kDa | 0 | 2 | 0 | 0 |
더블코틴 도메인-함유 단백질 2 OS=Homo sapiens OX=9606 GN=DCDC2 PE=1 SV=2 | 53 kDa | 0 | 17 | 0 | 2 |
더블-스트랜디드 RNA-바인딩 단백질 스tau펜 동족체 1 OS=Homo sapiens OX=9606 GN=Stau1 PE=1 SV=2 | 63 kDa | 0 | 15 | 4 | 4 |
디낵틴 서브유닛 2 OS=Homo sapiens GN=DCTN2 PE=1 SV=4 | 44 kDa | 0 | 6 | 0 | 2 |
디네인 헤비 체인 10, 악소네말 OS=Homo sapiens OX=9606 GN=DNAH10 PE=1 SV=4 | 515 kDa | 0 | 1 | 0 | 2 |
EBNA1 바인딩 단백질 2, 아이소폼 CRA_d OS=Homo sapiens GN=EBNA1BP2 PE=1 SV=1 | 41 kDa | 0 | 5 | 0 | 0 |
엑토뉴클레오티드 파이로포스파타제/포스포디에스터라아제 패밀리 멤버 1 OS=Homo sapiens OX=9606 GN=ENPP1 PE=1 SV=2 | 105 kDa | 0 | 0 | 0 | 2 |
EH 도메인-함유 단백질 4 OS=Homo sapiens OX=9606 GN=EHD4 PE=1 SV=1 | 61 kDa | 0 | 5 | 0 | 3 |
늘임 인자 Tu, 미토콘드리아 OS=Homo sapiens GN=TUFM PE=1 SV=2 | 50 kDa | 0 | 9 | 0 | 0 |
이메린 OS=Homo sapiens GN=EMD PE=1 SV=1 | 29 kDa | 0 | 6 | 0 | 0 |
에폭사이드 하이드로라제 1 OS=Homo sapiens OX=9606 GN=EPHX1 PE=1 SV=1 | 53 kDa | 0 | 0 | 0 | 3 |
ER 루멘 단백질-유지 수용체 3 OS=Homo sapiens GN=KDELR3 PE=2 SV=1 | 25 kDa | 0 | 5 | 0 | 0 |
진핵성 번역 개시 인자 3 서브유닛 E OS=Homo sapiens GN=EIF3E PE=1 SV=1 | 52 kDa | 0 | 8 | 0 | 0 |
진핵성 번역 개시 인자 3 서브유닛 F OS=Homo sapiens GN=EIF3F PE=1 SV=1 | 38 kDa | 0 | 14 | 0 | 0 |
진핵성 번역 개시 인자 3 서브유닛 H OS=Homo sapiens GN=EIF3H PE=1 SV=1 | 40 kDa | 0 | 5 | 0 | 0 |
FACT 컴플렉스 서브유닛 SPT16 OS=Homo sapiens GN=SUPT16H PE=1 SV=1 | 120 kDa | 0 | 7 | 0 | 0 |
파 업스트림 엘리먼트-바인딩 단백질 1 OS=Homo sapiens OX=9606 GN=FUBP1 PE=1 SV=3 | 68 kDa | 0 | 3 | 0 | 1 |
파신 OS=Homo sapiens GN=FSCN1 PE=1 SV=3 | 55 kDa | 0 | 12 | 0 | 0 |
피브루스 쉬스-인터랙팅 단백질 2 OS=Homo sapiens OX=9606 GN=FSIP2 PE=2 SV=4 | 781 kDa | 0 | 0 | 2 | 1 |
필라그린 OS=Homo sapiens GN=FLG PE=1 SV=3 | 435 kDa | 0 | 3 | 0 | 0 |
필라그린-2 OS=Homo sapiens GN=FLG2 PE=1 SV=1 | 248 kDa | 0 | 2 | 0 | 0 |
플로틸린-2 OS=Homo sapiens GN=FLOT2 PE=1 SV=1 | 53 kDa | 0 | 13 | 0 | 0 |
갈렉틴-3 OS=Homo sapiens GN=LGALS3 PE=1 SV=5 | 26 kDa | 0 | 39 | 0 | 0 |
갈렉틴-3-바인딩 단백질 OS=Homo sapiens OX=9606 GN=LGALS3BP PE=1 SV=1 | 65 kDa | 0 | 4 | 0 | 3 |
갈렉틴-8 OS=Homo sapiens OX=9606 GN=LGALS8 PE=1 SV=4 | 36 kDa | 0 | 5 | 2 | 0 |
글루타메이트 탈수소효소 1, 미토콘드리아 OS=Homo sapiens OX=9606 GN=GLUD1 PE=1 SV=2 | 61 kDa | 0 | 4 | 0 | 0 |
글루타치온 퍼옥시다아제 1 OS=Homo sapiens GN=GPX1 PE=1 SV=4 | 22 kDa | 0 | 3 | 0 | 2 |
글리실펩타이드 N-테트라데카노일트랜스퍼라아제 2 OS=Homo sapiens GN=NMT2 PE=1 SV=1 | 57 kDa | 0 | 2 | 0 | 0 |
글리피칸-6 OS=Homo sapiens GN=GPC6 PE=1 SV=1 | 63 kDa | 0 | 14 | 0 | 0 |
골지-관련 플랜트 패소제네시스-관련 단백질 1 OS=Homo sapiens GN=GLIPR2 PE=1 SV=3 | 17 kDa | 0 | 20 | 0 | 0 |
그렘린-1 OS=Homo sapiens OX=9606 GN=GREM1 PE=1 SV=1 | 21 kDa | 0 | 0 | 3 | 0 |
구아닌 뉴클레오티드-바인딩 단백질 G(I)/G(S)/G(O) 서브유닛 감마-12 OS=Homo sapiens GN=GNG12 PE=1 SV=3 | 8 kDa | 0 | 6 | 0 | 0 |
구아닌 뉴클레오티드-바인딩 단백질 G(k) 서브유닛 알파 OS=Homo sapiens GN=GNAI3 PE=1 SV=3 | 41 kDa | 0 | 17 | 0 | 0 |
하마틴 OS=Homo sapiens GN=TSC1 PE=1 SV=2 | 130 kDa | 0 | 0 | 0 | 2 |
히트 쇼크-관련 70 kDa 단백질 2 OS=Homo sapiens OX=9606 GN=HSPA2 PE=1 SV=1 | 70 kDa | 0 | 0 | 0 | 24 |
헤미센틴-2 OS=Homo sapiens OX=9606 GN=HMCN2 PE=2 SV=3 | 542 kDa | 0 | 0 | 0 | 0 |
헤파란 설페이트 글루코사민 3-O-설포트랜스퍼라아제 6 OS=Homo sapiens GN=HS3ST6 PE=1 SV=2 | 37 kDa | 0 | 3 | 0 | 0 |
이종성 핵 리보핵단백질 A0 OS=Homo sapiens GN=HNRNPA0 PE=1 SV=1 | 31 kDa | 0 | 15 | 0 | 0 |
이종성 핵 리보핵단백질 H2 OS=Homo sapiens GN=HNRNPH2 PE=1 SV=1 | 49 kDa | 0 | 14 | 0 | 0 |
호메오복스 단백질 Hox-B3 OS=Homo sapiens OX=9606 GN=HOXB3 PE=2 SV=2 | 44 kDa | 0 | 5 | 0 | 0 |
호네린 OS=Homo sapiens GN=HRNR PE=1 SV=2 | 282 kDa | 0 | 15 | 0 | 0 |
Hsc70-인터랙팅 단백질 (프래그먼트) OS=Homo sapiens GN=ST13 PE=1 SV=1 | 16 kDa | 0 | 2 | 0 | 0 |
히아루로난 및 프로테오글리칸 결합 단백질 1 OS=Homo sapiens OX=9606 GN=HAPLN1 PE=2 SV=2 | 40 kDa | 0 | 0 | 0 | 0 |
히아루로난 및 프로테오글리칸 결합 단백질 3 OS=Homo sapiens GN=HAPLN3 PE=2 SV=1 | 41 kDa | 0 | 6 | 0 | 0 |
세포간 어드헤션 분자 1 OS=Homo sapiens GN=ICAM1 PE=1 SV=2 | 58 kDa | 0 | 16 | 0 | 0 |
인터류킨 인헨서-바인딩 인자 2 OS=Homo sapiens GN=ILF2 PE=1 SV=1 | 39 kDa | 0 | 29 | 0 | 0 |
이소구연산염 탈수소효소 [NADP] 사이토플라즈믹 OS=Homo sapiens GN=IDH1 PE=1 SV=2 | 47 kDa | 0 | 7 | 0 | 0 |
감마-애덕신 아이소폼 1 OS=Homo sapiens OX=9606 GN=ADD3 | 76 kDa | 0 | 7 | 0 | 1 |
폴리피리미딘 트랙트-바인딩 단백질 3 아이소폼 1 OS=Homo sapiens OX=9606 GN=PTBP3 | 57 kDa | 0 | 5 | 0 | 3 |
시냅틱 기능성 조절자 FMR1 아이소폼 1 OS=Homo sapiens OX=9606 GN=FMR1 | 67 kDa | 0 | 5 | 0 | 1 |
2,4-디이노일-CoA 리덕타아제 아이소폼 2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=DECR1 | 35 kDa | 0 | 8 | 0 | 1 |
A-키나아제 앵커 단백질 13 아이소폼 2 OS=Homo sapiens OX=9606 GN=AKAP13 | 308 kDa | 0 | 2 | 0 | 0 |
안키린 리피트 도메인-함유 단백질 17 아이소폼 2 OS=Homo sapiens OX=9606 GN=ANKRD17 | 274 kDa | 0 | 0 | 0 | 0 |
AP-2 컴플렉스 서브유닛 뮤 아이소폼 2 OS=Homo sapiens OX=9606 GN=AP2M1 | 49 kDa | 0 | 9 | 0 | 1 |
Bcl-2-관련 전사 인자 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=BCLAF1 | 106 kDa | 0 | 4 | 0 | 0 |
카데린-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=CDH2 | 97 kDa | 0 | 7 | 0 | 2 |
칼포닌-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=CNN1 | 31 kDa | 0 | 1 | 5 | 8 |
크로모도메인 Y-유사 단백질 아이소폼 2 OS=Homo sapiens GN=CDYL | 61 kDa | 0 | 4 | 0 | 0 |
콜라겐 알파-1(VII) 체인 아이소폼 2 OS=Homo sapiens OX=9606 GN=COL7A1 | 292 kDa | 0 | 70 | 2 | 1 |
사이클린-Y 아이소폼 2 OS=Homo sapiens GN=CCNY | 37 kDa | 0 | 3 | 0 | 0 |
시스테인-풍부 단백질 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=CRIP2 | 30 kDa | 0 | 5 | 0 | 0 |
DnaJ 동족체 서브패밀리 C 멤버 10 아이소폼 2 OS=Homo sapiens GN=DNAJC10 | 86 kDa | 0 | 4 | 0 | 0 |
피브로블라스트 성장 인자 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=FGF2 | 23 kDa | 0 | 13 | 3 | 1 |
피불린-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=FBLN2 | 132 kDa | 0 | 6 | 0 | 0 |
GDNF 패밀리 수용체 알파-1 아이소폼 2 OS=Homo sapiens GN=GFRA1 | 51 kDa | 0 | 8 | 0 | 0 |
글리코젠 인산화효소, 리버 폼 아이소폼 2 OS=Homo sapiens OX=9606 GN=PYGL | 93 kDa | 0 | 2 | 0 | 1 |
골지n 서브패밀리 A 멤버 5 아이소폼 2 OS=Homo sapiens OX=9606 GN=GOLGA5 | 78 kDa | 0 | 0 | 0 | 0 |
H/ACA 리보핵단백질 컴플렉스 서브유닛 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=GAR1 | 21 kDa | 0 | 1 | 1 | 2 |
헬리카아제 SRCAP 아이소폼 2 OS=Homo sapiens OX=9606 GN=SRCAP | 337 kDa | 0 | 2 | 0 | 0 |
히스톤-바인딩 단백질 RBBP4 아이소폼 2 OS=Homo sapiens OX=9606 GN=RBBP4 | 48 kDa | 0 | 6 | 0 | 0 |
히스톤-리신 N-메틸트랜스퍼라아제 아이소폼 2, H3 리신-36 및 H4 리신-20 특이적 OS=Homo sapiens OX=9606 GN=NSD1 | 267 kDa | 0 | 6 | 0 | 1 |
인슐린-유사 성장 인자-바인딩 단백질 7 아이소폼 2 OS=Homo sapiens OX=9606 GN=IGFBP7 | 29 kDa | 0 | 54 | 13 | 7 |
인터페론-인듀서블 더블-스트랜디드 RNA-의존 단백질 키나아제 활성자 A 아이소폼 2 OS=Homo sapiens OX=9606 GN=PRKRA | 33 kDa | 0 | 4 | 1 | 1 |
KH 도메인-함유, RNA-바인딩, 시그널 형질도입-관련 단백질 3 아이소폼 2 OS=Homo sapiens GN=KHDRBS3 | 30 kDa | 0 | 8 | 0 | 0 |
락타데린 아이소폼 2 OS=Homo sapiens GN=MFGE8 | 35 kDa | 0 | 25 | 2 | 1 |
L-아미노-산 옥시다아제 아이소폼 2 OS=Homo sapiens OX=9606 GN=IL4I1 | 65 kDa | 0 | 2 | 0 | 1 |
매크로파지-캐핑 단백질 아이소폼 2 OS=Homo sapiens GN=CAPG | 37 kDa | 0 | 3 | 0 | 0 |
마트릴린-2 아이소폼 2 OS=Homo sapiens OX=9606 GN=MATN2 | 105 kDa | 0 | 37 | 8 | 5 |
메조덤-특이적 트랜스크립트 동족체 단백질 아이소폼 2 OS=Homo sapiens OX=9606 GN=MEST | 38 kDa | 0 | 0 | 0 | 4 |
마이크로튜불-관련 단백질 1A 아이소폼 2 OS=Homo sapiens OX=9606 GN=MAP1A | 306 kDa | 0 | 4 | 2 | 3 |
미드카인 아이소폼 2 OS=Homo sapiens OX=9606 GN=MDK | 10 kDa | 0 | 4 | 2 | 2 |
모노아실글리세롤 리파아제 ABHD12 아이소폼 2 OS=Homo sapiens GN=ABHD12 | 46 kDa | 0 | 2 | 0 | 0 |
다중약 저항성 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=ABCB1 | 134 kDa | 0 | 1 | 0 | 2 |
미오신-11 아이소폼 2 OS=Homo sapiens GN=MYH11 | 228 kDa | 0 | 161 | 37 | 0 |
미오신-14 아이소폼 2 OS=Homo sapiens OX=9606 GN=MYH14 | 232 kDa | 0 | 141 | 26 | 26 |
NADH 탈수소효소 [유비퀴논] 1 베타 서브컴플렉스 서브유닛 4 아이소폼 2 OS=Homo sapiens OX=9606 GN=NDUFB4 | 14 kDa | 0 | 1 | 0 | 2 |
핵 수용체 코어프레서 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=NCOR1 | 259 kDa | 0 | 0 | 2 | 0 |
페리오스틴 아이소폼 2 OS=Homo sapiens OX=9606 GN=POSTN | 87 kDa | 0 | 0 | 5 | 5 |
페스카딜로 동족체 아이소폼 2 OS=Homo sapiens OX=9606 GN=PES1 | 67 kDa | 0 | 5 | 1 | 0 |
혈소판-유래 성장 인자 서브유닛 B 아이소폼 2 OS=Homo sapiens OX=9606 GN=PDGFB | 26 kDa | 0 | 1 | 3 | 1 |
단백질 ELYS 아이소폼 2 OS=Homo sapiens OX=9606 GN=AHCTF1 | 256 kDa | 0 | 0 | 2 | 0 |
란-바인딩 단백질 3 아이소폼 2 OS=Homo sapiens OX=9606 GN=RANBP3 | 60 kDa | 0 | 5 | 0 | 0 |
크로모좀 condensation 조절자 아이소폼 2 OS=Homo sapiens OX=9606 GN=RCC1 | 48 kDa | 0 | 16 | 0 | 0 |
레티놀-바인딩 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=RBP1 | 17 kDa | 0 | 0 | 0 | 2 |
RNA-바인딩 단백질 39 아이소폼 2 OS=Homo sapiens GN=RBM39 | 59 kDa | 0 | 0 | 0 | 2 |
RNA-바인딩 단백질 8A 아이소폼 2 OS=Homo sapiens OX=9606 GN=RBM8A | 20 kDa | 0 | 5 | 0 | 1 |
라이아노다인 수용체 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=RYR1 | 565 kDa | 0 | 1 | 0 | 2 |
SCO-스폰딘 아이소폼 2 OS=Homo sapiens OX=9606 GN=SSPO | 139 kDa | 0 | 3 | 0 | 0 |
세마포린-7A 아이소폼 2 OS=Homo sapiens OX=9606 GN=SEMA7A | 73 kDa | 0 | 3 | 1 | 3 |
셉틴-8 아이소폼 2 OS=Homo sapiens OX=9606 GN=SEPT8 | 50 kDa | 0 | 12 | 0 | 3 |
세린/쓰레오닌-단백질 포스파타제 PGAM5 아이소폼 2, 미토콘드리아 OS=Homo sapiens OX=9606 GN=PGAM5 | 28 kDa | 0 | 5 | 0 | 1 |
SH3 도메인-함유 키나아제-바인딩 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=SH3KBP1 | 69 kDa | 0 | 2 | 0 | 2 |
시그널 인식 파티클 수용체 서브유닛 알파 아이소폼 2 OS=Homo sapiens OX=9606 GN=SRPRA | 67 kDa | 0 | 3 | 0 | 1 |
시그널-유도 증식-관련 1-유사 단백질 1 아이소폼 2 OS=Homo sapiens OX=9606 GN=SIPA1L1 | 197 kDa | 0 | 0 | 0 | 0 |
분류 넥신-27 아이소폼 2 OS=Homo sapiens GN=SNX27 | 60 kDa | 0 | 4 | 0 | 0 |
스펙트린 베타 체인 아이소폼 2, 적혈구 OS=Homo sapiens OX=9606 GN=SPTB | 268 kDa | 0 | 8 | 0 | 2 |
테스티스-발현된 단백질 10 아이소폼 2 OS=Homo sapiens OX=9606 GN=TEX10 | 104 kDa | 0 | 2 | 0 | 0 |
조직 인자 패스웨이 저해제 2 아이소폼 2 OS=Homo sapiens OX=9606 GN=TFPI2 | 26 kDa | 0 | 9 | 6 | 0 |
티로신-단백질 키나아제 BAZ1B 아이소폼 2 OS=Homo sapiens OX=9606 GN=BAZ1B | 170 kDa | 0 | 4 | 0 | 0 |
UDP-글루쿠로노실트랜스퍼라제 1-6 아이소폼 2 OS=Homo sapiens OX=9606 GN=UGT1A6 | 30 kDa | 0 | 4 | 0 | 0 |
소낭-관련 막 단백질-관련 단백질 A 아이소폼 2 OS=Homo sapiens OX=9606 GN=VAPA | 33 kDa | 0 | 3 | 0 | 1 |
전압-의존 칼슘 채널 서브유닛 알파-2/델타-1 아이소폼 2 OS=Homo sapiens OX=9606 GN=CACNA2D1 | 123 kDa | 0 | 2 | 1 | 0 |
Y-복스-바인딩 단백질 3 아이소폼 2 OS=Homo sapiens OX=9606 GN=YBX3 | 32 kDa | 0 | 15 | 0 | 1 |
징크 핑거 호메오복스 단백질 4 아이소폼 2 OS=Homo sapiens OX=9606 GN=ZFHX4 | 397 kDa | 0 | 2 | 0 | 0 |
1-포스파티딜이노시톨 4,5-비스포스페이트 포스포디에스터라아제 베타-4 아이소폼 3 OS=Homo sapiens OX=9606 GN=PLCB4 | 136 kDa | 0 | 3 | 0 | 0 |
알파-애덕신 아이소폼 3 OS=Homo sapiens GN=ADD1 | 84 kDa | 0 | 2 | 0 | 0 |
세포골격-관련 단백질 5 아이소폼 3 OS=Homo sapiens OX=9606 GN=CKAP5 | 226 kDa | 0 | 3 | 0 | 0 |
DnaJ 동족체 서브패밀리 C 멤버 11 아이소폼 3 OS=Homo sapiens GN=DNAJC11 | 57 kDa | 0 | 2 | 0 | 1 |
E3 유비퀴틴-단백질 리가아제 CHFR 아이소폼 3 OS=Homo sapiens OX=9606 GN=CHFR | 69 kDa | 0 | 0 | 0 | 0 |
H/ACA 리보핵단백질 컴플렉스 서브유닛 DKC1 아이소폼 3 OS=Homo sapiens OX=9606 GN=DKC1 | 48 kDa | 0 | 13 | 1 | 1 |
히스톤-리신 N-메틸트랜스퍼라아제 2D 아이소폼 3 OS=Homo sapiens OX=9606 GN=KMT2D | 594 kDa | 0 | 1 | 0 | 1 |
잠재(latent)-트랜스포밍 성장 인자 베타-바인딩 단백질 4 아이소폼 3 OS=Homo sapiens OX=9606 GN=LTBP4 | 169 kDa | 0 | 34 | 0 | 0 |
말레이트 탈수소효소 아이소폼 3, 사이토플라즈믹 OS=Homo sapiens OX=9606 GN=MDH1 | 39 kDa | 0 | 3 | 0 | 0 |
추정(Putative) 옥시도리덕타아제 GLYR1 아이소폼 3 OS=Homo sapiens OX=9606 GN=GLYR1 | 60 kDa | 0 | 4 | 0 | 0 |
스캐폴드 부착 인자 B1 아이소폼 3 OS=Homo sapiens GN=SAFB | 103 kDa | 0 | 3 | 0 | 0 |
톨신-1A-인터랙팅 단백질 1 아이소폼 3 OS=Homo sapiens GN=TOR1AIP1 | 66 kDa | 0 | 5 | 0 | 0 |
CD109 항원 아이소폼 4 OS=Homo sapiens GN=CD109 | 160 kDa | 0 | 18 | 0 | 0 |
FYVE 및 코일드-코일 도메인-함유 단백질 1 아이소폼 4 OS=Homo sapiens OX=9606 GN=FYCO1 | 169 kDa | 0 | 0 | 0 | 0 |
IQ 도메인-함유 단백질 N 아이소폼 4 OS=Homo sapiens OX=9606 GN=IQCN | 147 kDa | 0 | 0 | 0 | 3 |
키네신-유사 단백질 KIF24 아이소폼 4 OS=Homo sapiens OX=9606 GN=KIF24 | 129 kDa | 0 | 2 | 0 | 0 |
잠재(latent)-트랜스포밍 성장 인자 베타-바인딩 단백질 1 아이소폼 4 OS=Homo sapiens OX=9606 GN=LTBP1 | 187 kDa | 0 | 1 | 4 | 1 |
단백질 투명성(diaphanous) 동족체 3 아이소폼 4 OS=Homo sapiens GN=DIAPH3 | 136 kDa | 0 | 2 | 0 | 0 |
E1A-바인딩 단백질 p400 아이소폼 5 OS=Homo sapiens OX=9606 GN=EP400 | 340 kDa | 0 | 1 | 0 | 0 |
이뮤노글로불린-유사 및 피브로넥틴 타입 III 도메인-함유 단백질 1 아이소폼 5 OS=Homo sapiens OX=9606 GN=IGFN1 | 384 kDa | 0 | 3 | 0 | 2 |
LIM 도메인 유일(only) 단백질 7 아이소폼 5 OS=Homo sapiens GN=LMO7 | 158 kDa | 0 | 8 | 0 | 0 |
파필린 아이소폼 5 OS=Homo sapiens OX=9606 GN=PAPLN | 136 kDa | 0 | 17 | 1 | 1 |
트레아클 단백질 아이소폼 6 OS=Homo sapiens OX=9606 GN=TCOF1 | 148 kDa | 0 | 2 | 0 | 0 |
콜라겐 알파-1(XI) 체인 아이소폼 B OS=Homo sapiens OX=9606 GN=COL11A1 | 182 kDa | 0 | 0 | 1 | 2 |
콜라겐 알파-6(IV) 체인 아이소폼 B OS=Homo sapiens OX=9606 GN=COL4A6 | 164 kDa | 0 | 5 | 2 | 0 |
DnaJ 동족체 서브패밀리 B 멤버 6 아이소폼 B OS=Homo sapiens OX=9606 GN=DNAJB6 | 27 kDa | 0 | 0 | 1 | 2 |
메틸-CpG-바인딩 단백질 2 아이소폼 B OS=Homo sapiens OX=9606 GN=MECP2 | 53 kDa | 0 | 11 | 1 | 0 |
라스-관련 C3 보툴리눔 톡신 기질 1 아이소폼 B OS=Homo sapiens OX=9606 GN=RAC1 | 23 kDa | 0 | 3 | 0 | 0 |
트랜스포밍 성장 인자 베타-2 프로단백질 아이소폼 B OS=Homo sapiens OX=9606 GN=TGFB2 | 51 kDa | 0 | 5 | 1 | 2 |
인테그린 베타-3 아이소폼 베타-3B OS=Homo sapiens OX=9606 GN=ITGB3 | 86 kDa | 0 | 4 | 0 | 2 |
피불린-1 아이소폼 C OS=Homo sapiens OX=9606 GN=FBLN1 | 74 kDa | 0 | 13 | 0 | 8 |
프로테아좀 서브유닛 알파 타입-1 아이소폼 Long OS=Homo sapiens OX=9606 GN=PSMA1 | 30 kDa | 0 | 2 | 0 | 2 |
클라트린 라이트 체인 A 아이소폼 논-브레인 OS=Homo sapiens OX=9606 GN=CLTA | 24 kDa | 0 | 17 | 0 | 2 |
라미닌 서브유닛 감마-2 아이소폼 Short OS=Homo sapiens OX=9606 GN=LAMC2 | 122 kDa | 0 | 5 | 0 | 1 |
케라틴, 타입 I 세포골격 14 OS=Homo sapiens OX=9606 GN=KRT14 PE=1 SV=4 | 52 kDa | 0 | 94 | 0 | 18 |
케라틴, 타입 I 세포골격 16 OS=Homo sapiens GN=KRT16 PE=1 SV=4 | 51 kDa | 0 | 99 | 0 | 0 |
케라틴, 타입 I 세포골격 19 OS=Homo sapiens GN=KRT19 PE=1 SV=4 | 44 kDa | 0 | 753 | 0 | 0 |
케라틴, 타입 II 표피(cuticular) Hb5 OS=Homo sapiens GN=KRT85 PE=1 SV=1 | 56 kDa | 0 | 3 | 0 | 0 |
케라틴, 타입 II 세포골격 1 OS=Homo sapiens GN=KRT1 PE=1 SV=6 | 66 kDa | 0 | 497 | 0 | 0 |
케라틴, 타입 II 세포골격 5 OS=Homo sapiens GN=KRT5 PE=1 SV=3 | 62 kDa | 0 | 93 | 0 | 0 |
케라틴, 타입 II 세포골격 6B OS=Homo sapiens OX=9606 GN=KRT6B PE=1 SV=5 | 60 kDa | 0 | 104 | 18 | 0 |
케라틴, 타입 II 세포골격 7 OS=Homo sapiens OX=9606 GN=KRT7 PE=1 SV=5 | 51 kDa | 0 | 0 | 0 | 135 |
키네신-유사 단백질 KIFC2 OS=Homo sapiens OX=9606 GN=KIFC2 PE=2 SV=1 | 90 kDa | 0 | 2 | 0 | 1 |
라디닌-1 OS=Homo sapiens OX=9606 GN=LAD1 PE=1 SV=2 | 57 kDa | 0 | 0 | 0 | 6 |
라미닌 서브유닛 베타-3 OS=Homo sapiens GN=LAMB3 PE=1 SV=1 | 130 kDa | 0 | 10 | 0 | 0 |
잠재(latent)-트랜스포밍 성장 인자 베타-바인딩 단백질 2 OS=Homo sapiens GN=LTBP2 PE=1 SV=1 | 190 kDa | 0 | 23 | 0 | 0 |
류신 지퍼 단백질 1 OS=Homo sapiens OX=9606 GN=LUZP1 PE=1 SV=2 | 120 kDa | 0 | 5 | 0 | 0 |
브랜치드-체인 알파-케토 산 탈수소효소 콤플렉스 리포아마이드 아실트랜스퍼라아제 컴포넌트, 미토콘드리아 OS=Homo sapiens OX=9606 GN=DBT PE=1 SV=3 | 53 kDa | 0 | 6 | 4 | 8 |
저-밀도 리포단백질 수용체-관련 단백질 1B OS=Homo sapiens GN=LRP1B PE=1 SV=2 | 515 kDa | 0 | 2 | 0 | 0 |
저-밀도 리포단백질 수용체-관련 단백질 2 OS=Homo sapiens OX=9606 GN=LRP2 PE=1 SV=3 | 522 kDa | 0 | 0 | 0 | 2 |
리실 옥시다아제 동족체 1 OS=Homo sapiens OX=9606 GN=LOXL1 PE=1 SV=2 | 63 kDa | 0 | 24 | 1 | 0 |
마그네슘 트랜스포터 단백질 1 OS=Homo sapiens GN=MAGT1 PE=1 SV=1 | 42 kDa | 0 | 4 | 1 | 1 |
MARCKS-관련 단백질 OS=Homo sapiens GN=MARCKSL1 PE=1 SV=2 | 20 kDa | 0 | 4 | 0 | 0 |
전이-관련 단백질 MTA2 OS=Homo sapiens GN=MTA2 PE=1 SV=1 | 75 kDa | 0 | 5 | 0 | 0 |
마이크로소멀 글루타치온 S-트랜스퍼라아제 1 OS=Homo sapiens OX=9606 GN=MGST1 PE=1 SV=1 | 18 kDa | 0 | 0 | 0 | 3 |
미토콘드리아 GTP아제 1 OS=Homo sapiens OX=9606 PE=3 SV=1 | 37 kDa | 0 | 0 | 0 | 2 |
MKI67 FHA 도메인-인터랙팅 핵 포스포단백질 (프래그먼트) OS=Homo sapiens GN=NIFK PE=1 SV=1 | 20 kDa | 0 | 6 | 0 | 0 |
뮤신-16 OS=Homo sapiens OX=9606 GN=MUC16 PE=1 SV=3 | 1519 kDa | 0 | 0 | 2 | 4 |
미엘린 발현 인자 2 OS=Homo sapiens OX=9606 GN=MYEF2 PE=1 SV=3 | 64 kDa | 0 | 2 | 0 | 0 |
미오신 라이트 체인 6B OS=Homo sapiens OX=9606 GN=MYL6B PE=1 SV=1 | 23 kDa | 0 | 0 | 6 | 0 |
미리스토일화 알라닌-풍부 C-키나아제 기질 OS=Homo sapiens GN=MARCKS PE=1 SV=4 | 32 kDa | 0 | 11 | 0 | 0 |
N-아실뉴라미네이트 사이티디릴트랜스퍼라아제 OS=Homo sapiens GN=CMAS PE=1 SV=2 | 48 kDa | 0 | 6 | 0 | 0 |
NAD(P) 트랜스하이드로게나아제, 미토콘드리아 OS=Homo sapiens GN=NNT PE=1 SV=1 | 100 kDa | 0 | 3 | 0 | 0 |
네스틴 OS=Homo sapiens GN=NES PE=1 SV=2 | 177 kDa | 0 | 18 | 0 | 0 |
뉴라빈-2 OS=Homo sapiens GN=PPP1R9B PE=1 SV=1 | 89 kDa | 0 | 3 | 0 | 0 |
뉴로비아친 OS=Homo sapiens OX=9606 GN=NBEA PE=1 SV=3 | 328 kDa | 0 | 0 | 0 | 3 |
니코티네이트-뉴클레오티드 파이로인산화효소 [카복실레이팅] OS=Homo sapiens OX=9606 GN=QPRT PE=1 SV=3 | 31 kDa | 0 | 0 | 0 | 4 |
논-신드로믹 히어링 임페어먼트 단백질 5 OS=Homo sapiens GN=DFNA5 PE=1 SV=2 | 55 kDa | 0 | 2 | 0 | 0 |
핵 수용체-바인딩 단백질 OS=Homo sapiens GN=NRBP1 PE=1 SV=1 | 61 kDa | 0 | 5 | 0 | 0 |
핵 컴플렉스 단백질 3 동족체 OS=Homo sapiens GN=NOC3L PE=1 SV=1 | 93 kDa | 0 | 5 | 0 | 0 |
핵 컴플렉스 단백질 4 동족체 OS=Homo sapiens GN=NOC4L PE=1 SV=1 | 58 kDa | 0 | 5 | 0 | 0 |
핵 단백질 58 OS=Homo sapiens GN=NOP58 PE=1 SV=1 | 60 kDa | 0 | 6 | 0 | 0 |
핵 전사 인자 1 OS=Homo sapiens GN=UBTF PE=1 SV=1 | 87 kDa | 0 | 2 | 0 | 0 |
뉴클레오플라즈민-3 OS=Homo sapiens GN=NPM3 PE=1 SV=3 | 19 kDa | 0 | 3 | 0 | 0 |
팔라딘 OS=Homo sapiens OX=9606 GN=PALLD PE=1 SV=3 | 151 kDa | 0 | 7 | 0 | 6 |
PDZ 및 LIM 도메인 단백질 1 OS=Homo sapiens OX=9606 GN=PDLIM1 PE=1 SV=4 | 36 kDa | 0 | 0 | 0 | 4 |
PDZ 및 LIM 도메인 단백질 4 OS=Homo sapiens GN=PDLIM4 PE=1 SV=2 | 35 kDa | 0 | 3 | 0 | 0 |
펜트락신-관련 단백질 PTX3 OS=Homo sapiens GN=PTX3 PE=1 SV=3 | 42 kDa | 0 | 23 | 0 | 0 |
펩티딜-프롤릴 시스-트랜스 아이소머라아제 B OS=Homo sapiens GN=PPIB PE=1 SV=2 | 24 kDa | 0 | 52 | 0 | 0 |
펩티딜-프롤릴 시스-트랜스 아이소머라아제 FKBP10 OS=Homo sapiens GN=FKBP10 PE=1 SV=1 | 64 kDa | 0 | 3 | 0 | 0 |
펩티딜-프롤릴 시스-트랜스 아이소머라아제 FKBP3 OS=Homo sapiens GN=FKBP3 PE=1 SV=1 | 25 kDa | 0 | 8 | 0 | 0 |
페리악신 OS=Homo sapiens OX=9606 GN=PRX PE=1 SV=2 | 155 kDa | 0 | 0 | 0 | 2 |
피리오딕(Periodic) 트립토판 단백질 1 동족체 OS=Homo sapiens OX=9606 GN=PWP1 PE=1 SV=1 | 56 kDa | 0 | 2 | 0 | 0 |
퍼옥시레독신-1 (프래그먼트) OS=Homo sapiens GN=PRDX1 PE=1 SV=1 | 19 kDa | 0 | 13 | 0 | 0 |
포스포글리세르산 뮤테이즈 1 OS=Homo sapiens GN=PGAM1 PE=1 SV=2 | 29 kDa | 0 | 11 | 0 | 0 |
피닌 OS=Homo sapiens OX=9606 GN=PNN PE=1 SV=5 | 82 kDa | 0 | 6 | 2 | 4 |
혈소판-활성화 인자 아세틸하이드로라제 IB 서브유닛 알파 OS=Homo sapiens OX=9606 GN=PAFAH1B1 PE=1 SV=2 | 47 kDa | 0 | 4 | 0 | 0 |
폴리 [ADP-리보오스] 폴리머라아제 1 OS=Homo sapiens GN=PARP1 PE=1 SV=4 | 113 kDa | 0 | 30 | 0 | 0 |
폴리(U)-바인딩-스플라이싱 인자 PUF60 (프래그먼트) OS=Homo sapiens GN=PUF60 PE=1 SV=1 | 57 kDa | 0 | 3 | 0 | 0 |
폴리머라아제 델타-인터랙팅 단백질 3 OS=Homo sapiens GN=POLDIP3 PE=1 SV=1 | 48 kDa | 0 | 6 | 0 | 0 |
폴리머라아제 I 및 트랜스크립트 릴리즈 인자 OS=Homo sapiens GN=PTRF PE=1 SV=1 | 43 kDa | 0 | 89 | 0 | 0 |
폴리유비퀴틴-B OS=Homo sapiens GN=UBB PE=1 SV=1 | 17 kDa | 0 | 111 | 0 | 0 |
POU 도메인, 클래스 3, 전사 인자 3 OS=Homo sapiens GN=POU3F3 PE=2 SV=2 | 50 kDa | 0 | 20 | 0 | 0 |
PR 도메인 징크 핑거 단백질 8 OS=Homo sapiens GN=PRDM8 PE=1 SV=3 | 72 kDa | 0 | 2 | 0 | 0 |
프리폴딘 서브유닛 6 OS=Homo sapiens GN=PFDN6 PE=1 SV=1 | 15 kDa | 0 | 3 | 0 | 0 |
프로버블 ATP-의존 RNA 헬리카아제 DDX27 OS=Homo sapiens GN=DDX27 PE=1 SV=1 | 87 kDa | 0 | 4 | 0 | 0 |
프로버블 글로벌 전사 활성자 SNF2L1 OS=Homo sapiens OX=9606 GN=SMARCA1 PE=1 SV=2 | 123 kDa | 0 | 6 | 0 | 0 |
프로버블 말타아제-글루코아밀라아제 2 OS=Homo sapiens OX=9606 GN=MGAM2 PE=2 SV=3 | 278 kDa | 0 | 0 | 0 | 2 |
프로콜라겐 갈락토실트랜스퍼라제 1 OS=Homo sapiens GN=COLGALT1 PE=1 SV=1 | 72 kDa | 0 | 3 | 0 | 0 |
프로콜라겐-리신,2-옥소글루타레이트 5-디옥시게나아제 3 OS=Homo sapiens GN=PLOD3 PE=1 SV=1 | 85 kDa | 0 | 3 | 0 | 0 |
프로저-밀도 리포단백질 수용체-관련 단백질 1 OS=Homo sapiens GN=LRP1 PE=1 SV=2 | 505 kDa | 0 | 2 | 0 | 0 |
단백질 디설파이트-아이소머라아제 OS=Homo sapiens GN=P4HB PE=1 SV=2 | 53 kDa | 0 | 30 | 0 | 0 |
단백질 GREB1 OS=Homo sapiens GN=GREB1 PE=2 SV=1 | 216 kDa | 0 | 0 | 0 | 2 |
단백질 키나아제 C 델타-바인딩 단백질 OS=Homo sapiens GN=PRKCDBP PE=1 SV=1 | 31 kDa | 0 | 20 | 0 | 0 |
단백질 MAK16 동족체 OS=Homo sapiens GN=MAK16 PE=1 SV=2 | 35 kDa | 0 | 2 | 0 | 0 |
단백질 S100-A10 OS=Homo sapiens GN=S100A10 PE=1 SV=2 | 11 kDa | 0 | 11 | 0 | 0 |
단백질 S100-A13 OS=Homo sapiens GN=S100A13 PE=1 SV=1 | 11 kDa | 0 | 5 | 0 | 0 |
단백질 S100-A9 OS=Homo sapiens GN=S100A9 PE=1 SV=1 | 13 kDa | 0 | 12 | 0 | 0 |
단백질-글루타민 감마-글루타밀전달효소 E OS=Homo sapiens GN=TGM3 PE=1 SV=4 | 77 kDa | 0 | 2 | 0 | 0 |
푸밀리오 동족체 3 OS=Homo sapiens GN=PUM3 PE=1 SV=3 | 74 kDa | 0 | 6 | 0 | 0 |
라프트린 OS=Homo sapiens GN=RFTN1 PE=1 SV=4 | 63 kDa | 0 | 3 | 0 | 0 |
라스 GTP아제-활성화-유사 단백질 IQGAP1 OS=Homo sapiens GN=IQGAP1 PE=1 SV=1 | 189 kDa | 0 | 135 | 0 | 0 |
라스-관련 단백질 Rab-10 OS=Homo sapiens GN=RAB10 PE=1 SV=1 | 23 kDa | 0 | 13 | 0 | 0 |
라스-관련 단백질 Rab-14 (프래그먼트) OS=Homo sapiens GN=RAB14 PE=1 SV=1 | 20 kDa | 0 | 8 | 0 | 0 |
라스-관련 단백질 Rab-2A OS=Homo sapiens GN=RAB2A PE=1 SV=1 | 24 kDa | 0 | 5 | 0 | 1 |
라스-관련 단백질 Ral-A OS=Homo sapiens GN=RALA PE=1 SV=1 | 24 kDa | 0 | 2 | 0 | 0 |
핵 프리-mRNA 도메인-함유 단백질 1B 레귤레이션 OS=Homo sapiens GN=RPRD1B PE=1 SV=1 | 37 kDa | 0 | 2 | 0 | 0 |
레플리케이션 단백질 A 32 kDa 서브유닛 OS=Homo sapiens GN=RPA2 PE=1 SV=1 | 29 kDa | 0 | 3 | 0 | 1 |
레플리케이션 단백질 A 70 kDa DNA-바인딩 서브유닛 OS=Homo sapiens GN=RPA1 PE=1 SV=2 | 68 kDa | 0 | 4 | 0 | 0 |
레티큘로칼빈-1 OS=Homo sapiens GN=RCN1 PE=1 SV=1 | 39 kDa | 0 | 7 | 0 | 0 |
레티노익 산-유도 단백질 3 OS=Homo sapiens OX=9606 GN=GPRC5A PE=1 SV=2 | 40 kDa | 0 | 0 | 0 | 2 |
Rho GTP아제-활성화 단백질 1 OS=Homo sapiens GN=ARHGAP1 PE=1 SV=1 | 50 kDa | 0 | 8 | 0 | 0 |
리보솜 단백질 L19 OS=Homo sapiens GN=RPL19 PE=1 SV=1 | 23 kDa | 0 | 21 | 0 | 0 |
리보솜 바이오제네시스 단백질 BRX1 동족체 OS=Homo sapiens OX=9606 GN=BRIX1 PE=1 SV=2 | 41 kDa | 0 | 5 | 0 | 3 |
리보솜 바이오제네시스 단백질 WDR12 OS=Homo sapiens GN=WDR12 PE=1 SV=2 | 48 kDa | 0 | 3 | 0 | 0 |
리보솜 바이오제네시스 조절 단백질 동족체 OS=Homo sapiens GN=RRS1 PE=1 SV=2 | 41 kDa | 0 | 11 | 0 | 0 |
리보솜 프로덕션 인자 2 동족체 OS=Homo sapiens GN=RPF2 PE=1 SV=2 | 36 kDa | 0 | 3 | 0 | 0 |
RNA-바인딩 단백질 28 OS=Homo sapiens OX=9606 GN=RBM28 PE=1 SV=3 | 86 kDa | 0 | 2 | 0 | 2 |
RNA-바인딩 단백질 3 OS=Homo sapiens GN=RBM3 PE=1 SV=1 | 17 kDa | 0 | 3 | 0 | 0 |
rRNA 2'-O-메틸트랜스퍼라아제 피브릴라린 OS=Homo sapiens GN=FBL PE=1 SV=2 | 34 kDa | 0 | 23 | 0 | 0 |
셀레노단백질 H OS=Homo sapiens GN=C11orf31 PE=1 SV=1 | 13 kDa | 0 | 2 | 0 | 0 |
세마포린-3C OS=Homo sapiens GN=SEMA3C PE=2 SV=2 | 85 kDa | 0 | 3 | 0 | 0 |
세린 프로테아제 23 OS=Homo sapiens OX=9606 GN=PRSS23 PE=1 SV=1 | 43 kDa | 0 | 7 | 7 | 5 |
세린 프로테아제 HTRA3 OS=Homo sapiens OX=9606 GN=HTRA3 PE=1 SV=2 | 49 kDa | 0 | 3 | 3 | 0 |
세린/쓰레오닌-단백질 포스파타제 2A 촉매성 서브유닛 베타 아이소폼 OS=Homo sapiens GN=PPP2CB PE=1 SV=1 | 36 kDa | 0 | 4 | 0 | 0 |
세린/쓰레오닌-단백질 포스파타제 PP1-베타 촉매성 서브유닛 OS=Homo sapiens GN=PPP1CB PE=1 SV=3 | 37 kDa | 0 | 22 | 0 | 0 |
세르핀 B3 OS=Homo sapiens GN=세르핀B3 PE=1 SV=2 | 45 kDa | 0 | 4 | 0 | 0 |
SH3 도메인-바인딩 단백질 1 OS=Homo sapiens GN=SH3BP1 PE=1 SV=3 | 76 kDa | 0 | 2 | 0 | 0 |
시그널 펩티다아제 컴플렉스 서브유닛 1 OS=Homo sapiens GN=SPCS1 PE=1 SV=4 | 12 kDa | 0 | 2 | 0 | 0 |
시그널 펩티다아제 컴플렉스 서브유닛 3 OS=Homo sapiens GN=SPCS3 PE=1 SV=1 | 20 kDa | 0 | 5 | 0 | 0 |
시그널 인식 파티클 14 kDa 단백질 OS=Homo sapiens GN=SRP14 PE=1 SV=2 | 15 kDa | 0 | 9 | 0 | 0 |
시그널-유도 증식-관련 1-유사 단백질 2 OS=Homo sapiens OX=9606 GN=SIPA1L2 PE=1 SV=2 | 190 kDa | 0 | 0 | 0 | 2 |
단일-스트랜디드 DNA-바인딩 단백질, 미토콘드리아 OS=Homo sapiens GN=SSBP1 PE=1 SV=1 | 17 kDa | 0 | 24 | 0 | 0 |
SNW 도메인-함유 단백질 1 OS=Homo sapiens GN=SNW1 PE=1 SV=1 | 61 kDa | 0 | 4 | 0 | 0 |
용질 캐리어 패밀리 2, 촉진된 글루코오즈 트랜스포터 멤버 1 OS=Homo sapiens GN=SLC2A1 PE=1 SV=2 | 54 kDa | 0 | 9 | 0 | 0 |
SPARC (프래그먼트) OS=Homo sapiens GN=SPARC PE=1 SV=1 | 17 kDa | 0 | 2 | 0 | 0 |
스퍼마토제네시스-관련 세린-풍부 단백질 2 OS=Homo sapiens GN=SPATS2 PE=1 SV=1 | 60 kDa | 0 | 2 | 0 | 0 |
스핑고신-1-포스페이트 리아제 1 OS=Homo sapiens GN=SGPL1 PE=1 SV=3 | 64 kDa | 0 | 2 | 0 | 0 |
스플라이싱 인자 3B 서브유닛 2 OS=Homo sapiens GN=SF3B2 PE=1 SV=1 | 98 kDa | 0 | 7 | 0 | 0 |
SRA 줄기-루프-인터랙팅 RNA-바인딩 단백질, 미토콘드리아 OS=Homo sapiens GN=SLIRP PE=1 SV=1 | 14 kDa | 0 | 2 | 0 | 0 |
크로모좀 단백질 3 구조 유지 OS=Homo sapiens GN=SMC3 PE=1 SV=2 | 142 kDa | 0 | 11 | 0 | 0 |
염색질 서브패밀리 A 멤버 5 SWI/SNF-관련 매트릭스-관련 액틴-의존 조절자 OS=Homo sapiens GN=SMARCA5 PE=1 SV=1 | 122 kDa | 0 | 17 | 0 | 0 |
염색질 서브패밀리 E 멤버 1 SWI/SNF-관련 매트릭스-관련 액틴-의존 조절자 OS=Homo sapiens OX=9606 GN=SMARCE1 PE=1 SV=2 | 47 kDa | 0 | 4 | 0 | 0 |
키니노젠-1 전구체 SWISS-PROT:P01044-1 (Bos taurus) 아이소폼 HMW | 69 kDa | 0 | 3 | 0 | 0 |
SWISS-PROT:P02768-1 Tax_Id=9606 Gene_Symbol=ALB 세럼 알부민 전구체 아이소폼 1 | 69 kDa | 0 | 0 | 5 | 13 |
SWISS-PROT:Q3SZR3 (Bos taurus) 알파-1-산 당단백질 전구체 | 23 kDa | 0 | 2 | 0 | 0 |
SWISS-PROT:Q3TTY5 Tax_Id=10090 Gene_Symbol=Krt2 케라틴, 타입 II 세포골격 2 표피 | 71 kDa | 0 | 27 | 7 | 7 |
SWISS-PROT:Q9D312 Tax_Id=10090 Gene_Symbol=Krt20 케라틴, 타입 I 세포골격 20 | 49 kDa | 0 | 6 | 0 | 4 |
SWISS-PROT:Q9QWL7 Tax_Id=10090 Gene_Symbol=Krt17 케라틴, 타입 I 세포골격 17 | 48 kDa | 0 | 54 | 0 | 16 |
시냅토소멀-관련 단백질 23 OS=Homo sapiens GN=SNAP23 PE=1 SV=1 | 23 kDa | 0 | 6 | 0 | 0 |
타우-튜불린 키나아제 2 OS=Homo sapiens OX=9606 GN=TTBK2 PE=1 SV=1 | 182 kDa | 0 | 0 | 0 | 0 |
TBC1 도메인 패밀리 멤버 1 (프래그먼트) OS=Homo sapiens GN=TBC1D1 PE=1 SV=3 | 98 kDa | 0 | 2 | 0 | 0 |
T-컴플렉스 단백질 1 서브유닛 알파 OS=Homo sapiens GN=TCP1 PE=1 SV=1 | 60 kDa | 0 | 98 | 0 | 0 |
갑상선 호르몬 수용체-관련 단백질 3 OS=Homo sapiens GN=THRAP3 PE=1 SV=2 | 109 kDa | 0 | 11 | 0 | 0 |
타이트 정션 단백질 ZO-1 OS=Homo sapiens GN=TJP1 PE=1 SV=1 | 188 kDa | 0 | 3 | 0 | 0 |
타이트 정션 단백질 ZO-2 OS=Homo sapiens GN=TJP2 PE=4 SV=1 | 141 kDa | 0 | 3 | 0 | 0 |
전사 인자 A, 미토콘드리아 OS=Homo sapiens OX=9606 GN=TFAM PE=1 SV=1 | 29 kDa | 0 | 14 | 1 | 1 |
전사 인자 SOX-3 OS=Homo sapiens GN=SOX3 PE=1 SV=2 | 45 kDa | 0 | 2 | 0 | 0 |
트랜스포밍 성장 인자-베타-유도 단백질 ig-h3 OS=Homo sapiens OX=9606 GN=TGFBI PE=1 SV=1 | 75 kDa | 0 | 670 | 73 | 58 |
트랜스로케이터 단백질 OS=Homo sapiens OX=9606 GN=TSPO PE=1 SV=3 | 19 kDa | 0 | 0 | 0 | 3 |
트랜스막 단백질 165 OS=Homo sapiens GN=TMEM165 PE=1 SV=1 | 35 kDa | 0 | 5 | 0 | 1 |
인터-알파 (글로불린) 저해제 H3 아이소폼 2 유사 TREMBL:Q0V8M9;Q9TRI0 (Bos taurus) | 100 kDa | 0 | 7 | 0 | 0 |
TREMBL:Q2KJC7;Q8HZM3 (Bos taurus) 페리오스틴, 오스테오블라스트(osteoblast) 특이적 인자 | 87 kDa | 0 | 1 | 12 | 5 |
안지오텐시노겐 유사 TREMBL:Q3SZH5 (Bos taurus) | 45 kDa | 0 | 11 | 4 | 2 |
TREMBL:Q3T052;Q5EA67 (Bos taurus) 인터-알파 (글로불린) 저해제 H4 | 102 kDa | 0 | 10 | 5 | 1 |
TREMBL:Q6ISB0 케라틴, 헤어, 베이직, 4 - Homo sapiens (Human). | 65 kDa | 0 | 16 | 8 | 8 |
TREMBL:Q6NXH9 Tax_Id=10090 Gene_Symbol=Krt73 케라틴 73 | 59 kDa | 0 | 114 | 7 | 10 |
TRIO 및 F-액틴-바인딩 단백질 OS=Homo sapiens OX=9606 GN=TRIOBP PE=1 SV=3 | 261 kDa | 0 | 2 | 0 | 0 |
트로포모듈린-3 OS=Homo sapiens OX=9606 GN=TMOD3 PE=1 SV=1 | 40 kDa | 0 | 47 | 21 | 13 |
트로포미오신 1 (알파), 아이소폼 CRA_f OS=Homo sapiens GN=TPM1 PE=1 SV=1 | 37 kDa | 0 | 162 | 0 | 0 |
트로포미오신 1 (알파), 아이소폼 CRA_m OS=Homo sapiens GN=TPM1 PE=1 SV=1 | 29 kDa | 0 | 118 | 0 | 0 |
트로포미오신 알파-3 체인 OS=Homo sapiens GN=TPM3 PE=1 SV=1 | 33 kDa | 0 | 112 | 0 | 0 |
튜비-관련 단백질 2 (프래그먼트) OS=Homo sapiens OX=9606 GN=TULP2 PE=4 SV=1 | 24 kDa | 0 | 0 | 0 | 2 |
트윈필린-1 OS=Homo sapiens OX=9606 GN=TWF1 PE=1 SV=3 | 40 kDa | 0 | 1 | 1 | 4 |
티로신-단백질 키나아제 OS=Homo sapiens GN=YES1 PE=1 SV=1 | 61 kDa | 0 | 7 | 0 | 0 |
티로신--tRNA 리가아제 OS=Homo sapiens GN=YARS PE=1 SV=1 | 44 kDa | 0 | 6 | 0 | 0 |
U1 스몰 핵 리보핵단백질 A (프래그먼트) OS=Homo sapiens GN=SNRPA PE=1 SV=1 | 28 kDa | 0 | 7 | 0 | 0 |
U3 스몰 핵 리보핵단백질 단백질 MPP10 OS=Homo sapiens GN=MPHOSPH10 PE=1 SV=2 | 79 kDa | 0 | 6 | 0 | 0 |
U3 스몰 핵 RNA-관련 단백질 14 동족체 A OS=Homo sapiens OX=9606 GN=UTP14A PE=1 SV=1 | 88 kDa | 0 | 2 | 0 | 0 |
U4/U6.U5 트리-snRNP-관련 단백질 1 OS=Homo sapiens GN=SART1 PE=1 SV=1 | 90 kDa | 0 | 4 | 0 | 0 |
UAP56-인터랙팅 인자 OS=Homo sapiens OX=9606 GN=FYTTD1 PE=1 SV=3 | 36 kDa | 0 | 3 | 0 | 0 |
유비퀴틴 카복실-말단하이드로라제 24 OS=Homo sapiens OX=9606 GN=USP24 PE=1 SV=3 | 294 kDa | 0 | 0 | 0 | 2 |
언컨벤셔널 미오신-Id OS=Homo sapiens OX=9606 GN=MYO1D PE=1 SV=2 | 116 kDa | 0 | 0 | 2 | 0 |
언컨벤셔널 미오신-VI OS=Homo sapiens GN=MYO6 PE=1 SV=1 | 145 kDa | 0 | 26 | 0 | 0 |
언컨벤셔널 미오신-XV OS=Homo sapiens OX=9606 GN=MYO15A PE=1 SV=2 | 395 kDa | 0 | 0 | 2 | 0 |
우로키나아제-타입 플라스미노겐 활성자 OS=Homo sapiens GN=PLAU PE=1 SV=1 | 47 kDa | 0 | 8 | 0 | 0 |
UV 엑시시전 리페어 단백질 RAD23 동족체 B OS=Homo sapiens GN=RAD23B PE=1 SV=1 | 43 kDa | 0 | 5 | 0 | 0 |
액포 단백질 분류-관련 단백질 26A OS=Homo sapiens OX=9606 GN=VPS26A PE=1 SV=2 | 38 kDa | 0 | 5 | 0 | 3 |
매우-긴-체인 이노일-CoA 리덕타아제 OS=Homo sapiens GN=TECR PE=1 SV=1 | 36 kDa | 0 | 6 | 0 | 0 |
소낭-트래피킹 단백질 SEC22b OS=Homo sapiens GN=SEC22B PE=1 SV=4 | 25 kDa | 0 | 6 | 0 | 0 |
V-타입 프로톤 ATP아제 서브유닛 B, 브레인(brain) 아이소폼 OS=Homo sapiens GN=ATP6V1B2 PE=1 SV=3 | 57 kDa | 0 | 16 | 0 | 0 |
V-타입 프로톤 ATP아제 서브유닛 d 1 OS=Homo sapiens GN=ATP6V0D1 PE=1 SV=1 | 45 kDa | 0 | 22 | 0 | 0 |
징크 핑거 단백질 469 OS=Homo sapiens OX=9606 GN=ZNF469 PE=2 SV=3 | 410 kDa | 0 | 0 | 0 | 4 |
실시예 3- 양수 세포-유래 ECM 상에서 iPSC의 증식
유도만능줄기세포(iPSC)가 하기 절차를 이용하여 배양에서 실시예 1로부터의 양수 세포-유래 ECM(기질 B) 상에서 증식되었다: 상업적으로 이용 가능하고, 냉동보존된 iPSC를 37℃ 수조를 이용하여 해동시켰다. 세포 현탁액은 줄기세포 증식을 위해 상업적으로 이용 가능한 배지(Miltenyi Biotec MACS iPS Brew)로 희석되었고, 웰 당 2mL의 배지가 포함된 6-웰-플레이트 내에 약 1,000 세포/cm2으로 상기 ECM 상에 시딩되었다. Rock 저해제는 사용되지 않았다. 1일째에 상기 배지의 전체 부피가 배양에서 세포로부터 부드럽게 흡입되고 새 배지로 교체되었다. 매 24시간마다, 전체 배지는 새 배지로 교체되었다. 세포가 일단 융합에 도달하기 시작하면(명시야 현미경에 의해 결정되는 바에 따라), 세포는 멸균 바늘을 이용하여 큰 콜로니를 약 100개의 작은 콜로니로 분절한 후 그것을 멸균 바늘을 이용하여 디쉬로부터 물리적으로 리프트-오프 한 후 상기 ECM이 있는 새 플레이트 상에 배치함으로써 계대 배양되었다. 이러한 절차는 무한히 반복될 수 있다.
양수 세포-유래 ECM 및 골수 세포-유래 ECM에 상의 iPSC 0일차 및 2일차 배양을 보여주는 현미경 사진이 도 4에 도시된다.
양수 세포-유래 ECM 및 골수 세포-유래 ECM의 존재 하에 배양된 iPSC의 iPSC 콜로니 성장 커브의 플롯은 도 5에 도시된다.
도 4 및 도 5에서 볼 수 있는 바와 같이, 골수 세포-유래 ECM의 존재 하에 배양된 iPSC는 성장하지 않는 반면, 양수 세포-유래 ECM의 존재 하에 배양된 iPSC는 증식하였다.
실시예 4- AFC-ECM 상의 성숙 심근세포의 세포 구조의 준비 및 AFC-ECM 상의 미성숙 hiPSC-CM의 성숙
양수로부터 인-비트로 유래된 세포로부터 유래된 세포외 기질(AFC-ECM) 상의 성숙 심근세포의 단일층을 포함하는 세포 구조는 하기 방법을 이용하여 준비되었다.
실시예 1에 개략적으로 개시된 방법론을 이용하여, AFC-ECM이 96-웰 플레이트(실리콘 삽입물이 사용되지 않음) 내에서 준비되었다. 표준적인 세포 배양 기술을 이용하여 Cellular Dynamics International-FUJI로부터 상업적으로 이용 가능한 미성숙 hiPSC-CM(iCell® 심근세포)가 상기 AFC-ECM 상에 플레이팅 되었다. 상기 미성숙 hiPSC-CM은 웰 당 50,000 세포(96 웰 플레이트) 또는 웰 당 200,000 세포(6 웰 플레이트)의 밀도로 플레이트 되고, 상기 AFC-ECM 상에서 성숙 심근 세포의 융합성 단일층을 형성함으로써 상기 AFC-ECM 상의 성숙 심근세포 단일층의 세포 구조를 형성하도록 RPMI 배지 내에서 7일 간 배양되었다.
7일 기간에 걸쳐, 미성숙 hiPSC-CM은 분명한 근절 구조를 가지는 로드 형상 세포로 특징지어지는 성숙 원형 성체 심근세포의 형태학 및 배열로 성숙됨이 관찰되었다. 비교 목적으로, iCell® 미성숙 hiPSC-CM은 96-웰 플레이트 내에서 또한 플레이팅되고(실리콘 삽입물이 사용되지 않음) 표준 Matrigel™ ECM 및 본원에 참조되어 통합되는 미국 특허 8,084,023에 개시된 바에 따른 방법에 의해 준비된 골수 세포-유래 ECM(BM-ECM) 상에서 유사한 방식으로 배양되었다. 상기 연구의 결과는 다양한 ECM 상의 심근세포의 현미경 사진으로 도 6 내지 21에 도시된다.
도 6 내지 14에서 볼 수 있는 바와 같이, AFC-ECM 상의 심근세포는 성숙하고, 원형 성체 심근세포와 유사한 분명한 근절 구조를 가지는 로드 형상 세포이다. AFC-ECM 상에서 성숙된 심근세포의 형태학 및 근절 구조는 도 14의 현미경 사진의 화살표로 확인되는 줄무늬 외형을 가지는 로드 형상 세포의 존재에 의해 분명하게 보여질 수 있다. 상기 도면은 AFC-ECM 상의 섬유 트랙의 존재를 보여주고, 또한 성숙 심근세포의 단일층이 원형 성체 심근세포 및 원형 심장 근육 조직에서 찾을 수 있는 특성과 매우 유사하게 AFC-ECM에 배열된 것을 볼 수 있다. 대조적으로, 도 15 내지 19 및 도 20 및 21에서 보여질 수 있는 바에 따르면, 표준 Matrigel™ ECM 및 BM-ECM 상의 심근 세포는 각각 태아-유사 심근세포와 유사하고 원형 성체 심근세포 또는 원형 심장 근육 조직의 특성을 가지지 않는다.
따라서, 상기 AFC-ECM 상에서 배양된 미성숙 hiPSC-CM은 표준 Matrigel™ ECM 또는 골수 세포로부터의 자연 세포-유래 ECM 상에서 배양된 미성숙 hiPSC-CM 보다 더 높은 상태의 성숙을 달성한다. hiPSC-CM 형태학이 서로 다른 ECM에 의해 다르게 영향을 받은 것은 자명하다.
실시예 5- AFC-ECM 상의 성숙 심근세포의 세포 구조를 이용한 약물의 고 처리량 심장 독성 스크린 테스트
AFC-ECM 상의 성숙 심근세포의 단일층의 세포 구조는 96-웰 플레이트(실리콘 삽임물이 사용되지 않음)를 사용하여 실시예 4에 서술된 바에 따라 준비되었다. 7일 성숙 과정 이후, 다음의 고 처리량 스크린 방법을 이용하여 플레이트 리더를 이용하여 각 웰의 전기 생리학이 관찰되었다. Hanks Balanced Salt Solution의 FluoVolt™ 염료를 각 웰에 로딩했다. 높은 시공간 CCD 카메라(SciMeasure DaVinci 카메라)는 도 22에 개략적으로 도시된 바와 같이 발광 다이오드(LED)와 조합된다. 상기 카메라 및 렌즈의 조합은 활동 전위 및 칼슘 파 전파를 관찰하기에 충분한 해상도로 96-웰 플레이트의 모든 웰을 동시에 시각화할 수 있도록 디자인되었다. 각 플레이트가 카메라 시스템 하에 중앙 배열되었고, 라이팅 스위치가 켜졌으며, 카메라 획득이 시작되었고, 전기 생리학적 활동이 기록되었다. 실험은 약 37 ℃에서 수행되었다. 자발적인 활동을 최소 10초 동안 기록하고 상을 컴퓨터에 저장하였다. 베이스라인 판독이 행해진 후에, 500nM의 약물 E4031(hERG 채널 차단제)가 각 웰에 첨가되었다. 상이 분석되었고, 상 분석 소프트웨어를 사용하여 활동 전위 지속시간, 전도 속도, 박동률 및 활동 패턴이 정량화되었다. 비교 목적으로, 미성숙 hiPSC-CM이 실시예 4에 도시된 바에 따라 96 웰 플레이트(실리콘 삽입물이 사용되지 않음) 내에서 표준 Matrigel™ ECM 및 골수 세포 유래 ECM(BM-ECM) 상에서 배양되었고, 500nM의 약물 E4031(hERG 채널 차단제)가 상기 AFC-ECM 연구와 유사한 방식으로 분석되었다. E4031 테스트의 결과가 도 23 및 도 24에 도시된다. 도 23에서 볼 수 있는 바와 같이, Matrigel™ ECM 및 BM-ECM 상의 심근 세포로부터 기록된 자발적 활동 전위의 기록은 약물 E-4031가 활동 전위 지속 시간(APD) 연장만을 야기한다는 것을 보여준다; 하지만, 상기 AFC-ECM 상의 성숙 심근 세포에 대해서는, 약물 E-4031가 인간에게 발생하는 TdP 사례에서 발생하는 것으로 알려진 것과 일치하는 부정맥 활동 패턴인 APD 연장 플러스 로터(TdP-유사 부정맥)을 야기한다. 따라서, 세 가지 ECM 모두 예측된 APD 연장으로 반응하는 심근세포의 단일층을 형성했지만, 상기 AFC-ECM 만이 TdP의 특성인 빈박성 부정맥으로의 APD 연장의 전환을 보여주는 심근세포의 단일층을 형성했다. 도 24에서 볼 수 있는 바와 같이, 상기 AFC-ECM 상의 심근세포의 100%가 로터(TdP 유사 부정맥)로 약물 E4031에 반응했다.
추가 연구에서, 약물 돔페리돈(domperidone; 3 μM), 디소피라마이드(disopyramide; 100 μM), 아지밀라이드(azimilide; 10 μM), D,1 소타롤(D,1 Sotalol; 100 μM), 이뷰틸라이드(ibutilide; 0.10 μM), 및 베프리딜(Bepridil; 10 μM)이 상기 서술된 플레이트 리더 방법을 이용하여 96-웰 플레이트 내에서 실시예 4(실리콘 삽입물 없음)에서 준비된 바에 따라 AFC-ECM 상에서 성숙 심근세포로 테스트되었다. 상기 테스트의 결과는 도 25에 보여진다. 결과에서 볼 수 있는 바와 같이, 다양한 종류의 부정맥, 예컨대 빈박성 부정맥(tachyarrhythmia; TA), 정지(quiescence; Q), 조기 후탈분극(early afterdepolarization; EAD)이 기록에 표시된 바처럼 다양한 약물에 의해 야기되었다. FDA에 의해 환자에게 TdP 치명적인 부정맥을 야기할 높은 위험이 있다고 분류된 약물에 대한 반응에서, 이들은 관찰된 부정맥 유형의 범위이다.
하기 표 3 및 4에서 보여지는 다양한 약물 또한 상기 서술된 플레이트 리더 방법 및 감지된 어떠한 부정맥에 대한 관찰을 사용하여 96-웰 플레이트에서 실시예 4(실리콘 삽입물이 없음)에서 준비된 바에 따라 AFC-ECM 상의 성숙 심근세포로 테스트되었고, 유효 치료 혈장 농도(effective therapeutic plasma concentration; ETPC)의 10배에서 APD90 연장이 기록되었다. 상기 약물은 CiPA의 검증 및 테스를 위한 CiPA 이니셔티브의 화합물 목록에서 선택되었고, 환자에게서 치명적인 부정맥(TdP)를 야기하는 것에 대한 고위험, 중등도 위험 또는 저위험으로 분류된다. 상기 CiPA 화합물의 전체 목록은 http://cipaproject.org/wp-content/uploads/sites/24/2016/05/CiPA-Compounds.pdf에서 찾을 수 있다.
약물 | 위험 분류 | 도즈 1 (μM) |
도즈 2 (μM) |
도즈 3 (μM) |
도즈 4 (μM) |
부정맥 감지? | ETPC 10배에서 APD90 연장? |
타목시펜(Tamoxifen) | 저위험 | 0.1 | 0.5 | 1.0 | 10.0 | 아니요 | 아니요 |
니페디핀(Nifedipine) | 저위험 | 0.001 | 0.01 | 0.1 | 1.0 | 네, Q | 아니요, 짧아짐 |
니트렌디핀(Nitrendipine) | 저위험 | 0.00951 | 0.03004 | 0.09494 | 0.3 | 아니요 | 아니요, 짧아짐 |
멕실레틴(Mexiletine) | 저위험 | 0.01 | 0.1 | 1.0 | 10.0 | 아니요 | 아니요 |
라놀라진(Ranolazine) | 저위험 | 0.01 | 0.1 | 1.0 | 10.0 | 아니요 | 아니요 |
돔페리돈(Domperidone) | 중등도위험 | 0.003 | 0.03 | 0.3 | 3.0 | 네, TA | 네 |
드로페리돌(Droperidol) | 중등도위험 | 0.03169 | 0.10014 | 0.31646 | 1.0 | 네, EAD | 네 |
클로자핀(Clozapine) | 중등도위험 | 0.09507 | 0.30043 | 0.94937 | 3.0 | 아니요 | 네 |
테르페나딘(Terfenadine) | 중등도위험 | 0.001 | 0.01 | 0.1 | 1.0 | 아니요 | 네 |
디소피라미드(Disopyramide) | 고위험 | 0.100 | 1.00 | 10.00 | 100.00 | 네, EAD, TA | 네 |
퀴니딘(Quinidine) | 고위험 | 0.95 | 3.00 | 9.49 | 30.0 | 네, EAD | 네 |
D,I 소탈롤(D,I Sotalol) | 고위험 | 0.1 | 1.0 | 10.0 | 100.00 | 네, EAD | 네 |
베프리딜(Bepridil) | 고위험 | 0.01 | 0.10 | 1.00 | 10.0 | 네, Q | 네 |
도페틸리드(Dofetilide) | 고위험 | 0.0005 | 0.0010 | 0.0032 | 0.010 | 네, EAD | 네 |
약물 | 위험 분류 | 도즈 1 (μM) |
도즈 2 (μM) | 도즈 3 (μM) | 도즈 4 (μM) | 부정맥 감지? | ETPC 10배에서 APD90 연장? |
딜티아젬(Diltiazem) | 저위험 | 0.01 | 0.10 | 1.0 | 10.0 | 아니요 | 아니요, 짧아짐 |
로라타딘(Loratadine) | 저위험 | 0.00095 | 0.003 | 0.00949 | 0.03 | 아니요 | 아니요 |
메토프롤롤(Metoprolol) | 저위험 | 3.169 | 10.0144 | 31.6456 | 100 | 네, | 아니요 |
베라파밀(Verapamil) | 저위험 | 0.001 | 0.01 | 0.1 | 1 | 아니요 | 아니요, 짧아짐 |
아스테미졸(Astemizole) | 중등도위험 | 0.0001 | 0.001 | 0.01 | 0.1 | 네 | 네 |
클로르프로마지르(Chlorpromazir) | 중등도위험 | 0.09507 | 0.30043 | 0.94937 | 3.0 | NA | NA |
시사프라이드(Cisapride) | 중등도위험 | 0.00317 | 0.01001 | 0.03165 | 0.1 | 네 | 아니요 |
피모자이드(Pimozide) | 중등도위험 | 0.00095 | 0.003 | 0.00949 | 0.03 | 네 | 아니요 |
리스페리돈(Risperidone) | 중등도위험 | 0.00317 | 0.01001 | 0.03165 | 0.1 | 아니요 | |
온단세트론(Ondansetron) | 중등도위험 | 0.03 | 0.30 | 3.0 | 30.0 | 네, EAD | 네 |
아지밀리드(Azimilide) | 고위험 | 0.01 | 0.10 | 1.0 | 10.0 | 네, EAD | 네 |
이부틸리드(Ibutilide) | 고위험 | 0.0001 | 0.0010 | 0.0100 | 0.100 | 네, EAD | 네 |
반데타닙(Vandetanib) | 고위험 | 네, EAD | 네 |
표 3 및 4에서 시험된 약물로부터의 데이터에 대한 추가적인 분석이 도 26 내지 29에 도시된다. 도 26은 각 약물 화합물의 임의의 도즈 당 관측된 부정맥의 총 갯수를 그래픽으로 보여준다. 도 27은 특정 임상 관련 용량인 유효 치료 혈장 농도(effective therapeutic plasma concentration; ETPC)의 10배에서 각 약물의 상대 부정맥 유발을 그래픽으로 보여준다.
도 28은 각 약물에 대한 시간(ms)에 따른 활동 전위 삼각측량(APD90-APD30)을 그래픽으로 보여준다. 삼각측량이란 APD30 부터 APD90 까지 재분극시간으로 정의된다. 활동 전위 삼각측량(APD90-APD30)은 약물의 전부정맥에 대한 예측자로 사용된다. 도 20는 Matrigel™ ECM에 대해 상기 AFC-ECM(SBS-AF 기질) 상의 심근 세포의 심근세포 애새이 성능을 비교하여 일부 약물에 대한 시간(ms)에 따른 활동 전위 삼각측량을 보여준다.
도 30은 상기 나열된 약물의 임의의 농도에서 Cellular Dynamics의 iCell® hiPSC-CM(속이 빈 원) 대 Ncardia의 Cor.4U® hiPSC-CM(어두운 원)의 심근 세포 성능을 비교하여 상기 나열된 약물의 최대 약물-유도 활동 전위 삼각측량을 도시한다. 본 도면은 출판된 문헌 Blinova et al, International Multisite Study of Human-Induced pluripotent stem cell-Derived Cardiomyocytes for Drug Proarrhythmic Potential Assessment, 2018, Cell Reports 24, 3582-3592 으로부터 가져온 것이다. 도 28과 대조적으로, 도 30에 보여진 데이터 셋에서 고위험 및 중등도 위험 화합물 사이에서 계층화(stratification)가 거의 없다. 따라서, 본 개시의 AFC-ECM은 다른 천연 세포-유래 ECM 또는 Matrigel™ ECM 보다 더 현실적인 기능 및 약물 반응성을 가진 더 성숙한 심근세포의 생산을 제공한다.
실시예 6- AFC-ECM 상의 성숙 심근세포의 세포 구조의 관찰
AFC-ECM 상의 성숙 심근 세포의 세포 구조는 하기 참조되는 수정 사항과 함께 상기 실시예 4에서 서술된 바의 절차를 따라 준비되었다:
AFC-ECM은 레이저 스캐닝 공초점(confocal) 현미경(Nikon A1R)을 사용하여 세포의 면역역색 및 이미징을 가능하게 하기 위해 Thermanox 커버클립(coverslip) 상에 장착되었다.
Matrigel™ ECM 은 비교를 위하여 Thermanox 커버클립의 별도 서브세트(subset)에 적용되었다.
Cellular Dynamics International-FUJI 으로부터의 세포(iCell® 심근세포)는 6 웰 플레이트 내 웰 당 200,000 세포의 밀도로 각 ECM으로 코팅된 이러한 Thermanox 커버 클립 상의 단일층으로 플레이트된다.
세포 배양 배지에서의 7일 간의 인큐베이션(incubation) 후, 세포를 3% 파라포름알데히드(paraformaldehyde) 내에 고정하고, hiPSC-CM 내에서 세포 발현 및 국소화(localization)을 결정하기 위해 상업적으로 이용 가능한 1차 항체(primary antibody)의 적용으로 면역세포화학(immunocytochemistry)을 위한 처리를 하였다. 중요한 심장 미오필라멘트 단백질을 위한 하기 1차 항체가 사용되었다: 트로포닌 I(Troponin I), α-액티닌(α-actinin), 카디악 트로포닌 T(cardiac troponin T; cTnT), 카디악 트로포닌 I(cardiac troponin I; cTnI) 및 N-카데린(N-cadherin). 상업적으로 이용 가능한 형광 표지된 2차 항체를 감지에 사용하였다.
DAPI (4',6-디아미디노-2-페닐린돌)(DAPI (4',6-diamidino-2-phenylindole)) 형광 염색이 핵을 표지하기 위해 사용되었다.
세포 표지 및 시각화를 위한 모든 절차는 본원에 참조되어 통합되는 하기 참조문헌에 의해 기술된다. Herron, T.J. et al. Extracellular Matrix-Mediated Maturation of Human Pluripotent stem cell-Derived Cardiac Monolayer Structure and Electrophysiological Function. Circulation: Arrhythmia and Electrophysiology 9 (2016). da Rocha, M. A. et al. Deficient cMyBP-C protein expression during cardiomyocyte differentiation underlies human hypertrophic cardiomyopathy cellular phenotypes in disease specific human ES cell derived cardiomyocytes. J. Mol. Cell. Cardiol. 99, 197-206 (2016). da Rocha, A.M. et al. hiPSC-CM Monolayer Maturation State Determines Drug Responsiveness in High Throughput Pro-Arrhythmia Screen. Sci. Rep. 7, 13834 (2017).
NIS Elements Software에서 분석된 형광 이미지를 사용하여 세포 모양이 정량화되었다. 세포 면적과 둘레를 이용하여, 정립된 수학적 공식을 사용하여 세포의 원형도를 정량화하였다; 원형도 인덱스 = 4π*Area/Perimeter2.
일부 사례에서, 미토콘드리아는 MitoTracker™ Red CMXRos(Thermo Fisher)를 사용하여 염색되었다.
결과: 상기 실시예 4에서 보여지는 결과와 일치하게, 형광 표지 및 이미징을 이용한 데이터는 상기 AFC-ECM이 hiPSC-CM의 빠른 성숙(7 일) 촉진한다는 것을 보여주며, AFC-ECM 상에서 배양된 동일한 hiPSC-CM(동종성 코퍼레이터(isogenic coparator))의 배치(batch)는 로드 형상을 가지고 단단하게 조밀화되고 조직화된 근절 및 미오필라멘트를 가지는데 반해, Matrigel™ ECM 상에서 배양된 hiPSC-CM는 원형 형상을 가지고 근절 구조의 해체를 가진다는 것을 보여준다.
도 31에 도시된 현미경 사진은 핵을 표지하기 위해 DAPI를 사용하여 트로포닌 I의 면역 형광 염색에서 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM을 보여준다. 도 32에 도시된 현미경 사진은 핵을 표지하기 위해 DAPI를 사용하여 α-액티닌의 면역 형광 염색에서 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM을 보여준다. 도 33에 도시된 현미경 사진은 핵을 표지하기 위해 DAPI를 사용하여 cTnT 및 N Cadherin의 면역 형광 염색에서 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM을 보여준다. 도 31 내지 33에서 보여질 수 있는 바와 같이, AFC-ECM 상에서 배양된 동일한 hiPSC-CM(동종성 코퍼레이터)의 배치는 로드 형상을 가지고 단단하게 조밀화되고 조직화된 근절 및 미오필라멘트를 가지는데 반해, Matrigel™ ECM 상에서 배양된 hiPSC-CM는 원형 형상을 가지고 근절 구조의 해체를 가진다는 것을 보여준다. 세포의 일부 예시는 원형 형상 세포 또는 로드 형상 세포로 화살표로 식별되고, 근절의 일부 예시는 도 31 내지 33의 화살표로 식별된다. 도 34의 현미경 사진은 핵을 표지하기 위해 DAPI를 사용하여 cTnT의 면역 형광 염색에서 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 단일 hiPSC-CM을 보여주고, AFC-ECM 상에서 배양된 세포는 로드 형상인 것에 반하여 Matrigel™ ECM 상에서 배양된 세포는 원형인 것을 보여준다. 도 35의 현미경 사진은 핵을 표지하기 위해 DAPI를 사용하여 α-액티닌의 면역 형광 염색에서 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 단일 hiPSC-CM을 보여주고, AFC-ECM 상에서 배양된 세포는 로드 형상인 것에 반하여 Matrigel™ ECM 상에서 배양된 세포는 원형인 것을 보여준다. 도 36의 그래프는 도 35에 도시된 단일 세포의 세포 원형도의 비교를 보여주며, 상기 Matrigel™ ECM 상에서 배양된 세포가 더 높은 원형도 인데스를 가짐을 보여주고, 이는 더 둥글다는 것을 나타낸다.
도 37의 gsualrud 사진은 핵을 표지하기 위해 DAPI를 사용하여 cTnI 발현의 면역 형광 염색에서 Matrigel™ ECM 대 AFC-ECM 상에서 배양된 hiPSC-CM를 보여준다. 도 38은 cTnI 발현 및 GAPDH(글리세르알데히드 3-포스페이트 디하이드로게나아제(glyceraldehyde 3-phosphate dehydrogenase))에 대한 Matrigel™ ECM 및 AFC-ECM 상의 hiPSC-CM의 웨스턴 블로팅을 보여준다. 도 38의 웨스턴 블로팅의 분석이 도 39의 그래프에 보여지며, Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM에서 GAPDH에 대한 cTnI 발현을 보여준다. 상기 분석은 hiPSC-CM에서의 cTnI 발현/GAPDH 비율이 Matrigel™ ECM 상의 hiPSC-CM 보다 AFC-ECM 상의 hiPSC-CM에서 높다는 것을 보여주고, 이는 atrigel™ ECM 상의 hiPSC-CM 보다 AFC-ECM 상의 hiPSC-CM에서의 더 강한 cTnI 발현을 나타낸다.
도 40의 현미경 사진은 MitoTracker Red을 이용한 미토콘드리아를 염색한 Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM을 보여주며, AFC-ECM 상의 세포는 더 많은 미토콘드리아와 더 분극된 내막을 가지는 미토콘드리아를 가짐을 보여주며, 이는 더 강한 빨간 신호로 증명된다. 도 41의 그래프는 Matrigel™ ECM 대 AFC-ECM 상의 hiPSC-CM에서 MitoTraker™ Red 형광 강도/심근세포를 보여주고, AFC-ECM 상의 hiPSC-CM가 더 높은 MitoTraker™ Red 형광 강도를 가짐을 보여주며, 이는 이들 세포가 Matrigel™ ECM 상의 hiPSC-CM 보다 더 많은 미토콘드리아를 가지고 더 분극화된 내막을 가지는 미토콘드리아를 가진다는 것을 나타낸다.
도 42의 현미경 사진(투과광)은 마이크로전극 어래이(microelectrode array; MEA) 플레이트 상에 코팅된 Matrigel™ ECM 및 AFC-ECM 상에서 배양된 hiPSC-CM를 보여준다. 도 42에 보여질 수 있는 바와 같이, Matrigel™ ECM 상에서 배양된 hiPSC-CM은 원형 형상이고, AFC-ECM 상에서 배양된 hiPSC-CM은 로드 형상이다.
Claims (20)
- 인간 유도만능줄기세포(induced pluripotent stem cell)로부터 유래된 미성숙 심근세포(cardiomyocyte)를 성숙시키는 방법으로서, 상기 방법은
(a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)을 제공하는 것;
(b) 양수(amniotic fluid)로부터 분리된 세포로부터 인 비트로(in vitro) 유래된 세포외 기질(AFC-ECM)을 제공하는 것;
(c) 상기 미성숙 hiPSC-CM을 상기 AFC-ECM와 접촉하는 것; 및
(d) 상기 미성숙 hiPSC-CM의 성숙을 유도하도록 상기 미성숙 hiPSC-CM를 상기 AFC-ECM와 배양 배지(culture media)에서 배양함으로써 성숙 심근세포를 형성하는 것;을 포함하고,
상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절(sarcomere) 구조를 가지는 로드(rod) 형상 세포인 것을 특징으로 하는,
방법. - 제1항에 있어서,
상기 미성숙 hiPSC-CM는 상기 AFC-ECM 상에 플레이트 된(plated),
방법. - 제1항 또는 제2항에 있어서,
상기 성숙 심근세포는 상기 AFC-ECM 상에 단일층으로 형성됨으로써, 상기 AFC-ECM 상에 성숙 심근세포의 단일층을 포함하는 세포 구조를 형성하고,
상기 성숙 심근세포는 상기 AFC-ECM 상에 배열된,
방법. - 제1항 내지 제3항 중 어느 한 항에 있어서,
상기 미성숙 hiPSC-CM는 내향-정류기 포타슘 채널(inward-rectifier potassium channel) Kir2.1을 발현하지 않는,
방법. - 양수로부터 인 비트로 분리된 세포로부터 유래된 세포외 기질(AFC-ECM) 상의 성숙 심근세포의 단일층을 포함하는 세포 구조로서,
상기 성숙 심근세포는 인간 유도만능줄기세포으로부터 유래된 AFC-ECM 배양 심근세포(hiPSC-CM)이고,
상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 하는,
세포 구조. - 제5항에 있어서,
상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된,
세포 구조. - 제5항 또는 제6항에 있어서,
섬유 트랙(track)이 상기 구조 상에 존재하는,
세포 구조. - 제5항 내지 제7항 중 어느 한 항에 있어서,
상기 AFC-ECM은 라미닌(laminin), 콜라겐 알파-1(collagen alpha-1) (ⅩⅤⅢ), 베이스먼트 막-특이적 헤파린 설페이트 프로테오글리칸 코어 단백질(basement membrane-specific heparan sulfate proteoglycan core protein), 아그린(agrin), 비멘틴(vimentin), 콜라겐 알파-2(collagen alpha-2) (Ⅳ) 및/또는 이들의 아이소폼(isoform)을 포함하는,
세포 구조. - 제8항에 있어서,
상기 콜라겐 알파-1 (ⅩⅤⅢ)의 아이소폼은 아이소폼 2 이고/거나 상기 아그린의 아이소폼은 아이소폼 6 인,
세포 구조. - 제8항 또는 제9항에 있어서,
상기 AFC-ECM은 피브로넥틴(fibronectin) 및/또는 그것의 아이소폼을 더 포함하는,
세포 구조. - 제5항 내지 제10항 중 어느 한 항에 있어서,
상기 AFC-ECM은 데코린(decorin), 퍼레칸(perlecan) 및/또는 콜라겐 (Ⅲ)을 포함하지 않는,
세포 구조. - 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM) 상에 성숙 심근세포의 세포 구조를 형성하는 방법으로서, 상기 방법은,
(a) 인간 유도만능줄기세포로부터 유래된 미성숙 심근세포(미성숙 hiPSC-CM)를 제공하는 것;
(b) 양수로부터 분리된 세포로부터 인 비트로 유래된 세포외 기질(AFC-ECM)을 제공하는 것;
(c) 상기 AFC-ECM 상에 상기 미성숙 hiPSC-CM을 플레이팅(plating)하는 것;
(d) 성숙 심근세포 내에 상기 미성숙 hiPSC-CM의 성숙을 유도하고 상기 AFC-ECM 상에 상기 성숙 심근세포의 단일층을 형성하도록 배양 배지 내의 상기 AFC-ECM 상에 상기 플레이트 된 미성숙 hiPSC-CM를 배양함으로써 상기 세포 구조를 형성하는 것; 을 포함하고,
상기 성숙 심근세포는 성체 인간 심장 조직과 유사한 분명한 근절 구조를 가지는 로드 형상 세포인 것을 특징으로 하는,
방법. - 제12항에 있어서,
상기 성숙 심근세포의 단일층은 상기 AFC-ECM 상에 배열된,
방법. - 제12항 또는 제13항에 있어서,
섬유 트랙이 상기 세포 구조 상에 존재하는,
방법. - 약물 화합물의 심장 독성(cardiotoxicity) 및/또는 전부정맥 효과(proarrhythmic effect)를 인 비트로 결정하는 방법으로서, 상기 방법은,
제5항 내지 제11항의 세포 구조 중 어느 하나의 성숙 심근세포에 상기 약물 화합물을 접촉하는 것; 및
상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과가 있는지 확인하기 위하여 상기 성숙 심근세포의 전기 생리학적 변화를 관찰하는 것; 을 포함하는,
방법. - 제15항에 있어서,
상기 성숙 심근세포의 상기 전기 생리학적 변화는 활동 전위 지속시간(action potential duration; APD)의 연장이고,
APD의 연장은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인하는,
방법. - 제15항에 있어서,
상기 성숙 심근세포의 상기 전기 생리학적 변화는 조기 후탈분극(early after depolarization; EAD)이고,
상기 조기 후탈분극(EAD)은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인하는,
방법. - 제15항에 있어서,
상기 성숙 심근세포의 상기 전기 생리학적 변화는 지연 후탈분극(delayed after depolarization; DAD)이고,
상기 지연 후탈분극(DAD)은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인하는,
방법. - 제15항에 있어서,
상기 성숙 심근세포의 상기 전기 생리학적 변화는 활동 전위 지속시간(action potential duration; APD) 플러스 로터(plus rotor)이고,
APD 플러스 로터의 연장은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인하는,
방법. - 제15항에 있어서,
상기 성숙 심근세포의 상기 전기 생리학적 변화는 부정맥(arrhythmia)이고,
상기 부정맥은 상기 약물 화합물이 상기 성숙 심근세포에 심장 독성 및/또는 전부정맥 효과를 가짐을 확인하는,
방법.
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201962808690P | 2019-02-21 | 2019-02-21 | |
US62/808,690 | 2019-02-21 | ||
PCT/US2020/019311 WO2020172589A1 (en) | 2019-02-21 | 2020-02-21 | Methods for the maturation of cardiomyocytes on amniotic fluid cell-derived ecm, cellular constructs, and uses for cardiotoxicity and proarrhythmic screening of drug compounds |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20210132110A true KR20210132110A (ko) | 2021-11-03 |
KR102639023B1 KR102639023B1 (ko) | 2024-02-20 |
Family
ID=69846590
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020217030159A KR102639023B1 (ko) | 2019-02-21 | 2020-02-21 | 양수 세포-유래 ecm 상에서 심근세포 성숙을 위한 방법, 세포 구조, 및 약물 화합물의 심장 독성 및 전부정맥 스크리닝을 위한 용도 |
Country Status (7)
Country | Link |
---|---|
US (2) | US11220671B2 (ko) |
EP (1) | EP3927814A1 (ko) |
JP (2) | JP7250154B2 (ko) |
KR (1) | KR102639023B1 (ko) |
CN (1) | CN113728092A (ko) |
CA (1) | CA3130860A1 (ko) |
WO (1) | WO2020172589A1 (ko) |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP3861103A1 (en) * | 2018-10-03 | 2021-08-11 | Stembiosys, Inc. | Amniotic fluid cell-derived extracellular matrix and uses thereof |
Citations (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US20150329825A1 (en) * | 2014-05-13 | 2015-11-19 | The Regents Of The University Of Michigan | Compositions and methods employing stem cell-derived cardiomyocytes |
WO2017136786A1 (en) * | 2016-02-05 | 2017-08-10 | The Trustees Of Columbia University In The City Of New York | Rigionally specific tissua-derived extracellular metrix |
US20190242879A1 (en) * | 2018-02-02 | 2019-08-08 | Simula Innovation | Methods for determining drug effects |
Family Cites Families (39)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5563067A (en) | 1994-06-13 | 1996-10-08 | Matsushita Electric Industrial Co., Ltd. | Cell potential measurement apparatus having a plurality of microelectrodes |
TWM243483U (en) | 1996-01-24 | 2004-09-11 | Matsushita Electric Ind Co Ltd | A test instrument for electric physiological properties of organism, cell, and the section from live organ |
WO2000034434A1 (en) | 1998-12-07 | 2000-06-15 | Acacia Biosciences, Inc. | Multi-channel electrode arrays |
US7312043B2 (en) | 2000-07-10 | 2007-12-25 | Vertex Pharmaceuticals (San Diego) Llc | Ion channel assay methods |
CA2437957C (en) | 2001-02-14 | 2014-04-22 | Robert J. Hariri | Renovation and repopulation of decellularized tissues and cadaveric organs by stem cells |
US8206903B2 (en) | 2002-12-20 | 2012-06-26 | Acea Biosciences | Device and method for electroporation-based delivery of molecules into cells and dynamic monitoring of cell responses |
DE60329187D1 (de) | 2002-07-20 | 2009-10-22 | Acea Biosciences Inc | Impedanz basierende vorrichtungen und verfahren zur analyse von zellen und partikeln |
US7470533B2 (en) | 2002-12-20 | 2008-12-30 | Acea Biosciences | Impedance based devices and methods for use in assays |
US8263375B2 (en) | 2002-12-20 | 2012-09-11 | Acea Biosciences | Dynamic monitoring of activation of G-protein coupled receptor (GPCR) and receptor tyrosine kinase (RTK) in living cells using real-time microelectronic cell sensing technology |
US10551371B2 (en) | 2003-11-10 | 2020-02-04 | Acea Biosciences, Inc. | System and method for monitoring cardiomyocyte beating, viability and morphology and for screening for pharmacological agents which may induce cardiotoxicity or modulate cardiomyocyte function |
US7501301B2 (en) | 2004-03-10 | 2009-03-10 | The Board Of Trustees Of The Leland Stanford Junior University | Low cost fabrication of microelectrode arrays for cell-based biosensors and drug discovery methods |
US20060153894A1 (en) | 2004-06-30 | 2006-07-13 | Ragae Ghabrial | Multi-compartment delivery system |
EP2267114B1 (en) | 2005-10-28 | 2014-03-12 | Universität Zürich | Tissue engineering using pure populations of isolated non-embryoblastic fetal cells |
US8084023B2 (en) | 2007-01-22 | 2011-12-27 | The Board Of Trustees Of The University Of Arkansas | Maintenance and propagation of mesenchymal stem cells |
WO2009035612A2 (en) | 2007-09-11 | 2009-03-19 | The University Of Miami | Multilineage-inducible cells and uses thereof |
WO2009052132A1 (en) | 2007-10-15 | 2009-04-23 | Children's Medical Center Corporation | Human amniotic fluid derived mesenchymal stem cells |
EP2291645B1 (en) | 2008-05-05 | 2015-09-09 | Acea Biosciences, Inc. | Label-free monitoring of excitation-contraction coupling and excitable cells using impedance based systems with millisecond time resolution |
US9290756B2 (en) | 2008-11-10 | 2016-03-22 | The Board Of Trustees Of The University Of Illinois | Apparatus and methods for high throughput network electrophysiology and cellular analysis |
SG174991A1 (en) | 2009-03-31 | 2011-11-28 | Univ Texas | Isolation of human umbilical cord blood-derived mesenchymal stem cells |
WO2011088365A1 (en) | 2010-01-14 | 2011-07-21 | Organogenesis, Inc. | Bioengineered tissue constructs and methods for producing and using thereof |
WO2011146531A1 (en) | 2010-05-18 | 2011-11-24 | Acea Biosciences, Inc | Data analysis of impedance-based cardiomyocyte-beating signals as detected on real-time cell analysis (rtca) cardio instruments |
EP2614145B1 (en) | 2010-09-07 | 2020-12-02 | The Board of Regents of The University of Texas System | Tissue-specific differentiation matrices and uses thereof |
EP2833930B1 (en) | 2012-04-04 | 2018-05-30 | University of Washington through its Center for Commercialization | Systems and method for engineering muscle tissue |
MX2015002711A (es) | 2012-09-04 | 2015-06-05 | Anthrogenesis Corp | Metodos de generacion de tejidos. |
DK3047019T3 (da) | 2013-09-20 | 2019-08-26 | Georg August Univ Goettingen Stiftung Oeffentlichen Rechts Univsmedizin | Fremgangsmåde til at lede differentiering af pluripotente stamceller til funktionel hjertemuskel |
US9587221B2 (en) | 2013-11-11 | 2017-03-07 | Auburn University | Encapsulation and cardiac differentiation of hiPSCs in 3D PEG-fibrinogen hydrogels |
US20170182216A1 (en) | 2014-05-14 | 2017-06-29 | NuTech Spine, Inc. | Wound care treatment and methods of making and using same |
WO2016025646A1 (en) | 2014-08-12 | 2016-02-18 | Axion Biosystems, Inc. | Cell-based biosensor array and associated methods for manufacturing the same |
WO2016070057A1 (en) | 2014-10-30 | 2016-05-06 | Stembiosys, Inc. | Methods for maintaining and expanding mesenchymal stem cells on extracellular matrix coated microcarriers |
US9694104B2 (en) | 2014-12-08 | 2017-07-04 | Cormatrix Cardiovascular, Inc. | Vascular casted prostheses and methods of forming same for treating biological tissue |
CN107636149A (zh) | 2015-04-03 | 2018-01-26 | 普罗帕格尼克斯公司 | 上皮细胞的离体增殖 |
US20180044640A1 (en) | 2015-05-15 | 2018-02-15 | Agency For Science, Technology And Research | Contractile cellular construct for cell culture |
US11802272B2 (en) | 2015-11-04 | 2023-10-31 | The Board Of Regents Of The University Of Texas System | Enrich and amplify highly potent human mesenchymal stem cells from elderly cell populations |
JP2019510823A (ja) | 2016-03-30 | 2019-04-18 | ステムバイオシス インコーポレイテッド | 骨髄間質細胞由来細胞外マトリクスタンパク質抽出物およびその使用 |
WO2018029535A1 (en) | 2016-08-11 | 2018-02-15 | Novoheart Limited | Systems and methods for modeling disease and assessing adverse side effects of therapeutics therefor |
JP7262385B2 (ja) | 2016-08-26 | 2023-04-21 | ザ・カウンシル・オブ・ザ・クィーンズランド・インスティテュート・オブ・メディカル・リサーチ | 心筋細胞の成熟 |
US20190017028A1 (en) | 2017-07-12 | 2019-01-17 | The Regents Of The University Of Michigan | Systems and methods for cardiomyocyte pacing |
WO2019126315A1 (en) | 2017-12-19 | 2019-06-27 | The Regents Of The University Of Michigan | Cardiac microtissue and uses thereof |
EP3861103A1 (en) * | 2018-10-03 | 2021-08-11 | Stembiosys, Inc. | Amniotic fluid cell-derived extracellular matrix and uses thereof |
-
2020
- 2020-02-21 US US16/797,945 patent/US11220671B2/en active Active
- 2020-02-21 CN CN202080030383.0A patent/CN113728092A/zh active Pending
- 2020-02-21 JP JP2021548693A patent/JP7250154B2/ja active Active
- 2020-02-21 CA CA3130860A patent/CA3130860A1/en active Pending
- 2020-02-21 EP EP20712770.5A patent/EP3927814A1/en active Pending
- 2020-02-21 KR KR1020217030159A patent/KR102639023B1/ko active IP Right Grant
- 2020-02-21 WO PCT/US2020/019311 patent/WO2020172589A1/en unknown
-
2021
- 2021-11-19 US US17/531,402 patent/US20220119770A1/en active Pending
-
2023
- 2023-03-20 JP JP2023044022A patent/JP2023076502A/ja active Pending
Patent Citations (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US20150329825A1 (en) * | 2014-05-13 | 2015-11-19 | The Regents Of The University Of Michigan | Compositions and methods employing stem cell-derived cardiomyocytes |
WO2017136786A1 (en) * | 2016-02-05 | 2017-08-10 | The Trustees Of Columbia University In The City Of New York | Rigionally specific tissua-derived extracellular metrix |
US20190242879A1 (en) * | 2018-02-02 | 2019-08-08 | Simula Innovation | Methods for determining drug effects |
Non-Patent Citations (2)
Title |
---|
A Method for the Generation of single Contracting Human-Induced Pluripotent stem cell-Derived Cardiomyocytes, Circ. Res., 2015, Vol.117, No.12, pp.995-1000 * |
Extracellular Matrix-Mediated Maturation of Human Pluripotent Stem Cell-Derived Cardiac Monolayer Structure and Electrophysiological Function, Circ. Arrhythm. Electrophysiol., 2016, Vol.9, No.4 * |
Also Published As
Publication number | Publication date |
---|---|
CN113728092A (zh) | 2021-11-30 |
KR102639023B1 (ko) | 2024-02-20 |
JP7250154B2 (ja) | 2023-03-31 |
US20220119770A1 (en) | 2022-04-21 |
EP3927814A1 (en) | 2021-12-29 |
CA3130860A1 (en) | 2020-08-27 |
US11220671B2 (en) | 2022-01-11 |
JP2022521238A (ja) | 2022-04-06 |
WO2020172589A1 (en) | 2020-08-27 |
JP2023076502A (ja) | 2023-06-01 |
US20200270577A1 (en) | 2020-08-27 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
Sun et al. | The mechanosensitive Piezo1 channel is required for bone formation | |
KR102634265B1 (ko) | 심근세포 성숙 | |
Cossu et al. | Cell heterogeneity in the myogenic lineage | |
Capkovic et al. | Neural cell adhesion molecule (NCAM) marks adult myogenic cells committed to differentiation | |
Elder et al. | Effect of compressive loading on chondrocyte differentiation in agarose cultures of chick limb‐bud cells | |
Lozoya et al. | Regulation of hepatic stem/progenitor phenotype by microenvironment stiffness in hydrogel models of the human liver stem cell niche | |
US20220106567A1 (en) | Amniotic fluid cell-derived extracellular matrix and uses thereof | |
US11896480B2 (en) | Bioengineered vocal fold mucosa for functional voice restoration | |
US20220119770A1 (en) | Methods for the maturation of cardiomyocytes on amniotic fluid cell-derived ecm, cellular constructs, and uses for cardiotoxicity and proarrhythmic screening of drug compounds | |
Kowalski et al. | Sympathetic neurons regulate cardiomyocyte maturation in culture | |
CN116042519A (zh) | 一种修复型中性粒细胞的分类、诱导活化方法及其用途 | |
Barth et al. | Cordial connections: molecular ensembles and structures of adhering junctions connecting interstitial cells of cardiac valves in situ and in cell culture | |
US9267956B2 (en) | Stimulated cell standards | |
Liu et al. | Hyaluronan substratum holds mesenchymal stem cells in slow-cycling mode by prolonging G1 phase | |
Miretti et al. | Bovine Skeletal Muscle Satellite Cells: Isolation, Growth, and Differentiation | |
JP7136434B2 (ja) | 三次元培養表皮モデルを用いた皮膚一次刺激性の評価方法及び評価キット | |
Kawai et al. | Relationships between myonuclear domain size and fibre properties in the muscles of Thoroughbred horses | |
JP6572198B2 (ja) | 皮膚弾性改善剤の評価又は選択方法 | |
Hoes | Studying cardiac diseases using human stem cell-derived cardiomyocytes | |
Ye et al. | Proliferation of cardiomyocytes in young infants, future implication in human heart regeneration | |
Bhavsar | Newt lens regeneration: Role of oct-4 in newt regenerating tissue and proteome analysis of regeneration competent vs. regeneration incompetent cells | |
Vuorenpää | Development of human cell based in vitro vascular and cardiovascular models | |
Majkut | Mechanical development and functional mechanosensitivity during early cardiogenesis | |
Olkowska et al. | Skeletal Muscle Stem Cells as a tool in muscle regenera on | |
Weber et al. | Jeanne de la Roche, 2 Kristin Schwanke, 3 Birgit Piep, Neele Peschel, Uwe Krumm, Alexander Lingk, Meike Wendland, Stephan Greten, Jan Dieter Schmitto, 3 Issam Ismail, 3 Gregor Warnecke, 3 Urs Zywietz, 4 Boris Chichkov, 4 Joachim Meißner, Axel Haverich, 3 Ulrich Martin, 3 Bernhard Brenner, Robert Zweigerdt, 3 and Theresia Kraft |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
E902 | Notification of reason for refusal | ||
E701 | Decision to grant or registration of patent right | ||
GRNT | Written decision to grant |