KR20210087127A - The one-way-ring/two-way-ring network quantum key distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key - Google Patents
The one-way-ring/two-way-ring network quantum key distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key Download PDFInfo
- Publication number
- KR20210087127A KR20210087127A KR1020200000001A KR20200000001A KR20210087127A KR 20210087127 A KR20210087127 A KR 20210087127A KR 1020200000001 A KR1020200000001 A KR 1020200000001A KR 20200000001 A KR20200000001 A KR 20200000001A KR 20210087127 A KR20210087127 A KR 20210087127A
- Authority
- KR
- South Korea
- Prior art keywords
- quantum
- alice
- bob
- server
- eve
- Prior art date
Links
- 238000004891 communication Methods 0.000 title claims abstract description 613
- 238000009826 distribution Methods 0.000 title claims abstract description 73
- 238000000034 method Methods 0.000 claims abstract description 93
- 230000000694 effects Effects 0.000 claims abstract description 6
- VLCQZHSMCYCDJL-UHFFFAOYSA-N tribenuron methyl Chemical compound COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)N(C)C1=NC(C)=NC(OC)=N1 VLCQZHSMCYCDJL-UHFFFAOYSA-N 0.000 claims description 4053
- 230000009977 dual effect Effects 0.000 claims description 201
- 230000006870 function Effects 0.000 claims description 102
- 230000005540 biological transmission Effects 0.000 claims description 88
- 230000002093 peripheral effect Effects 0.000 claims description 88
- 238000012545 processing Methods 0.000 claims description 76
- 238000003860 storage Methods 0.000 claims description 69
- 238000010191 image analysis Methods 0.000 claims description 58
- 239000000284 extract Substances 0.000 claims description 54
- 230000003287 optical effect Effects 0.000 claims description 51
- QVFWZNCVPCJQOP-UHFFFAOYSA-N chloralodol Chemical compound CC(O)(C)CC(C)OC(O)C(Cl)(Cl)Cl QVFWZNCVPCJQOP-UHFFFAOYSA-N 0.000 claims description 37
- 230000002265 prevention Effects 0.000 claims description 28
- 238000005259 measurement Methods 0.000 claims description 18
- 238000001514 detection method Methods 0.000 claims description 14
- 238000012360 testing method Methods 0.000 claims description 14
- 239000002245 particle Substances 0.000 claims description 13
- 230000004044 response Effects 0.000 claims description 13
- 230000001427 coherent effect Effects 0.000 claims description 12
- 230000001172 regenerating effect Effects 0.000 claims description 12
- 238000000926 separation method Methods 0.000 claims description 12
- 239000006117 anti-reflective coating Substances 0.000 claims description 10
- 239000011248 coating agent Substances 0.000 claims description 10
- 238000000576 coating method Methods 0.000 claims description 10
- 238000007689 inspection Methods 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 230000014509 gene expression Effects 0.000 claims description 7
- 238000012546 transfer Methods 0.000 claims description 6
- 230000009471 action Effects 0.000 claims description 4
- 238000012423 maintenance Methods 0.000 claims description 3
- 230000002285 radioactive effect Effects 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims 3
- 239000000969 carrier Substances 0.000 claims 1
- 238000005516 engineering process Methods 0.000 description 39
- 230000008569 process Effects 0.000 description 22
- 238000004519 manufacturing process Methods 0.000 description 15
- 239000004065 semiconductor Substances 0.000 description 10
- 239000000306 component Substances 0.000 description 7
- 238000010276 construction Methods 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 238000013461 design Methods 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- 230000008859 change Effects 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000012806 monitoring device Methods 0.000 description 3
- 230000008901 benefit Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 239000008358 core component Substances 0.000 description 2
- 238000010200 validation analysis Methods 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 238000007726 management method Methods 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 238000010248 power generation Methods 0.000 description 1
- 230000005610 quantum mechanics Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 238000012795 verification Methods 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
Images
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/08—Key distribution or management, e.g. generation, sharing or updating, of cryptographic keys or passwords
- H04L9/0816—Key establishment, i.e. cryptographic processes or cryptographic protocols whereby a shared secret becomes available to two or more parties, for subsequent use
- H04L9/0852—Quantum cryptography
- H04L9/0855—Quantum cryptography involving additional nodes, e.g. quantum relays, repeaters, intermediate nodes or remote nodes
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/08—Key distribution or management, e.g. generation, sharing or updating, of cryptographic keys or passwords
- H04L9/0816—Key establishment, i.e. cryptographic processes or cryptographic protocols whereby a shared secret becomes available to two or more parties, for subsequent use
- H04L9/0852—Quantum cryptography
- H04L9/0858—Details about key distillation or coding, e.g. reconciliation, error correction, privacy amplification, polarisation coding or phase coding
-
- G—PHYSICS
- G06—COMPUTING; CALCULATING OR COUNTING
- G06F—ELECTRIC DIGITAL DATA PROCESSING
- G06F13/00—Interconnection of, or transfer of information or other signals between, memories, input/output devices or central processing units
- G06F13/38—Information transfer, e.g. on bus
- G06F13/42—Bus transfer protocol, e.g. handshake; Synchronisation
- G06F13/4282—Bus transfer protocol, e.g. handshake; Synchronisation on a serial bus, e.g. I2C bus, SPI bus
-
- G—PHYSICS
- G06—COMPUTING; CALCULATING OR COUNTING
- G06N—COMPUTING ARRANGEMENTS BASED ON SPECIFIC COMPUTATIONAL MODELS
- G06N10/00—Quantum computing, i.e. information processing based on quantum-mechanical phenomena
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L63/00—Network architectures or network communication protocols for network security
- H04L63/02—Network architectures or network communication protocols for network security for separating internal from external traffic, e.g. firewalls
- H04L63/0272—Virtual private networks
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L67/00—Network arrangements or protocols for supporting network services or applications
- H04L67/01—Protocols
- H04L67/12—Protocols specially adapted for proprietary or special-purpose networking environments, e.g. medical networks, sensor networks, networks in vehicles or remote metering networks
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/06—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols the encryption apparatus using shift registers or memories for block-wise or stream coding, e.g. DES systems or RC4; Hash functions; Pseudorandom sequence generators
- H04L9/0643—Hash functions, e.g. MD5, SHA, HMAC or f9 MAC
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/08—Key distribution or management, e.g. generation, sharing or updating, of cryptographic keys or passwords
- H04L9/0816—Key establishment, i.e. cryptographic processes or cryptographic protocols whereby a shared secret becomes available to two or more parties, for subsequent use
- H04L9/0819—Key transport or distribution, i.e. key establishment techniques where one party creates or otherwise obtains a secret value, and securely transfers it to the other(s)
- H04L9/0827—Key transport or distribution, i.e. key establishment techniques where one party creates or otherwise obtains a secret value, and securely transfers it to the other(s) involving distinctive intermediate devices or communication paths
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/08—Key distribution or management, e.g. generation, sharing or updating, of cryptographic keys or passwords
- H04L9/0861—Generation of secret information including derivation or calculation of cryptographic keys or passwords
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/08—Key distribution or management, e.g. generation, sharing or updating, of cryptographic keys or passwords
- H04L9/0861—Generation of secret information including derivation or calculation of cryptographic keys or passwords
- H04L9/0869—Generation of secret information including derivation or calculation of cryptographic keys or passwords involving random numbers or seeds
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/32—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols including means for verifying the identity or authority of a user of the system or for message authentication, e.g. authorization, entity authentication, data integrity or data verification, non-repudiation, key authentication or verification of credentials
- H04L9/3263—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols including means for verifying the identity or authority of a user of the system or for message authentication, e.g. authorization, entity authentication, data integrity or data verification, non-repudiation, key authentication or verification of credentials involving certificates, e.g. public key certificate [PKC] or attribute certificate [AC]; Public key infrastructure [PKI] arrangements
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L9/00—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols
- H04L9/32—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols including means for verifying the identity or authority of a user of the system or for message authentication, e.g. authorization, entity authentication, data integrity or data verification, non-repudiation, key authentication or verification of credentials
- H04L9/3271—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols including means for verifying the identity or authority of a user of the system or for message authentication, e.g. authorization, entity authentication, data integrity or data verification, non-repudiation, key authentication or verification of credentials using challenge-response
- H04L9/3278—Cryptographic mechanisms or cryptographic arrangements for secret or secure communications; Network security protocols including means for verifying the identity or authority of a user of the system or for message authentication, e.g. authorization, entity authentication, data integrity or data verification, non-repudiation, key authentication or verification of credentials using challenge-response using physically unclonable functions [PUF]
-
- H04N5/2254—
-
- H04N5/23296—
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N7/00—Television systems
- H04N7/18—Closed-circuit television [CCTV] systems, i.e. systems in which the video signal is not broadcast
Landscapes
- Engineering & Computer Science (AREA)
- Computer Security & Cryptography (AREA)
- Signal Processing (AREA)
- Computer Networks & Wireless Communication (AREA)
- Theoretical Computer Science (AREA)
- Physics & Mathematics (AREA)
- Computing Systems (AREA)
- General Physics & Mathematics (AREA)
- General Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Power Engineering (AREA)
- Electromagnetism (AREA)
- Health & Medical Sciences (AREA)
- Medical Informatics (AREA)
- Evolutionary Computation (AREA)
- Condensed Matter Physics & Semiconductors (AREA)
- Mathematical Optimization (AREA)
- Pure & Applied Mathematics (AREA)
- Data Mining & Analysis (AREA)
- Mathematical Physics (AREA)
- Software Systems (AREA)
- Mathematical Analysis (AREA)
- Computational Mathematics (AREA)
- Computer Hardware Design (AREA)
- Artificial Intelligence (AREA)
- Optical Communication System (AREA)
- Mobile Radio Communication Systems (AREA)
- Telephonic Communication Services (AREA)
- Multimedia (AREA)
Abstract
Description
본 발명은 QUANTUM KEY 생성기술을 포함하는 QKD(Quantum Key Distribution)를 주요 특징으로 선행기술과 차별성을 갖는다.The present invention is differentiated from the prior art by the main feature of QKD (Quantum Key Distribution) including QUANTUM KEY generation technology.
특히, One-Way-Ring/Two-Way-Ring Network QKD(Quantum Key Distribution)에 대해 주요 신규성과 진보성을 갖는다.In particular, it has major novelty and inventive step for One-Way-Ring/Two-Way-Ring Network QKD (Quantum Key Distribution).
과도기적 양자통신 시스템으로 양자통신망과 고전통신망이 결합한 하이브리드 양자통신망 시스템으로 비면허주파수를 사용하는 와이파이 AP(Access Point) 등에 대한 에빌 트윈(Evil Twin) 공격 등에 대응하는 것으로, 자치단체(사기업) 등의 폐쇄형 무선 자가통신망 구축 관련 One-Way-Ring/Two-Way-Ring Network QKD(Quantum Key Distribution) 기술이다.As a transitional quantum communication system, it is a hybrid quantum communication network system that combines a quantum communication network and a classical communication network. It is a response to the Evil Twin attack on Wi-Fi access points (APs) using unlicensed frequencies, etc., and the closure of local governments (private companies), etc. One-Way-Ring/Two-Way-Ring Network QKD (Quantum Key Distribution) technology related to wireless self-communication network construction.
일 실시 예로, IDQ 및 SK텔레콤에서 개발한 2.5㎜×2.5㎜(5㎜×5㎜) QRNG(Quantum Random Number Generator) Chip을 적용한다.In one embodiment, a 2.5 mm × 2.5 mm (5 mm × 5 mm) QRNG (Quantum Random Number Generator) chip developed by IDQ and SK Telecom is applied.
6×6㎜ 이하 물리적인 PUF(eFUSE)-TRNG(QRNG) SoC Chip을 기반으로 한 QUANTUM Encrypt TLS(Transport Layer Security protocol) MODULE을 일 실시 주요 특징으로 한다.It features a QUANTUM Encrypt Transport Layer Security protocol (TLS) MODULE based on a physical PUF (eFUSE)-TRNG (QRNG) SoC chip of 6×6 mm or less.
반도체 공정편차를 이용한 PUF(Physically Unclonable Function) Chip의 PIN 데이터를 추출 후 eFUSE 회로로 단절하는 기술을 적용하는 일 실시 본 기술은 협의의 개념인 eFUSE와 광의 개념인 PUF는 동일한 개념이다.An embodiment of applying the technology to disconnect the eFUSE circuit after extracting the PIN data of the PUF (Physically Unclonable Function) chip using the semiconductor process deviation. In this technology, eFUSE, a concept in a narrow sense, and PUF, a concept in light, are the same concept.
또한, PUF(Physically Unclonable Function)의 구현 일 실시 예로 AC(Access Controller)와 AP(Access Point) 사이에 IP주소(Internet Protocol Address) 및 Log 정보(ID/Password)를 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 생성하는 양자난수를 시드(Seed)로 생성하여 NFC(Near Field Communication)에 입력한 NFC-PUF를 OTP(One Time Password) 또는 월간 정기점검때 교체되는 물리적인 PUF(Physically Unclonable Function)를 특징으로 한다.In addition, as an embodiment of the implementation of a Physically Unclonable Function (PUF), an Internet Protocol Address (IP address) and log information (ID/Password) are generated between an Access Controller (AC) and an Access Point (AP) with a Quantum Random Number Generator (QRNG). Number Generator) generates a quantum random number as a seed, and the NFC-PUF input in NFC (Near Field Communication) is replaced with OTP (One Time Password) or a physical PUF (Physically Unclonable Function) that is replaced during regular monthly inspections. ) is characterized.
또한, QRNG(Quantum Random Number Generator) Chip을 통해 양자난수를 생성하는 것은 협의의 자연난수 TRNG(True Random Number Generator) 개념으로 협의의 QRNG는 광의의 TRNG과 동일한 개념이다.In addition, generating a quantum random number through a QRNG (Quantum Random Number Generator) chip is a narrowly defined TRNG (True Random Number Generator) concept, and a narrowly defined QRNG is the same concept as a broadly defined TRNG.
MitM(Man in the Middle, 중간자) 공격은 공격자가 비밀리에 도청하거나 이동하는 트래픽을 수정하기 위해 두 당사자 사이에서 통신을 가로채는 것이다. 공격자는 MitM 공격을 이용해 로그인 자격 증명이나 개인 정보를 훔치거나 피해자를 염탐하거나 통신을 방해하거나 데이터를 파괴할 수 있다.A Man in the Middle (MitM) attack is one in which an attacker secretly intercepts communications between two parties in order to eavesdrop or modify moving traffic. Attackers can use MitM attacks to steal login credentials or personal information, spy on victims, disrupt communication, or destroy data.
MitM은 암호화로 방지할 수 있지만 공격자는 정상적인 것처럼 보이도록 고안된 피싱(Phishing) 사이트로 트래픽을 전환하거나 트래픽을 획득하거나 기록한 후 의도한 목적지로 전달할 것이기 때문에 이 공격을 탐지하기란 매우 어렵다. MitM can be prevented with encryption, but this attack is very difficult to detect because an attacker will either divert traffic to a phishing site designed to appear legitimate, or will acquire or log the traffic and then deliver it to its intended destination.
또한, 양자컴퓨터의 등장으로 더 이상의 일반적인 암호화의 방법은 대책이 되지않는다.In addition, with the advent of quantum computers, general encryption methods are no longer a countermeasure.
본 발명의 양자 데이터는 복사가 불가능하다는 이론을 기반으로 MitM 공격을 원천적으로 봉쇄할 수 있을 것이다.The quantum data of the present invention will be able to fundamentally block the MitM attack based on the theory that copying is impossible.
그러나, 본 발명과 같이 과도기적인 양자통신과 비양자통신이 하이브리드 시스템으로 구성된 상태에서 에빌 트윈(Evil Twin) 공격은 정상적인 와이파이 AP(Access Point) 인척 하지만 해커가 전적으로 통제해 사용자가 전송하는 모든 정보를 모니터링, 수집, 조작할 수 있다.However, as in the present invention, in a state where transitional quantum communication and non-quantum communication are configured as a hybrid system, the Evil Twin attack pretends to be a normal Wi-Fi access point (AP), but the hacker completely controls all information transmitted by the user. It can be monitored, collected and manipulated.
본 발명에서는 물리적인 QRNG SoC Chip을 기반으로 한 양자암호에 하이브리드 (고전)양자통신 구간에서 MitM 공격 대응을 강화하기 위한 TLS(Transport Layer Security protocol) 암호화 프로토콜 디바이스인 QUANTUM COLLABO를 일 실시 주요 특징으로 한다.In the present invention, QUANTUM COLLABO, which is a Transport Layer Security protocol (TLS) encryption protocol device to strengthen the response to MitM attacks in the hybrid (classic) quantum communication section, is a quantum cryptography based on a physical QRNG SoC chip. .
본 발명은 무선통신 구간에 있어서, 면허주파수 ISP 사업자망과 비면허주파수 폐쇄형 무선자가망를 이용한 하이브리드 양자통신망에서 QUANTUM KEY QKD(Quantum Key Distribution) 기술을 중요 특징으로 한다. The present invention is an important feature of the QUANTUM KEY QKD (Quantum Key Distribution) technology in the hybrid quantum communication network using the licensed frequency ISP operator network and the unlicensed frequency closed wireless self-network in the wireless communication section.
방범용 CCTV, 방송장치, 자동제어, 배전반, 태양광발전, 스마트폰, 산업용 휴대형 단말기, CLOUD SERVER, G-Cloue, 동보방송, 산업안전보건법 적용 근로자 안전장비 등 관련이다.It is related to crime prevention CCTV, broadcasting device, automatic control, switchboard, solar power generation, smart phone, industrial portable terminal, CLOUD SERVER, G-Cloue, broadcasting, worker safety equipment to which the Industrial Safety and Health Act applies.
공지된 대한민국 등록특허공보 등록번호 제10-1918976호(출원일 2017.03.28) Known Republic of Korea Patent Publication No. 10-1918976 (application date 2017.03.28)
공지된 '클라우드 보안 시스템'은,The known 'cloud security system' is,
양자단말기 내부의 단말 의사난수생성기 및 클라우드서버 내부의 클라우드 의사난수생성기는 마이크로프로세서로 구성되어 프로그램 입력된 의사난수 프로그램에 의해 상기 단말 의사난수생성기의 의사난수와 상기 클라우드 의사난수생성기의 의사난수가 동일하게 발생하며, 양자단말기는 단말 의사난수생성기, 단말 양자난수생성기, 보안인증스위치, 단말 OTP 메모리로 구성되고, 단말 양자난수생성기는 단말난수소스생성기, 단말양자검출 다이오드, 단말양자랜덤펄스 생성기, 단말양자난수 제어부로 구성되고, 상기 단말난수소스생성기는 양자입자를 방출하고, 상기 단말양자검출 다이오드는 상기 단말난수소스생성기로부터 발생하는 양자입자를 검출하고, 상기 단말양자랜덤펄스 생성기는 상기 단말양자검출 다이오드로부터 양자입자 이벤트를 검출하여 양자입자의 검출에 상응하는 랜덤펄스를 발생하고, 상기 단말양자난수 제어부는 마이크로프로세서로 구성되어, 상기 단말양자랜덤펄스 생성기를 통해 발생하는 무작위 난수소스로 단말양자난수를 생성하되, 클라우드서버가 양자단말기에 접속하면, 단말 의사난수생성기는 프로그램에 의해 의사난수를 발생하여 대칭암호키를 생성하여 상기 단말 양자난수생성기의 단말양자난수 제어부로 전송하고, 단말양자난수 제어부는 대칭암호키를 수신하여 단말양자난수를 통해 단말비대칭암호키를 생성하여 대칭암호키 및 단말비대칭암호키를 단말 OTP 메모리에 저장 후 단말비대칭암호키를 클라우드서버로 전송하고, 클라우드서버 내부의 클라우드 의사난수생성기는 프로그램에 의해 의사난수를 발생하여 대칭암호키를 생성하여 상기 단말비대칭암호키로 암호화한 클라우드대칭암호키를 생성하여 양자단말기 내부의 단말양자난수 제어부로 전송하고, 단말양자난수 제어부는 클라우드서버로 부터 수신한 클라우드대칭암호키를 단말 OTP 메모리에 저장된 단말비대칭암호키로 복호화하여, OTP 메모리에 저장된 대칭암호키와 일치할 경우, 보안인증스위치가 ON되어 로그인(Login) 네트워크망과 연결되고, 단말 OTP 메모리의 단말비대칭암호키를 삭제하고, 로그아웃(Log-out)시 보안인증스위치가 OFF되어, 네트워크망을 차단하는 것을 특징으로 하는 클라우드 보안 시스템이다.The terminal pseudo-random number generator inside the quantum terminal and the cloud pseudo-random number generator inside the cloud server are composed of a microprocessor, and the pseudo-random number of the terminal pseudo-random number generator and the pseudo-random number of the cloud pseudo-random number generator are the same by the program-input pseudo-random number program. The quantum terminal is composed of a terminal pseudo random number generator, a terminal quantum random number generator, a security authentication switch, and a terminal OTP memory, and the terminal quantum random number generator is a terminal random number source generator, terminal quantum detection diode, terminal quantum random pulse generator, terminal and a quantum random number control unit, wherein the terminal random number source generator emits quantum particles, the terminal quantum detection diode detects quantum particles generated from the terminal random number source generator, and the terminal quantum random pulse generator detects the terminal quantum. A quantum particle event is detected from the diode to generate a random pulse corresponding to the detection of the quantum particle, and the terminal quantum random number control unit is composed of a microprocessor, and is a terminal quantum random number as a random random number source generated through the terminal quantum random pulse generator. However, when the cloud server accesses the quantum terminal, the terminal pseudo-random number generator generates a pseudo-random number by a program, generates a symmetric encryption key, and transmits it to the terminal quantum random number control unit of the terminal quantum random number generator, and the terminal quantum random number control unit receives the symmetric encryption key, generates a terminal asymmetric encryption key through the terminal quantum random number, stores the symmetric encryption key and the terminal asymmetric encryption key in the terminal OTP memory, and transmits the terminal asymmetric encryption key to the cloud server, and transmits the terminal asymmetric encryption key to the cloud server inside the cloud server. The pseudo-random number generator generates a pseudo-random number by a program, generates a symmetric encryption key, generates a cloud symmetric encryption key encrypted with the terminal asymmetric encryption key, and transmits it to the terminal quantum random number control unit inside the quantum terminal, and the terminal quantum random number control unit is the cloud The cloud symmetric encryption key received from the server is decrypted with the terminal asymmetric encryption key stored in the terminal OTP memory, and if it matches the symmetric encryption key stored in the OTP memory, the security authentication switch is turned on and connected to the login network, Delete the terminal asymmetric encryption key in the terminal OTP memory and log out (Log-o ut), the security authentication switch is OFF, and it is a cloud security system, characterized in that it blocks the network.
공지된 iTWIN USB(https://youtu.be/UWj-weu_CXs).Announced iTWIN USB (https://youtu.be/UWj-weu_CXs).
S/W 또는 H/W 방법에 의해 구현된 VPN에 있어서,In the VPN implemented by S / W or H / W method,
S/W 방법은 비용 및 사용이 간단하나, 해커에 의한 공격에 취약한 문제점이 있었다. H/W 방법은 상대적으로 해커에 의한 공격에 강하나 비용이 비싸고 부피가 큰 문제점이 있었다.Although the S/W method is costly and simple to use, there is a problem in that it is vulnerable to attacks by hackers. Although the H/W method is relatively strong against attacks by hackers, it has a problem of high cost and large volume.
iTWIN은 상기의 장단점을 살려 한 쌍의 USB에 AES 256bit 암호화 소프트웨어를 탑재하고, 전 세계 어디서든 한 쌍의 iTWIN 끼리만 암호화 통신을 할 수 있게 했다.Taking advantage of the above advantages and disadvantages, iTWIN is equipped with AES 256bit encryption software on a pair of USBs, and enables encrypted communication between only a pair of iTWINs anywhere in the world.
주요한 특징으로, 종래의 S/W 방법은 보안에 취약(ID/PW)했고, H/W 방법은 지정된 장소에 고정적으로 사용하였으나, iTWIN은 3CH인증 플랫폼 방식을 적용하여 IP를 교환 후 1:1 VPN 통신을 제공하는 특징을 갖는다.As a major feature, the conventional S/W method was weak in security (ID/PW), and the H/W method was fixedly used in a designated place, but iTWIN applies the 3CH authentication platform method to exchange IP 1:1 It has a feature that provides VPN communication.
그러나, 속도가 늦고 일반인 사용자들이 100달러를 지불하고 사용하기 보다는 디자인과 호기심이 더 강했다.(현재 폐업 및 서비스 중단)However, it was slow and the general users were more curious about the design and use it than paying $100 to use it. (Currently out of business and out of service)
공지된 '물리적 이중화 망분리 보안이 강화된 방범 CCTV 감시장치 및 그 제어방법'Announced 'Crime-prevention CCTV monitoring device with enhanced physical redundant network separation security and its control method'
물리적 망분리에 있어서,In the physical network separation,
제 1메인보드와 제 2메인보드의 I/O포트의 물리적 입출력선 중 하나가 강제로 끊긴 물리적 구조상태에서 에러를 보정하는 기술로 휴대폰으로 단방향으로만 영상을 전송하는 방법으로 데이터 입/출력 케이블 중 하나가 물리적으로 끊겨 해킹이 불가능한 것으로 한다. This is a technology that corrects errors in the state of the physical structure in which one of the physical input/output lines of the I/O ports of the 1st and 2nd motherboards is forcibly cut off. It is a method of transmitting images to a mobile phone in one direction only, using a data input/output cable One of them is physically cut off, so it is impossible to hack.
PCT/SG2012/000118(2012.04.04)PCT/SG2012/000118 (2012.04.04)
A method for remote access to data stored on a host system from a remote system via a data link, the method comprising the steps of: connecting a first module and a second module to the host system, the first module initially being connected to and associated with the second module; storing validation password data for verifying the identity of the first module on the second module; and upon connecting the removed first module to the remote system to establish a secure communication channel between said first and second modules across said data link to access said data, the host system having the second module connected thereto, entering a user password for generating user password data for verification by the second module based on the stored validation password data.A method for remote access to data stored on a host system from a remote system via a data link, the method comprising the steps of: connecting a first module and a second module to the host system, the first module initially being connected to and associated with the second module; storing validation password data for verifying the identity of the first module on the second module; and upon connecting the removed first module to the remote system to establish a secure communication channel between said first and second modules across said data link to access said data, the host system having the second module connected thereto, entering a user password for generating user password data for verification by the second module based on the stored validation password data.
10-2012-0042383(2012.04.24)10-2012-0042383 (2012.04.24)
로컬서버는 감시카메라의 제어 및 개인휴대용단말기에 영상데이터를 전송하는 로컬서버로 제1 메인보드와 제2메인보드를 포함하여 구성되며; 제1 메인보드는 제1 하드디스크, 제1 랜카드, 내부망 랜포트를 포함하며; 제2 메인보드는 제2 랜카드, 외부망 랜포트, 차단기를 포함하여 구성되어 외부망 랜포트를 통해 ISP사업자의 무선네트워크망을 통해 개인휴대용단말기에 연결 접속되며; 감시카메라로부터 출력된 영상데이터 선은 분배기를 통해 분기되어 한 선은 내부망 랜포트를 통해 제1 메인보드에 업로드되어 제1 하드디스크에 영상데이터가 저장되며; 나머지 한 선은 차단기를 거쳐 제2 메인보드에 연결되나, 차단기의 접점은 차단 상태로 감시카메라의 출력 영상데이터는 제2 메인보드에 업로드 되지 못하며; 상기 차단기의 접점이 차단 상태에서 온도센서, 화재수신기, 침입감지센서, PLC제어반, 자동제어반 중 어느 하나 이상으로 구성된 계측부에서 위험 이벤트 신호가 발생할 경우 차단기의 차단 접점을 연결 접점으로 전환하여 감시카메라의 출력 영상데이터를 제2 메인보드에 업로드 후 무선네트워크망을 통해 영상데이터를 개인휴대용단말기로 전송하는 것을 특징으로 하는 물리적 이중화 망분리 보안이 강화된 방범 CCTV 감시장치.The local server is a local server for controlling a surveillance camera and transmitting image data to a personal portable terminal, and is configured including a first main board and a second main board; the first main board includes a first hard disk, a first LAN card, and an internal network LAN port; the second main board is configured to include a second LAN card, an external network LAN port, and a circuit breaker, and is connected and connected to the personal portable terminal through the wireless network network of the ISP operator through the external network LAN port; The video data line output from the surveillance camera is branched through the distributor, and one line is uploaded to the first main board through the internal network LAN port, and the video data is stored in the first hard disk; The other line is connected to the second main board through the breaker, but the contact of the breaker is blocked, and the output image data of the surveillance camera cannot be uploaded to the second main board; When a dangerous event signal occurs in the measuring unit composed of any one or more of a temperature sensor, fire receiver, intrusion detection sensor, PLC control panel, and automatic control panel when the contact point of the circuit breaker is blocked, the blocking contact of the circuit breaker is converted to a connection contact and the monitoring camera A crime prevention CCTV monitoring device with enhanced physical dual network separation security, characterized in that after uploading the output image data to the second main board, the image data is transmitted to a personal portable terminal through a wireless network.
10-2012-0089227(2012.08.16)10-2012-0089227 (2012.08.16)
사물지능통신을 수행하는 보안 인증 단말 장치에 있어서,In the security authentication terminal device for performing intelligent communication,
상기 보안 인증 단말 장치가 공개키 암호화 방식으로 통신하기 위한 공개키를 비밀키 암호화 방식으로 외부 장치에 전달하기 위한 비밀키를 상기 보안 인증 단말 장치에 제공하는 비밀키 모듈; 상기 공개키를 생성하기 위한 개인키를 상기 보안 인증 단말 장치에 제공하는 개인키 모듈; 상기 보안 인증 단말 장치의 시리얼번호를 저장하는 시리얼번호 저장부;및 상기 시리얼번호가 상기 시리얼번호 저장부에 저장되고 상기 비밀키가 상기 보안 인증 단말 장치의 외부로 추출된 이후에 상기 비밀키가 상기 보안 인증 단말 장치의 외부로 추출되는 인터페이스로의 연결 경로를 차단하는 퓨즈부를 포함하며, 상기 비밀키 모듈 및 상기 개인키 모듈 중 적어도 하나는 PUF(Physical unclonable Functions)를 포함하여 구현되는 보안 인증 단말 장치.a secret key module for providing, to the security authentication terminal device, a secret key for transmitting a public key for the security authentication terminal device to communicate using a public key encryption method to an external device using a secret key encryption method; a private key module for providing a private key for generating the public key to the secure authentication terminal device; A serial number storage unit for storing the serial number of the security authentication terminal device; And the serial number is stored in the serial number storage unit, after the secret key is extracted to the outside of the security authentication terminal device, the secret key is the A security authentication terminal device comprising a fuse unit for blocking a connection path to an interface extracted to the outside of the security authentication terminal device, wherein at least one of the private key module and the private key module includes a PUF (Physical unclonable Functions). .
10-2015-0096606(2015.07.07)10-2015-0096606(2015.07.07)
CPU코드를 실행하는 메인CPU를 내부에 포함하고, 외부에 JTAG 디버거가 연결되는 SoC에 있어서,In the SoC that includes the main CPU that executes the CPU code inside and the JTAG debugger is connected to the outside,
SoC의 제조시에 미리 내장되는 SoC 내의 하드웨어 핀 설정에 따라서 단절신호를 생성하는 시큐리티 이네이블 회로와, 상기 단절신호를 받아서 상기 JTAG 디버거와 SoC 사이의 연결을 하드웨어적으로 끊는 디버그 인터페이스 회로가 포함됨을 특징으로 하는 보안기능을 가지는 SoC.It includes a security enable circuit that generates a disconnect signal according to the hardware pin setting in the SoC, which is pre-built at the time of manufacturing the SoC, and a debug interface circuit that receives the disconnect signal and cuts the connection between the JTAG debugger and the SoC by hardware. SoC with security function characterized by.
PCT/EP2016/076200(2016.10.31)PCT/EP2016/076200 (2016.10.31)
A method for generating random numbers based on an optical process of quantum nature, the method comprising: emitting photons from a light source; absorbing, by a photon sensor having a plurality of pixels, the photons emitted from the light source; calculating respective minimum entropy levels for the plurality of pixels of the photon sensor; associating one of a plurality of extractors with at least one of the plurality of pixels based on the calculated minimum entropy level of the at least one pixel; and generating, by the extractor associated with the at least one pixel, a number of high-entropy bits for generating a random number. A method for generating random numbers based on an optical process of quantum nature, the method comprising: emitting photons from a light source; absorbing, by a photon sensor having a plurality of pixels, the photons emitted from the light source; calculating minimum entropy levels for the respective plurality of pixels of the photon sensor; associating one of a plurality of extractors with at least one of the plurality of pixels based on the calculated minimum entropy level of the at least one pixel; and generating, by the extractor associated with the at least one pixel, a number of high-entropy bits for generating a random number.
대칭키 암호 알고리즘(symmetric cryptographic algorithm)에 사용되는 암호학적 키는‘대칭키’라고 불리우며, 대칭키는 암호화와 복호화가 서로 동일한 1개의 키를 이용한다는 사실은 이미 이 발명이 속하는 기술분야에서 통상의 지식을 가진자(이하 ‘통상의 기술자’라함)에게 주지관용의 기술적 사실이다. A cryptographic key used in a symmetric cryptographic algorithm is called a 'symmetric key', and the fact that a symmetric key uses one key for encryption and decryption is already common in the art to which this invention belongs. It is a technical fact of common tolerance for those with knowledge (hereinafter referred to as 'common engineer').
또한, 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)은‘개인키(private key)’와 이 개인키에 수학적으로 상응하는‘공개키(public key)’라는 키쌍이 존재하며, 공개키로 암호화를 수행하고, 상응하는 개인키로 복호화를 수행한다는 사실은 통상의 기술자에게 주지관용의 기술적 사실이다.In addition, in the asymmetric cryptographic algorithm, there is a key pair called a 'private key' and a 'public key' mathematically corresponding to the private key, and performs encryption with the public key, The fact that decryption is performed with the corresponding private key is a technical fact well known to those skilled in the art.
또한, 상기 수학식은 RSA 암호화가 대표적이고 해시함수(고정길이 해시함수), 연산자(베타적 논리합(EX-OR)) 등 다양한 방법이 공지되어 있다.In addition, RSA encryption is representative of the above equation, and various methods such as a hash function (a fixed-length hash function) and an operator (exclusive OR (EX-OR)) are known.
본 발명에서는 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)의 개인키(private key)와 공개키(public key) 키쌍 사이의 키 생성은 RSA, 해시함수<(HASH(DATA1)+(TRN)∥DATA2>, 함수식, 연산자 등 공지된 다양한 방법이 적용된다.( '+' 연산자 기호는 베타적 논리합(EX-OR) 연산자 기호를 의미한다.)In the present invention, the key generation between the private key and the public key key pair of the asymmetric cryptographic algorithm is RSA, a hash function <(HASH(DATA1)+(TRN) | DATA2>, Various well-known methods such as functional expressions and operators are applied. (The '+' operator symbol means the exclusive OR (EX-OR) operator symbol.)
일 예로, For example,
해시함수<(HASH(DATA1)+(TRN)))∥DATA2>에서 HASH(DATA1)은 DATA1을 고정길이 해시함수로 포맷한 개인키를 생성 후 자연난수(TRN)를 난수 시드(Seed)로 베타적 논리합(EX-OR) 연산하여 공개키를 생성 후 DATA2를 암호화한 일방향 해시함수이다.In the hash function <(HASH(DATA1)+(TRN))) DATA2>, HASH(DATA1) generates a private key that formats DATA1 as a fixed-length hash function, and then converts a natural random number (TRN) as a random number seed. It is a one-way hash function that encrypts DATA2 after generating a public key by performing an EX-OR operation.
상기 일방향 해시함수는 일방향 전달 함수로, Alice가 Bob에게 해시함수<(HASH(DATA1)+(TRN))>를 전달한 후 Bob이 DATA2를 암호화하여 해시함수<(HASH(DATA1)+(TRN)∥DATA2>를 Alice에게 재전송하면, Alice는 개인키 해시함수<HASH(DATA1)>와 1회용 OTP 자연난수 TRN을 알고 있다면, DATA2를 복호화할 수 있는 해시함수이다. The one-way hash function is a one-way transfer function. After Alice transmits the hash function <(HASH(DATA1)+(TRN))> to Bob, Bob encrypts DATA2 and the hash function <(HASH(DATA1)+(TRN)) When DATA2> is retransmitted to Alice, if Alice knows the private key hash function <HASH(DATA1)> and the one-time OTP natural random number TRN, it is a hash function that can decrypt DATA2.
양자컴퓨터 등을 이용한 사이버테러 공격에 대응하는 것으로 양자통신망 구축을 목표로 하지만, 모든 네트워크망을 양자통신망으로 구축하기에는 현실적으로 어려움에 따라 양자통신망(QUANTUM Communication Channel)과 비양자통신망(Non-QUANTUM Communication Channel)을 하이브리드형(hybrid-QUANTUM Communication Channel)으로 적용한 양자암호 기술로 보안강화 및 통신요금의 최소화를 과제로한 One-Way-Ring/Two-Way-Ring Network QKD(Quantum Key Distribution) 기술이다.The goal is to establish a quantum communication network in response to cyber terror attacks using quantum computers, but it is practically difficult to build all networks using quantum communication networks. Therefore, QUANTUM Communication Channel and Non-QUANTUM Communication Channel ) as a hybrid-QUANTUM Communication Channel, one-Way-Ring/Two-Way-Ring Network QKD (Quantum Key Distribution) technology with the goal of strengthening security and minimizing communication charges.
특히, 본 기술의 주요 과제는 비양자통신 채널이 해킹되는 파이어 세일(Fire sale)에 대한 물리적 보안 대책을 제공하는 것을 해결하고자 하는 과제로 한다.In particular, the main task of the present technology is to solve the problem of providing a physical security measure against a fire sale in which a non-quantum communication channel is hacked.
사물지능통신 분야에서 PUF라는 새로운 기술에 의해 장치(Device)가 스스로 패스워드를 생성하여 이를 인증에 이용함으로써, 장치들 간에 서로 식별하고 정당한 개체인지 확인하기 위한 보안 인증을 신뢰할 수 있는 수준으로 수행하는 장치 및 방법이 제공된다.A device that generates a password by itself by a new technology called PUF in the field of IoT communication and uses it for authentication, so that the device performs security authentication at a reliable level to identify each other and check whether it is a legitimate entity. and methods are provided.
또한, PUF의 기능을 구현하는 물리적 장치로 QUANTUM COLLABO와 Alice QUANTUM SERVER가 물리적으로 한 쌍의 동일한 의사난수를 발생하는 NFC 카드(스티커)를 사용한다.In addition, as a physical device that implements the PUF function, QUANTUM COLLABO and Alice QUANTUM SERVER use an NFC card (sticker) that physically generates a pair of identical pseudorandom numbers.
특히, 광케이블로 연결된 전용선 상에서 양자 결맞음과 펄스 도착시간을 랜덤 선택 측정, non empty 펄스 위치로 큐비트 구성되며 미끼펄스(decoi-PULSE DEBUGGER)로 결맞음 공격을 방어하는 특징의 양자통신과 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 임대망에서 데이터의 QUANTUM KEY 인증을 통해 보안을 강화하는 양자통신 시스템이다.In particular, the quantum communication and quantum communication channel, which are characterized by random selection measurement of quantum coherence and pulse arrival time on a dedicated line connected by optical cable, and qubits composed of non-empty pulse positions, to defend against coherence attacks with decoi-PULSE DEBUGGER. It is a quantum communication system that strengthens security through QUANTUM KEY authentication of data in the ISP (Internet Service Provider) rental network that does not form.
암호화 복호화를 이용한 보안 통신이 사물지능통신을 수행하는 장치나 시스템들에 적용됨에 있어서, 장치의 보안 인증 시스템에 대한 물리적 공격이나 인가되지 않은 접근(access)에 강인한 보안 인증장치 및 방법이 제공된다.When secure communication using encryption/decryption is applied to devices or systems that perform IoT communication, a security authentication apparatus and method that are strong against physical attacks or unauthorized access to the security authentication system of the device are provided.
시스템적으로 양자통신(QUANTUM Channel)과 비양자통신(non-QUANTUM Channel) 사이에 하이브리드양자암호(hybrid-QUANTUM G-Cloud) 기술을 적용하여, 양자통신 적용이 어려운 음영단말기에 대한 양자(수퍼)컴퓨터의 무차별대입공격(brute force cracking)에 대한 ARIA, AES 등의 암호보안 문제점을 해결하는 유일한 대안이 된다.By systematically applying hybrid-QUANTUM G-Cloud technology between QUANTUM Channel and non-QUANTUM Channel, quantum (super) for shadow terminals where it is difficult to apply quantum communication. It is the only alternative to solve cryptographic security problems such as ARIA and AES against brute force cracking of computers.
일 예로,For example,
방범용 CCTV 1개소를 구축시 약 15,000천원의 시공비와 월 88천원의 전용회선(고정 IP) 임대료가 발생한다.When one crime prevention CCTV is built, a construction cost of about 15,000 won and a leased line (fixed IP) rent of 88 thousand won per month are incurred.
상기 방범 시스템에 안전한 통신을 위해 현 시점에서 BB84 양자통신망을 구축할 경우 최소 5억 이상의 비용이 발생하므로, 현실적으로 양자통신망이 아닌 본 발명의 하이브리드양자암호(hybrid-QUANTUM G-Cloud) 통신기술이 적용된다.For safe communication in the crime prevention system, if the BB84 quantum communication network is built at the present time, at least 500 million or more costs are incurred, so in reality, the hybrid-QUANTUM G-Cloud communication technology of the present invention is applied rather than a quantum communication network. do.
세부적인 과제로as a detailed task
1. 통신비용 부담으로 사각방지 블랙박스형으로 운영되는 방범용 CCTV 감시카메라의 문제점을 해결한다.1. It solves the problem of CCTV surveillance cameras for crime prevention operated in the blind-proof black box type due to the burden of communication cost.
2. 비면허주파수를 이용한 자치단체 폐쇄형 무선자가망 구축을 통해 통신비용을 최소화 한다.2. Minimize communication costs by constructing a closed wireless self-network using unlicensed frequencies.
3. 하이브리드 양자암호통신(hybrid-QUANTUM G-Cloud) 기술을 적용해 보안 강화한다.3. Reinforce security by applying hybrid-QUANTUM G-Cloud technology.
최소의 통신비용으로 사물인터넷망을 구축하되 보안은 현존하는 보안체계 중 가장 보안이 높은 기술을 적용하는 것을 과제로 한다.The task of building an IoT network with minimal communication cost is to apply the highest security technology among the existing security systems.
최소 비용(LPWAN/월 1,000원 ~ MMS/5,500원)으로 통신사업자의 LTE 보안기술을 유료로 적용하여 QUANTUM KEY를 전송하는 QKD(Quantum Key Distribution) 면허주파수 및 QUANTUM KEY로 암호화된 대용량의 데이터를 전송하는 비면허주파수 이종망 기술을 적용한다. QKD (Quantum Key Distribution) licensed frequency that transmits QUANTUM KEY by applying the LTE security technology of the telecommunication service provider at a minimum cost (LPWAN/monthly 1,000 won ~ MMS/5,500 won) and transmitting large amounts of data encrypted with QUANTUM KEY Unlicensed frequency heterogeneous network technology is applied.
LoRA(TM) 자가망을 구축할 경우 통신 비용이 발생하지 않지만 망 운영 및 시설비 등의 초기 투자비용이 발생하며 통신사업자 전용 보안설비의 보안기술이 적용되지 않는다.When building a LoRA(TM) own network, communication costs are not incurred, but initial investment costs such as network operation and facility costs occur, and the security technology of security facilities dedicated to telecommunication service providers is not applied.
ISP 사업자의 LoRA(AL) 임대망을 사용할 경우 월 약 1,000원 정도의 비용이 발생하나, MMS 요금 5,500원, 임대망 22,000원, 자가임대망(방범용 고정 IP) 88,000원 비용대비 최저 비용으로 블랙박스형으로 운영되는 방범용 CCTV 감시카메라의 문제점 해결이 가능한 비면허주파수 폐쇄형 무선통신 자가망을 구축한다.When using the LoRA (AL) rental network of the ISP operator, the monthly cost is about KRW 1,000, but the MMS fee is KRW 5,500, the rental network KRW 22,000, and the private rental network (fixed IP for crime prevention) KRW 88,000 is the lowest cost compared to the cost. Establish a closed wireless communication network with unlicensed frequency that can solve the problems of box-type CCTV surveillance cameras for crime prevention.
또한, PUF(Phisycally Unclonable Function) Chip 또는 물리적 의사난수 발생 NFC 카드(스티커)와 QRNG(Quantum Random Number Generator) Chip을 이용한 보안키 생성 및 분배 관련으로 반도체 제조공정상 발생하는 공정편차를 통해 PUF Chip으로부터 PIN(Personal Identification Number) 데이터를 추출하여 고정길이 해시함수, 포맷함수 등으로 비공개키(개인키, 복호키)를 생성하고, QRNG를 통해 발생하는 무작위 양자난수를 통해 상기 비공개키(개인키, 복호키)를 베타적 논리합(EX-OR) 연산자, 암호화함수 등으로 암호화 통하여 공개키(암호키)를 생성 및 반대의 과정도 가능한 키생성 및 분배기술을 바탕으로 PUF(또는 NFC) Chip를 탑재한 단말기를 통합 관리 운영하는 시스템으로 ISP 사업자 무선망 QUANTUM KEY 인증 QKD(Quantum Key Distribution) 기술과 폐쇄 무선자가망 대용량 데이터 전송기술을 결합한 신기술이다.In addition, PIN from PUF chip through process deviation that occurs in semiconductor manufacturing process related to generation and distribution of security key using PUF (Physycally Unclonable Function) Chip or physical pseudo-random number-generating NFC card (sticker) and QRNG (Quantum Random Number Generator) Chip (Personal Identification Number) Data is extracted and a private key (private key, decryption key) is generated using a fixed-length hash function, a format function, etc., and the private key (private key, decryption key) is generated through a random quantum random number generated through QRNG. ), a terminal equipped with a PUF (or NFC) chip based on key generation and distribution technology that can generate a public key (encryption key) through encryption with an EX-OR operator, an encryption function, etc. and vice versa It is a new technology that combines ISP operator's wireless network QUANTUM KEY authentication QKD (Quantum Key Distribution) technology and closed wireless self-network large-capacity data transmission technology.
hybrid-QUANTUM CHANNEL에 적용된 One-Way-Ring Network 및 Two-Way-Ring Network QKD(Quantum Key Distribution)는 선행기술이 없는 최초의 신기술로 최소비용으로 현존하는 최고 hybrid-QUANTUM 보안기술이다.One-Way-Ring Network and Two-Way-Ring Network QKD (Quantum Key Distribution) applied to hybrid-QUANTUM CHANNEL is the first new technology without prior art and is the best existing hybrid-QUANTUM security technology at minimum cost.
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하면, When Bob QUANTUM SERVER receives terminal device generated data encrypted with Alice QUANTUM public key from QUANTUM DUAL AP,
non-QUANTUM CHANNEL 또는 QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;transmitted to Alice QUANTUM SERVER through any one of the non-QUANTUM CHANNEL and QUANTUM CHANNEL wired networks;
Alice QUANTUM SERVER는 유선네트워크망과 면허주파수 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)이다.Alice QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM public key from any one or more of the wired network and the wireless network of a licensed frequency carrier, and decrypts it with the Alice QUANTUM private key to enhance security. Improve communication speed and reduce communication charges. It is an asymmetric cryptographic algorithm featuring a hybrid-QUANTUM CHANNEL One-Way-Ring Network.
hybrid-QUANTUM CHANNEL One-Way-Ring Network는 단방향으로 QUANTUM KEY가 전송되는 QKD(Quantum Key Distribution)기술로 아래와 같은 특징으로 한다.The hybrid-QUANTUM CHANNEL One-Way-Ring Network is a QKD (Quantum Key Distribution) technology that transmits QUANTUM KEY in one direction, and has the following features.
QKD 인증 경로 : QUANTUM COLLABO → QUANTUM AC → 통신모뎀 → 통신사업자 무선망 → Alice QUANTUM SERVER → 유선자가망(hybrid-QUANTUM CHANNEL) → Bob QUANTUM SERVER → QUANTUM AP → 무선자가망 → 통신모뎀 → QUANTUM COLLABO QKD Certification Path: QUANTUM COLLABO → QUANTUM AC → Communication Modem → Communication Operator Wireless Network → Alice QUANTUM SERVER → Wired Self Network (hybrid-QUANTUM CHANNEL) → Bob QUANTUM SERVER → QUANTUM AP → Wireless Self Network → Communication Modem → QUANTUM COLLABO
대용량 데이터 전송 : QUANTUM COLLABO → QUANTUM AC → 통신모뎀 → 무선자가망 → QUANTUM AP → Bob QUANTUM SERVER → 유선자가망(hybrid-QUANTUM CHANNEL) → Alice QUANTUM SERVER Massive data transmission: QUANTUM COLLABO → QUANTUM AC → Communication modem → Wireless self-network → QUANTUM AP → Bob QUANTUM SERVER → Wired private network (hybrid-QUANTUM CHANNEL) → Alice QUANTUM SERVER
hybrid-QUANTUM CHANNEL Two-Way-Ring Network는 hybrid-QUANTUM CHANNEL에서 양자결맞음(Quantum Coherence)과 같이 QUANTUM KEY 생성에 서로 50%씩 영향을 미치는 공유 상태를 특징으로 하는 대칭키 알고리즘(symmetric cryptographic algorithm)이다.The hybrid-QUANTUM CHANNEL Two-Way-Ring Network is a symmetric cryptographic algorithm characterized by a shared state that affects each other by 50% in QUANTUM KEY generation, such as quantum coherence in hybrid-QUANTUM CHANNEL. .
Alice/Bob HALF QUANTUM KEY(양자난수) : QUANTUM COLLABO ↔ QUANTUM AC ↔ 통신모뎀 ↔ 통신사업자 무선망 ↔ Alice QUANTUM SERVER Alice/Bob HALF QUANTUM KEY (Quantum Random Number) : QUANTUM COLLABO ↔ QUANTUM AC ↔ Communication Modem ↔ Telecommunication Operator Wireless Network ↔ Alice QUANTUM SERVER
대용량 데이터 전송 : QUANTUM COLLABO → 통신모뎀 → 무선자가망 → QUANTUM AP → Bob QUANTUM SERVER → 유선자가망(hybrid-QUANTUM CHANNEL) → Alice QUANTUM SERVERMassive data transmission: QUANTUM COLLABO → Communication modem → Wireless self network → QUANTUM AP → Bob QUANTUM SERVER → Hybrid-QUANTUM CHANNEL → Alice QUANTUM SERVER
통신 사업자망을 통해 보안성 높게 개인(대칭)키를 전송하고, 비면허주파수 폐쇄형 무선자가망 AP를 통해 공개키로 암호화한 대용량 데이터를 전송하는 QUANTUM KEY QKD(Quantum Key Distribution) 기술이다.It is a QUANTUM KEY QKD (Quantum Key Distribution) technology that transmits a private (symmetric) key with high security through the network of a telecommunication service provider and transmits large amounts of data encrypted with a public key through an unlicensed frequency closed wireless self-network AP.
5G 무선망은 8K 감시카메라에서 촬영한 UHD급 영상데이터를 전송하는데 문제가 없으나 데이터 트래픽에 대한 부담으로 데이터요금이 많이 발생할 수 밖에 없었고, 유선 네트워크망에 연결된 폐쇄형 무선자가망 AP를 통해 데이터를 전송할 경우 보안에 취약한 문제점이 발생하는 문제점을 해결한다.The 5G wireless network has no problem in transmitting UHD-level video data captured by 8K surveillance cameras, but data charges were inevitably high due to the burden of data traffic. Resolves the problem of weak security when transmitting.
PUF(NFC) Chip 또는 PIN 데이터(PRNG)를 통해 비공개키(개인키, 복호키)를 생성하고, QRNG(TRNG) Chip를 통해 암호화한 OTP QUANTUM KEY를 이중화망을 통해 전송하는 것으로, 보안성이 높은 ISP 사업자 LTE 네트워크망 또는 LoRA(NB-IoT) 등 소물인터넷(IoST; Internet of Small Thing)을 통해 소용량 데이터의 양자암호 OTP 비공개키(개인키, 복호키)를 전송하고, 대용량의 영상데이터는 양자암호 OTP 공개키로 암호화하여 비면허주파수 폐쇄형 무선자가망 AP를 통해 전송 후 QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선(자치단체 CCTV)자가망을 통해 전송한다.It generates a private key (private key, decryption key) through a PUF (NFC) chip or PIN data (PRNG), and transmits the encrypted OTP QUANTUM KEY through a dual network through a QRNG (TRNG) chip. Quantum encryption OTP private key (private key, decryption key) of small data is transmitted through high ISP operator LTE network or Internet of Small Thing (IoST) such as LoRA (NB-IoT), and large amount of image data Quantum encryption OTP is encrypted with the public key and transmitted through the unlicensed frequency closed wireless self-network AP, and then transmitted through one of the wired (local government CCTV) self-network among QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL
별정통신사업자 면허가 없는 자치단체의 스마트시티 구축을 위한 공공분야 공익 목적의 폐쇄형 무선자가망 구축방법으로, 방범용 CCTV 유선자가망(고정 IP 임대망 포함)을 활용한 하이브리드(hybrid-QUANTUM Communication Channel) 양자통신 무선자가망 구축기술이다.Hybrid-QUANTUM Communication using CCTV wired private network (including fixed IP rental network) for crime prevention as a method of establishing a closed wireless self-network for the public interest for the purpose of establishing a smart city of a local government without a specific telecommunication business license. Channel) is a quantum communication wireless self-network construction technology.
본 발명은 무선통신 구간에 있어서, 면허주파수 ISP 사업자망과 비면허주파수 폐쇄형 무선자가망를 이용한 QUANTUM KEY QKD(Quantum Key Distribution) 기술을 가장 큰 특징으로, 유선자가망을 하이브리드 형태로 비면허주파수 자치단체 폐쇄형 자가망에 적용할 경우, 자치단체 입장에선 통신요금 발생을 최소화한 스마트 퀀텀시티 무선자가망을 구축할 수 있다.In the wireless communication section, the biggest feature of the present invention is the QUANTUM KEY QKD (Quantum Key Distribution) technology using the licensed frequency ISP operator network and the unlicensed frequency closed wireless self-network. When applied to a type of self-network, local governments can build a smart quantum city wireless self-network that minimizes communication charges.
(참고로. ISP 사업자는 데이터 요금을 통한 수익창출이 아닌 스마트시티 하이브리드망 구축을 통한 서비스 플랫폼 활성화를 통한 수익과 비면허주파수 폐쇄형 무선자가망 AP의 접속 데이터의 증가에 따른 자치단체 Back Haul 구축 및 OPEN-API 플랫폼 서버구축에서 더 큰 Business Model이 발생한다.) (For reference. ISP operators are not generating revenue through data charges, but rather profit from service platform activation through smart city hybrid network construction, and local government Back Haul construction and A larger business model occurs in the OPEN-API platform server construction.)
도 1~5는 본 발명의 일 실시 예 간략도
도 6은 IDQ QRNG Chip 탑재 TLS MODULE 일 예1 to 5 are simplified diagrams of an embodiment of the present invention;
6 is an example of TLS MODULE equipped with IDQ QRNG Chip
발명의 차별화된 특징으로, 본 발명은 LTE 면허대역과 와이파이(Wi-Fi) 주파수가 포함된 비면허대역을 묶어 데이터를 전송하는 LTE-LAA 주파수 묶음기술과는 별개의 기술분야이다.As a differentiating feature of the invention, the present invention is a separate technical field from LTE-LAA frequency bundling technology that transmits data by tying up LTE licensed bands and unlicensed bands including Wi-Fi frequencies.
종래 기술은 데이터 전송에 있어서, 트래픽에 따라 주파수를 선택하는 기술이지만,The prior art is a technique for selecting a frequency according to traffic in data transmission,
본 기술의 QUANTUM KEY는 면허대역으로, 데이터는 비면허대역 주파수를 선택하는 AC(Access Controller) 등이 적용된 QUANTUM COLLABO로 차별성을 갖는다.The QUANTUM KEY of this technology is a licensed band, and the data is differentiated as a QUANTUM COLLABO with AC (Access Controller) that selects an unlicensed band frequency.
목적 및 효과적으로, 통신사업자 측면에서 기지국 트래픽을 관리하기 위해 보조적으로 비면허주파수를 응용하는 것과 사용자 측면에서 비면허주파수를 활용하는데 있어서 보안을 강화하기 위한 이종망 응용 기술로 차별성을 갖는다.Purpose and effectively, the application of unlicensed frequency auxiliary to manage base station traffic from the telecom operator's point of view is differentiated from the heterogeneous network application technology to enhance security in using unlicensed frequency from the user's point of view.
산업상 이용분야에 있어서, 본 발명은 자치단체(개인) 등의 보안을 강화한 폐쇄형 무선자가망 구축분야이다.In the field of industrial use, the present invention is a field of constructing a closed wireless self-network with enhanced security of local governments (individuals).
해결하고자 하는 과제에 있어서, 본 발명은 하이브리드 양자통신망에서 보안성을 강화하기 위해 QRNG Chip을 적용한 QUANTUM KEY 분배 기술로 통신(데이터)비용을 최소화하기 위한 과제를 해결하는 것을 목적으로 한다.In the task to be solved, the present invention aims to solve the task for minimizing communication (data) cost with QUANTUM KEY distribution technology to which QRNG Chip is applied to enhance security in a hybrid quantum communication network.
결론적으로, 종래의 Multiplexing Mode, Diversity Mode 등 어떤 형태이더라도 전송하고자 하는 데이터를 Licensed Band 또는 Unlicensed Band 중 어느 하나를 선택하는 기술과 달리 본 발명은 통신사업자 Licensed Band 3G, 4G, 5G 중 어느 하나의 보안채널을 통해 QUANTUM KEY를 전송하고, 전송하고자 하는 데이터는 Unlicensed Band 폐쇄형 무선자가망을 통해 전송하는 것으로 이종망을 명확히 분리하는 차별적인 출발에서 '목적' '배경' 과제' '수단' '효과'를 달리한다.In conclusion, unlike the technology of selecting either the Licensed Band or the Unlicensed Band for data to be transmitted in any form, such as the conventional Multiplexing Mode, Diversity Mode, etc., the present invention provides the security of any one of 3G, 4G, and 5G service providers Licensed Band. The QUANTUM KEY is transmitted through the channel, and the data to be transmitted is transmitted through the unlicensed band closed wireless self-network. From a differentiated start that clearly separates heterogeneous networks, 'purpose' 'background' task' 'means' 'effect' change the
본 발명에 적용된 키 생성 알고리즘에 의해 생성되는 QUANTUM KEY는 3개로 구성된다.The QUANTUM KEY generated by the key generation algorithm applied to the present invention consists of three pieces.
Alice QUANTUM SERVER와 QUANTUM COLLABO 사이에 저장된 대칭키 알고리즘(symmetric cryptographic algorithm)의 동일한 대칭키(SYMMETRIC KEY) 및 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)으로 생성된 비대칭 개인키(PRIVATE KEY) 및 비대칭 공개키(PUBLIC KEY)로 대칭키, 개인키, 공개키 3가지로 구성된다.The same symmetric key (SYMMETRIC KEY) of a symmetric cryptographic algorithm stored between Alice QUANTUM SERVER and QUANTUM COLLABO, and an asymmetric private key (PRIVATE KEY) and an asymmetric public key ( PUBLIC KEY) consists of three types: a symmetric key, a private key, and a public key.
QRNG(Quantum Random Number Generator)를 통해 생성된 난수 시드(Seed)로 대칭키를 생성 후 데이터 통신 암/복호화키로 사용한다.A symmetric key is generated from a random number seed generated through QRNG (Quantum Random Number Generator) and then used as a data communication encryption/decryption key.
PUF(Phisycally Unclonable Function)의 PIN 데이터를 시드(Seed)로 생성한 개인키와 QRNG를 통해 생성한 양자난수 시드(Seed)로 개인키를 암호화 생성한 공개키 쌍은 OTP(One Time Password) 로그인(Log In) 네트워크망 연결하는 목적으로 생성하는 1회용 패스워드이다.The private key generated from the PUF (Physycally Unclonable Function) PIN data as a seed and the public key pair generated by encrypting the private key with the quantum random number seed generated through QRNG is an OTP (One Time Password) login ( Log In) A one-time password created for the purpose of connecting to a network.
일 예로, PUF PIN 데이터를 시드(Seed)로 개인키를 생성하고 양자난수로 베타적 논리합(EX-OR) 암호화 연산자로 암호화하여 공개키를 생성한 후 공개키로 암호화한 데이터는 개인키와 상기 양자난수 및 암호화 연산자(EX-OR)를 알고 있으면 역연산하여 복호화가 가능하다.For example, a private key is generated from PUF PIN data as a seed, and a public key is generated by encrypting it with a quantum random number beta-OR (EX-OR) encryption operator. Then, the data encrypted with the public key is the private key and the quantum If you know the random number and the encryption operator (EX-OR), you can decrypt it by performing the reverse operation.
본 발명에서 키생성을 위한 양자난수는 자체 메모리에 저장하였다가 복호화할 때 사용하며, Alice 및 Bob 사이에 동일한 암호화 연산자, 함수식, 해시함수를 사용하여 복호화한다.In the present invention, the quantum random number for key generation is stored in its own memory and used for decryption, and it is decrypted using the same encryption operator, function expression, and hash function between Alice and Bob.
Alice와 Bob 사이의 QUANTUM KEY QKD(Quantum Key Distribution) 기술이 아닌, non-QUANTUM CHANNEL, QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL로 구성된 유선 양자네트워크망과 5G 무선네트워크망에서 Eve 단일 QUANTUM KEY에 대한 유/무선 이종(異種) 망간 및 면허/비면허주파수 무선통신망 사이의 QKD(Quantum Key Distribution) 기술로, 보안성을 극대화 하면서 데이터 요금이 최소화로 발생하기 위한 기술을 중요한 특징으로 한다.QUANTUM KEY between Alice and Bob, not QKD (Quantum Key Distribution) technology, but wired/wireless for Eve single QUANTUM KEY in wired quantum network consisting of non-QUANTUM CHANNEL, QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL and 5G wireless network It is a QKD (Quantum Key Distribution) technology between heterogeneous manganese and licensed/unlicensed frequency wireless communication networks, and it is an important feature of technology for minimizing data charges while maximizing security.
즉, UHD 카메라에서 촬영되는 영상데이터를 통신사업자 5G 무선망을 통해 데이터 전송을 최소화하여 데이터 통신요금을 최소화하는 것에 중요한 차별성이 있다. In other words, there is an important difference in minimizing data communication charges by minimizing data transmission of video data captured by UHD cameras through the 5G wireless network of telecommunication service providers.
특히, 하나의 채널(단일 유선 광통신망, 단일 주파수 무선통신망)을 통해 QUANTUM KEY를 Alice와 Bob 사이에 교환하는 종래의 QKD(Quantum Key Distribution)가 아닌, 면허/비면허 무선주파수 및 유/무선 이종네트워크망에서 Eve QUANTUM KEY가 단방향으로만 RING 방식으로 전송되는 One Way Ring Network을 특징으로 한다. In particular, it is not the conventional QKD (Quantum Key Distribution) that exchanges QUANTUM KEY between Alice and Bob through one channel (single wired optical communication network, single frequency wireless communication network), but licensed/unlicensed radio frequency and wired/wireless heterogeneous networks It features a One Way Ring Network in which the Eve QUANTUM KEY is transmitted in the RING method only in one direction in the network.
즉, 아래와 같은 데이터 전송경로를 특징으로 한다.That is, the data transmission path is characterized as follows.
QUANTUM COLLABO ⇒ 5G 통신모뎀 ⇒ 5G 무선네트워크망 ⇒ Alice 6G QUANTUM SERVER ⇒ 유선 양자통신망 ⇒ Bob 6G QUANTUM SERVER ⇒ QUANTUM 5G AP ⇒ 5G 통신모뎀 ⇒ QUANTUM COLLABO ⇒ 5G 통신모뎀 ⇒ QUANTUM 5G AP ⇒ Bob 6G QUANTUM SERVER ⇒ 유선 양자통신망 ⇒ Alice 6G QUANTUM SERVER
종래의,conventional,
'Alice 6G QUANTUM SERVER ⇔ 유선 양자통신망 ⇔ Bob 6G QUANTUM SERVER'와 차별화를 통해 통신요금을 최소화한 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템을 특징으로 한다.It features a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system that minimizes communication charges through differentiation from '
종래의 양자보안 통신에 있어서, Quantum Key 전송방식은 전용선과 전송거리의 한계가 있는 문제점을 해결하는 기술로, 물리적으로 유일한 PUF를 상호 인증하는 TRNG(QRNG)이 적용된 TIWIN USB를 통해 양자역학이 적용 인증된 발명이다.In the conventional quantum security communication, the quantum key transmission method is a technology that solves the problem of the limitation of the exclusive line and the transmission distance, and quantum mechanics is applied through the TIWIN USB to which the TRNG (QRNG) that mutually authenticates the physically unique PUF is applied. It is a certified invention.
특히, 양자통신 채널이 형성되지 않은 ISP 사업자 네트워크망 상에서 Alice VPN과 Bob VPN이 암호화 통신을 할 경우 양자컴퓨터로 해킹이 가능한 종래의 문제점을 해결하기 위해 PUF의 Unique TRNG(QRNG)의 One Time Password 양자통신 양자결맞음을 이용하는 decoy-Quantum Certificate 기술이 적용된다.In particular, in order to solve the conventional problem of hacking with a quantum computer when Alice VPN and Bob VPN communicate encrypted on the ISP operator network where a quantum communication channel is not formed, PUF's Unique TRNG (QRNG) One Time Password quantum Decoy-Quantum Certificate technology using communication quantum coherence is applied.
또한, PUF 자체는 변형 복제가 불가능하지만 PUF Chip 자체를 타 단말기(보드)에 탑재 변조할 경우 위변조가 가능한 문제점을 e-FUSE SoC(Syste on Chip) 기술로 해결한다. In addition, the e-FUSE SoC (System on Chip) technology solves the problem that the PUF itself cannot be modified and copied, but forgery is possible when the PUF chip itself is mounted and modulated on another terminal (board).
상세히 설명하면, In detail,
Alice 양자보안 USB 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 (Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터에 Alice e-FUSE ID(IDentity Address)와 결합하여) 암호화한 Alice KEY를 Alice VPN을 통해 Bob 양자보안 USB 내부의 Bob VPN으로 전송한다.The Alice main controller (MCU) inside the Alice quantum security USB combines the Bob PIN data stored in the Alice PUF memory (PUF M/M) with the Alice e-FUSE ID (IDentity Address) with the Bob public key received through Alice VPN. ) Send the encrypted Alice KEY to Bob VPN inside Bob quantum security USB through Alice VPN.
Bob 양자보안 USB 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 (Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터에 Bob e-FUSE ID(IDentity Address)와 결합하여) 암호화한 Bob KEY를 Bob VPN을 통해 Alice 양자보안 USB 내부의 Alice VPN으로 전송한다.Bob's main controller (MCU) inside Bob's quantum security USB combines the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Bob e-FUSE ID (IDentity Address) with the Alice public key received through Bob VPN. ) The encrypted Bob KEY is sent to Alice VPN inside Alice quantum security USB through Bob VPN.
Alice 양자보안 USB 내부의 Alice 주제어부(MCU)는 Alice QUANTUM 공개키 암호화된 Bob KEY를 Alice 비공개키로 복호화함에 있어서, When the Alice main controller (MCU) inside the Alice quantum security USB decrypts the Alice QUANTUM public key encrypted Bob KEY with the Alice private key,
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터에 Bob e-FUSE ID와 베타적 논리합(EX-OR) 결합한 Alice 비공개키를 생성하였기 때문에 복호화가 가능한 것으로, Alice PIN 데이터 및 SOC 자체 Bob e-FUSE ID 중 어느 하나라도 일치하지 않을 경우 복호화가 불가능해 진다. Since the Alice Security CPU generated Alice private key by combining the Bob e-FUSE ID and the beta-OR (EX-OR) with the Alice PIN data, it is possible to decrypt the Alice PIN data and the SOC's own Bob e-FUSE ID. If any one of them does not match, decryption becomes impossible.
비공개키는 개인키, 복호키, PRIVATE KEY 등으로 통용되며, 공개키는 암호키, PUBLIC KEY로 통용된다.The private key is commonly used as a private key, decryption key, and PRIVATE KEY, and the public key is commonly used as an encryption key and PUBLIC KEY.
대칭키 암호 알고리즘(symmetric cryptographic algorithm)에 사용되는 암호학적 키는‘대칭키’라고 불리우며, 대칭키는 암호화와 복호화가 서로 동일한 1개의 키를 이용한다는 사실은 이미 이 발명이 속하는 기술분야에서 통상의 지식을 가진자(이하 ‘통상의 기술자’라 함)에게 주지관용의 기술적 사실이다. A cryptographic key used in a symmetric cryptographic algorithm is called a 'symmetric key', and the fact that a symmetric key uses one key for encryption and decryption is already common in the art to which this invention belongs. It is a technical fact common to those with knowledge (hereinafter referred to as 'common engineer').
일 예로, Alice와 Bob이 대칭키를 서로 공유하고 Alice가 대칭키로 데이터를 암호화하여 Bob에게 전송하면, Bob은 같은 대칭키로 복호화한다. For example, when Alice and Bob share a symmetric key and Alice encrypts data with the symmetric key and transmits it to Bob, Bob decrypts it with the same symmetric key.
또한, 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)은 ‘개인키(private key)’와 이 개인키에 수학적으로 상응하는 ‘공개키(public key)’라는 키쌍이 존재하며, 공개키로 암호화를 수행하고, 상응하는 개인키로 복호화를 수행한다는 사실은 통상의 기술자에게 주지관용의 기술적 사실이다.In addition, in an asymmetric cryptographic algorithm, a 'private key' and a key pair called 'public key' mathematically corresponding to this private key exist, and encryption is performed with the public key, The fact that decryption is performed with the corresponding private key is a technical fact well known to those skilled in the art.
위 주지관용의 기술적 사실과 발명의 설명에 개시된 기술적 구성(키생성 방식 및 암/복호화 방식)을 살펴보면, 비대칭키 암호 알고리즘의 ‘공개키’와 ‘개인키’로 이뤄진 키 쌍을 의미하는 것으로 ‘공개키’와 ‘비공개키’ 사이의 기술적 혹은 수학적 상호 연관성은 Alic와 Bob 사이에 미리 규정된 베타적 논리합(EX-OR), 고정길이 해시함수, AES 암호화 등 통상의 기술자에게 주지관용 기술을 적용하여 본 발명에서는 청구범위로 한정하지 않으나, 발명의 이해를 위해 베타적 논리합(EX-OR)을 대표적인 일 실시 예로 설명을 한다. Looking at the technical facts (key generation method and encryption/decryption method) disclosed in the above general knowledge and description of the invention, it refers to a key pair consisting of a 'public key' and a 'private key' of the asymmetric key encryption algorithm. The technical or mathematical correlation between the 'public key' and the 'private key' is applied to those of ordinary skill in the art, such as the predefined beta-OR (EX-OR) between Alic and Bob, a fixed-length hash function, and AES encryption. Therefore, the present invention is not limited to the claims, but for the purpose of understanding the invention, beta-OR (EX-OR) will be described as a representative example.
즉,‘공개키’와‘비공개키' 사이의 기술적 혹은 수학적 상호 연관성과 복호화에 있어서, 베타적 논리합(EX-OR) 등 다양한 공지기술 또는 공지된 연산자, 수학식 적용이 가능하다.That is, in the technical or mathematical correlation and decryption between the 'public key' and the 'private key', various well-known technologies such as beta OR (EX-OR) or well-known operators and equations can be applied.
일 예로, 초소형의 PUF(Phisycally Unclonable Function) Chip과 QRNG(Quantum Random Number Generator) Chip을 이용한 보안키 생성 및 분배 관련으로 반도체 제조공정상 발생하는 공정편차를 통해 PUF Chip으로 부터 PIN(Personal Identification Number) 데이터를 추출하여 난수 시드(Seed)로 비공개키(개인키, 복호키, PRIVATE KEY)를 생성한다.For example, PIN (Personal Identification Number) data from the PUF chip through process deviations that occur in the semiconductor manufacturing process related to the generation and distribution of security keys using an ultra-small Physically Unclonable Function (PUF) Chip and a Quantum Random Number Generator (QRNG) Chip extract and generate a private key (private key, decryption key, PRIVATE KEY) as a random number seed.
PUF Chip으로 부터 공급받는 PIN(Personal Identification Number) 데이터를 시드(Seed)로 비공개키를 생성하는 것뿐만아니라, 예측 불가능한 무작위 양자(자연)난수를 시드(Seed)로 비공개키를 생성 및 프로그램에 의해 생성된 의사난수를 시드(Seed)로 비공개키 생성이 가능하다.In addition to generating a private key using the PIN (Personal Identification Number) data supplied from the PUF Chip as a seed, an unpredictable random quantum (natural) random number is used as a seed to generate a private key and program It is possible to generate a private key by using the generated pseudo-random number as a seed.
상기 방법에 의해 생성된 비공개키는 PIN(Personal Identification Number) 데이터, QRNG를 통해 생성한 양자난수, TRNG를 통해 생성한 자연난수, PRNG를 통해 생성한 난수 시드(Seed)를 비공개키와 베타적 논리합(EX-OR) 연산하여 공개키(암호키, PUBLIC KEY)를 생성하고, 연산식 베타적 논리합(EX-OR)과 난수 시드(Seed)를 알고 있을 경우 비공개키(PRIVATE KEY, 개인키)로 암호화돤 데이터를 공개키(PUBLIC KEY)로 복호화가 가능한 것은 이 발명이 속하는 기술분야에서 통상의 지식을 가진자(이하 ‘통상의 기술자’라 함)에게 주지관용의 기술적 사실이 적용되는 것으로 청구범위로 한정하지 않는다.The private key generated by the above method is a beta OR of PIN (Personal Identification Number) data, a quantum random number generated through QRNG, a natural random number generated through TRNG, and a random number seed generated through PRNG with the private key. (EX-OR) to generate a public key (encryption key, PUBLIC KEY), and if you know the formula beta OR (EX-OR) and the random number seed, use the private key (PRIVATE KEY, private key) The fact that encrypted data can be decrypted with a public key (PUBLIC KEY) is a claim that a well-known and common technical fact is applied to a person having ordinary knowledge in the technical field to which this invention belongs (hereinafter referred to as a 'technical person') not limited to
QRNG를 통해 발생하는 무작위 양자난수를 통해 상기 비공개키(PRIVATE KEY, 개인키)를 암호화하여 공개키(PUBLIC KEY)를 생성한다. A public key (PUBLIC KEY) is generated by encrypting the private key (PRIVATE KEY, private key) through a random quantum random number generated through QRNG.
Sensor에서 측정되는 데이터를 공개키(PUBLIC KEY, 암호키)로 암호화 할 경우 비공개키(PRIVATE KEY, 복호키)를 통해서 원래의 Sensor에서 측정되는 데이터를 복원할 수 있다.When the data measured by the sensor is encrypted with the public key (PUBLIC KEY, encryption key), the data measured by the original sensor can be restored through the private key (PRIVATE KEY, decryption key).
"비공개키=개인키=복호키=PRIVATE KEY" 및 "공개키=암호키=PUBLIC KEY"로 동일한 개념이다."Private key=private key=decryption key=PRIVATE KEY" and "public key=encryption key=PUBLIC KEY" have the same concept.
일 실시 예로,In one embodiment,
감시카메라, TRNG 자연난수생성기, QUANTUM COLLABO, 무선 통신모뎀을 포함하여 구성되는 단말부;및A terminal unit comprising a surveillance camera, a TRNG natural random number generator, a QUANTUM COLLABO, and a wireless communication modem; and
QUANTUM 5G AP를 포함하여 구성되는 Bob 6G QUANTUM SERVER;및 유선 및 무선 네트워크망으로 연결된 Alice 6G QUANTUM SERVER로 구성되어, QUANTUM COLLABO은 내부 eFUSE Chip에서 Eve PIN 데이터(Eve PIN DATA)를 추출하여 해시함수(HASH)로 암호화하여 Eve 비공개키<HASH(Eve PIN DATA)>를 생성하며; Eve PIN 데이터(Eve PIN DATA) 및 Eve 비공개키<HASH(Eve PIN DATA)>는 QUANTUM COLLABO 및 Alice 6G QUANTUM SERVER에 저장하며; QUANTUM COLLABO는 TRNG 자연난수생성기로부터 자연난수(TRN)를 수신하여 Eve 비공개키<HASH(Eve PIN DATA)>를 상기 자연난수(TRN)로 암호화하여 Eve 공개키<HASH(Eve PIN DATA)+(TRN)>를 생성하며; 무선 통신모뎀은 QUANTUM COLLABO로부터 Eve 공개키<HASH(Eve PIN DATA)+(TRN)> 및 해시함수(HASH)를 수신하며; 무선 통신모뎀은 Eve 공개키로 암호화한 해시함수<(HASH(Eve PIN DATA)+(TRN))∥(HASH)>를 무선 네트워크망을 통해 Alice 6G QUANTUM SERVER로 전송하며; Alice 6G QUANTUM SERVER는 무선 네트워크망을 통해 Eve 공개키로 암호화한 해시함수<(HASH(Eve PIN DATA)+(TRN))∥(HASH)>를 수신하여 Eve 비공개키<HASH(Eve PIN DATA)>로 복호화하며; 상기 복호화된 해시함수(HASH)로 Eve 비공개키<HASH(Eve PIN DATA)>를 복호화하여 Alice 6G QUANTUM SERVER에 저장된 Eve PIN 데이터(Eve PIN DATA)와 일치할 경우, Alice 6G QUANTUM SERVER는 Eve 공개키로 암호화된 Eve PIN 데이터<HASH(Eve PIN DATA)+(TRN)∥(Eve PIN DATA)>를 유선 네트워크망을 통해 Bob 6G QUANTUM SERVER로 전송하며; Bob 6G QUANTUM SERVER는 Eve 공개키로 암호화된 Eve PIN 데이터<HASH(Eve PIN DATA)+(TRN)∥(Eve PIN DATA)>를 QUANTUM 5G AP를 통해 무선 통신모뎀으로 전송하며; 무선 통신모뎀은 QUANTUM COLLABO로 Eve 공개키로 암호화된 Eve PIN 데이터<HASH(Eve PIN DATA)+(TRN)∥(Eve PIN DATA)>를 전송하며; QUANTUM COLLABO은 Eve 공개키로 암호화된 Eve PIN 데이터<HASH(Eve PIN DATA)+(TRN)∥(Eve PIN DATA)>를 Eve 비공개키<HASH(Eve PIN DATA)>로 복호화하여 저장된 Eve PIN 데이터(Eve PIN DATA)와 일치하면, Eve 공개키로 암호화한 영상데이터<HASH(Eve PIN DATA)+(TRN)∥(영상데이터)>를 무선 통신모뎀으로 전송하며; 무선 통신모뎀은 Eve 공개키로 암호화한 영상데이터<HASH(Eve PIN DATA)+(TRN)∥(영상데이터)>를 QUANTUM 5G AP를 통해 Bob 6G QUANTUM SERVER로 전송하며; Bob 6G QUANTUM SERVER는 Eve 공개키로 암호화한 영상데이터<HASH(Eve PIN DATA)+(TRN)∥(영상데이터)>를 유선 네트워크망을 통해 Alice 6G QUANTUM SERVER로 전송하며; Alice 6G QUANTUM SERVER는 유선 네트워크망으로부터 Eve 공개키로 암호화한 영상데이터<HASH(Eve PIN DATA)+(TRN)∥(영상데이터)>를 수신하여 Eve 비공개키<HASH(Eve PIN DATA)>로 복호화한다.Consists of Bob 6G QUANTUM SERVER including QUANTUM 5G AP; and Alice 6G QUANTUM SERVER connected to wired and wireless networks, QUANTUM COLLABO extracts Eve PIN DATA from the internal eFUSE Chip, HASH) to generate an Eve private key <HASH(Eve PIN DATA)>; Eve PIN data (Eve PIN DATA) and Eve private key <HASH(Eve PIN DATA)> are stored in QUANTUM COLLABO and Alice 6G QUANTUM SERVER; QUANTUM COLLABO receives a natural random number (TRN) from a TRNG natural random number generator, encrypts the Eve private key <HASH(Eve PIN DATA)> with the natural random number (TRN), and encrypts the Eve public key <HASH(Eve PIN DATA)+(TRN) )> is created; The wireless communication modem receives an Eve public key <HASH(Eve PIN DATA)+(TRN)> and a hash function (HASH) from QUANTUM COLLABO; The wireless communication modem transmits the hash function <(HASH(Eve PIN DATA)+(TRN))|(HASH)> encrypted with the Eve public key to the Alice 6G QUANTUM SERVER through the wireless network; Alice 6G QUANTUM SERVER receives the hash function <(HASH(Eve PIN DATA)+(TRN))|(HASH)> encrypted with the Eve public key through the wireless network and uses the Eve private key <HASH(Eve PIN DATA)> decrypt; When the Eve private key <HASH(Eve PIN DATA)> is decrypted with the decrypted hash function (HASH) and it matches the Eve PIN data (Eve PIN DATA) stored in Alice 6G QUANTUM SERVER, Alice 6G QUANTUM SERVER uses the Eve public key Transmitting encrypted Eve PIN data <HASH(Eve PIN DATA)+(TRN)|(Eve PIN DATA)> to Bob 6G QUANTUM SERVER through a wired network; Bob 6G QUANTUM SERVER transmits Eve PIN data <HASH(Eve PIN DATA)+(TRN)|(Eve PIN DATA)> encrypted with Eve public key to the wireless communication modem through QUANTUM 5G AP; The wireless communication modem transmits Eve PIN data <HASH(Eve PIN DATA)+(TRN)|(Eve PIN DATA)> encrypted with Eve public key to QUANTUM COLLABO; QUANTUM COLLABO decrypts Eve PIN data <HASH(Eve PIN DATA)+(TRN)|(Eve PIN DATA)> encrypted with Eve public key with Eve private key <HASH(Eve PIN DATA)> and stores Eve PIN data (Eve PIN DATA), the video data <HASH(Eve PIN DATA)+(TRN)|(video data)> encrypted with the Eve public key is transmitted to the wireless communication modem; The wireless communication modem transmits the video data <HASH(Eve PIN DATA)+(TRN)|(video data)> encrypted with the Eve public key to the Bob 6G QUANTUM SERVER through the QUANTUM 5G AP; Bob 6G QUANTUM SERVER transmits video data <HASH(Eve PIN DATA)+(TRN)|(video data)> encrypted with Eve public key to Alice 6G QUANTUM SERVER through wired network; Alice 6G QUANTUM SERVER receives the video data <HASH(Eve PIN DATA)+(TRN)|(video data)> encrypted with the Eve public key from the wired network network and decrypts it with the Eve private key <HASH(Eve PIN DATA)> .
일 실시 예로,In one embodiment,
양자통신 채널(QUANTUM Communication Channel)QUANTUM Communication Channel
Alice QUANTUM SERVER와 Bob QUANTUM SERVER는 양자통신 채널을 형성한 네트워크망에 연결된다.Alice QUANTUM SERVER and Bob QUANTUM SERVER are connected to a network that forms a quantum communication channel.
Alice QUANTUM SERVER는 Alice QRNG에서 발생하는 무작위 양자난수를 수신하여 QUANTUM KEY를 생성하여 Alice QKD 및 Alice MASTER SERVER로 전송한다.Alice QUANTUM SERVER receives a random quantum random number generated from Alice QRNG, generates a QUANTUM KEY, and transmits it to Alice QKD and Alice MASTER SERVER.
Alice QKD는 상기 QUANTUM KEY를 양자통신 채널을 통해 Bob QKD로 전송한다.Alice QKD transmits the QUANTUM KEY to Bob QKD through a quantum communication channel.
Bob QUANTUM SERVER는 Bob QKD로부터 QUANTUM KEY를 수신하여 Bob MASTER SERVER로 전송한다.Bob QUANTUM SERVER receives QUANTUM KEY from Bob QKD and sends it to Bob MASTER SERVER.
비양자통신 채널(non-QUANTUM Communication Channel)Non-QUANTUM Communication Channel
Alice MASTER SERVER와 Bob MASTER SERVER는 양자통신 채널을 형성하지 않는 네트워크망에 연결된다.Alice MASTER SERVER and Bob MASTER SERVER are connected to a network that does not form a quantum communication channel.
양자보안 단말기는 MCU, QRNG, PUF, VPN, 메모리, 네트워크망 차단기로 구성되어 Alice 양자보안 단말기, Bob 양자보안 단말기로 구별된다.The quantum security terminal consists of MCU, QRNG, PUF, VPN, memory, and network network breaker, and is divided into Alice quantum security terminal and Bob quantum security terminal.
Alice 양자보안 단말기 내부의 Alice PUF로부터 Alice PIN 데이터를 추출하여 Bob 양자보안 단말기 내부의 Bob 메모리에 저장한다.Alice PIN data is extracted from the Alice PUF inside the Alice quantum secure terminal and stored in Bob's memory inside the Bob quantum secure terminal.
Bob 양자보안 단말기 내부의 Bob PUF로부터 Bob PIN 데이터를 추출하여 Alice 양자보안 단말기 내부의 Alice 메모리에 저장한다.The Bob PIN data is extracted from the Bob PUF inside the Bob quantum secure terminal and stored in Alice's memory inside the Alice quantum secure terminal.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice PUF에서 Alice PIN 데이터를 추출하여 Alice 개인키를 생성한다.The Alice MCU inside the Alice quantum security terminal extracts the Alice PIN data from the Alice PUF to generate the Alice private key.
Alice QRNG은 무작위 양자난수를 발생하여 Alice MCU로 전송한다.Alice QRNG generates a random quantum random number and sends it to Alice MCU.
Alice MCU는 상기 무작위 양자난수를 시드(seed)로 Alice 개인키를 EX-OR 암호화 연산하여 Alice 공개키를 생성한다.Alice MCU generates the Alice public key by performing an EX-OR encryption operation on the Alice private key using the random quantum random number as a seed.
Bob 양자보안 단말기 내부의 Bob MCU는 Bob PUF에서 Bob PIN 데이터를 추출하여 Bob 개인키를 생성한다.Bob MCU inside Bob's quantum security terminal extracts Bob PIN data from Bob PUF to generate Bob's private key.
Bob QRNG은 무작위 양자난수를 발생하여 Bob MCU로 전송한다.Bob QRNG generates a random quantum random number and sends it to Bob MCU.
Bob MCU는 상기 무작위 양자난수를 시드(seed)로 Bob 개인키를 EX-OR 암호화 연산하여 Bob 공개키를 생성한다.The Bob MCU generates the Bob public key by performing an EX-OR encryption operation on the Bob private key using the random quantum random number as a seed.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice 공개키를 Alice VPN을 통해 Bob VPN으로 전송하면, Bob 양자보안 단말기 내부의 Bob MCU는 Bob VPN으로부터 Alice 공개키를 수신한다.When the Alice MCU inside the Alice quantum security terminal transmits the Alice public key to Bob VPN through the Alice VPN, the Bob MCU inside the Bob quantum security terminal receives the Alice public key from the Bob VPN.
Bob 양자보안 단말기 내부의 Bob MCU는 Bob 공개키를 Bob VPN을 통해 Alice VPN으로 전송하면, Alice 양자보안 단말기 내부의 Alice MCU는 Alice VPN으로부터 Bob 공개키를 수신한다.When Bob MCU inside Bob quantum security terminal sends Bob public key to Alice VPN through Bob VPN, Alice MCU inside Alice quantum security terminal receives Bob public key from Alice VPN.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice VPN을 통해 수신한 Bob 공개키로 Alice 메모리에 저장된 Bob PIN 데이터를 암호화하여 Alice VPN을 통해 Bob 양자보안 단말기 내부의 Bob VPN으로 전송한다.The Alice MCU inside the Alice quantum security terminal encrypts the Bob PIN data stored in Alice's memory with the Bob public key received through the Alice VPN and transmits it to the Bob VPN inside the Bob quantum security terminal through the Alice VPN.
Bob 양자보안 단말기 내부의 Bob MCU는 Bob VPN을 통해 수신한 Alice 공개키로 Bob 메모리에 저장된 Alice PIN 데이터를 암호화하여 Bob VPN을 통해 Alice 양자보안 단말기 내부의 Alice VPN으로 전송한다.Bob MCU inside Bob's quantum security terminal encrypts the Alice PIN data stored in Bob's memory with the Alice public key received through Bob VPN and transmits it to Alice VPN inside the Alice quantum security terminal through Bob VPN.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice 공개키로 암호화된 Alice PIN 데이터를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF에서 Alice PIN 데이터를 추출한 Alice PIN 데이터가 일치하고, Bob 양자보안 단말기 내부의 Bob MCU는 Bob 공개키로 암호화된 Bob PIN 데이터를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF에서 추출한 Bob PIN 데이터가 일치 할 경우, Alice 양자보안 단말기에 연결된 Alice MASTER SERVER와 Bob 양자보안 단말기에 연결된 Bob MASTER SERVER 사이에 네트워크망 차단기를 로그인(LOG In) 연결한다.The Alice MCU inside the Alice quantum security terminal matches the Alice PIN data obtained by decrypting the Alice PIN data encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF, and Bob MCU inside the Bob quantum security terminal If the Bob PIN data encrypted with the Bob public key and the Bob PIN data decrypted with the Bob private key match the Bob PIN data extracted from the Bob PUF, the Alice MASTER SERVER connected to the Alice quantum security terminal and the Bob MASTER SERVER connected to the Bob quantum security terminal are identical. Connect the network network breaker in between.
일 실시 예로, In one embodiment,
반도체 제조 공정상에서 발생하는 물리적으로 유일한 고유의 하드웨어 핀(PIN)을 추출한 PIN 데이터를 e-FUSE가 추출하여 프로그램하여 ID를 부여하고 재추출이 불가능하게 e-FUSE 핀을 차단(short circuit)하여 반도체 칩(System On Chip)의 유니크 ID를 부여한다.e-FUSE extracts and program the PIN data from the physically unique hardware pin (PIN) generated during the semiconductor manufacturing process to give an ID, and short circuit the e-FUSE pin to prevent re-extraction. Gives a unique ID of the chip (System On Chip).
PUF Chip은 반도체 제조 공정상에서 발생하는 물리적으로 유일한 고유의 하드웨어 핀(PIN)을 추출한 PIN 데이터를 추출할 수 있으며, PUF Chip을 복제할 경우 PUF 하드웨어 핀을 차단(short circuit)하는 것으로 정상적인 PIN 데이터의 재추출이 가능하다.The PUF Chip can extract PIN data from which the unique physically unique hardware pin (PIN) that occurs during the semiconductor manufacturing process is extracted. Re-extraction is possible.
데이터의 암호화/복호화에 있어서,In data encryption/decryption,
Alice PUF 메모리에 저장된 Bob PIN 데이터에 Alice e-FUSE ID와 결합하여 암호화한 Alice KEY로 암호화된 데이터는 Bob 보안 CPU가 상기 Bob PIN 데이터에 Alice e-FUSE ID와 결합한 Bob 개인키를 생성하여 Bob 보안 OTP 메모리에 저장된 Bob 개인키로 복호화된다. The data encrypted with the Alice KEY that is encrypted by combining with the Alice e-FUSE ID in the Bob PIN data stored in the Alice PUF memory is secured by the Bob security CPU by generating the Bob private key combined with the Alice e-FUSE ID in the Bob PIN data. It is decrypted with Bob's private key stored in the OTP memory.
일 실시 예로,In one embodiment,
Alice와 Bob은 2개 1조로 구성되고, 동일한 시스템을 추가(4개 2조)로 구성하여 같은 원리로 양방향 통신이 가능한 것으로 단방향 중심으로 설명하나, 역방향도 같은 원리로 양방향 통신이 가능한 것은 통상적인 방법으로 상세한 설명에서 일부 생략한다.Alice and Bob are composed of two sets, and the same system is configured with additional (two sets of four) and two-way communication is possible in the same principle. However, it is common for two-way communication in the reverse direction to be possible according to the same principle. As a method, some are omitted from the detailed description.
또한, 양방향 통신모뎀을 적용할 경우 Alice와 Bob은 2개 1조로 양방향 통신이 가능하다.In addition, when a two-way communication modem is applied, two-way communication is possible between Alice and Bob.
보안(PUF-QRNG TIWIN)USB는 Alice 양자보안 USB와 Bob 양자보안 USB가 한 세트로 구성된 것으로 구조와 기능은 동일하다. Security (PUF-QRNG TIWIN) USB consists of Alice quantum security USB and Bob quantum security USB as a set, and the structure and function are the same.
양자인증서(QC)의 전달 방향에 따라, 보안(PUF-QRNG TIWIN)USB 내부의 디버거(QC-DEBUGGER)는 수신부에서만 작동하나, 동일한 보안(PUF-QRNG TIWIN)USB인 관계로 구조적으로 동일하게 설명한다.According to the delivery direction of the quantum certificate (QC), the debugger (QC-DEBUGGER) inside the secure (PUF-QRNG TIWIN) USB works only on the receiving part, but it is structurally the same as it is the same secure (PUF-QRNG TIWIN) USB. do.
또한, 양자통신 채널이 2개 채널로 양방향 통신일 경우, 디버거(QC-DEBUGGER)도 역시 똑같이 2개 보안(PUF-QRNG TIWIN)USB에서 같은 작동을 하는 TIWIN USB이다.In addition, if the quantum communication channel is two-way communication with two channels, the debugger (QC-DEBUGGER) is also a TIWIN USB that works the same in the two secure (PUF-QRNG TIWIN)USB.
한 쌍의 보안(PUF-QRNG TIWIN)USB 내부의 Aice VPN과 Bob VPN은 오직 한 쌍의 보안(PUF-QRNG TIWIN)USB 사이에서만 통신이 되게 하는 특징을 갖는다. Aice VPN and Bob VPN inside a pair of secure (PUF-QRNG TIWIN)USB have a feature that allows communication only between a pair of secure (PUF-QRNG TIWIN)USB.
양자난수 발생기 QRNG(Quantum Random Number Generator)는 Photon을 half mirror를 통과시켜 Single-photon detectors를 통해 감지되고 Quantum의 변조, 복제를 모니터링 한다.Quantum Random Number Generator QRNG (Quantum Random Number Generator) passes a photon through a half mirror, detects it through single-photon detectors, and monitors the modulation and duplication of the quantum.
Quantum-APPLIANCE를 통해 난수를 읽고 파일에 저장하거나 화면에 표시하며 Libraries를 통해 양자난수 발생기 QRNG를 액세스한다.It reads random numbers via Quantum-APPLIANCE, saves them to a file or displays them on the screen, and accesses the quantum random number generator QRNG via Libraries.
Quantum-PLATFORM을 통해 보안 정책을 구현하고 모니터링 및 양자인증서 QC(Quantum Certificate)에 서명하여 암호생성기에 배포하며 QC-DEBUGGER를 수용하는 인증기관의 역할을 수행하는 암호화 플랫폼이다.It is an encryption platform that implements security policies through Quantum-PLATFORM, monitors and signs quantum certificates QC (Quantum Certificate) and distributes them to cryptographic generators, and plays the role of a certification authority that accepts QC-DEBUGGER.
양자키 분배기 QKD(Quantum Key Distribution)는 송신기 Alice QKD와 수신기 Bob QKD로 구성되어 광케이블 전용선을 통해 연결된 암호키 분배기로 송신기인 QKD-A(ALICE)는 레이져 빔을 방출하고 수신기인 QKD-B(BOB)는 외장형 단일광자 탐지기가 적용된다.Quantum Key Distribution (QKD) is an encryption key distributor that is composed of a transmitter Alice QKD and a receiver Bob QKD and is connected through an optical cable dedicated line. The transmitter QKD-A (ALICE) emits a laser beam, and the receiver QKD-B (BOB) ), an external single-photon detector is applied.
본 발명의 물리적 객체인증 PUF(Phisycally Unclonable Function) Chip과 자연난수를 발생하는 QRNG(Quantum Random Number Generator)를 통해 생성한 OTP(One Time Password) 인증 보안은 양자컴퓨터로도 해킹이 불가능한 최고의 보안성을 갖는다. The OTP (One Time Password) authentication security generated by the physical object authentication PUF (Physically Unclonable Function) Chip of the present invention and QRNG (Quantum Random Number Generator) that generates natural random numbers provides the highest security that cannot be hacked even with a quantum computer. have
초소형의 PUF(Phisycally Unclonable Function) Chip과 QRNG(Quantum Random Number Generator) Chip을 이용한 보안키 생성 및 분배 관련으로 반도체 제조공정상 발생하는 공정편차를 통해 PUF Chip으로 부터 PIN(Personal Identification Number) 데이터를 추출하여 개인키를 생성하고, QRNG를 통해 발생하는 무작위 양자난수를 통해 상기 개인키를 암호화하여 공개키를 생성한다.By extracting PIN (Personal Identification Number) data from the PUF chip through process deviations that occur in the semiconductor manufacturing process in relation to the generation and distribution of security keys using an ultra-small PUF (Physycally Unclonable Function) Chip and QRNG (Quantum Random Number Generator) Chip, A private key is generated, and a public key is generated by encrypting the private key through a random quantum random number generated through QRNG.
Sensor에서 측정되는 데이터를 공개키로 암호화 할 경우 개인키를 통해서 원래의 Sensor에서 측정되는 데이터를 복원할 수 있다.When the data measured by the sensor is encrypted with the public key, the data measured by the original sensor can be restored through the private key.
장치 간에 사물지능통신을 수행함에 있어서 사물지능통신을 수행하는 장치 스스로가 안전한 PIN 또는 패스워드를 자체적으로 생성하여 보유하여, 지식 기반의 인증을 수행할 수 있다.In performing IoT communication between devices, the device performing intelligent communication may generate and hold a secure PIN or password by itself, thereby performing knowledge-based authentication.
이러한 지식 기반 인증을 위해, 장치에는 외부의 보안 공격에 강인하면서도, 무작위의 고유한 PIN을 생성하는 PUF(Physical unclonable Functions)가 포함될 수 있다.For such knowledge-based authentication, the device may include physical unclonable functions (PUFs) that generate a unique, random PIN while being robust against external security attacks.
일 실시 예에 따르면, PUF는 지식 기반 인증을 위한 인증 키로 사용될 수 있는 PIN을 생성한다. 이 PIN은 PUF 제조 공정 중 발생하는 공정 편차에 의해 생성되는 무작위의 디지털 값일 수 있다.According to an embodiment, the PUF generates a PIN that can be used as an authentication key for knowledge-based authentication. This PIN may be a random digital value generated by process variations that occur during the PUF manufacturing process.
또한, 이 PIN은 한 번 생성된 이후 그 값이 주변 환경에 따라 변경되지 않는 시불변(Time-invariant)의 디지털 값일 수 있다. 이러한 PIN은 외부로 노출되지 않으므로, 일 실시 예에 따르면 장치의 인증 체계에 대한 보안 위협에 대한 방지가 가능하다.In addition, the PIN may be a time-invariant digital value whose value is not changed according to the surrounding environment after being generated once. Since such a PIN is not exposed to the outside, according to an embodiment, it is possible to prevent a security threat to the authentication system of the device.
장치가 통신 인터페이스를 통해 다른 장치와 사물지능통신을 수행하는 경우, 인증부는 PUF에 의해 자체적으로 생성되는 상기 PIN을 수신하여 지식 기반 인증을 수행할 수 있다.In case the device performs IoT communication with another device through the communication interface, the authenticator may receive the PIN generated by the PUF and perform knowledge-based authentication.
일 실시 예에 따른 보안 인증에 있어서, 장치는 비밀키 모듈과 개인키 모듈을 포함할 수 있다. 여기서, 비밀키 모듈 및 개인키 모듈 중 적어도 하나는 PUF를 포함할 수 있다.In the security authentication according to an embodiment, the device may include a private key module and a private key module. Here, at least one of the private key module and the private key module may include a PUF.
일 실시 예에 따르면, 비밀키 모듈 및 개인키 모듈 각각은 자신의 고유한 PUF를 가지며, 각각의 PUF는 물리적 특성 자체로부터 비밀키(secret key)와 개인키(private key)를 갖는다. 이하에서는 이러한 비밀키 및/또는 개인키를 PIN으로 표현하기도 하므로, PIN은 장치의 보안 인증을 위해 사용되는 비밀키, 개인키 등 어느 것도 배제하지 않고 포함하는 개념으로 이해될 수 있다.According to an embodiment, each of the private key module and the private key module has its own PUF, and each PUF has a secret key and a private key from the physical characteristics themselves. Hereinafter, since such a private key and/or a private key is also expressed as a PIN, the PIN may be understood as a concept including, without excluding any, such as a private key and a private key used for device security authentication.
PUF는 공정변이로 발생하는 특성 편차를 이용하여 동일 설계 도면으로 제작하더라도 서로 다른 함수 값을 발생하는 회로로서, 일부 실시 예들에서는 사물지능통신 장치의 PIN을 생성하여 제공한다. 엄밀히는 PUF의 물리적 특성에 의해 생성된 디지털 값 자체가 아니라 이를 이용하여 PIN이 생성되는 것으로 볼 수도 있다.The PUF is a circuit that generates different function values even when manufactured with the same design drawing using characteristic deviations caused by process variations. In some embodiments, a PIN of an IoT device is generated and provided. Strictly, it can be seen that the PIN is generated using the digital value itself, not the digital value itself generated by the physical characteristics of the PUF.
이를 테면, 외부의 신뢰할 수 있는 소스로부터 주어지는 값을 시드(Seed)로 하여, 상기 PUF가 생성한 오리지널 디지털 값을 암호화한 결과 값을 상기 PIN으로 할 수도 있다.For example, a value given from an external trusted source may be used as a seed, and a result value obtained by encrypting the original digital value generated by the PUF may be used as the PIN.
이러한 과정에서 일 실시 예에 따르면, PUF가 제공하는 디지털 값 VPUF를 상기 시드(Seed)와 해시 함수에 넣는 방식을 이용한다. 따라서, 최종적으로 사용되는 PIN 값은 Hash (VPUF|| Seed)일 수 있다.In this process, according to an embodiment , a method of putting the digital value V PUF provided by the PUF into the seed and the hash function is used. Therefore, the finally used PIN value may be Hash (V PUF || Seed).
이러한 실시 예에 따르면, 어떤 경로로든 개인키가 유출되는 경우 상기 시드 값만을 변경함으로써 PIN을 쉽게 변경할 수 있으므로, 안전성과 편의성이 개선될 수 있다.According to this embodiment, when the private key is leaked through any path, the PIN can be easily changed by changing only the seed value, so that safety and convenience can be improved.
다만, 이러한 PIN 값 생성은 일부 실시 예에 불과하며, 실시 예들은 PUF가 생성한 디지털 값 자체를 PIN으로 사용하는 경우와 상기 PUF를 별도로 처리한 값을 PIN으로 사용하는 경우를 모두 포함한다. 이하에서는 PUF가 생성한 디지털 값을 처리하여 새로운 PIN을 만들어 내는 과정에 대해서 일일이 언급하지 않더라도 이러한 실시 예들을 모두 포함하여 내용이 이해되어야 한다.However, the generation of such a PIN value is only some embodiments, and the embodiments include both a case in which a digital value generated by the PUF itself is used as a PIN and a case in which a value obtained by separately processing the PUF is used as a PIN. Hereinafter, even if the process of generating a new PIN by processing the digital value generated by the PUF is not mentioned individually, the contents should be understood including all of these embodiments.
한편, PUF는 예측 불가능한 랜덤한 값을 갖기 때문에 장치의 PIN을 결정하는데 사용될 수 있으며, 이를 이용하면 외부에서 생성 주입하여 메모리에 저장할 때 발생할 수 있는 PIN의 사전 누출 문제를 방지할 수 있다.On the other hand, since the PUF has an unpredictable random value, it can be used to determine the PIN of the device, and by using this, it is possible to prevent a PIN leak problem that may occur when externally generated and injected and stored in the memory.
또한, PUF는 물리적으로 복제가 불가능하다는 특징을 가지고 있기 때문에 장치의 PIN 번호가 사후적으로 유출 또는 복제될 가능성도 제거할 수 있다.In addition, since the PUF has the feature that it is physically impossible to copy, the possibility that the PIN number of the device is leaked or copied can also be eliminated.
또한, PUF가 생성하는 PIN 값은 랜덤성이 뛰어나고 실시 예들에서는 한 번 생성한 값이 시간에 따라 변하지 않는 신뢰할 수 있는 것이다. In addition, the PIN value generated by the PUF has excellent randomness, and in embodiments, a value generated once is reliable and does not change with time.
일 실시 예에 따르면, 시리얼번호 저장부에는 장치의 제조 공정에서 공장(Factory)가 제공하는 기기의 고유 값이 시리얼번호(Serial number)가 저장되며, 공장으로부터 장치의 고유한 시리얼번호가 I/O 인터페이스를 통해 장치에 입력되고, 최초 1회 - 정책에 따라 꼭 한 번일 필요는 없으나 보안 유지 상 한 번으로 지정될 수 있다 - 에 한해 비밀키 모듈로부터 비밀키가 공장 또는 관리 권한을 갖는 외부로 추출될 수 있다.According to an embodiment, in the serial number storage unit, a serial number is stored as a unique value of a device provided by a factory in the manufacturing process of the device, and the unique serial number of the device from the factory is I/O It is input to the device through the interface, and the secret key is extracted from the secret key module to the factory or outside with management authority only for the first time - it does not have to be once according to the policy, but can be designated once for security maintenance - can be
그리고, 일 실시 예에 따르면, PUF Chip은 SOC(System On Chip) 제조과정에서 발생하는 ENABLE 회로의 하드웨어핀 설정에 따른 단절신호를 추출하는 e-FUSE로 퓨즈부(e-FUSE)로 대체될 수 있다. 이러한 실시 예에서는, 상기한 최초 1회의 비밀키 추출 이후 퓨즈부가 비밀키 모듈과 I/O 인터페이스 사이의 연결을 물리적으로 차단하며, 이는 비가역적이다.And, according to an embodiment, the PUF chip can be replaced by an e-FUSE with an e-FUSE that extracts a disconnect signal according to the hardware pin setting of the ENABLE circuit generated in the SOC (System On Chip) manufacturing process. have. In this embodiment, the fuse unit physically blocks the connection between the secret key module and the I/O interface after the first extraction of the secret key, which is irreversible.
그러면 이제는 최초 1회 추출된 비밀키만 관리 권한이 있는 주체가 안전하게 관리하면 되고, 퓨즈부의 상기 차단 이후에 새롭게 장치의 비밀키가 추출되는 것은 불가능하다. 비밀키 모듈은 PUF에 의해 구현되어 물리적으로 복제 불가능하고, 전력분석 공격 등을 비롯한 다양한 역공학(Reverse engineering)에 의한 비밀키 추출이 불가능하거나 매우 어렵기 때문이다.Then, only the first-time extracted secret key only needs to be safely managed by the subject having the management authority, and it is impossible to newly extract the secret key of the device after the fuse is cut off. This is because the secret key module is implemented by PUF and cannot be physically copied, and it is impossible or very difficult to extract the secret key by various reverse engineering including power analysis attacks.
일 실시 예에 따르면 장치는 공개키 암호화/복호화 통신 방식에 사용될 개인키를 생성하는 개인키 모듈을 포함하며, 개인키 모듈은 상기 비밀키 모듈과는 별개의 PUF에 의해 개인키를 제공할 수 있다.According to an embodiment, the device includes a private key module that generates a private key to be used in a public key encryption/decryption communication method, and the private key module may provide a private key by a PUF separate from the private key module. .
이 개인키 모듈이 생성 및 제공하는 개인키는 외부와는 물리적으로 고립되어 있으며, 장치 제조에서부터 유통 및 사용에 이르기까지 외부로 추출되지 않는다. 물론, 앞서 설명한 비밀키 모듈과 같은 이유에서 물리적 공격에 의한 인위적인 개인키 유출도 불가능하다.The private key generated and provided by this private key module is physically isolated from the outside and is not extracted from the device manufacturing to distribution and use. Of course, for the same reason as the private key module described above, it is impossible to artificially leak the private key by a physical attack.
따라서, 개인키 모듈이 제공한 개인키의 외부 유출은 발생하지 않아 사물지능통신(M2M)에서 장치 스스로 생성한 PIN을 통한 기기 인증이 가능하다.Therefore, external leakage of the private key provided by the private key module does not occur, enabling device authentication through a PIN generated by the device itself in M2M.
일 실시 예에 따르면, 개인키 모듈이 생성한 개인키를 이용하여 공개키 생성부는 상기 공개키 암호/복호화 통신 방식에서 장치가 사용할 공개키(public key)를 생성하고, 이는 공개키 저장부에 저장된다. 공개키 저장부는 생성된 공개키를 저장하는 수단으로서 일 실시 예에 따르면 비휘발성(non volatile) 메모리일 수 있다.According to an embodiment, using the private key generated by the private key module, the public key generator generates a public key to be used by the device in the public key encryption/decryption communication method, and stores it in the public key storage unit. do. The public key storage unit is a means for storing the generated public key, and according to an embodiment, may be a non-volatile memory.
물론, 공개키 저장부는 선택적으로 채용 가능한(employed optionally) 구성으로, 다른 실시 예에서는 공개키 저장부 없이 인증이 필요한 경우마다 공개키 생성부가 생성한 공개키를 읽는 것도 가능하다.Of course, the public key storage unit is a configuration that can be employed optionally, and in another embodiment, it is also possible to read the public key generated by the public key generation unit whenever authentication is required without the public key storage unit.
암복호화 프로세서는 통상적인 데이터 암호화와 복호화를 수행하는 Crypto-coprocessor 등으로 이해될 수 있으며, 실제 암호화된 데이터를 통신 네트워크에서 외부와 주고 받는 구성은 통신 인터페이스이다.The encryption/decryption processor may be understood as a Crypto-coprocessor that performs normal data encryption and decryption, and the configuration for sending and receiving actual encrypted data to and from the outside in a communication network is a communication interface.
실시 예에 따르면, 상기 최초 1회 추출된 비밀키는 장치와 보안 통신을 수행할 정당한 권한이 있는 관리 주체인 인증 기관(Certification Authority, CA)과 공개키를 주고 받는 경우에 서로가 정당한 개체임을 확인하는 수단으로만 사용된다.According to an embodiment, it is confirmed that the first-time extracted secret key is a legitimate entity when exchanging a public key with a certification authority (CA), which is a management subject having a legitimate authority to perform secure communication with the device. used only as a means to
즉, 최초 1회이기는 하지만 이미 추출된 바 있는 비밀키가 직접 암복호화에 사용되는 것이 아니라, 비밀키는 비밀키 암호화 방식으로 공개키를 외부에 보내는 과정에서만 사용되어, 이중의 보안이 보장된다. 따라서 실제 기기 인증에 사용되는 개인키는 외부로 절대 노출되지 않는다.That is, although it is the first time, the previously extracted secret key is not directly used for encryption/decryption, but the secret key is used only in the process of sending the public key to the outside using the secret key encryption method, thereby ensuring double security. Therefore, the private key used for actual device authentication is never exposed to the outside.
이하에서는 공장에서 장치를 제조하는 과정, 장치가 유통 또는 배포되는 과정, 실제로 사용되면서 비밀키 통신 방식으로 공개키를 교환하는 과정, 실제로 장치가 CA나 다른 장치들과 서로의 정당성을 확인하여 통신을 수행하게 되는 과정에 대해 이하 구체적으로 설명한다.Hereinafter, the process of manufacturing a device in a factory, the process of distributing or distributing the device, the process of exchanging a public key using a secret key communication method while actually being used, and the process of actually communicating the device by verifying the validity of each other with the CA or other devices The process to be performed will be described in detail below.
먼저 PUF 구현에 대해 실시 예들에서 채택되는 차이점을 종래의 PUF 구현들과 비교하여 설명한 다음 구체적 구현의 일 예로 설명한다.First, differences adopted in the embodiments for PUF implementation will be described in comparison with conventional PUF implementations, and then described as an example of a specific implementation.
PUF(Physically Unclonable Function)는 예측 불가능한 (Unpredictable) 디지털 값을 제공할 수 있다. 개개의 PUF들은 정확한 제조 공정이 주어지고, 동일한 공정에서 제조되더라도, 상기 개개의 PUF들이 제공하는 디지털 값은 다르다.A Physically Unclonable Function (PUF) may provide an unpredictable digital value. Although individual PUFs are given an exact manufacturing process and are manufactured in the same process, the digital values provided by the individual PUFs are different.
따라서, PUF는 복제가 불가능한 POWF(Physical One-Way Function practically impossible to be duplicated)로 지칭될 수도 있고, 또한 PRF(Physical Random Function)으로 지칭될 수도 있다.Accordingly, PUF may be referred to as a POWF (Physical One-Way Function practically impossible to be duplicated) that cannot be duplicated, or may also be referred to as a PRF (Physical Random Function).
이러한 PUF는 보안 및/또는 인증을 위한 암호 키의 생성에 이용될 수 있다. 이를테면, 디바이스를 다른 디바이스와 구별하기 위한 유니크 키(Unique key to distinguish devices from one another)를 제공하기 위해 PUF가 이용될 수 있다.This PUF may be used to generate an encryption key for security and/or authentication. For example, PUF may be used to provide a unique key to distinguish devices from one another.
종래에는 이러한 PUF를 구현하기 위해 IC의 최 상위 레이어(top layer)에 랜덤하게 도핑(doping)된 입자를 이용하여 코팅(Coating) PUF를 구현하기도 하였고, 래치(latch)와 같은 하드웨어 칩에 일반적으로 쓰이는 CMOS 소자 내부의 공정 변이를 이용하여 FPGA에서도 구현 가능한 최근의 버터플라이(butterfly) PUF 등이 구현되기도 하였다.Conventionally, in order to implement such a PUF, a coated PUF has been implemented using randomly doped particles in the top layer of the IC, and is generally applied to hardware chips such as latches. Recent butterfly PUFs, which can be implemented in FPGAs, have also been implemented using process variations inside CMOS devices used.
그런데, PUF를 PIN 생성에 활용하는 응용이 상용화될 수 있도록 신뢰 가능하려면 PUF 회로 자체의 물리적 복제 불가능성, 생성된 PIN 값의 랜덤성 및 한 번 생성된 PIN의 값이 시간의 흐름에 따라 변화하지 않는 시불변성이 모두 보장되어야 한다.However, in order to be reliable so that the application that utilizes PUF for PIN generation can be commercialized, the physical replication impossibility of the PUF circuit itself, the randomness of the generated PIN value, and the once generated PIN value must not change over time. All time invariance must be guaranteed.
그러나 종래의 대부분의 PUF 회로들은 PUF 또는 PRF로서 충족시켜야 하는 랜덤성과 값의 시불변성 중 적어도 하나를 높은 수준으로 보장하지 못했기 때문에 상용화에 어려움이 있었다.However, since most of the conventional PUF circuits did not guarantee at least one of randomness and time invariance of values that must be satisfied as PUF or PRF at a high level, it was difficult to commercialize them.
실시 예들에서 사용되는 PUF는 이러한 종래의 문제점을 해결하여 시불변성과 랜덤성을 굉장히 신뢰할 수 있는 수준으로 보장하면서도 반도체 제작 과정에서 매우 낮은 단가로 생성 가능하다.The PUF used in the embodiments can be generated at a very low unit cost in a semiconductor manufacturing process while ensuring time invariance and randomness at a very reliable level by solving these conventional problems.
일 실시 예에 따르면, PUF가 생성한 PIN의 랜덤성과 시불변성을 동시에 만족하기 위해 반도체 공정에서 존재하는 노드들 사이의 단락 여부 등에 의한 무작위성을 이용하여 랜덤값을 만들어 낸다.According to an embodiment, in order to simultaneously satisfy the randomness and time-invariance of the PIN generated by the PUF, a random value is generated by using the randomness caused by the short circuit between nodes existing in the semiconductor process.
일 실시 예에 따른 PUF는 반도체 칩 내의 전도성 레이어(metal) 사이를 전기적으로 연결하기 위해 사용되는 콘택(contact) 또는 비아(via)의 크기를 공정에서 연결 여부가 확실한 크기, 즉 디자인 룰 보다 작은 형태로 구현하여, 그 단락 여부가 랜덤하게 결정되게 한다. 즉, 의도적으로 디자인 룰을 위반하여 랜덤한 PIN 값을 생성하는 것이다.The PUF according to an embodiment is a size smaller than the design rule, that is, whether the size of a contact or a via used to electrically connect between conductive layers in a semiconductor chip is clearly connected in a process. , so that the short circuit is determined randomly. That is, a random PIN value is generated by intentionally violating a design rule.
이러한 새로운 PUF 회로는 매우 간단한 단락 회로로 구성되기 때문에 별도의 추가적인 회로나 공정 중의 과정이 없고, 특별한 측정 장치도 필요 없기 때문에, 쉽게 구현이 가능하다. 그리고 공정의 특성을 이용하기 때문에 값의 랜덤성을 유지하면서 안정성을 충족시킬 수 있다.Since this new PUF circuit is composed of a very simple short circuit, there is no additional circuit or process in the process, and no special measuring device is required, so it can be easily implemented. And because the characteristics of the process are used, the stability can be satisfied while maintaining the randomness of the values.
반도체 칩의 제조과정 특히, 본 발명의 SOC(System On Chip) 제조 과정에서 발생하는 비아(또는 이네이블(Enable)회로)는 e-FUSE의 하드웨어 핀 설정을 PIN 데이터로 추출하여 개인키를 생성하고, 상기 개인키를 무작위 난수(QRNG)로 암호화한 공개키는 개인키(PIN 데이터)로 복호화가 된다.In the manufacturing process of the semiconductor chip, in particular, the via (or enable circuit) generated during the SOC (System On Chip) manufacturing process of the present invention extracts the hardware pin setting of e-FUSE as PIN data to generate a private key, , the public key obtained by encrypting the private key with a random random number (QRNG) is decrypted with the private key (PIN data).
본 발명의 SOC(System On Chip)을 특징으로 SOC 내의 하드웨어 핀 설정(via)에 따라서 생성하는 단절신호를 PIN 데이터로 추출하되 e-FUSE(electrical-FUSE)에 고유 ID를 부여하여 추출하는 것을 특징으로 한다.Characterized by the SOC (System On Chip) of the present invention, the disconnection signal generated according to the hardware pin setting (via) in the SOC is extracted as PIN data, but is extracted by giving a unique ID to the e-FUSE (electrical-FUSE) do it with
PUF 자체는 위변조가 불가능하지만 PUF Chip을 분리한 후 타 보드(단말기)에 장착하여 PUF가 탑재된 단말기(보드)가 변조될 수 있어, e-FUSE와 PUF를 일체형으로 탑재한 Security ENABLE 회로부를 포함하는 SOC Chip 형태로 개발한 최초의 기술을 특징으로 한다.PUF itself cannot be forged or altered, but after removing the PUF chip, it can be mounted on another board (terminal) so that the terminal (board) equipped with the PUF can be tampered with, including a Security ENABLE circuit with e-FUSE and PUF integrated. It is characterized by the first technology developed in the form of SOC Chip.
특히, e-FUSE 탑재 SOC을 통해 부팅하는 SOC와 PUF가 분리되어 있어도, 서로 유일하게 PUF의 물리적 유니크한 인증이 위변조 되어도 e-FUSE 탑재 SOC의 부트롬(Boot-ROM) 프로그램 인증이 상호 인증되어야 시스템 부팅이 가능한 Security ENABLE 회로부를 특징으로 하는 보안 CPU(Security CPU) 및 OTP(One-Time Programmable) e-FUSE를 특징으로 한다.In particular, even if the booting SOC and PUF are separated through the e-FUSE-equipped SOC, even if the unique physical authentication of the PUF is forged or forged, the boot-ROM program authentication of the e-FUSE-equipped SOC must be mutually authenticated. It features a Security CPU (Security CPU) and One-Time Programmable (OTP) e-FUSE featuring bootable Security ENABLE circuitry.
일 실시 예로,In one embodiment,
Alice 양자보안 USB는 Alice 시스템 버스(System Bus)로 연결된Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable FunctionMEMORY),Alice e-FUSE, Alice PUF Chip(Phisycally Unclonable FunctionChip)으로 구성된다.Alice quantum security USB is Alice Boot-ROM connected to Alice System Bus, Alice Main Controller (MCU), Alice System Storage (System M/M; System MEMORY), Alice VPN (Virtual Private Network) , Alice Debugger (QC-DEBUGGER), Alice I/O Port, Alice Serial Peripheral Interface Controller (SPI Controller), Alice True Random Number Generator (TRNG), Alice Secure CPU (Security CPU; Security Central Processing Unit), Alice Security OTP Memory (Security OTP M/M; Security One Time Password MEMORY), Alice PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Alice e-FUSE, Alice PUF Chip It is composed of (Phisycally Unclonable FunctionChip).
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로연결된Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어한다.Alice main controller (MCU) is Alice boot-ROM (Boot-ROM) connected to Alice system bus (System Bus), Alice system storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) , Alice I/O Port, and Alice Serial Peripheral Interface (SPI Controller) are controlled.
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice e-FUSE, Alice PUF Chip를 제어한다.Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), Alice e-FUSE, and Alice PUF Chip.
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장한다.The Alice system storage device (System M/M) stores programs and data necessary for the Alice main controller (MCU).
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어한다.The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control.
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장한다.Alice Boot-ROM stores programs and data necessary for booting Alice main controller (MCU).
Alice VPN은 네트워크망에 연결된 Bob 양자보안 USB 내부의 Bob VPN 사이에 1:1 암호화통신을 한다.Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob quantum secure USB connected to the network.
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어한다.Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control.
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를통해Alice 주제어부(MCU)로 전송한다.The Alice input/output device (I/O Port) is a switch connected to the network network, and it controls the network network ON/OFF and transmits the data received through the network network to the Alice main controller (MCU) through the Alice system bus.
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장한다. Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M).
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송한다.Alice Security CPU sends Alice PIN data to Alice main controller (MCU).
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터에 Bob e-FUSE ID(IDentity Address)와 결합한 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장한다.The Alice security CPU (Security CPU) generates the Alice private key combined with the Bob e-FUSE ID (IDentity Address) in the Alice PIN data and stores it in the Alice security OTP memory (Security OTP M/M).
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Alice 개인키를 암호화하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송한다.The Alice Security CPU encrypts the Alice private key with the random number generated by the Alice pure random number generator (TRNG), generates the Alice public key, and transmits it to the Alice main controller (MCU).
Bob 양자보안 USB는 Bob 시스템 버스(System Bus)로연결된Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random NumberGenerator),Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable FunctionMEMORY),Bob e-FUSE, Bob PUF Chip(Phisycally Unclonable FunctionChip)으로 구성된다.Bob Quantum Security USB is Bob Boot-ROM (Boot-ROM) connected by Bob System Bus, Bob Main Controller (MCU), Bob System Storage (System M/M; System MEMORY), Bob VPN (Virtual Private Network) , Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG; True Random NumberGenerator), Bob Secure CPU ( Security CPU; Security Central Processing Unit), Bob Security OTP Memory (Security OTP M/M; Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable FunctionMEMORY), Bob e-FUSE, Bob PUF Chip ( Phisycally Unclonable FunctionChip).
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로연결된Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어한다.Bob main control unit (MCU) connected by Bob system bus (Boot-ROM), Bob system storage (System M/M), Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER) , Bob I/O Port, and Bob Serial Peripheral Interface (SPI Controller).
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob e-FUSE, Bob PUF Chip를 제어한다.Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), Bob e-FUSE, and Bob PUF Chip.
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장한다.Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU).
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어한다.Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control.
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장한다.Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU).
Bob VPN은 네트워크망에 연결된 Alice 양자보안 USB 내부의 Alice VPN 사이에 1:1 암호화통신한다.Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice quantum secure USB connected to the network.
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; QuantumCertificate)를수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어한다.Bob Debugger (QC-DEBUGGER) receives a QuantumCertificate (QC) through Bob's I/O Port and controls network ON/OFF through Bob's I/O Port depending on whether or not authentication is performed. do.
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송한다.Bob I/O Port is a switch connected to the network network, and controls the network network ON/OFF and transmits the data received through the network network to the Bob main controller (MCU) through the Bob system bus.
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장한다.Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M).
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송한다.Bob Security CPU (Security CPU) sends Bob PIN data to Bob main control unit (MCU).
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터에 Alice e-FUSE ID(IDentity Address)와 결합한 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장한다.Bob security CPU (Security CPU) generates Bob private key combined with Alice e-FUSE ID (IDentity Address) in the Bob PIN data, and stores it in Bob's security OTP memory (Security OTP M/M).
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Bob 개인키를 암호화하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송한다.The Bob Security CPU (Security CPU) encrypts the Bob private key with the random number generated by the Bob pure random number generator (TRNG), generates the Bob public key, and transmits it to the Bob main controller (MCU).
(양자통신 채널(QUANTUM Communication Channel))(QUANTUM Communication Channel)
양자난수발생기(QRNG; QuantumRandomNumberGenerator)는무작위 양자난수를 발생하는 송신부의 Alice 양자난수발생기(Alice QRNG)와 수신부의 Bob 양자난수발생기(Bob QRNG)로 구성된다.A quantum random number generator (QRNG; QuantumRandomNumberGenerator) consists of an Alice quantum random number generator (Alice QRNG) in the transmitter and Bob QRNG in the receiver, which generate random quantum random numbers.
양자키분배기(QKD; QuantumKeyDistribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성된다.A quantum key distributor (QKD; QuantumKeyDistribution) is composed of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector.
양자플랫폼(Quantum Platform)은 Alice 양자난수발생기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; QuantumCertificate)를생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; QuantumCertificate)를수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성된다.The Quantum Platform generates a quantum certificate (QC; QuantumCertificate) with the quantum random number generated by Alice QRNG and sends it through the Alice Quantum Key Distributor (QKD). Aliec Quantum Platform and Bob It consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Quantum Key Distributor (QKD).
송신부(a transmitting set) Alice 양자난수발생기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송한다.Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform.
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 통합제어서버 및 Alice 양자키분배기(QKD)로 전송한다.Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to the integrated control server and Alice Quantum Key Distributor (QKD).
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송한다.Alice Quantum Key Distributor (QKD) transmits a quantum certificate (QC) to Bob Quantum Key Distributor (QKD) through a quantum communication channel connected by an optical cable.
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장된다.A receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform.
(비양자통신 채널(Non-QUANTUM Communication Channel))(Non-QUANTUM Communication Channel)
Alice 양자보안 USB와 Bob 양자보안 USB는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결된다. Alice Quantum Secure USB and Bob Quantum Secure USB are connected to ISP (Internet Service Provider) operator network that does not form a quantum communication channel.
Alice 양자보안 USB 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로연결된Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob 양자보안 USB 내부의 Bob VPN으로 전송한다.Alice main controller (MCU) inside Alice quantum security USB boots through Alice Boot-ROM connected to Alice System Bus, and according to the program stored in Alice system storage (System M/M), Alice Controls the serial peripheral interface (SPI Controller) to control the network network ON/OFF through the Alice input/output device (I/O Port), and sends the Alice public key received through the Alice Security CPU to Bob through Alice VPN. Send to Bob VPN inside quantum secure USB.
Bob 양자보안 USB 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice 양자보안 USB 내부의 Alice VPN으로 전송한다.Bob's Quantum Security USB's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and according to the program stored in Bob's System Storage (System M/M), Bob By controlling the serial peripheral interface (SPI Controller), the network network ON/OFF is controlled through Bob I/O Port, and the Bob public key received through Bob Security CPU (Security CPU) is transferred to Alice through Bob VPN. Transfer to Alice VPN inside quantum secure USB.
Alice 양자보안 USB 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 <Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터에 Alice e-FUSE ID(IDentity Address)와 결합>하여 암호화한 Alice KEY를 Alice VPN을 통해 Bob 양자보안 USB 내부의 Bob VPN으로 전송한다.Alice main controller (MCU) inside Alice quantum security USB <Combined with Alice e-FUSE ID (IDentity Address) to Bob PIN data stored in Alice PUF memory (PUF M/M)> with Bob public key received through Alice VPN and send the encrypted Alice KEY to Bob VPN inside Bob quantum security USB through Alice VPN.
Bob 양자보안 USB 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 <Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터에 Bob e-FUSE ID(IDentity Address)와 결합>하여 암호화한 Bob KEY를 Bob VPN을 통해 Alice 양자보안 USB 내부의 Alice VPN으로 전송한다.Bob's main controller (MCU) inside Bob's quantum security USB is Alice's public key received through Bob VPN <Combined with Bob e-FUSE ID (IDentity Address) to Alice PIN data stored in Bob PUF memory (PUF M/M)> and send the encrypted Bob KEY to Alice VPN inside Alice quantum security USB through Bob VPN.
Alice 양자보안 USB 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터 및 Alice e-FUSE ID(IDentity Address)가 일치하고, Bob 양자보안 USB 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터 및 Bob e-FUSE ID(IDentity Address)가 일치할 경우, Alice 양자보안 USB에 연결된 통합제어서버와 Bob 양자보안 USB에 연결된 로컬서버 사이에 I/O Port를 ON 접점 제어하여 네트워크망 로그인(LOG In) 연결하여 통합제어서버는 CPTED TOWER 내부의 감시카메라의 촬영 영상을 로컬서버를 통해 수신한다.The Alice main controller (MCU) inside the Alice quantum security USB matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key, the Alice PIN data extracted from the Alice PUF Chip, and the Alice e-FUSE ID (IDentity Address). and Bob's main controller (MCU) inside Bob's quantum security USB decrypts Alice KEY encrypted with Bob public key with Bob's private key, Bob PIN data, and Bob PIN data extracted from Bob PUF Chip, and Bob e-FUSE ID (IDentity Address) If , the integrated control server connected to the Alice quantum security USB and the local server connected to the Bob quantum security USB connect the I/O port ON contact control to connect the network network login (LOG In), and the integrated control server is inside the CPTED TOWER. Receives the captured video of the surveillance camera through the local server.
Alice 양자보안 USB 내부의 Alice 주제어부(MCU)는 통합제어서버로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob 양자보안 USB 내부의 Bob VPN으로 전송한다.The Alice main controller (MCU) inside the Alice quantum security USB receives the quantum certificate (QC) from the integrated control server, encrypts it with Bob's public key, and sends it to Bob VPN inside the Bob quantum security USB through Alice VPN.
Bob 양자보안 USB 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화한다.Bob Quantum Security The Bob main controller (MCU) inside the USB decrypts the quantum certificate (QC) by decrypting the quantum certificate (QC) encrypted with the Bob public key received through the Bob VPN with the Bob private key.
로컬서버는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob 양자보안 USB 내부의 Bob 디버거(QC-DEBUGGER)로 전송한다.The local server sends the quantum certificate (QC) stored in Bob's Quantum Platform to Bob's Debugger (QC-DEBUGGER) inside Bob's Quantum Secure USB.
Bob 양자보안 USB 내부의 Bob 주제어부(MCU)는 통합제어서버로 부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송한다.Bob's quantum security Bob's main control unit (MCU) inside the USB transmits the quantum certificate (QC) received from the integrated control server to Bob's debugger (QC-DEBUGGER).
Bob 디버거(QC-DEBUGGER)는 Alice 양자보안 USB로부터 전송받은 양자인증서(QC)와 상기 로컬서버로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점으로 전환 제어하여 통합제어서버와 로컬서버 사이에 네트워크망 연결을 차단한다.Bob Debugger (QC-DEBUGGER) controls the integrated control by switching the I/O port to the OFF contact when the quantum certificate (QC) received from Alice’s quantum security USB and the quantum certificate (QC) received from the local server do not match. Block the network connection between the server and the local server.
일 실시 예로,In one embodiment,
Alice 양자보안 단말기가 연결된 통합제어서버와 Bob 양자보안 단말기가 연결된 로컬서버는 네트워크망에 연결된다. The integrated control server to which Alice's quantum security terminal is connected and the local server to which Bob's quantum security terminal is connected are connected to the network.
양자보안 단말기는 MCU, TRNG, PUF, VPN, 메모리, 네트워크망 차단기로 구성되어 Alice 양자보안 단말기, Bob 양자보안 단말기로 구별된다.The quantum security terminal consists of MCU, TRNG, PUF, VPN, memory, and network network breaker, and is divided into Alice quantum security terminal and Bob quantum security terminal.
Alice 양자보안 단말기 내부의 Alice PUF로부터 Alice PIN 데이터를 추출하여 Bob 양자보안 단말기 내부의 Bob 메모리에 저장한다.Alice PIN data is extracted from the Alice PUF inside the Alice quantum secure terminal and stored in Bob's memory inside the Bob quantum secure terminal.
Bob 양자보안 단말기 내부의 Bob PUF로부터 Bob PIN 데이터를 추출하여 Alice 양자보안 단말기 내부의 Alice 메모리에 저장한다.The Bob PIN data is extracted from the Bob PUF inside the Bob quantum secure terminal and stored in Alice's memory inside the Alice quantum secure terminal.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice PUF에서 Alice PIN 데이터를 추출하여 Alice 개인키를 생성한다.The Alice MCU inside the Alice quantum security terminal extracts the Alice PIN data from the Alice PUF to generate the Alice private key.
Alice TRNG은 무작위 자연난수를 발생하여 Alice MCU로 전송한다.Alice TRNG generates a random natural random number and sends it to Alice MCU.
Alice MCU는 상기 무작위 자연난수로 Alice 개인키를 암호화하여 Alice 공개키를 생성한다.Alice MCU generates Alice public key by encrypting Alice private key with the random natural random number.
Bob 양자보안 단말기 내부의 Bob MCU는 Bob PUF에서 Bob PIN 데이터를 추출하여 Bob 개인키를 생성한다.Bob MCU inside Bob's quantum security terminal extracts Bob PIN data from Bob PUF to generate Bob's private key.
Bob TRNG은 무작위 자연난수를 발생하여 Bob MCU로 전송한다.Bob TRNG generates a random natural random number and sends it to Bob MCU.
Bob MCU는 상기 무작위 자연난수로 Bob 개인키를 암호화하여 Bob 공개키를 생성한다.Bob MCU generates Bob public key by encrypting Bob private key with the random natural random number.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice 공개키를 Alice VPN을 통해 Bob VPN으로 전송하면, Bob 양자보안 단말기 내부의 Bob MCU는 Bob VPN으로부터 Alice 공개키를 수신한다.When the Alice MCU inside the Alice quantum security terminal transmits the Alice public key to Bob VPN through the Alice VPN, the Bob MCU inside the Bob quantum security terminal receives the Alice public key from the Bob VPN.
Bob 양자보안 단말기 내부의 Bob MCU는 Bob 공개키를 Bob VPN을 통해 Alice VPN으로 전송하면, Alice 양자보안 단말기 내부의 Alice MCU는 Alice VPN으로부터 Bob 공개키를 수신한다.When Bob MCU inside Bob quantum security terminal sends Bob public key to Alice VPN through Bob VPN, Alice MCU inside Alice quantum security terminal receives Bob public key from Alice VPN.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice VPN을 통해 수신한 Bob 공개키로 Alice 메모리에 저장된 Bob PIN 데이터를 암호화하여 Alice VPN을 통해 Bob 양자보안 단말기 내부의 Bob VPN으로 전송한다.The Alice MCU inside the Alice quantum security terminal encrypts the Bob PIN data stored in Alice's memory with the Bob public key received through the Alice VPN and transmits it to the Bob VPN inside the Bob quantum security terminal through the Alice VPN.
Bob 양자보안 단말기 내부의 Bob MCU는 Bob VPN을 통해 수신한 Alice 공개키로 Bob 메모리에 저장된 Alice PIN 데이터를 암호화하여 Bob VPN을 통해 Alice 양자보안 단말기 내부의 Alice VPN으로 전송한다.Bob MCU inside Bob's quantum security terminal encrypts the Alice PIN data stored in Bob's memory with the Alice public key received through Bob VPN and transmits it to Alice VPN inside the Alice quantum security terminal through Bob VPN.
Alice 양자보안 단말기 내부의 Alice MCU는 Alice 공개키로 암호화된 Alice PIN 데이터를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF에서 Alice PIN 데이터를 추출한 Alice PIN 데이터가 일치 및 Bob 양자보안 단말기 내부의 Bob MCU는 Bob 공개키로 암호화된 Bob PIN 데이터를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF에서 추출한 Bob PIN 데이터가 일치 할 경우, Alice 양자보안 단말기에 연결된 통합제어서버와 Bob 양자보안 단말기에 연결된 로컬서버 사이에 I/O Port를 ON 접점 제어하여 네트워크망 로그인(LOG In) 연결한다.The Alice MCU inside the Alice quantum security terminal matches the Alice PIN data encrypted with the Alice public key and the Alice PIN data decrypted with the Alice private key and the Alice PIN data extracted from the Alice PUF, and the Bob MCU inside the Bob quantum security terminal If the Bob PIN data encrypted with Bob's public key is decrypted with the Bob's private key and the Bob PIN data extracted from Bob PUF match, it is transmitted between the integrated control server connected to the Alice quantum security terminal and the local server connected to the Bob quantum security terminal. I/O Port is controlled by ON contact to connect network network login (LOG In).
일 실시 예로,In one embodiment,
UHD 감시카메라는 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성된다.The UHD surveillance camera consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit.
단말부는 센서부(46), AMI(47), 하나 이상의 배전반(48), 배전반 우선순위절체기(49), 하나 이상의 방송장치(50), 방송장치 우선순위절체기(51), LED 가로/보안등(52), 디머(53), 단말 6G SECURITY ENGINE(54)으로 구성되고, 광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성된다.The terminal unit includes a
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성된다.The driving unit is composed of a
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성된다.The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성된다.The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37).
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성된다.The image analysis unit is composed of an
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성된다.The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43).
양자통신부는 Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), Non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), Hybrid-QUANTUM CHANNEL(60), Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN 통신모뎀(66)으로 구성된다.The quantum communication unit is
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성된다.The
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택한다.One of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter is selected by driving the
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변한다.By driving the
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변한다.The focus focus is changed through the
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송한다. The driving
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송한다.The image sensor inside the
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송한다.The
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생한다.The
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증한다.The network security
센서부(46)로부터 수집되는 센싱 데이터, AMI(47)로부터 측정되는 측정 데이터, 하나 이상의 배전반(48)으로부터 수집되는 배전반 상태정보 데이터, 하나 이상의 방송장치(50)로부터 수집되는 음성/영상 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 6G SECURITY ENGINE(54)으로 전송한다.Sensing data collected from the
단말 6G SECURITY ENGINE(54)는 측정 데이터, 배전반 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하고, Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN USB(65) 중 어느 하나로부터 배전반 우선순위절체기 제어데이터 또는 방송장치 우선순위절체기 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 6G SECURITY ENGINE(54)로 전송한다.The terminal 6G SECURITY ENGINE 54 transmits measurement data, switchboard status information data, voice/video data, and on/off data to
단말 6G SECURITY ENGINE(54)는 Bob 6G QUANTUM SERVER(55)로부터 배전반 우선순위절체기 제어데이터를 수신하여 LPWAN 통신모뎀(66)을 통해 배전반 우선순위절체기(49)로 전송 및 방송장치 우선순위절체기 제어데이터를 수신하여 방송장치 우선순위절체기(51)로 전송 및 디머 제어데이터를 수신하여 디머(53)로 전송하고, 배전반 우선순위절체기 제어데이터에 따라 배전반 우선순위절체기(49)를 ON/OFF 제어하여 하나 이상의 배전반(48)를 선택 운전하고, 방송장치 우선순위절체기 제어데이터에 따라 방송장치 우선순위절체기(51)를 ON/OFF 제어하여 하나 이상의 방송장치(50)를 선택하여 선택 방송하고, 디머 제어데이터에 따라 디머(53)를 통해 LED 가로/보안등(52)의 밝기를 디밍(Dimming)제어 한다.The terminal 6G SECURITY ENGINE 54 receives the switchboard priority changer control data from
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어한다.Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이다.The System Memory 24 is a System Memory in which the main
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장한다.The
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송한다.The
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터로 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수로 개인키를 암호화하여 공개키를 생성하여 Security OTP Memory(30)에 저장한다.
Bob 6G QUANTUM SERVER(55)는 Non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송한다.
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 UHD 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결한다.When the
SPI Controller(32)는 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller) 데이터 통신버스로 MCU(27)의 제어 데이터를 각부에 전송하는 통신버스로, MCU(27)의 제어로 SPI Controller(32)를 통해 Boot-ROM(31)을 부팅 또는 Network Switch를 ON접점 전환하여 네트워크망 로그인(Log In)/연결 한다.The
Alice QUANTUM SERVER(63)와 Bob QUANTUM SERVER(56)는 QUANTUM CHANNEL(59)로 연결된다.Alice QUANTUM SERVER (63) and Bob QUANTUM SERVER (56) are connected to QUANTUM CHANNEL (59).
QUANTUM 6G SECURITY ENGINE(64)에서 BB84 또는 COW(Coherent One Way) 중 어느 하나의 방법으로부터 QUANTUM KEY를 생성하여 Alice QUANTUM SERVER(63)로 전송한다.The
Alice QUANTUM SERVER(63)는 QUANTUM KEY를 QUANTUM CHANNEL(59)를 통해 Bob QUANTUM SERVER(56)로 전송한다.Alice QUANTUM SERVER (63) transmits the QUANTUM KEY to Bob QUANTUM SERVER (56) through the QUANTUM CHANNEL (59).
Bob QUANTUM SERVER(56)는 Bob 6G QUANTUM SERVER(55)를 거쳐 입출력부를 통해 Quantum Entanglement(36)로 전송한다.The
Quantum Entanglement(36)는 COW(Coherent One Way) 생성방법에 의해 생성된 QUANTUM KEY일 경우 영상 6G SECURITY ENGINE(35)로 전송한다.
영상 6G SECURITY ENGINE(35)은 Decoy Pulse(37)로 검증하여 양자얽힘 상태일 경우, 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 QUANTUM KEY로 영상데이터를 암호화하여 입출력부를 통해 Bob 6G QUANTUM SERVER(55)를 거쳐 Bob QUANTUM SERVER(56)로 전송한다.
Bob QUANTUM SERVER(56)는 상기 QUANTUM KEY로 암호화한 영상데이터를 QUANTUM CHANNEL(59)를 통해 Alice QUANTUM SERVER(63)로 전송한다.
Alice QUANTUM SERVER(63)는 6G SECURITY ENGINE(64)로부터 수신한 QUANTUM KEY로 상기 QUANTUM KEY로 암호화한 영상데이터를 복호화한다.Alice QUANTUM SERVER (63) decrypts the video data encrypted with the QUANTUM KEY with the QUANTUM KEY received from the 6G SECURITY ENGINE (64).
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 비양자통신 채널(Non-QUANTUM Communication Channel(58)) 및 양자통신 채널(QUANTUM Communication Channel(59))로 구성된 Hybrid-QUANTUM CHANNEL(60)에 연결된다.Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are hybrid- consisting of a non-quantum communication channel (Non-QUANTUM Communication Channel (58)) and a quantum communication channel (QUANTUM Communication Channel (59)). connected to QUANTUM CHANNEL (60).
Alice PUF-QRNG TWIN USB(65)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF Chip(Phisycally Unclonable Function Chip)으로 구성된다.Alice PUF-
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어한다.Alice main controller (MCU) consists of Alice Boot-ROM, Alice System Storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) connected to Alice System Bus. , Alice I/O Port, and Alice Serial Peripheral Interface (SPI Controller) are controlled.
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice PUF Chip를 제어한다.Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), and Alice PUF Chip.
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장한다.The Alice system storage device (System M/M) stores programs and data necessary for the Alice main controller (MCU).
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어한다.The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control.
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장한다.Alice Boot-ROM stores programs and data necessary for booting Alice main controller (MCU).
Alice VPN은 네트워크망에 연결된 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN 사이에 1:1 암호화통신을 한다.Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob PUF-
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어한다.Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control.
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를 통해 Alice 주제어부(MCU)로 전송한다.The Alice input/output device (I/O Port) is a switch connected to the network network, and it controls the network network ON/OFF and transmits the data received through the network network to the Alice main controller (MCU) through the Alice system bus.
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장한다.Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M).
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송한다.Alice Security CPU sends Alice PIN data to Alice main controller (MCU).
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터로 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장한다.The Alice security CPU (Security CPU) generates the Alice private key from the Alice PIN data and stores it in the Alice security OTP memory (Security OTP M/M).
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Alice 개인키를 암호화하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송한다.The Alice Security CPU encrypts the Alice private key with the random number generated by the Alice pure random number generator (TRNG), generates the Alice public key, and transmits it to the Alice main controller (MCU).
Bob PUF-QRNG TWIN USB(57)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random Number Generator), Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF Chip(Phisycally Unclonable Function Chip)으로 구성된다.Bob PUF-QRNG TWIN USB (57) is connected to Bob's System Bus (Boot-ROM), Bob's Master Controller (MCU), Bob's System Storage (System M/M; System MEMORY), and Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG) ), Bob Security CPU (Security Central Processing Unit), Bob Security OTP M/M (Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF It is composed of Chip (Physically Unclonable Function Chip).
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어한다.Bob main controller (MCU) is connected to Bob's System Bus (Boot-ROM), Bob's System Storage (System M/M), Bob's Virtual Private Network (VPN), and Bob's Debugger (QC-DEBUGGER). , Bob I/O Port, and Bob Serial Peripheral Interface (SPI Controller).
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob PUF Chip를 제어한다.Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), and Bob PUF Chip.
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장한다.Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU).
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어한다.Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control.
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장한다.Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU).
Bob VPN은 네트워크망에 연결된 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN 사이에 1:1 암호화통신을 한다.Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice PUF-
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어한다.Bob Debugger (QC-DEBUGGER) receives a Quantum Certificate (QC) through Bob's I/O Port and turns on/off the network through Bob's I/O Port depending on whether or not it is authenticated. Control.
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송한다.Bob I/O Port is a switch connected to the network network, and controls the network network ON/OFF and transmits the data received through the network network to the Bob main controller (MCU) through the Bob system bus.
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장한다.Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M).
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송한다.Bob Security CPU (Security CPU) sends Bob PIN data to Bob main control unit (MCU).
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터로 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장한다.Bob Security CPU (Security CPU) generates Bob private key with the Bob PIN data and stores it in Bob's security OTP memory (Security OTP M/M).
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Bob 개인키를 암호화하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송한다.The Bob Security CPU (Security CPU) encrypts the Bob private key with the random number generated by the Bob pure random number generator (TRNG), generates the Bob public key, and transmits it to the Bob main controller (MCU).
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)은 Hybrid-QUANTUM CHANNEL(60) 중 양자통신 채널(QUANTUM Communication Channel)에 연결된다.Alice PUF-
양자난수발생기(QRNG; Quantum Random Number Generator)는 무작위 양자난수를 발생하는 송신부의 Alice 양자난수발생기(Alice QRNG)와 수신부의 Bob 양자난수발생기(Bob QRNG)로 구성된다.A Quantum Random Number Generator (QRNG) is composed of an Alice Quantum Random Number Generator (Alice QRNG) in the transmitter and Bob QRNG in the Receiver for generating random quantum random numbers.
양자키분배기(QKD; Quantum Key Distribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성된다.Quantum Key Distribution (QKD) consists of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector.
양자플랫폼(Quantum Platform)은 Alice 양자난수발생기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; Quantum Certificate)를 생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성된다.The Quantum Platform is an Aliec Quantum Platform that generates a Quantum Certificate (QC) with quantum random numbers generated by Alice QRNG and transmits it through the Alice Quantum Key Distributor (QKD). It consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Bob Quantum Key Distributor (QKD).
송신부(a transmitting set) Alice 양자난수발생기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송한다.Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform.
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 Alice 마스터서버(Alice MASTER SERVER) 및 Alice 양자키분배기(QKD)로 전송한다.Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to Alice Master Server (Alice MASTER SERVER) and Alice Quantum Key Distributor (QKD).
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송한다.Alice Quantum Key Distributor (QKD) transmits a quantum certificate (QC) to Bob Quantum Key Distributor (QKD) through a quantum communication channel connected by an optical cable.
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장된다.A receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform.
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어, Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송한다.Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to an ISP (Internet Service Provider) operator network that does not form a quantum communication channel, and inside Alice PUF-QRNG TWIN USB (65) Alice's main controller (MCU) boots through the Alice boot-ROM connected to the Alice system bus, and according to the program stored in the Alice system storage device (System M/M), the Alice serial peripheral interface ( SPI Controller) to control the network network ON/OFF through the Alice I/O device (I/O Port), and the Alice public key received through the Alice Security CPU (Bob PUF-QRNG TWIN USB) through Alice VPN (57) to the internal Bob VPN.
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송한다.Bob PUF-QRNG TWIN USB(57) inside Bob's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and stores it in Bob's system storage (System M/M). According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob input/output device (I/O port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송한다.Alice PUF-
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송한다.Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob VPN, the Bob KEY that encrypted the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Alice public key received through Bob VPN. Through Alice PUF-
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치 및 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치하면, Alice PUF-QRNG TWIN USB(65)에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN USB(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결한다.Alice PUF-QRNG The Alice main controller (MCU) inside the
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송한다.Alice PUF-QRNG TWIN The Alice main controller (MCU) inside the
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화한다.Bob PUF-
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송한다.Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송한다.Bob PUF-
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN USB(65)로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 한다.Bob Debugger (QC-DEBUGGER) does not match the quantum certificate (QC) received from Alice PUF-QRNG TWIN USB (65) and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) I/ It is characterized in that it blocks the network connection between the Alice master server and the Bob master server by controlling the O Port as OFF contact point.
일 실시 예로,In one embodiment,
단말부는 센서부(46), AMI(47), 배전반(48), QUANTUM 5G AP(49), 방송장치(50), 비상벨(51), LED 가로/보안등(52), 디머(53), 단말 SINGLE USB(54)으로 구성된다.The terminal unit includes a
SINGLE USB(54)는 PCI Board 형태의 SINGLE MODULE로 대체할 수 있다.The SINGLE USB 54 can be replaced with a SINGLE MODULE in the form of a PCI Board.
AMI(47)는 상용전원을 공급받아 전력 사용량을 측정 및 LPWAN(Low Power Wide Area Network) 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이다.The
배전반(48)은 상기 AMI(47)를 거쳐 LED 가로/보안등(52)에 전력을 공급하는 배전반(48)이며;the
상기 LED 가로/보안등(52) 지주 또는 내부에 부착되어 전력을 공급 받는 디머(53), QUANTUM 5G AP(49), 방송장치(50), 비상벨(51)이다.The LED street/
방송장치(50)는 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE USB(54)가 수신하여 방송하는 방송장치(50)이다.The
비상벨(51) 작동시 비상벨 작동 이벤트를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE USB(54)를 통해 전송하는 비상벨(51)이다.When the
센서부(46)는 센서를 통해 측정되는 데이터를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE USB(54)를 통해 전송하는 센서부(46)이다.The
디머(53)는 UHD 감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이다.The dimmer 53 is a dimmer 53 that adjusts the brightness of the LED street/
QUANTUM 5G AP(49)는 UHD 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이다.
단말 SINGLE USB(54) 및 Master QUANTUM SERVER(61) 및 Alice 6G QUANTUM SERVER(62) 및 Alice QUANTUM SERVER(63)는 대칭키 알고리즘(symmetric cryptographic algorithm)의 동일한 대칭키를 저장하고 있어, 방송데이터, 비상벨 작동 이벤트 데이터, 센서를 통해 측정되는 데이터, 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터, 감시카메라 제어데이터, 방송장치 제어데이터, 디머 제어데이터를 암/복호화한다.Terminals SINGLE USB 54 and
UHD 감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성된다.UHD surveillance camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical part, a driving part, a main controller, an image security processing part, an image analysis part, a network security processing part, and an input/output part.
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성된다. The optical unit includes a
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성된다.The driving unit is composed of a
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성된다.The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성된다.The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37).
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성된다.The image analysis unit is composed of an
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성된다.The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43).
양자통신부는 Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN 통신모뎀(66)으로 구성된다.The quantum communication unit is
구성요소 사이의 구체적인 결합관계에 대해 이하 상세히 설명한다.A specific coupling relationship between the components will be described in detail below.
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성된다.The
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택한다.One of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter is selected by driving the
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변한다.By driving the
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변한다.The focus focus is changed through the
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송한다. The driving
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송한다.The image sensor inside the
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송한다.The
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생한다.The
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증한다.The network security
센서부(46)로부터 수집되는 센싱 데이터, AMI(47)로부터 측정되는 측정 데이터, 하나 이상의 배전반(48)으로부터 수집되는 배전반 상태정보 데이터, 하나 이상의 방송장치(50)로부터 수집되는 음성/영상 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE USB(54)으로 전송한다.Sensing data collected from the
단말 SINGLE USB(54)는 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송 및 Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN USB(65) 중 어느 하나로부터 UHD 감시카메라 제어데이터 또는 방송장치 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE USB(54)로 전송한다.Terminal SINGLE USB 54 transmits measurement data, sensor state information data, voice/video data, and on/off data to
단말 SINGLE USB(54)는 Bob 6G QUANTUM SERVER(55)로부터 UHD 감시카메라 제어데이터를 수신한다.The terminal SINGLE USB 54 receives the UHD surveillance camera control data from the
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하고 주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어한다.The LPWAN communication modem (66) communicates data with the LPWAN terminal, and the main control unit MCU (27) is the TRNG (23), System Memory (24), PUF-PIN Memory (25), Security CPU (26), MCU (27). ,
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이다.The System Memory 24 is a System Memory in which the main
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장한다.The
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송한다.The
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 비대칭 개인키(PRIVATE KEY)를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 비대칭 개인키(PRIVATE KEY)와 베타적 논리합(EX-OR) 암호화 연산하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 비대칭 공개키(PUBLIC KEY)를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장한다.
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송한다.
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 UHD 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송한다.When the
QUANTUM CHANNEL 사이에 구체적인 결합관계에 대해 이하 상세히 설명한다.The specific coupling relationship between QUANTUM CHANNEL will be described in detail below.
Alice QUANTUM SERVER(63)와 Bob QUANTUM SERVER(56)는 QUANTUM CHANNEL(59)로 연결된다.Alice QUANTUM SERVER (63) and Bob QUANTUM SERVER (56) are connected to QUANTUM CHANNEL (59).
QUANTUM 6G SECURITY ENGINE(64)에서 BB84 또는 COW(Coherent One Way) 중 어느 하나의 방법으로부터 QUANTUM KEY를 생성하여 Alice QUANTUM SERVER(63)로 전송한다.The
Alice QUANTUM SERVER(63)는 QUANTUM KEY를 QUANTUM CHANNEL(59)를 통해 Bob QUANTUM SERVER(56)로 전송한다.Alice QUANTUM SERVER (63) transmits the QUANTUM KEY to Bob QUANTUM SERVER (56) through the QUANTUM CHANNEL (59).
Bob QUANTUM SERVER(56)는 Bob 6G QUANTUM SERVER(55)를 거쳐 입출력부를 통해 Quantum Entanglement(36)로 전송한다.The
Quantum Entanglement(36)는 COW(Coherent One Way) 생성방법에 의해 생성된 QUANTUM KEY일 경우 영상 6G SECURITY ENGINE(35)로 전송한다.
영상 6G SECURITY ENGINE(35)은 Decoy Pulse(37)로 검증하여 양자얽힘 상태일 경우, 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 QUANTUM KEY로 영상데이터를 암호화하여 입출력부를 통해 Bob 6G QUANTUM SERVER(55)를 거쳐 Bob QUANTUM SERVER(56)로 전송한다.
Bob QUANTUM SERVER(56)는 상기 QUANTUM KEY로 암호화한 영상데이터를 QUANTUM CHANNEL(59)를 통해 Alice QUANTUM SERVER(63)로 전송한다.
Alice QUANTUM SERVER(63)는 6G SECURITY ENGINE(64)로부터 수신한 QUANTUM KEY로 상기 QUANTUM KEY로 암호화한 영상데이터를 복호화한다.Alice QUANTUM SERVER (63) decrypts the video data encrypted with the QUANTUM KEY with the QUANTUM KEY received from the 6G SECURITY ENGINE (64).
hybrid-QUANTUM CHANNEL 사이에 구체적인 결합 관계에 대해 상세히 설명한다.The specific binding relationship between hybrid-QUANTUM CHANNEL will be described in detail.
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 비양자통신 채널(Non-QUANTUM Communication Channel(58)) 및 양자통신 채널(QUANTUM Communication Channel(59))로 구성된 hybrid-QUANTUM CHANNEL(60)에 연결된다.Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are hybrid- consisting of a Non-QUANTUM Communication Channel (58) and a quantum communication channel (QUANTUM Communication Channel (59)). connected to QUANTUM CHANNEL (60).
Alice PUF-QRNG TWIN USB(65)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF Chip(Phisycally Unclonable Function Chip)으로 구성된다.Alice PUF-
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어한다.Alice main controller (MCU) consists of Alice Boot-ROM, Alice System Storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) connected to Alice System Bus. , Alice I/O Port, and Alice Serial Peripheral Interface (SPI Controller) are controlled.
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice PUF Chip를 제어한다.Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), and Alice PUF Chip.
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장한다.The Alice system storage device (System M/M) stores programs and data necessary for the Alice main controller (MCU).
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어한다.The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control.
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장한다.Alice Boot-ROM stores programs and data necessary for booting Alice main controller (MCU).
Alice VPN은 네트워크망에 연결된 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN 사이에 1:1 암호화 통신한다.Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob PUF-
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어한다.Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control.
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를 통해 Alice 주제어부(MCU)로 전송한다.The Alice input/output device (I/O Port) is a switch connected to the network network, and it controls the network network ON/OFF and transmits the data received through the network network to the Alice main controller (MCU) through the Alice system bus.
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장한다.Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M).
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송한다.Alice Security CPU sends Alice PIN data to Alice main controller (MCU).
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터를 난수 시드(Seed)로 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장한다.The Alice security CPU generates the Alice private key using the Alice PIN data as a random number seed and stores it in the Alice security OTP memory (Security OTP M/M).
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 자연난수 시드(Seed)로 Alice 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송한다.The Alice security CPU (Security CPU) is a natural random number seed generated from the Alice pure random number generator (TRNG), and after generating the Alice public key by performing an EX-OR encryption operation with the Alice private key, the Alice main controller ( to the MCU).
Bob PUF-QRNG TWIN USB(57)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random Number Generator), Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF Chip(Phisycally Unclonable Function Chip)으로 구성된다.Bob PUF-QRNG TWIN USB (57) is connected to Bob's System Bus (Boot-ROM), Bob's Master Controller (MCU), Bob's System Storage (System M/M; System MEMORY), and Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG) ), Bob Security CPU (Security Central Processing Unit), Bob Security OTP M/M (Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF It is composed of Chip (Physically Unclonable Function Chip).
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어한다.Bob main controller (MCU) is connected to Bob's System Bus (Boot-ROM), Bob's System Storage (System M/M), Bob's Virtual Private Network (VPN), and Bob's Debugger (QC-DEBUGGER). , Bob I/O Port, and Bob Serial Peripheral Interface (SPI Controller).
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob PUF Chip를 제어한다.Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), and Bob PUF Chip.
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장한다.Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU).
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어한다.Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control.
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장한다.Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU).
Bob VPN은 네트워크망에 연결된 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN 사이에 1:1 암호화통신을 한다.Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice PUF-
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어한다.Bob Debugger (QC-DEBUGGER) receives a Quantum Certificate (QC) through Bob's I/O Port and turns on/off the network through Bob's I/O Port depending on whether or not it is authenticated. Control.
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송한다.Bob I/O Port is a switch connected to the network network, and controls the network network ON/OFF and transmits the data received through the network network to the Bob main controller (MCU) through the Bob system bus.
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장한다.Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M).
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송한다.Bob Security CPU (Security CPU) sends Bob PIN data to Bob main control unit (MCU).
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터를 난수 시드(Seed)로 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장한다.The Bob security CPU (Security CPU) generates the Bob private key using the Bob PIN data as a random number seed, and stores it in the Bob security OTP memory (Security OTP M/M).
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 자연난수 시드(Seed)로 Bob 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송한다.Bob Security CPU (Security CPU) is a natural random number seed generated from Bob's pure random number generator (TRNG). After generating Bob's public key by performing an EX-OR encryption operation with Bob's private key, the Bob main controller ( to the MCU).
hybrid-QUANTUM CHANNEL 중 양자통신 채널(QUANTUM Communication Channel)에서 구체적인 결합 관계에 대해 상세히 설명한다.The specific coupling relationship in the QUANTUM Communication Channel among hybrid-QUANTUM CHANNEL will be described in detail.
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)은 hybrid-QUANTUM CHANNEL(60) 중 양자통신 채널(QUANTUM Communication Channel)에 연결된다.Alice PUF-
양자난수생성기(QRNG; Quantum Random Number Generator)는 무작위 양자난수를 발생하는 송신부의 Alice 양자난수생성기(Alice QRNG)와 수신부의 Bob 양자난수생성기(Bob QRNG)로 구성된다.Quantum Random Number Generator (QRNG) is composed of Alice QRNG of the transmitter and Bob QRNG of the receiver that generate random quantum random numbers.
양자키분배기(QKD; Quantum Key Distribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성된다.Quantum Key Distribution (QKD) consists of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector.
양자플랫폼(Quantum Platform)은 Alice 양자난수생성기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; Quantum Certificate)를 생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성된다.The Quantum Platform is an Aliec Quantum Platform that generates a Quantum Certificate (QC) with quantum random numbers generated by Alice QRNG and transmits it through the Alice Quantum Key Distributor (QKD). It consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Bob Quantum Key Distributor (QKD).
송신부(a transmitting set) Alice 양자난수생성기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송한다.Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform.
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 Alice 마스터서버(Alice MASTER SERVER) 및 Alice 양자키분배기(QKD)로 전송한다.Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to Alice Master Server (Alice MASTER SERVER) and Alice Quantum Key Distributor (QKD).
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송하며;Alice quantum key distributor (QKD) transmits a quantum certificate (QC) to Bob quantum key distributor (QKD) through a quantum communication channel (QUANTUM Communication Channel) connected by an optical cable;
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장된다.A receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform.
hybrid-QUANTUM CHANNEL 중 고전통신 채널(non-QUANTUM Communication Channel)에서 구체적인 결합 관계에 대해 상세히 설명한다.The specific coupling relationship in the non-QUANTUM Communication Channel among hybrid-QUANTUM CHANNEL will be described in detail.
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결된다.Alice PUF-
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송한다.Alice PUF-
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송한다.Bob PUF-QRNG TWIN USB(57) inside Bob's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and stores it in Bob's system storage (System M/M). According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob input/output device (I/O port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송한다.Alice PUF-
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송한다.Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob VPN, the Bob KEY that encrypted the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Alice public key received through Bob VPN. Through Alice PUF-
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치하고, Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치하면, Alice PUF-QRNG TWIN USB(65)에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN USB(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결한다.The Alice main controller (MCU) inside the Alice PUF-
네트워크망 로그인(LOG In) 연결 상태에서, Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송한다.In the network login (LOG In) connection state, the Alice main controller (MCU) inside the Alice PUF-
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화한다.Bob PUF-
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송한다.Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송한다.Bob PUF-
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN USB(65)로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 배전반, 방송장치, 가로/보안등, 방범용 CCTV 감시카메라 단말부를 포함하는 하이브리드 양자통신망.Bob Debugger (QC-DEBUGGER) does not match the quantum certificate (QC) received from Alice PUF-QRNG TWIN USB (65) and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) I/ A hybrid quantum communication network comprising a switchboard, a broadcasting device, a street/security light, and a CCTV surveillance camera terminal for crime prevention, characterized in that the O Port is controlled by the OFF contact to block the network connection between the Alice master server and the Bob master server.
일 실시 예로,In one embodiment,
주요 구성요소로, QUANTUM COLLABO는 양자난수생성기를 포함하여 구성된다.As the main component, QUANTUM COLLABO is composed including a quantum random number generator.
자율주행차는 감시카메라 및 5G 통신모뎀을 포함하여 구성된다. The autonomous vehicle is composed of a surveillance camera and a 5G communication modem.
또한, QUANTUM 5G AP(Access Point) 및 Alice 6G QUANTUM SERVER, Bob 6G QUANTUM SERVER로 구성된다.In addition, it consists of
QUANTUM COLLABO, 자율주행차, QUANTUM 5G AP(Access Point), Alice 6G QUANTUM SERVER, Bob 6G QUANTUM SERVER로 주요 구성된다.It is mainly composed of QUANTUM COLLABO, self-driving car,
네트워크망 구성에 있어서, 유선 양자네트워크망은 QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된다. 또한, 5G 무선네트워크망이 추가로 이중화 이중망으로 구성되는 특징을 갖는다.In the network configuration, the wired quantum network is composed of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL. In addition, the 5G wireless network network is additionally configured as a redundant duplex network.
유선 양자네트워크 자가망과 ISP 사업자 5G 무선네트워크망을 선택적으로 접속하는 것과, 데이터 특성에 따라 PUF, QRNG SoC Chip을 이용해 생성한 QUANTUM KEY(개인키/공개키)로 암/복호화하는 QKD(Quantum Key Distribution) TLS(Transport Layer Security) 시스템을 주요 특징으로 이하 상세히 설명한다. Quantum Key (QKD) that selectively connects wired quantum network own network and ISP operator's 5G wireless network network and encrypts/decrypts with QUANTUM KEY (private key/public key) generated using PUF or QRNG SoC Chip according to data characteristics Distribution) The TLS (Transport Layer Security) system will be described in detail below with its main features.
핵심 구성요소인, QUANTUM COLLABO(QUANTUM encrypt Transport Layer Security protocol DEVICE)은 Eve 양자난수생성기, 5G QUANTUM JUMP ENGINE, Boot Mode S/W(SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W(SWITCH), LED, I/O Pin Header로 구성된다.The core component, QUANTUM COLLABO (QUANTUM encrypt Transport Layer Security protocol DEVICE), is an Eve quantum random number generator, 5G QUANTUM JUMP ENGINE, Boot Mode S/W (SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W ( SWITCH), LED, and I/O Pin Header.
또한, QUANTUM COLLABO 내부 5G QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 포함하는 것을 특징으로 구성된다.In addition, the 5G QUANTUM JUMP ENGINE inside QUANTUM COLLABO is characterized by including System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
핵심 구성요소인, Eve 양자난수생성기는 난수소스생성기, 양자검출 다이오드, 양자랜덤펄스 생성기, 양자난수 제어부, 입출력부로 구성된다.The Eve quantum random number generator, which is a core component, is composed of a random number source generator, quantum detection diode, quantum random pulse generator, quantum random number control unit, and input/output unit.
세부 구성요소와 세부적인 결합관계를 이하 상세히 설명한다.Detailed components and detailed coupling relationships will be described in detail below.
난수소스생성기는 LED(Light-Emitting Diode), LD(Laser Diode), 방사선 동위원소, 트랜지스터 노이즈, 열잡음 중 어느 하나 이상으로부터 양자입자를 방출한다.The random number source generator emits quantum particles from any one or more of LED (Light-Emitting Diode), LD (Laser Diode), radioactive isotopes, transistor noise, and thermal noise.
상기 양자검출 다이오드는 상기 난수소스생성기로 부터 발생하는 양자입자를 검출한다.The quantum detection diode detects quantum particles generated from the random number source generator.
상기 양자랜덤펄스 생성기는 상기 양자검출 다이오드로부터 양자입자 이벤트를 검출하여 양자입자의 검출에 상응하는 랜덤펄스를 발생한다.The quantum random pulse generator detects a quantum particle event from the quantum detection diode and generates a random pulse corresponding to the detection of the quantum particle.
상기 양자난수 제어부는 상기 양자랜덤펄스 생성기를 통해 발생하는 랜덤펄스 무작위 난수소스로 양자난수를 생성하여 5G QUANTUM JUMP ENGINE 내부 Security CPU로 전송한다.The quantum random number control unit generates a quantum random number from a random pulse random number source generated through the quantum random pulse generator and transmits it to the 5G QUANTUM JUMP ENGINE internal Security CPU.
Boot Mode S/W(SWITCH)는 5G QUANTUM JUMP ENGINE 내부 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 5G 통신모뎀으로 전송하는 Boot Mode S/W(SWITCH)이다.Boot Mode S/W (SWITCH) is Boot Mode S/W (S/W) that boots the Boot-ROM through the SPI Controller inside 5G QUANTUM JUMP ENGINE, receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key, and transmits it to the 5G communication modem. SWITCH).
JTAG Connector는 디지털 입출력을 위해 직렬 통신 방식으로 출력 데이터를 전송하거나 입력데이터를 수신하는 JTAG(Joint Test Action Group) Connector로 자율주행차 운영 프로그램 등을 입출력한다.JTAG Connector is a JTAG (Joint Test Action Group) connector that transmits output data or receives input data in a serial communication method for digital input/output.
ETHERNET Connector는 자율주행차와 ETHERNET 통신하는 입출력포트이다.ETHERNET Connector is an input/output port for ETHERNET communication with an autonomous vehicle.
RESET S/W(SWITCH)는 QUANTUM COLLABO을 초기화하는 RESET S/W(SWITCH)이며;RESET S/W(SWITCH) is RESET S/W(SWITCH) initializing QUANTUM COLLABO;
전원공급 표시 LED 및 QUANTUM COLLABO 각 부분과 통신하는 I/O Pin Header 및 USB Connector로 구성된다.It is composed of power supply indicator LED, I/O Pin Header and USB Connector that communicates with each part of QUANTUM COLLABO.
네트워크망을 중심으로 구성요소와 시스템 결합관계를 상세히 설명한다.The relationship between components and systems will be described in detail with a focus on the network network.
자율주행차량 내부에 탑재되는 감시카메라, QUANTUM COLLABO, 5G 통신모뎀과 자율주행차량 외부 도로에 설치되는 QUANTUM 5G AP, Bob 6G QUANTUM SERVER로 구성되고, QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선 양자네트워크망 및 5G 무선네트워크망과 연결된 Alice 6G QUANTUM SERVER로 구성된다.It consists of a surveillance camera mounted inside an autonomous vehicle, QUANTUM COLLABO, 5G communication modem, and
5G QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어한다.5G QUANTUM JUMP ENGINE's internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다.System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice 6G QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Eve QUANTUM 개인키(PRIVATE KEY)를 생성한다. MCU controls the Security CPU to extract Eve PIN data from the hardware pin of the eve-PUF Chip and store it in PUF-PIN Memory and
포맷함수는 고정길이 해시함수, 함수식 등 공지된 다양한 방법을 사용하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 개인키(PRIVATE KEY)를 생성한다.The format function generates an asymmetric cryptographic algorithm PRIVATE KEY using various well-known methods such as a fixed-length hash function and a function expression.
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송한다.MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU.
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, 상기 양자난수 시드(Seed) 및 Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키(PUBLIC KEY)를 5G 통신모뎀으로 전송한다.Security CPU generates Eve QUANTUM public key (PUBLIC KEY) by performing beta-OR (EX-OR) encryption operation on the Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed, and the quantum random number seed ( Seed) and Eve QUANTUM public key are stored in Security OTP Memory and Eve QUANTUM public key (PUBLIC KEY) is transmitted to 5G communication modem.
베타적 논리합(EX-OR) 암호화 연산은 연산자(EX-OR, EX-AND 등), 고정길이 해시함수, 함수식 등 공지된 다양한 방법을 사용하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 공개키(PUBLIC KEY)를 생성한다.The beta-OR (EX-OR) cryptographic operation uses a variety of well-known methods such as operators (EX-OR, EX-AND, etc.), fixed-length hash functions, and function expressions. KEY) is created.
5G 통신모뎀은 5G 무선네트워크망 내부의 5G 기지국을 통해 Alice 6G QUANTUM SERVER로 전송한다.The 5G communication modem transmits to
Alice 6G QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성된다.
Alice 6G QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Alice QUANTUM 개인키를 생성한다.
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)와 Alice QUANTUM 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키(PUBLIC KEY)를 생성한다.Alice QUANTUM public key (PUBLIC KEY) is generated by performing beta-OR (EX-OR) encryption operation with the quantum random number seed that generated quantum random number from Alice quantum random number generator and Alice QUANTUM private key.
베타적 논리합(EX-OR) 암호화 연산은 연산자(EX-OR, EX-AND 등), 고정길이 해시함수, 함수식 등 공지된 다양한 방법을 사용하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 공개키(PUBLIC KEY)를 생성한다.The beta-OR (EX-OR) cryptographic operation uses a variety of well-known methods such as operators (EX-OR, EX-AND, etc.), fixed-length hash functions, and function expressions. KEY) is created.
Alice 6G QUANTUM SERVER는 5G 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 5G 무선네트워크망을 통해 QUANTUM COLLABO로 재전송한다.
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 Security OTP Memory에 저장된 양자난수 시드(Seed)와 베타적 논리합(EX-OR) 복호화 역 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성한다.QUANTUM COLLABO internal MCU performs the reverse operation of Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the quantum random number seed stored in the Security OTP Memory with the Eve QUANTUM private key and EX-OR decryption to reverse the Alice QUANTUM Decrypt and generate public key and Eve PIN data.
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우, MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 5G 통신모뎀으로 전송한다.If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF chip match, the MCU boots the Boot-ROM through the SPI Controller and encrypts the video data captured by the surveillance camera with the Alice QUANTUM public key to encrypt the 5G communication modem. send to
5G 통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 5G LAN(Local Area Network) 셀망을 통해 QUANTUM 5G AP로 전송하지만, QUANTUM 5G AP와 통신이 불가능할 경우에는 5G 무선네트워크망 5G 기지국으로 전송한다.The 5G communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the
Bob 6G QUANTUM SERVER는 QUANTUM 5G AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선 양자네트워크망을 통해 Alice 6G QUANTUM SERVER로 전송한다.When
Alice 6G QUANTUM SERVER는 유선 양자네트워크망과 5G 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM 5G AP를 이용한 SMART QUANTUM G-Cloud 자율주행차 5G 자치단체 자가망이다.
일 실시 예로,In one embodiment,
자율주행차는 QUANTUM COLLABO 및 감시카메라 및 통신모뎀을 포함하여 구성된다.The autonomous vehicle consists of a QUANTUM COLLABO and a surveillance camera and communication modem.
자율주행차 외부에 QUANTUM AP(Access Point), Alice QUANTUM SERVER, Bob QUANTUM SERVER가 구성된다.Outside the autonomous vehicle, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER are configured.
유선 자가망 및 무선 자가망과 통신사업자 무선망을 선택적으로 접속하여 QUANTUM KEY로 암/복호화 통신하는 QKD(Quantum Key Distribution) TLS(Transport Layer Security) 시스템을 특징으로 한다. It features a QKD (Quantum Key Distribution) TLS (Transport Layer Security) system that selectively connects wired and wireless private networks and telecommunication service provider wireless networks to encrypt/decrypt communication with QUANTUM KEY.
주요 구성요소로,As the main component,
자율주행차량 내부에 탑재되는 감시카메라, QUANTUM COLLABO, 통신모뎀으로 구성된다.It consists of a surveillance camera mounted inside an autonomous vehicle, QUANTUM COLLABO, and a communication modem.
자율주행차량 외부에 설치되는 QUANTUM AP, Bob QUANTUM SERVER로 구성된다.It consists of QUANTUM AP and Bob QUANTUM SERVER installed outside the autonomous vehicle.
네트워크망은 유선 자가망 및 무선 자가망과 통신사업자 무선망으로 구성된 유/무선네트워크망과 연결된 Alice QUANTUM SERVER로 구성된다.The network is composed of Alice QUANTUM SERVER connected to wired/wireless network consisting of wired and wireless self-network and telecommunication operator's wireless network.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성된다.QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송한다. QUANTUM COLLABO's internal Eve quantum random number generator generates quantum random numbers and sends them to QUANTUM JUMP ENGINE's internal Security CPU.
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성된다.QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어한다.QUANTUM JUMP ENGINE's internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다.System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성한다.The MCU controls the Security CPU to extract Eve PIN data from the hardware pin of the eve-PUF Chip, stores it in PUF-PIN Memory and Alice QUANTUM SERVER, and generates the Eve QUANTUM private key with the Eve PIN data as a random number seed.
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송한다.MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU.
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 통신모뎀으로 전송한다.The Security CPU encrypts the Eve QUANTUM private key stored in the PUF-PIN Memory with the quantum random number seed to generate the Eve QUANTUM public key, stores the Eve QUANTUM public key in the Security OTP Memory, and communicates the Eve QUANTUM public key. send to the modem.
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선네트워크망 내부의 무선기지국을 통해 Alice QUANTUM SERVER로 전송한다.The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless base station inside the wireless network network of the communication service provider.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성된다.Alice QUANTUM SERVER is configured by including Alice quantum random number generator and Alice PUF Chip inside.
Alice QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성 및 Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER extracts Alice PIN data from the hardware pin of Alice PUF Chip, stores it in QUANTUM COLLABO, generates Alice QUANTUM private key as a random number seed, and generates quantum random numbers from Alice quantum random number generator. The Alice QUANTUM public key is generated by encrypting the Alice QUANTUM private key with the quantum random number seed.
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO로 재전송하고, QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하고, 상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우,Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network network of the telecommunication service provider and retransmits it to the QUANTUM COLLABO through the wireless network of the telecommunication service provider. Eve PIN data encrypted with QUANTUM public key and Alice QUANTUM public key are decrypted with Eve QUANTUM private key to decrypt and generate Alice QUANTUM public key and Eve PIN data, and Eve extracted from the decrypted generated Eve PIN data and eve-PUF Chip If it matches the PIN data,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송한다.The MCU boots the Boot-ROM through the SPI Controller, encrypts the video data captured by the surveillance camera with the Alice QUANTUM public key, and sends it to the communication modem.
통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 QUANTUM AP로 전송하지만, QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선네트워크망 무선기지국으로 전송한다.The communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM AP that can communicate.
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wired network;
Alice QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 SMART QUANTUM G-Cloud 자율주행차 자치단체 자가망.Alice QUANTUM SERVER receives video data from the surveillance camera encrypted with the Alice QUANTUM public key from at least one of the wired network and the wireless network, and decrypts it with the Alice QUANTUM private key. SMART QUANTUM G-Cloud autonomous vehicle autonomy using QUANTUM AP group self-network.
일 실시 예로,In one embodiment,
QUANTUM COLLABO, 감시카메라, 통신모뎀, QUANTUM AP(Access Point), Alice QUANTUM SERVER, Bob QUANTUM SERVER로 기본 구성된다.It basically consists of QUANTUM COLLABO, surveillance camera, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성된다.QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송한다.QUANTUM COLLABO's internal Eve quantum random number generator generates quantum random numbers and sends them to QUANTUM JUMP ENGINE's internal Security CPU.
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성된다. QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어한다.QUANTUM JUMP ENGINE's internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다.System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터를 시드(Seed)로 Eve QUANTUM 개인키를 생성한다.The MCU controls the Security CPU to extract Eve PIN data from the hardware pin of the eve-PUF Chip, stores it in PUF-PIN Memory and Alice QUANTUM SERVER, and generates the Eve QUANTUM private key with the Eve PIN data as the seed.
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송한다.MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU.
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송한다.The Security CPU generates an Eve QUANTUM public key by encrypting the Eve QUANTUM private key stored in the PUF-PIN memory with the quantum random number, stores the Eve QUANTUM public key in the Security OTP Memory, and transmits it to the communication modem.
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송한다.The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the communication service provider.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Alice QUANTUM 개인키를 생성하고, Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 공지된 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER is composed of Alice Quantum Random Number Generator and Alice PUF Chip inside. Alice QUANTUM SERVER extracts Alice PIN data from the hardware pin of Alice PUF Chip, stores it in QUANTUM COLLABO, and seeds the Alice PIN data. Asymmetric cryptographic algorithm Alice QUANTUM private key is generated, and the Alice QUANTUM private key is used as a quantum random number generated from Alice quantum random number generator by known asymmetric cryptographic algorithm encryption operation. to generate the Alice QUANTUM public key.
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송한다.Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside with the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and retransmits it to the QUANTUM COLLABO through the wireless network of the telecommunication service provider.
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성한다.QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the asymmetric cryptographic algorithm Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data.
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우, MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송한다.If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF chip match, the MCU boots the Boot-ROM through the SPI Controller, encrypts the video data captured by the surveillance camera with the Alice QUANTUM public key, and sends it to the communication modem. send.
통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송한다.The communication modem transmits the surveillance camera video data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the wireless self-network QUANTUM AP, but if communication with the wireless self-network QUANTUM AP is impossible, it is sent to the Alice QUANTUM SERVER through the wireless network of the carrier send.
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wire network.
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 SMART QUANTUM G-Cloud 자가망이다.Alice QUANTUM SERVER is a SMART QUANTUM G-Cloud self-network using QUANTUM AP that receives video data captured by a surveillance camera encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of the wired own network and the wireless network of the telecommunication service provider. .
일 실시 예로,In one embodiment,
QUANTUM COLLABO, 감시카메라, 통신모뎀, QUANTUM AP(Access Point), Alice QUANTUM SERVER, Bob QUANTUM SERVER로 구성된다.It consists of QUANTUM COLLABO, surveillance camera, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성된다.QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송한다.QUANTUM COLLABO's internal Eve quantum random number generator generates quantum random numbers and sends them to QUANTUM JUMP ENGINE's internal Security CPU.
QUANTUM JUMP ENGINE은 System Memory, NFC Memory, Security CPU, MCU, eve-NFC Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성된다.QUANTUM JUMP ENGINE consists of System Memory, NFC Memory, Security CPU, MCU, eve-NFC Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, NFC Memory, Security CPU, eve-NFC Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어한다.QUANTUM JUMP ENGINE's internal MCU controls System Memory, NFC Memory, Security CPU, eve-NFC Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다.System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 eve-NFC Chip(또는 eve-NFC 카드, eve-NFC 스티커)에서 Eve NFC 데이터를 추출하여 NFC Memory 및 난수 시드(Seed)로 Alice QUANTUM SERVER에 저장 후 Eve NFC 데이터 난수 시드로 Eve QUANTUM 개인키를 생성한다.MCU controls Security CPU to extract Eve NFC data from eve-NFC Chip (or eve-NFC card, eve-NFC sticker) and store it in Alice QUANTUM SERVER as NFC Memory and random number seed, then seed Eve NFC data to generate the Eve QUANTUM private key.
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송한다.MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU.
Security CPU는 NFC Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송한다.The Security CPU generates an Eve QUANTUM public key by encrypting the Eve QUANTUM private key stored in the NFC Memory with the quantum random number, stores the Eve QUANTUM public key in the Security OTP Memory, and transmits it to the communication modem.
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송한다.The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the communication service provider.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice NFC Chip를 포함하여 구성된다.Alice QUANTUM SERVER is configured by including Alice quantum random number generator and Alice NFC Chip inside.
Alice QUANTUM SERVER는 Alice NFC Chip에서 Alice NFC 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice NFC 데이터로 Alice QUANTUM 개인키를 생성 후 Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER extracts Alice NFC data from Alice NFC Chip, stores it in QUANTUM COLLABO, generates Alice QUANTUM private key with Alice NFC data, and encrypts Alice QUANTUM private key with quantum random number generated from Alice quantum random number generator operation to generate the Alice QUANTUM public key.
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송한다.Alice QUANTUM SERVER encrypts the Eve NFC data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and retransmits it to the QUANTUM COLLABO through the wireless network of the telecommunication service provider.
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve NFC 데이터를 복호화 생성한다.QUANTUM COLLABO internal MCU decrypts the Eve NFC data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve NFC data.
상기 복호화 생성된 Eve NFC 데이터와 eve-NFC Chip으로 부터 추출한 Eve NFC 데이터와 일치할 경우, MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송한다.If the decryption-generated Eve NFC data and the Eve NFC data extracted from the eve-NFC Chip match, the MCU boots the Boot-ROM through the SPI Controller, encrypts the video data captured by the surveillance camera with the Alice QUANTUM public key, and sends it to the communication modem. send.
통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송한다.The communication modem transmits the surveillance camera video data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the wireless self-network QUANTUM AP, but if communication with the wireless self-network QUANTUM AP is impossible, it is sent to the Alice QUANTUM SERVER through the wireless network of the carrier send.
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wire network.
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 SMART QUANTUM G-Cloud 자가망이다.Alice QUANTUM SERVER is a SMART QUANTUM G-Cloud self-network using QUANTUM AP that receives video data captured by a surveillance camera encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of the wired own network and the wireless network of the telecommunication service provider. .
일 실시 예로,In one embodiment,
단말부, QUANTUM AP(Access Point), Alice QUANTUM SERVER, Bob QUANTUM SERVER로 기본 구성된다.It basically consists of a terminal, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
단말부는 세부적으로 QUANTUM COLLABO 및 자가 무선망 통신모뎀 및 통신사업자 통신모뎀을 포함하여 구성된다.The terminal unit is configured including QUANTUM COLLABO, self-wired network communication modem and communication operator communication modem in detail.
단말부 QUANTUM COLLABO는 통신사업자 통신모뎀을 통해 통신사업자 무선망으로 Alice QUANTUM SERVER와 네트워크망 연결된다.The terminal unit QUANTUM COLLABO is connected to the Alice QUANTUM SERVER through the telecommunication carrier's communication modem through the telecommunication carrier's wireless network.
또한, QUANTUM COLLABO는 자가 무선망 통신모뎀을 통해 QUANTUM AP와 자가 무선망으로 연결된 Bob QUANTUM SERVER를 통해 자가 유선망으로 연결된 Alice QUANTUM SERVER와 네트워크망 연결된다.In addition, QUANTUM COLLABO is networked with Alice QUANTUM SERVER connected through its own wired network through Bob QUANTUM SERVER connected with QUANTUM AP through its own wireless network through its own wireless network communication modem.
통신사업자 무선망 : QUANTUM COLLABO ↔ 통신사업자 통신모뎀 ↔ 면허주파수 통신사업자 무선망 ↔ Alice QUANTUM SERVERTelecommunication service provider wireless network: QUANTUM COLLABO ↔ Telecom carrier communication modem ↔ Licensed frequency carrier radio network ↔ Alice QUANTUM SERVER
자가 유/무선망 : QUANTUM COLLABO ↔ 자가 무선망 통신모뎀 ↔ QUANTUM AP ↔ 자가 무선망(비면허주파수 폐쇄형 무선자가망) ↔ Bob QUANTUM SERVER ↔ 자가 유선망(QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선네트워크망) ↔ Alice QUANTUM SERVER Self-wired/wireless network: QUANTUM COLLABO ↔ self-wired communication modem ↔ QUANTUM AP ↔ self-wired network (unlicensed frequency closed wireless self-network) ↔ Bob QUANTUM SERVER ↔ self-wired network (QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANT) wired network consisting of any one of them) ↔ Alice QUANTUM SERVER
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성된다.QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송한다.QUANTUM COLLABO's internal Eve quantum random number generator generates quantum random numbers and sends them to QUANTUM JUMP ENGINE's internal Security CPU.
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller로 구성된다.QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF, Security OTP Memory, Network Switch, and SPI Controller.
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller를 제어한다.QUANTUM JUMP ENGINE's internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF, Security OTP Memory, Network Switch, and SPI Controller.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다.System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 eve-PUF에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성한다.MCU controls Security CPU to extract Eve PIN data from eve-PUF, store it in PUF-PIN Memory and Alice QUANTUM SERVER, and then creates Eve QUANTUM private key with Eve PIN data as a random number seed.
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송한다.MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU.
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 통신사업자 통신모뎀으로 전송한다. The Security CPU encrypts the Eve QUANTUM private key stored in the PUF-PIN Memory with the quantum random number seed to generate the Eve QUANTUM public key, stores the Eve QUANTUM public key in the Security OTP Memory, and communicates the Eve QUANTUM public key. It is transmitted to the operator's communication modem.
통신사업자 통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송한다.The communication operator's communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the communication operator's wireless network.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF를 포함하여 구성된다.Alice QUANTUM SERVER is configured by including Alice quantum random number generator and Alice PUF inside.
Alice QUANTUM SERVER는 Alice PUF에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성 후 Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER extracts Alice PIN data from Alice PUF, stores it in QUANTUM COLLABO, generates Alice QUANTUM private key as a random number seed, and generates a quantum random number seed from Alice quantum random number generator. Seed) to generate the Alice QUANTUM public key by encrypting the Alice QUANTUM private key.
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송 또는 Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 자가 유선망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 QUANTUM AP를 통해 자가 무선망 통신모뎀으로 전송하면, 자가 무선망 통신모뎀을 통해 QUANTUM COLLABO가 수신한다.Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network of the operator and retransmits it to the QUANTUM COLLABO through the wireless network of the operator or Alice QUANTUM SERVER uses the wireless network of the operator The Eve PIN data and Alice QUANTUM public key stored inside are encrypted with the Eve QUANTUM public key received through the Eve QUANTUM public key and transmitted to the Bob QUANTUM SERVER through their own wired network. Bob QUANTUM SERVER transmits it to its own wireless network communication modem through the QUANTUM AP. QUANTUM COLLABO receives through wireless network communication modem.
QUANTUM COLLABO는 통신사업자 무선망 또는 자가 유선망 중 어느 하나로 부터 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 수신하여 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성 및 상기 복호화 생성된 Eve PIN 데이터와 eve-PUF으로 부터 추출한 Eve PIN 데이터와 일치할 경우,QUANTUM COLLABO receives Eve PIN data and Alice QUANTUM public key encrypted with the Eve QUANTUM public key from either the wireless network of the telecommunication service provider or its own wired network, decrypts the Eve QUANTUM private key, and decrypts the Alice QUANTUM public key and Eve PIN data. If the decrypted generated Eve PIN data matches the Eve PIN data extracted from eve-PUF,
MCU는 SPI Controller를 통해 Network Switch을 ON점점 전환하여 Alice QUANTUM 공개키로 데이터를 암호화하여 자가 무선망 통신모뎀 및 통신사업자 통신모뎀으로 전송한다.The MCU gradually turns the Network Switch ON through the SPI Controller, encrypts the data with the Alice QUANTUM public key, and transmits it to its own wireless network communication modem and communication operator communication modem.
자가 무선망 통신모뎀은 Alice QUANTUM 공개키로 암호화한 데이터를 통신 가능한 QUANTUM AP로 전송하지만, QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 통신모뎀을 통해 통신사업자 무선망으로 전송한다.The self-wired network communication modem transmits the data encrypted with the Alice QUANTUM public key to the available QUANTUM AP, but if communication with the QUANTUM AP is not possible, it transmits it to the telecommunication service provider's wireless network through the operator's communication modem.
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하면, 자가 유선망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives data encrypted with Alice QUANTUM public key from QUANTUM AP, it transmits it to Alice QUANTUM SERVER through its own wired network.
Alice QUANTUM SERVER는 자가 유선망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 SMART QUANTUM G-Cloud 자가망이다.Alice QUANTUM SERVER is a SMART QUANTUM G-Cloud self-network using QUANTUM AP that receives data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of its own wired network and wireless network of a telecommunication service provider.
일 실시 예로,In one embodiment,
감시카메라(Closed Circuit Camera, 또는 방범용 감시카메라, 방범용 감시카메라, 감시카메라), QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP(Access Point), 망분리서버, 양자스마트폰, NFC Tag, police-APP, SK텔레콤 통신사업자 LoRA 무선네트워크망(통신사업자 무선네트워크망), SK텔레콤 양자인증서버 및 유/무선 자가망으로 구성된다.Surveillance Camera (Closed Circuit Camera, or Security Surveillance Camera, Security Surveillance Camera, Surveillance Camera), QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP(Access Point), Network Separation Server, Quantum Smartphone, NFC It consists of Tag, police-APP, SK Telecom's telecom operator's LoRA wireless network (communication operator's wireless network), SK Telecom's quantum authentication server, and wired/wireless self-network.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 최초 양자난수를 생성하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하여 QUANTUM COLLABO 내부 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장하여 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이에 네트워크망 로그인(Log In) 후 감시카메라(감시카메라) 촬영 영상데이터를 QUANTUM 대칭키로 암/복호화 데이터 통신하는 것을 특징으로 한다.Alice QUANTUM SERVER generates the first quantum random number through the Alice Quantum Random Number Generator (QRNG) inside, and generates the QUANTUM symmetric key of the symmetric cryptographic algorithm to create the QUANTUM COLLABO internal PUF-PIN Memory and Alice After logging in to the network network between QUANTUM COLLABO and Alice QUANTUM SERVER by storing it in QUANTUM SERVER, it is characterized in that the video data captured by the surveillance camera (surveillance camera) is encrypted/decrypted data communication with the QUANTUM symmetric key.
(통합방범센터)(Integrated Crime Prevention Center)
통합방범센터 내부에 Alice QUANTUM SERVER는 SK텔레콤 통신사업자 3G, 4G, 5G, LoRA 무선네트워크망 중 어느 하나를 통해 SK텔레콤 양자인증서버와 연결된다.Alice QUANTUM SERVER inside the integrated crime prevention center is connected to SK Telecom's quantum authentication server through any one of SK Telecom's 3G, 4G, 5G, and LoRA wireless networks.
통합방범센터 내부에 망분리서버는 내부망메인보드와 외부망메인보드로 구성되어, 내부망메인보드는 Alice QUANTUM SERVER로 부터 영상데이터를 전송받아 외부망메인보드 한 방향으로 영상데이터만 전송된다.The network separation server inside the integrated crime prevention center consists of an internal network main board and an external network main board. The internal network main board receives video data from Alice QUANTUM SERVER and transmits only the video data in one direction to the external network main board.
(스쿨존 제어부)(School Zone Control)
폐쇄형 함체는 원격시건장치 및 문열림센서를 포함하여 구성되어, 폐쇄형 함체 도어 문열림센서 검지데이터는 Bob QUANTUM SERVER를 통해 Alice QUANTUM SERVER로 전송되고, Alice QUANTUM SERVER는 원격시건장치를 제어하여 원격으로 폐쇄형 함체를 개방 제어한다.The closed enclosure includes a remote locking device and a door open sensor, and the closed enclosure door door open sensor detection data is transmitted to Alice QUANTUM SERVER through Bob QUANTUM SERVER, and Alice QUANTUM SERVER controls the remote locking device to remotely control the opening of the closed enclosure.
폐쇄형 함체 내부에 Bob QUANTUM SERVER, CC인증 VPN, QUANTUM DUAL AP(Access Point)를 포함하여 구성되어, Bob QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER와 연결된다.It is composed of Bob QUANTUM SERVER, CC certified VPN, and QUANTUM DUAL AP (Access Point) inside a closed enclosure, and Bob QUANTUM SERVER can use non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, PUF-QRNG TWIN USB through CC certified VPN. It is connected to Alice QUANTUM SERVER through any one of the wired networks of the hybrid-QUANTUM CHANNEL.
(스쿨존 단말부)(School zone terminal)
단말부는 감시카메라(Closed Circuit Camera), 멀티통신모뎀, QUANTUM COLLABO로 구성ehld다The terminal is composed of a closed circuit camera, a multi-communication modem, and a QUANTUM COLLABO.
감시카메라는 PUF-TRNG SoC(System on Chip) 또는 eFUSE-TRNG SoC(System on Chip) 중 어느 하나의 보안칩을 탑재한 감시카메라이다.A surveillance camera is a surveillance camera equipped with either a PUF-TRNG SoC (System on Chip) or an eFUSE-TRNG SoC (System on Chip) security chip.
QUANTUM COLLABO는 감시카메라를 제어한다. \QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 선택적으로 선택하는 것으로, QUANTUM COLLABO controls surveillance cameras. \QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency SK Telecom carrier's LoRA wireless network through QUANTUM AC (Access Controller) in data transmission/reception.
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결하거나, QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망에 연결된 SK텔레콤 양자인증서버 인증을 통해 Alice QUANTUM SERVER와 연결한다.QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems, or QUANTUM COLLABO to QUANTUM Controls AC (Access Controller) and connects with Alice QUANTUM SERVER through SK Telecom quantum authentication server authentication connected to the licensed frequency SK Telecom carrier LoRA wireless network through licensed frequency modem among multi-communication modems.
(시스템 결합 - Log In)(System Combine - Log In)
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성된다.QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE.
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller로 구성된다.Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, Main Control Unit (MCU), eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, and SPI Controller.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송한다. QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU.
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller를 제어한다.Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다.System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성한다.The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. Asymmetric cryptographic algorithm Eve QUANTUM Generates a private key (PRIVATE KEY).
eve-NFC Chip은 유지보수 용역 월간 정기점검 때 매월(또는 매주, 수시) 교체되는 물리적인 PUF(Physically Unclonable Function)의 하나로, NFC Writer를 통해서 Eve PIN 데이터를 입력 및 Eve PIN 데이터를 Alice QUANTUM SERVER에 저장한다.The eve-NFC Chip is one of the physical PUFs (Physically Unclonable Function) that is replaced every month (or weekly, frequently) during the monthly maintenance service inspection. Input the Eve PIN data through the NFC Writer and send the Eve PIN data to the Alice QUANTUM SERVER. Save.
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송한다.MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU.
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송한다.Security CPU performs beta-OR (EX-OR) encryption operation of the Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed. OTP (One Time Password) asymmetric cryptographic algorithm Eve QUANTUM A public key (PUBLIC KEY) is generated, the Eve QUANTUM public key is stored in the Security OTP (One Time Password) memory, and the Eve QUANTUM public key is transmitted to the QUANTUM AC (Access Controller).
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망에 연결된 SK텔레콤 양자인증서버 인증을 통해 Alice QUANTUM SERVER로 전송한다.QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through SK Telecom quantum authentication server authentication connected to the licensed frequency SK Telecom carrier LoRA wireless network through the licensed frequency modem among multi-communication modems.
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성된다.Alice QUANTUM SERVER is configured by including an Alice Pseudo Random Number Generator (PRNG) and an Alice Quantum Random Number Generator (QRNG) therein.
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice 의사난수 시드(Seed)로 생성한 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하고, Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER generates Alice PIN data with the Alice pseudo-random number seed generated through the Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and uses the Alice PIN data generated with Alice pseudo-random number seed as a random number seed. Generates the Alice QUANTUM private key with , and generates the Alice QUANTUM public key by performing a beta OR (EX-OR) encryption operation on the Alice QUANTUM private key with the quantum random number seed that generated the quantum random number from the Alice quantum random number generator. .
Alice QUANTUM SERVER는 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하고, QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하고, 상기 복호화 생성된 Eve PIN 데이터와 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터가 일치할 경우,Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the SK Telecom carrier LoRA wireless network network to encrypt the licensed frequency with the SK Telecom carrier LoRA wireless network or wired network network and unlicensed. It retransmits to QUANTUM COLLABO through the frequency closed wireless network, and QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to obtain the Alice QUANTUM public key and Eve PIN data. When the decryption is generated and the decrypted Eve PIN data and the Eve PIN data extracted from the eve-NFC chip match,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결한다.MCU boots Boot-ROM through SPI Controller to control QUANTUM AC (Access Controller), and Bob QUANTUM through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems Connect SERVER and network network login (Log In).
(시스템 결합 - DATA 전송)(System Combine - DATA Transmission)
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송하지만, QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤사업자 3G 또는 4G 또는 5G 무선네트워크망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송한다.QUANTUM AC (Access Controller) transmits video data captured by surveillance camera encrypted with QUANTUM symmetric key through QUANTUM DUAL AP to Bob QUANTUM SERVER who is logged in to network network, but if communication with QUANTUM DUAL AP is impossible, multi-communication modem It is transmitted to Alice QUANTUM SERVER through any one of the 3G, 4G, or 5G wireless network of SK Telecom's licensed frequency through modem.
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it is transmitted to the Alice QUANTUM SERVER through one of the wired networks of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL. do.
Alice QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화한다.(대칭키알고리즘(Symmetric-key algorithm) 적용)Alice QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key from at least one of the wired network and the wireless network and decrypts it with the QUANTUM symmetric key. (Symmetric-key algorithm applied)
(핵심 구성요소 시스템 결합 방법)(How to combine key component systems)
QUANTUM COLLABO 내부의 QUANTUM AC(Access Controller)는 Alice QUANTUM 공개키를 멀티통신모뎀은 SK텔레콤 통신사업자 3G 면허주파수 모뎀, 4G 면허주파수 모뎀, 5G 면허주파수 모뎀, LoRA 모뎀 중 어느 하나를 통해 무선네트워크망으로 Alice QUANTUM SERVER로 전송하고, QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,QUANTUM AC (Access Controller) inside QUANTUM COLLABO uses the Alice QUANTUM public key, and the multi-communication modem is SK Telecom's telecommunication service provider's 3G licensed frequency modem, 4G licensed frequency modem, 5G licensed frequency modem, and LoRA modem. It transmits to Alice QUANTUM SERVER and transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency that can be communicated.
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC(Access Controller)와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 영상데이터를 암호화하여 전송하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로 한다.QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency for data transmission according to the communication environment according to obstacles. Before data transmission, QUANTUM AC (Access Controller) and QUANTUM DUAL A hybrid-QUANTUM CHANNEL One-Way- that selects a frequency with a fast response speed by conducting Low Frequency and High Frequency PING tests, encrypts large-capacity image data with the QUANTUM symmetric key, and transmits them to enhance security and reduce communication costs It features a Ring Network.
(경찰 업무용 양자스마트폰 서비스)(Quantum smartphone service for police work)
SK텔레콤 양자인증서버로 부터 인증된 경찰 업무용 police-APP이 업로드된 양자스마트폰(삼성전자 Galsxy S11 등) 내부에 탑재된 QRNG SoChip 양자난수생성기 및 외부에 NFC Tag 의사난수생성기로 구성된다.It consists of a QRNG SoChip quantum random number generator mounted inside a quantum smartphone (Samsung Electronics Galsxy S11, etc.) to which a police-app for police work certified by SK Telecom's quantum authentication server has been uploaded and an NFC Tag pseudo-random number generator on the outside.
NFC Tag 의사난수생성기는 NFC Writer를 통해서 OTP(One Time Password) 의사난수를 저장 및 동일한 OTP(One Time Password) 의사난수를 Alice QUANTUM SERVER에 저장한다.NFC Tag pseudo random number generator stores OTP (One Time Password) pseudo random number through NFC Writer and stores the same OTP (One Time Password) pseudo random number in Alice QUANTUM SERVER.
Alice QUANTUM SERVER에 양자스마트폰이 외부망메인보드에 접속하면,When a quantum smartphone connects to the external network main board in Alice QUANTUM SERVER,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여, Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하고, Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하고, 상기 Alice QUANTUM 공개키를 양자스마트폰으로 전송하면, 양자스마트폰은 Alice QUANTUM 공개키로 상기 NFC Tag를 양자스마트폰 NFC칩에 태깅하여 생성된 OTP(One Time Password) 의사난수를 암호화하여 재전송한다.Alice QUANTUM SERVER generates Alice PIN data with the Alice pseudo-random number seed generated through the Alice pseudo-random number generator, generates the Alice QUANTUM private key with the Alice PIN data as the random number seed, and uses the Alice quantum random number generator. When the Alice QUANTUM private key is subjected to beta-OR (EX-OR) encryption operation with the quantum random number seed generated from the quantum random number, the Alice QUANTUM public key is generated, and the Alice QUANTUM public key is transmitted to the quantum smartphone, The quantum smartphone encrypts and retransmits the OTP (One Time Password) pseudo-random number generated by tagging the NFC Tag to the quantum smartphone NFC chip with the Alice QUANTUM public key.
Alice QUANTUM SERVER는 QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 OTP(One Time Password) 의사난수를 복호화 후 저장된 OTP(One Time Password) 의사난수와 일치할 경우, 감시카메라 촬영 영상데이터를 망분리서버 내부망메인보드를 통해 외부망메인보드로 전송하고, 양자스마트폰은 외부망메인보드에 접속하여 양자스마트폰 MAC Address를 ID로 상기 OTP(One Time Password) 의사난수를 One-Time Password로 로그인하여 상기 영상데이터를 수신하는 것을 특징으로 하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄자가망 시스템이다.Alice QUANTUM SERVER decrypts the OTP (One Time Password) pseudo-random number encrypted with the Alice QUANTUM public key with the QUANTUM private key, and if it matches the stored OTP (One Time Password) pseudo-random number, the video data captured by the surveillance camera is transferred to the internal network main of the network separation server. The image data is transmitted to the external network main board through the board, and the quantum smartphone connects to the external network main board and logs in the OTP (One Time Password) pseudo-random number as the one-time password with the quantum smartphone MAC Address as the ID. It is a heterogeneous network QUANTUM KEY distribution hybrid quantum communication closed self-network system, characterized in that it receives
일 실시 예로,In one embodiment,
단말 SERVER, QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP(Access Point), 면허주파수 통신사업자 무선네트워크망, 비면허주파수 폐쇄형 무선자가망, 유선자가망으로 구성되어, Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 최초 양자난수를 생성하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하여 QUANTUM COLLABO 내부 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장하여 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이에 네트워크망 로그인(Log In) 후 영상데이터를 QUANTUM 대칭키로 암/복호화 데이터 통신하는 것을 특징으로 한다.Terminal SERVER, QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), licensed frequency carrier wireless network, unlicensed frequency closed wireless self-network, and wired self-network. The first quantum random number is generated through the Alice Quantum Random Number Generator (QRNG), and the QUANTUM symmetric key of the symmetric cryptographic algorithm is generated and stored in the QUANTUM COLLABO internal PUF-PIN Memory and Alice QUANTUM SERVER. After logging in to the network network between QUANTUM COLLABO and Alice QUANTUM SERVER, it is characterized in that the image data is encrypted/decrypted data communication with the QUANTUM symmetric key.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO와 무선네트워크망 연결된다. Alice QUANTUM SERVER is connected to QUANTUM COLLABO through a wireless network network of a licensed frequency carrier.
또한, Alice QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 3개 중 어느 하나의 유선자가망을 통해 Bob QUANTUM SERVER와 유선네트워크망 연결된다.In addition, Alice QUANTUM SERVER connects to Bob QUANTUM SERVER and a wired network through any one of the 3 non-QUANTUM CHANNEL or BB84 QUANTUM CHANNEL or hybrid-
QUANTUM COLLABO는 QUANTUM DUAL AP(Access Point)를 통해 비면허주파수 폐쇄형 무선자가망을 통해 Bob QUANTUM SERVER와 무선네트워크망 연결된다. QUANTUM COLLABO is connected to Bob QUANTUM SERVER and wireless network through QUANTUM DUAL AP (Access Point) through closed wireless self-network of unlicensed frequency.
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로, QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결되거나, QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결된다.QUANTUM COLLABO controls QUANTUM AC (Access Controller) and is connected to Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems, or QUANTUM COLLABO is QUANTUM It is connected to Alice QUANTUM SERVER through the licensed frequency communication operator wireless network through the licensed frequency modem among the multi communication modems by controlling the AC (Access Controller).
상기 구성요소 사이의 시스템 결합 관계를 설명한다.The system coupling relationship between the above components will be described.
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성된다. QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE.
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch로 구성된다.Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, MCU (Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, and Network Switch.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송한다. QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU.
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch를 제어한다.Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, and Network Switch.
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이다. System Memory is the system memory in which the MCU operating OS program is stored.
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성한다.The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. Asymmetric cryptographic algorithm Eve QUANTUM Generates a private key (PRIVATE KEY).
NFC Writer를 통해서 Eve PIN 데이터를 eve-NFC Chip에 입력 및 Alice QUANTUM SERVER에 저장한다.Input Eve PIN data to eve-NFC Chip through NFC Writer and save to Alice QUANTUM SERVER.
MCU는 Eve 양자난수생성기로 부터 수신하여 Security CPU에 저장된 양자난수 시드(Seed)와 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송한다. MCU receives from Eve quantum random number generator and performs beta OR (EX-OR) encryption operation on quantum random number seed stored in Security CPU and Eve QUANTUM private key stored in PUF-PIN memory to achieve OTP (One Time Password) asymmetry Asymmetric cryptographic algorithm Generates Eve QUANTUM public key (PUBLIC KEY), stores Eve QUANTUM public key in Security OTP (One Time Password) memory, and transmits Eve QUANTUM public key to QUANTUM AC (Access Controller) .
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송한다.QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network of the licensed frequency carrier.
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성된다.Alice QUANTUM SERVER is configured by including an Alice Pseudo Random Number Generator (PRNG) and an Alice Quantum Random Number Generator (QRNG) therein.
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하고, Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, generates Alice QUANTUM private key as a random number seed, and generates quantum random numbers from Alice quantum random number generator. The Alice QUANTUM public key is generated by performing an EX-OR encryption operation on the Alice QUANTUM private key with a quantum random number seed.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선자가망과 비면허주파수 폐쇄형 무선자가망 중 어느 하나를 통해 QUANTUM COLLABO로 재전송한다.Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired self-network and unlicensed frequency closed radio It retransmits to QUANTUM COLLABO through one of its own networks.
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성한다.QUANTUM COLLABO internal MCU decrypts Eve PIN data encrypted with Eve QUANTUM public key and Alice QUANTUM public key with Eve QUANTUM private key to decrypt and generate Alice QUANTUM public key and Eve PIN data.
상기 복호화 생성된 Eve PIN 데이터와 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터가 일치할 경우, MCU는 SPI Controller를 통해 Network Switch를 ON접점 전환 및 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며; When the decrypted Eve PIN data and the Eve PIN data extracted from the eve-NFC chip match, the MCU switches the Network Switch ON contact and controls the QUANTUM AC (Access Controller) through the SPI Controller to obtain a license among multi-communication modems. Connecting to Bob QUANTUM SERVER and the network network login (Log In) through the QUANTUM DUAL AP (Access Point) connected to the unlicensed frequency closed wireless self-network through the frequency modem;
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 단말 SERVER가 생성하는 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송에 있어서,QUANTUM AC (Access Controller) transmits the data generated by the terminal SERVER encrypted with the QUANTUM symmetric key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER who is logged in to the network network,
QUANTUM 대칭키로 암호화한 상기 단말 SERVER가 생성하는 데이터를 비면허주파수 모뎀을 통해 통신 가능한 Low 주파수 채널 또는 High 주파수 채널 중 어느 하나로 QUANTUM DUAL AP로 전송하는 것으로, QUANTUM DUAL AP는 전송 주파수를 Low Frequency 또는 High Frequency 중 하나를 선택하여 QUANTUM 대칭키로 단말 SERVER가 생성하는 데이터를 암호화하여 전송한다.The data generated by the terminal server encrypted with the QUANTUM symmetric key is transmitted to the QUANTUM DUAL AP through either a low frequency channel or a high frequency channel that can be communicated through an unlicensed frequency modem, and the QUANTUM DUAL AP transmits the transmission frequency to Low Frequency or High Frequency. Select one of them and send it by encrypting the data generated by the terminal server with the QUANTUM symmetric key.
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송한다.If communication with QUANTUM DUAL AP is impossible, it is transmitted to Alice QUANTUM SERVER through licensed frequency communication operator wireless network through licensed frequency modem among multi communication modems.
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 단말 SERVER가 생성하는 데이터를 수신하면, non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives data generated by the terminal SERVER encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it goes to Alice QUANTUM SERVER through one of the non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired networks. send.
Alice QUANTUM SERVER는 유선자가망과 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 단말 SERVER가 생성하는 데이터를 수신하여 QUANTUM 대칭키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄자가망 시스템이다.Alice QUANTUM SERVER receives the data generated by the terminal server encrypted with the QUANTUM symmetric key from one or more of the wired self-network and the wireless network and decrypts it with the QUANTUM symmetric key to enhance security. Hybrid-QUANTUM improves communication speed and reduces communication charges It is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed self-network system featuring CHANNEL One-Way-Ring Network.
일 실시 예로,In one embodiment,
QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, Bob QUANTUM SERVER로 구성된다.It consists of QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 Eve 양자난수를 최초 생성하여 Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성하고, QUANTUM COLLABO는 Eve 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Eve QUANTUM 개인키와 암호화 연산하여 Eve QUANTUM 공개키를 생성한다.QUANTUM COLLABO is composed of Eve quantum random number generator, it generates Eve quantum random number for the first time with Eve quantum random number generator and generates Eve QUANTUM private key with Eve quantum random number as a seed, QUANTUM COLLABO generates quantum random number with Eve quantum random number generator Generates Eve QUANTUM public key by encrypting it with Eve QUANTUM private key with random number seed by regenerating it.
DUAL MODEM은 Eve QUANTUM 공개키를 제1 네트워크망(통신사업자 무선네트워크망 또는 통신사업자 유선네트워크망)을 통해 Alice QUANTUM SERVER로 전송한다.DUAL MODEM transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the first network (communicator wireless network or telecommunication operator wired network).
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 Alice 양자난수를 최초 생성하여 Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하고 Alice QUANTUM SERVER is configured including the Alice quantum random number generator, and first generates Alice quantum random numbers with the Alice quantum random number generator, and generates the Alice QUANTUM private key with the Alice quantum random number as a seed.
Alice QUANTUM SERVER는 Alice 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER generates an Alice QUANTUM public key by regenerating a quantum random number with an Alice quantum random number generator and performing an encryption operation with the Alice QUANTUM private key as a random number seed.
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 제1 네트워크망을 통해 QUANTUM COLLABO로 전송한다.Alice QUANTUM SERVER transmits the Alice QUANTUM public key to QUANTUM COLLABO through the first network.
QUANTUM COLLABO는 Alice QUANTUM 공개키로 Eve 양자난수를 암호화하여 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송한다.QUANTUM COLLABO encrypts Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the first network.
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 Alice 양자난수를 암호화하여 제1 네트워크망을 통해 QUANTUM COLLABO로 전송한다.Alice QUANTUM SERVER encrypts Alice quantum random number with the Eve QUANTUM public key and transmits it to QUANTUM COLLABO through the first network.
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 Alice 양자난수를 복호화 후 내부 메모리에 저장된 Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성한다.QUANTUM COLLABO generates QUANTUM symmetric key by decrypting Alice quantum random number encrypted with Eve QUANTUM public key with Eve QUANTUM private key and performing encryption operation with Eve quantum random number stored in internal memory.
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 Eve 양자난수를 복호화 후 내부 메모리에 저장된 Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성한다.Alice QUANTUM SERVER decrypts the Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, and then performs an encryption operation with the Alice quantum random number stored in the internal memory to generate the QUANTUM symmetric key.
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송한다.QUANTUM COLLABO transmits encrypted data by encrypting internal data with QUANTUM symmetric key to DUAL MODEM.
DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 제2 네트워크 무선자가망(자치단체 무선자가망, 비면허주파수 폐쇄형 무선자가망) QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송한다.DUAL MODEM transmits the encrypted data encrypted with the QUANTUM symmetric key to the Bob QUANTUM SERVER through the QUANTUM AP of the second network wireless self-network (local government wireless self-network, unlicensed frequency closed wireless self-network).
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하면, 제2 네트워크 유선자가망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives the encrypted data encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it transmits it to Alice QUANTUM SERVER through the second network wired self-network.
제2 네트워크망은 Bob QUANTUM SERVER 전/후로 비면허주파수 폐쇄형 무선자가망과 유선자가망이 결합된 네트워크망이다.The second network is a network in which an unlicensed frequency closed wireless self-network and a wired self-network are combined before and after Bob QUANTUM SERVER.
일 예로, 제2 네트워크망은 'QUANTUM COLLABO-비면허주파수 폐쇄형 무선자가망-Bob QUANTUM SERVER-유선자가망-Alice QUANTUM SERVER'로 구성된다.As an example, the second network is composed of 'QUANTUM COLLABO-Unlicensed frequency closed wireless self-network-Bob QUANTUM SERVER-Cable self-network-Alice QUANTUM SERVER'.
Alice QUANTUM SERVER는 제2 네트워크 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄자가망 시스템이다.Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed self-network system featuring a Two-Way-Ring Network that receives encrypted data encrypted with the QUANTUM symmetric key from the second network wired self-network and decrypts it with the QUANTUM symmetric key. .
일 실시 예로,In one embodiment,
QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, Bob QUANTUM SERVER로 구성된다.It consists of QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 개인키(PRIVATE KEY)를 생성하기 위한 basic-Eve 양자난수를 생성하여 내부 메모리에 저장 및 basic-Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성한다. QUANTUM COLLABO consists of an Eve quantum random number generator, which generates a basic-Eve quantum random number for generating an asymmetric cryptographic algorithm PRIVATE KEY with the Eve quantum random number generator and stores it in the internal memory. Generates an Eve QUANTUM private key with a basic-Eve quantum random number as a seed.
QUANTUM COLLABO는 Eve 양자난수생성기로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 공개키(PUBLIC KEY)를 생성하기 위한 새로운 new-Eve 양자난수를 생성하여 시드로 Eve QUANTUM 개인키와 암호화 연산(공지된 EX-OR, EX-AND, 연산자, 연산함수 등)하여 Eve QUANTUM 공개키를 생성한다.QUANTUM COLLABO is an Eve quantum random number generator that generates a new new-Eve quantum random number to generate an asymmetric cryptographic algorithm public key (PUBLIC KEY) and uses the Eve QUANTUM private key and cryptographic operation (known EX-) as a seed. OR, EX-AND, operators, operation functions, etc.) to generate the Eve QUANTUM public key.
DUAL MODEM은 Eve QUANTUM 공개키를 통신사업자 유선 또는 무선망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송한다.DUAL MODEM transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through either the telecom operator's wired or wireless network.
상기와 같은 방법으로 Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 basic-Alice 양자난수를 생성하여 내부 메모리에 저장 및 basic-Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성한다.In the same way as above, Alice QUANTUM SERVER is configured including the Alice quantum random number generator, generates basic-Alice quantum random numbers with the Alice quantum random number generator, stores it in internal memory, and uses the basic-Alice quantum random number as a seed to generate the Alice QUANTUM private key. create
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 새로운 new-Alice 양자 난수를 생성하여 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성한다.Alice QUANTUM SERVER generates a new new-Alice quantum random number from the Alice quantum random number generator and performs an encryption operation with the Alice QUANTUM private key as a seed to generate the Alice QUANTUM public key.
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 통신사업자 유선 또는 무선망 중 어느하나를 통해 QUANTUM COLLABO로 전송한다.Alice QUANTUM SERVER transmits the Alice QUANTUM public key to QUANTUM COLLABO through either the telecommunication operator's wired or wireless network.
QUANTUM COLLABO는 Alice QUANTUM 공개키로 basic-Eve 양자난수를 암호화하여 통신사업자 유선 또는 무선망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송한다.QUANTUM COLLABO encrypts basic-Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through either wired or wireless networks of telecommunication service providers.
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 basic-Alice 양자난수를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 전송한다.Alice QUANTUM SERVER encrypts the basic-Alice quantum random number with the Eve QUANTUM public key and transmits it to the QUANTUM COLLABO through the wireless network of the telecommunication service provider.
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 basic-Alice 양자난수를 복호화 후 내부 메모리에 저장된 basic-Eve 양자난수와 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm) QUANTUM 대칭키를 생성한다.QUANTUM COLLABO generates a symmetric cryptographic algorithm QUANTUM symmetric key by decrypting the basic-Alice quantum random number encrypted with the Eve QUANTUM private key and the Eve QUANTUM public key, and then performing an encryption operation with the basic-Eve quantum random number stored in the internal memory.
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 basic-Eve 양자난수를 복호화 후 내부 메모리에 저장된 basic-Alice 양자난수와 암호화 연산하여 상기와 같이 대칭키 알고리즘(symmetric cryptographic algorithm) QUANTUM 대칭키를 생성한다.Alice QUANTUM SERVER decrypts the basic-Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, and performs an encryption operation with the basic-Alice quantum random number stored in the internal memory to obtain the symmetric cryptographic algorithm QUANTUM symmetric key as described above. create
즉, QUANTUM COLLABO와 Alice QUANTUM SERVER는 각 각 동일한 basic-Alice 양자난수와 basic-Eve 양자난수를 동일한 암호화 연산자를 사용하여 동일한 QUANTUM 대칭키를 생성한다.That is, QUANTUM COLLABO and Alice QUANTUM SERVER generate the same QUANTUM symmetric key by using the same encryption operator for the same basic-Alice quantum random number and basic-Eve quantum random number, respectively.
QUANTUM COLLABO에서 생성되는 내부 데이터(센서 등에서 측정되는 데이터)를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송한다.Internal data (measured by sensors, etc.) generated in QUANTUM COLLABO is encrypted with QUANTUM symmetric key and encrypted data is transmitted to DUAL MODEM.
DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송한다.DUAL MODEM transmits the encrypted data encrypted with the QUANTUM symmetric key to the Bob QUANTUM SERVER through the wireless self-network QUANTUM AP.
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송한다.When Bob QUANTUM SERVER receives the encrypted data encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it transmits it to the Alice QUANTUM SERVER through the wired network.
Alice QUANTUM SERVER는 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄자가망 시스템이다.Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed self-network system featuring a Two-Way-Ring Network that receives encrypted data encrypted with the QUANTUM symmetric key from the wired network and decrypts it with the QUANTUM symmetric key.
일 실시 예로,In one embodiment,
eve-NFC Chip은 정기점검 때 교체되는 물리적인 PUF(Physically Unclonable Function)의 하나로, NFC Writer를 통해서 Eve PIN 데이터를 입력 및 Alice QUANTUM SERVER에 저장하는 Eve PIN 데이터 생성단계.The eve-NFC Chip is one of the physical PUFs (Physically Unclonable Functions) that are replaced during regular inspection. The Eve PIN data is generated through the NFC Writer and stored in the Alice QUANTUM SERVER.
(Eve PIN 데이터 생성단계를 포함하는)Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장하는 Alice PIN 데이터를 생성단계.Alice QUANTUM SERVER (including the step of generating Eve PIN data) generates Alice PIN data through the Alice pseudo-random number generator and stores the Alice PIN data in QUANTUM COLLABO.
(Alice PIN 데이터를 생성단계를 포함하는)QUANTUM COLLABO 내부 QUANTUM JUMP ENGINE은 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계.The QUANTUM JUMP ENGINE inside QUANTUM COLLABO (including the step of generating Alice PIN data) receives the Eve PIN data stored in the eve-NFC Chip through non-contact Near Field Communication and the NFC Reader receives it and stores it in the PUF-PIN Memory. After that, the Eve QUANTUM private key generation step generates the Eve QUANTUM private key using the Eve PIN data as a random number seed.
(Eve QUANTUM 개인키 생성단계를 포함하는)QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) Eve QUANTUM 공개키를 생성하는 Eve QUANTUM 공개키 생성단계.QUANTUM COLLABO internal Eve quantum random number generator (including the step of generating the Eve QUANTUM private key) generates a quantum random number and performs a beta-OR (EX-OR) encryption operation with the Eve QUANTUM private key as the quantum random number seed to OTP ( One Time Password) Eve QUANTUM public key generation step to generate Eve QUANTUM public key.
(Eve QUANTUM 공개키 생성단계를 포함하는)QUANTUM COLLABO 내부 QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 전송단계.QUANTUM AC (Access Controller) inside QUANTUM COLLABO (including the step of generating the Eve QUANTUM public key) sends the Eve QUANTUM public key to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the SK Telecom carrier LoRA wireless network. Eve QUANTUM public key transmission step.
(Eve QUANTUM 공개키 전송단계를 포함하는)Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계.Alice QUANTUM SERVER (including the step of transmitting the Eve QUANTUM public key) generates Alice PIN data through the Alice pseudo-random number generator and generates the Alice QUANTUM private key with the Alice PIN data as a random number seed. Alice QUANTUM private key generation step .
(Alice QUANTUM 개인키 생성단계를 포함하는)Alice QUANTUM SERVER는 Alice 양자난수생성기를 통해 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계.Alice QUANTUM SERVER (including the step of generating the Alice QUANTUM private key) is a quantum random number seed that generates a quantum random number through the Alice quantum random number generator. Alice QUANTUM public key generation step to generate QUANTUM public key.
(Alice QUANTUM 공개키 생성단계를 포함하는)Alice QUANTUM SERVER는 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA(Certification Authority certificate)를 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Bob QUANTUM SERVER로 전송하는 유선네트워크망 전송단계.The Alice QUANTUM SERVER (including the step of generating the Alice QUANTUM public key) is the QUANTUM CA (Certification Authority) that encrypted the Eve PIN data and the Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the LoRA wireless network network of SK Telecom telecom operator. certificate) to the Bob QUANTUM SERVER through any one of the non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, or hybrid-QUANTUM CHANNEL via PUF-QRNG TWIN USB wired networks.
(유선네트워크망 전송단계를 포함하는)Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA를 2.4GHz Low Frequency로 QUANTUM COLLABO 내부 QUANTUM AC(QUANTUM ACcess Controller)로 전송하는 QUANTUM AC 전송단계.Bob QUANTUM SERVER (including the wire network transmission step) QUANTUM CA, which encrypted the Eve PIN data stored inside the Eve QUANTUM public key and the Alice QUANTUM public key, through the QUANTUM DUAL AP (Access Point), QUANTUM CA at 2.4GHz Low Frequency QUANTUM AC transmission stage that transmits to QUANTUM AC (QUANTUM ACcess Controller) inside COLLABO.
(QUANTUM AC 전송단계를 포함하는)QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA를 Eve QUANTUM 개인키로 복호화 하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화하는 복호화단계.QUANTUM COLLABO (including QUANTUM AC transmission step) decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and QUANTUM CA that encrypted the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt the Alice QUANTUM public key and Eve PIN data step.
(복호화단계를 포함하는)QUANTUM COLLABO는 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터를 추출한 후 상기 복호화단계에서 생성된 Eve PIN 데이터와 상기 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우, Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 QUANTUM AC(Access Controller)로 전송하는 영상데이터 전송 준비단계.QUANTUM COLLABO (including the decryption step) extracts the Eve PIN data extracted from the eve-NFC Chip and matches the Eve PIN data generated in the decryption step with the Eve PIN data extracted from the eve-NFC Chip, Alice Video data transmission preparation step of encrypting the video data captured by the surveillance camera with the QUANTUM public key and transmitting it to the QUANTUM AC (Access Controller).
(영상데이터 전송 준비단계를 포함하는)QUANTUM AC(Access Controller) 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 QUANTUM DUAL AP로 전송하는 영상데이터 전송단계.It performs QUANTUM AC (Access Controller) and High Frequency PING tests (including video data transmission preparation stage), selects a frequency with a fast response speed, and transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM DUAL AP. Video data transmission step.
(영상데이터 전송단계를 포함하는)Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 영상데이터 수신단계.When Bob QUANTUM SERVER (including the video data transmission step) receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key from the QUANTUM DUAL AP, one of the non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL Video data receiving step to be transmitted to Alice QUANTUM SERVER through a wired network.
(영상데이터 수신단계를 포함하는)Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 One-Way-Ring Network를 특징으로 하는 영상데이터 복호화단계.Alice QUANTUM SERVER (including the step of receiving the video data) receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key and decrypts the video data with the Alice QUANTUM private key. A video data decryption step characterized by a One-Way-Ring Network.
(영상데이터 복호화단계를 포함하는)Alice QUANTUM SERVER에 양자스마트폰이 외부망메인보드에 접속하면, Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 재생성하여, Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 재생성하는 Alice QUANTUM 개인키 재생성단계.When the quantum smartphone connects to the external network main board of the Alice QUANTUM SERVER (including the image data decryption step), the Alice QUANTUM SERVER regenerates the Alice PIN data through the Alice pseudo-random number generator, and seed the Alice PIN data as a random number. ) to regenerate the Alice QUANTUM private key with the Alice QUANTUM private key regeneration step.
(Alice QUANTUM 개인키를 재생성단계를 포함하는)Alice 양자난수생성기로 부터 새로운 양자난수를 생성한 신규 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 new Alice QUANTUM 공개키를 생성하는 new Alice QUANTUM 공개키 생성단계.(Including the step of regenerating the Alice QUANTUM private key) With a new quantum random number seed that generated a new quantum random number from the Alice quantum random number generator, EX-OR encryption operation of the Alice QUANTUM private key is performed to create a new Alice New Alice QUANTUM public key generation step to generate QUANTUM public key.
(new Alice QUANTUM 공개키 생성단계를 포함하는)상기 new Alice QUANTUM 공개키를 양자스마트폰으로 전송하면, 양자스마트폰은 new Alice QUANTUM 공개키로 상기 NFC Tag를 양자스마트폰 NFC칩에 태깅하여 생성된 OTP(One Time Password) 의사난수를 암호화하여 재전송하는 OTP 전송단계.When the new Alice QUANTUM public key is transmitted to the quantum smartphone (including the step of generating the new Alice QUANTUM public key), the quantum smartphone tags the NFC Tag with the new Alice QUANTUM public key to the quantum smartphone NFC chip and generates OTP (One Time Password) OTP transmission step of retransmitting the pseudo-random number by encrypting it.
(OTP 전송단계를 포함하는)Alice QUANTUM SERVER는 QUANTUM 개인키로 new Alice QUANTUM 공개키로 암호화된 OTP(One Time Password) 의사난수를 복호화 후 저장된 OTP(One Time Password) 의사난수와 일치할 경우, 감시카메라 촬영 영상데이터를 망분리서버 내부망메인보드를 통해 외부망메인보드로 전송하는 영상반출 준비단계.(Including the OTP transmission step) Alice QUANTUM SERVER decrypts the OTP (One Time Password) pseudo-random number encrypted with the new Alice QUANTUM public key with the QUANTUM private key. If it matches the stored OTP (One Time Password) pseudo-random number, the surveillance camera shoots Video export preparation stage in which the video data is transmitted to the external network main board through the internal network main board of the network separation server.
(영상반출 준비단계를 포함하는)양자스마트폰은 외부망메인보드에 접속하여 양자스마트폰 MAC Address를 ID로 상기 OTP(One Time Password) 의사난수를 One-Time Password로 로그인하여 상기 영상데이터를 수신하는 영상반출단계;를 특징으로 하는 hybrid-QUANTUM CHANNEL에 적용된 One-Way-Ring/Two-Way-Ring Network QUANTUM KEY 분배방법.The quantum smartphone (including the image export preparation step) receives the image data by accessing the external network main board and logging in the OTP (One Time Password) pseudo-random number with the quantum smartphone MAC Address as the ID as the One-Time Password. One-Way-Ring/Two-Way-Ring Network QUANTUM KEY distribution method applied to hybrid-QUANTUM CHANNEL, characterized in that
일 실시 예로,In one embodiment,
eve-NFC Chip은 정기점검 때 교체되는 물리적인 PUF(Physically Unclonable Function)의 하나로, NFC Writer를 통해서 Eve PIN 데이터를 입력 및 Alice QUANTUM SERVER에 저장하는 Eve PIN 데이터 생성단계.The eve-NFC Chip is one of the physical PUFs (Physically Unclonable Functions) that are replaced during regular inspection. The Eve PIN data is generated through the NFC Writer and stored in the Alice QUANTUM SERVER.
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장하는 Alice PIN 데이터를 생성단계.Alice QUANTUM SERVER generates Alice PIN data through the Alice pseudo-random number generator and stores the Alice PIN data in QUANTUM COLLABO.
QUANTUM COLLABO 내부 QUANTUM JUMP ENGINE은 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계.The QUANTUM JUMP ENGINE inside QUANTUM COLLABO receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication and the NFC Reader stores it in the PUF-PIN memory and then converts the Eve PIN data as a random number seed. Eve QUANTUM private key generation step to generate Eve QUANTUM private key.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) Eve QUANTUM 공개키를 생성하는 Eve QUANTUM 공개키 생성단계.QUANTUM COLLABO internal Eve quantum random number generator generates quantum random numbers and performs beta-OR (EX-OR) encryption operation of Eve QUANTUM private key with the quantum random number seed to generate OTP (One Time Password) Eve QUANTUM public key. Eve QUANTUM public key generation step.
QUANTUM COLLABO 내부 QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 전송단계.QUANTUM AC (Access Controller) inside QUANTUM COLLABO transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the licensed frequency SK Telecom carrier LoRA wireless network.
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계.Alice QUANTUM SERVER generates Alice PIN data through the Alice pseudo-random number generator, and generates the Alice QUANTUM private key using the Alice PIN data as a random number seed. Alice QUANTUM private key generation step.
Alice QUANTUM SERVER는 Alice 양자난수생성기를 통해 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계.Alice QUANTUM SERVER generates the Alice QUANTUM public key that generates the Alice QUANTUM public key by performing beta-OR (EX-OR) encryption on the Alice QUANTUM private key with the quantum random number seed that generates the quantum random number through the Alice quantum random number generator. step.
Alice QUANTUM SERVER는 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA(Certification Authority certificate)를 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Bob QUANTUM SERVER로 전송하는 유선네트워크망 전송단계.Alice QUANTUM SERVER transfers the Eve PIN data stored inside the Eve QUANTUM public key received through the SK Telecom operator LoRA wireless network network and the QUANTUM CA (Certification Authority certificate) that encrypted the Alice QUANTUM public key to non-QUANTUM CHANNEL or BB84 QUANTUM CHANNEL. Or a wired network transmission step of transmitting to Bob QUANTUM SERVER through any one wired network of hybrid-QUANTUM CHANNEL through PUF-QRNG TWIN USB.
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA를 2.4GHz Low Frequency로 QUANTUM COLLABO 내부 QUANTUM AC(QUANTUM ACcess Controller)로 전송하는 QUANTUM AC 전송단계.Bob QUANTUM SERVER, through QUANTUM DUAL AP (Access Point), encrypts Eve PIN data stored inside Eve QUANTUM public key and Alice QUANTUM public key to QUANTUM CA at 2.4GHz Low Frequency to QUANTUM AC (QUANTUM ACcess Controller) inside QUANTUM COLLABO Transmitting QUANTUM AC transmission stage.
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA를 Eve QUANTUM 개인키로 복호화 하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화하는 복호화단계.QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and QUANTUM CA that encrypted the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt the Alice QUANTUM public key and Eve PIN data.
QUANTUM COLLABO는 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터를 추출한 후 상기 복호화단계에서 생성된 Eve PIN 데이터와 상기 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우, Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 QUANTUM AC(Access Controller)로 전송하는 영상데이터 전송 준비단계.QUANTUM COLLABO extracts the Eve PIN data extracted from the eve-NFC Chip and matches the Eve PIN data generated in the decryption step with the Eve PIN data extracted from the eve-NFC Chip, the video captured by the surveillance camera with the Alice QUANTUM public key Video data transmission preparation step by encrypting data and transmitting it to QUANTUM AC (Access Controller).
QUANTUM AC(Access Controller) 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 QUANTUM DUAL AP로 전송하는 영상데이터 전송단계.The video data transmission step of performing QUANTUM AC (Access Controller) and High Frequency PING tests, selecting a frequency with a fast response speed, and transmitting the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM DUAL AP.
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 영상데이터 수신단계.When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the Alice QUANTUM public key from the QUANTUM DUAL AP, it goes to Alice QUANTUM SERVER through one of the wired networks of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL. The step of receiving video data to be transmitted.
Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 One-Way-Ring Network를 특징으로 하는 영상데이터 복호화단계.Alice QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key and decrypts the video data with the Alice QUANTUM private key. An image data decryption step characterized by a One-Way-Ring Network.
Alice QUANTUM SERVER에 양자스마트폰이 외부망메인보드에 접속하면, Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 재생성하여, Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 재생성하는 Alice QUANTUM 개인키를 재생성단계.When the quantum smartphone accesses the external network mainboard of the Alice QUANTUM SERVER, the Alice QUANTUM SERVER regenerates the Alice PIN data through the Alice pseudo-random number generator, and regenerates the Alice QUANTUM private key with the Alice PIN data as a random number seed. Step to regenerate Alice QUANTUM private key.
Alice 양자난수생성기로 부터 새로운 양자난수를 생성한 신규 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 new Alice QUANTUM 공개키를 생성하는 new Alice QUANTUM 공개키 생성단계.Create a new Alice QUANTUM public key that generates a new Alice QUANTUM public key by performing an EX-OR encryption operation on the Alice QUANTUM private key with a new quantum random number seed that generates a new quantum random number from the Alice quantum random number generator step.
상기 new Alice QUANTUM 공개키를 양자스마트폰으로 전송하면, 양자스마트폰은 new Alice QUANTUM 공개키로 상기 NFC Tag를 양자스마트폰 NFC칩에 태깅하여 생성된 OTP(One Time Password) 의사난수를 암호화하여 재전송하는 OTP 전송단계.When the new Alice QUANTUM public key is transmitted to the quantum smartphone, the quantum smartphone encrypts and retransmits the OTP (One Time Password) pseudo-random number generated by tagging the NFC Tag to the quantum smartphone NFC chip with the new Alice QUANTUM public key. OTP transmission step.
Alice QUANTUM SERVER는 QUANTUM 개인키로 new Alice QUANTUM 공개키로 암호화된 OTP(One Time Password) 의사난수를 복호화 후 저장된 OTP(One Time Password) 의사난수와 일치할 경우, 감시카메라 촬영 영상데이터를 망분리서버 내부망메인보드를 통해 외부망메인보드로 전송하는 영상반출 준비단계.Alice QUANTUM SERVER decrypts the OTP (One Time Password) pseudo-random number encrypted with the new Alice QUANTUM public key with the QUANTUM private key, and if it matches the stored OTP (One Time Password) pseudo-random number, the video data captured by the surveillance camera is transferred to the internal network of the network separation server. The video export preparation stage, which is transmitted to the external network main board through the main board.
양자스마트폰은 외부망메인보드에 접속하여 양자스마트폰 MAC Address를 ID로 상기 OTP(One Time Password) 의사난수를 One-Time Password로 로그인하여 상기 영상데이터를 수신하는 영상반출단계를 특징으로 하는 HYBRID-QUANTUM CHANNEL에 적용된 ONE-WAY-RING/TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.HYBRID characterized in that the quantum smartphone connects to the external network main board and receives the image data by logging in the OTP (One Time Password) pseudo-random number as the quantum smartphone MAC Address as the ID as the One-Time Password. - ONE-WAY-RING/TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to QUANTUM CHANNEL.
일 실시 예로,In one embodiment,
Alice/Bob QUANTUM SERVER는 내부에 Alice/Bob 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 무작위 양자난수를 Alice/Bob이 생성하여 암호화 연산을 통해 Half Mirror Effect 대칭키 알고리즘(Symmetric Cryptographic Algorithm)의 QUANTUM 대칭키를 생성하는 것을 특징으로,Alice/Bob QUANTUM SERVER generates a random quantum random number by Alice/Bob through the Alice/Bob Quantum Random Number Generator (QRNG) inside and uses the Half Mirror Effect Symmetric Cryptographic Algorithm through encryption operation. Characterized in generating a QUANTUM symmetric key,
양자난수생성기(QRNG)는 대칭키 알고리즘의 QUANTUM 대칭키를 생성하기 위한 난수 시드(Seed) early-QRN(Quantum Random Number)을 생성 및 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)의 QUANTUM 개인키(PRIVATE KEY)를 생성하기 위한 난수 시드(Seed) basic-QRN(Quantum Random Number)와 QUANTUM 공개키(PUBLIC KEY) 쌍을 생성하기 위한 난수 시드(Seed) new-QRN(Quantum Random Number)를 생성하는 new-QRN 생성단계.Quantum random number generator (QRNG) generates a random number seed early-QRN (Quantum Random Number) for generating QUANTUM symmetric key of symmetric key algorithm and QUANTUM private key (PRIVATE KEY) of asymmetric cryptographic algorithm ), a random number seed for generating basic-QRN (Quantum Random Number) and a QUANTUM public key (PUBLIC KEY) pair, a random number seed for generating new-QRN (Quantum Random Number) new-QRN creation stage.
Alice QUANTUM SERVER는 통신사업자 네트워크망을 통해 QUANTUM COLLABO와 네트워크망 연결 및 Alice QUANTUM SERVER는 non-QUANTUM CHANNEL, QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 연결된 Bob QUANTUM SERVER를 거쳐 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO와 네트워크망과 연결하는 네트워크망 연결단계.Alice QUANTUM SERVER is connected to QUANTUM COLLABO through the network of a telecommunication service provider, and Alice QUANTUM SERVER is a non-licensed frequency closed wireless self-network through Bob QUANTUM SERVER connected through one of non-QUANTUM CHANNEL and QUANTUM CHANNEL wired self-network. Network network connection stage to connect QUANTUM COLLABO and network network through
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 통신사업자 네트워크망 중 어느 하나 이상을 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결 또는 QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 통신사업자 모뎀을 통해 통신사업자 네트워크망을 통해 Alice QUANTUM SERVER와 연결하는 네트워크망 선택단계.QUANTUM COLLABO is composed of QUANTUM AC and Eve quantum random number generator, QUANTUM COLLABO controls QUANTUM AC and connects to Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems or QUANTUM COLLABO controls QUANTUM AC Network network selection step of connecting with Alice QUANTUM SERVER through the communication operator network network through the communication operator modem among the multi-communication modems.
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN 난수를 생성하여 난수 시드로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계.QUANTUM COLLABO generates basic-QRN random number from Eve quantum random number generator and generates an asymmetric key cryptographic algorithm Eve QUANTUM private key with random number seed Eve QUANTUM private key generation step.
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN 난수를 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 비대칭키 암호 알고리즘 OTP(One Time Password) Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하고, QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 통신사업자 모뎀으로 통신사업자 네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 전송단계.QUANTUM COLLABO generates new-QRN random number from Eve quantum random number generator and encrypts Eve QUANTUM private key and new-QRN random number seed to generate asymmetric key encryption algorithm OTP (One Time Password) Eve QUANTUM public key to QUANTUM AC A transmission step in which QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the telecommunication carrier network as a telecommunication carrier modem among multi-communication modems.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN를 수신하여 난수 시드로 비대칭키 암호 알고리즘 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계.Alice QUANTUM SERVER is configured with an Alice quantum random number generator inside. Alice QUANTUM SERVER receives basic-QRN from Alice quantum random number generator and generates an asymmetric key cryptographic algorithm Alice QUANTUM private key as a random number seed Alice QUANTUM private key creation stage.
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN 난수를 수신하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 비대칭키 암호 알고리즘 OTP(One Time Password) Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계.Alice QUANTUM SERVER receives new-QRN random number from Alice quantum random number generator and encrypts Alice QUANTUM private key and new-QRN random number seed to generate asymmetric key encryption algorithm OTP (One Time Password) Alice QUANTUM public key Alice QUANTUM public key generation.
Alice QUANTUM SERVER와 QUANTUM COLLABO는 통신사업자 네트워크망을 통하여 Alice QUANTUM 공개키를 전송하여 Alice QUANTUM 공개키와 Eve QUANTUM 공개키를 서로 교환하는 키 교환단계.A key exchange step in which Alice QUANTUM SERVER and QUANTUM COLLABO exchange the Alice QUANTUM public key and the Eve QUANTUM public key by transmitting the Alice QUANTUM public key through the network of the telecommunication service provider.
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN를 수신하여 Alice QUANTUM 공개키로 early-Eve QRN를 암호화하여 통신사업자 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN를 수신하여 Eve QUANTUM 공개키로 early-Alice QRN를 암호화하여 통신사업자 네트워크망을 통하여 QUANTUM COLLABO로 전송하는 전송 단계.QUANTUM COLLABO receives the early-Eve QRN from the Eve quantum random number generator, encrypts the early-Eve QRN with the Alice QUANTUM public key, and transmits it to the Alice QUANTUM SERVER through the network of the operator, and the Alice QUANTUM SERVER from the Alice quantum random number generator Transmission step of receiving early-Alice QRN, encrypting early-Alice QRN with the Eve QUANTUM public key, and transmitting it to QUANTUM COLLABO through the carrier network.
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 대칭키 알고리즘의 QUANTUM 대칭키를 생성하고, Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 상기와 동일한 암호화 연산하여 대칭키 알고리즘의 QUANTUM 대칭키를 생성하는 대칭키 생성단계.QUANTUM COLLABO decrypts early-Alice QRN encrypted with Eve QUANTUM public key with Eve QUANTUM private key, and generates QUANTUM symmetric key of symmetric key algorithm by cryptographic operation with early-Eve QRN. Alice QUANTUM SERVER discloses Alice QUANTUM with Alice QUANTUM private key A symmetric key generation step of generating the QUANTUM symmetric key of the symmetric key algorithm by decrypting the early-Eve QRN encrypted with the key and performing the same encryption operation as the early-Alice QRN.
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보를 QUATUM 대칭키로 암호화하여 유선자가망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 비면허주파수 폐쇄형 무선자가망을 통해 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM COLLABO로 전송하고, QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM 대칭키로 복호화하여 승인된 Log 정보일 경우, QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하는 로그인 단계. Alice QUANTUM SERVER encrypts QUANTUM COLLABO's log information with QUATUM symmetric key and transmits it to Bob QUANTUM SERVER through wired self-network, and Bob QUANTUM SERVER encrypts QUANTUM COLLABO's log information with QUATUM symmetric key through unlicensed frequency closed wireless self-network. to QUANTUM COLLABO, and QUANTUM COLLABO decrypts the log information of QUANTUM COLLABO encrypted with the QUATUM symmetric key and decrypts the log information with the QUANTUM symmetric key. If it is the approved log information, it controls QUANTUM AC to close the unlicensed frequency through the unlicensed frequency modem among the multi-communication modems. Login step to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM DUAL AP (Access Point) connected by type wireless self-network.
QUANTUM AC는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 비면허주파수 폐쇄형 무선자가망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 감시카메라 촬영 영상데이터를 non-QUANTUM CHANNEL, QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.QUANTUM AC transmits video data from surveillance cameras encrypted with QUANTUM symmetric key through QUANTUM DUAL AP to Bob QUANTUM SERVER through a closed wireless self-network with unlicensed frequency that is logged in to the network network, and Bob QUANTUM SERVER shoots surveillance cameras Video data is transmitted to Alice QUANTUM SERVER through any one of non-QUANTUM CHANNEL, QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired self-network, and Alice QUANTUM SERVER encrypted surveillance camera video data from the wired self-network with QUANTUM symmetric key. TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to HYBRID-QUANTUM CHANNEL featuring a hybrid-QUANTUM CHANNEL Two-Way-Ring Network, characterized by receiving and decrypting with a QUANTUM symmetric key.
일 실시 예로,In one embodiment,
QUANTUM SERVER는 내부에 양자난수생성기를 통해 생성한 무작위 양자난수를 시드로 QUANTUM 대칭키, QUANTUM 개인키, QUANTUM 공개키를 생성하는 교환하는 QKD(Quantum Key Distribution)를 특징으로,QUANTUM SERVER features QKD (Quantum Key Distribution) that exchanges the random quantum random number generated through the internal quantum random number generator as a seed to generate QUANTUM symmetric key, QUANTUM private key, and QUANTUM public key.
양자난수생성기는 QUANTUM 대칭키를 생성하기 위한 early-QRN 난수를 생성 및 QUANTUM 개인키를 생성하기 위한 basic-QRN 난수와 QUANTUM 공개키를 생성하기 위한 new-QRN 난수를 생성하는 난수생성 단계.The quantum random number generator generates an early-QRN random number to generate a QUANTUM symmetric key, and a basic-QRN random number to generate a QUANTUM private key and a new-QRN random number to generate a QUANTUM public key.
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 제1 네트워크망 또는 제2 네트워크망 중 어느 하나를 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC를 제어하여 제1 네트워크망을 통해 QUANTUM COLLABO와 연결되는 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이의 제1 네트워크망에 연결 또는 QUANTUM COLLABO는 QUANTUM AC를 제어하여 제2 네트워크망을 통해 Alice QUANTUM SERVER와 연결되는 Alice QUANTUM SERVER와 QUANTUM COLLABO 사이의 제2 네트워크망에 연결하는 네트워크망 연결단계.QUANTUM COLLABO is composed of QUANTUM AC and Eve quantum random number generator, QUANTUM COLLABO selectively selects either the first network or the second network through QUANTUM AC inside, QUANTUM COLLABO uses QUANTUM AC Connected to the first network between QUANTUM COLLABO and Alice QUANTUM SERVER connected to QUANTUM COLLABO through the first network or QUANTUM COLLABO controls QUANTUM AC and Alice QUANTUM connected to Alice QUANTUM SERVER through the second network Network connection step of connecting to the second network between SERVER and QUANTUM COLLABO.
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성 단계.QUANTUM COLLABO generates basic-QRN from Eve quantum random number generator and generates Eve QUANTUM private key with random number seed Eve QUANTUM private key generation step.
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN을 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하는 QUANTUM AC 전송단계.QUANTUM COLLABO generates new-QRN from Eve quantum random number generator, encrypts Eve QUANTUM private key and new-QRN random number seed, generates Eve QUANTUM public key, and transmits QUANTUM AC to QUANTUM AC.
QUANTUM AC는 Eve QUANTUM 공개키를 제1 네트워크망으로 연결된 Alice QUANTUM SERVER로 전송하는 Alice QUANTUM SERVER 전송단계.QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER connected to the first network in the Alice QUANTUM SERVER transmission step.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Alice QUANTUM 개인키를 생성하고, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN을 생성하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계.Alice QUANTUM SERVER is configured with Alice quantum random number generator inside, Alice QUANTUM SERVER generates basic-QRN from Alice quantum random number generator to generate Alice QUANTUM private key as a random number seed, and Alice QUANTUM SERVER generates Alice quantum random number Alice QUANTUM public key generation step of generating a new-QRN from the generator and encrypting the Alice QUANTUM private key and the new-QRN random number seed to generate the Alice QUANTUM public key.
Alice QUANTUM SERVER는 제1 네트워크망을 통하여 Alice QUANTUM 공개키를 QUANTUM COLLABO로 전송하고, QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN을 수신하여 Alice QUANTUM 공개키로 early-Eve QRN을 암호화하여 제1 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN을 수신하여 Eve QUANTUM 공개키로 early-Alice QRN을 암호화하여 제1 네트워크망을 통하여 QUANTUM COLLABO로 전송하는 QUANTUM COLLABO 전송단계.Alice QUANTUM SERVER sends Alice QUANTUM public key to QUANTUM COLLABO through the first network, QUANTUM COLLABO receives early-Eve QRN from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and encrypts the first It transmits to Alice QUANTUM SERVER through the network, and Alice QUANTUM SERVER receives the early-Alice QRN from the Alice quantum random number generator, encrypts the early-Alice QRN with the Eve QUANTUM public key, and transmits it to the QUANTUM COLLABO through the first network. QUANTUM COLLABO transfer stage.
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하고, Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하는 QUANTUM 대칭키 생성단계.QUANTUM COLLABO decrypts the early-Alice QRN encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and generates a QUANTUM symmetric key by performing an encryption operation with the early-Eve QRN, and the Alice QUANTUM SERVER early encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key. - QUANTUM symmetric key generation step to generate QUANTUM symmetric key by encrypting with early-Alice QRN after decrypting Eve QRN.
QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 내부 데이터를 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 QUATUM 대칭키로 암호화한 내부 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.QUANTUM COLLABO transmits internal data encrypted with QUATUM symmetric key to Alice QUANTUM SERVER, and Alice QUANTUM SERVER receives internal data encrypted with QUATUM symmetric key and decrypts with QUANTUM symmetric key hybrid-QUANTUM CHANNEL Two-Way-Ring TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to HYBRID-QUANTUM CHANNEL featuring Network.
일 실시 예로,In one embodiment,
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망과 연결되고, 또한 Alice QUANTUM SERVER는 non-QUANTUM CHANNEL 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되고, Bob QUANTUM SERVER는 QUANTUM DUAL AP를 통해 QUANTUM COLLABO와 비면허주파수 폐쇄형 무선자가망 연결되어,Alice QUANTUM SERVER is connected to the licensed frequency carrier wireless network, and Alice QUANTUM SERVER is connected to Bob QUANTUM SERVER through a non-QUANTUM CHANNEL wired network network, and Bob QUANTUM SERVER is connected to QUANTUM COLLABO through QUANTUM DUAL AP. Unlicensed frequency closed wireless self-network is connected,
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 연결 또는 QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결을 선택적으로 연결하는 네트워크망 선택단계. QUANTUM COLLABO selectively selects unlicensed frequency closed radio self-network or licensed frequency carrier wireless network network through QUANTUM AC in data transmission/reception, QUANTUM COLLABO controls QUANTUM AC to control unlicensed frequency among multi-communication modems Connected to Bob QUANTUM SERVER through QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through modem or QUANTUM COLLABO controls QUANTUM AC and Alice through licensed frequency modem among multi-communication modems through licensed frequency carrier wireless network Network network selection step to selectively connect QUANTUM SERVER and connection.
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하면, Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신(Near Field Communication)으로 Eve PIN 데이터가 수신되면 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계Eve quantum random number generator inside QUANTUM COLLABO generates quantum random number and transmits it to Encrypt TLS MODULE. When Eve PIN data is received from NFC card through contactless near field communication, the Encrypt TLS MODULE stores the Eve PIN data as a random number. Eve QUANTUM private key generation step to generate Eve QUANTUM private key, asymmetric key encryption algorithm with seed
NFC 카드에 NFC Writer를 통해서 Eve PIN 데이터를 입력 후 Alice QUANTUM SERVER에 저장하고, Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;After inputting the Eve PIN data to the NFC card through the NFC Writer, it is stored in Alice QUANTUM SERVER, and the Encrypt TLS MODULE receives the quantum random number from the Eve quantum random number generator and encrypts the Eve QUANTUM private key with the quantum random number seed. OTP (One Time Password) asymmetric key encryption algorithm generates and stores the Eve QUANTUM public key and transmits the Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 생성단계.QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency communication operator wireless network network through the licensed frequency modem among multi-communication modems. Eve QUANTUM public key generation step.
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계.Alice QUANTUM SERVER is configured with Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside. Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo random number generator and stores it in QUANTUM COLLABO and Alice PIN Alice QUANTUM private key generation step of generating the Alice QUANTUM private key using data as a random number seed.
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계.Alice QUANTUM public key generation step of generating the Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed that generated the quantum random number from the Alice quantum random number generator.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하는 재전송단계.Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed radio Retransmission step of retransmitting to QUANTUM COLLABO through own network.
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하는 복호화단계.QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data.
상기 복호화단계에서 복호화된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우, QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하는 로그인단계.If the Eve PIN data decrypted in the decryption step matches the Eve PIN data stored inside, QUANTUM COLLABO controls QUANTUM AC and QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems Login step to connect Bob QUANTUM SERVER with network login (Log In).
QUANTUM AC는 QUANTUM DUAL AP를 통해 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송함에 있어서, Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 비면허주파수 데이터 전송단계.When QUANTUM AC transmits the terminal device generated data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER who is logged in to the network network through the QUANTUM DUAL AP, the terminal device generated data encrypted with the Alice QUANTUM public key is transmitted to the unlicensed frequency modem. Unlicensed frequency data transmission step to be transmitted to QUANTUM DUAL AP through
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 영상데이터를 수신하면, non-QUANTUM CHANNEL 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Bob QUANTUM SERVER의 유선네트워크망 중계단계. When Bob QUANTUM SERVER receives the terminal device-generated image data encrypted with the Alice QUANTUM public key from the QUANTUM DUAL AP, it transmits it to the Alice QUANTUM SERVER through the non-QUANTUM CHANNEL wired network.
Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.Alice QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key to enhance security, improve communication speed and reduce communication charges. HYBRID- featuring hybrid-QUANTUM CHANNEL One-Way-Ring Network TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to QUANTUM CHANNEL.
일 실시 예로,In one embodiment,
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 Eve 양자난수를 최초 생성하여 Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계.QUANTUM COLLABO is composed of Eve quantum random number generator, and Eve QUANTUM private key generation step to generate Eve QUANTUM private key with Eve quantum random number as a seed by first generating Eve quantum random number with Eve quantum random number generator.
QUANTUM COLLABO는 Eve 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Eve QUANTUM 개인키와 암호화 연산하여 Eve QUANTUM 공개키를 생성하는 Eve QUANTUM 공개키를 생성단계.QUANTUM COLLABO generates Eve QUANTUM public key that generates Eve QUANTUM public key by regenerating quantum random numbers with Eve quantum random number generator and encrypting Eve QUANTUM private key with random number seed.
DUAL MODEM은 Eve QUANTUM 공개키를 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 전송단계.DUAL MODEM transmits Eve QUANTUM public key to Alice QUANTUM SERVER through the first network, Eve QUANTUM public key transmission step.
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 Alice 양자난수를 최초 생성하여 Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키를 생성단계.Alice QUANTUM SERVER is configured to include an Alice quantum random number generator, and the Alice QUANTUM private key is generated by first generating an Alice quantum random number with the Alice quantum random number generator and using the Alice quantum random number as a seed to generate the Alice QUANTUM private key.
Alice QUANTUM SERVER는 Alice 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계.Alice QUANTUM SERVER generates an Alice QUANTUM public key that generates an Alice QUANTUM public key by regenerating a quantum random number with an Alice quantum random number generator and encrypting it with the Alice QUANTUM private key as a random number seed
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하는 Alice QUANTUM 공개키 전송단계.Alice QUANTUM SERVER transmits the Alice QUANTUM public key to the QUANTUM COLLABO through the first network, an Alice QUANTUM public key transmission step.
QUANTUM COLLABO는 Alice QUANTUM 공개키로 Eve 양자난수를 암호화하여 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 Alice 양자난수를 암호화하여 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하는 양자난수 교환단계.QUANTUM COLLABO encrypts Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the first network, and Alice QUANTUM SERVER encrypts Alice quantum random number with Eve QUANTUM public key and transmits it to QUANTUM COLLABO through the first network Quantum random number exchange step.
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 Alice 양자난수를 복호화 후 내부 메모리에 저장된 Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하고, 역시 Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 Eve 양자난수를 복호화 후 내부 메모리에 저장된 Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하여 동일한 QUANTUM 대칭키를 생성하는 QUANTUM 대칭키 생성단계.QUANTUM COLLABO decrypts Alice quantum random number encrypted with Eve QUANTUM public key with Eve QUANTUM private key and performs encryption operation with Eve quantum random number stored in internal memory to generate QUANTUM symmetric key. A QUANTUM symmetric key generation step of generating the same QUANTUM symmetric key by decrypting the encrypted Eve quantum random number and performing an encryption operation with the Alice quantum random number stored in the internal memory.
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송하면, DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 제2 네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 암호화 데이터 전송단계.When QUANTUM COLLABO sends encrypted data encrypted with QUANTUM symmetric key to DUAL MODEM, DUAL MODEM transmits encrypted data encrypted with QUANTUM symmetric key to Alice QUANTUM SERVER through the second network.
Alice QUANTUM SERVER는 제2 네트워크망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 복호화단계를 포함하는 Two-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.Alice QUANTUM SERVER receives the encrypted data encrypted with the QUANTUM symmetric key from the second network and decrypts it with the QUANTUM symmetric key. TWO-WAY- applied to the HYBRID-QUANTUM CHANNEL featuring a Two-Way-Ring Network including a decryption step RING NETWORK QUANTUM KEY distribution method.
10. 필터부
11. 필터구동모터
12. 줌렌즈
13. 줌모터
14. 가변초점렌즈
15. 포커스모터
16. 포커스렌즈
17. 모터구동드라이브
18. M/M
19. CPU
20. RS-485
21. 수동조작부
22. 리모트컨트롤부
23. TRNG
24. System M/M
25. PUF-PIN M/M
26. Security CPU
27. MCU
28. PUF Chip
29. e-FUSE
30. Security OTP M/M
31. Boot-ROM
32. SPI Controller
33. 촬상센서부
34. 5G QUANTUM JUMP ENGINE
35. 영상 6G SECURITY ENGINE
36. Quantum Entanglement
37. Decoy Pulse
38. 영상분석모듈
39. 객체인식 모듈
40. 번호인식 모듈
41. DEBUGGER
42. QUANTUM BLOCK CHAIN
43. 1:N BLOCK CHAIN
44. BNC 커넥터
45. RJ-45 커넥터
46. 센서부
47. AMI
48. 배전반
49. QUANTUM 5G AP(Access Point)
50. 방송장치
51. 비상벨
52. 가로/보안등
53. 디머
54. 단말 SINGLE USB
55. Bob 6G QUANTUM SERVER
56. Bob QUANTUM SERVER
57. Bob PUF-QRNG TWIN USB
58. non-QUANTUM CHANNEL
59. QUANTUM CHANNEL
60. hybrid-QUANTUM CHANNEL
61. Master QUANTUM SERVER
62. Alice 6G QUANTUM SERVER
63. Alice QUANTUM SERVER
64. QUANTUM 6G SECURITY ENGINE
65. Alice PUF-QRNG TWIN USB
66. LPWAN 통신모뎀10. Filter unit
11. Filter drive motor
12. Zoom Lens
13. Zoom Motor
14. Varifocal Lens
15. Focus Motor
16. Focus Lens
17. Motor drive drive
18. M/M
19. CPU
20. RS-485
21. Manual control panel
22. Remote control unit
23. TRNG
24. System M/M
25. PUF-PIN M/M
26. Security CPU
27. MCU
28. PUF Chip
29. e-FUSE
30. Security OTP M/M
31. Boot-ROM
32. SPI Controller
33. Image sensor unit
34. 5G QUANTUM JUMP ENGINE
35.
36. Quantum Entanglement
37. Decoy Pulse
38. Image analysis module
39. Object Recognition Module
40. Number recognition module
41. DEBUGGER
42. QUANTUM BLOCK CHAIN
43. 1:N BLOCK CHAIN
44. BNC connector
45. RJ-45 connector
46. Sensor unit
47. AMI
48. switchboard
49.
50. Broadcasting device
51. Emergency Bell
52. Street/security light
53. Dimmer
54. Terminal SINGLE USB
55.
56. Bob QUANTUM SERVER
57. Bob PUF-QRNG TWIN USB
58. non-QUANTUM CHANNEL
59. QUANTUM CHANNEL
60. hybrid-QUANTUM CHANNEL
61. Master QUANTUM SERVER
62.
63. Alice QUANTUM SERVER
64.
65. Alice PUF-QRNG TWIN USB
66. LPWAN communication modem
Claims (53)
상용전원을 공급받아 전력 사용량을 측정 및 LPWAN(Low Power Wide Area Network) 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이며;
상기 AMI(47)를 거쳐 LED 가로/보안등(52)에 전력을 공급하는 배전반(48)이며;
상기 LED 가로/보안등(52)에 부착되어 전력을 공급 받는 디머(53), QUANTUM 5G AP(49), 방송장치(50), 비상벨(51)이며;
Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE USB(54)가 수신하여 방송하는 방송장치(50)이며;
비상벨(51) 작동시 비상벨 작동 이벤트를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE USB(54)를 통해 전송하는 비상벨(51)이며;
센서부(46)는 센서를 통해 측정되는 데이터를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE USB(54)를 통해 전송하는 센서부(46)이며;
UHD 감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이며;
QUANTUM 5G AP(49)는 UHD 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이며;
단말 SINGLE USB(54) 및 Master QUANTUM SERVER(61) 및 Alice 6G QUANTUM SERVER(62) 및 Alice QUANTUM SERVER(63)는 대칭키 알고리즘(symmetric cryptographic algorithm)의 동일한 대칭키를 저장하고 있어, 방송데이터, 비상벨 작동 이벤트 데이터, 센서를 통해 측정되는 데이터, 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터, 감시카메라 제어데이터, 방송장치 제어데이터, 디머 제어데이터를 암/복호화하며;
UHD 감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
양자통신부는 Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN 통신모뎀(66)으로 구성되어,
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
센서부(46)로부터 수집되는 센싱 데이터, AMI(47)로부터 측정되는 측정 데이터, 하나 이상의 배전반(48)으로부터 수집되는 배전반 상태정보 데이터, 하나 이상의 방송장치(50)로부터 수집되는 음성/영상 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE USB(54)으로 전송하며;
단말 SINGLE USB(54)는 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN USB(65) 중 어느 하나로부터 UHD 감시카메라 제어데이터 또는 방송장치 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE USB(54)로 전송하며;
단말 SINGLE USB(54)는 Bob 6G QUANTUM SERVER(55)로부터 UHD 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 비대칭 개인키(PRIVATE KEY)를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 비대칭 개인키(PRIVATE KEY)와 베타적 논리합(EX-OR) 암호화 연산하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 비대칭 공개키(PUBLIC KEY)를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 UHD 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice QUANTUM SERVER(63)와 Bob QUANTUM SERVER(56)는 QUANTUM CHANNEL(59)로 연결되어,
QUANTUM 6G SECURITY ENGINE(64)에서 BB84 또는 COW(Coherent One Way) 중 어느 하나의 방법으로부터 QUANTUM KEY를 생성하여 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 QUANTUM KEY를 QUANTUM CHANNEL(59)를 통해 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 Bob 6G QUANTUM SERVER(55)를 거쳐 입출력부를 통해 Quantum Entanglement(36)로 전송하며;
Quantum Entanglement(36)는 COW(Coherent One Way) 생성방법에 의해 생성된 QUANTUM KEY일 경우 영상 6G SECURITY ENGINE(35)로 전송하며;
영상 6G SECURITY ENGINE(35)은 Decoy Pulse(37)로 검증하여 양자얽힘 상태일 경우, 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 QUANTUM KEY로 영상데이터를 암호화하여 입출력부를 통해 Bob 6G QUANTUM SERVER(55)를 거쳐 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 상기 QUANTUM KEY로 암호화한 영상데이터를 QUANTUM CHANNEL(59)를 통해 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 6G SECURITY ENGINE(64)로부터 수신한 QUANTUM KEY로 상기 QUANTUM KEY로 암호화한 영상데이터를 복호화하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 비양자통신 채널(Non-QUANTUM Communication Channel(58)) 및 양자통신 채널(QUANTUM Communication Channel(59))로 구성된 hybrid-QUANTUM CHANNEL(60)에 연결되어,
Alice PUF-QRNG TWIN USB(65)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice PUF Chip를 제어하며;
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Alice VPN은 네트워크망에 연결된 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN 사이에 1:1 암호화통신하며;
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를 통해 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터를 난수 시드(Seed)로 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 자연난수 시드(Seed)로 Alice 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송하며;
Bob PUF-QRNG TWIN USB(57)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random Number Generator), Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob PUF Chip를 제어하며;
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Bob VPN은 네트워크망에 연결된 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN 사이에 1:1 암호화통신을 하며;
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터를 난수 시드(Seed)로 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 자연난수 시드(Seed)로 Bob 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)은 hybrid-QUANTUM CHANNEL(60) 중 양자통신 채널(QUANTUM Communication Channel)에 연결되어,
양자난수생성기(QRNG; Quantum Random Number Generator)는 무작위 양자난수를 발생하는 송신부의 Alice 양자난수생성기(Alice QRNG)와 수신부의 Bob 양자난수생성기(Bob QRNG)로 구성되며;
양자키분배기(QKD; Quantum Key Distribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성되며;
양자플랫폼(Quantum Platform)은 Alice 양자난수생성기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; Quantum Certificate)를 생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성되며;
송신부(a transmitting set) Alice 양자난수생성기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송하며;
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 Alice 마스터서버(Alice MASTER SERVER) 및 Alice 양자키분배기(QKD)로 전송하며;
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송하며;
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장되며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN USB(65)에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN USB(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN USB(65)로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 배전반, 방송장치, 가로/보안등, 방범용 CCTV 감시카메라 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal unit includes a sensor unit 46 , an AMI 47 , a switchboard 48 , a QUANTUM 5G AP 49 , a broadcasting device 50 , an emergency bell 51 , an LED street/security light 52 , a dimmer 53 . , is composed of a terminal SINGLE USB (54),
an AMI 47 that receives commercial power, measures power usage, and transmits power usage through an LPWAN (Low Power Wide Area Network) communication modem;
a switchboard (48) for supplying power to the LED street/security lights (52) via the AMI (47);
a dimmer 53 , QUANTUM 5G AP 49 , a broadcasting device 50 , and an emergency bell 51 attached to the LED street/security light 52 to receive power;
A broadcasting device 50 that receives broadcast data from any one of Master QUANTUM SERVER 61 or Alice 6G QUANTUM SERVER 62 or Alice QUANTUM SERVER 63, and the terminal SINGLE USB 54 receives and broadcasts;
When the emergency bell 51 operates, the emergency bell operation event is transmitted through the terminal SINGLE USB 54 to either the Master QUANTUM SERVER 61 or Alice 6G QUANTUM SERVER 62 or Alice QUANTUM SERVER 63. );
The sensor unit 46 transmits the data measured through the sensor to either the Master QUANTUM SERVER 61 or the Alice 6G QUANTUM SERVER 62 or the Alice QUANTUM SERVER 63 via the terminal SINGLE USB 54. The sensor unit ( 46);
a dimmer 53 that adjusts the brightness of the LED street/security light 52 according to whether a human object is detected or not through the UHD surveillance camera image analysis unit;
QUANTUM 5G AP (49) receives the captured image data of the UHD surveillance camera and transmits it to either Master QUANTUM SERVER (61) or Alice 6G QUANTUM SERVER (62) or Alice QUANTUM SERVER (63) through a 5G wireless network base station. 5G AP 49;
Terminals SINGLE USB 54 and Master QUANTUM SERVER 61 and Alice 6G QUANTUM SERVER 62 and Alice QUANTUM SERVER 63 store the same symmetric key of a symmetric cryptographic algorithm, so broadcast data, emergency Encrypt/decrypt bell operation event data, data measured through a sensor, measurement data, sensor status information data, audio/video data, point/off data, surveillance camera control data, broadcasting device control data, and dimmer control data;
UHD Surveillance Camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit.
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The quantum communication unit is Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), It consists of Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN communication modem(66),
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
Sensing data collected from the sensor unit 46, measurement data measured from the AMI 47, switchboard status information data collected from one or more switchboards 48, audio/video data collected from one or more broadcasting devices 50, The LPWAN communication modem 66 collects the point/off data collected from the LED street/security light 52 and transmits it to the terminal SINGLE USB 54;
The terminal SINGLE USB 54 transmits measurement data, sensor status information data, audio/video data, and on/off data to the Bob 6G QUANTUM SERVER 55; and
Bob 6G QUANTUM SERVER (55) is from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN USB (65) UHD surveillance camera control data or broadcasting device control data or dimmer control data to receive and transmit to the terminal internal terminal SINGLE USB 54;
terminal SINGLE USB 54 receives UHD surveillance camera control data from Bob 6G QUANTUM SERVER 55;
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 formats PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed to form an asymmetric cryptographic algorithm PRIVATE KEY) and then perform an asymmetric cryptographic algorithm by encrypting an asymmetric private key (PRIVATE KEY) and a beta-OR (EX-OR) with the natural random number seed generated through the TRNG (23). Generates a public key (PUBLIC KEY) and stores it in the Security OTP Memory (30) and Alice 6G QUANTUM SERVER (62);
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to control the UHD surveillance camera. and Alice 6G QUANTUM SERVER 62 and login (LOG In) network to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice QUANTUM SERVER (63) and Bob QUANTUM SERVER (56) are connected to QUANTUM CHANNEL (59),
QUANTUM 6G SECURITY ENGINE 64 generates QUANTUM KEY from either BB84 or COW (Coherent One Way) and transmits it to Alice QUANTUM SERVER 63;
Alice QUANTUM SERVER 63 sends QUANTUM KEY to Bob QUANTUM SERVER 56 via QUANTUM CHANNEL 59;
Bob QUANTUM SERVER (56) transmits to Quantum Entanglement (36) through the input/output unit via Bob 6G QUANTUM SERVER (55);
Quantum Entanglement (36) is transmitted to the image 6G SECURITY ENGINE (35) in case of a QUANTUM KEY generated by the Coherent One Way (COW) generation method;
Image 6G SECURITY ENGINE (35) is verified with Decoy Pulse (37) and in the case of quantum entanglement, it receives image data from 5G QUANTUM JUMP ENGINE (34), encrypts image data with QUANTUM KEY, and then uses the input/output unit to encrypt Bob 6G QUANTUM SERVER. via (55) to Bob QUANTUM SERVER (56);
Bob QUANTUM SERVER (56) transmits the image data encrypted with the QUANTUM KEY to Alice QUANTUM SERVER (63) through QUANTUM CHANNEL (59);
Alice QUANTUM SERVER 63 decrypts the video data encrypted with the QUANTUM KEY with the QUANTUM KEY received from the 6G SECURITY ENGINE 64;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are hybrid- consisting of a Non-QUANTUM Communication Channel (58) and a quantum communication channel (QUANTUM Communication Channel (59)). connected to QUANTUM CHANNEL (60),
Alice PUF-QRNG TWIN USB 65 is Alice Boot-ROM connected to Alice System Bus, Alice Master Controller (MCU), Alice System Storage Device (System M/M; System MEMORY), and Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface Controller (SPI Controller), Alice True Random Number Generator (TRNG; True Random Number Generator) ), Alice Security CPU (Security Central Processing Unit), Alice Security OTP Memory (Security OTP M/M; Security One Time Password MEMORY), Alice PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF It is composed of Chip (Physically Unclonable Function Chip),
Alice main controller (MCU) consists of Alice Boot-ROM, Alice System Storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) connected to Alice System Bus. , controlling Alice I/O Port, Alice Serial Peripheral Interface (SPI Controller);
Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), and Alice PUF Chip;
Alice system storage (System M/M) stores programs and data necessary for Alice main control unit (MCU);
The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control;
Alice Boot-ROM stores programs and data necessary for booting of Alice Main Control Unit (MCU);
Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob PUF-QRNG TWIN USB 57 connected to the network;
Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control;
Alice input/output device (I/O Port) is a switch connected to the network network, and transmits the network network ON/OFF control and data received through the network network to the Alice main controller (MCU) through the Alice system bus;
Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M);
Alice Security CPU sends Alice PIN data to Alice Main Control Unit (MCU);
Alice security CPU (Security CPU) generates Alice private key using the Alice PIN data as a random number seed and stores it in Alice security OTP memory (Security OTP M/M);
The Alice security CPU (Security CPU) is a natural random number seed generated from the Alice pure random number generator (TRNG), and after generating the Alice public key by performing an EX-OR encryption operation with the Alice private key, the Alice main controller ( MCU);
Bob PUF-QRNG TWIN USB (57) is connected to Bob's System Bus (Boot-ROM), Bob's Master Controller (MCU), Bob's System Storage (System M/M; System MEMORY), and Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG) ), Bob Security CPU (Security Central Processing Unit), Bob Security OTP M/M (Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF It is composed of Chip (Physically Unclonable Function Chip),
Bob main controller (MCU) is connected to Bob's System Bus (Boot-ROM), Bob's System Storage (System M/M), Bob's Virtual Private Network (VPN), and Bob's Debugger (QC-DEBUGGER). , control Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller);
Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), and Bob PUF Chip;
Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU);
Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control;
Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU);
Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice PUF-QRNG TWIN USB 65 connected to the network;
Bob Debugger (QC-DEBUGGER) receives a Quantum Certificate (QC) through Bob's I/O Port and turns on/off the network through Bob's I/O Port depending on whether or not it is authenticated. control;
Bob input/output device (I/O Port) is a switch connected to the network network and transmits the network network ON/OFF control and data received through the network network to the Bob main control unit (MCU) through the Bob system bus (System Bus);
Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M);
Bob Security CPU sends Bob PIN data to Bob main control unit (MCU);
The Bob security CPU (Security CPU) generates the Bob private key using the Bob PIN data as a random number seed and stores it in the Bob security OTP memory (Security OTP M/M);
Bob Security CPU (Security CPU) is a natural random number seed generated from Bob's pure random number generator (TRNG). After generating Bob's public key by performing an EX-OR encryption operation with Bob's private key, the Bob main controller ( MCU);
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to a QUANTUM Communication Channel among hybrid-QUANTUM CHANNEL (60),
Quantum Random Number Generator (QRNG) is composed of Alice QRNG of the transmitter and Bob QRNG of the receiver that generate random quantum random numbers;
Quantum Key Distribution (QKD) is composed of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector;
The Quantum Platform is an Aliec Quantum Platform that generates a Quantum Certificate (QC) with quantum random numbers generated by Alice QRNG and transmits it through the Alice Quantum Key Distributor (QKD). Consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Bob Quantum Key Distributor (QKD);
Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform;
Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to Alice Master Server (Alice MASTER SERVER) and Alice Quantum Key Distributor (QKD);
Alice quantum key distributor (QKD) transmits a quantum certificate (QC) to Bob quantum key distributor (QKD) through a quantum communication channel (QUANTUM Communication Channel) connected by an optical cable;
a receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to an ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) boots through Alice Boot-ROM connected to Alice System Bus, and is stored in Alice system storage device (System M/M). According to the stored program, it controls the Alice serial peripheral interface (SPI Controller) to control the network network ON/OFF through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) Send to Bob VPN inside Bob PUF-QRNG TWIN USB 57 via Alice VPN;
Bob PUF-QRNG TWIN USB(57) inside Bob's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and stores it in Bob's system storage (System M/M). According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob input/output device (I/O port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN USB 65 via Bob VPN;
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) uses the Alice KEY that encrypted the Bob PIN data stored in the Alice PUF memory (PUF M/M) with the Bob public key received through the Alice VPN, and the Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN USB 57 through;
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob VPN, the Bob KEY that encrypted the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Alice public key received through Bob VPN. through Alice PUF-QRNG TWIN USB 65 to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN USB 65 matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob PIN data decrypted from Alice KEY encrypted with Bob public key with Bob private key and Bob PIN data extracted from Bob PUF Chip match;
A network login (LOG In) is connected between the Alice Master Server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN USB (65) and the Bob Master Server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN USB (57). ;
Alice PUF-QRNG TWIN The Alice main controller (MCU) inside the USB 65 receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through Alice VPN, to Bob VPN inside USB 57;
Bob PUF-QRNG TWIN USB 57 inside Bob main controller (MCU) decrypts the quantum certificate (QC) by decrypting the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key;
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN USB 57;
Bob PUF-QRNG TWIN USB 57, Bob's main controller (MCU) transmits the quantum certificate (QC) received from Alice Master Server (Alice MASTER SERVER) to Bob Debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) does not match the quantum certificate (QC) received from Alice PUF-QRNG TWIN USB (65) and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) I/ A hybrid quantum communication system terminal comprising a switchboard, a broadcasting device, a street/security light, and a CCTV surveillance camera terminal for crime prevention, characterized in that the O Port is controlled by the OFF contact to block the network connection between the Alice master server and the Bob master server .
Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE USB(54)가 수신하여 방송하는 방송장치(50)이며;
QUANTUM 5G AP(49)는 UHD 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이며;
UHD 감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
양자통신부는 Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN 통신모뎀(66)으로 구성되어,
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
방송장치(50)로부터 수집되는 음성/영상 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE USB(54)으로 전송하며;
단말 SINGLE USB(54)는 음성/영상 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN USB(65) 중 어느 하나로부터 UHD 감시카메라 제어데이터 또는 방송장치 제어데이터를 수신하여 단말부 내부 단말 SINGLE USB(54)로 전송하며;
단말 SINGLE USB(54)는 Bob 6G QUANTUM SERVER(55)로부터 UHD 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 공개키를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 UHD 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice QUANTUM SERVER(63)와 Bob QUANTUM SERVER(56)는 QUANTUM CHANNEL(59)로 연결되어,
QUANTUM 6G SECURITY ENGINE(64)에서 BB84 또는 COW(Coherent One Way) 중 어느 하나의 방법으로부터 QUANTUM KEY를 생성하여 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 QUANTUM KEY를 QUANTUM CHANNEL(59)를 통해 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 Bob 6G QUANTUM SERVER(55)를 거쳐 입출력부를 통해 Quantum Entanglement(36)로 전송하며;
Quantum Entanglement(36)는 COW(Coherent One Way) 생성방법에 의해 생성된 QUANTUM KEY일 경우 영상 6G SECURITY ENGINE(35)로 전송하며;
영상 6G SECURITY ENGINE(35)은 Decoy Pulse(37)로 검증하여 양자얽힘 상태일 경우, 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 QUANTUM KEY로 영상데이터를 암호화하여 입출력부를 통해 Bob 6G QUANTUM SERVER(55)를 거쳐 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 상기 QUANTUM KEY로 암호화한 영상데이터를 QUANTUM CHANNEL(59)를 통해 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 6G SECURITY ENGINE(64)로부터 수신한 QUANTUM KEY로 상기 QUANTUM KEY로 암호화한 영상데이터를 복호화하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 비양자통신 채널(Non-QUANTUM Communication Channel(58)) 및 양자통신 채널(QUANTUM Communication Channel(59))로 구성된 hybrid-QUANTUM CHANNEL(60)에 연결되어,
Alice PUF-QRNG TWIN USB(65)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice PUF Chip를 제어하며;
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Alice VPN은 네트워크망에 연결된 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN 사이에 1:1 암호화통신하며;
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를 통해 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터로 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Alice 개인키를 암호화하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송하며;
Bob PUF-QRNG TWIN USB(57)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random Number Generator), Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob PUF Chip를 제어하며;
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Bob VPN은 네트워크망에 연결된 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN 사이에 1:1 암호화통신을 하며;
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터로 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Bob 개인키를 암호화하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)은 hybrid-QUANTUM CHANNEL(60) 중 양자통신 채널(QUANTUM Communication Channel)에 연결되어,
양자난수생성기(QRNG; Quantum Random Number Generator)는 무작위 양자난수를 발생하는 송신부의 Alice 양자난수생성기(Alice QRNG)와 수신부의 Bob 양자난수생성기(Bob QRNG)로 구성되며;
양자키분배기(QKD; Quantum Key Distribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성되며;
양자플랫폼(Quantum Platform)은 Alice 양자난수생성기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; Quantum Certificate)를 생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성되며;
송신부(a transmitting set) Alice 양자난수생성기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송하며;
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 Alice 마스터서버(Alice MASTER SERVER) 및 Alice 양자키분배기(QKD)로 전송하며;
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송하며;
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장되며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN USB(65)에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN USB(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN USB(65)로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 방송장치 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal unit consists of a broadcasting device 50 and a terminal SINGLE USB 54,
A broadcasting device 50 that receives broadcast data from any one of Master QUANTUM SERVER 61 or Alice 6G QUANTUM SERVER 62 or Alice QUANTUM SERVER 63, and the terminal SINGLE USB 54 receives and broadcasts;
QUANTUM 5G AP (49) receives the captured image data of the UHD surveillance camera and transmits it to either Master QUANTUM SERVER (61) or Alice 6G QUANTUM SERVER (62) or Alice QUANTUM SERVER (63) through a 5G wireless network base station. 5G AP 49;
UHD Surveillance Camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit.
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The quantum communication unit is Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), It consists of Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN communication modem(66),
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
The LPWAN communication modem 66 collects audio/video data collected from the broadcasting device 50 and transmits it to the terminal SINGLE USB 54;
terminal SINGLE USB 54 transmits audio/video data to Bob 6G QUANTUM SERVER 55; and
Bob 6G QUANTUM SERVER (55) receives the UHD surveillance camera control data or broadcasting device control data from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN USB (65) to the terminal to the secondary internal terminal SINGLE USB 54;
terminal SINGLE USB 54 receives UHD surveillance camera control data from Bob 6G QUANTUM SERVER 55;
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 generates a private key by formatting PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed, and then generated through the TRNG 23. A public key is generated by performing an EX-OR encryption operation with the private key using a natural random number seed and stored in the Security OTP Memory 30 and Alice 6G QUANTUM SERVER 62;
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to control the UHD surveillance camera. and Alice 6G QUANTUM SERVER 62 and login (LOG In) network to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice QUANTUM SERVER (63) and Bob QUANTUM SERVER (56) are connected to QUANTUM CHANNEL (59),
QUANTUM 6G SECURITY ENGINE 64 generates QUANTUM KEY from either BB84 or COW (Coherent One Way) and transmits it to Alice QUANTUM SERVER 63;
Alice QUANTUM SERVER 63 sends QUANTUM KEY to Bob QUANTUM SERVER 56 via QUANTUM CHANNEL 59;
Bob QUANTUM SERVER (56) transmits to Quantum Entanglement (36) through the input/output unit via Bob 6G QUANTUM SERVER (55);
Quantum Entanglement (36) is transmitted to the image 6G SECURITY ENGINE (35) in case of a QUANTUM KEY generated by the Coherent One Way (COW) generation method;
Image 6G SECURITY ENGINE (35) is verified with Decoy Pulse (37) and in the case of quantum entanglement, it receives image data from 5G QUANTUM JUMP ENGINE (34), encrypts image data with QUANTUM KEY, and then uses the input/output unit to encrypt Bob 6G QUANTUM SERVER. via (55) to Bob QUANTUM SERVER (56);
Bob QUANTUM SERVER (56) transmits the image data encrypted with the QUANTUM KEY to Alice QUANTUM SERVER (63) through QUANTUM CHANNEL (59);
Alice QUANTUM SERVER 63 decrypts the video data encrypted with the QUANTUM KEY with the QUANTUM KEY received from the 6G SECURITY ENGINE 64;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are hybrid- consisting of a Non-QUANTUM Communication Channel (58) and a quantum communication channel (QUANTUM Communication Channel (59)). connected to QUANTUM CHANNEL (60),
Alice PUF-QRNG TWIN USB 65 is Alice Boot-ROM connected to Alice System Bus, Alice Master Controller (MCU), Alice System Storage Device (System M/M; System MEMORY), and Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface Controller (SPI Controller), Alice True Random Number Generator (TRNG; True Random Number Generator) ), Alice Security CPU (Security Central Processing Unit), Alice Security OTP Memory (Security OTP M/M; Security One Time Password MEMORY), Alice PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF It is composed of Chip (Physically Unclonable Function Chip),
Alice main controller (MCU) consists of Alice Boot-ROM, Alice System Storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) connected to Alice System Bus. , controlling Alice I/O Port, Alice Serial Peripheral Interface (SPI Controller);
Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), and Alice PUF Chip;
Alice system storage (System M/M) stores programs and data necessary for Alice main control unit (MCU);
The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control;
Alice Boot-ROM stores programs and data necessary for booting of Alice Main Control Unit (MCU);
Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob PUF-QRNG TWIN USB 57 connected to the network;
Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control;
Alice input/output device (I/O Port) is a switch connected to the network network, and transmits the network network ON/OFF control and data received through the network network to the Alice main controller (MCU) through the Alice system bus;
Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M);
Alice Security CPU sends Alice PIN data to Alice Main Control Unit (MCU);
Alice secure CPU (Security CPU) generates Alice private key with the Alice PIN data and stores it in Alice secure OTP memory (Security OTP M/M);
The Alice Security CPU encrypts the Alice private key with the random number generated by the Alice pure random number generator (TRNG), generates the Alice public key, and transmits it to the Alice main controller (MCU);
Bob PUF-QRNG TWIN USB (57) is connected to Bob's System Bus (Boot-ROM), Bob's Master Controller (MCU), Bob's System Storage (System M/M; System MEMORY), and Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG) ), Bob Security CPU (Security Central Processing Unit), Bob Security OTP M/M (Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF It is composed of Chip (Physically Unclonable Function Chip),
Bob main controller (MCU) is connected to Bob's System Bus (Boot-ROM), Bob's System Storage (System M/M), Bob's Virtual Private Network (VPN), and Bob's Debugger (QC-DEBUGGER). , control Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller);
Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), and Bob PUF Chip;
Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU);
Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control;
Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU);
Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice PUF-QRNG TWIN USB 65 connected to the network;
Bob Debugger (QC-DEBUGGER) receives a Quantum Certificate (QC) through Bob's I/O Port and turns on/off the network through Bob's I/O Port depending on whether or not it is authenticated. control;
Bob input/output device (I/O Port) is a switch connected to the network network and transmits the network network ON/OFF control and data received through the network network to the Bob main control unit (MCU) through the Bob system bus (System Bus);
Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M);
Bob Security CPU sends Bob PIN data to Bob main control unit (MCU);
Bob Security CPU (Security CPU) generates Bob private key with the Bob PIN data and stores it in Bob Security OTP memory (Security OTP M/M);
The Bob Security CPU (Security CPU) encrypts the Bob private key with the random number generated by the Bob pure random number generator (TRNG), generates the Bob public key, and transmits it to the Bob main controller (MCU);
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to a QUANTUM Communication Channel among hybrid-QUANTUM CHANNEL (60),
Quantum Random Number Generator (QRNG) is composed of Alice QRNG of the transmitter and Bob QRNG of the receiver that generate random quantum random numbers;
Quantum Key Distribution (QKD) is composed of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector;
The Quantum Platform is an Aliec Quantum Platform that generates a Quantum Certificate (QC) with quantum random numbers generated by Alice QRNG and transmits it through the Alice Quantum Key Distributor (QKD). Consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Bob Quantum Key Distributor (QKD);
Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform;
Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to Alice Master Server (Alice MASTER SERVER) and Alice Quantum Key Distributor (QKD);
Alice quantum key distributor (QKD) transmits a quantum certificate (QC) to Bob quantum key distributor (QKD) through a quantum communication channel (QUANTUM Communication Channel) connected by an optical cable;
a receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to an ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) boots through Alice Boot-ROM connected to Alice System Bus, and is stored in Alice system storage device (System M/M). According to the stored program, it controls the Alice serial peripheral interface (SPI Controller) to control the network network ON/OFF through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) Send to Bob VPN inside Bob PUF-QRNG TWIN USB 57 via Alice VPN;
Bob PUF-QRNG TWIN USB(57) inside Bob's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and stores it in Bob's system storage (System M/M). According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob input/output device (I/O port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN USB 65 via Bob VPN;
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) uses the Alice KEY that encrypted the Bob PIN data stored in the Alice PUF memory (PUF M/M) with the Bob public key received through the Alice VPN, and the Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN USB 57 through;
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob VPN, the Bob KEY that encrypted the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Alice public key received through Bob VPN. through Alice PUF-QRNG TWIN USB 65 to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN USB 65 matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob PIN data decrypted from Alice KEY encrypted with Bob public key with Bob private key and Bob PIN data extracted from Bob PUF Chip match;
A network login (LOG In) is connected between the Alice Master Server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN USB (65) and the Bob Master Server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN USB (57). ;
Alice PUF-QRNG TWIN The Alice main controller (MCU) inside the USB 65 receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through Alice VPN, to Bob VPN inside USB 57;
Bob PUF-QRNG TWIN USB 57 inside Bob main controller (MCU) decrypts the quantum certificate (QC) by decrypting the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key;
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN USB 57;
Bob PUF-QRNG TWIN USB 57, Bob's main controller (MCU) transmits the quantum certificate (QC) received from Alice Master Server (Alice MASTER SERVER) to Bob Debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) does not match the quantum certificate (QC) received from Alice PUF-QRNG TWIN USB (65) and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) I/ A hybrid quantum communication system terminal including a broadcasting device terminal, characterized in that the O Port is controlled by the OFF contact to block the network connection between the Alice master server and the Bob master server.
상용전원을 공급받아 전력 사용량을 측정 및 LPWAN 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이며;
UHD 감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이며;
UHD 감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
양자통신부는 Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN 통신모뎀(66)으로 구성되어,
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
AMI(47)로부터 측정되는 측정 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE USB(54)으로 전송하며;
단말 SINGLE USB(54)는 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN USB(65) 중 어느 하나로부터 UHD 감시카메라 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE USB(54)로 전송하며;
단말 SINGLE USB(54)는 Bob 6G QUANTUM SERVER(55)로부터 UHD 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 공개키를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 UHD 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice QUANTUM SERVER(63)와 Bob QUANTUM SERVER(56)는 QUANTUM CHANNEL(59)로 연결되어,
QUANTUM 6G SECURITY ENGINE(64)에서 BB84 또는 COW(Coherent One Way) 중 어느 하나의 방법으로부터 QUANTUM KEY를 생성하여 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 QUANTUM KEY를 QUANTUM CHANNEL(59)를 통해 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 Bob 6G QUANTUM SERVER(55)를 거쳐 입출력부를 통해 Quantum Entanglement(36)로 전송하며;
Quantum Entanglement(36)는 COW(Coherent One Way) 생성방법에 의해 생성된 QUANTUM KEY일 경우 영상 6G SECURITY ENGINE(35)로 전송하며;
영상 6G SECURITY ENGINE(35)은 Decoy Pulse(37)로 검증하여 양자얽힘 상태일 경우, 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 QUANTUM KEY로 영상데이터를 암호화하여 입출력부를 통해 Bob 6G QUANTUM SERVER(55)를 거쳐 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 상기 QUANTUM KEY로 암호화한 영상데이터를 QUANTUM CHANNEL(59)를 통해 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 6G SECURITY ENGINE(64)로부터 수신한 QUANTUM KEY로 상기 QUANTUM KEY로 암호화한 영상데이터를 복호화하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 비양자통신 채널(Non-QUANTUM Communication Channel(58)) 및 양자통신 채널(QUANTUM Communication Channel(59))로 구성된 hybrid-QUANTUM CHANNEL(60)에 연결되어,
Alice PUF-QRNG TWIN USB(65)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice PUF Chip를 제어하며;
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Alice VPN은 네트워크망에 연결된 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN 사이에 1:1 암호화통신하며;
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를 통해 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터로 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Alice 개인키를 암호화하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송하며;
Bob PUF-QRNG TWIN USB(57)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random Number Generator), Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob PUF Chip를 제어하며;
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Bob VPN은 네트워크망에 연결된 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN 사이에 1:1 암호화통신을 하며;
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터로 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Bob 개인키를 암호화하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)은 hybrid-QUANTUM CHANNEL(60) 중 양자통신 채널(QUANTUM Communication Channel)에 연결되어,
양자난수생성기(QRNG; Quantum Random Number Generator)는 무작위 양자난수를 발생하는 송신부의 Alice 양자난수생성기(Alice QRNG)와 수신부의 Bob 양자난수생성기(Bob QRNG)로 구성되며;
양자키분배기(QKD; Quantum Key Distribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성되며;
양자플랫폼(Quantum Platform)은 Alice 양자난수생성기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; Quantum Certificate)를 생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성되며;
송신부(a transmitting set) Alice 양자난수생성기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송하며;
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 Alice 마스터서버(Alice MASTER SERVER) 및 Alice 양자키분배기(QKD)로 전송하며;
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송하며;
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장되며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN USB(65)에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN USB(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN USB(65)로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 가로/보안등 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal is composed of LED street/security light 52, AMI 47, dimmer 53, and terminal SINGLE USB 54,
an AMI 47 that receives commercial power, measures power usage, and transmits power usage through an LPWAN communication modem;
a dimmer 53 that adjusts the brightness of the LED street/security light 52 according to whether a human object is detected or not through the UHD surveillance camera image analysis unit;
UHD Surveillance Camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit.
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The quantum communication unit is Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), It consists of Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN communication modem(66),
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
The measurement data measured from the AMI 47 and the point/off data collected from the LED street/security light 52 are collected by the LPWAN communication modem 66 and transmitted to the terminal SINGLE USB 54;
terminal SINGLE USB 54 transmits on/off data to Bob 6G QUANTUM SERVER 55; and
Bob 6G QUANTUM SERVER (55) receives UHD surveillance camera control data or dimmer control data from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN USB (65) to the terminal unit transmit to the internal terminal SINGLE USB 54;
terminal SINGLE USB 54 receives UHD surveillance camera control data from Bob 6G QUANTUM SERVER 55;
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 generates a private key by formatting PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed, and then generated through the TRNG 23. A public key is generated by performing an EX-OR encryption operation with the private key using a natural random number seed and stored in the Security OTP Memory 30 and Alice 6G QUANTUM SERVER 62;
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to control the UHD surveillance camera. and Alice 6G QUANTUM SERVER 62 and login (LOG In) network to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice QUANTUM SERVER (63) and Bob QUANTUM SERVER (56) are connected to QUANTUM CHANNEL (59),
QUANTUM 6G SECURITY ENGINE 64 generates QUANTUM KEY from either BB84 or COW (Coherent One Way) and transmits it to Alice QUANTUM SERVER 63;
Alice QUANTUM SERVER 63 sends QUANTUM KEY to Bob QUANTUM SERVER 56 via QUANTUM CHANNEL 59;
Bob QUANTUM SERVER (56) transmits to Quantum Entanglement (36) through the input/output unit via Bob 6G QUANTUM SERVER (55);
Quantum Entanglement (36) is transmitted to the image 6G SECURITY ENGINE (35) in case of a QUANTUM KEY generated by the Coherent One Way (COW) generation method;
Image 6G SECURITY ENGINE (35) is verified with Decoy Pulse (37) and in the case of quantum entanglement, it receives image data from 5G QUANTUM JUMP ENGINE (34), encrypts image data with QUANTUM KEY, and then uses the input/output unit to encrypt Bob 6G QUANTUM SERVER. via (55) to Bob QUANTUM SERVER (56);
Bob QUANTUM SERVER (56) transmits the image data encrypted with the QUANTUM KEY to Alice QUANTUM SERVER (63) through QUANTUM CHANNEL (59);
Alice QUANTUM SERVER 63 decrypts the video data encrypted with the QUANTUM KEY with the QUANTUM KEY received from the 6G SECURITY ENGINE 64;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are hybrid- consisting of a Non-QUANTUM Communication Channel (58) and a quantum communication channel (QUANTUM Communication Channel (59)). connected to QUANTUM CHANNEL (60),
Alice PUF-QRNG TWIN USB 65 is Alice Boot-ROM connected to Alice System Bus, Alice Master Controller (MCU), Alice System Storage Device (System M/M; System MEMORY), and Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface Controller (SPI Controller), Alice True Random Number Generator (TRNG; True Random Number Generator) ), Alice Security CPU (Security Central Processing Unit), Alice Security OTP Memory (Security OTP M/M; Security One Time Password MEMORY), Alice PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF It is composed of Chip (Physically Unclonable Function Chip),
Alice main controller (MCU) consists of Alice Boot-ROM, Alice System Storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) connected to Alice System Bus. , controlling Alice I/O Port, Alice Serial Peripheral Interface (SPI Controller);
Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), and Alice PUF Chip;
Alice system storage (System M/M) stores programs and data necessary for Alice main control unit (MCU);
The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control;
Alice Boot-ROM stores programs and data necessary for booting of Alice Main Control Unit (MCU);
Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob PUF-QRNG TWIN USB 57 connected to the network;
Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control;
Alice input/output device (I/O Port) is a switch connected to the network network, and transmits the network network ON/OFF control and data received through the network network to the Alice main controller (MCU) through the Alice system bus;
Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M);
Alice Security CPU sends Alice PIN data to Alice Main Control Unit (MCU);
Alice secure CPU (Security CPU) generates Alice private key with the Alice PIN data and stores it in Alice secure OTP memory (Security OTP M/M);
The Alice Security CPU encrypts the Alice private key with the random number generated by the Alice pure random number generator (TRNG), generates the Alice public key, and transmits it to the Alice main controller (MCU);
Bob PUF-QRNG TWIN USB (57) is connected to Bob's System Bus (Boot-ROM), Bob's Master Controller (MCU), Bob's System Storage (System M/M; System MEMORY), and Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG) ), Bob Security CPU (Security Central Processing Unit), Bob Security OTP M/M (Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF It is composed of Chip (Physically Unclonable Function Chip),
Bob main controller (MCU) is connected to Bob's System Bus (Boot-ROM), Bob's System Storage (System M/M), Bob's Virtual Private Network (VPN), and Bob's Debugger (QC-DEBUGGER). , control Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller);
Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), and Bob PUF Chip;
Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU);
Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control;
Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU);
Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice PUF-QRNG TWIN USB 65 connected to the network;
Bob Debugger (QC-DEBUGGER) receives a Quantum Certificate (QC) through Bob's I/O Port and turns on/off the network through Bob's I/O Port depending on whether or not it is authenticated. control;
Bob input/output device (I/O Port) is a switch connected to the network network and transmits the network network ON/OFF control and data received through the network network to the Bob main control unit (MCU) through the Bob system bus (System Bus);
Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M);
Bob Security CPU sends Bob PIN data to Bob main control unit (MCU);
Bob Security CPU (Security CPU) generates Bob private key with the Bob PIN data and stores it in Bob Security OTP memory (Security OTP M/M);
The Bob Security CPU (Security CPU) encrypts the Bob private key with the random number generated by the Bob pure random number generator (TRNG), generates the Bob public key, and transmits it to the Bob main controller (MCU);
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to a QUANTUM Communication Channel among hybrid-QUANTUM CHANNEL (60),
Quantum Random Number Generator (QRNG) is composed of Alice QRNG of the transmitter and Bob QRNG of the receiver that generate random quantum random numbers;
Quantum Key Distribution (QKD) is composed of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector;
The Quantum Platform is an Aliec Quantum Platform that generates a Quantum Certificate (QC) with quantum random numbers generated by Alice QRNG and transmits it through the Alice Quantum Key Distributor (QKD). Consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Bob Quantum Key Distributor (QKD);
Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform;
Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to Alice Master Server (Alice MASTER SERVER) and Alice Quantum Key Distributor (QKD);
Alice quantum key distributor (QKD) transmits a quantum certificate (QC) to Bob quantum key distributor (QKD) through a quantum communication channel (QUANTUM Communication Channel) connected by an optical cable;
a receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to an ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) boots through Alice Boot-ROM connected to Alice System Bus, and is stored in Alice system storage device (System M/M). According to the stored program, it controls the Alice serial peripheral interface (SPI Controller) to control the network network ON/OFF through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) Send to Bob VPN inside Bob PUF-QRNG TWIN USB 57 via Alice VPN;
Bob PUF-QRNG TWIN USB(57) inside Bob's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and stores it in Bob's system storage (System M/M). According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob input/output device (I/O port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN USB 65 via Bob VPN;
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) uses the Alice KEY that encrypted the Bob PIN data stored in the Alice PUF memory (PUF M/M) with the Bob public key received through the Alice VPN, and the Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN USB 57 through;
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob VPN, the Bob KEY that encrypted the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Alice public key received through Bob VPN. through Alice PUF-QRNG TWIN USB 65 to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN USB 65 matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob PIN data decrypted from Alice KEY encrypted with Bob public key with Bob private key and Bob PIN data extracted from Bob PUF Chip match;
A network login (LOG In) is connected between the Alice Master Server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN USB (65) and the Bob Master Server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN USB (57). ;
Alice PUF-QRNG TWIN The Alice main controller (MCU) inside the USB 65 receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through Alice VPN, to Bob VPN inside USB 57;
Bob PUF-QRNG TWIN USB 57 inside Bob main controller (MCU) decrypts the quantum certificate (QC) by decrypting the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key;
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN USB 57;
Bob PUF-QRNG TWIN USB 57, Bob's main controller (MCU) transmits the quantum certificate (QC) received from Alice Master Server (Alice MASTER SERVER) to Bob Debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) does not match the quantum certificate (QC) received from Alice PUF-QRNG TWIN USB (65) and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) I/ A hybrid quantum communication system terminal including a street/security light terminal, characterized in that it blocks the network connection between the Alice master server and the Bob master server by controlling the O Port OFF contact point.
배전반(48) 내부에 AMI(47)는 상용전원을 공급받아 전력 사용량을 측정 및 LPWAN 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이며;
배전반(48)은 내부에 AMI(47)를 거쳐 LED 가로/보안등(52)에 전력을 공급하며;
배전반(48) 내부에 방송장치(50)는 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE USB(54)가 수신하여 방송하는 방송장치(50)이며;
배전반(48)은 비상벨(51) 작동시 비상벨 작동 이벤트를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE USB(54)를 통해 전송하는 비상벨(51)이며;
배전반(48) 내부에 센서부(46)는 센서를 통해 측정되는 데이터를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE USB(54)를 통해 전송하는 센서부(46)이며;
배전반(48) 내부에 디머(53)는 UHD 감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이며;
QUANTUM 5G AP(49)는 UHD 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이며;
UHD 감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
양자통신부는 Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN 통신모뎀(66)으로 구성되어,
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
센서부(46)로부터 수집되는 센싱 데이터, AMI(47)로부터 측정되는 측정 데이터, 하나 이상의 배전반(48)으로부터 수집되는 배전반 상태정보 데이터, 하나 이상의 방송장치(50)로부터 수집되는 음성/영상 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE USB(54)으로 전송하며;
단말 SINGLE USB(54)는 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN USB(65) 중 어느 하나로부터 UHD 감시카메라 제어데이터 또는 방송장치 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE USB(54)로 전송하며;
단말 SINGLE USB(54)는 Bob 6G QUANTUM SERVER(55)로부터 UHD 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 공개키를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 UHD 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice QUANTUM SERVER(63)와 Bob QUANTUM SERVER(56)는 QUANTUM CHANNEL(59)로 연결되어,
QUANTUM 6G SECURITY ENGINE(64)에서 BB84 또는 COW(Coherent One Way) 중 어느 하나의 방법으로부터 QUANTUM KEY를 생성하여 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 QUANTUM KEY를 QUANTUM CHANNEL(59)를 통해 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 Bob 6G QUANTUM SERVER(55)를 거쳐 입출력부를 통해 Quantum Entanglement(36)로 전송하며;
Quantum Entanglement(36)는 COW(Coherent One Way) 생성방법에 의해 생성된 QUANTUM KEY일 경우 영상 6G SECURITY ENGINE(35)로 전송하며;
영상 6G SECURITY ENGINE(35)은 Decoy Pulse(37)로 검증하여 양자얽힘 상태일 경우, 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 QUANTUM KEY로 영상데이터를 암호화하여 입출력부를 통해 Bob 6G QUANTUM SERVER(55)를 거쳐 Bob QUANTUM SERVER(56)로 전송하며;
Bob QUANTUM SERVER(56)는 상기 QUANTUM KEY로 암호화한 영상데이터를 QUANTUM CHANNEL(59)를 통해 Alice QUANTUM SERVER(63)로 전송하며;
Alice QUANTUM SERVER(63)는 6G SECURITY ENGINE(64)로부터 수신한 QUANTUM KEY로 상기 QUANTUM KEY로 암호화한 영상데이터를 복호화하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 비양자통신 채널(Non-QUANTUM Communication Channel(58)) 및 양자통신 채널(QUANTUM Communication Channel(59))로 구성된 hybrid-QUANTUM CHANNEL(60)에 연결되어,
Alice PUF-QRNG TWIN USB(65)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 주제어부(MCU), Alice 시스템 저장장치(System M/M; System MEMORY), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Alice 순수난수생성기(TRNG; True Random Number Generator), Alice 보안 CPU(Security CPU; Security Central Processing Unit), Alice 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Alice PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM), Alice 시스템 저장장치(System M/M), Alice VPN(Virtual Private Network), Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Alice 보안 CPU(Security CPU)는 Alice 디버거(QC-DEBUGGER), Alice 입출력장치(I/O Port), Alice 직렬주변장치 인터페이스(SPI Controller), Alice 순수난수생성기(TRNG), Alice 보안 OTP 메모리(Security OTP M/M), Alice PUF 메모리(PUF M/M), Alice PUF Chip를 제어하며;
Alice 시스템 저장장치(System M/M)는 Alice 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Alice 직렬주변장치 인터페이스(SPI Controller)는 Alice 입출력장치(I/O Port)와 연결되어 Alice 주제어부(MCU)의 제어명령에 따라 Alice 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Alice 부트롬(Boot-ROM)은 Alice 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Alice VPN은 네트워크망에 연결된 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN 사이에 1:1 암호화통신하며;
Alice 디버거(QC-DEBUGGER)는 Alice 입출력장치(I/O Port)를 통해 양자인증서(QC; decoy Qantum Certificate)를 수신하여 인증 여부에 따라 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Alice 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Alice 시스템 버스(System Bus)를 통해 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 Alice PUF Chip에서 Alice PIN 데이터를 추출하여 Bob PUF 메모리(PUF M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice PIN 데이터를 Alice 주제어부(MCU)로 전송하며;
Alice 보안 CPU(Security CPU)는 상기 Alice PIN 데이터로 Alice 개인키를 생성하여 Alice 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Alice 보안 CPU(Security CPU)는 Alice 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Alice 개인키를 암호화하여 Alice 공개키를 생성 후 Alice 주제어부(MCU)로 전송하며;
Bob PUF-QRNG TWIN USB(57)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 주제어부(MCU), Bob 시스템 저장장치(System M/M; System MEMORY), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller; Serial Peripheral Interface Controller), Bob 순수난수생성기(TRNG; True Random Number Generator), Bob 보안 CPU(Security CPU; Security Central Processing Unit), Bob 보안 OTP 메모리(Security OTP M/M; Security One Time Password MEMORY), Bob PUF 메모리(PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF Chip(Phisycally Unclonable Function Chip)으로 구성되어,
Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM), Bob 시스템 저장장치(System M/M), Bob VPN(Virtual Private Network), Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하며;
Bob 보안 CPU(Security CPU)는 Bob 디버거(QC-DEBUGGER), Bob 입출력장치(I/O Port), Bob 직렬주변장치 인터페이스(SPI Controller), Bob 순수난수생성기(TRNG), Bob 보안 OTP 메모리(Security OTP M/M), Bob PUF 메모리(PUF M/M), Bob PUF Chip를 제어하며;
Bob 시스템 저장장치(System M/M)는 Bob 주제어부(MCU)에 필요한 프로그램과 데이터를 저장하며;
Bob 직렬주변장치 인터페이스(SPI Controller)는 Bob 입출력장치(I/O Port)와 연결되어 Bob 주제어부(MCU)의 제어명령에 따라 Bob 입출력장치(I/O Port)를 제어하여 네트워크망 연결을 ON/OFF 제어하며;
Bob 부트롬(Boot-ROM)은 Bob 주제어부(MCU)의 부팅시 필요한 프로그램과 데이터를 저장하며;
Bob VPN은 네트워크망에 연결된 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN 사이에 1:1 암호화통신을 하며;
Bob 디버거(QC-DEBUGGER)는 Bob 입출력장치(I/O Port)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 인증 여부에 따라 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하며;
Bob 입출력장치(I/O Port)는 네트워크망에 연결된 스위치로 네트워크망 ON/OFF 제어 및 네트워크망을 통해 수신한 데이터를 Bob 시스템 버스(System Bus)를 통해 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 Bob PUF Chip에서 Bob PIN 데이터를 추출한 후 Alice PUF 메모리(PUF M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob PIN 데이터를 Bob 주제어부(MCU)로 전송하며;
Bob 보안 CPU(Security CPU)는 상기 Bob PIN 데이터로 Bob 개인키를 생성하여 Bob 보안 OTP 메모리(Security OTP M/M)에 저장하며;
Bob 보안 CPU(Security CPU)는 Bob 순수난수생성기(TRNG)에서 발생하는 난수로 상기 Bob 개인키를 암호화하여 Bob 공개키를 생성 후 Bob 주제어부(MCU)로 전송하며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)은 hybrid-QUANTUM CHANNEL(60) 중 양자통신 채널(QUANTUM Communication Channel)에 연결되어,
양자난수생성기(QRNG; Quantum Random Number Generator)는 무작위 양자난수를 발생하는 송신부의 Alice 양자난수생성기(Alice QRNG)와 수신부의 Bob 양자난수생성기(Bob QRNG)로 구성되며;
양자키분배기(QKD; Quantum Key Distribution)는 레이져를 포함하는 송신부의 Alice 양자키분배기(QKD)와 단일광자 탐지기를 포함하는 수신부의 Bob 양자키분배기(QKD)로 구성되며;
양자플랫폼(Quantum Platform)은 Alice 양자난수생성기(Alice QRNG)에서 발생한 양자난수로 양자인증서(QC; Quantum Certificate)를 생성하여 Alice 양자키분배기(QKD)를 통해 송신하는 Aliec 양자플랫폼(Quantum Platform)과 Bob 양자키분배기(QKD)를 통해 양자인증서(QC; Quantum Certificate)를 수신하여 저장하는 Bob 양자플랫폼(Quantum Platform)으로 구성되며;
송신부(a transmitting set) Alice 양자난수생성기(Alice QRNG)에서 발생하는 무작위 양자난수는 Aliec 양자플랫폼(Quantum Platform)로 전송하며;
Aliec 양자플랫폼(Quantum Platform)은 상기 양자난수를 수신하여 양자인증서(QC)를 생성하여 Alice 마스터서버(Alice MASTER SERVER) 및 Alice 양자키분배기(QKD)로 전송하며;
Alice 양자키분배기(QKD)는 양자인증서(QC)를 광케이블로 연결된 양자통신 채널(QUANTUM Communication Channel)을 통해 Bob 양자키분배기(QKD)로 전송하며;
수신부(a receiving set) Bob 양자키분배기(QKD)는 상기 양자인증서(QC)를 수신하여 Bob 양자플랫폼(Quantum Platform)에 저장되며;
Alice PUF-QRNG TWIN USB(65)와 Bob PUF-QRNG TWIN USB(57)는 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN USB(65) 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN USB(65)에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN USB(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN USB(65) 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN USB(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN USB(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN USB(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN USB(65)로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 배전반 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal switchboard 48 includes a sensor unit 46 , an AMI 47 , a QUANTUM 5G AP 49 , a broadcasting device 50 , an emergency bell 51 , a dimmer 53 , and a terminal SINGLE USB 54 . composed by
The AMI 47 inside the switchboard 48 is an AMI 47 that receives commercial power, measures the power usage, and transmits the power usage through the LPWAN communication modem;
The switchboard 48 supplies power to the LED street/security light 52 via the AMI 47 therein;
The broadcasting device 50 inside the switchboard 48 receives broadcast data from either the Master QUANTUM SERVER 61 or the Alice 6G QUANTUM SERVER 62 or the Alice QUANTUM SERVER 63, and the terminal SINGLE USB 54 receives and broadcasts the broadcast data. a broadcasting device 50 that does;
When the emergency bell 51 operates, the switchboard 48 transmits an emergency bell operation event to either the Master QUANTUM SERVER 61 or Alice 6G QUANTUM SERVER 62 or Alice QUANTUM SERVER 63 via the terminal SINGLE USB 54 is an emergency bell (51);
The sensor unit 46 inside the switchboard 48 transmits the data measured through the sensor to either the Master QUANTUM SERVER 61 or the Alice 6G QUANTUM SERVER 62 or the Alice QUANTUM SERVER 63. through the sensor unit 46;
The dimmer 53 inside the switchboard 48 is a dimmer 53 that adjusts the brightness of the LED street/security light 52 according to whether or not a human object is detected through the UHD surveillance camera image analysis unit;
QUANTUM 5G AP (49) receives the captured image data of the UHD surveillance camera and transmits it to either Master QUANTUM SERVER (61) or Alice 6G QUANTUM SERVER (62) or Alice QUANTUM SERVER (63) through a 5G wireless network base station. 5G AP 49;
UHD Surveillance Camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit.
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The quantum communication unit is Bob 6G QUANTUM SERVER(55), Bob QUANTUM SERVER(56), Bob PUF-QRNG TWIN USB(57), non-QUANTUM CHANNEL(58), QUANTUM CHANNEL(59), hybrid-QUANTUM CHANNEL(60), It consists of Master QUANTUM SERVER(61), Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), QUANTUM 6G SECURITY ENGINE(64), Alice PUF-QRNG TWIN USB(65), LPWAN communication modem(66),
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
Sensing data collected from the sensor unit 46, measurement data measured from the AMI 47, switchboard status information data collected from one or more switchboards 48, audio/video data collected from one or more broadcasting devices 50, The LPWAN communication modem 66 collects the point/off data collected from the LED street/security light 52 and transmits it to the terminal SINGLE USB 54;
The terminal SINGLE USB 54 transmits measurement data, sensor status information data, audio/video data, and on/off data to the Bob 6G QUANTUM SERVER 55; and
Bob 6G QUANTUM SERVER (55) is from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN USB (65) UHD surveillance camera control data or broadcasting device control data or dimmer control data to receive and transmit to the terminal internal terminal SINGLE USB 54;
terminal SINGLE USB 54 receives UHD surveillance camera control data from Bob 6G QUANTUM SERVER 55;
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 generates a private key by formatting PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed, and then generated through the TRNG 23. A public key is generated by performing an EX-OR encryption operation with the private key using a natural random number seed and stored in the Security OTP Memory 30 and Alice 6G QUANTUM SERVER 62;
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to control the UHD surveillance camera. and Alice 6G QUANTUM SERVER 62 and login (LOG In) network to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice QUANTUM SERVER (63) and Bob QUANTUM SERVER (56) are connected to QUANTUM CHANNEL (59),
QUANTUM 6G SECURITY ENGINE 64 generates QUANTUM KEY from either BB84 or COW (Coherent One Way) and transmits it to Alice QUANTUM SERVER 63;
Alice QUANTUM SERVER 63 sends QUANTUM KEY to Bob QUANTUM SERVER 56 via QUANTUM CHANNEL 59;
Bob QUANTUM SERVER (56) transmits to Quantum Entanglement (36) through the input/output unit via Bob 6G QUANTUM SERVER (55);
Quantum Entanglement (36) is transmitted to the image 6G SECURITY ENGINE (35) in case of a QUANTUM KEY generated by the Coherent One Way (COW) generation method;
Image 6G SECURITY ENGINE (35) is verified with Decoy Pulse (37) and in the case of quantum entanglement, it receives image data from 5G QUANTUM JUMP ENGINE (34), encrypts image data with QUANTUM KEY, and then uses the input/output unit to encrypt Bob 6G QUANTUM SERVER. via (55) to Bob QUANTUM SERVER (56);
Bob QUANTUM SERVER (56) transmits the image data encrypted with the QUANTUM KEY to Alice QUANTUM SERVER (63) through QUANTUM CHANNEL (59);
Alice QUANTUM SERVER 63 decrypts the video data encrypted with the QUANTUM KEY with the QUANTUM KEY received from the 6G SECURITY ENGINE 64;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are hybrid- consisting of a Non-QUANTUM Communication Channel (58) and a quantum communication channel (QUANTUM Communication Channel (59)). connected to QUANTUM CHANNEL (60),
Alice PUF-QRNG TWIN USB 65 is Alice Boot-ROM connected to Alice System Bus, Alice Master Controller (MCU), Alice System Storage Device (System M/M; System MEMORY), and Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface Controller (SPI Controller), Alice True Random Number Generator (TRNG; True Random Number Generator) ), Alice Security CPU (Security Central Processing Unit), Alice Security OTP Memory (Security OTP M/M; Security One Time Password MEMORY), Alice PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Alice PUF It is composed of Chip (Physically Unclonable Function Chip),
Alice main controller (MCU) consists of Alice Boot-ROM, Alice System Storage (System M/M), Alice VPN (Virtual Private Network), Alice Debugger (QC-DEBUGGER) connected to Alice System Bus. , controlling Alice I/O Port, Alice Serial Peripheral Interface (SPI Controller);
Alice Security CPU (Security CPU) is Alice Debugger (QC-DEBUGGER), Alice I/O Device (I/O Port), Alice Serial Peripheral Interface (SPI Controller), Alice Pure Random Number Generator (TRNG), Alice Secure OTP Memory (Security) OTP M/M), Alice PUF memory (PUF M/M), and Alice PUF Chip;
Alice system storage (System M/M) stores programs and data necessary for Alice main control unit (MCU);
The Alice Serial Peripheral Interface (SPI Controller) is connected to the Alice I/O Device (I/O Port) and controls the Alice I/O Device (I/O Port) according to the control command of the Alice Main Controller (MCU) to turn on the network connection. /OFF control;
Alice Boot-ROM stores programs and data necessary for booting of Alice Main Control Unit (MCU);
Alice VPN performs 1:1 encrypted communication between Bob VPN inside Bob PUF-QRNG TWIN USB 57 connected to the network;
Alice Debugger (QC-DEBUGGER) receives a decoy Qantum Certificate (QC) through the Alice input/output device (I/O Port) and turns on/off the network network through the Alice input/output device (I/O Port) depending on whether or not authentication is performed. OFF control;
Alice input/output device (I/O Port) is a switch connected to the network network, and transmits the network network ON/OFF control and data received through the network network to the Alice main controller (MCU) through the Alice system bus;
Alice Security CPU (Security CPU) extracts Alice PIN data from Alice PUF Chip and stores it in Bob PUF memory (PUF M/M);
Alice Security CPU sends Alice PIN data to Alice Main Control Unit (MCU);
Alice secure CPU (Security CPU) generates Alice private key with the Alice PIN data and stores it in Alice secure OTP memory (Security OTP M/M);
The Alice Security CPU encrypts the Alice private key with the random number generated by the Alice pure random number generator (TRNG), generates the Alice public key, and transmits it to the Alice main controller (MCU);
Bob PUF-QRNG TWIN USB (57) is connected to Bob's System Bus (Boot-ROM), Bob's Master Controller (MCU), Bob's System Storage (System M/M; System MEMORY), and Bob VPN (Virtual Private Network), Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface Controller (SPI Controller), Bob True Random Number Generator (TRNG) ), Bob Security CPU (Security Central Processing Unit), Bob Security OTP M/M (Security One Time Password MEMORY), Bob PUF Memory (PUF M/M; Phisycally Unclonable Function MEMORY), Bob PUF It is composed of Chip (Physically Unclonable Function Chip),
Bob main controller (MCU) is connected to Bob's System Bus (Boot-ROM), Bob's System Storage (System M/M), Bob's Virtual Private Network (VPN), and Bob's Debugger (QC-DEBUGGER). , control Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller);
Bob Security CPU (Security CPU) includes Bob Debugger (QC-DEBUGGER), Bob I/O Port, Bob Serial Peripheral Interface (SPI Controller), Bob Pure Random Number Generator (TRNG), and Bob Secure OTP Memory (Security). OTP M/M), Bob PUF memory (PUF M/M), and Bob PUF Chip;
Bob's system storage (System M/M) stores programs and data necessary for Bob's main control unit (MCU);
Bob Serial Peripheral Interface (SPI Controller) is connected to Bob I/O Port and controls Bob I/O Port according to the control command of Bob's main controller (MCU) to turn on the network connection. /OFF control;
Bob Boot-ROM stores programs and data necessary for booting Bob's main control unit (MCU);
Bob VPN performs 1:1 encrypted communication between Alice VPN inside Alice PUF-QRNG TWIN USB 65 connected to the network;
Bob Debugger (QC-DEBUGGER) receives a Quantum Certificate (QC) through Bob's I/O Port and turns on/off the network through Bob's I/O Port depending on whether or not it is authenticated. control;
Bob input/output device (I/O Port) is a switch connected to the network network and transmits the network network ON/OFF control and data received through the network network to the Bob main control unit (MCU) through the Bob system bus (System Bus);
Bob Security CPU (Security CPU) extracts Bob PIN data from Bob PUF Chip and stores it in Alice PUF memory (PUF M/M);
Bob Security CPU sends Bob PIN data to Bob main control unit (MCU);
Bob Security CPU (Security CPU) generates Bob private key with the Bob PIN data and stores it in Bob Security OTP memory (Security OTP M/M);
The Bob Security CPU (Security CPU) encrypts the Bob private key with the random number generated by the Bob pure random number generator (TRNG), generates the Bob public key, and transmits it to the Bob main controller (MCU);
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to a QUANTUM Communication Channel among hybrid-QUANTUM CHANNEL (60),
Quantum Random Number Generator (QRNG) is composed of Alice QRNG of the transmitter and Bob QRNG of the receiver that generate random quantum random numbers;
Quantum Key Distribution (QKD) is composed of an Alice quantum key distributor (QKD) of a transmitter including a laser and a Bob quantum key distributor (QKD) of a receiver including a single photon detector;
The Quantum Platform is an Aliec Quantum Platform that generates a Quantum Certificate (QC) with quantum random numbers generated by Alice QRNG and transmits it through the Alice Quantum Key Distributor (QKD). Consists of a Bob Quantum Platform that receives and stores a Quantum Certificate (QC) through a Bob Quantum Key Distributor (QKD);
Random quantum random numbers generated from a transmitting set Alice QRNG are transmitted to the Aliec Quantum Platform;
Aliec Quantum Platform receives the quantum random number, generates a quantum certificate (QC), and transmits it to Alice Master Server (Alice MASTER SERVER) and Alice Quantum Key Distributor (QKD);
Alice quantum key distributor (QKD) transmits a quantum certificate (QC) to Bob quantum key distributor (QKD) through a quantum communication channel (QUANTUM Communication Channel) connected by an optical cable;
a receiving set Bob Quantum Key Distributor (QKD) receives the quantum certificate (QC) and stores it in Bob Quantum Platform;
Alice PUF-QRNG TWIN USB (65) and Bob PUF-QRNG TWIN USB (57) are connected to an ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) boots through Alice Boot-ROM connected to Alice System Bus, and is stored in Alice system storage device (System M/M). According to the stored program, it controls the Alice serial peripheral interface (SPI Controller) to control the network network ON/OFF through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) Send to Bob VPN inside Bob PUF-QRNG TWIN USB 57 via Alice VPN;
Bob PUF-QRNG TWIN USB(57) inside Bob's main controller (MCU) boots through Bob's Boot-ROM connected to Bob's System Bus, and stores it in Bob's system storage (System M/M). According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob input/output device (I/O port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN USB 65 via Bob VPN;
Alice PUF-QRNG TWIN USB 65 inside Alice main controller (MCU) uses the Alice KEY that encrypted the Bob PIN data stored in the Alice PUF memory (PUF M/M) with the Bob public key received through the Alice VPN, and the Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN USB 57 through;
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob VPN, the Bob KEY that encrypted the Alice PIN data stored in the Bob PUF memory (PUF M/M) with the Alice public key received through Bob VPN. through Alice PUF-QRNG TWIN USB 65 to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN USB 65 matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
Bob PUF-QRNG TWIN USB (57) Bob main controller (MCU) inside the Bob PIN data decrypted from Alice KEY encrypted with Bob public key with Bob private key and Bob PIN data extracted from Bob PUF Chip match;
A network login (LOG In) is connected between the Alice Master Server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN USB (65) and the Bob Master Server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN USB (57). ;
Alice PUF-QRNG TWIN The Alice main controller (MCU) inside the USB 65 receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through Alice VPN, to Bob VPN inside USB 57;
Bob PUF-QRNG TWIN USB 57 inside Bob main controller (MCU) decrypts the quantum certificate (QC) by decrypting the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key;
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN USB 57;
Bob PUF-QRNG TWIN USB 57, Bob's main controller (MCU) transmits the quantum certificate (QC) received from Alice Master Server (Alice MASTER SERVER) to Bob Debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) does not match the quantum certificate (QC) received from Alice PUF-QRNG TWIN USB (65) and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) I/ A hybrid quantum communication system terminal including a switchboard terminal, characterized in that the O Port is controlled by the OFF contact to block the network connection between the Alice master server and the Bob master server.
QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선 양자네트워크망 및 5G 무선네트워크망과 연결;되고
유선 양자네트워크 자가망과 ISP 사업자 5G 무선네트워크망을 선택적으로 접속 및 데이터 특성에 따라 PUF, QRNG SoC Chip을 이용한 QUANTUM KEY(개인키/공개키)로 암/복호화하는 QKD(Quantum Key Distribution) TLS(Transport Layer Security) 시스템을 특징으로,
QUANTUM COLLABO(QUANTUM encrypt Transport Layer Security protocol DEVICE)은 Eve 양자난수생성기, 5G QUANTUM JUMP ENGINE, Boot Mode S/W(SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W(SWITCH), LED, I/O Pin Header로 구성되고,
QUANTUM COLLABO 내부 5G QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성되어,
Eve 양자난수생성기는 난수소스생성기, 양자검출 다이오드, 양자랜덤펄스 생성기, 양자난수 제어부, 입출력부로 구성되어,
난수소스생성기는 LED(Light-Emitting Diode), LD(Laser Diode), 방사선 동위원소, 트랜지스터 노이즈, 열잡음 중 어느 하나 이상으로부터 양자입자를 방출하며;
상기 양자검출 다이오드는 상기 난수소스생성기로 부터 발생하는 양자입자를 검출하며;
상기 양자랜덤펄스 생성기는 상기 양자검출 다이오드로부터 양자입자 이벤트를 검출하여 양자입자의 검출에 상응하는 랜덤펄스를 발생하며;
상기 양자난수 제어부는 상기 양자랜덤펄스 생성기를 통해 발생하는 랜덤펄스 무작위 난수소스로 양자난수를 생성하여 5G QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
Boot Mode S/W(SWITCH)는 5G QUANTUM JUMP ENGINE 내부 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 5G 통신모뎀으로 전송하는 Boot Mode S/W(SWITCH)이며;
JTAG Connector는 디지털 입출력을 위해 직렬 통신 방식으로 출력 데이터를 전송하거나 입력데이터를 수신하는 JTAG(Joint Test Action Group) Connector로 자율주행차 운영 프로그램 등을 입출력하며;
ETHERNET Connector는 자율주행차와 ETHERNET 통신하는 입출력포트이며;
RESET S/W(SWITCH)는 QUANTUM COLLABO을 초기화하는 RESET S/W(SWITCH)이며;
전원공급 표시 LED 및 QUANTUM COLLABO 각 부분과 통신하는 I/O Pin Header 및 USB Connector로 구성되며;
자율주행차량 내부에 탑재되는 감시카메라, QUANTUM COLLABO, 5G 통신모뎀;및
자율주행차량 외부 도로에 설치되는 QUANTUM 5G AP, Bob 6G QUANTUM SERVER;및
QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선 양자네트워크망 및 5G 무선네트워크망과 연결된 Alice 6G QUANTUM SERVER로 구성되어,
5G QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice 6G QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, 상기 양자난수 시드(Seed) 및 Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 5G 통신모뎀으로 전송하며;
5G 통신모뎀은 5G 무선네트워크망 내부의 5G 기지국을 통해 Alice 6G QUANTUM SERVER로 전송하며;
Alice 6G QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성되어,
Alice 6G QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)와 Alice QUANTUM 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice 6G QUANTUM SERVER는 5G 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 5G 무선네트워크망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 Security OTP Memory에 저장된 양자난수 시드(Seed)와 베타적 논리합(EX-OR) 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 5G 통신모뎀으로 전송하며;
5G 통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 5G LAN(Local Area Network) 셀망을 통해 QUANTUM 5G AP로 전송하지만, QUANTUM 5G AP와 통신이 불가능할 경우에는 5G 무선네트워크망 5G 기지국으로 전송하며;
Bob 6G QUANTUM SERVER는 QUANTUM 5G AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선 양자네트워크망을 통해 Alice 6G QUANTUM SERVER로 전송하며;
Alice 6G QUANTUM SERVER는 유선 양자네트워크망과 5G 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM 5G AP를 이용한 SMART QUANTUM G-Cloud 자율주행차 하이브리드 양자통신 시스템 단말기.
It consists of QUANTUM COLLABO including quantum random number generator, self-driving car including surveillance camera and 5G communication modem, QUANTUM 5G AP (Access Point), Alice 6G QUANTUM SERVER, and Bob 6G QUANTUM SERVER;
Connected with wired quantum network and 5G wireless network consisting of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL;
QKD (Quantum Key Distribution) TLS (Quantum Key Distribution) that selectively accesses wired quantum network and ISP operator 5G wireless network network and encrypts/decrypts with QUANTUM KEY (private key/public key) using PUF and QRNG SoC Chip according to data characteristics Transport Layer Security) system,
QUANTUM COLLABO (QUANTUM encrypt Transport Layer Security protocol DEVICE) is an Eve quantum random number generator, 5G QUANTUM JUMP ENGINE, Boot Mode S/W (SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W (SWITCH), LED, Consists of I/O Pin Header,
QUANTUM COLLABO internal 5G QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller.
Eve quantum random number generator consists of random number source generator, quantum detection diode, quantum random pulse generator, quantum random number control unit, input/output unit,
The random number source generator emits quantum particles from any one or more of a Light-Emitting Diode (LED), a Laser Diode (LD), a radioactive isotope, transistor noise, and thermal noise;
the quantum detection diode detects quantum particles generated from the random number source generator;
the quantum random pulse generator detects a quantum particle event from the quantum detection diode and generates a random pulse corresponding to the detection of the quantum particle;
the quantum random number control unit generates a quantum random number from a random pulse random number source generated through the quantum random pulse generator and transmits it to the 5G QUANTUM JUMP ENGINE internal Security CPU;
Boot Mode S/W (SWITCH) is Boot Mode S/W (S/W) that boots the Boot-ROM through the SPI Controller inside 5G QUANTUM JUMP ENGINE, receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key, and transmits it to the 5G communication modem. SWITCH);
JTAG Connector is a Joint Test Action Group (JTAG) Connector that transmits output data or receives input data in a serial communication method for digital input/output, and inputs and outputs an autonomous vehicle operation program;
ETHERNET Connector is an input/output port for ETHERNET communication with an autonomous vehicle;
RESET S/W(SWITCH) is RESET S/W(SWITCH) initializing QUANTUM COLLABO;
Consists of power supply indicator LED and I/O Pin Header and USB Connector that communicates with each part of QUANTUM COLLABO;
Surveillance camera mounted inside autonomous vehicle, QUANTUM COLLABO, 5G communication modem; and
QUANTUM 5G AP, Bob 6G QUANTUM SERVER installed on the road outside the autonomous vehicle; and
It consists of a wired quantum network consisting of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL and Alice 6G QUANTUM SERVER connected to a 5G wireless network,
5G QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls the Security CPU to extract Eve PIN data from the hardware pin of the eve-PUF Chip and store it in PUF-PIN Memory and Alice 6G QUANTUM SERVER. generate a key;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU generates Eve QUANTUM public key by performing beta-OR (EX-OR) encryption operation of Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed, and the quantum random number seed and Eve storing QUANTUM public key in Security OTP Memory and transmitting Eve QUANTUM public key to 5G communication modem;
5G communication modem transmits to Alice 6G QUANTUM SERVER through 5G base station inside 5G wireless network;
Alice 6G QUANTUM SERVER is composed of Alice Quantum Random Number Generator and Alice PUF Chip inside,
Alice 6G QUANTUM SERVER extracts Alice PIN data from the hardware pin of Alice PUF Chip, stores it in QUANTUM COLLABO, and encrypts the Alice PIN data with a random number seed format function to generate the Alice QUANTUM private key; and
generating the Alice QUANTUM public key by performing an EX-OR encryption operation with the quantum random number seed that generated the quantum random number from the Alice quantum random number generator and the Alice QUANTUM private key;
Alice 6G QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the 5G wireless network network and retransmits it to the QUANTUM COLLABO through the 5G wireless network; and
QUANTUM COLLABO internal MCU performs Eve PIN data encrypted with Eve QUANTUM public key and Alice QUANTUM public key with Eve QUANTUM private key with quantum random number seed stored in Security OTP Memory and beta-OR (EX-OR) decryption operation to reveal Alice QUANTUM decrypt and generate the key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF Chip match,
MCU boots Boot-ROM through SPI Controller, encrypts surveillance camera video data with Alice QUANTUM public key, and transmits it to 5G communication modem;
The 5G communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM 5G AP through the 5G LAN (Local Area Network) cell network that can communicate. However, if communication with the QUANTUM 5G AP is not possible, the 5G wireless network 5G base station sent to;
When Bob 6G QUANTUM SERVER receives surveillance camera video data encrypted with Alice QUANTUM public key from QUANTUM 5G AP, Alice 6G QUANTUM through a wired quantum network consisting of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL send to SERVER;
Alice 6G QUANTUM SERVER receives SMART QUANTUM G-Cloud using QUANTUM 5G AP that receives video data captured by a surveillance camera encrypted with Alice QUANTUM public key and decrypts it with Alice QUANTUM private key from at least one of wired quantum network and 5G wireless network network. Self-driving car hybrid quantum communication system terminal.
QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선네트워크망 및 무선네트워크망과 연결;되고
유선 양자네트워크 자가망과 통신사업자 무선네트워크망을 선택적으로 접속 및 데이터 특성에 따라 PUF, QRNG SoC Chip을 이용한 QUANTUM KEY로 암/복호화하는 QKD(Quantum Key Distribution) TLS(Transport Layer Security) 시스템을 특징으로,
QUANTUM COLLABO(QUANTUM encrypt Transport Layer Security protocol DEVICE)은 Eve 양자난수생성기, 5G QUANTUM JUMP ENGINE, Boot Mode S/W(SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W(SWITCH), LED, I/O Pin Header로 구성되어,
Eve 양자난수생성기는 내부에 QRNG(Quantum Random Number Generator) SoC(System On Chip) Chip를 통해 양자난수를 생성하여 5G QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
Boot Mode S/W(SWITCH)는 5G QUANTUM JUMP ENGINE 내부 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 5G 통신모뎀으로 전송하는 Boot Mode S/W(SWITCH)이며;
JTAG Connector는 디지털 입출력을 위해 직렬 통신 방식으로 출력 데이터를 전송하거나 입력데이터를 수신하는 JTAG(Joint Test Action Group) Connector로 자율주행차 운영 프로그램 등을 입출력하며;
ETHERNET Connector는 자율주행차와 ETHERNET 통신하는 입출력포트이며;
RESET S/W(SWITCH)는 QUANTUM COLLABO을 초기화하는 RESET S/W(SWITCH)이며;
전원공급 표시 LED 및 QUANTUM COLLABO 각 부분과 통신하는 I/O Pin Header 및 USB Connector로 구성되며;
자율주행차량 내부에 탑재되는 감시카메라, QUANTUM COLLABO, 5G 통신모뎀;및
자율주행차량 외부에 설치되는 QUANTUM 5G AP, Bob 6G QUANTUM SERVER;및
QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선네트워크망 및 무선네트워크망과 연결된 Alice 6G QUANTUM SERVER로 구성되어,
QUANTUM COLLABO 내부 5G QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
5G QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice 6G QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, 상기 양자난수 시드(Seed) 및 Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 5G 통신모뎀으로 전송하며;
5G 통신모뎀은 무선네트워크망 내부의 5G 기지국을 통해 Alice 6G QUANTUM SERVER로 전송하며;
Alice 6G QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성되어,
Alice 6G QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)와 Alice QUANTUM 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice 6G QUANTUM SERVER는 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 무선네트워크망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 Security OTP Memory에 저장된 양자난수 시드(Seed)와 베타적 논리합(EX-OR) 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 5G 통신모뎀으로 전송하며;
5G 통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 5G LAN(Local Area Network) 셀망을 통해 QUANTUM 5G AP로 전송하지만, QUANTUM 5G AP와 통신이 불가능할 경우에는 무선네트워크망 5G 기지국으로 전송하며;
Bob 6G QUANTUM SERVER는 QUANTUM 5G AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, QUANTUM CHANNEL, non-QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나로 구성된 유선네트워크망을 통해 Alice 6G QUANTUM SERVER로 전송하며;
Alice 6G QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM 5G AP를 이용한 SMART QUANTUM G-Cloud 자율주행차 하이브리드 양자통신 시스템 단말기.
It consists of QUANTUM COLLABO including quantum random number generator, self-driving car including surveillance camera and 5G communication modem, QUANTUM 5G AP (Access Point), Alice 6G QUANTUM SERVER, and Bob 6G QUANTUM SERVER;
Connected to a wired network or a wireless network composed of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL;
It features a QKD (Quantum Key Distribution) TLS (Transport Layer Security) system that selectively accesses wired quantum networks and wireless network networks of telecommunication providers and encrypts/decrypts them with QUANTUM KEY using PUF and QRNG SoC Chip according to data characteristics. ,
QUANTUM COLLABO (QUANTUM encrypt Transport Layer Security protocol DEVICE) is an Eve quantum random number generator, 5G QUANTUM JUMP ENGINE, Boot Mode S/W (SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W (SWITCH), LED, Consists of I/O Pin Header,
Eve Quantum Random Number Generator generates quantum random number through QRNG (Quantum Random Number Generator) SoC (System On Chip) Chip inside and transmits it to 5G QUANTUM JUMP ENGINE internal Security CPU;
Boot Mode S/W (SWITCH) is Boot Mode S/W (S/W) that boots the Boot-ROM through the SPI Controller inside 5G QUANTUM JUMP ENGINE, receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key, and transmits it to the 5G communication modem. SWITCH);
JTAG Connector is a Joint Test Action Group (JTAG) Connector that transmits output data or receives input data in a serial communication method for digital input/output, and inputs and outputs an autonomous vehicle operation program;
ETHERNET Connector is an input/output port for ETHERNET communication with an autonomous vehicle;
RESET S/W(SWITCH) is RESET S/W(SWITCH) initializing QUANTUM COLLABO;
Consists of power supply indicator LED and I/O Pin Header and USB Connector that communicates with each part of QUANTUM COLLABO;
Surveillance camera mounted inside autonomous vehicle, QUANTUM COLLABO, 5G communication modem; and
QUANTUM 5G AP, Bob 6G QUANTUM SERVER installed outside the autonomous vehicle; and
It consists of Alice 6G QUANTUM SERVER connected to a wired network and a wireless network consisting of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL,
QUANTUM COLLABO internal 5G QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
5G QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls the Security CPU to extract Eve PIN data from the hardware pin of the eve-PUF Chip and store it in PUF-PIN Memory and Alice 6G QUANTUM SERVER. generate a key;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU generates Eve QUANTUM public key by performing beta-OR (EX-OR) encryption operation of Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed, and the quantum random number seed and Eve storing QUANTUM public key in Security OTP Memory and transmitting Eve QUANTUM public key to 5G communication modem;
5G communication modem transmits to Alice 6G QUANTUM SERVER through the 5G base station inside the wireless network;
Alice 6G QUANTUM SERVER is composed of Alice Quantum Random Number Generator and Alice PUF Chip inside,
Alice 6G QUANTUM SERVER extracts Alice PIN data from the hardware pin of Alice PUF Chip, stores it in QUANTUM COLLABO, and encrypts the Alice PIN data with a random number seed format function to generate the Alice QUANTUM private key; and
generating the Alice QUANTUM public key by performing an EX-OR encryption operation with the quantum random number seed that generated the quantum random number from the Alice quantum random number generator and the Alice QUANTUM private key;
Alice 6G QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network and retransmits it to the QUANTUM COLLABO through the wireless network; and
QUANTUM COLLABO internal MCU performs Eve PIN data encrypted with Eve QUANTUM public key and Alice QUANTUM public key with Eve QUANTUM private key with quantum random number seed stored in Security OTP Memory and beta-OR (EX-OR) decryption operation to reveal Alice QUANTUM decrypt and generate the key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF Chip match,
MCU boots Boot-ROM through SPI Controller, encrypts surveillance camera video data with Alice QUANTUM public key, and transmits it to 5G communication modem;
The 5G communication modem transmits the surveillance camera video data encrypted with the Alice QUANTUM public key to the QUANTUM 5G AP through the 5G LAN (Local Area Network) cell network that can communicate, but if communication with the QUANTUM 5G AP is not possible, it is sent to the 5G base station of the wireless network network. transmit;
When Bob 6G QUANTUM SERVER receives surveillance camera video data encrypted with Alice QUANTUM public key from QUANTUM 5G AP, Alice 6G QUANTUM SERVER through a wired network consisting of any one of QUANTUM CHANNEL, non-QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL sent to;
Alice 6G QUANTUM SERVER receives video data from the surveillance camera encrypted with the Alice QUANTUM public key from one or more of the wired network and the wireless network, and decrypts it with the Alice QUANTUM private key SMART QUANTUM G-Cloud autonomous driving using QUANTUM 5G AP Primary hybrid quantum communication system terminal.
5G 통신모뎀은 QUANTUM AP(Access Point)를 통해 Bob 6G QUANTUM SERVER와 무선네트워크망으로 연결;및
5G 통신모뎀은 LPWAN(Low Power Wide Area Network) 또는 LTE 또는 LoRA 또는 NB-IoT 또는 5G 네트워크망 중 어느 하나의 통신사업자 무선네트워크망를 통해 Alice 6G QUANTUM SERVER와 무선네트워크망으로 연결;및
Alice 6G QUANTUM SERVER와 Bob 6G QUANTUM SERVER는 유선네트워크망으로 연결;되고
유/무선네트워크 자가망과 통신사업자 무선네트워크망을 선택적으로 접속 및 데이터 특성에 따라 PUF, QRNG SoC Chip을 이용한 QUANTUM KEY로 암/복호화하는 QKD(Quantum Key Distribution) TLS(Transport Layer Security) 시스템을 특징으로,
QUANTUM COLLABO(QUANTUM encrypt Transport Layer Security protocol DEVICE)은 Eve 양자난수생성기, 5G QUANTUM JUMP ENGINE, Boot Mode S/W(SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W(SWITCH), LED, I/O Pin Header로 구성되어,
Eve 양자난수생성기는 내부에 QRNG(Quantum Random Number Generator) SoC(System On Chip) Chip를 통해 양자난수를 생성하여 5G QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
Boot Mode S/W(SWITCH)는 5G QUANTUM JUMP ENGINE 내부 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 5G 통신모뎀으로 전송하는 Boot Mode S/W(SWITCH)이며;
JTAG Connector는 디지털 입출력을 위해 직렬 통신 방식으로 출력 데이터를 전송하거나 입력데이터를 수신하는 JTAG(Joint Test Action Group) Connector로 자율주행차 운영 프로그램 등을 입출력하며;
ETHERNET Connector는 자율주행차와 ETHERNET 통신하는 입출력포트이며;
RESET S/W(SWITCH)는 QUANTUM COLLABO을 초기화하는 RESET S/W(SWITCH)이며;
전원공급 표시 LED 및 QUANTUM COLLABO 각 부분과 통신하는 I/O Pin Header 및 USB Connector로 구성되며;
자율주행차량 내부에 탑재되는 감시카메라, QUANTUM COLLABO, 5G 통신모뎀;및
자율주행차량 외부에 설치되는 QUANTUM AP, Bob 6G QUANTUM SERVER;및
유/무선네트워크망과 연결된 Alice 6G QUANTUM SERVER로 구성되어,
QUANTUM COLLABO 내부 5G QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
5G QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice 6G QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, 상기 양자난수 시드(Seed) 및 Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 5G 통신모뎀으로 전송하며;
5G 통신모뎀은 무선네트워크망 내부의 5G 기지국을 통해 Alice 6G QUANTUM SERVER로 전송하며;
Alice 6G QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성되어,
Alice 6G QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 포맷함수 암호화하여 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)와 Alice QUANTUM 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice 6G QUANTUM SERVER는 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 무선네트워크망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 Security OTP Memory에 저장된 양자난수 시드(Seed)와 베타적 논리합(EX-OR) 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 5G 통신모뎀으로 전송하며;
5G 통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 5G LAN(Local Area Network) 셀망을 통해 QUANTUM AP로 전송하지만, QUANTUM AP와 통신이 불가능할 경우에는 무선네트워크망 5G 기지국으로 전송하며;
Bob 6G QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선네트워크망을 통해 Alice 6G QUANTUM SERVER로 전송하며;
Alice 6G QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 SMART QUANTUM G-Cloud 자율주행차 하이브리드 양자통신 시스템 단말기.
It consists of QUANTUM COLLABO including quantum random number generator, self-driving car including surveillance camera and 5G communication modem, QUANTUM AP (Access Point), Alice 6G QUANTUM SERVER, Bob 6G QUANTUM SERVER;
5G communication modem is connected to Bob 6G QUANTUM SERVER through a wireless network through QUANTUM AP (Access Point); and
5G communication modem is connected to Alice 6G QUANTUM SERVER and wireless network through LPWAN (Low Power Wide Area Network) or LTE or LoRA or NB-IoT or any one of the 5G network networks through the wireless network network of the operator; and
Alice 6G QUANTUM SERVER and Bob 6G QUANTUM SERVER are connected through a wired network;
Features a QKD (Quantum Key Distribution) TLS (Transport Layer Security) system that selectively accesses wired/wireless networks and wireless networks of telecommunication service providers and encrypts/decrypts them with QUANTUM KEY using PUF and QRNG SoC chips according to data characteristics to,
QUANTUM COLLABO (QUANTUM encrypt Transport Layer Security protocol DEVICE) is an Eve quantum random number generator, 5G QUANTUM JUMP ENGINE, Boot Mode S/W (SWITCH), JTAG Connector, USB Connector, ETHERNET Connector, RESET S/W (SWITCH), LED, Consists of I/O Pin Header,
Eve Quantum Random Number Generator generates quantum random number through QRNG (Quantum Random Number Generator) SoC (System On Chip) Chip inside and transmits it to 5G QUANTUM JUMP ENGINE internal Security CPU;
Boot Mode S/W (SWITCH) is Boot Mode S/W (S/W) that boots the Boot-ROM through the SPI Controller inside 5G QUANTUM JUMP ENGINE, receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key, and transmits it to the 5G communication modem. SWITCH);
JTAG Connector is a Joint Test Action Group (JTAG) Connector that transmits output data or receives input data in a serial communication method for digital input/output, and inputs and outputs an autonomous vehicle operation program;
ETHERNET Connector is an input/output port for ETHERNET communication with an autonomous vehicle;
RESET S/W(SWITCH) is RESET S/W(SWITCH) initializing QUANTUM COLLABO;
Consists of power supply indicator LED and I/O Pin Header and USB Connector that communicates with each part of QUANTUM COLLABO;
Surveillance camera mounted inside autonomous vehicle, QUANTUM COLLABO, 5G communication modem; and
QUANTUM AP, Bob 6G QUANTUM SERVER installed outside the autonomous vehicle; and
It consists of Alice 6G QUANTUM SERVER connected to the wired/wireless network,
QUANTUM COLLABO internal 5G QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
5G QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls the Security CPU to extract Eve PIN data from the hardware pin of the eve-PUF Chip and store it in PUF-PIN Memory and Alice 6G QUANTUM SERVER. generate a key;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU generates Eve QUANTUM public key by performing beta-OR (EX-OR) encryption operation of Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed, and the quantum random number seed and Eve storing QUANTUM public key in Security OTP Memory and transmitting Eve QUANTUM public key to 5G communication modem;
5G communication modem transmits to Alice 6G QUANTUM SERVER through the 5G base station inside the wireless network;
Alice 6G QUANTUM SERVER is composed of Alice Quantum Random Number Generator and Alice PUF Chip inside,
Alice 6G QUANTUM SERVER extracts Alice PIN data from the hardware pin of Alice PUF Chip, stores it in QUANTUM COLLABO, and encrypts the Alice PIN data with a random number seed format function to generate the Alice QUANTUM private key; and
generating the Alice QUANTUM public key by performing an EX-OR encryption operation with the quantum random number seed that generated the quantum random number from the Alice quantum random number generator and the Alice QUANTUM private key;
Alice 6G QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network and retransmits it to the QUANTUM COLLABO through the wireless network; and
QUANTUM COLLABO internal MCU performs Eve PIN data encrypted with Eve QUANTUM public key and Alice QUANTUM public key with Eve QUANTUM private key with quantum random number seed stored in Security OTP Memory and beta-OR (EX-OR) decryption operation to reveal Alice QUANTUM decrypt and generate the key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF Chip match,
MCU boots Boot-ROM through SPI Controller, encrypts surveillance camera video data with Alice QUANTUM public key, and transmits it to 5G communication modem;
The 5G communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM AP through the 5G LAN (Local Area Network) cell network that can communicate, but if communication with the QUANTUM AP is not possible, it is transmitted to the 5G base station of the wireless network network. ;
When Bob 6G QUANTUM SERVER receives surveillance camera video data encrypted with Alice QUANTUM public key from QUANTUM AP, it transmits it to Alice 6G QUANTUM SERVER through wired network;
Alice 6G QUANTUM SERVER is a SMART QUANTUM G-Cloud autonomous vehicle using QUANTUM AP that receives video data from a surveillance camera encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of the wired network and the wireless network. Hybrid quantum communication system terminal.
유/무선 자가망과 통신사업자 무선망을 선택적으로 접속하여 QUANTUM KEY로 암/복호화하는 QKD(Quantum Key Distribution) TLS(Transport Layer Security) 시스템을 특징으로,
자율주행차량 내부에 탑재되는 감시카메라, QUANTUM COLLABO, 통신모뎀;및
자율주행차량 외부에 설치되는 QUANTUM AP, Bob QUANTUM SERVER;및
유/무선네트워크망과 연결된 Alice QUANTUM SERVER로 구성되어,
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선네트워크망 내부의 무선기지국을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 QUANTUM AP로 전송하지만, QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선네트워크망 무선기지국으로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 SMART QUANTUM G-Cloud 자율주행차 하이브리드 양자통신 시스템 단말기.
Consists of QUANTUM COLLABO and self-driving cars including surveillance cameras and communication modems, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER;
It features a QKD (Quantum Key Distribution) TLS (Transport Layer Security) system that selectively connects wired/wireless own networks and wireless networks of telecommunication providers to encrypt/decrypt with QUANTUM KEY.
Surveillance camera, QUANTUM COLLABO, communication modem mounted inside an autonomous vehicle; and
QUANTUM AP, Bob QUANTUM SERVER installed outside the autonomous vehicle; and
It consists of Alice QUANTUM SERVER connected to the wired/wireless network,
QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls Security CPU to extract Eve PIN data from the hardware pin of eve-PUF Chip, store it in PUF-PIN Memory and Alice QUANTUM SERVER, and generate Eve QUANTUM private key with Eve PIN data as a random number seed;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU generates Eve QUANTUM public key by encrypting Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed, stores Eve QUANTUM public key in Security OTP Memory, and communicates Eve QUANTUM public key transmit by modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless base station inside the wireless network network of the operator;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice PUF Chip inside,
Alice QUANTUM SERVER extracts Alice PIN data from hardware pin of Alice PUF Chip, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; and
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network of the telecommunication service provider, and retransmits it to the QUANTUM COLLABO through the wireless network of the carrier; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF Chip match,
MCU boots Boot-ROM through SPI Controller, encrypts surveillance camera video data with Alice QUANTUM public key, and transmits it to communication modem;
The communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM AP that can communicate, but when communication with the QUANTUM AP is not possible, it transmits it to the wireless base station of the wireless network network of the communication service provider;
When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wired network;
Alice QUANTUM SERVER is a SMART QUANTUM G-Cloud autonomous vehicle hybrid using QUANTUM AP, which receives video data from a surveillance camera encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of the wired network and the wireless network. Quantum communication system terminal.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF Chip의 하드웨어 핀에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터로 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF Chip를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice PUF Chip의 하드웨어 핀에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 하이브리드 양자통신 시스템 단말기.
It consists of QUANTUM COLLABO, surveillance camera, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER,
QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF Chip, Security OTP Memory, Boot-ROM, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF Chip, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls Security CPU to extract Eve PIN data from the hardware pin of eve-PUF Chip, store it in PUF-PIN Memory and Alice QUANTUM SERVER, and generate Eve QUANTUM private key with Eve PIN data;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
The Security CPU generates an Eve QUANTUM public key by encrypting the Eve QUANTUM private key stored in the PUF-PIN Memory with the quantum random number, stores the Eve QUANTUM public key in the Security OTP Memory, and transmits the Eve QUANTUM public key to the communication modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice PUF Chip inside,
The Alice QUANTUM SERVER extracts the Alice PIN data from the hardware pin of the Alice PUF Chip, stores it in the QUANTUM COLLABO, and generates the Alice QUANTUM private key with the Alice PIN data; and
encrypting the Alice QUANTUM private key with the quantum random number generated from the Alice quantum random number generator to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and retransmits it to the QUANTUM COLLABO through the wireless network of the carrier; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF Chip match,
MCU boots Boot-ROM through SPI Controller, encrypts surveillance camera video data with Alice QUANTUM public key, and transmits it to communication modem;
The communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the QUANTUM AP of the wireless self-network network. transmit;
When Bob QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wired network;
Alice QUANTUM SERVER is a hybrid quantum communication system terminal using a QUANTUM AP that receives video data captured by a surveillance camera encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of the wired self network and the wireless network of the telecommunication service provider.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, NFC Memory, Security CPU, MCU, eve-NFC Chip, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, NFC Memory, Security CPU, eve-NFC Chip, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-NFC Chip에서 Eve NFC 데이터를 추출하여 NFC Memory 및 Alice QUANTUM SERVER에 저장 후 Eve NFC 데이터로 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 NFC Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice NFC Chip를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice NFC Chip에서 Alice NFC 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice NFC 데이터로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve NFC 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve NFC 데이터와 eve-NFC Chip으로 부터 추출한 Eve NFC 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 하이브리드 양자통신 시스템 단말기.
It consists of QUANTUM COLLABO, surveillance camera, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, NFC Memory, Security CPU, MCU, eve-NFC Chip, Security OTP Memory, Boot-ROM, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, NFC Memory, Security CPU, eve-NFC Chip, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls Security CPU to extract Eve NFC data from eve-NFC Chip, store it in NFC Memory and Alice QUANTUM SERVER, and generate Eve QUANTUM private key with Eve NFC data;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
The Security CPU generates an Eve QUANTUM public key by encrypting the Eve QUANTUM private key stored in the NFC Memory with the quantum random number, stores the Eve QUANTUM public key in the Security OTP Memory, and transmits the Eve QUANTUM public key to the communication modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice NFC Chip inside,
Alice QUANTUM SERVER extracts Alice NFC data from Alice NFC Chip, stores it in QUANTUM COLLABO and generates Alice QUANTUM private key with Alice NFC data; and
encrypting the Alice QUANTUM private key with the quantum random number generated from the Alice quantum random number generator to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER encrypts the Eve NFC data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and retransmits it to the QUANTUM COLLABO through the wireless network of the carrier; and
QUANTUM COLLABO internal MCU decrypts the Eve NFC data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve NFC data; and
When the decrypted Eve NFC data and the Eve NFC data extracted from the eve-NFC Chip match,
MCU boots Boot-ROM through SPI Controller, encrypts surveillance camera video data with Alice QUANTUM public key, and transmits it to communication modem;
The communication modem transmits the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the QUANTUM AP of the wireless self-network network. transmit;
When Bob QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wired network;
Alice QUANTUM SERVER is a hybrid quantum communication system terminal using a QUANTUM AP that receives video data captured by a surveillance camera encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of the wired self network and the wireless network of the telecommunication service provider.
상용전원을 공급받아 전력 사용량을 측정 및 LPWAN(Low Power Wide Area Network) 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이며;
상기 AMI(47)를 거쳐 LED 가로/보안등(52)에 전력을 공급하는 배전반(48)이며;
상기 LED 가로/보안등(52)에 부착되어 전력을 공급 받는 디머(53), QUANTUM 5G AP(49), 방송장치(50), 비상벨(51)이며;
Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE MODULE이 수신하여 방송하는 방송장치(50)이며;
비상벨(51) 작동시 비상벨 작동 이벤트를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE MODULE를 통해 전송하는 비상벨(51)이며;
센서부(46)는 센서를 통해 측정되는 데이터를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE MODULE를 통해 전송하는 센서부(46)이며;
감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이며;
QUANTUM 5G AP(49)는 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이며;
단말 SINGLE MODULE 및 Alice 6G QUANTUM SERVER(62)는 대칭키 알고리즘(symmetric cryptographic algorithm)의 동일한 대칭키를 저장하고 있어, 방송데이터, 비상벨 작동 이벤트 데이터, 센서를 통해 측정되는 데이터, 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터, 감시카메라 제어데이터, 방송장치 제어데이터, 디머 제어데이터를 암/복호화하며;
감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
센서부(46)로부터 수집되는 센싱 데이터, AMI(47)로부터 측정되는 측정 데이터, 하나 이상의 배전반(48)으로부터 수집되는 배전반 상태정보 데이터, 하나 이상의 방송장치(50)로부터 수집되는 음성/영상 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE MODULE으로 전송하며;
단말 SINGLE MODULE은 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN MODULE 중 어느 하나로부터 감시카메라 제어데이터 또는 방송장치 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE MODULE로 전송하며;
단말 SINGLE MODULE는 Bob 6G QUANTUM SERVER(55)로부터 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 비대칭 개인키(PRIVATE KEY)를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 비대칭 개인키(PRIVATE KEY)와 베타적 논리합(EX-OR) 암호화 연산하여 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 비대칭 공개키(PUBLIC KEY)를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice PUF-QRNG TWIN MODULE과 Bob PUF-QRNG TWIN MODULE은 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN MODULE에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN MODULE(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN MODULE로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 배전반, 방송장치, 가로/보안등, 방범용 CCTV 감시카메라 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal unit includes a sensor unit 46 , an AMI 47 , a switchboard 48 , a QUANTUM 5G AP 49 , a broadcasting device 50 , an emergency bell 51 , an LED street/security light 52 , a dimmer 53 . , is composed of a terminal SINGLE MODULE,
an AMI 47 that receives commercial power, measures power usage, and transmits power usage through an LPWAN (Low Power Wide Area Network) communication modem;
a switchboard (48) for supplying power to the LED street/security lights (52) via the AMI (47);
a dimmer 53 , QUANTUM 5G AP 49 , a broadcasting device 50 , and an emergency bell 51 attached to the LED street/security light 52 to receive power;
A broadcasting device 50 that receives and broadcasts broadcast data from any one of Master QUANTUM SERVER 61, Alice 6G QUANTUM SERVER 62, or Alice QUANTUM SERVER 63;
When the emergency bell 51 operates, the emergency bell operation event is transmitted to either the Master QUANTUM SERVER 61 or Alice 6G QUANTUM SERVER 62 or Alice QUANTUM SERVER 63 through the terminal SINGLE MODULE;
The sensor unit 46 transmits the data measured through the sensor to either the Master QUANTUM SERVER 61 or the Alice 6G QUANTUM SERVER 62 or the Alice QUANTUM SERVER 63 through the terminal SINGLE MODULE. ;
a dimmer 53 that adjusts the brightness of the LED street/security light 52 according to whether or not a human object is detected through the surveillance camera image analysis unit;
QUANTUM 5G AP (49) receives the video data captured by the surveillance camera and transmits it to either Master QUANTUM SERVER (61) or Alice 6G QUANTUM SERVER (62) or Alice QUANTUM SERVER (63) through a 5G wireless network base station. AP 49;
Terminal SINGLE MODULE and Alice 6G QUANTUM SERVER 62 store the same symmetric key of a symmetric cryptographic algorithm, so broadcast data, emergency bell operation event data, data measured through a sensor, measurement data, and sensor state Encrypt/decrypt information data, audio/video data, point/off data, surveillance camera control data, broadcasting device control data, and dimmer control data;
The surveillance camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
Sensing data collected from the sensor unit 46, measurement data measured from the AMI 47, switchboard status information data collected from one or more switchboards 48, audio/video data collected from one or more broadcasting devices 50, The LPWAN communication modem 66 collects the point/off data collected from the LED street/security light 52 and transmits it to the terminal SINGLE MODULE;
The terminal SINGLE MODULE transmits measurement data, sensor status information data, audio/video data, and on/off data to Bob 6G QUANTUM SERVER (55); and
Bob 6G QUANTUM SERVER (55) receives the surveillance camera control data or broadcasting device control data or dimmer control data from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN MODULE to the terminal transmitted to the secondary internal terminal SINGLE MODULE;
The terminal SINGLE MODULE receives surveillance camera control data from Bob 6G QUANTUM SERVER (55);
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 formats PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed to form an asymmetric cryptographic algorithm PRIVATE KEY) and then perform an asymmetric cryptographic algorithm by encrypting an asymmetric private key (PRIVATE KEY) and a beta-OR (EX-OR) with the natural random number seed generated through the TRNG (23). Generates a public key (PUBLIC KEY) and stores it in the Security OTP Memory (30) and Alice 6G QUANTUM SERVER (62);
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to communicate with the surveillance camera. Alice 6G QUANTUM SERVER 62 and the login (LOG In) network connection to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice PUF-QRNG TWIN MODULE and Bob PUF-QRNG TWIN MODULE are connected to the ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE boots through the Alice Boot-ROM connected to the Alice system bus, and accesses the program stored in the Alice system storage device (System M/M). Accordingly, by controlling the Alice serial peripheral interface (SPI Controller), the network network ON/OFF is controlled through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) is transferred to Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE (57) Bob main controller (MCU) inside the Bob boot ROM (Boot-ROM) connected to the Bob system bus (System Bus), and to the Bob system storage (System M/M) According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob I/O device (I/O Port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN MODULE via Bob VPN;
Alice PUF-QRNG TWIN MODULE The Alice main controller (MCU) inside the Alice VPN uses the Bob public key received through Alice VPN to encrypt the Bob PIN data stored in the Alice PUF memory (PUF M/M), and returns the Alice KEY to Bob PUF through Alice VPN. - send to Bob VPN inside QRNG TWIN MODULE 57;
Bob's main controller (MCU) inside Bob PUF-QRNG TWIN MODULE(57) uses Alice's public key received through Bob VPN to send the encrypted Alice PIN data stored in Bob PUF memory (PUF M/M) to Bob VPN. through Alice PUF-QRNG TWIN MODULE to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
The Bob main controller (MCU) inside the Bob PUF-QRNG TWIN MODULE (57) matches the Bob PIN data obtained by decrypting the Alice KEY encrypted with the Bob public key with the Bob private key and the Bob PIN data extracted from the Bob PUF Chip;
network login (LOG In) connection between the Alice master server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN MODULE and the Bob master server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN MODULE (57);
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through the Alice VPN, the Bob PUF-QRNG TWIN MODULE (57). ) to the internal Bob VPN;
Bob main controller (MCU) inside Bob PUF-QRNG TWIN MODULE 57 decrypts the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key to decrypt the quantum certificate (QC);
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE 57, the internal Bob main controller (MCU) transmits the quantum certificate (QC) received from the Alice master server (Alice MASTER SERVER) to the Bob debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) sends the I/O port when the quantum certificate (QC) received from Alice PUF-QRNG TWIN MODULE and the quantum certificate (QC) received from the Bob MASTER SERVER do not match. A hybrid quantum communication system terminal including a switchboard, a broadcasting device, a street/security light, and a CCTV surveillance camera terminal for crime prevention, characterized in that the OFF contact control blocks the network connection between the Alice master server and the Bob master server.
Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE MODULE가 수신하여 방송하는 방송장치(50)이며;
QUANTUM 5G AP(49)는 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이며;
감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
방송장치(50)로부터 수집되는 음성/영상 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE MODULE으로 전송하며;
단말 SINGLE MODULE는 음성/영상 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN MODULE 중 어느 하나로부터 감시카메라 제어데이터 또는 방송장치 제어데이터를 수신하여 단말부 내부 단말 SINGLE MODULE로 전송하며;
단말 SINGLE MODULE는 Bob 6G QUANTUM SERVER(55)로부터 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 공개키를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice PUF-QRNG TWIN MODULE과 Bob PUF-QRNG TWIN MODULE은 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN MODULE에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN MODULE(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN MODULE로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 방송장치 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal unit is composed of a broadcasting device 50 and a terminal SINGLE MODULE,
A broadcasting device 50 that receives and broadcasts broadcast data from any one of Master QUANTUM SERVER 61, Alice 6G QUANTUM SERVER 62, or Alice QUANTUM SERVER 63;
QUANTUM 5G AP (49) receives the video data captured by the surveillance camera and transmits it to either Master QUANTUM SERVER (61) or Alice 6G QUANTUM SERVER (62) or Alice QUANTUM SERVER (63) through a 5G wireless network base station. AP 49;
The surveillance camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
The LPWAN communication modem 66 collects the audio/video data collected from the broadcasting device 50 and transmits it to the terminal SINGLE MODULE;
The terminal SINGLE MODULE transmits audio/video data to Bob 6G QUANTUM SERVER 55; and
Bob 6G QUANTUM SERVER (55) receives the surveillance camera control data or broadcasting device control data from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN MODULE to receive the terminal internal terminal SINGLE Send to MODULE;
The terminal SINGLE MODULE receives surveillance camera control data from Bob 6G QUANTUM SERVER (55);
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 generates a private key by formatting PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed, and then generated through the TRNG 23. A public key is generated by performing an EX-OR encryption operation with the private key using a natural random number seed and stored in the Security OTP Memory 30 and Alice 6G QUANTUM SERVER 62;
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to communicate with the surveillance camera. Alice 6G QUANTUM SERVER 62 and the login (LOG In) network connection to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice PUF-QRNG TWIN MODULE and Bob PUF-QRNG TWIN MODULE are connected to the ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE boots through the Alice Boot-ROM connected to the Alice system bus, and accesses the program stored in the Alice system storage device (System M/M). Accordingly, by controlling the Alice serial peripheral interface (SPI Controller), the network network ON/OFF is controlled through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) is transferred to Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE (57) Bob main controller (MCU) inside the Bob boot ROM (Boot-ROM) connected to the Bob system bus (System Bus), and to the Bob system storage (System M/M) According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob I/O device (I/O Port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN MODULE via Bob VPN;
Alice PUF-QRNG TWIN MODULE The Alice main controller (MCU) inside the Alice VPN uses the Bob public key received through Alice VPN to encrypt the Bob PIN data stored in the Alice PUF memory (PUF M/M), and returns the Alice KEY to Bob PUF through Alice VPN. - send to Bob VPN inside QRNG TWIN MODULE 57;
Bob's main controller (MCU) inside Bob PUF-QRNG TWIN MODULE(57) uses Alice's public key received through Bob VPN to send the encrypted Alice PIN data stored in Bob PUF memory (PUF M/M) to Bob VPN. through Alice PUF-QRNG TWIN MODULE to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
The Bob main controller (MCU) inside the Bob PUF-QRNG TWIN MODULE (57) matches the Bob PIN data obtained by decrypting the Alice KEY encrypted with the Bob public key with the Bob private key and the Bob PIN data extracted from the Bob PUF Chip;
network login (LOG In) connection between the Alice master server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN MODULE and the Bob master server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN MODULE (57);
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through the Alice VPN, the Bob PUF-QRNG TWIN MODULE (57). ) to the internal Bob VPN;
Bob main controller (MCU) inside Bob PUF-QRNG TWIN MODULE 57 decrypts the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key to decrypt the quantum certificate (QC);
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE 57, the internal Bob main controller (MCU) transmits the quantum certificate (QC) received from the Alice master server (Alice MASTER SERVER) to the Bob debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) uses the I/O port when the quantum certificate (QC) received from Alice PUF-QRNG TWIN MODULE and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) do not match. A hybrid quantum communication system terminal comprising a broadcasting device terminal, characterized in that the OFF contact control blocks the network connection between the Alice master server and the Bob master server.
상용전원을 공급받아 전력 사용량을 측정 및 LPWAN 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이며;
감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이며;
감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
AMI(47)로부터 측정되는 측정 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE MODULE으로 전송하며;
단말 SINGLE MODULE는 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN MODULE 중 어느 하나로부터 감시카메라 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE MODULE로 전송하며;
단말 SINGLE MODULE는 Bob 6G QUANTUM SERVER(55)로부터 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 공개키를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice PUF-QRNG TWIN MODULE과 Bob PUF-QRNG TWIN MODULE은 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN MODULE에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN MODULE(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN MODULE로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 가로/보안등 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal part is composed of LED street/security light (52), AMI (47), dimmer (53), and terminal single module
an AMI 47 that receives commercial power, measures power usage, and transmits power usage through an LPWAN communication modem;
a dimmer 53 that adjusts the brightness of the LED street/security light 52 according to whether or not a human object is detected through the surveillance camera image analysis unit;
The surveillance camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
The measurement data measured from the AMI 47 and the point/off data collected from the LED street/security light 52 are collected by the LPWAN communication modem 66 and transmitted to the terminal SINGLE MODULE;
The terminal SINGLE MODULE transmits on/off data to Bob 6G QUANTUM SERVER 55; and
Bob 6G QUANTUM SERVER (55) receives surveillance camera control data or dimmer control data from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN MODULE to receive the terminal internal terminal SINGLE MODULE sent to;
The terminal SINGLE MODULE receives surveillance camera control data from Bob 6G QUANTUM SERVER (55);
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 generates a private key by formatting PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed, and then generated through the TRNG 23. A public key is generated by performing an EX-OR encryption operation with the private key using a natural random number seed and stored in the Security OTP Memory 30 and Alice 6G QUANTUM SERVER 62;
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to communicate with the surveillance camera. Alice 6G QUANTUM SERVER 62 and the login (LOG In) network connection to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice PUF-QRNG TWIN MODULE and Bob PUF-QRNG TWIN MODULE are connected to the ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE boots through the Alice Boot-ROM connected to the Alice system bus, and accesses the program stored in the Alice system storage device (System M/M). Accordingly, by controlling the Alice serial peripheral interface (SPI Controller), the network network ON/OFF is controlled through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) is transferred to Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE (57) Bob main controller (MCU) inside the Bob boot ROM (Boot-ROM) connected to the Bob system bus (System Bus), and to the Bob system storage (System M/M) According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob I/O device (I/O Port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN MODULE via Bob VPN;
Alice PUF-QRNG TWIN MODULE The Alice main controller (MCU) inside the Alice VPN uses the Bob public key received through Alice VPN to encrypt the Bob PIN data stored in the Alice PUF memory (PUF M/M), and returns the Alice KEY to Bob PUF through Alice VPN. - send to Bob VPN inside QRNG TWIN MODULE 57;
Bob's main controller (MCU) inside Bob PUF-QRNG TWIN MODULE(57) uses Alice's public key received through Bob VPN to send the encrypted Alice PIN data stored in Bob PUF memory (PUF M/M) to Bob VPN. through Alice PUF-QRNG TWIN MODULE to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
The Bob main controller (MCU) inside the Bob PUF-QRNG TWIN MODULE (57) matches the Bob PIN data obtained by decrypting the Alice KEY encrypted with the Bob public key with the Bob private key and the Bob PIN data extracted from the Bob PUF Chip;
network login (LOG In) connection between the Alice master server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN MODULE and the Bob master server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN MODULE (57);
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through the Alice VPN, the Bob PUF-QRNG TWIN MODULE (57). ) to the internal Bob VPN;
Bob main controller (MCU) inside Bob PUF-QRNG TWIN MODULE 57 decrypts the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key to decrypt the quantum certificate (QC);
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE 57, the internal Bob main controller (MCU) transmits the quantum certificate (QC) received from the Alice master server (Alice MASTER SERVER) to the Bob debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) uses the I/O port when the quantum certificate (QC) received from Alice PUF-QRNG TWIN MODULE and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) do not match. A hybrid quantum communication system terminal including a street/security light terminal, characterized in that the OFF contact control blocks the network connection between the Alice master server and the Bob master server.
배전반(48) 내부에 AMI(47)는 상용전원을 공급받아 전력 사용량을 측정 및 LPWAN 통신모뎀을 통해 전력 사용량을 전송하는 AMI(47)이며;
배전반(48)은 내부에 AMI(47)를 거쳐 LED 가로/보안등(52)에 전력을 공급하며;
배전반(48) 내부에 방송장치(50)는 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 부터 방송데이터를 단말 SINGLE MODULE가 수신하여 방송하는 방송장치(50)이며;
배전반(48)은 비상벨(51) 작동시 비상벨 작동 이벤트를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE MODULE를 통해 전송하는 비상벨(51)이며;
배전반(48) 내부에 센서부(46)는 센서를 통해 측정되는 데이터를 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 단말 SINGLE MODULE를 통해 전송하는 센서부(46)이며;
배전반(48) 내부에 디머(53)는 감시카메라 영상분석부를 통해 사람 객체 검출 여/부에 따라 LED 가로/보안등(52)의 밝기를 조절하는 디머(53)이며;
QUANTUM 5G AP(49)는 감시카메라의 촬영 영상데이터를 수신하여 5G 무선네트워크망 기지국를 통해 Master QUANTUM SERVER(61) 또는 Alice 6G QUANTUM SERVER(62) 또는 Alice QUANTUM SERVER(63) 중 어느 하나로 전송하는 QUANTUM 5G AP(49)이며;
감시카메라는 UHD급 방범용 CCTV 감시카메라로 광학부, 구동부, 주제어부, 영상 보안처리부, 영상분석부, 네트워크 보안처리부, 입출력부로 구성되고,
광학부는 필터부(10), 필터구동모터(11), 줌렌즈(12), 줌모터(13), 가변초점렌즈(14), 포커스모터(15), 포커스렌즈(16)로 구성되며;
구동부는 모터구동드라이브(17), 구동부 메모리(18), 구동부 제어부(19), RS-485(20), 수동조작부(21), 리모트컨트롤부(22)로 구성되며;
주제어부는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI(Serial Peripheral Interface) Controller(32)로 구성되며;
영상 보안처리부는 촬상센서부(33), 5G QUANTUM JUMP ENGINE(34), Quantum Entanglement(36), Decoy Pulse(37)로 구성되며;
영상분석부는 영상분석모듈(38), 객체인식 모듈(39), 번호인식 모듈(40)로 구성되며;
네트워크 보안처리부는 DEBUGGER(41), QUANTUM BLOCK CHAIN(42), 1:N BLOCK CHAIN(43)으로 구성되며;
필터부(10)는 적외선 필터, 자외선 필터, 무반사코팅 필터 중 어느 하나 이상으로 구성되며;
필터구동모터(11)의 구동에 의해 상기 적외선 필터, 자외선 필터, 무반사코팅 필터 중 하나를 선택하며;
줌렌즈(12)를 구동하는 줌모터(13)를 구동하여 줌렌즈 배율을 가변하며;
가변초점렌즈(14) 및 포커스렌즈(16)를 구동하는 포커스모터(15)를 통해 포커스 촛점을 가변하며;
RS-485(20) 또는 수동조작부(21) 또는 리모트컨트롤부(22)로부터 입력되는 입력 데이터에 의해 프로그램되는 구동부 제어부(19)는 입력 데이터를 구동부 메모리(18) 및 모터구동드라이브(17)를 제어하여 상기 필터구동모터(11), 줌모터(13), 포커스모터(15)를 구동하여 광학신호를 수집하여 촬상센서부(33)로 전송하며;
촬상센서부(33) 내부 이미지센서는 광학신호를 전기신호로 변환한 영상데이터를 5G QUANTUM JUMP ENGINE(34) 및 영상분석모듈(38)로 전송하며;
영상분석모듈(38)은 영상데이터를 수신하여 객체인식 모듈(39)를 통해 객체를 추출한 객체 데이터 및 객체 데이터 중 차량의 경우 번호인식 모듈(40)를 통해 차량번호판를 텍스트화한 차량번호 데이터를 네트워크 보안처리부 QUANTUM BLOCK CHAIN(42)으로 전송하며;
QUANTUM BLOCK CHAIN(42)은 BLOCK CHAIN으로 연결된 1:N BLOCK CHAIN(43)으로부터 수신된 수배차량 차량번호 데이터와 비교하여 수배차량일 경우 수배차량 이벤트를 발생하며;
네트워크 보안처리부 DEBUGGER(41)는 주제어부 Boot-ROM(31)이 최초 부팅시 부팅오류를 검증하며;
센서부(46)로부터 수집되는 센싱 데이터, AMI(47)로부터 측정되는 측정 데이터, 하나 이상의 배전반(48)으로부터 수집되는 배전반 상태정보 데이터, 하나 이상의 방송장치(50)로부터 수집되는 음성/영상 데이터, LED 가로/보안등(52)로부터 수집되는 점/소등 데이터를 LPWAN 통신모뎀(66)이 수집하여 단말 SINGLE MODULE으로 전송하며;
단말 SINGLE MODULE는 측정 데이터, 센서 상태정보 데이터, 음성/영상 데이터, 점/소등 데이터를 Bob 6G QUANTUM SERVER(55)로 전송하며;및
Bob 6G QUANTUM SERVER(55)는 Alice 6G QUANTUM SERVER(62), Alice QUANTUM SERVER(63), Alice PUF-QRNG TWIN MODULE 중 어느 하나로부터 감시카메라 제어데이터 또는 방송장치 제어데이터 또는 디머 제어데이터를 수신하여 단말부 내부 단말 SINGLE MODULE로 전송하며;
단말 SINGLE MODULE은 Bob 6G QUANTUM SERVER(55)로부터 감시카메라 제어데이터를 수신하며;
LPWAN 통신모뎀(66)은 LPWAN 단말기와 데이터 통신을 하며;
주제어부 MCU(27)는 TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Boot-ROM(31), SPI Controller(32)를 제어하며;
System Memory(24)는 주제어부 MCU(27) 운영 OS 프로그램이 저장된 System Memory이며;
상기 MCU(27)는 Security CPU(26)를 제어하여 PUF Chip(28)의 하드웨어 핀에서 PIN(Personal Identification Number) 데이터를 추출하여 PUF-PIN Memory(25) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
상기 MCU(27)는 TRNG(23)를 제어하여 자연난수를 발생시켜 수신하여 Security CPU(26)로 전송하며;
Security CPU(26)는 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터를 난수 시드(Seed)로 고정길이 포맷함수로 포맷하여 개인키를 생성 후 상기 TRNG(23)를 통해 생성한 자연난수 시드(Seed)로 개인키와 베타적 논리합(EX-OR) 암호화 연산하여 공개키를 생성하여 Security OTP Memory(30) 및 Alice 6G QUANTUM SERVER(62)에 저장하며;
Bob 6G QUANTUM SERVER(55)는 non-QUANTUM CHANNEL(58)를 통해 Alice 6G QUANTUM SERVER(62)로 부터 공개키로 암호화된 PIN(Personal Identification Number) 데이터를 수신 후 입출력부를 통해 MCU(27)로 전송하며;
상기 MCU(27)는 개인키로 복호화하여 PUF-PIN Memory(25)에 저장된 PIN(Personal Identification Number) 데이터와 일치할 경우 Boot-ROM(31)을 부팅 및 SPI Controller(32)를 제어하여 감시카메라와 Alice 6G QUANTUM SERVER(62)와 로그인(LOG In) 네트워크망 연결하여 5G QUANTUM JUMP ENGINE(34)로부터 영상데이터를 수신하여 Alice 6G QUANTUM SERVER(62)로 전송하며;
Alice PUF-QRNG TWIN MODULE과 Bob PUF-QRNG TWIN MODULE은 양자통신 채널을 형성하지 않는 ISP(Internet Service Provider) 사업자 네트워크망에 연결되어,
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 시스템 버스(System Bus)로 연결된 Alice 부트롬(Boot-ROM)을 통해 부팅하고, Alice 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Alice 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Alice 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Alice 보안 CPU(Security CPU)를 통해 수신한 Alice 공개키를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 시스템 버스(System Bus)로 연결된 Bob 부트롬(Boot-ROM)을 통해 부팅하고, Bob 시스템 저장장치(System M/M)에 저장된 프로그램에 따라 Bob 직렬주변장치 인터페이스(SPI Controller)를 제어하여 Bob 입출력장치(I/O Port)를 통해 네트워크망 ON/OFF 제어하고, Bob 보안 CPU(Security CPU)를 통해 수신한 Bob 공개키를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice VPN을 통해 수신한 Bob 공개키로 Alice PUF 메모리(PUF M/M)에 저장된 Bob PIN 데이터를 암호화한 Alice KEY를 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Alice 공개키로 Bob PUF 메모리(PUF M/M)에 저장된 Alice PIN 데이터를 암호화한 Bob KEY를 Bob VPN을 통해 Alice PUF-QRNG TWIN MODULE 내부의 Alice VPN으로 전송하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 공개키로 암호화된 Bob KEY를 Alice 개인키로 복호화한 Alice PIN 데이터와 Alice PUF Chip에서 추출한 Alice PIN 데이터가 일치;및
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob 공개키로 암호화된 Alice KEY를 Bob 개인키로 복호화한 Bob PIN 데이터와 Bob PUF Chip에서 추출한 Bob PIN 데이터가 일치;하면
Alice PUF-QRNG TWIN MODULE에 연결된 Alice 마스터서버(Alice MASTER SERVER)와 Bob PUF-QRNG TWIN MODULE(57)에 연결된 Bob 마스터서버(Bob MASTER SERVER) 사이에 네트워크망 로그인(LOG In) 연결하며;
Alice PUF-QRNG TWIN MODULE 내부의 Alice 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 양자인증서(QC)를 수신하여 Bob 공개키로 암호화한 후 Alice VPN을 통해 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob VPN으로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Bob VPN을 통해 수신한 Bob 공개키로 암호화된 양자인증서(QC)를 Bob 개인키로 복호화하여 양자인증서(QC)를 복호화하며;
Bob 마스터서버(Bob MASTER SERVER)는 Bob 양자플랫폼(Quantum Platform)에 저장된 양자인증서(QC)를 Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob PUF-QRNG TWIN MODULE(57) 내부의 Bob 주제어부(MCU)는 Alice 마스터서버(Alice MASTER SERVER)로부터 수신한 양자인증서(QC)를 Bob 디버거(QC-DEBUGGER)로 전송하며;
Bob 디버거(QC-DEBUGGER)는 Alice PUF-QRNG TWIN MODULE로부터 전송받은 양자인증서(QC)와 상기 Bob 마스터서버(Bob MASTER SERVER)로부터 전송받은 양자인증서(QC)가 일치하지 않을 경우 I/O Port를 OFF 접점 제어하여 Alice 마스터서버와 Bob 마스터서버 사이에 네트워크망 연결을 차단하는 것을 특징으로 하는 배전반 단말부를 포함하는 하이브리드 양자통신 시스템 단말기.
The terminal switchboard 48 includes a sensor unit 46, an AMI 47, a QUANTUM 5G AP 49, a broadcasting device 50, an emergency bell 51, a dimmer 53, and a terminal SINGLE MODULE. ,
The AMI 47 inside the switchboard 48 is an AMI 47 that receives commercial power, measures the power usage, and transmits the power usage through the LPWAN communication modem;
The switchboard 48 supplies power to the LED street/security light 52 via the AMI 47 therein;
The broadcasting device 50 inside the switchboard 48 is a broadcasting device that the terminal SINGLE MODULE receives and broadcasts broadcasting data from any one of Master QUANTUM SERVER 61, Alice 6G QUANTUM SERVER 62, or Alice QUANTUM SERVER 63 (50);
When the emergency bell 51 operates, the switchboard 48 transmits an emergency bell operation event to either the Master QUANTUM SERVER 61 or Alice 6G QUANTUM SERVER 62 or Alice QUANTUM SERVER 63 through the terminal SINGLE MODULE. (51);
The sensor unit 46 inside the switchboard 48 transmits the data measured through the sensor to either the Master QUANTUM SERVER 61 or the Alice 6G QUANTUM SERVER 62 or the Alice QUANTUM SERVER 63 through the terminal SINGLE MODULE. a sensor unit 46;
The dimmer 53 inside the switchboard 48 is a dimmer 53 that adjusts the brightness of the LED street/security light 52 according to whether or not a human object is detected through the surveillance camera image analysis unit;
QUANTUM 5G AP (49) receives the video data captured by the surveillance camera and transmits it to either Master QUANTUM SERVER (61) or Alice 6G QUANTUM SERVER (62) or Alice QUANTUM SERVER (63) through a 5G wireless network base station. AP 49;
The surveillance camera is a UHD level crime prevention CCTV surveillance camera and consists of an optical unit, a driving unit, a main control unit, an image security processing unit, an image analysis unit, a network security processing unit, and an input/output unit
The optical unit includes a filter unit 10 , a filter driving motor 11 , a zoom lens 12 , a zoom motor 13 , a variable focus lens 14 , a focus motor 15 , and a focus lens 16 ;
The driving unit is composed of a motor driving drive 17 , a driving unit memory 18 , a driving unit control unit 19 , an RS-485 20 , a manual operation unit 21 , and a remote control unit 22 ;
The main control unit is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(Machine Control Unit)(27), PUF Chip(28), Security OTP Memory(30), It is composed of a Boot-ROM 31 and a Serial Peripheral Interface (SPI) Controller 32;
The image security processing unit is composed of an image sensor unit (33), 5G QUANTUM JUMP ENGINE (34), Quantum Entanglement (36), and Decoy Pulse (37);
The image analysis unit is composed of an image analysis module 38 , an object recognition module 39 , and a number recognition module 40 ;
The network security processing unit is composed of DEBUGGER (41), QUANTUM BLOCK CHAIN (42), and 1:N BLOCK CHAIN (43);
The filter unit 10 is composed of any one or more of an infrared filter, an ultraviolet filter, and an anti-reflective coating filter;
selecting one of the infrared filter, the ultraviolet filter, and the anti-reflection coating filter by driving the filter driving motor 11;
driving the zoom motor 13 for driving the zoom lens 12 to vary the zoom lens magnification;
a variable focus lens 14 and a focus motor 15 for driving the focus lens 16 to vary the focus focus;
The driving unit control unit 19 programmed by the input data input from RS-485 20 or the manual operation unit 21 or the remote control unit 22 transmits the input data to the driving unit memory 18 and the motor driving drive 17 . control to drive the filter driving motor 11 , the zoom motor 13 , and the focus motor 15 to collect optical signals and transmit them to the image pickup sensor unit 33 ;
The image sensor inside the image sensor unit 33 transmits the image data converted from the optical signal into an electric signal to the 5G QUANTUM JUMP ENGINE 34 and the image analysis module 38;
The image analysis module 38 receives the image data and extracts the object through the object recognition module 39. In the case of a vehicle, the vehicle license plate is converted into text through the number recognition module 40 among object data and object data. transmitted to the security processing unit QUANTUM BLOCK CHAIN (42);
QUANTUM BLOCK CHAIN 42 compares wanted vehicle license plate number data received from 1:N BLOCK CHAIN 43 connected to BLOCK CHAIN and generates a wanted vehicle event if it is a wanted vehicle;
The network security processing unit DEBUGGER 41 verifies a boot error when the main control unit Boot-ROM 31 first boots;
Sensing data collected from the sensor unit 46, measurement data measured from the AMI 47, switchboard status information data collected from one or more switchboards 48, audio/video data collected from one or more broadcasting devices 50, The LPWAN communication modem 66 collects the point/off data collected from the LED street/security light 52 and transmits it to the terminal SINGLE MODULE;
The terminal SINGLE MODULE transmits measurement data, sensor status information data, audio/video data, and on/off data to Bob 6G QUANTUM SERVER (55); and
Bob 6G QUANTUM SERVER (55) receives the surveillance camera control data or broadcasting device control data or dimmer control data from any one of Alice 6G QUANTUM SERVER (62), Alice QUANTUM SERVER (63), and Alice PUF-QRNG TWIN MODULE to the terminal transmitted to the secondary internal terminal SINGLE MODULE;
The terminal SINGLE MODULE receives surveillance camera control data from Bob 6G QUANTUM SERVER (55);
The LPWAN communication modem 66 performs data communication with the LPWAN terminal;
Main controller MCU(27) is TRNG(23), System Memory(24), PUF-PIN Memory(25), Security CPU(26), MCU(27), PUF Chip(28), Security OTP Memory(30), Controls the Boot-ROM 31 and the SPI Controller 32;
The System Memory 24 is a System Memory in which the main control unit MCU 27 operating OS program is stored;
The MCU 27 controls the Security CPU 26 to extract PIN (Personal Identification Number) data from the hardware pin of the PUF Chip 28 and stores it in the PUF-PIN Memory 25 and Alice 6G QUANTUM SERVER 62 and;
the MCU 27 controls the TRNG 23 to generate and receive a natural random number and transmit it to the Security CPU 26;
Security CPU 26 generates a private key by formatting PIN (Personal Identification Number) data stored in PUF-PIN Memory 25 with a fixed-length format function as a random number seed, and then generated through the TRNG 23. A public key is generated by performing an EX-OR encryption operation with the private key using a natural random number seed and stored in the Security OTP Memory 30 and Alice 6G QUANTUM SERVER 62;
Bob 6G QUANTUM SERVER (55) receives PIN (Personal Identification Number) data encrypted with the public key from Alice 6G QUANTUM SERVER (62) through the non-QUANTUM CHANNEL (58) and transmits it to the MCU 27 through the input/output unit. ;
When the MCU 27 decrypts the private key and matches the PIN (Personal Identification Number) data stored in the PUF-PIN Memory 25, it boots the Boot-ROM 31 and controls the SPI Controller 32 to communicate with the surveillance camera. Alice 6G QUANTUM SERVER 62 and the login (LOG In) network connection to receive video data from 5G QUANTUM JUMP ENGINE 34 and transmit it to Alice 6G QUANTUM SERVER 62;
Alice PUF-QRNG TWIN MODULE and Bob PUF-QRNG TWIN MODULE are connected to the ISP (Internet Service Provider) operator network that does not form a quantum communication channel,
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE boots through the Alice Boot-ROM connected to the Alice system bus, and accesses the program stored in the Alice system storage device (System M/M). Accordingly, by controlling the Alice serial peripheral interface (SPI Controller), the network network ON/OFF is controlled through the Alice input/output device (I/O Port), and the Alice public key received through the Alice security CPU (Security CPU) is transferred to Alice VPN. to Bob VPN inside Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE (57) Bob main controller (MCU) inside the Bob boot ROM (Boot-ROM) connected to the Bob system bus (System Bus), and to the Bob system storage (System M/M) According to the stored program, it controls the Bob serial peripheral interface (SPI Controller) to control the network ON/OFF through the Bob I/O device (I/O Port), and the Bob public key received through the Bob Security CPU (Security CPU) is Send to Alice VPN inside Alice PUF-QRNG TWIN MODULE via Bob VPN;
Alice PUF-QRNG TWIN MODULE The Alice main controller (MCU) inside the Alice VPN uses the Bob public key received through Alice VPN to encrypt the Bob PIN data stored in the Alice PUF memory (PUF M/M), and returns the Alice KEY to Bob PUF through Alice VPN. - send to Bob VPN inside QRNG TWIN MODULE 57;
Bob's main controller (MCU) inside Bob PUF-QRNG TWIN MODULE(57) uses Alice's public key received through Bob VPN to send the encrypted Alice PIN data stored in Bob PUF memory (PUF M/M) to Bob VPN. through Alice PUF-QRNG TWIN MODULE to Alice VPN inside;
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE matches the Alice PIN data obtained by decrypting the Bob KEY encrypted with the Alice public key with the Alice private key and the Alice PIN data extracted from the Alice PUF Chip; and
The Bob main controller (MCU) inside the Bob PUF-QRNG TWIN MODULE (57) matches the Bob PIN data obtained by decrypting the Alice KEY encrypted with the Bob public key with the Bob private key and the Bob PIN data extracted from the Bob PUF Chip;
network login (LOG In) connection between the Alice master server (Alice MASTER SERVER) connected to the Alice PUF-QRNG TWIN MODULE and the Bob master server (Bob MASTER SERVER) connected to the Bob PUF-QRNG TWIN MODULE (57);
The Alice main controller (MCU) inside the Alice PUF-QRNG TWIN MODULE receives the quantum certificate (QC) from the Alice master server (Alice MASTER SERVER), encrypts it with the Bob public key, and then through the Alice VPN, the Bob PUF-QRNG TWIN MODULE (57). ) to the internal Bob VPN;
Bob main controller (MCU) inside Bob PUF-QRNG TWIN MODULE 57 decrypts the quantum certificate (QC) encrypted with the Bob public key received through Bob VPN with the Bob private key to decrypt the quantum certificate (QC);
Bob MASTER SERVER transmits the quantum certificate (QC) stored in the Bob Quantum Platform to the Bob Debugger (QC-DEBUGGER) inside the Bob PUF-QRNG TWIN MODULE 57;
Bob PUF-QRNG TWIN MODULE 57, the internal Bob main controller (MCU) transmits the quantum certificate (QC) received from the Alice master server (Alice MASTER SERVER) to the Bob debugger (QC-DEBUGGER);
Bob Debugger (QC-DEBUGGER) uses the I/O port when the quantum certificate (QC) received from Alice PUF-QRNG TWIN MODULE and the quantum certificate (QC) received from the Bob master server (Bob MASTER SERVER) do not match. A hybrid quantum communication system terminal including a switchboard terminal, characterized in that the OFF contact control blocks the network connection between the Alice master server and the Bob master server.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 최초 양자난수를 생성하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하여 QUANTUM COLLABO 내부 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장하여 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이에 네트워크망 로그인(Log In) 후 영상데이터를 QUANTUM 대칭키로 암/복호화 데이터 통신하는 것으로,
(통합방범센터)
통합방범센터 내부에 Alice QUANTUM SERVER는 SK텔레콤 통신사업자 3G, 4G, 5G, LoRA 무선네트워크망 중 어느 하나를 통해 SK텔레콤 양자인증서버와 연결되며;
통합방범센터 내부에 망분리서버는 내부망메인보드와 외부망메인보드로 구성되어, 내부망메인보드는 Alice QUANTUM SERVER로 부터 영상데이터를 전송받아 외부망메인보드 한 방향으로 영상데이터만 전송되며;
(스쿨존 제어부)
폐쇄형 함체는 원격시건장치 및 문열림센서를 포함하여 구성되어, 폐쇄형 함체 도어 문열림센서 검지데이터는 Bob QUANTUM SERVER를 통해 Alice QUANTUM SERVER로 전송되고, Alice QUANTUM SERVER는 원격시건장치를 제어하여 원격으로 폐쇄형 함체를 개방하며;
폐쇄형 함체 내부에 Bob QUANTUM SERVER, CC인증 VPN, QUANTUM DUAL AP(Access Point)를 포함하여 구성되어,
Bob QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER와 연결되며;
(스쿨존 단말부)
단말부는 감시카메라(Closed Circuit Camera), 멀티통신모뎀, QUANTUM COLLABO로 구성되어,
감시카메라는 PUF-TRNG SoC(System on Chip) 또는 eFUSE-TRNG SoC(System on Chip) 중 어느 하나의 보안칩을 탑재한 감시카메라이며;
QUANTUM COLLABO는 감시카메라를 제어하며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결되며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망에 연결된 SK텔레콤 양자인증서버 인증을 통해 Alice QUANTUM SERVER와 연결되며;
(시스템 결합 - Log In)
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성되어,
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송하며;
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
eve-NFC Chip은 월간 정기점검 때 교체되는 물리적인 PUF(Physically Unclonable Function)의 하나로, NFC Writer를 통해서 Eve PIN 데이터를 입력 및 Eve PIN 데이터를 Alice QUANTUM SERVER에 저장하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하며;
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망에 연결된 SK텔레콤 양자인증서버 인증을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice 의사난수 시드(Seed)로 생성한 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터가 일치할 경우,
MCU는 SPI Controller를 통해 Boot-ROM을 부팅하여 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
(시스템 결합 - DATA 전송)
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송하지만,
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤사업자 3G 또는 4G 또는 5G 무선네트워크망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면,
non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하며;
(핵심 구성요소 시스템 결합 방법)
QUANTUM COLLABO 내부의 QUANTUM AC(Access Controller)는 Alice QUANTUM 공개키를 멀티통신모뎀은 SK텔레콤 통신사업자 3G 면허주파수 모뎀, 4G 면허주파수 모뎀, 5G 면허주파수 모뎀, LoRA 모뎀 중 어느 하나를 통해 무선네트워크망으로 Alice QUANTUM SERVER로 전송하며;및
QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC(Access Controller)와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 영상데이터를 암호화하여 전송하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하며;
(경찰 업무용 양자스마트폰 서비스)
SK텔레콤 양자인증서버로 부터 인증된 경찰 업무용 police-APP이 업로드된 양자스마트폰 내부에 탑재된 QRNG SoChip 양자난수생성기 및 외부에 NFC Tag 의사난수생성기로 구성되어,
NFC Tag 의사난수생성기는 NFC Writer를 통해서 OTP(One Time Password) 의사난수를 저장 및 동일한 OTP(One Time Password) 의사난수를 Alice QUANTUM SERVER에 저장하며;
Alice QUANTUM SERVER에 양자스마트폰이 외부망메인보드에 접속하면,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여, Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;및
상기 Alice QUANTUM 공개키를 양자스마트폰으로 전송하면, 양자스마트폰은 Alice QUANTUM 공개키로 상기 NFC Tag를 양자스마트폰 NFC칩에 태깅하여 생성된 OTP(One Time Password) 의사난수를 암호화하여 재전송하며;및
Alice QUANTUM SERVER는 QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 OTP(One Time Password) 의사난수를 복호화 후 저장된 OTP(One Time Password) 의사난수와 일치할 경우, 감시카메라 촬영 영상데이터를 망분리서버 내부망메인보드를 통해 외부망메인보드로 전송하며;및
양자스마트폰은 외부망메인보드에 접속하여 양자스마트폰 MAC Address를 ID로 상기 OTP(One Time Password) 의사난수를 One-Time Password로 로그인하여 상기 영상데이터를 수신하는 것을 특징으로 하는 하이브리드 양자통신 시스템 단말기.
Closed Circuit Camera, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), network separation server, quantum smartphone, NFC Tag, police-APP, SK Telecom’s telecommunication service provider LoRA wireless network, SK It consists of a telecom quantum authentication server,
Alice QUANTUM SERVER generates the first quantum random number through the Alice Quantum Random Number Generator (QRNG) inside, and generates the QUANTUM symmetric key of the symmetric cryptographic algorithm to create the QUANTUM COLLABO internal PUF-PIN Memory and Alice It is stored in QUANTUM SERVER and encrypted/decrypted data is communicated between QUANTUM COLLABO and Alice QUANTUM SERVER after logging in (Log In) and then encrypting/decrypting image data with QUANTUM symmetric key.
(Integrated Crime Prevention Center)
Alice QUANTUM SERVER inside the integrated crime prevention center is connected to the SK Telecom quantum authentication server through any one of SK Telecom's 3G, 4G, 5G, and LoRA wireless networks;
The network separation server inside the integrated crime prevention center is composed of an internal network main board and an external network main board. The internal network main board receives video data from Alice QUANTUM SERVER and transmits only the video data in one direction to the external network main board;
(School Zone Control)
The closed enclosure includes a remote locking device and a door open sensor, and the closed enclosure door open sensor detection data is transmitted to Alice QUANTUM SERVER through Bob QUANTUM SERVER, and Alice QUANTUM SERVER controls the remote locking device to remotely open the enclosed enclosure;
It consists of Bob QUANTUM SERVER, CC certified VPN, and QUANTUM DUAL AP (Access Point) inside a closed enclosure.
Bob QUANTUM SERVER is connected to Alice QUANTUM SERVER through one of the wired networks of non-QUANTUM CHANNEL through CC-certified VPN, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL through PUF-QRNG TWIN USB;
(School zone terminal)
The terminal part consists of a closed circuit camera, a multi-communication modem, and a QUANTUM COLLABO.
The surveillance camera is a surveillance camera equipped with either a PUF-TRNG SoC (System on Chip) or an eFUSE-TRNG SoC (System on Chip) security chip;
QUANTUM COLLABO controls surveillance cameras;
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency SK Telecom carrier LoRA wireless network network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC (Access Controller) and is connected to Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
QUANTUM COLLABO controls QUANTUM AC (Access Controller) and is connected to Alice QUANTUM SERVER through SK Telecom quantum authentication server authentication connected to the licensed frequency SK Telecom carrier LoRA wireless network through the licensed frequency modem among multi-communication modems;
(System Combine - Log In)
QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE,
Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, MCU (Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU;
Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. generate an asymmetric cryptographic algorithm Eve QUANTUM PRIVATE KEY;
The eve-NFC Chip is one of the Physically Unclonable Functions (PUFs) that are replaced during monthly periodic inspections. It inputs Eve PIN data through NFC Writer and stores Eve PIN data in Alice QUANTUM SERVER;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU performs beta-OR (EX-OR) encryption operation of the Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed. OTP (One Time Password) asymmetric cryptographic algorithm Eve QUANTUM generating a public key (PUBLIC KEY), storing the Eve QUANTUM public key in a Security One Time Password (OTP) memory, and transmitting the Eve QUANTUM public key to the QUANTUM Access Controller (QUANTUM AC);
QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the SK Telecom quantum authentication server authentication connected to the licensed frequency SK Telecom carrier LoRA wireless network through the licensed frequency modem among the multi-communication modems;
Alice QUANTUM SERVER is configured by including Alice Pseudo Random Number Generator (PRNG) and Alice Quantum Random Number Generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data with the Alice pseudo-random number seed generated through the Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and uses the Alice PIN data generated with Alice pseudo-random number seed as a random number seed. to generate the Alice QUANTUM private key; and
generating the Alice QUANTUM public key by performing an EX-OR encryption operation on the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the SK Telecom carrier LoRA wireless network network, and licenses the licensed frequency with the SK Telecom carrier LoRA wireless network or wired network network and unlicensed. retransmit to QUANTUM COLLABO over a closed-frequency radio network; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-NFC chip match,
MCU boots Boot-ROM through SPI Controller to control QUANTUM AC (Access Controller), and Bob QUANTUM through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems SERVER and network network login (Log In) connection;
(System Combine - DATA Transmission)
QUANTUM AC (Access Controller) transmits video data captured by surveillance camera encrypted with QUANTUM symmetric key through QUANTUM DUAL AP to Bob QUANTUM SERVER logged in to network network,
If communication with QUANTUM DUAL AP is not possible, it is transmitted to Alice QUANTUM SERVER through any one of the 3G, 4G, or 5G wireless networks of SK Telecom's licensed frequency network through licensed frequency modems among multi-communication modems;
When Bob QUANTUM SERVER receives surveillance camera video data encrypted with QUANTUM symmetric key from QUANTUM DUAL AP,
transmitted to Alice QUANTUM SERVER through any one of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired networks;
Alice QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key from at least one of the wired network and the wireless network, and decrypts it with the QUANTUM symmetric key;
(How to combine key component systems)
QUANTUM AC (Access Controller) inside QUANTUM COLLABO sends the Alice QUANTUM public key to the wireless network network through any one of SK Telecom’s telecom operator’s 3G licensed frequency modem, 4G licensed frequency modem, 5G licensed frequency modem, and LoRA modem. to Alice QUANTUM SERVER; and
It transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency that can be communicated.
QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency for data transmission according to the communication environment according to obstacles. Before data transmission, QUANTUM AC (Access Controller) and QUANTUM DUAL AP conducts Low Frequency and High Frequency PING tests, selects a frequency with a fast response speed, encrypts large-capacity image data with QUANTUM symmetric key and transmits them to enhance security, improves communication speed and reduces communication charges. Hybrid-QUANTUM CHANNEL One-Way- Features a Ring Network;
(Quantum smartphone service for police work)
It consists of a QRNG SoChip quantum random number generator mounted inside a quantum smartphone to which the police-APP for police work certified by SK Telecom quantum authentication server has been uploaded, and an NFC Tag pseudo random number generator on the outside.
NFC Tag pseudo random number generator stores OTP (One Time Password) pseudo random number through NFC Writer and stores the same OTP (One Time Password) pseudo random number in Alice QUANTUM SERVER;
When the quantum smartphone connects to the external network main board in Alice QUANTUM SERVER,
The Alice QUANTUM SERVER generates Alice PIN data with the Alice pseudo-random number seed generated through the Alice pseudo-random number generator, and generates the Alice QUANTUM private key with the Alice PIN data as the random number seed; And
Generates the Alice QUANTUM public key by performing an EX-OR encryption operation on the Alice QUANTUM private key with the quantum random number seed that generates the quantum random number from the Alice quantum random number generator; and
When the Alice QUANTUM public key is transmitted to the quantum smartphone, the quantum smartphone encrypts and retransmits the OTP (One Time Password) pseudo-random number generated by tagging the NFC Tag to the quantum smartphone NFC chip with the Alice QUANTUM public key; And
Alice QUANTUM SERVER decrypts the OTP (One Time Password) pseudo-random number encrypted with the Alice QUANTUM public key with the QUANTUM private key, and if it matches the stored OTP (One Time Password) pseudo-random number, the video data captured by the surveillance camera is transmitted to the through the board to the external network main board; and
Quantum smart phone connects to an external network main board and logs in the OTP (One Time Password) pseudo-random number as the quantum smart phone MAC Address as the ID as the One-Time Password to receive the image data. terminal.
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 최초 양자난수를 생성하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하여 QUANTUM COLLABO 내부 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장하여 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이에 네트워크망 로그인(Log In) 후 영상데이터를 QUANTUM 대칭키로 암/복호화 데이터 통신하는 것으로,
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO와 네트워크망 연결;및
Alice QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 자가 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결;및
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 QUANTUM COLLABO와 폐쇄형 무선자가망으로 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결되며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
(시스템 결합 - Log In)
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성되어,
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch로 구성되며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송하며;
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
eve-NFC Chip은 월간 정기점검 때 교체되는 물리적인 PUF(Physically Unclonable Function)의 하나로, NFC Writer를 통해서 Eve PIN 데이터를 입력 및 Eve PIN 데이터를 Alice QUANTUM SERVER에 저장하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하며;
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 자가 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터가 일치할 경우,
MCU는 SPI Controller를 통해 Network Switch를 ON접점 전환 및 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
(시스템 결합 - DATA 전송)
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송에 있어서,
QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC(Access Controller)와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 영상데이터를 암호화하여 전송하며;
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면,
non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 자가 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 자가 유선네트워크망과 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 하이브리드 양자통신 시스템 단말기.
Surveillance Camera (Closed Circuit Camera), QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), wireless network of telecommunication service providers, self-wired network, and closed wireless self-network.
Alice QUANTUM SERVER generates the first quantum random number through the Alice Quantum Random Number Generator (QRNG) inside, and generates the QUANTUM symmetric key of the symmetric cryptographic algorithm to create the QUANTUM COLLABO internal PUF-PIN Memory and Alice It is stored in QUANTUM SERVER and encrypted/decrypted data is communicated between QUANTUM COLLABO and Alice QUANTUM SERVER after logging in (Log In) and then encrypting/decrypting image data with QUANTUM symmetric key.
Alice QUANTUM SERVER connects to QUANTUM COLLABO through the wireless network network of the telecommunication service provider; and
Alice QUANTUM SERVER connects to Bob QUANTUM SERVER and Bob QUANTUM SERVER through any one of non-QUANTUM CHANNEL or BB84 QUANTUM CHANNEL or hybrid-QUANTUM CHANNEL via PUF-QRNG TWIN USB via CC-certified VPN's own wired network; and
Bob QUANTUM SERVER is connected to QUANTUM COLLABO through a QUANTUM DUAL AP (Access Point) through a closed wireless network;
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC (Access Controller) and is connected to Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency carrier wireless network;
(System Combine - Log In)
QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE,
Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, MCU (Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, and Network Switch;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU;
Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch;
System Memory is System Memory in which MCU operating OS program is stored;
The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. generate an asymmetric cryptographic algorithm Eve QUANTUM PRIVATE KEY;
The eve-NFC Chip is one of the Physically Unclonable Functions (PUFs) that are replaced during monthly periodic inspections. It inputs Eve PIN data through NFC Writer and stores Eve PIN data in Alice QUANTUM SERVER;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU performs beta-OR (EX-OR) encryption operation of the Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed. OTP (One Time Password) asymmetric cryptographic algorithm Eve QUANTUM generating a public key (PUBLIC KEY), storing the Eve QUANTUM public key in a Security One Time Password (OTP) memory, and transmitting the Eve QUANTUM public key to the QUANTUM Access Controller (QUANTUM AC);
QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency communication service provider;
Alice QUANTUM SERVER is configured by including Alice Pseudo Random Number Generator (PRNG) and Alice Quantum Random Number Generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data with the Alice pseudo-random number seed generated through the Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates the Alice QUANTUM private key with the Alice PIN data as the random number seed; And
generating the Alice QUANTUM public key by performing an EX-OR encryption operation on the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the telecommunication service provider, so that the licensed frequency carrier wireless network or self-wired network and unlicensed frequency closed radio retransmit over the network to QUANTUM COLLABO; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-NFC chip match,
MCU uses SPI Controller to switch ON contact and controls QUANTUM AC (Access Controller) to control the QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems. QUANTUM SERVER and network network login (Log In) connection;
(System Combine - DATA Transmission)
QUANTUM AC (Access Controller) transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER that is logged in to the network,
It transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency that can be communicated.
QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency for data transmission according to the communication environment according to obstacles. Before data transmission, QUANTUM AC (Access Controller) and QUANTUM DUAL AP conducts Low Frequency and High Frequency PING tests, selects a frequency with fast response speed, encrypts large-capacity image data with QUANTUM symmetric key, and transmits;
If communication with QUANTUM DUAL AP is impossible, it is transmitted to Alice QUANTUM SERVER through a licensed frequency communication operator wireless network through a licensed frequency modem among multi-communication modems;
When Bob QUANTUM SERVER receives surveillance camera video data encrypted with QUANTUM symmetric key from QUANTUM DUAL AP,
Any one of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL transmits to Alice QUANTUM SERVER through a wired network;
Alice QUANTUM SERVER is a hybrid that enhances security by receiving surveillance camera video data encrypted with QUANTUM symmetric key from any one or more of its own wired network and wireless network network of a telecommunication service provider and decrypting it with QUANTUM symmetric key to enhance security and reduce communication costs. - A hybrid quantum communication system terminal featuring the QUANTUM CHANNEL One-Way-Ring Network.
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO와 네트워크망 연결;및
Alice QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 자가 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 QUANTUM COLLABO와 자가 무선네트워크망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결되며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
(시스템 결합)
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성되어,
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch로 구성되며;
대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 Encrypt TLS MODULE 내부 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장하여 네트워크망 로그인(Log In) 후 영상데이터를 암/복호화 통신하며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송하며;
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
eve-NFC Chip은 월간 정기점검 때 교체되는 물리적인 PUF(Physically Unclonable Function)로, NFC Writer를 통해서 Eve PIN 데이터를 입력 및 Alice QUANTUM SERVER에 저장하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하며;
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 자가 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터가 일치할 경우,
MCU는 SPI Controller를 통해 Network Switch를 ON접점 전환 및 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송에 있어서,
QUANTUM AC(Access Controller)와 QUANTUM DUAL AP 사이의 통신방법은 QUANTUM COLLABO 내부의 QUANTUM AC(Access Controller)는 Alice QUANTUM 공개키를 멀티통신모뎀은 통신사업자 면허주파수 모뎀을 통해 통신사업자 무선네트워크망으로 Alice QUANTUM SERVER로 전송하며;및
QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC(Access Controller)와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 영상데이터를 암호화하여 전송하며;
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면,
non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 자가 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 자가 유선네트워크망과 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 하이브리드 양자통신 시스템 단말기.
Surveillance Camera (Closed Circuit Camera), QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), wireless network of telecommunication service providers, and self-wired/wireless network.
Alice QUANTUM SERVER connects to QUANTUM COLLABO through the wireless network network of the telecommunication service provider; and
Alice QUANTUM SERVER is networked with Bob QUANTUM SERVER through any one of non-QUANTUM CHANNEL through CC-certified VPN or hybrid-QUANTUM CHANNEL through PUF-QRNG TWIN USB through its own wired network;
Bob QUANTUM SERVER is connected to his own wireless network with QUANTUM COLLABO through QUANTUM DUAL AP (Access Point);
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC (Access Controller) and is connected to Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency carrier wireless network;
(System Combine)
QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE,
Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, MCU (Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, and Network Switch;
Storing the QUANTUM symmetric key of the symmetric cryptographic algorithm in the Encrypt TLS MODULE internal PUF-PIN Memory and Alice QUANTUM SERVER to encrypt/decrypt image data after logging in to the network network;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU;
Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch;
System Memory is System Memory in which MCU operating OS program is stored;
The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. generate an asymmetric cryptographic algorithm Eve QUANTUM PRIVATE KEY;
The eve-NFC Chip is a physical PUF (Physically Unclonable Function) that is replaced during monthly periodic inspection, and it stores Eve PIN data through NFC Writer and stores it in Alice QUANTUM SERVER;
Security CPU encrypts the Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed to generate OTP (One Time Password) asymmetric cryptographic algorithm Eve QUANTUM public key (PUBLIC KEY) and storing the Eve QUANTUM public key in the Security One Time Password (OTP) Memory and transmitting the Eve QUANTUM public key to the QUANTUM Access Controller (AC);
QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency communication service provider;
Alice QUANTUM SERVER is configured by including Alice Pseudo Random Number Generator (PRNG) and Alice Quantum Random Number Generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data from Alice pseudo-random number seed through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data; and
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the telecommunication service provider, so that the licensed frequency carrier wireless network or self-wired network and unlicensed frequency closed radio retransmit over the network to QUANTUM COLLABO; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-NFC chip match,
MCU uses SPI Controller to switch ON contact and controls QUANTUM AC (Access Controller) to control the QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems. QUANTUM SERVER and network network login (Log In) connection;
QUANTUM AC (Access Controller) transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER that is logged in to the network,
The communication method between QUANTUM AC (Access Controller) and QUANTUM DUAL AP is QUANTUM AC (Access Controller) inside QUANTUM COLLABO, Alice QUANTUM public key, Multi-communication modem, Alice QUANTUM through the operator’s license frequency modem to the operator’s wireless network to SERVER; and
It transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency that can be communicated.
QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency for data transmission according to the communication environment according to obstacles. Before data transmission, QUANTUM AC (Access Controller) and QUANTUM DUAL AP conducts Low Frequency and High Frequency PING tests, selects a frequency with fast response speed, encrypts large-capacity image data with QUANTUM symmetric key, and transmits;
If communication with QUANTUM DUAL AP is impossible, it is transmitted to Alice QUANTUM SERVER through a licensed frequency communication operator wireless network through a licensed frequency modem among multi-communication modems;
When Bob QUANTUM SERVER receives surveillance camera video data encrypted with QUANTUM symmetric key from QUANTUM DUAL AP,
Any one of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL transmits to Alice QUANTUM SERVER through a wired network;
Alice QUANTUM SERVER is a hybrid that enhances security by receiving surveillance camera video data encrypted with QUANTUM symmetric key from any one or more of its own wired network and wireless network network of a telecommunication service provider and decrypting it with QUANTUM symmetric key to enhance security and reduce communication costs. - A hybrid quantum communication system terminal featuring the QUANTUM CHANNEL One-Way-Ring Network.
Alice QUANTUM SERVER는 통신사업자 무선네트워크망과 연결;및
Alice QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기, Encrypt TLS MODULE을 포함하여 구성되어,
QUANTUM 대칭키를 Encrypt TLS MODULE 내부 및 Alice QUANTUM SERVER에 저장하여 네트워크망 로그인(Log In) 후 영상데이터를 암/복호화 통신하며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하며;
Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신(Near Field Communication)으로 Eve PIN 데이터가 수신되면 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하며;
NFC 카드는 월간 정기점검 때 교체되는 물리적인 PUF(Physically Unclonable Function)로, NFC Writer를 통해서 Eve PIN 데이터를 NFC 카드에 입력 후 Alice QUANTUM SERVER에 저장하며;
Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice 의사난수 시드(Seed)로 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송함에 있어서,
QUANTUM AC와 QUANTUM DUAL AP 사이의 통신방법은 QUANTUM COLLABO 내부의 QUANTUM AC는 Alice QUANTUM 공개키를 멀티통신모뎀은 통신사업자 면허주파수 모뎀을 통해 무선네트워크망으로 Alice QUANTUM SERVER로 전송하며;및
QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 영상데이터를 암호화하여 전송하며;
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면,
non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선네트워크망과 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 하이브리드 양자통신 시스템 단말기.
It consists of surveillance camera, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP, and wireless network of telecommunication service providers
Alice QUANTUM SERVER is connected to the wireless network network of the carrier; and
Alice QUANTUM SERVER is connected to Bob QUANTUM SERVER through any wired network of non-QUANTUM CHANNEL through CC-certified VPN or hybrid-QUANTUM CHANNEL through BB84 QUANTUM CHANNEL or PUF-QRNG TWIN USB;
QUANTUM COLLABO is to selectively select an unlicensed frequency closed wireless self-network network or a licensed frequency carrier wireless network network through QUANTUM AC in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC to connect with Bob QUANTUM SERVER through QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC to connect to Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency communication operator wireless network;
QUANTUM COLLABO consists of QUANTUM AC, Eve quantum random number generator, and Encrypt TLS MODULE,
The QUANTUM symmetric key is stored in the Encrypt TLS MODULE and in Alice QUANTUM SERVER to encrypt/decrypt video data after logging in to the network network;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE;
Encrypt TLS MODULE generates an asymmetric key encryption algorithm Eve QUANTUM private key by storing Eve PIN data as a random number seed after storing when Eve PIN data is received from an NFC card through contactless near field communication;
The NFC card is a physical PUF (Physically Unclonable Function) that is replaced at the time of monthly maintenance, and after inputting Eve PIN data into the NFC card through the NFC Writer, it is stored in Alice QUANTUM SERVER;
Encrypt TLS MODULE receives quantum random number from Eve quantum random number generator and encrypts the Eve QUANTUM private key with the quantum random number seed to generate OTP (One Time Password) asymmetric key encryption algorithm Eve QUANTUM public key and store it and Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data as an Alice pseudo-random number seed through the Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates the Alice QUANTUM private key by storing the Alice PIN data as a random number seed; and
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the telecommunication service provider, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed wireless self-network. retransmit to QUANTUM COLLABO via; and
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the internally stored Eve PIN data match,
QUANTUM COLLABO controls QUANTUM AC to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM DUAL AP, which is connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
QUANTUM AC transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER that is logged in to the network,
As for the communication method between QUANTUM AC and QUANTUM DUAL AP, QUANTUM AC inside QUANTUM COLLABO transmits Alice QUANTUM public key to Alice QUANTUM SERVER through the wireless network network through the telecommunication operator licensed frequency modem; and
It transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency that can be communicated.
QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency as the data transmission frequency according to the communication environment according to obstacles. Before data transmission, QUANTUM AC and QUANTUM DUAL AP have Low Frequency and a High Frequency PING test to select a frequency with a fast response speed and encrypt and transmit large-capacity image data with the QUANTUM symmetric key;
If communication with QUANTUM DUAL AP is impossible, it is transmitted to Alice QUANTUM SERVER through a licensed frequency communication operator wireless network through a licensed frequency modem among multi-communication modems;
When Bob QUANTUM SERVER receives surveillance camera video data encrypted with QUANTUM symmetric key from QUANTUM DUAL AP,
transmitted to Alice QUANTUM SERVER through any one of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired networks;
Alice QUANTUM SERVER receives video data from a surveillance camera encrypted with QUANTUM symmetric key from at least one of wired network and wireless network, and decrypts it with QUANTUM symmetric key to enhance security. Hybrid-QUANTUM CHANNEL improves communication speed and reduces communication charges Hybrid quantum communication system terminal featuring One-Way-Ring Network.
Alice QUANTUM SERVER는 통신사업자 무선네트워크망 및 자가 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, 내부에 QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 내부에 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기, Encrypt TLS MODULE을 포함하여 구성되어,
QUANTUM 대칭키를 Encrypt TLS MODULE 내부 및 Alice QUANTUM SERVER에 저장하여 네트워크망 로그인(Log In) 후 영상데이터를 암/복호화 통신하며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하며;
Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신으로 Eve PIN 데이터가 수신되면 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하며;
NFC 카드는 물리적인 PUF로, NFC Writer를 통해서 Eve PIN 데이터를 NFC 카드에 입력 후 Alice QUANTUM SERVER에 저장하며;
Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 자가 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 자가 유선네트워크망과 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 하이브리드 양자통신 시스템 단말기.
Security camera, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP, wireless network of telecommunication service providers, self-wired network, self-closing wireless self-network,
Alice QUANTUM SERVER is connected to Bob QUANTUM SERVER through a wireless network network of a telecommunication service provider and a self-wired network network;
QUANTUM COLLABO is to selectively select unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network through QUANTUM AC inside in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC inside and connects with Bob QUANTUM SERVER through QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC to connect to Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency communication operator wireless network;
QUANTUM COLLABO consists of QUANTUM AC, Eve quantum random number generator, and Encrypt TLS MODULE,
The QUANTUM symmetric key is stored in the Encrypt TLS MODULE and in Alice QUANTUM SERVER to encrypt/decrypt video data after logging in to the network network;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE;
Encrypt TLS MODULE generates Eve QUANTUM private key as a random number seed after storing Eve PIN data when receiving Eve PIN data from NFC card through contactless short-distance wireless communication;
The NFC card is a physical PUF, and after inputting Eve PIN data to the NFC card through the NFC Writer, it is stored in the Alice QUANTUM SERVER;
Encrypt TLS MODULE receives quantum random number from Eve quantum random number generator, encrypts the Eve QUANTUM private key with the quantum random number seed, generates Eve QUANTUM public key, stores it, and transmits Eve QUANTUM public key to QUANTUM AC and;
QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; And
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the telecommunication service provider, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed wireless self-network. retransmit to QUANTUM COLLABO via; and
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the internally stored Eve PIN data match,
QUANTUM COLLABO controls QUANTUM AC to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM DUAL AP, which is connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
Transmitting the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through a low frequency or high frequency unlicensed frequency modem that can communicate;
When Bob QUANTUM SERVER receives surveillance camera video data encrypted with QUANTUM symmetric key from QUANTUM DUAL AP, it transmits it to Alice QUANTUM SERVER through its own wired network;
Alice QUANTUM SERVER is a hybrid that enhances security by receiving surveillance camera video data encrypted with QUANTUM symmetric key from any one or more of its own wired network and wireless network network of a telecommunication service provider and decrypting it with QUANTUM symmetric key to enhance security and reduce communication costs. - A hybrid quantum communication system terminal featuring the QUANTUM CHANNEL One-Way-Ring Network.
단말부 QUANTUM COLLABO는 통신사업자 통신모뎀을 통해 통신사업자 무선망으로 Alice QUANTUM SERVER와 네트워크망 연결되며;및
QUANTUM COLLABO는 자가 무선망 통신모뎀을 통해 QUANTUM AP와 자가 무선망으로 연결 후 Bob QUANTUM SERVER를 통해 자가 유선망으로 연결된 Alice QUANTUM SERVER와 네트워크망 연결되는 것으로,
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 및 Eve QUANTUM 공개키를 통신사업자 통신모뎀으로 전송하며;
통신사업자 통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice PUF에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송하며;또는
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 자가 유선망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 QUANTUM AP를 통해 자가 무선망 통신모뎀으로 전송하면, 자가 무선망 통신모뎀을 통해 QUANTUM COLLABO가 수신하며;
QUANTUM COLLABO는 통신사업자 무선망 또는 자가 유선망 중 어느 하나로 부터 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 수신하여 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Network Switch을 ON점점 전환하여 Alice QUANTUM 공개키로 데이터를 암호화하여 자가 무선망 통신모뎀 및 통신사업자 통신모뎀으로 전송하며;
자가 무선망 통신모뎀은 Alice QUANTUM 공개키로 암호화한 데이터를 통신 가능한 QUANTUM AP로 전송하지만, QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 통신모뎀을 통해 통신사업자 무선망으로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하면, 자가 유선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 자가 유선망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO and a terminal unit including a wireless network communication modem and a communication service provider communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER;
The terminal unit QUANTUM COLLABO is connected to the Alice QUANTUM SERVER network through the telecommunication carrier communication modem through the telecommunication carrier wireless network; and
QUANTUM COLLABO is connected to the QUANTUM AP through its own wireless network through its own wireless network communication modem and then to the Alice QUANTUM SERVER connected to its own wired network through Bob QUANTUM SERVER.
QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF, Security OTP Memory, Network Switch, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls Security CPU to extract Eve PIN data from eve-PUF, store it in PUF-PIN Memory and Alice QUANTUM SERVER, and generate Eve QUANTUM private key with Eve PIN data as a random number seed;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
Security CPU generates Eve QUANTUM public key by encrypting Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed, stores Eve QUANTUM public key in Security OTP Memory, and communicates Eve QUANTUM public key transmitted to the operator communication modem;
The communication operator's communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the communication operator's wireless network;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice PUF inside,
Alice QUANTUM SERVER extracts Alice PIN data from Alice PUF, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; and
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network of the carrier and retransmits it to the QUANTUM COLLABO through the wireless network of the carrier; or
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and transmits it to the Bob QUANTUM SERVER through its own wired network. When it is transmitted through the wireless network communication modem, QUANTUM COLLABO receives it through its own wireless network communication modem;
QUANTUM COLLABO receives the Eve PIN data and Alice QUANTUM public key encrypted with the Eve QUANTUM public key from either the wireless network of the telecommunication service provider or the self-wired network, and decrypts the Alice QUANTUM public key and Eve PIN data by decrypting the Eve QUANTUM private key ;and
If the decrypted generated Eve PIN data matches the Eve PIN data extracted from eve-PUF,
MCU gradually turns the Network Switch ON through the SPI Controller, encrypts data with the Alice QUANTUM public key, and transmits it to its own wireless network communication modem and communication operator communication modem;
The self-wireless network communication modem transmits the data encrypted with the Alice QUANTUM public key to the communicable QUANTUM AP, but if communication with the QUANTUM AP is not possible, it transmits it to the telecommunication operator's wireless network through the communication operator's communication modem;
When Bob QUANTUM SERVER receives data encrypted with Alice QUANTUM public key from QUANTUM AP, it transmits it to Alice QUANTUM SERVER through its own wired network;
Alice QUANTUM SERVER is a heterogeneous network QUANTUM KEY distribution hybrid quantum communication closed network system using QUANTUM AP that receives data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from one or more of its own wired network and wireless network of a telecommunication service provider.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-PUF에서 Eve PIN 데이터를 추출하여 PUF-PIN Memory 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터로 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice PUF를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice PUF에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송하며;또는
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 자가 유선망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 QUANTUM AP를 통해 통신모뎀으로 전송하면, QUANTUM COLLABO가 통신모뎀을 통해 수신하며;
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF으로 부터 추출한 Eve PIN 데이터와 일치할 경우,
MCU는 SPI Controller를 제어하여 Network Switch을 통해 Alice QUANTUM 공개키로 데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, PUF-PIN Memory, Security CPU, MCU, eve-PUF, Security OTP Memory, Network Switch, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-PUF, Security OTP Memory, Network Switch, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls Security CPU to extract Eve PIN data from eve-PUF, store it in PUF-PIN Memory and Alice QUANTUM SERVER, and generate Eve QUANTUM private key with Eve PIN data;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
The Security CPU generates an Eve QUANTUM public key by encrypting the Eve QUANTUM private key stored in the PUF-PIN Memory with the quantum random number, stores the Eve QUANTUM public key in the Security OTP Memory, and transmits the Eve QUANTUM public key to the communication modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice PUF inside,
Alice QUANTUM SERVER extracts Alice PIN data from Alice PUF and stores it in QUANTUM COLLABO and generates Alice QUANTUM private key with Alice PIN data; and
encrypting the Alice QUANTUM private key with the quantum random number generated from the Alice quantum random number generator to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network of the carrier and retransmits it to the QUANTUM COLLABO through the wireless network of the carrier; or
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and transmits it to the Bob QUANTUM SERVER through its own wired network, and Bob QUANTUM SERVER communicates through the QUANTUM AP. Transmitting via modem, QUANTUM COLLABO receives via modem;
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted generated Eve PIN data matches the Eve PIN data extracted from eve-PUF,
The MCU controls the SPI Controller to encrypt data with the Alice QUANTUM public key through the Network Switch and transmits it to the communication modem;
The communication modem transmits the data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the wireless self-network QUANTUM AP, but if communication with the wireless self-network QUANTUM AP is impossible, it transmits it to the Alice QUANTUM SERVER through the wireless network of the carrier;
When Bob QUANTUM SERVER receives the data encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wire network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system using QUANTUM AP that receives data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from either the wired self-network or the wireless network of a telecommunication service provider.
QUANTUM COLLABO는 Eve 양자난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, NFC Memory, Security CPU, MCU, eve-NFC, Security OTP Memory, Network Switch, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, NFC Memory, Security CPU, eve-NFC, Security OTP Memory, Network Switch, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 eve-NFC에서 Eve NFC 데이터를 추출하여 NFC Memory 및 Alice QUANTUM SERVER에 저장 후 Eve NFC 데이터로 Eve QUANTUM 개인키를 생성하며;
MCU는 Eve 양자난수생성기로 부터 양자난수를 수신하여 Security CPU로 전송하며;
Security CPU는 NFC Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice NFC를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice NFC에서 Alice NFC 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice NFC 데이터로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 재전송하며;또는
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 유선자가망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 QUANTUM AP를 통해 통신모뎀으로 전송하면, QUANTUM COLLABO가 통신모뎀을 통해 수신하며;
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve NFC 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve NFC 데이터와 eve-NFC으로 부터 추출한 Eve NFC 데이터와 일치할 경우,
MCU는 SPI Controller를 통해 Network Switch을 통하여 Alice QUANTUM 공개키로 데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO consists of Eve quantum random number generator and QUANTUM JUMP ENGINE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, NFC Memory, Security CPU, MCU, eve-NFC, Security OTP Memory, Network Switch, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, NFC Memory, Security CPU, eve-NFC, Security OTP Memory, Network Switch, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU controls Security CPU to extract Eve NFC data from eve-NFC, store it in NFC Memory and Alice QUANTUM SERVER, and generate Eve QUANTUM private key with Eve NFC data;
MCU receives quantum random number from Eve quantum random number generator and sends it to Security CPU;
The Security CPU generates an Eve QUANTUM public key by encrypting the Eve QUANTUM private key stored in the NFC Memory with the quantum random number, stores the Eve QUANTUM public key in the Security OTP Memory, and transmits the Eve QUANTUM public key to the communication modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice NFC inside,
Alice QUANTUM SERVER extracts Alice NFC data from Alice NFC and stores it in QUANTUM COLLABO and generates Alice QUANTUM private key with Alice NFC data; and
encrypting the Alice QUANTUM private key with the quantum random number generated from the Alice quantum random number generator to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER encrypts the Eve NFC data and Alice QUANTUM public key stored therein with the Eve QUANTUM public key received through the wireless network of the carrier and retransmits it to the QUANTUM COLLABO through the wireless network of the carrier; or
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and transmits it to Bob QUANTUM SERVER through the wired self-network, and Bob QUANTUM SERVER uses the QUANTUM AP When transmitting through the communication modem, QUANTUM COLLABO receives it through the communication modem;
QUANTUM COLLABO internal MCU decrypts the Eve NFC data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve NFC data; and
When the decrypted generated Eve NFC data matches the Eve NFC data extracted from eve-NFC,
MCU transmits data to communication modem by encrypting data with Alice QUANTUM public key through Network Switch through SPI Controller;
The communication modem transmits the data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the wireless self-network QUANTUM AP, but if communication with the wireless self-network QUANTUM AP is impossible, it transmits it to the Alice QUANTUM SERVER through the wireless network of the carrier;
When Bob QUANTUM SERVER receives the data encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wire network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system using QUANTUM AP that receives data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key from either the wired self-network or the wireless network of a telecommunication service provider.
QUANTUM COLLABO 내부 eve-PUF에서 Eve PIN 데이터를 추출하여 내부 메모리에 저장 및 Alice QUANTUM SERVER에 저장 후 Eve PIN 데이터를 시드로 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO 내부 Eve 양자난수생성기를 통해 양자난수를 생성하여 상기 Eve QUANTUM 개인키를 양자난수로 암호화 연산하여 Eve QUANTUM 공개키를 생성 후 Eve QUANTUM 공개키를 내부 메모리에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice PUF에서 Alice PIN 데이터를 추출하여 QUANTUM COLLABO에 저장 후 Alice PIN 데이터를 시드로 Alice QUANTUM 개인키를 생성하며;
Alice QUANTUM SERVER는 내부 Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 상기 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 암호화 데이터를 유선자가망을 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 상기 암호화 데이터를 QUANTUM AP로 자가 무선망을 통해 통신모뎀으로 전송하면, QUANTUM COLLABO가 통신모뎀을 통해 수신하며;
QUANTUM COLLABO는 상기 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 암호화 데이터를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-PUF으로 부터 추출한 Eve PIN 데이터와 일치할 경우, QUANTUM COLLABO에서 생성한 단말 데이터를 Alice QUANTUM 공개키로 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 단말 데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 단말 데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망으로 부터 Alice QUANTUM 공개키로 암호화한 단말 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
Extracting Eve PIN data from QUANTUM COLLABO internal eve-PUF, storing it in internal memory and storing it in Alice QUANTUM SERVER, and generating Eve QUANTUM private key with Eve PIN data as seed;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random numbers, encrypts the Eve QUANTUM private key with a quantum random number to generate an Eve QUANTUM public key, stores the Eve QUANTUM public key in the internal memory, and transmits the Eve QUANTUM public key to the communication modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER extracts Alice PIN data from Alice PUF inside, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a seed;
Alice QUANTUM SERVER generates an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with a quantum random number generated from an internal Alice quantum random number generator;
Alice QUANTUM SERVER transmits the Eve PIN data stored inside the Eve QUANTUM public key and the encrypted data obtained by encrypting the Alice QUANTUM public key received through the wireless network of the telecommunication service provider to the Bob QUANTUM SERVER through the wired network;
Bob QUANTUM SERVER transmits the encrypted data to QUANTUM AP through its own wireless network to a communication modem, and QUANTUM COLLABO receives it through a communication modem;
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the encrypted data encrypted with the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; And
when the decrypted Eve PIN data and the Eve PIN data extracted from the eve-PUF match, the terminal data generated by QUANTUM COLLABO is encrypted with the Alice QUANTUM public key and transmitted to the communication modem;
The communication modem transmits the terminal data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER through the wireless self-network QUANTUM AP;
When Bob QUANTUM SERVER receives terminal data encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wired self-network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system using QUANTUM AP that receives terminal data encrypted with the Alice QUANTUM public key from the wired network and decrypts it with the Alice QUANTUM private key.
QUANTUM COLLABO 내부 eve-NFC에서 Eve NFC 데이터를 추출하여 Alice QUANTUM SERVER에 저장 및 Eve NFC 데이터를 시드로 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 상기 Eve QUANTUM 개인키를 양자난수를 시드로 암호화 연산하여 Eve QUANTUM 공개키를 생성하고, Eve QUANTUM 공개키를 내부 메모리에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice NFC에서 Alice NFC 데이터를 추출하여 QUANTUM COLLABO에 저장 및 Alice NFC 데이터를 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 내부 Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 유선자가망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 QUANTUM AP를 통해 통신모뎀으로 전송하면, QUANTUM COLLABO가 통신모뎀을 통해 수신하며;
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve NFC 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화 연산하여 Alice QUANTUM 공개키 및 Eve NFC 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve NFC 데이터와 eve-NFC으로 부터 추출한 Eve NFC 데이터와 일치할 경우,
Alice QUANTUM 공개키로 QUANTUM COLLABO 내부 데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 Alice QUANTUM 공개키로 암호화한 QUANTUM COLLABO 내부 데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 QUANTUM COLLABO 내부 데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망으로 부터 Alice QUANTUM 공개키로 암호화한 QUANTUM COLLABO 내부 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 QUANTUM AP를 이용한 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, communication modem, QUANTUM AP, Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
Extracting Eve NFC data from eve-NFC inside QUANTUM COLLABO, storing it in Alice QUANTUM SERVER, and generating Eve QUANTUM private key with Eve NFC data as seed;
QUANTUM COLLABO internal Eve quantum random number generator generates a quantum random number, encrypts the Eve QUANTUM private key with the quantum random number as a seed, generates the Eve QUANTUM public key, stores the Eve QUANTUM public key in the internal memory, and transmits it to the communication modem. ;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER extracts Alice NFC data from Alice NFC and stores it in QUANTUM COLLABO and generates Alice QUANTUM private key with Alice NFC data as seed; and
Alice QUANTUM SERVER generates the Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number generated from the internal Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data and Alice QUANTUM public key stored inside the Eve QUANTUM public key received through the wireless network of the telecommunication service provider and transmits it to Bob QUANTUM SERVER through the wired self-network, and Bob QUANTUM SERVER uses the QUANTUM AP When transmitting through the communication modem, QUANTUM COLLABO receives it through the communication modem;
QUANTUM COLLABO decrypts the Eve NFC data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve NFC data; and
When the decrypted generated Eve NFC data matches the Eve NFC data extracted from eve-NFC,
Encrypting QUANTUM COLLABO internal data with the Alice QUANTUM public key and transmitting it to the communication modem;
The communication modem transmits QUANTUM COLLABO internal data encrypted with the Alice QUANTUM public key to Bob QUANTUM SERVER through the wireless self-network QUANTUM AP;
When Bob QUANTUM SERVER receives QUANTUM COLLABO internal data encrypted with Alice QUANTUM public key from QUANTUM AP, it transmits it to Alice QUANTUM SERVER through its own wire network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system using QUANTUM AP that receives QUANTUM COLLABO internal data encrypted with the Alice QUANTUM public key from the wired network and decrypts it with the Alice QUANTUM private key.
Alice QUANTUM SERVER는 통신사업자 무선망 및 유/무선 자가망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, 비면허주파수 무선자가망 또는 면허주파수 통신사업자 무선망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 비면허주파수 모뎀을 통해 비면허주파수 무선자가망으로 연결된 QUANTUM AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM 대칭키를 QUANTUM COLLABO 및 Alice QUANTUM SERVER에 저장하여 네트워크망 로그인(Log In) 후 데이터를 암/복호화 통신하며;
QUANTUM COLLABO는 Eve 의사난수 생성기를 통해 생성한 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하며;
Eve 양자난수생성기를 통해 생성된 양자난수를 시드(Seed)로 상기 Eve QUANTUM 개인키를 암호화하여 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기 및 Alice 양자난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선망 또는 유/무선 자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키를 복호화 생성하며;및
QUANTUM AC는 QUANTUM AP를 통해 Alice QUANTUM 공개키로 암호화한 데이터를 Bob QUANTUM SERVER로 전송함에 있어서,
Alice QUANTUM 공개키로 암호화한 데이터를 통신 가능한 무선 자가망 비면허주파수 모뎀 채널을 통해 QUANTUM AP로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하면, 유선 자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선 자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM AP, wireless network of telecommunication service providers, and wired/wireless self-network.
Alice QUANTUM SERVER is networked with Bob QUANTUM SERVER through the wireless network of the telecommunication service provider and wired/wireless self-network;
QUANTUM COLLABO is to selectively select an unlicensed frequency radio self-network or a licensed radio operator's radio network in data transmission/reception,
QUANTUM COLLABO connects with Bob QUANTUM SERVER through QUANTUM AP connected to unlicensed frequency radio self-network through unlicensed frequency modem; or
QUANTUM COLLABO connects with Alice QUANTUM SERVER through licensed frequency carrier wireless network through licensed frequency modem;
storing the QUANTUM symmetric key in QUANTUM COLLABO and Alice QUANTUM SERVER to encrypt/decrypt data after logging in to the network network;
QUANTUM COLLABO generates the Eve QUANTUM private key with the random number seed generated by the Eve pseudo-random number generator;
Encrypting the Eve QUANTUM private key using the quantum random number generated through the Eve quantum random number generator as a seed to generate an Eve QUANTUM public key, storing and transmitting the Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator and Alice quantum random number generator inside,
Alice QUANTUM SERVER generates the Alice QUANTUM private key with the random number seed generated through the Alice pseudo-random number generator; and
Encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER encrypts the Alice QUANTUM public key with the Eve QUANTUM public key received through the carrier's wireless network and retransmits it to QUANTUM COLLABO through the licensed frequency carrier's wireless network or wired/wireless self-network; and
QUANTUM COLLABO decrypts the Alice QUANTUM public key encrypted with the Eve QUANTUM public key and decrypts the Alice QUANTUM public key with the Eve QUANTUM private key to generate and decrypts the Alice QUANTUM public key; and
QUANTUM AC transmits the data encrypted with the Alice QUANTUM public key to Bob QUANTUM SERVER through the QUANTUM AP,
transmitting the data encrypted with the Alice QUANTUM public key to the QUANTUM AP through a wireless private network unlicensed frequency modem channel that can communicate;
When Bob QUANTUM SERVER receives data encrypted with the Alice QUANTUM public key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through its own wired network;
Alice QUANTUM SERVER receives data encrypted with the Alice QUANTUM public key from one or more of the wired own network and the wireless network of a telecommunication service provider, and decrypts it with the Alice QUANTUM private key to enhance security. Hybrid-QUANTUM CHANNEL One improves communication speed and reduces communication charges -Heterogeneous network QUANTUM KEY distribution hybrid quantum communication closed network system featuring Way-Ring Network.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO와 네트워크망 연결;및
Alice QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
QUANTUM COLLABO는 QUANTUM DUAL AP(Access Point)를 통해 비면허주파수 폐쇄형 무선자가망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
(시스템 결합)
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성되어,
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch로 구성되며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송하며;
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
NFC Writer를 통해서 Eve PIN 데이터를 eve-NFC Chip에 입력 및 Alice QUANTUM SERVER에 저장하며;
MCU는 Eve 양자난수생성기로 부터 수신하여 Security CPU에 저장된 양자난수 시드(Seed)와 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하며;
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선자가망과 비면허주파수 폐쇄형 무선자가망 중 어느 하나를 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터가 일치할 경우,
MCU는 SPI Controller를 통해 Network Switch를 ON접점 전환 및 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
(시스템 결합 - Log In)
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 단말 SERVER가 생성하는 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송에 있어서,
QUANTUM 대칭키로 암호화한 상기 단말 SERVER가 생성하는 데이터를 비면허주파수 모뎀을 통해 통신 가능한 Low 주파수 채널 또는 High 주파수 채널 중 어느 하나로 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 전송 주파수를 Low Frequency 또는 High Frequency 중 하나를 선택하여 QUANTUM 대칭키로 단말 SERVER가 생성하는 데이터를 암호화하여 전송하며;
QUANTUM DUAL AP와 통신이 불가능할 경우에는 QUANTUM 대칭키로 단말 SERVER가 생성하는 데이터를 암호화하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 단말 SERVER가 생성하는 데이터를 수신하면,
non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 단말 SERVER가 생성하는 데이터를 수신하여 QUANTUM 대칭키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
Terminal SERVER, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), licensed frequency carrier wireless network network, unlicensed frequency closed wireless self-network, and wired self-network. The QUANTUM symmetric key of the symmetric cryptographic algorithm is generated by generating the first quantum random number through the Quantum Random Number Generator (QRNG) and stored in the QUANTUM COLLABO internal PUF-PIN Memory and Alice QUANTUM SERVER, It is to communicate data encryption/decryption data with QUANTUM symmetric key after network network login (Log In) between and Alice QUANTUM SERVER.
Alice QUANTUM SERVER connects QUANTUM COLLABO and QUANTUM COLLABO through the licensed frequency carrier wireless network network; and
Alice QUANTUM SERVER is networked with Bob QUANTUM SERVER through any one of non-QUANTUM CHANNEL via CC-certified VPN or hybrid-QUANTUM CHANNEL via PUF-QRNG TWIN USB via a wired own network;
QUANTUM COLLABO is networked with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) through a closed radio self-network of unlicensed frequency;
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency carrier wireless network;
(System Combine)
QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE,
Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, MCU (Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, and Network Switch;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU;
Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch;
System Memory is System Memory in which MCU operating OS program is stored;
The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. generate an asymmetric cryptographic algorithm Eve QUANTUM PRIVATE KEY;
Input Eve PIN data to eve-NFC Chip through NFC Writer and store it in Alice QUANTUM SERVER;
MCU receives from Eve quantum random number generator and performs beta OR (EX-OR) encryption operation on quantum random number seed stored in Security CPU and Eve QUANTUM private key stored in PUF-PIN memory to achieve OTP (One Time Password) asymmetry Asymmetric cryptographic algorithm Generates Eve QUANTUM public key (PUBLIC KEY), stores Eve QUANTUM public key in Security OTP (One Time Password) Memory, and transmits Eve QUANTUM public key to QUANTUM AC (Access Controller). ;
QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency communication service provider;
Alice QUANTUM SERVER is configured by including Alice Pseudo Random Number Generator (PRNG) and Alice Quantum Random Number Generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; And
generating the Alice QUANTUM public key by performing an EX-OR encryption operation on the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the licensed frequency carrier wireless network network, and the licensed frequency carrier wireless network or wired self-network and unlicensed frequency closed radio retransmit to QUANTUM COLLABO over any of its own networks; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from the eve-NFC chip match,
MCU uses SPI Controller to switch ON contact and controls QUANTUM AC (Access Controller) to control the QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems. QUANTUM SERVER and network network login (Log In) connection;
(System Combine - Log In)
QUANTUM AC (Access Controller) transmits the data generated by the terminal SERVER encrypted with the QUANTUM symmetric key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER logged in to the network,
By transmitting the data generated by the terminal SERVER encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through either a low frequency channel or a high frequency channel that can be communicated through an unlicensed frequency modem,
QUANTUM DUAL AP selects one of Low Frequency or High Frequency as a transmission frequency and encrypts data generated by the terminal server with the QUANTUM symmetric key and transmits;
When communication with the QUANTUM DUAL AP is impossible, data generated by the terminal SERVER is encrypted with the QUANTUM symmetric key and transmitted to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network of the licensed frequency carrier;
When Bob QUANTUM SERVER receives data generated by the terminal SERVER encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP,
transmitted to Alice QUANTUM SERVER through any one of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired self-network;
Alice QUANTUM SERVER receives the data generated by the terminal server encrypted with the QUANTUM symmetric key from one or more of the wired own network and the wireless network of the telecommunication service provider, and decrypts it with the QUANTUM symmetric key to enhance security. -QUANTUM CHANNEL Heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring One-Way-Ring Network.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 QUANTUM COLLABO와 연결;및
Alice QUANTUM SERVER는 non-QUANTUM CHANNEL 또는 QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 QUANTUM COLLABO와 비면허주파수 폐쇄형 무선자가망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성되어,
Encrypt TLS MODULE은 System Memory, PUF-PIN Memory, Security CPU, MCU(Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch로 구성되며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송하며;
Encrypt TLS MODULE 내부 MCU는 System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
NFC Writer를 통해서 eve-NFC에 Eve PIN 데이터를 입력 및 Alice QUANTUM SERVER에 저장하며;
Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하며;
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG; Pseudo Random Number Generator) 및 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 eve-NFC로 부터 추출한 Eve PIN 데이터가 일치할 경우,
MCU는 SPI Controller를 통해 Network Switch를 ON접점 전환 및 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송에 있어서,
Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 통신 가능한 Low 주파수 또는 High 주파수 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하며;
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하면,
non-QUANTUM CHANNEL 또는 QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선네트워크망과 면허주파수 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of a terminal device, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, and QUANTUM DUAL AP (Access Point),
Alice QUANTUM SERVER is connected to QUANTUM COLLABO through a wireless network of a licensed frequency carrier; and
Alice QUANTUM SERVER is networked with Bob QUANTUM SERVER through either a non-QUANTUM CHANNEL or a QUANTUM CHANNEL wired network;
Bob QUANTUM SERVER is connected to the QUANTUM COLLABO through the QUANTUM DUAL AP (Access Point) and the unlicensed frequency closed wireless self-network;
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency carrier wireless network;
QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE,
Encrypt TLS MODULE consists of System Memory, PUF-PIN Memory, Security CPU, MCU (Main Control Unit), eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, and Network Switch;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal Security CPU;
Encrypt TLS MODULE Internal MCU controls System Memory, PUF-PIN Memory, Security CPU, eve-NFC Chip, NFC Reader, Security OTP Memory, SPI Controller, Network Switch;
System Memory is System Memory in which MCU operating OS program is stored;
The MCU controls the Security CPU and the NFC Reader receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, stores it in the PUF-PIN memory, and then converts the Eve PIN data as a random number seed. generate an asymmetric cryptographic algorithm Eve QUANTUM PRIVATE KEY;
input Eve PIN data to eve-NFC through NFC Writer and store it in Alice QUANTUM SERVER;
Security CPU encrypts the Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed to generate OTP (One Time Password) asymmetric cryptographic algorithm Eve QUANTUM public key (PUBLIC KEY) and storing the Eve QUANTUM public key in the Security One Time Password (OTP) Memory and transmitting the Eve QUANTUM public key to the QUANTUM Access Controller (AC);
QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency communication service provider;
Alice QUANTUM SERVER is configured by including Alice Pseudo Random Number Generator (PRNG) and Alice Quantum Random Number Generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; And
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed radio retransmit to QUANTUM COLLABO over your own network; and
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the Eve PIN data extracted from eve-NFC match,
MCU uses SPI Controller to switch ON contact and controls QUANTUM AC (Access Controller) to control the QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems. QUANTUM SERVER and network network login (Log In) connection;
QUANTUM AC (Access Controller) transmits the terminal device generated data encrypted with the Alice QUANTUM public key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER that is logged in to the network network,
Transmitting the terminal device generated data encrypted with the Alice QUANTUM public key to the QUANTUM DUAL AP through a communicable low frequency or high frequency unlicensed frequency modem;
If communication with QUANTUM DUAL AP is impossible, it is transmitted to Alice QUANTUM SERVER through a licensed frequency communication operator wireless network through a licensed frequency modem among multi-communication modems;
When Bob QUANTUM SERVER receives terminal device generated data encrypted with Alice QUANTUM public key from QUANTUM DUAL AP,
transmitted to Alice QUANTUM SERVER through any one of the non-QUANTUM CHANNEL and QUANTUM CHANNEL wired networks;
Alice QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM public key from one or more of the wired network network and the wireless network network of a licensed frequency carrier, and decrypts it with the Alice QUANTUM private key to enhance security. Improve communication speed and reduce communication charges. A heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a hybrid-QUANTUM CHANNEL One-Way-Ring Network.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망과 연결;및
Alice QUANTUM SERVER는 non-QUANTUM CHANNEL 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP를 통해 QUANTUM COLLABO와 비면허주파수 폐쇄형 무선자가망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
NFC 카드에 NFC Writer를 통해서 Eve PIN 데이터를 입력 후 Alice QUANTUM SERVER에 저장하며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기, Encrypt TLS MODULE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하며;
Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신(Near Field Communication)으로 Eve PIN 데이터가 수신되면 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하며;
Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC는 QUANTUM DUAL AP를 통해 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송함에 있어서,
Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 어느 하나의 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하면,
non-QUANTUM CHANNEL 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of a terminal device, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, and QUANTUM DUAL AP,
Alice QUANTUM SERVER is connected to the licensed frequency carrier wireless network; and
Alice QUANTUM SERVER is networked with Bob QUANTUM SERVER through the non-QUANTUM CHANNEL wired network;
Bob QUANTUM SERVER is connected to the QUANTUM COLLABO through the QUANTUM DUAL AP through the unlicensed frequency closed radio self-network;
QUANTUM COLLABO is to selectively select an unlicensed frequency closed wireless self-network network or a licensed frequency carrier wireless network network through QUANTUM AC in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC to connect with Bob QUANTUM SERVER through QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC to connect to Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency communication operator wireless network;
After entering the Eve PIN data through the NFC Writer on the NFC card, it is stored in Alice QUANTUM SERVER;
QUANTUM COLLABO consists of QUANTUM AC, Eve quantum random number generator, and Encrypt TLS MODULE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE;
Encrypt TLS MODULE generates an asymmetric key encryption algorithm Eve QUANTUM private key by storing Eve PIN data as a random number seed after storing when Eve PIN data is received from an NFC card through contactless near field communication;
Encrypt TLS MODULE receives quantum random number from Eve quantum random number generator and encrypts the Eve QUANTUM private key with the quantum random number seed to generate OTP (One Time Password) asymmetric key encryption algorithm Eve QUANTUM public key and store it and Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; And
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed radio retransmit to QUANTUM COLLABO over your own network; and
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the internally stored Eve PIN data match,
QUANTUM COLLABO controls QUANTUM AC to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM DUAL AP, which is connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
QUANTUM AC transmits the terminal device generated data encrypted with the Alice QUANTUM public key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER that is logged in to the network network,
Transmitting the terminal device generated data encrypted with the Alice QUANTUM public key to the QUANTUM DUAL AP through a non-licensed frequency modem of either a communicable low frequency or a high frequency;
When Bob QUANTUM SERVER receives terminal device generated data encrypted with Alice QUANTUM public key from QUANTUM DUAL AP,
transmitted to Alice QUANTUM SERVER through the non-QUANTUM CHANNEL wired network;
Alice QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key to enhance security QUANTUM KEY Distributed Hybrid Quantum Communication Closed Network System.
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망과 연결;및
Alice QUANTUM SERVER는 non-QUANTUM CHANNEL 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
Bob QUANTUM SERVER는 QUANTUM AP를 통해 QUANTUM COLLABO와 비면허주파수 폐쇄형 무선자가망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기, Encrypt TLS MODULE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하며;
Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신(Near Field Communication)으로 Eve PIN 데이터가 수신되면 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하며;
NFC 카드에 NFC Writer를 통해서 Eve PIN 데이터를 입력 후 Alice QUANTUM SERVER에 저장하며;
Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC는 QUANTUM AP를 통해 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송함에 있어서,
Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 비면허주파수 모뎀을 통해 QUANTUM AP로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하면,
non-QUANTUM CHANNEL 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of a terminal device, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, and QUANTUM AP,
Alice QUANTUM SERVER is connected to the licensed frequency carrier wireless network; and
Alice QUANTUM SERVER is networked with Bob QUANTUM SERVER through the non-QUANTUM CHANNEL wired network;
Bob QUANTUM SERVER is connected to the QUANTUM COLLABO through the QUANTUM AP and the unlicensed frequency closed wireless network;
QUANTUM COLLABO is to selectively select an unlicensed frequency closed wireless self-network network or a licensed frequency carrier wireless network network through QUANTUM AC in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC and connects with Bob QUANTUM SERVER through QUANTUM AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC to connect to Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency communication operator wireless network;
QUANTUM COLLABO consists of QUANTUM AC, Eve quantum random number generator, and Encrypt TLS MODULE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE;
Encrypt TLS MODULE generates an asymmetric key encryption algorithm Eve QUANTUM private key by storing Eve PIN data as a random number seed after storing when Eve PIN data is received from an NFC card through contactless near field communication;
After entering the Eve PIN data through the NFC Writer on the NFC card, it is stored in Alice QUANTUM SERVER;
Encrypt TLS MODULE receives quantum random number from Eve quantum random number generator and encrypts the Eve QUANTUM private key with the quantum random number seed to generate OTP (One Time Password) asymmetric key encryption algorithm Eve QUANTUM public key and store it and Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; And
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed radio retransmit to QUANTUM COLLABO over your own network; and
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the internally stored Eve PIN data match,
QUANTUM COLLABO controls QUANTUM AC to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
QUANTUM AC transmits the terminal device generated data encrypted with the Alice QUANTUM public key through the QUANTUM AP to the Bob QUANTUM SERVER that is logged in to the network network,
transmitting the terminal device generated data encrypted with the Alice QUANTUM public key to the QUANTUM AP through the unlicensed frequency modem;
When Bob QUANTUM SERVER receives terminal device generated data encrypted with Alice QUANTUM public key from QUANTUM AP,
transmitted to Alice QUANTUM SERVER through the non-QUANTUM CHANNEL wired network;
Alice QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key to enhance security QUANTUM KEY Distributed Hybrid Quantum Communication Closed Network System.
Alice QUANTUM SERVER는 통신사업자 무선네트워크망 및 자가 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결되며;
Bob QUANTUM SERVER는 QUANTUM AP를 통해 QUANTUM COLLABO와 비면허주파수 폐쇄형 무선자가망 연결되며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, 내부에 QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 내부에 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기, Encrypt TLS MODULE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하며;
Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신으로 Eve PIN 데이터를 수신하여 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성 및 Eve PIN 데이터를 Alice QUANTUM SERVER에 저장하며;
Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 자가 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하며;및
상기 복호화 생성된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 통신 가능한 비면허주파수 모뎀을 통해 QUANTUM AP로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하면, 자가 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 자가 유선네트워크망과 비면허주파수 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 개인키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of a terminal device, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, and QUANTUM AP,
Alice QUANTUM SERVER is connected to Bob QUANTUM SERVER through a wireless network network of a telecommunication service provider and a self-wired network network;
Bob QUANTUM SERVER is connected to the QUANTUM COLLABO through the QUANTUM AP and the unlicensed frequency closed wireless network;
QUANTUM COLLABO is to selectively select unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network through QUANTUM AC inside in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC inside and connects with Bob QUANTUM SERVER through QUANTUM AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC to connect to Alice QUANTUM SERVER through licensed frequency modem among multi-communication modems through licensed frequency communication operator wireless network;
QUANTUM COLLABO consists of QUANTUM AC, Eve quantum random number generator, and Encrypt TLS MODULE,
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE;
Encrypt TLS MODULE receives and stores Eve PIN data through contactless short-range wireless communication from NFC card, generates Eve QUANTUM private key with Eve PIN data as a random number seed, and stores Eve PIN data in Alice QUANTUM SERVER;
Encrypt TLS MODULE receives quantum random number from Eve quantum random number generator, encrypts the Eve QUANTUM private key with the quantum random number seed, generates Eve QUANTUM public key, stores it, and transmits Eve QUANTUM public key to QUANTUM AC and;
QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside,
Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key with Alice PIN data as a random number seed; And
generating an Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the telecommunication service provider, so that the licensed frequency carrier wireless network or self-wired network and unlicensed frequency closed radio retransmit over the network to QUANTUM COLLABO; and
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data; and
If the decrypted Eve PIN data and the internally stored Eve PIN data match,
QUANTUM COLLABO controls QUANTUM AC to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems;
transmitting the terminal device generated data encrypted with the Alice QUANTUM public key to the QUANTUM AP through a communicable unlicensed frequency modem;
When Bob QUANTUM SERVER receives terminal device generated data encrypted with Alice QUANTUM public key from QUANTUM AP, it transmits it to Alice QUANTUM SERVER through its own wired network;
Alice QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM private key from one or more of its own wired network and the wireless network of an unlicensed frequency carrier, and decrypts it with the Alice QUANTUM private key to enhance security. Heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a hybrid-QUANTUM CHANNEL One-Way-Ring Network that saves money.
QUANTUM COLLABO는 비면허주파수 모뎀을 통해 비면허주파수 무선자가망으로 연결된 QUANTUM AP를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선망을 통해 Alice QUANTUM SERVER와 연결하며;
QUANTUM COLLABO는 내부 Eve 의사난수 생성기를 통해 생성한 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO는 내부 Eve 양자난수생성기를 통해 생성된 양자난수를 시드(Seed)로 상기 Eve QUANTUM 개인키를 암호화하여 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기 및 Alice 양자난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 생성한 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하며;및
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선망을 통해 수신한 Eve QUANTUM 공개키로 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선망 또는 자가 유선네트워크망과 비면허주파수 무선자가망을 통해 QUANTUM COLLABO로 재전송하며;및
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키를 복호화 생성하며;및
QUANTUM AC는 QUANTUM AP를 통해 Alice QUANTUM 공개키로 암호화한 데이터를 Bob QUANTUM SERVER로 전송함에 있어서,
Alice QUANTUM 공개키로 암호화한 데이터를 통신 가능한 비면허주파수 모뎀 채널을 통해 QUANTUM AP로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하면, 자가 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 자가 유선네트워크망으로 부터 Alice QUANTUM 공개키로 암호화한 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL One-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
QUANTUM COLLABO is to selectively select an unlicensed frequency radio self-network or a licensed radio operator's radio network in data transmission/reception,
QUANTUM COLLABO connects with Bob QUANTUM SERVER through QUANTUM AP connected to unlicensed frequency radio self-network through unlicensed frequency modem; or
QUANTUM COLLABO connects with Alice QUANTUM SERVER through licensed frequency carrier wireless network through licensed frequency modem;
QUANTUM COLLABO generates an Eve QUANTUM private key with a random number seed generated through an internal Eve pseudo-random number generator;
QUANTUM COLLABO encrypts the Eve QUANTUM private key with the quantum random number generated through the internal Eve quantum random number generator as a seed, generates the Eve QUANTUM public key, stores it, and transmits the Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the wireless network of the licensed frequency carrier;
Alice QUANTUM SERVER is composed of Alice pseudo random number generator and Alice quantum random number generator inside,
Alice QUANTUM SERVER generates the Alice QUANTUM private key with the random number seed generated through the Alice pseudo-random number generator; and
Encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER encrypts the Alice QUANTUM public key with the Eve QUANTUM public key received through the licensed frequency carrier wireless network, and retransmits it to QUANTUM COLLABO through the licensed frequency carrier wireless network or its own wired network and unlicensed frequency wireless own network; and
QUANTUM COLLABO decrypts the Alice QUANTUM public key encrypted with the Eve QUANTUM public key and decrypts the Alice QUANTUM public key with the Eve QUANTUM private key to generate and decrypts the Alice QUANTUM public key; and
QUANTUM AC transmits the data encrypted with the Alice QUANTUM public key to Bob QUANTUM SERVER through the QUANTUM AP,
Transmitting data encrypted with the Alice QUANTUM public key to the QUANTUM AP through a communicable unlicensed frequency modem channel;
When Bob QUANTUM SERVER receives data encrypted with Alice QUANTUM public key from QUANTUM AP, it transmits it to Alice QUANTUM SERVER through its own wired network;
Alice QUANTUM SERVER receives data encrypted with the Alice QUANTUM public key from its own wired network and decrypts it with the Alice QUANTUM private key to enhance security. It features a hybrid-QUANTUM CHANNEL One-Way-Ring Network that improves communication speed and reduces communication costs. Heterogeneous Network QUANTUM KEY Distribution Hybrid Quantum Communication Closed Network System.
QUANTUM COLLABO는 Eve 양자난수생성기 및 Eve 의사난수생성기 및 QUANTUM JUMP ENGINE을 포함하여 구성되어,
QUANTUM COLLABO 내부 Eve 양자난수생성기는 Eve 양자난수를 생성하여 QUANTUM JUMP ENGINE 내부 Security CPU로 전송하며;
QUANTUM JUMP ENGINE은 System Memory, MCU, Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
QUANTUM JUMP ENGINE 내부 MCU는 System Memory, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Eve 양자난수생성기로 부터 Eve 양자난수를 수신하여 Security OTP Memory에 저장 및 Eve 양자난수를 시드(Seed)로 Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
MCU는 Eve 의사난수생성기로 부터 Eve 의사난수를 수신하여 Security OTP Memory에 저장 및 Eve 의사난수를 시드(Seed)로 Eve QUANTUM 개인키(PRIVATE KEY)와 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 베타적 논리합(EX-OR) 암호화 연산하여 Eve QUANTUM 공개키(PUBLIC KEY)를 생성하며;
MCU는 Eve QUANTUM 공개키를 Security OTP Memory에 저장 후 통신모뎀으로 전송하며;
통신모뎀은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기 및 Alice 의사난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 Alice 양자난수를 수신하여 Alice 양자난수를 시드(Seed)로 Alice QUANTUM 개인키(PRIVATE KEY)를 생성하여 내부 메모리에 저장하며;
Alice QUANTUM SERVER는 Alice 의사난수생성기로 부터 Alice 의사난수를 수신하여 내부 메모리에 저장 및 Alice 의사난수를 시드(Seed)로 Alice QUANTUM 개인키(PRIVATE KEY)와 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키(PUBLIC KEY)를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 통신사업자 무선망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 Eve 양자난수를 암호화하여 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 Alice 양자난수를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 Alice 양자난수를 복호화 후 Security OTP Memory에 저장된 Eve 양자난수와 베타적 논리합(EX-OR) 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 Eve 양자난수를 복호화 후 내부 메모리에 저장된 Alice 양자난수와 베타적 논리합(EX-OR) 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보(ID/Password)를 QUANTUM 대칭키로 암호화 전송하면, QUANTUM COLLABO는 QUANTUM 대칭키로 복호화하여 사용자 Log 정보(ID/Password)로 일치할 경우, SPI Controller를 통해 Boot-ROM을 부팅하여 QUANTUM 대칭키로 감시카메라 촬영 영상데이터를 암호화하여 통신모뎀으로 전송하며;
통신모뎀은 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, surveillance camera, communication modem, QUANTUM AP (Access Point), Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO consists of Eve quantum random number generator and Eve pseudo random number generator and QUANTUM JUMP ENGINE.
QUANTUM COLLABO internal Eve quantum random number generator generates Eve quantum random number and sends it to QUANTUM JUMP ENGINE internal Security CPU;
QUANTUM JUMP ENGINE consists of System Memory, MCU, Security OTP Memory, Boot-ROM, and SPI Controller;
QUANTUM JUMP ENGINE internal MCU controls System Memory, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU receives Eve quantum random number from Eve quantum random number generator and stores it in Security OTP Memory and generates Eve QUANTUM private key (PRIVATE KEY) with Eve quantum random number as a seed;
MCU receives Eve pseudo-random number from Eve pseudo-random number generator, stores it in Security OTP Memory, and uses Eve pseudo-random number as a seed. Eve QUANTUM private key (PRIVATE KEY) and asymmetric cryptographic algorithm beta OR (EX-OR) cryptographic operation to generate an Eve QUANTUM public key (PUBLIC KEY);
MCU stores Eve QUANTUM public key in Security OTP Memory and transmits it to communication modem;
The communication modem transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the wireless network of the carrier;
Alice QUANTUM SERVER is composed of Alice quantum random number generator and Alice pseudo random number generator inside,
Alice QUANTUM SERVER receives Alice quantum random number from Alice quantum random number generator, generates Alice QUANTUM private key (PRIVATE KEY) with Alice quantum random number as a seed and stores it in internal memory;
Alice QUANTUM SERVER receives Alice pseudo-random number from Alice pseudo-random number generator, stores it in internal memory, and uses Alice pseudo-random number as a seed Alice QUANTUM private key (PRIVATE KEY) and asymmetric cryptographic algorithm Exclusive generating an Alice QUANTUM public key (PUBLIC KEY) by performing an EX-OR cryptographic operation;
Alice QUANTUM SERVER transmits the Alice QUANTUM public key to QUANTUM COLLABO through the wireless network of the carrier;
QUANTUM COLLABO encrypts Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the wireless network of the telecommunication service provider;
Alice QUANTUM SERVER encrypts Alice quantum random number with the Eve QUANTUM public key and transmits it to QUANTUM COLLABO through the wireless network of the telecommunication service provider;
QUANTUM COLLABO decrypts Alice quantum random number encrypted with Eve QUANTUM public key with Eve QUANTUM private key and performs beta-OR (EX-OR) encryption operation with Eve quantum random number stored in Security OTP Memory. generate a key;
Alice QUANTUM SERVER decrypts the Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, and then performs an EX-OR encryption operation with the Alice quantum random number stored in the internal memory to perform QUANTUM symmetry of the symmetric cryptographic algorithm. generate a key;
Alice QUANTUM SERVER encrypts QUANTUM COLLABO's log information (ID/Password) with the QUANTUM symmetric key, and QUANTUM COLLABO decrypts it with the QUANTUM symmetric key. booting, encrypting the video data captured by the surveillance camera with the QUANTUM symmetric key and transmitting it to the communication modem;
The communication modem transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the Bob QUANTUM SERVER through the QUANTUM AP in the wireless self-network network. and;
When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the QUANTUM symmetric key from the QUANTUM AP, it transmits it to the Alice QUANTUM SERVER through the wire network;
Alice QUANTUM SERVER is a heterogeneous network featuring a Two-Way-Ring Network that receives video data captured by a surveillance camera encrypted with a QUANTUM symmetric key and decrypts it with a QUANTUM symmetric key from any one or more of a wired self-network and a wireless network of a telecommunication service provider. Distributed Hybrid Quantum Communication Closed Network System.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 basic-Eve 양자난수를 생성하여 내부 메모리에 저장 및 basic-Eve 양자난수를 시드(Seed)로 Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;및
QUANTUM COLLABO는 Eve 양자난수생성기로 새로운 new-Eve 양자난수를 생성하여 시드(Seed)로 Eve QUANTUM 개인키(PRIVATE KEY)와 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 베타적 논리합(EX-OR) 암호화 연산하여 Eve QUANTUM 공개키(PUBLIC KEY)를 생성하며;
DUAL MODEM은 Eve QUANTUM 공개키를 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 부터 basic-Alice 양자난수를 수신하여 내부 메모리에 저장 및 basic-Alice 양자난수를 시드(Seed)로 Alice QUANTUM 개인키(PRIVATE KEY)를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 새로운 new-Alice 양자 난수를 생성하여 시드(Seed)로 Alice QUANTUM 개인키(PRIVATE KEY)와 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키(PUBLIC KEY)를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 통신사업자 무선망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 basic-Eve 양자난수를 암호화하여 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 basic-Alice 양자난수를 암호화하여 통신사업자 무선망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 basic-Alice 양자난수를 복호화 후 내부 메모리에 저장된 basic-Eve 양자난수와 베타적 논리합(EX-OR) 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 basic-Eve 양자난수를 복호화 후 내부 메모리에 저장된 basic-Alice 양자난수와 베타적 논리합(EX-OR) 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하며;
QUANTUM COLLABO는 QUANTUM 대칭키로 감시카메라 촬영 영상데이터를 암호화하여 DUAL MODEM으로 전송하며;
DUAL MODEM은 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하지만, 무선자가망 QUANTUM AP와 통신이 불가능할 경우에는 통신사업자 무선망을 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 통신사업자 무선망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, surveillance camera, DUAL MODEM, QUANTUM DUAL AP(Access Point), Alice QUANTUM SERVER, Bob QUANTUM SERVER,
QUANTUM COLLABO is composed of Eve quantum random number generator, generates basic-Eve quantum random number with Eve quantum random number generator, stores it in internal memory, and uses basic-Eve quantum random number as seed Eve QUANTUM private key (PRIVATE KEY) generate; and
QUANTUM COLLABO is an Eve quantum random number generator that generates a new new-Eve quantum random number, and as a seed, Eve QUANTUM private key (PRIVATE KEY) and asymmetric cryptographic algorithm beta-OR (EX-OR) encryption operation to generate an Eve QUANTUM public key (PUBLIC KEY);
DUAL MODEM transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the carrier's wireless network;
Alice QUANTUM SERVER is configured including Alice quantum random number generator, receives basic-Alice quantum random number from Alice quantum random number generator, stores it in internal memory, and uses basic-Alice quantum random number as a seed Alice QUANTUM private key (PRIVATE) KEY); and
Alice QUANTUM SERVER generates a new new-Alice quantum random number from Alice quantum random number generator, and as a seed, Alice QUANTUM private key (PRIVATE KEY) and asymmetric cryptographic algorithm beta OR (EX-OR) generate an Alice QUANTUM public key (PUBLIC KEY) by cryptographic operation;
Alice QUANTUM SERVER transmits the Alice QUANTUM public key to QUANTUM COLLABO through the wireless network of the carrier;
QUANTUM COLLABO encrypts basic-Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the wireless network of the telecommunication service provider;
Alice QUANTUM SERVER encrypts the basic-Alice quantum random number with the Eve QUANTUM public key and transmits it to the QUANTUM COLLABO through the wireless network of the carrier;
QUANTUM COLLABO decrypts the basic-Alice quantum random number encrypted with the Eve QUANTUM private key with the Eve QUANTUM private key and then performs an EX-OR encryption operation with the basic-Eve quantum random number stored in the internal memory to create a symmetric cryptographic algorithm. generate a QUANTUM symmetric key of ;
Alice QUANTUM SERVER decrypts the basic-Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, then performs an EX-OR encryption operation with the basic-Alice quantum random number stored in the internal memory to perform a symmetric cryptographic algorithm. ) to generate a QUANTUM symmetric key;
QUANTUM COLLABO encrypts video data captured by surveillance camera with QUANTUM symmetric key and transmits it to DUAL MODEM;
DUAL MODEM transmits surveillance camera video data encrypted with QUANTUM symmetric key to Bob QUANTUM SERVER through QUANTUM AP in wireless self-network, but if communication with QUANTUM AP is not possible, it is transmitted to Alice QUANTUM SERVER through wireless network and;
When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it transmits it to Alice QUANTUM SERVER through the wired network;
Alice QUANTUM SERVER is a heterogeneous network featuring a Two-Way-Ring Network that receives video data captured by a surveillance camera encrypted with a QUANTUM symmetric key and decrypts it with a QUANTUM symmetric key from any one or more of a wired self-network and a wireless network of a telecommunication service provider. Distributed Hybrid Quantum Communication Closed Network System.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 basic-Eve 양자난수를 생성하여 내부 메모리에 저장 및 basic-Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성하며;및
QUANTUM COLLABO는 Eve 양자난수생성기로 새로운 new-Eve 양자난수를 생성하여 시드로 Eve QUANTUM 개인키와 암호화 연산하여 Eve QUANTUM 공개키를 생성하며;
DUAL MODEM은 Eve QUANTUM 공개키를 통신사업자 유선 또는 무선망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 basic-Alice 양자난수를 생성하여 내부 메모리에 저장 및 basic-Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 새로운 new-Alice 양자 난수를 생성하여 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 통신사업자 유선 또는 무선망 중 어느하나를 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 basic-Eve 양자난수를 암호화하여 통신사업자 유선 또는 무선망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 basic-Alice 양자난수를 암호화하여 통신사업자 유선 또는 무선망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 basic-Alice 양자난수를 복호화 후 내부 메모리에 저장된 basic-Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 basic-Eve 양자난수를 복호화 후 내부 메모리에 저장된 basic-Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송하며;
DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하면, 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO consists of an Eve quantum random number generator, generating basic-Eve quantum random numbers with the Eve quantum random number generator, storing them in internal memory, and using the basic-Eve quantum random numbers as seeds to generate the Eve QUANTUM private key; and
QUANTUM COLLABO is an Eve quantum random number generator that generates a new new-Eve quantum random number and performs cryptographic operations with the Eve QUANTUM private key as a seed to generate the Eve QUANTUM public key;
DUAL MODEM transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through either the telecom operator's wired or wireless network;
Alice QUANTUM SERVER is configured to include an Alice quantum random number generator, generating basic-Alice quantum random numbers with the Alice quantum random number generator, storing them in internal memory, and using the basic-Alice quantum random number as a seed to generate the Alice QUANTUM private key; And
Alice QUANTUM SERVER generates a new new-Alice quantum random number from the Alice quantum random number generator and performs cryptographic operation with the Alice QUANTUM private key as a seed to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER transmits the Alice QUANTUM public key to QUANTUM COLLABO through either the wired or wireless network of the telecommunication service provider;
QUANTUM COLLABO encrypts basic-Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through either wired or wireless network of a telecommunication service provider;
Alice QUANTUM SERVER encrypts the basic-Alice quantum random number with the Eve QUANTUM public key and transmits it to the QUANTUM COLLABO through the telecommunication operator wired or wireless network;
QUANTUM COLLABO generates a QUANTUM symmetric key by decrypting the basic-Alice quantum random number encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key and performing encryption operations with the basic-Eve quantum random number stored in the internal memory;
Alice QUANTUM SERVER decrypts the basic-Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, and then performs an encryption operation with the basic-Alice quantum random number stored in the internal memory to generate the QUANTUM symmetric key;
QUANTUM COLLABO transmits encrypted data by encrypting internal data with QUANTUM symmetric key to DUAL MODEM;
DUAL MODEM transmits the encrypted data encrypted with the QUANTUM symmetric key to Bob QUANTUM SERVER through the wireless self-network QUANTUM AP;
When Bob QUANTUM SERVER receives the encrypted data encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it transmits it to the Alice QUANTUM SERVER through the wire network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a Two-Way-Ring Network that receives encrypted data encrypted with the QUANTUM symmetric key from the wired network and decrypts it with the QUANTUM symmetric key.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 Eve 양자난수를 최초 생성하여 Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성하며;및
QUANTUM COLLABO는 Eve 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Eve QUANTUM 개인키와 암호화 연산하여 Eve QUANTUM 공개키를 생성하며;
DUAL MODEM은 Eve QUANTUM 공개키를 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 Alice 양자난수를 최초 생성하여 Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 Eve 양자난수를 암호화하여 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 Alice 양자난수를 암호화하여 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 Alice 양자난수를 복호화 후 내부 메모리에 저장된 Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 Eve 양자난수를 복호화 후 내부 메모리에 저장된 Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송하며;
DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 제2 네트워크 무선자가망 QUANTUM AP를 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하면, 제2 네트워크 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 제2 네트워크 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO is configured to include an Eve quantum random number generator, first generating an Eve quantum random number with the Eve quantum random number generator, and using the Eve quantum random number as a seed to generate an Eve QUANTUM private key; and
QUANTUM COLLABO generates an Eve QUANTUM public key by regenerating a quantum random number with an Eve quantum random number generator and performing an encryption operation with the Eve QUANTUM private key as a random number seed;
DUAL MODEM transmits Eve QUANTUM public key to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER is configured to include an Alice quantum random number generator, to initially generate an Alice quantum random number with the Alice quantum random number generator, and use the Alice quantum random number as a seed to generate the Alice QUANTUM private key; and
Alice QUANTUM SERVER generates an Alice QUANTUM public key by regenerating a quantum random number with an Alice quantum random number generator and performing an encryption operation with the Alice QUANTUM private key as a random number seed;
Alice QUANTUM SERVER sends the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
QUANTUM COLLABO encrypts Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER encrypts Alice quantum random number with the Eve QUANTUM public key and transmits it to QUANTUM COLLABO through the first network;
QUANTUM COLLABO decrypts Alice's quantum random number encrypted with Eve QUANTUM public key with Eve QUANTUM private key and performs encryption operation with Eve quantum random number stored in internal memory to generate QUANTUM symmetric key;
Alice QUANTUM SERVER decrypts the Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key and performs an encryption operation with the Alice quantum random number stored in the internal memory to generate the QUANTUM symmetric key;
QUANTUM COLLABO transmits encrypted data by encrypting internal data with QUANTUM symmetric key to DUAL MODEM;
DUAL MODEM transmits the encrypted data encrypted with QUANTUM symmetric key to Bob QUANTUM SERVER through the second network wireless self-network QUANTUM AP;
When Bob QUANTUM SERVER receives the encrypted data encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP, it transmits it to Alice QUANTUM SERVER through the second network wired self-network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a Two-Way-Ring Network that receives encrypted data encrypted with the QUANTUM symmetric key from the second network wired self-network and decrypts it with the QUANTUM symmetric key.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 Eve 양자난수를 최초 생성하여 Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성하며;및
QUANTUM COLLABO는 Eve 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Eve QUANTUM 개인키와 암호화 연산하여 Eve QUANTUM 공개키를 생성하며;
DUAL MODEM은 Eve QUANTUM 공개키를 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 Alice 양자난수를 최초 생성하여 Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 Eve 양자난수를 암호화하여 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 Alice 양자난수를 암호화하여 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 Alice 양자난수를 복호화 후 내부 메모리에 저장된 Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 Eve 양자난수를 복호화 후 내부 메모리에 저장된 Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송하며;
DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 제2 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 제2 네트워크망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, DUAL MODEM, QUANTUM DUAL AP, Alice QUANTUM SERVER, and Bob QUANTUM SERVER.
QUANTUM COLLABO is configured to include an Eve quantum random number generator, first generating an Eve quantum random number with the Eve quantum random number generator, and using the Eve quantum random number as a seed to generate an Eve QUANTUM private key; and
QUANTUM COLLABO generates an Eve QUANTUM public key by regenerating a quantum random number with an Eve quantum random number generator and performing an encryption operation with the Eve QUANTUM private key as a random number seed;
DUAL MODEM transmits Eve QUANTUM public key to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER is configured to include an Alice quantum random number generator, to initially generate an Alice quantum random number with the Alice quantum random number generator, and use the Alice quantum random number as a seed to generate the Alice QUANTUM private key; and
Alice QUANTUM SERVER generates an Alice QUANTUM public key by regenerating a quantum random number with an Alice quantum random number generator and performing an encryption operation with the Alice QUANTUM private key as a random number seed;
Alice QUANTUM SERVER sends the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
QUANTUM COLLABO encrypts Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER encrypts Alice quantum random number with the Eve QUANTUM public key and transmits it to QUANTUM COLLABO through the first network;
QUANTUM COLLABO decrypts Alice's quantum random number encrypted with Eve QUANTUM public key with Eve QUANTUM private key and performs encryption operation with Eve quantum random number stored in internal memory to generate QUANTUM symmetric key;
Alice QUANTUM SERVER decrypts the Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key and performs an encryption operation with the Alice quantum random number stored in the internal memory to generate the QUANTUM symmetric key;
QUANTUM COLLABO transmits encrypted data by encrypting internal data with QUANTUM symmetric key to DUAL MODEM;
DUAL MODEM transmits encrypted data encrypted with QUANTUM symmetric key to Alice QUANTUM SERVER through the second network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a Two-Way-Ring Network that receives encrypted data encrypted with the QUANTUM symmetric key from the second network and decrypts it with the QUANTUM symmetric key.
Alice/Bob QUANTUM SERVER는 내부에 Alice/Bob 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 무작위 양자난수를 Alice/Bob이 생성하여 베타적 논리합(EX-OR) 연산을 통해 상호 50% 씩의 영향을 미치는 Half Mirror Effect 키생성 대칭키 알고리즘(Symmetric Cryptographic Algorithm)의 QUANTUM 대칭키를 생성하는 것을 특징으로,
양자난수생성기(QRNG; Quantum Random Number Generator)는 대칭키 알고리즘(Symmetric Cryptographic Algorithm)의 QUANTUM 대칭키를 생성하기 위한 난수 시드(Seed) early-QRN(Quantum Random Number)을 생성 및 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) QUANTUM 개인키(PRIVATE KEY)를 생성하기 위한 난수 시드(Seed) basic-QRN(Quantum Random Number), QUANTUM 공개키(PUBLIC KEY)를 생성하기 위한 난수 시드(Seed) new-QRN(Quantum Random Number)를 생성하며;
통합방범센터 내부에 Alice QUANTUM SERVER는 SK텔레콤 통신사업자 LoRA 무선네트워크망 및 유선자가망에 연결되며;
Bob QUANTUM SERVER는 CC인증 VPN을 통한 non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER와 연결되며;
단말부는 방범용 감시카메라, 멀티통신모뎀, QUANTUM COLLABO로 구성되어,
QUANTUM COLLABO는 방범용 감시카메라를 제어하며;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결되며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기, Encrypt TLS(Transport Layer Security protocol) MODULE을 포함하여 구성되어,
Encrypt TLS MODULE은 System Memory, MCU(Main Control Unit), Security OTP Memory, Boot-ROM, SPI Controller로 구성되며;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 MCU로 전송하며;
Encrypt TLS MODULE 내부 MCU는 System Memory, Security OTP Memory, Boot-ROM, SPI Controller를 제어하며;
System Memory는 MCU 운영 OS 프로그램이 저장된 System Memory이며;
MCU는 Eve 양자난수생성기로 부터 basic-QRN를 수신하여 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하며;
MCU는 Eve 양자난수생성기로 부터 new-QRN 난수를 수신하여 Eve QUANTUM 개인키에 new-QRN 난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하고, Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하며;
QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기(QRNG; Quantum Random Number Generator)를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN를 수신하여 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Alice QUANTUM 개인키(PRIVATE KEY)를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN 난수를 수신하여 Alice QUANTUM 개인키를 상기 new-QRN 난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Alice QUANTUM 공개키(PUBLIC KEY)를 생성하며;
Alice QUANTUM SERVER와 QUANTUM COLLABO는 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통하여 Alice QUANTUM 공개키와 Eve QUANTUM 공개키를 서로 교환하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN를 수신하여 Alice QUANTUM 공개키로 early-Eve QRN를 암호화하여 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통하여 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN를 수신하여 Eve QUANTUM 공개키로 early-Alice QRN를 암호화하여 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통하여 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 내부에 저장된 early-Eve QRN과 베타적 논리합(EX-OR) 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 내부에 저장된 early-Alice QRN과 베타적 논리합(EX-OR) 암호화 연산하여 대칭키 알고리즘(symmetric cryptographic algorithm)의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보(ID/Password)를 QUANTUM 대칭키로 암호화하여 non-QUANTUM CHANNEL, QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 비면허주파수 모뎀으로 QUANTUM 대칭키로 암호화된 QUANTUM COLLABO의 Log 정보(ID/Password)를 전송하며;
QUANTUM COLLABO는 비면허주파수 모뎀을 통해 QUANTUM 대칭키로 암호화된 QUANTUM COLLABO의 Log 정보(ID/Password)를 수신하여 QUANTUM 대칭키로 복호화하여 승인된 Log 정보(ID/Password)일 경우, SPI Controller를 통해 Boot-ROM을 부팅하며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀으로 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 방범용 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 비면허주파수 폐쇄형 무선자가망을 통해 Bob QUANTUM SERVER로 전송하지만,
QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤사업자 3G 또는 4G 또는 5G 무선네트워크망 중 어느 하나를 통해 Alice QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM DUAL AP로 부터 QUANTUM 대칭키로 암호화한 방범용 감시카메라 촬영 영상데이터를 수신하면, non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망과 SK텔레콤 통신사업자 LoRA 무선네트워크망 중 어느 하나 이상으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하며;
QUANTUM COLLABO 내부의 QUANTUM AC(Access Controller)는 Alice QUANTUM 공개키를 면허주파수 모뎀을 통해 SK텔레콤 통신사업자 LoRA 무선네트워크망으로 Alice QUANTUM SERVER로 전송하며;및
QUANTUM 대칭키로 암호화한 방범용 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC(Access Controller)와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 감시카메라 촬영 영상데이터 영상데이터를 암호화하여 전송하여 보안강화 통신속도 향상 및 통신요금을 절감하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
Security camera, QUANTUM COLLABO, Alice/Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), SK Telecom's telecom operator LoRA wireless network
Alice/Bob QUANTUM SERVER generates a random quantum random number by Alice/Bob through the Alice/Bob Quantum Random Number Generator (QRNG) inside, It is characterized by generating the QUANTUM symmetric key of the Half Mirror Effect key generation Symmetric Cryptographic Algorithm that affects it,
Quantum Random Number Generator (QRNG) generates a random number seed early-QRN (Quantum Random Number) for generating a QUANTUM symmetric key of a Symmetric Cryptographic Algorithm and generates an asymmetric key cryptographic algorithm (asymmetric) cryptographic algorithm) Random number seed for generating QUANTUM private key (PRIVATE KEY) basic-QRN (Quantum Random Number), Random number seed for generating QUANTUM public key (PUBLIC KEY) new-QRN (Quantum Random) Number);
Alice QUANTUM SERVER inside the integrated crime prevention center is connected to SK Telecom's telecom operator's LoRA wireless network and wired self-network;
Bob QUANTUM SERVER is connected to Alice QUANTUM SERVER through any one of the non-QUANTUM CHANNEL via CC-certified VPN, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL via PUF-QRNG TWIN USB cable;
The terminal part consists of a security surveillance camera, a multi-communication modem, and a QUANTUM COLLABO.
QUANTUM COLLABO controls security surveillance cameras;
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency SK Telecom carrier LoRA wireless network network through QUANTUM AC (Access Controller) in data transmission/reception,
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC (Access Controller) and is connected to Alice QUANTUM SERVER through licensed frequency SK Telecom carrier LoRA wireless network network through licensed frequency modem among multi-communication modems;
QUANTUM COLLABO consists of QUANTUM AC (Access Controller), Eve quantum random number generator, and Encrypt TLS (Transport Layer Security protocol) MODULE,
Encrypt TLS MODULE consists of System Memory, MCU (Main Control Unit), Security OTP Memory, Boot-ROM, and SPI Controller;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and sends it to Encrypt TLS MODULE internal MCU;
Encrypt TLS MODULE Internal MCU controls System Memory, Security OTP Memory, Boot-ROM, SPI Controller;
System Memory is System Memory in which MCU operating OS program is stored;
MCU receives basic-QRN from Eve quantum random number generator and generates an asymmetric cryptographic algorithm Eve QUANTUM PRIVATE KEY as a random number seed;
MCU receives new-QRN random number from Eve quantum random number generator and performs beta-OR (EX-OR) encryption operation with new-QRN random number seed on Eve QUANTUM private key, OTP (One Time Password) asymmetric key encryption algorithm (asymmetric cryptographic algorithm) generating an Eve QUANTUM public key (PUBLIC KEY), storing the Eve QUANTUM public key in a Security One Time Password (OTP) Memory, and transmitting the Eve QUANTUM public key to a QUANTUM Access Controller (AC);
QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency SK Telecom carrier LoRA wireless network network through the licensed frequency modem among the multi-communication modems;
Alice QUANTUM SERVER is configured by including Alice Quantum Random Number Generator (QRNG) inside,
Alice QUANTUM SERVER receives basic-QRN from Alice quantum random number generator and generates an asymmetric cryptographic algorithm Alice QUANTUM private key (PRIVATE KEY) with a random number seed; and
Alice QUANTUM SERVER receives new-QRN random number from Alice quantum random number generator, performs beta-OR (EX-OR) encryption operation on Alice QUANTUM private key with the new-QRN random number seed, and OTP (One Time Password) asymmetry generate an asymmetric cryptographic algorithm Alice QUANTUM PUBLIC KEY;
Alice QUANTUM SERVER and QUANTUM COLLABO exchange the Alice QUANTUM public key and the Eve QUANTUM public key with each other through the licensed frequency SK Telecom carrier LoRA wireless network;
QUANTUM COLLABO receives early-Eve QRN from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and transmits to Alice QUANTUM SERVER through licensed frequency SK Telecom carrier LoRA wireless network;
Alice QUANTUM SERVER receives early-Alice QRN from Alice quantum random number generator, encrypts early-Alice QRN with Eve QUANTUM public key, and transmits it to QUANTUM COLLABO through the licensed frequency SK Telecom carrier LoRA wireless network;
QUANTUM COLLABO decrypts the early-Alice QRN encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and then performs an EX-OR encryption operation with the early-Eve QRN stored inside the QUANTUM symmetric of the symmetric cryptographic algorithm. generate a key;
Alice QUANTUM SERVER decrypts the early-Eve QRN encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, and performs beta-OR (EX-OR) encryption with the early-Alice QRN stored inside the QUANTUM of the symmetric cryptographic algorithm. generate a symmetric key;
Alice QUANTUM SERVER encrypts QUANTUM COLLABO's log information (ID/Password) with QUANTUM symmetric key and transmits it to Bob QUANTUM SERVER through any one of non-QUANTUM CHANNEL, QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired self-network;
Bob QUANTUM SERVER transmits QUANTUM COLLABO's log information (ID/Password) encrypted with the QUANTUM symmetric key to the unlicensed frequency modem connected to the unlicensed frequency closed wireless self-network through the QUANTUM DUAL AP (Access Point);
QUANTUM COLLABO receives the log information (ID/Password) of QUANTUM COLLABO encrypted with the QUANTUM symmetric key through the unlicensed frequency modem and decrypts it with the QUANTUM symmetric key. to boot;
QUANTUM COLLABO controls QUANTUM AC (Access Controller) to connect Bob QUANTUM SERVER and network network login (Log In) through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network with unlicensed frequency modem among multi-communication modems and;
QUANTUM AC (Access Controller) transmits video data captured by security cameras encrypted with QUANTUM symmetric key through QUANTUM DUAL AP to Bob QUANTUM SERVER through a closed wireless self-network with unlicensed frequency that is logged in to the network network.
If communication with QUANTUM DUAL AP is not possible, it is transmitted to Alice QUANTUM SERVER through any one of the 3G, 4G, or 5G wireless networks of SK Telecom's licensed frequency network through licensed frequency modems among multi-communication modems;
When Bob QUANTUM SERVER receives video data from the QUANTUM symmetric key encrypted with the QUANTUM symmetric key from the QUANTUM DUAL AP through the unlicensed frequency closed wireless network, one of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL transmitted to Alice QUANTUM SERVER through the wired self-network of
Alice QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key from any one or more of the wired own network and the LoRA wireless network network of SK Telecom, and decrypts it with the QUANTUM symmetric key;
QUANTUM AC (Access Controller) inside QUANTUM COLLABO transmits the Alice QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem to the SK Telecom carrier LoRA wireless network; and
Transmitting the video data captured by the security surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency,
QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency for data transmission according to the communication environment according to obstacles. Before data transmission, QUANTUM AC (Access Controller) AP conducts Low-Frequency and High-Frequency PING tests, selects a frequency with fast response speed, and encrypts and transmits large-capacity surveillance camera video data with QUANTUM symmetric key to enhance security and reduce communication costs. Heterogeneous Network QUANTUM KEY Distribution Hybrid Quantum Communication Closed Network System featuring CHANNEL Two-Way-Ring Network.
Alice/Bob QUANTUM SERVER는 내부에 Alice/Bob 양자난수생성기(QRNG; Quantum Random Number Generator)를 통해 무작위 양자난수를 Alice/Bob이 생성하여 암호화 연산을 통해 Half Mirror Effect 대칭키 알고리즘(Symmetric Cryptographic Algorithm)의 QUANTUM 대칭키를 생성하는 것을 특징으로,
양자난수생성기(QRNG)는 대칭키 알고리즘의 QUANTUM 대칭키를 생성하기 위한 난수 시드(Seed) early-QRN(Quantum Random Number)을 생성 및 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)의 QUANTUM 개인키(PRIVATE KEY)를 생성하기 위한 난수 시드(Seed) basic-QRN(Quantum Random Number)와 QUANTUM 공개키(PUBLIC KEY)를 생성하기 위한 난수 시드(Seed) new-QRN(Quantum Random Number)를 생성하며;
Alice QUANTUM SERVER는 통신사업자 네트워크망을 통해 QUANTUM COLLABO와 네트워크망 연결되며;및
Alice QUANTUM SERVER는 non-QUANTUM CHANNEL, QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 연결된 Bob QUANTUM SERVER를 거쳐 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO와 네트워크망 연결되며;
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 통신사업자 네트워크망 중 어느 하나 이상을 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 통신사업자 모뎀을 통해 통신사업자 네트워크망을 통해 Alice QUANTUM SERVER와 연결되며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN 난수를 생성하여 난수 시드로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN 난수를 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 비대칭키 암호 알고리즘 OTP(One Time Password) Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 통신사업자 모뎀으로 통신사업자 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN를 수신하여 난수 시드로 비대칭키 암호 알고리즘 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN 난수를 수신하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 비대칭키 암호 알고리즘 OTP(One Time Password) Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER와 QUANTUM COLLABO는 통신사업자 네트워크망을 통하여 Alice QUANTUM 공개키와 Eve QUANTUM 공개키를 서로 교환하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN를 수신하여 Alice QUANTUM 공개키로 early-Eve QRN를 암호화하여 통신사업자 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN를 수신하여 Eve QUANTUM 공개키로 early-Alice QRN를 암호화하여 통신사업자 네트워크망을 통하여 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 대칭키 알고리즘의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 상기와 동일한 암호화 연산하여 대칭키 알고리즘의 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보를 QUATUM 대칭키로 암호화하여 유선자가망을 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 비면허주파수 폐쇄형 무선자가망을 통해 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM 대칭키로 복호화하여 승인된 Log 정보일 경우, QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하며;
QUANTUM AC는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 QUANTUM COLLABO 내부 데이터를 네트워크망 로그인(Log In)된 비면허주파수 폐쇄형 무선자가망을 통해 Bob QUANTUM SERVER로 전송하며;
Bob QUANTUM SERVER는 QUANTUM COLLABO 내부 데이터를 non-QUANTUM CHANNEL, QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 QUANTUM COLLABO 내부 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP (Access Point), multi-communication modem, telecommunication operator network, wired/wireless self-network,
Alice/Bob QUANTUM SERVER generates a random quantum random number by Alice/Bob through the Alice/Bob Quantum Random Number Generator (QRNG) inside, and uses the Half Mirror Effect Symmetric Cryptographic Algorithm through encryption operation. Characterized in generating a QUANTUM symmetric key,
Quantum random number generator (QRNG) generates a random number seed early-QRN (Quantum Random Number) for generating QUANTUM symmetric key of symmetric key algorithm and QUANTUM private key (PRIVATE KEY) of asymmetric cryptographic algorithm ), a random number seed for generating basic-QRN (Quantum Random Number) and a random number seed for generating QUANTUM public key (PUBLIC KEY) new-QRN (Quantum Random Number);
Alice QUANTUM SERVER is networked with QUANTUM COLLABO through a carrier network network; and
Alice QUANTUM SERVER is connected to QUANTUM COLLABO through a non-QUANTUM CHANNEL and QUANTUM CHANNEL wired self-network, via Bob QUANTUM SERVER, and through a closed wireless self-network with unlicensed frequency;
QUANTUM COLLABO is composed of QUANTUM AC (Access Controller) and Eve quantum random number generator. as,
QUANTUM COLLABO controls QUANTUM AC and connects with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems; or
QUANTUM COLLABO controls QUANTUM AC and is connected to Alice QUANTUM SERVER through a telecommunication carrier network through a telecommunication carrier modem among multi-communication modems;
QUANTUM COLLABO generates basic-QRN random number from Eve quantum random number generator and generates an asymmetric key cryptographic algorithm Eve QUANTUM private key with random number seed;
QUANTUM COLLABO generates new-QRN random number from Eve quantum random number generator and encrypts Eve QUANTUM private key and new-QRN random number seed to generate asymmetric key encryption algorithm OTP (One Time Password) Eve QUANTUM public key to QUANTUM AC transmit;
QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the telecommunication carrier network as a carrier modem among multi-communication modems;
Alice QUANTUM SERVER is composed of Alice quantum random number generator inside,
Alice QUANTUM SERVER receives basic-QRN from Alice quantum random number generator and generates an asymmetric key cryptographic algorithm Alice QUANTUM private key with a random number seed; and
Alice QUANTUM SERVER receives new-QRN random number from Alice quantum random number generator and encrypts Alice QUANTUM private key and new-QRN random number seed to generate an asymmetric key encryption algorithm OTP (One Time Password) Alice QUANTUM public key;
Alice QUANTUM SERVER and QUANTUM COLLABO exchange the Alice QUANTUM public key and the Eve QUANTUM public key with each other through the carrier network;
QUANTUM COLLABO receives early-Eve QRN from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and transmits it to Alice QUANTUM SERVER through network of telecommunication service providers;
Alice QUANTUM SERVER receives early-Alice QRN from Alice quantum random number generator, encrypts early-Alice QRN with Eve QUANTUM public key, and transmits it to QUANTUM COLLABO through network of telecommunication service providers;
QUANTUM COLLABO decrypts the early-Alice QRN encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and performs encryption operations with the early-Eve QRN to generate the QUANTUM symmetric key of the symmetric key algorithm;
Alice QUANTUM SERVER decrypts the early-Eve QRN encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key, and then performs the same encryption operation with the early-Alice QRN to generate the QUANTUM symmetric key of the symmetric key algorithm;
Alice QUANTUM SERVER encrypts the log information of QUANTUM COLLABO with the QUATUM symmetric key and transmits it to Bob QUANTUM SERVER through the wired self-network;
Bob QUANTUM SERVER transmits the log information of QUANTUM COLLABO encrypted with QUATUM symmetric key to QUANTUM COLLABO through the unlicensed frequency closed wireless self-network;
QUANTUM COLLABO uses the QUANTUM symmetric key to decrypt the QUANTUM COLLABO's log information encrypted with the QUANTUM symmetric key, and if it is the approved log information, QUANTUM AC controls QUANTUM AC to control QUANTUM AC through unlicensed frequency modem among multi-communication modems. Connect with Bob QUANTUM SERVER through DUAL AP (Access Point) through network login (Log In);
QUANTUM AC transmits QUANTUM COLLABO internal data encrypted with QUANTUM symmetric key through QUANTUM DUAL AP to Bob QUANTUM SERVER through network network login (Log In) unlicensed frequency closed wireless self-network;
Bob QUANTUM SERVER transmits QUANTUM COLLABO internal data to Alice QUANTUM SERVER through any one of non-QUANTUM CHANNEL, QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wireline networks;
Alice QUANTUM SERVER is a hybrid-QUANTUM CHANNEL Two-Way-Ring Network characterized by a hybrid-QUANTUM CHANNEL Two-Way-Ring Network, characterized by receiving QUANTUM COLLABO internal data encrypted with QUANTUM symmetric key from a wired network and decrypting it with QUANTUM symmetric key. Quantum communication closed network system.
QUANTUM SERVER는 내부에 양자난수생성기를 통해 생성한 무작위 양자난수를 시드로 암호화 연산을 통해 대칭키 알고리즘의 QUANTUM 대칭키 및 비대칭키 암호 알고리즘 QUANTUM 개인키와 QUANTUM 공개키를 생성하는 것을 특징으로,
양자난수생성기는 대칭키 알고리즘의 QUANTUM 대칭키를 생성하기 위한 early-QRN(Quantum Random Number) 난수를 생성 및 비대칭키 암호 알고리즘 QUANTUM 개인키(PRIVATE KEY)를 생성하기 위한 basic-QRN(Quantum Random Number) 난수와 QUANTUM 공개키(PUBLIC KEY)를 생성하기 위한 new-QRN(Quantum Random Number) 난수를 생성하며;
Alice QUANTUM SERVER는 제1 네트워크망 및 제2 네트워크망의 이중망을 통해 QUANTUM COLLABO와 연결되며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 제1 네트워크망 또는 제2 네트워크망 중 어느 하나를 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀으로 통신사업자 유선 네트워크망 또는 무선네트워크망과 연결되는 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이의 제1 네트워크망에 연결되며;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀으로 비면허주파수 폐쇄형 무선자가망을 통하여 QUANTUM DUAL AP에 연결 또는 유선자가망을 통해 Bob QUANTUM SERVER와 연결되는 QUANTUM COLLABO와 Bob QUANTUM SERVER 사이의 제2 네트워크망에 연결되며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN 난수를 생성하여 난수 시드로 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN 난수를 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀을 통해 제1 네트워크망으로 연결된 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN 난수를 생성하여 난수 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN 난수를 생성하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 제1 네트워크망을 통하여 Alice QUANTUM 공개키를 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN 난수를 수신하여 Alice QUANTUM 공개키로 early-Eve QRN을 암호화하여 제1 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN을 수신하여 Eve QUANTUM 공개키로 early-Alice QRN을 암호화하여 제1 네트워크망을 통하여 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보를 QUATUM 대칭키로 암호화하여 Bob QUANTUM SERVER로 제2 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM 대칭키로 복호화하여 승인된 Log 정보일 경우, QUANTUM AC를 제어하여 멀티통신모뎀으로 제2 네트워크망과 연결된 Bob QUANTUM SERVER을 통해 Alice QUANTUM SERVER로 QUATUM 대칭키로 암호화한 내부 데이터를 전송하며;
Alice QUANTUM SERVER는 QUATUM 대칭키로 암호화한 내부 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP, multi-communication modem, the first network, and the second network,
QUANTUM SERVER generates the QUANTUM symmetric key of the symmetric key algorithm and the QUANTUM private key and QUANTUM public key of the asymmetric key encryption algorithm through cryptographic operation of the random quantum random number generated through the quantum random number generator inside,
The quantum random number generator generates an early-QRN (Quantum Random Number) random number for generating the QUANTUM symmetric key of the symmetric key algorithm and basic-QRN (Quantum Random Number) for generating the asymmetric key cryptographic algorithm QUANTUM private key (PRIVATE KEY) generate a random number and a new-QRN (Quantum Random Number) random number for generating a QUANTUM PUBLIC KEY;
Alice QUANTUM SERVER is connected to QUANTUM COLLABO through a dual network of the first network and the second network;
QUANTUM COLLABO is composed of QUANTUM AC and Eve quantum random number generator, and QUANTUM COLLABO selectively selects either the first network or the second network through QUANTUM AC inside,
QUANTUM COLLABO controls QUANTUM AC and is connected to the first network between QUANTUM COLLABO and Alice QUANTUM SERVER, which is connected to a telecommunication operator wired network or wireless network with a multi-communication modem; or
QUANTUM COLLABO is a multi-communication modem that controls QUANTUM AC and connects to QUANTUM DUAL AP through a closed wireless self-network of unlicensed frequency or a second network network between QUANTUM COLLABO and Bob QUANTUM SERVER that is connected to Bob QUANTUM SERVER through a wired self-network connected to;
QUANTUM COLLABO generates basic-QRN random number from Eve quantum random number generator to generate Eve QUANTUM private key with random number seed;
QUANTUM COLLABO generates new-QRN random number from Eve quantum random number generator and encrypts Eve QUANTUM private key and new-QRN random number seed to generate Eve QUANTUM public key and sends it to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER connected to the first network through the multi-communication modem;
Alice QUANTUM SERVER is composed of Alice quantum random number generator inside,
Alice QUANTUM SERVER generates basic-QRN random number from Alice quantum random number generator to generate Alice QUANTUM private key as a random number seed; and
Alice QUANTUM SERVER generates new-QRN random number from Alice quantum random number generator, and encrypts Alice QUANTUM private key and new-QRN random number seed to generate Alice QUANTUM public key;
Alice QUANTUM SERVER sends the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
QUANTUM COLLABO receives early-Eve QRN random number from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and transmits it to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER receives early-Alice QRN from Alice quantum random number generator, encrypts early-Alice QRN with Eve QUANTUM public key, and transmits it to QUANTUM COLLABO through the first network;
QUANTUM COLLABO decrypts the early-Alice QRN encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and then performs an encryption operation with the early-Eve QRN to generate the QUANTUM symmetric key;
Alice QUANTUM SERVER decrypts the early-Eve QRN encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key and performs encryption operations with the early-Alice QRN to generate the QUANTUM symmetric key;
Alice QUANTUM SERVER encrypts the log information of QUANTUM COLLABO with the QUATUM symmetric key and transmits it to Bob QUANTUM SERVER to QUANTUM COLLABO through a second network;
QUANTUM COLLABO uses the QUANTUM symmetric key to decrypt the QUANTUM COLLABO's log information encrypted with the QUANTUM symmetric key, and if it is the approved log information, it controls QUANTUM AC to Alice QUANTUM SERVER through Bob QUANTUM SERVER connected to the second network with a multi-communication modem. Transmits internal data encrypted with the QUATUM symmetric key;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a hybrid-QUANTUM CHANNEL Two-Way-Ring Network that receives internal data encrypted with the QUANTUM symmetric key and decrypts it with the QUANTUM symmetric key.
QUANTUM SERVER는 내부에 양자난수생성기를 통해 생성한 무작위 양자난수를 시드로 암호화 연산을 통해 QUANTUM 대칭키, QUANTUM 개인키, QUANTUM 공개키를 생성하는 것을 특징으로,
양자난수생성기는 대칭키 알고리즘의 QUANTUM 대칭키를 생성하기 위한 early-QRN(Quantum Random Number) 난수를 생성 및 비대칭키 암호 알고리즘 QUANTUM 개인키(PRIVATE KEY)를 생성하기 위한 basic-QRN(Quantum Random Number) 난수와 QUANTUM 공개키(PUBLIC KEY)를 생성하기 위한 new-QRN(Quantum Random Number) 난수를 생성하며;
Alice QUANTUM SERVER와 QUANTUM COLLABO는 제1 네트워크망 및 제2 네트워크망의 이중 네트워크망으로 연결되며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 제1 네트워크망 또는 제2 네트워크망 중 어느 하나를 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀으로 통신사업자 네트워크망을 통해 QUANTUM COLLABO와 연결되는 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이의 제1 네트워크망에 연결되며;
QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀으로 비면허주파수 폐쇄형 무선자가망을 통하여 QUANTUM DUAL AP에 연결 후 Bob QUANTUM SERVER를 거쳐 유선자가망을 통해 Alice QUANTUM SERVER와 연결되는 Alice QUANTUM SERVER와 QUANTUM COLLABO 사이의 제2 네트워크망에 연결되며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN을 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀을 통해 제1 네트워크망으로 연결된 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN을 생성하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 제1 네트워크망을 통하여 Alice QUANTUM 공개키를 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN을 수신하여 Alice QUANTUM 공개키로 early-Eve QRN을 암호화하여 제1 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN을 수신하여 Eve QUANTUM 공개키로 early-Alice QRN을 암호화하여 제1 네트워크망을 통하여 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보를 QUATUM 대칭키로 암호화하여 Bob QUANTUM SERVER로 제2 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM 대칭키로 복호화하여 승인된 Log 정보일 경우, QUANTUM AC를 제어하여 멀티통신모뎀으로 제2 네트워크망과 연결된 Bob QUANTUM SERVER을 통해 Alice QUANTUM SERVER로 QUATUM 대칭키로 암호화한 내부 데이터를 전송하며;
Alice QUANTUM SERVER는 QUATUM 대칭키로 암호화한 내부 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, QUANTUM DUAL AP, multi-communication modem, the first network, and the second network,
QUANTUM SERVER is characterized by generating QUANTUM symmetric key, QUANTUM private key, and QUANTUM public key through cryptographic operation using random quantum random numbers generated through internal quantum random number generator.
The quantum random number generator generates an early-QRN (Quantum Random Number) random number for generating the QUANTUM symmetric key of the symmetric key algorithm and basic-QRN (Quantum Random Number) for generating the asymmetric key cryptographic algorithm QUANTUM private key (PRIVATE KEY) generate a random number and a new-QRN (Quantum Random Number) random number for generating a QUANTUM PUBLIC KEY;
Alice QUANTUM SERVER and QUANTUM COLLABO are connected by a dual network of the first network and the second network;
QUANTUM COLLABO is composed of QUANTUM AC and Eve quantum random number generator, and QUANTUM COLLABO selectively selects either the first network or the second network through QUANTUM AC inside,
QUANTUM COLLABO controls QUANTUM AC and is a multi-communication modem connected to the first network between QUANTUM COLLABO and Alice QUANTUM SERVER, which is connected to QUANTUM COLLABO through a network of carriers;
QUANTUM COLLABO controls QUANTUM AC and connects to QUANTUM DUAL AP through a closed wireless self-network of unlicensed frequency with a multi-communication modem between Alice QUANTUM SERVER and QUANTUM COLLABO, which is connected to Alice QUANTUM SERVER through a wired self-network via Bob QUANTUM SERVER connected to a second network of
QUANTUM COLLABO generates basic-QRN from Eve quantum random number generator to generate Eve QUANTUM private key with random number seed;
QUANTUM COLLABO generates new-QRN from Eve quantum random number generator and encrypts Eve QUANTUM private key and new-QRN random number seed to generate Eve QUANTUM public key and sends it to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER connected to the first network through the multi-communication modem;
Alice QUANTUM SERVER is composed of Alice quantum random number generator inside,
Alice QUANTUM SERVER generates basic-QRN from Alice quantum random number generator to generate Alice QUANTUM private key as a random number seed; and
Alice QUANTUM SERVER generates new-QRN from Alice quantum random number generator and encrypts Alice QUANTUM private key and new-QRN random number seed to generate Alice QUANTUM public key;
Alice QUANTUM SERVER sends the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
QUANTUM COLLABO receives early-Eve QRN from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and transmits it to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER receives early-Alice QRN from Alice quantum random number generator, encrypts early-Alice QRN with Eve QUANTUM public key, and transmits it to QUANTUM COLLABO through the first network;
QUANTUM COLLABO decrypts the early-Alice QRN encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and then performs an encryption operation with the early-Eve QRN to generate the QUANTUM symmetric key;
Alice QUANTUM SERVER decrypts the early-Eve QRN encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key and performs encryption operations with the early-Alice QRN to generate the QUANTUM symmetric key;
Alice QUANTUM SERVER encrypts the log information of QUANTUM COLLABO with the QUATUM symmetric key and transmits it to Bob QUANTUM SERVER to QUANTUM COLLABO through a second network;
QUANTUM COLLABO uses the QUANTUM symmetric key to decrypt the QUANTUM COLLABO's log information encrypted with the QUANTUM symmetric key, and if it is the approved log information, it controls QUANTUM AC to Alice QUANTUM SERVER through Bob QUANTUM SERVER connected to the second network with a multi-communication modem. Transmits internal data encrypted with the QUATUM symmetric key;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a hybrid-QUANTUM CHANNEL Two-Way-Ring Network that receives internal data encrypted with the QUANTUM symmetric key and decrypts it with the QUANTUM symmetric key.
QUANTUM SERVER는 내부에 양자난수생성기를 통해 생성한 무작위 양자난수를 시드로 QUANTUM 대칭키, QUANTUM 개인키, QUANTUM 공개키를 생성하는 것을 특징으로,
양자난수생성기는 QUANTUM 대칭키를 생성하기 위한 early-QRN 난수를 생성 및 QUANTUM 개인키를 생성하기 위한 basic-QRN 난수와 QUANTUM 공개키를 생성하기 위한 new-QRN 난수를 생성하며;
Alice QUANTUM SERVER와 QUANTUM COLLABO는 제1 네트워크망 및 제2 네트워크망의 이중 네트워크망 연결되며;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 제1 네트워크망 또는 제2 네트워크망 중 어느 하나를 선택적으로 선택하는 것으로,
QUANTUM COLLABO는 QUANTUM AC를 제어하여 제1 네트워크망을 통해 QUANTUM COLLABO와 연결되는 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이의 제1 네트워크망에 연결;또는
QUANTUM COLLABO는 QUANTUM AC를 제어하여 제2 네트워크망을 통해 Alice QUANTUM SERVER와 연결되는 Alice QUANTUM SERVER와 QUANTUM COLLABO 사이의 제2 네트워크망에 연결되며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Eve QUANTUM 개인키를 생성하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN을 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하며;
QUANTUM AC는 Eve QUANTUM 공개키를 제1 네트워크망으로 연결된 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어,
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN을 생성하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 제1 네트워크망을 통하여 Alice QUANTUM 공개키를 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN을 수신하여 Alice QUANTUM 공개키로 early-Eve QRN을 암호화하여 제1 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN을 수신하여 Eve QUANTUM 공개키로 early-Alice QRN을 암호화하여 제1 네트워크망을 통하여 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하며;
QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 내부 데이터를 제2 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 QUATUM 대칭키로 암호화한 내부 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 이종망 QUANTUM KEY 분배 하이브리드 양자통신 폐쇄망 시스템.
It consists of QUANTUM COLLABO, Alice QUANTUM SERVER, Bob QUANTUM SERVER, the first network, and the second network,
QUANTUM SERVER is characterized by generating QUANTUM symmetric key, QUANTUM private key, and QUANTUM public key using random quantum random numbers generated through internal quantum random number generator.
The quantum random number generator generates an early-QRN random number for generating a QUANTUM symmetric key, a basic-QRN random number for generating a QUANTUM private key, and a new-QRN random number for generating a QUANTUM public key;
Alice QUANTUM SERVER and QUANTUM COLLABO are connected to a dual network of the first network and the second network;
QUANTUM COLLABO is composed of QUANTUM AC and Eve quantum random number generator, and QUANTUM COLLABO selectively selects either the first network or the second network through QUANTUM AC inside,
QUANTUM COLLABO controls QUANTUM AC to connect to the first network between QUANTUM COLLABO and Alice QUANTUM SERVER, which are connected to QUANTUM COLLABO through the first network; or
QUANTUM COLLABO is connected to a second network between Alice QUANTUM SERVER and QUANTUM COLLABO, which is connected to Alice QUANTUM SERVER through a second network by controlling QUANTUM AC;
QUANTUM COLLABO generates basic-QRN from Eve quantum random number generator to generate Eve QUANTUM private key with random number seed;
QUANTUM COLLABO generates new-QRN from Eve quantum random number generator and encrypts Eve QUANTUM private key and new-QRN random number seed to generate Eve QUANTUM public key and sends it to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to Alice QUANTUM SERVER connected to the first network;
Alice QUANTUM SERVER is composed of Alice quantum random number generator inside,
Alice QUANTUM SERVER generates basic-QRN from Alice quantum random number generator to generate Alice QUANTUM private key as a random number seed; and
Alice QUANTUM SERVER generates new-QRN from Alice quantum random number generator and encrypts Alice QUANTUM private key and new-QRN random number seed to generate Alice QUANTUM public key;
Alice QUANTUM SERVER sends the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
QUANTUM COLLABO receives early-Eve QRN from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and transmits it to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER receives early-Alice QRN from Alice quantum random number generator, encrypts early-Alice QRN with Eve QUANTUM public key, and transmits it to QUANTUM COLLABO through the first network;
QUANTUM COLLABO decrypts the early-Alice QRN encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and then performs an encryption operation with the early-Eve QRN to generate the QUANTUM symmetric key;
Alice QUANTUM SERVER decrypts the early-Eve QRN encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key and performs encryption operations with the early-Alice QRN to generate the QUANTUM symmetric key;
QUANTUM COLLABO transmits internal data encrypted with QUATUM symmetric key to Alice QUANTUM SERVER through the second network;
Alice QUANTUM SERVER is a heterogeneous QUANTUM KEY distribution hybrid quantum communication closed network system featuring a hybrid-QUANTUM CHANNEL Two-Way-Ring Network that receives internal data encrypted with the QUANTUM symmetric key and decrypts it with the QUANTUM symmetric key.
QUANTUM COLLABO는 Eve 양자난수생성기를 포함하여 구성되어, Eve 양자난수생성기로 early-Eve 양자난수 및 basic-Eve 양자난수 및 new-Eve 양자난수를 생성하여 내부 메모리에 저장하며;
QUANTUM COLLABO는 basic-Eve 양자난수를 시드로 Eve QUANTUM 개인키를 생성하며;및
QUANTUM COLLABO는 new-Eve 양자난수를 시드로 Eve QUANTUM 개인키와 베타적 논리합(EX-OR) 또는 베타적 논리곱(EX-AND) 또는 고정길이 해시함수 또는 AES 암호화 또는 암호함수식 또는 암호연산자 중 어느 하나를 통하여 암호화 연산하여 Eve QUANTUM 공개키를 생성하며;
DUAL MODEM은 Eve QUANTUM 공개키를 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 early-Alice 양자난수 및 basic-Alice 양자난수 및 new-Alice 양자난수를 생성하여 내부 메모리에 저장하며;
Alice QUANTUM SERVER는 basic-Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하며;및
Alice QUANTUM SERVER는 new-Alice 양자난수를 시드로 Alice QUANTUM 개인키와 베타적 논리합(EX-OR) 또는 베타적 논리곱(EX-AND) 또는 고정길이 해시함수 또는 AES 암호화 또는 암호함수식 또는 암호연산자 중 어느 하나를 통하여 암호화 연산하여 Alice QUANTUM 공개키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 early-Alice 양자난수를 암호화하여 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하며;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 early-Eve 양자난수를 암호화하여 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하며;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice 양자난수를 복호화 후 내부 메모리에 저장된 early-Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve 양자난수를 복호화 후 내부 메모리에 저장된 early-Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하며;
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송하며;
DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 제2 네트워크망 을 통해 Alice QUANTUM SERVER로 전송하며;
Alice QUANTUM SERVER는 제2 네트워크망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 Two-Way-Ring Network를 특징으로 한다.
Claims 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13 Claims 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, Claims 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38 42. The method of any one of claims 39, 40, 41,
QUANTUM COLLABO includes an Eve quantum random number generator, which generates early-Eve quantum random numbers, basic-Eve quantum random numbers and new-Eve quantum random numbers and stores them in the internal memory;
QUANTUM COLLABO generates an Eve QUANTUM private key with a basic-Eve quantum random number as a seed; and
QUANTUM COLLABO uses the new-Eve quantum random number as the seed, and either the Eve QUANTUM private key and the beta-OR (EX-OR) or beta-OR (EX-AND) or fixed-length hash function or AES encryption or cryptographic function expression or cryptographic operator. generate an Eve QUANTUM public key by cryptographic operation through one;
DUAL MODEM transmits Eve QUANTUM public key to Alice QUANTUM SERVER through the first network;
Alice QUANTUM SERVER includes an Alice quantum random number generator, and the Alice quantum random number generator generates early-Alice quantum random numbers, basic-Alice quantum random numbers, and new-Alice quantum random numbers, and stores them in the internal memory;
Alice QUANTUM SERVER generates the Alice QUANTUM private key with the basic-Alice quantum random number as a seed; and
Alice QUANTUM SERVER uses new-Alice quantum random number as a seed, and either a beta OR (EX-OR) or beta OR (EX-AND) or fixed-length hash function or AES encryption or cryptographic function expression or cryptographic operator with the Alice QUANTUM private key. generate an Alice QUANTUM public key by cryptographic operation through any one;
Alice QUANTUM SERVER sends the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
Alice QUANTUM SERVER encrypts the early-Alice quantum random number with the Eve QUANTUM public key and transmits it to the QUANTUM COLLABO through the first network;
QUANTUM COLLABO encrypts the early-Eve quantum random number with the Alice QUANTUM public key and transmits it to the Alice QUANTUM SERVER through the first network;
QUANTUM COLLABO decrypts the early-Alice quantum random number encrypted with the Eve QUANTUM public key with the Eve QUANTUM private key, and performs encryption operations with the early-Eve quantum random number stored in the internal memory to generate the QUANTUM symmetric key;
Alice QUANTUM SERVER decrypts the early-Eve quantum random number encrypted with the Alice QUANTUM public key with the Alice QUANTUM private key and performs encryption operations with the early-Alice quantum random number stored in the internal memory to generate the QUANTUM symmetric key;
QUANTUM COLLABO transmits encrypted data by encrypting internal data with QUANTUM symmetric key to DUAL MODEM;
DUAL MODEM transmits encrypted data encrypted with QUANTUM symmetric key to Alice QUANTUM SERVER through the second network;
Alice QUANTUM SERVER features a Two-Way-Ring Network that receives encrypted data encrypted with the QUANTUM symmetric key from the second network and decrypts it with the QUANTUM symmetric key.
QUANTUM COLLABO 내부의 QUANTUM AC는 Alice QUANTUM 공개키를 통신사업자 모뎀을 통해 통신사업자 네트워크망으로 Alice QUANTUM SERVER로 전송하며;및
QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 통신 가능한 Low 주파수 또는 High 주파수 중 통신속도가 빠른 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 것으로,
QUANTUM DUAL AP는 2.4GHz Low Frequency 및 5GHz High Frequency 이중 송수신이 가능한 것으로 장애물에 따른 통신환경에 따라 데이터의 전송 주파수를 Low Frequency 또는 High Frequency를 선택하는 것으로 데이터 전송 전에 QUANTUM AC와 QUANTUM DUAL AP는 Low Frequency 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 QUANTUM 대칭키로 대용량 데이터를 암호화하여 전송하여 보안강화 통신속도 향상 및 통신요금을 절감하는 것을 특징으로 한다.
Claims 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13 Claims 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, Claims 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38 42. The method of any one of claims 39, 40, 41,
QUANTUM AC inside QUANTUM COLLABO transmits the Alice QUANTUM public key to the Alice QUANTUM SERVER through the operator's modem to the operator's network network; and
It transmits the video data captured by the surveillance camera encrypted with the QUANTUM symmetric key to the QUANTUM DUAL AP through the unlicensed frequency modem, which has the fastest communication speed among low frequency or high frequency that can be communicated.
QUANTUM DUAL AP is capable of dual transmission and reception of 2.4GHz Low Frequency and 5GHz High Frequency. It selects Low Frequency or High Frequency for data transmission according to the communication environment according to obstacles. Before data transmission, QUANTUM AC and QUANTUM DUAL AP have and High Frequency PING test, selects a frequency with a fast response speed, encrypts large data with the QUANTUM symmetric key and transmits it to enhance security, improve communication speed and reduce communication charges.
PIN 데이터(PIN DATA)를 추출하여 암호화 함수(HASH; 고정길이 해시함수)로 암호화하여 개인키<HASH(PIN DATA)>를 생성하며;
QRNG 양자난수생성기로부터 양자난수(QRN)를 수신하여 개인키<HASH(PIN DATA)>를 상기 양자난수(QRN)로 베타적 논리합(EX-OR/+) 암호화하여 공개키<HASH(PIN DATA)+(QRN)>를 생성하며;
공개키<HASH(PIN DATA)+(QRN)>로 데이터를 암호화한 데이터<HASH(PIN DATA)+(QRN)∥DATA>를 생성하는 것을 특징으로 한다.
Claims 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13 Claims 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, Claims 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38 42. The method of any one of claims 39, 40, 41,
extracting PIN data and encrypting it with an encryption function (HASH; fixed-length hash function) to generate a private key <HASH(PIN DATA)>;
Receive a quantum random number (QRN) from a QRNG quantum random number generator and beta-OR (EX-OR/+) the private key <HASH(PIN DATA)> with the quantum random number (QRN) to encrypt the public key <HASH(PIN DATA) generate +(QRN)>;
It is characterized in that data <HASH(PIN DATA)+(QRN)|DATA> is generated by encrypting data with the public key <HASH(PIN DATA)+(QRN)>
PIN 데이터(PIN DATA)를 추출하여 암호화함수로 암호화하여 개인키<HASH(PIN DATA)>를 생성하며;
QRNG 양자난수생성기로부터 양자난수(QRN)를 수신하여 개인키<HASH(PIN DATA)>를 상기 양자난수(QRN)로 암호화하여 공개키<HASH(PIN DATA)+(QRN)>를 생성하며;
공개키<HASH(PIN DATA)+(QRN)>로 데이터를 암호화한 데이터<HASH(PIN DATA)+(QRN)∥DATA>를 생성하는 것을 특징으로 한다.
Claims 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13 Claims 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, Claims 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38 42. The method of any one of claims 39, 40, 41,
extracting PIN data and encrypting it with an encryption function to generate a private key <HASH(PIN DATA)>;
receiving a quantum random number (QRN) from a QRNG quantum random number generator and encrypting the private key <HASH(PIN DATA)> with the quantum random number (QRN) to generate a public key <HASH(PIN DATA)+(QRN)>;
It is characterized in that data <HASH(PIN DATA)+(QRN)|DATA> is generated by encrypting data with the public key <HASH(PIN DATA)+(QRN)>
QRNG(Quantum Random Number Generator) 양자난수생성기는 TRNG(True Random Number Generator) 자연난수 생성기로 대체되는 것을 특징으로 한다.
Claims 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13 Claims 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, Claims 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38 42. The method of any one of claims 39, 40, 41,
The QRNG (Quantum Random Number Generator) quantum random number generator is characterized in that it is replaced by a TRNG (True Random Number Generator) natural random number generator.
PUF(Phisycally Unclonable Function)는 NFC(Near Field Communication)로 대체되어,
NFC Writer를 통해 NFC(Near Field Communication)에 PIN(Personal Identification Number) 데이터를 입력하고 NFC Reader를 통해 PIN(Personal Identification Number) 데이터를 읽어 출력하는 것을 특징으로 한다.
Claims 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13 Claims 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, Claims 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38 42. The method of any one of claims 39, 40, 41,
PUF (Physically Unclonable Function) is replaced by NFC (Near Field Communication),
It is characterized in that PIN (Personal Identification Number) data is input to NFC (Near Field Communication) through NFC Writer, and PIN (Personal Identification Number) data is read and output through NFC Reader.
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장하는 Alice PIN 데이터를 생성단계;
QUANTUM COLLABO 내부 QUANTUM JUMP ENGINE은 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 베타적 논리합(EX-OR) 암호화 연산하여 OTP(One Time Password) Eve QUANTUM 공개키를 생성하는 Eve QUANTUM 공개키 생성단계;
QUANTUM COLLABO 내부 QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 전송단계;
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 통해 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER는 SK텔레콤 통신사업자 LoRA 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA(Certification Authority certificate)를 non-QUANTUM CHANNEL 또는 BB84 QUANTUM CHANNEL 또는 PUF-QRNG TWIN USB를 통한 hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Bob QUANTUM SERVER로 전송하는 유선네트워크망 전송단계;
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA를 2.4GHz Low Frequency로 QUANTUM COLLABO 내부 QUANTUM AC(QUANTUM Access Controller)로 전송하는 QUANTUM AC 전송단계;
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화한 QUANTUM CA를 Eve QUANTUM 개인키로 복호화 하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화하는 복호화단계;
QUANTUM COLLABO는 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터를 추출한 후 상기 복호화단계에서 생성된 Eve PIN 데이터와 상기 eve-NFC Chip으로 부터 추출한 Eve PIN 데이터와 일치할 경우, Alice QUANTUM 공개키로 감시카메라 촬영 영상데이터를 암호화하여 QUANTUM AC(Access Controller)로 전송하는 영상데이터 전송 준비단계;
QUANTUM AC(Access Controller) 및 High Frequency PING 테스트를 실시하여 응답속도가 빠른 주파수를 선택하여 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 QUANTUM DUAL AP로 전송하는 영상데이터 전송단계;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하면, non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 영상데이터 수신단계;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 영상데이터 복호화단계;
Alice QUANTUM SERVER에 양자스마트폰이 외부망메인보드에 접속하면, Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 재생성하여, Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 재생성하는 Alice QUANTUM 개인키를 재생성단계;
Alice 양자난수생성기로 부터 새로운 양자난수를 생성한 신규 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 베타적 논리합(EX-OR) 암호화 연산하여 new Alice QUANTUM 공개키를 생성하는 new Alice QUANTUM 공개키 생성단계;
상기 new Alice QUANTUM 공개키를 양자스마트폰으로 전송하면, 양자스마트폰은 new Alice QUANTUM 공개키로 상기 NFC Tag를 양자스마트폰 NFC칩에 태깅하여 생성된 OTP(One Time Password) 의사난수를 암호화하여 재전송하는 OTP 전송단계;
Alice QUANTUM SERVER는 QUANTUM 개인키로 new Alice QUANTUM 공개키로 암호화된 OTP(One Time Password) 의사난수를 복호화 후 저장된 OTP(One Time Password) 의사난수와 일치할 경우, 감시카메라 촬영 영상데이터를 망분리서버 내부망메인보드를 통해 외부망메인보드로 전송하는 영상반출 준비단계;
양자스마트폰은 외부망메인보드에 접속하여 양자스마트폰 MAC Address를 ID로 상기 OTP(One Time Password) 의사난수를 One-Time Password로 로그인하여 상기 영상데이터를 수신하는 영상반출단계;를 특징으로 하는 HYBRID-QUANTUM CHANNEL에 적용된 ONE-WAY-RING/TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.
The eve-NFC Chip is one of the physical PUFs (Physically Unclonable Functions) that are replaced during regular inspection, and the Eve PIN data generation step of inputting the Eve PIN data through the NFC Writer and storing it in the Alice QUANTUM SERVER;
Alice QUANTUM SERVER generates Alice PIN data through the Alice pseudo-random number generator inside and stores the Alice PIN data in QUANTUM COLLABO;
The QUANTUM JUMP ENGINE inside QUANTUM COLLABO receives the Eve PIN data stored in the eve-NFC Chip through contactless near field communication, and the NFC Reader stores it in the PUF-PIN memory and then converts the Eve PIN data as a random number seed. Eve QUANTUM private key generation step of generating the Eve QUANTUM private key;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random numbers and performs beta-OR (EX-OR) encryption operation of Eve QUANTUM private key with the quantum random number seed to generate OTP (One Time Password) Eve QUANTUM public key. Eve QUANTUM public key generation step;
QUANTUM COLLABO internal QUANTUM AC (Access Controller) transmits the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency modem among the multi-communication modems through the licensed frequency SK Telecom carrier LoRA wireless network network Eve QUANTUM public key transmission step;
Alice QUANTUM SERVER generates Alice PIN data through the Alice pseudo-random number generator, and generates the Alice QUANTUM private key by using the Alice PIN data as a random number seed to generate the Alice QUANTUM private key;
Alice QUANTUM SERVER generates the Alice QUANTUM public key that generates the Alice QUANTUM public key by performing an EX-OR encryption operation on the Alice QUANTUM private key with a quantum random number seed that generates a quantum random number through the Alice quantum random number generator. step;
Alice QUANTUM SERVER transfers the Eve PIN data stored inside the Eve QUANTUM public key received through SK Telecom’s LoRA wireless network network and the QUANTUM CA (Certification Authority certificate) that encrypted the Alice QUANTUM public key to non-QUANTUM CHANNEL or BB84 QUANTUM CHANNEL. or a wired network transmission step of transmitting to Bob QUANTUM SERVER through any one wired network of hybrid-QUANTUM CHANNEL through PUF-QRNG TWIN USB;
Bob QUANTUM SERVER uses QUANTUM DUAL AP (Access Point) to encrypt QUANTUM CA, which has encrypted Eve PIN data stored inside Eve QUANTUM public key and Alice QUANTUM public key, to QUANTUM COLLABO internal QUANTUM AC (QUANTUM Access Controller) at 2.4GHz Low Frequency. QUANTUM AC transmission step of transmitting;
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and QUANTUM CA that encrypted the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt the Alice QUANTUM public key and Eve PIN data;
QUANTUM COLLABO extracts the Eve PIN data extracted from the eve-NFC Chip and matches the Eve PIN data generated in the decryption step with the Eve PIN data extracted from the eve-NFC Chip, the video captured by the surveillance camera with the Alice QUANTUM public key image data transmission preparation step of encrypting data and transmitting it to QUANTUM AC (Access Controller);
A video data transmission step of performing QUANTUM AC (Access Controller) and High Frequency PING tests, selecting a frequency with a fast response speed, and transmitting the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key to the QUANTUM DUAL AP;
When Bob QUANTUM SERVER receives the surveillance camera video data encrypted with the Alice QUANTUM public key from QUANTUM DUAL AP, it goes to Alice QUANTUM SERVER through one of the wired networks of non-QUANTUM CHANNEL, BB84 QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL. receiving image data to be transmitted;
Alice QUANTUM SERVER receives the video data captured by the surveillance camera encrypted with the Alice QUANTUM public key and decrypts the video data with the Alice QUANTUM private key;
When the quantum smartphone accesses the external network mainboard of the Alice QUANTUM SERVER, the Alice QUANTUM SERVER regenerates the Alice PIN data through the Alice pseudo-random number generator, and regenerates the Alice QUANTUM private key with the Alice PIN data as a random number seed. regenerating the Alice QUANTUM private key;
Create a new Alice QUANTUM public key that generates a new Alice QUANTUM public key by performing an EX-OR cryptographic operation on the Alice QUANTUM private key with the new quantum random number seed that generates a new quantum random number from the Alice quantum random number generator step;
When the new Alice QUANTUM public key is transmitted to the quantum smartphone, the quantum smartphone encrypts and retransmits the OTP (One Time Password) pseudo-random number generated by tagging the NFC Tag to the quantum smartphone NFC chip with the new Alice QUANTUM public key. OTP transmission step;
Alice QUANTUM SERVER decrypts the OTP (One Time Password) pseudo-random number encrypted with the new Alice QUANTUM public key with the QUANTUM private key, and if it matches the stored OTP (One Time Password) pseudo-random number, the video data captured by the surveillance camera is transferred to the internal network of the network separation server. image export preparation step of transmitting to the external network main board through the main board;
An image export step of receiving the image data by connecting the quantum smartphone to an external network main board and logging in the OTP (One Time Password) pseudo-random number as the quantum smartphone MAC Address as the ID as the One-Time Password; characterized in that ONE-WAY-RING/TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to HYBRID-QUANTUM CHANNEL.
양자난수생성기(QRNG)는 대칭키 알고리즘의 QUANTUM 대칭키를 생성하기 위한 난수 시드(Seed) early-QRN(Quantum Random Number)을 생성 및 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm)의 QUANTUM 개인키(PRIVATE KEY)를 생성하기 위한 난수 시드(Seed) basic-QRN(Quantum Random Number)와 QUANTUM 공개키(PUBLIC KEY) 쌍을 생성하기 위한 난수 시드(Seed) new-QRN(Quantum Random Number)를 생성하는 new-QRN 생성단계;
Alice QUANTUM SERVER는 통신사업자 네트워크망을 통해 QUANTUM COLLABO와 네트워크망 연결 및 Alice QUANTUM SERVER는 non-QUANTUM CHANNEL, QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 연결된 Bob QUANTUM SERVER를 거쳐 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO와 네트워크망과 연결하는 네트워크망 연결단계;
QUANTUM COLLABO는 QUANTUM AC(Access Controller), Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 통신사업자 네트워크망 중 어느 하나 이상을 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결 또는 QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 통신사업자 모뎀을 통해 통신사업자 네트워크망을 통해 Alice QUANTUM SERVER와 연결하는 네트워크망 선택단계;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN 난수를 생성하여 난수 시드로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN 난수를 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 비대칭키 암호 알고리즘 OTP(One Time Password) Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하고, QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 통신사업자 모뎀으로 통신사업자 네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 전송단계;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN를 수신하여 난수 시드로 비대칭키 암호 알고리즘 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN 난수를 수신하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 비대칭키 암호 알고리즘 OTP(One Time Password) Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER와 QUANTUM COLLABO는 통신사업자 네트워크망을 통하여 Alice QUANTUM 공개키와 Eve QUANTUM 공개키를 서로 교환하는 키 교환단계;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN를 수신하여 Alice QUANTUM 공개키로 early-Eve QRN를 암호화하여 통신사업자 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN를 수신하여 Eve QUANTUM 공개키로 early-Alice QRN를 암호화하여 통신사업자 네트워크망을 통하여 QUANTUM COLLABO로 전송하는 난수전송 단계;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 대칭키 알고리즘의 QUANTUM 대칭키를 생성하고, Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 상기와 동일한 암호화 연산하여 대칭키 알고리즘의 QUANTUM 대칭키를 생성하는 대칭키 생성단계;
Alice QUANTUM SERVER는 QUANTUM COLLABO의 Log 정보를 QUATUM 대칭키로 암호화하여 유선자가망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 비면허주파수 폐쇄형 무선자가망을 통해 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM COLLABO로 전송하고, QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 QUANTUM COLLABO의 Log 정보를 QUANTUM 대칭키로 복호화하여 승인된 Log 정보일 경우, QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하는 로그인 단계;
QUANTUM AC는 QUANTUM DUAL AP를 통해 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 네트워크망 로그인(Log In)된 비면허주파수 폐쇄형 무선자가망을 통해 Bob QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 감시카메라 촬영 영상데이터를 non-QUANTUM CHANNEL, QUANTUM CHANNEL, hybrid-QUANTUM CHANNEL 중 어느 하나의 유선자가망을 통해 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 유선자가망으로 부터 QUANTUM 대칭키로 암호화한 감시카메라 촬영 영상데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.
Alice/Bob QUANTUM SERVER generates a random quantum random number by Alice/Bob through the Alice/Bob Quantum Random Number Generator (QRNG) inside, and uses the Half Mirror Effect Symmetric Cryptographic Algorithm through encryption operation. Characterized in generating a QUANTUM symmetric key,
Quantum random number generator (QRNG) generates a random number seed early-QRN (Quantum Random Number) for generating QUANTUM symmetric key of symmetric key algorithm and QUANTUM private key (PRIVATE KEY) of asymmetric cryptographic algorithm ), a random number seed for generating basic-QRN (Quantum Random Number) and a QUANTUM public key (PUBLIC KEY) pair, a random number seed for generating new-QRN (Quantum Random Number) new-QRN creation step;
Alice QUANTUM SERVER is connected to QUANTUM COLLABO through the network of a telecommunication service provider, and Alice QUANTUM SERVER is a non-licensed frequency closed wireless self-network through Bob QUANTUM SERVER connected through one of non-QUANTUM CHANNEL and QUANTUM CHANNEL wired self-network. A network connection step of connecting QUANTUM COLLABO and the network through the network;
QUANTUM COLLABO is composed of QUANTUM AC (Access Controller) and Eve quantum random number generator. QUANTUM COLLABO controls QUANTUM AC and connects to Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems or QUANTUM COLLABO controls QUANTUM AC a network network selection step of connecting to Alice QUANTUM SERVER through a communication operator network network through a communication operator modem among multi-communication modems;
QUANTUM COLLABO generates a basic-QRN random number from the Eve quantum random number generator and generates an asymmetric key cryptographic algorithm Eve QUANTUM private key with a random number seed Eve QUANTUM private key generation step;
QUANTUM COLLABO generates new-QRN random number from Eve quantum random number generator and encrypts Eve QUANTUM private key and new-QRN random number seed to generate asymmetric key encryption algorithm OTP (One Time Password) Eve QUANTUM public key to QUANTUM AC Transmitting, QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER through the telecommunication carrier network as a telecommunication carrier modem among multi-communication modems;
Alice QUANTUM SERVER is configured with an Alice quantum random number generator inside. Alice QUANTUM SERVER receives basic-QRN from Alice quantum random number generator and generates an asymmetric key cryptographic algorithm Alice QUANTUM private key as a random number seed Alice QUANTUM private key creation step;
Alice QUANTUM SERVER receives new-QRN random number from Alice quantum random number generator and encrypts Alice QUANTUM private key and new-QRN random number seed to generate asymmetric key encryption algorithm OTP (One Time Password) Alice QUANTUM public key Alice QUANTUM public key generation step;
A key exchange step in which Alice QUANTUM SERVER and QUANTUM COLLABO exchange the Alice QUANTUM public key and the Eve QUANTUM public key with each other through a network of a telecommunication service provider;
QUANTUM COLLABO receives the early-Eve QRN from the Eve quantum random number generator, encrypts the early-Eve QRN with the Alice QUANTUM public key, and transmits it to the Alice QUANTUM SERVER through the network of the operator, and the Alice QUANTUM SERVER from the Alice quantum random number generator A random number transmission step of receiving the early-Alice QRN, encrypting the early-Alice QRN with the Eve QUANTUM public key, and transmitting it to the QUANTUM COLLABO through the network of the telecommunication service provider;
QUANTUM COLLABO decrypts early-Alice QRN encrypted with Eve QUANTUM public key with Eve QUANTUM private key, and generates QUANTUM symmetric key of symmetric key algorithm by cryptographic operation with early-Eve QRN. Alice QUANTUM SERVER discloses Alice QUANTUM with Alice QUANTUM private key A symmetric key generation step of generating a QUANTUM symmetric key of a symmetric key algorithm by decrypting the early-Eve QRN encrypted with the key and performing the same encryption operation as the early-Alice QRN;
Alice QUANTUM SERVER encrypts QUANTUM COLLABO's log information with QUATUM symmetric key and transmits it to Bob QUANTUM SERVER through wired self-network, and Bob QUANTUM SERVER encrypts QUANTUM COLLABO's log information with QUATUM symmetric key through unlicensed frequency closed wireless self-network. to QUANTUM COLLABO, and QUANTUM COLLABO decrypts the log information of QUANTUM COLLABO encrypted with the QUATUM symmetric key and decrypts the log information with the QUANTUM symmetric key. If it is the approved log information, it controls QUANTUM AC to close the unlicensed frequency through the unlicensed frequency modem among the multi-communication modems. A login step of connecting Bob QUANTUM SERVER and a network network login (Log In) through a QUANTUM DUAL AP (Access Point) connected through a wireless type wireless network;
QUANTUM AC transmits video data from surveillance cameras encrypted with QUANTUM symmetric key through QUANTUM DUAL AP to Bob QUANTUM SERVER through a closed wireless self-network with unlicensed frequency that is logged in to the network network, and Bob QUANTUM SERVER shoots surveillance cameras Video data is transmitted to Alice QUANTUM SERVER through any one of non-QUANTUM CHANNEL, QUANTUM CHANNEL, and hybrid-QUANTUM CHANNEL wired self-network, and Alice QUANTUM SERVER encrypted surveillance camera video data from the wired self-network with QUANTUM symmetric key. TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to HYBRID-QUANTUM CHANNEL featuring a hybrid-QUANTUM CHANNEL Two-Way-Ring Network, characterized by receiving and decrypting with a QUANTUM symmetric key.
양자난수생성기는 QUANTUM 대칭키를 생성하기 위한 early-QRN 난수를 생성 및 QUANTUM 개인키를 생성하기 위한 basic-QRN 난수와 QUANTUM 공개키를 생성하기 위한 new-QRN 난수를 생성하는 난수생성 단계;
QUANTUM COLLABO는 QUANTUM AC, Eve 양자난수생성기를 포함하여 구성되어, QUANTUM COLLABO는 내부에 QUANTUM AC를 통해 제1 네트워크망 또는 제2 네트워크망 중 어느 하나를 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC를 제어하여 제1 네트워크망을 통해 QUANTUM COLLABO와 연결되는 QUANTUM COLLABO와 Alice QUANTUM SERVER 사이의 제1 네트워크망에 연결 또는 QUANTUM COLLABO는 QUANTUM AC를 제어하여 제2 네트워크망을 통해 Alice QUANTUM SERVER와 연결되는 Alice QUANTUM SERVER와 QUANTUM COLLABO 사이의 제2 네트워크망에 연결하는 네트워크망 연결단계;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성 단계;
QUANTUM COLLABO는 Eve 양자난수생성기로 부터 new-QRN을 생성하여 Eve QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Eve QUANTUM 공개키를 생성하여 QUANTUM AC로 전송하는 QUANTUM AC 전송단계;
QUANTUM AC는 Eve QUANTUM 공개키를 제1 네트워크망으로 연결된 Alice QUANTUM SERVER로 전송하는 Alice QUANTUM SERVER 전송단계;
Alice QUANTUM SERVER는 내부에 Alice 양자난수생성기를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 basic-QRN을 생성하여 난수 시드로 Alice QUANTUM 개인키를 생성하고, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 new-QRN을 생성하여 Alice QUANTUM 개인키와 new-QRN 난수 시드를 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER는 제1 네트워크망을 통하여 Alice QUANTUM 공개키를 QUANTUM COLLABO로 전송하고, QUANTUM COLLABO는 Eve 양자난수생성기로 부터 early-Eve QRN을 수신하여 Alice QUANTUM 공개키로 early-Eve QRN을 암호화하여 제1 네트워크망을 통하여 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 Alice 양자난수생성기로 부터 early-Alice QRN을 수신하여 Eve QUANTUM 공개키로 early-Alice QRN을 암호화하여 제1 네트워크망을 통하여 QUANTUM COLLABO로 전송하는 QUANTUM COLLABO 전송단계;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 early-Alice QRN을 복호화 후 early-Eve QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하고, Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 early-Eve QRN을 복호화 후 early-Alice QRN과 암호화 연산하여 QUANTUM 대칭키를 생성하는 QUANTUM 대칭키 생성단계;
QUANTUM COLLABO는 QUATUM 대칭키로 암호화한 내부 데이터를 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 QUATUM 대칭키로 암호화한 내부 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 것을 특징으로 하는 hybrid-QUANTUM CHANNEL Two-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.
QUANTUM SERVER features QKD (Quantum Key Distribution) that generates and exchanges a QUANTUM symmetric key, QUANTUM private key, and QUANTUM public key using a random quantum random number generated through a quantum random number generator inside.
The quantum random number generator generates an early-QRN random number for generating a QUANTUM symmetric key and a random number generation step of generating a basic-QRN random number for generating a QUANTUM private key and a new-QRN random number for generating a QUANTUM public key;
QUANTUM COLLABO is composed of QUANTUM AC and Eve quantum random number generator, QUANTUM COLLABO selectively selects either the first network or the second network through QUANTUM AC inside, QUANTUM COLLABO uses QUANTUM AC Connected to the first network between QUANTUM COLLABO and Alice QUANTUM SERVER connected to QUANTUM COLLABO through the first network or QUANTUM COLLABO controls QUANTUM AC and Alice QUANTUM connected to Alice QUANTUM SERVER through the second network Network network connection step of connecting to a second network network between the SERVER and QUANTUM COLLABO;
QUANTUM COLLABO generates basic-QRN from Eve quantum random number generator and generates Eve QUANTUM private key with random number seed Eve QUANTUM private key generation step;
QUANTUM COLLABO generates new-QRN from Eve quantum random number generator, encrypts Eve QUANTUM private key and new-QRN random number seed, generates Eve QUANTUM public key, and transmits QUANTUM AC to QUANTUM AC;
QUANTUM AC transmits the Eve QUANTUM public key to the Alice QUANTUM SERVER connected to the first network in the Alice QUANTUM SERVER transmission step;
Alice QUANTUM SERVER is configured with Alice quantum random number generator inside, Alice QUANTUM SERVER generates basic-QRN from Alice quantum random number generator to generate Alice QUANTUM private key as a random number seed, and Alice QUANTUM SERVER generates Alice quantum random number Alice QUANTUM public key generation step of generating a new-QRN from the generator and encrypting the Alice QUANTUM private key and the new-QRN random number seed to generate the Alice QUANTUM public key;
Alice QUANTUM SERVER sends Alice QUANTUM public key to QUANTUM COLLABO through the first network, QUANTUM COLLABO receives early-Eve QRN from Eve quantum random number generator, encrypts early-Eve QRN with Alice QUANTUM public key, and encrypts the first It transmits to Alice QUANTUM SERVER through the network, and Alice QUANTUM SERVER receives the early-Alice QRN from the Alice quantum random number generator, encrypts the early-Alice QRN with the Eve QUANTUM public key, and transmits it to the QUANTUM COLLABO through the first network. QUANTUM COLLABO transmission step;
QUANTUM COLLABO decrypts early-Alice QRN encrypted with Eve QUANTUM public key with Eve QUANTUM private key, and generates QUANTUM symmetric key by cryptographic operation with early-Eve QRN. Alice QUANTUM SERVER early encrypted with Alice QUANTUM public key with Alice QUANTUM private key - QUANTUM symmetric key generation step of generating QUANTUM symmetric key by encrypting with early-Alice QRN after decrypting Eve QRN;
QUANTUM COLLABO transmits internal data encrypted with QUATUM symmetric key to Alice QUANTUM SERVER, and Alice QUANTUM SERVER receives internal data encrypted with QUATUM symmetric key and decrypts with QUANTUM symmetric key hybrid-QUANTUM CHANNEL Two-Way-Ring TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to HYBRID-QUANTUM CHANNEL featuring Network.
Alice QUANTUM SERVER는 non-QUANTUM CHANNEL 또는 QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Bob QUANTUM SERVER와 네트워크망 연결하는 유선네트워크망 연결단계;
Bob QUANTUM SERVER는 QUANTUM DUAL AP(Access Point)를 통해 QUANTUM COLLABO와 비면허주파수 폐쇄형 무선자가망 연결하는 무선자가망 연결단계;
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC(Access Controller)를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 연결 또는 QUANTUM COLLABO는 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결하는 네트워크망 선택 연결단계;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE 내부 Security CPU로 전송하고, MCU는 Security CPU를 제어하여 비접촉식 근거리무선통신(Near Field Communication)을 통해 eve-NFC Chip에 저장된 Eve PIN 데이터를 NFC Reader가 수신하여 PUF-PIN Memory에 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 개인키(PRIVATE KEY)를 생성하는 Eve QUANTUM 개인키 생성단계;
NFC Writer를 통해서 eve-NFC에 Eve PIN 데이터를 입력 및 Alice QUANTUM SERVER에 저장하고, Security CPU는 PUF-PIN Memory에 저장된 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘(asymmetric cryptographic algorithm) Eve QUANTUM 공개키(PUBLIC KEY)를 생성하는 Eve QUANTUM 공개키 생성단계;
Eve QUANTUM 공개키를 Security OTP(One Time Password) Memory에 저장 및 Eve QUANTUM 공개키를 QUANTUM AC(Access Controller)로 전송하고, QUANTUM AC(Access Controller)는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 면허주파수 무선네트워크망 Eve QUANTUM 공개키 전송단계;
Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계;
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하는 재전송단계;
QUANTUM COLLABO 내부 MCU는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성 후 상기 복호화 생성된 Eve PIN 데이터와 eve-NFC로 부터 추출한 Eve PIN 데이터가 일치할 경우, MCU는 SPI Controller를 통해 Network Switch를 ON접점 전환 및 QUANTUM AC(Access Controller)를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP(Access Point)를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하는 로그인단계;
QUANTUM AC(Access Controller)는 QUANTUM DUAL AP를 통해 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송에 있어서, Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 통신 가능한 Low 주파수 또는 High 주파수 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송 또는 QUANTUM DUAL AP와 통신이 불가능할 경우에는 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하고, Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하면, non-QUANTUM CHANNEL 또는 QUANTUM CHANNEL 중 어느 하나의 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 데이터 전송단계;
Alice QUANTUM SERVER는 유선네트워크망과 면허주파수 통신사업자 무선네트워크망 중 어느 하나 이상으로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 복호화 단계;를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.
Alice QUANTUM SERVER is a wireless network connection step of connecting the QUANTUM COLLABO and the network network through the licensed frequency carrier wireless network network;
A wired network connection step of Alice QUANTUM SERVER and Bob QUANTUM SERVER through any one of the non-QUANTUM CHANNEL and QUANTUM CHANNEL wired networks;
Bob QUANTUM SERVER is a wireless self-network connection step of connecting QUANTUM COLLABO and unlicensed frequency closed wireless self-network through QUANTUM DUAL AP (Access Point);
QUANTUM COLLABO selectively selects unlicensed frequency closed wireless self-network or licensed frequency carrier wireless network through QUANTUM AC (Access Controller) in data transmission/reception, QUANTUM COLLABO uses QUANTUM AC (Access Controller) Control and connect with Bob QUANTUM SERVER through QUANTUM DUAL AP (Access Point) connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi communication modems or QUANTUM COLLABO controls QUANTUM AC (Access Controller) to control multi communication modem a network network selection connection step of connecting with Alice QUANTUM SERVER through a wireless network network of a licensed frequency communication service provider through a medium licensed frequency modem;
QUANTUM COLLABO internal Eve quantum random number generator generates quantum random number and transmits it to Encrypt TLS MODULE internal Security CPU, MCU controls Security CPU and Eve PIN data stored in eve-NFC Chip through contactless Near Field Communication Eve QUANTUM private key generation step of generating an asymmetric cryptographic algorithm Eve QUANTUM private key (PRIVATE KEY) with the Eve PIN data as a random number seed after receiving it by the NFC reader and storing it in the PUF-PIN memory;
Input Eve PIN data to eve-NFC through NFC Writer and store it in Alice QUANTUM SERVER, Security CPU encrypts Eve QUANTUM private key stored in PUF-PIN Memory with the quantum random number seed Password) an asymmetric cryptographic algorithm Eve QUANTUM public key generation step of generating an Eve QUANTUM public key (PUBLIC KEY);
Eve QUANTUM public key is stored in Security OTP (One Time Password) Memory and Eve QUANTUM public key is transmitted to QUANTUM AC (Access Controller), and QUANTUM AC (Access Controller) sends Eve QUANTUM public key to licensed frequency modem among multi-communication modems. Eve QUANTUM public key transmission step of the licensed frequency wireless network network transmitting to Alice QUANTUM SERVER through the licensed frequency communication operator wireless network network through the;
Alice QUANTUM SERVER generates Alice PIN data through the Alice pseudo-random number generator, stores it in QUANTUM COLLABO, and generates Alice QUANTUM private key generating Alice QUANTUM private key with Alice PIN data as a random number seed;
Alice QUANTUM public key generation step of generating the Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed radio a retransmission step of retransmitting to QUANTUM COLLABO through the own network;
QUANTUM COLLABO internal MCU decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data, and then uses the decrypted generated Eve PIN data and eve-NFC If the Eve PIN data extracted from the data matches, the MCU switches the Network Switch to ON contact through the SPI Controller and controls QUANTUM AC (Access Controller) to connect to the unlicensed frequency closed wireless self-network through the unlicensed frequency modem among the multi communication modems A login step of connecting Bob QUANTUM SERVER and network network login (Log In) through QUANTUM DUAL AP (Access Point);
QUANTUM AC (Access Controller) transmits the terminal device generated data encrypted with the Alice QUANTUM public key through the QUANTUM DUAL AP to the Bob QUANTUM SERVER who is logged in to the network network, and transmits the terminal device generated data encrypted with the Alice QUANTUM public key. Transmission to QUANTUM DUAL AP through low frequency or high frequency unlicensed frequency modem that can communicate or, if communication with QUANTUM DUAL AP is not possible, through licensed frequency modem among multi communication modems to Alice QUANTUM SERVER through licensed frequency carrier wireless network When Bob QUANTUM SERVER receives terminal device-generated data encrypted with the Alice QUANTUM public key from QUANTUM DUAL AP, it transmits the data to Alice QUANTUM SERVER through either the non-QUANTUM CHANNEL or QUANTUM CHANNEL wired network. ;
Alice QUANTUM SERVER receives terminal device generated data encrypted with the Alice QUANTUM public key from any one or more of a wired network network and a wireless network network of a licensed frequency carrier and decrypts it with the Alice QUANTUM private key; a HYBRID-QUANTUM comprising a TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to CHANNEL.
QUANTUM COLLABO는 데이터 송/수신에 있어서, QUANTUM AC를 통해 비면허주파수 폐쇄형 무선자가망 또는 면허주파수 통신사업자 무선네트워크망을 선택적으로 선택하는 것으로, QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 연결 또는 QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER와 연결을 선택적으로 연결하는 네트워크망 선택단계;
QUANTUM COLLABO 내부 Eve 양자난수생성기는 양자난수를 생성하여 Encrypt TLS MODULE로 전송하면, Encrypt TLS MODULE은 NFC 카드로부터 비접촉식 근거리무선통신(Near Field Communication)으로 Eve PIN 데이터가 수신되면 저장 후 Eve PIN 데이터를 난수 시드(Seed)로 비대칭키 암호 알고리즘 Eve QUANTUM 개인키를 생성하는 Eve QUANTUM 개인키 생성단계;
NFC 카드에 NFC Writer를 통해서 Eve PIN 데이터를 입력 후 Alice QUANTUM SERVER에 저장하고, Encrypt TLS MODULE은 Eve 양자난수생성기로 부터 양자난수를 수신하여 상기 Eve QUANTUM 개인키를 상기 양자난수 시드(Seed)로 암호화 연산하여 OTP(One Time Password) 비대칭키 암호 알고리즘 Eve QUANTUM 공개키를 생성 후 저장 및 Eve QUANTUM 공개키를 QUANTUM AC로 전송하는 전송단계;
QUANTUM AC는 Eve QUANTUM 공개키를 멀티통신모뎀 중 면허주파수 모뎀을 통해 면허주파수 통신사업자 무선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER는 내부에 Alice 의사난수생성기(PRNG) 및 Alice 양자난수생성기(QRNG)를 포함하여 구성되어, Alice QUANTUM SERVER는 Alice 의사난수생성기를 통해 Alice PIN 데이터를 생성하여 QUANTUM COLLABO에 저장 및 Alice PIN 데이터를 난수 시드(Seed)로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키 생성단계;
Alice 양자난수생성기로 부터 양자난수를 생성한 양자난수 시드(Seed)로 Alice QUANTUM 개인키를 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER는 면허주파수 통신사업자 무선네트워크망을 통해 수신한 Eve QUANTUM 공개키로 내부에 저장된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 암호화하여 면허주파수 통신사업자 무선네트워크망 또는 유선네트워크망과 비면허주파수 폐쇄형 무선자가망을 통해 QUANTUM COLLABO로 재전송하는 재전송단계;
QUANTUM COLLABO는 Eve QUANTUM 공개키로 암호화된 Eve PIN 데이터 및 Alice QUANTUM 공개키를 Eve QUANTUM 개인키로 복호화하여 Alice QUANTUM 공개키 및 Eve PIN 데이터를 복호화 생성하는 복호화단계;
상기 복호화단계에서 복호화된 Eve PIN 데이터와 내부에 저장된 Eve PIN 데이터가 일치할 경우, QUANTUM COLLABO는 QUANTUM AC를 제어하여 멀티통신모뎀 중 비면허주파수 모뎀을 통해 비면허주파수 폐쇄형 무선자가망으로 연결된 QUANTUM DUAL AP를 통해 Bob QUANTUM SERVER와 네트워크망 로그인(Log In) 연결하는 로그인단계;
QUANTUM AC는 QUANTUM DUAL AP를 통해 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 네트워크망 로그인(Log In)된 Bob QUANTUM SERVER로 전송함에 있어서, Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 비면허주파수 모뎀을 통해 QUANTUM DUAL AP로 전송하는 비면허주파수 데이터 전송단계;
Bob QUANTUM SERVER는 QUANTUM DUAL AP로 부터 Alice QUANTUM 공개키로 암호화한 단말장치 생성 영상데이터를 수신하면, non-QUANTUM CHANNEL 유선네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Bob QUANTUM SERVER의 유선네트워크망 중계단계;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키로 암호화한 단말장치 생성 데이터를 수신하여 Alice QUANTUM 개인키로 복호화하는 복호화단계;를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법.
Alice QUANTUM SERVER is connected to licensed frequency carrier wireless network, Alice QUANTUM SERVER is connected to Bob QUANTUM SERVER through non-QUANTUM CHANNEL wired network, Bob QUANTUM SERVER is connected to QUANTUM COLLABO through QUANTUM DUAL AP Unlicensed frequency closed wireless self network connected,
QUANTUM COLLABO selectively selects unlicensed frequency closed radio self-network or licensed frequency carrier wireless network network through QUANTUM AC in data transmission/reception, QUANTUM COLLABO controls QUANTUM AC to control unlicensed frequency among multi-communication modems Connected to Bob QUANTUM SERVER through QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through modem or QUANTUM COLLABO controls QUANTUM AC and Alice through licensed frequency modem among multi-communication modems through licensed frequency carrier wireless network Network network selection step of selectively connecting QUANTUM SERVER and connection;
Eve quantum random number generator inside QUANTUM COLLABO generates quantum random number and transmits it to Encrypt TLS MODULE. When Eve PIN data is received from NFC card through contactless near field communication, the Encrypt TLS MODULE stores the Eve PIN data as a random number. Eve QUANTUM private key generation step of generating an asymmetric key encryption algorithm Eve QUANTUM private key as a seed;
After inputting the Eve PIN data to the NFC card through the NFC Writer, it is stored in Alice QUANTUM SERVER, and the Encrypt TLS MODULE receives the quantum random number from the Eve quantum random number generator and encrypts the Eve QUANTUM private key with the quantum random number seed. A transmission step of generating an OTP (One Time Password) asymmetric key encryption algorithm Eve QUANTUM public key by calculating, storing and transmitting the Eve QUANTUM public key to QUANTUM AC;
QUANTUM AC is an Eve QUANTUM public key generation step of transmitting the Eve QUANTUM public key to Alice QUANTUM SERVER through the licensed frequency communication operator wireless network network through the licensed frequency modem among the multi-communication modems;
Alice QUANTUM SERVER is configured with Alice pseudo random number generator (PRNG) and Alice quantum random number generator (QRNG) inside. Alice QUANTUM SERVER generates Alice PIN data through Alice pseudo random number generator and stores it in QUANTUM COLLABO and Alice PIN Alice QUANTUM private key generation step of generating an Alice QUANTUM private key using data as a random number seed;
Alice QUANTUM public key generation step of generating the Alice QUANTUM public key by encrypting the Alice QUANTUM private key with the quantum random number seed generated from the Alice quantum random number generator;
Alice QUANTUM SERVER encrypts the Eve PIN data stored inside and the Alice QUANTUM public key with the Eve QUANTUM public key received through the wireless network network of the licensed frequency carrier, and the licensed frequency carrier wireless network or wired network and unlicensed frequency closed radio a retransmission step of retransmitting to QUANTUM COLLABO through the own network;
QUANTUM COLLABO decrypts the Eve PIN data encrypted with the Eve QUANTUM public key and the Alice QUANTUM public key with the Eve QUANTUM private key to decrypt and generate the Alice QUANTUM public key and Eve PIN data;
If the Eve PIN data decrypted in the decryption step matches the Eve PIN data stored inside, QUANTUM COLLABO controls QUANTUM AC and QUANTUM DUAL AP connected to unlicensed frequency closed wireless self-network through unlicensed frequency modem among multi-communication modems Login step of connecting Bob QUANTUM SERVER and network login (Log In) through
When QUANTUM AC transmits the terminal device generated data encrypted with the Alice QUANTUM public key to the Bob QUANTUM SERVER who is logged in to the network network through the QUANTUM DUAL AP, the terminal device generated data encrypted with the Alice QUANTUM public key is transmitted to the unlicensed frequency modem. Unlicensed frequency data transmission step of transmitting to QUANTUM DUAL AP through;
When the Bob QUANTUM SERVER receives the terminal device-generated image data encrypted with the Alice QUANTUM public key from the QUANTUM DUAL AP, it is transmitted to the Alice QUANTUM SERVER through the non-QUANTUM CHANNEL wired network network.
The TWO-WAY-RING NETWORK QUANTUM KEY distribution method applied to the HYBRID-QUANTUM CHANNEL, characterized in that Alice QUANTUM SERVER receives the terminal device generated data encrypted with the Alice QUANTUM public key and decrypts it with the Alice QUANTUM private key.
QUANTUM COLLABO는 Eve 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Eve QUANTUM 개인키와 암호화 연산하여 Eve QUANTUM 공개키를 생성하는 Eve QUANTUM 공개키를 생성단계;
DUAL MODEM은 Eve QUANTUM 공개키를 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 Eve QUANTUM 공개키 전송단계;
Alice QUANTUM SERVER는 Alice 양자난수생성기를 포함하여 구성되어, Alice 양자난수생성기로 Alice 양자난수를 최초 생성하여 Alice 양자난수를 시드로 Alice QUANTUM 개인키를 생성하는 Alice QUANTUM 개인키를 생성단계;
Alice QUANTUM SERVER는 Alice 양자난수생성기로 양자난수를 재생성하여 난수 시드로 Alice QUANTUM 개인키와 암호화 연산하여 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키를 생성하는 Alice QUANTUM 공개키 생성단계;
Alice QUANTUM SERVER는 Alice QUANTUM 공개키를 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하는 Alice QUANTUM 공개키 전송단계;
QUANTUM COLLABO는 Alice QUANTUM 공개키로 Eve 양자난수를 암호화하여 제1 네트워크망을 통해 Alice QUANTUM SERVER로 전송하고, Alice QUANTUM SERVER는 Eve QUANTUM 공개키로 Alice 양자난수를 암호화하여 제1 네트워크망을 통해 QUANTUM COLLABO로 전송하는 양자난수 교환단계;
QUANTUM COLLABO는 Eve QUANTUM 개인키로 Eve QUANTUM 공개키로 암호화된 Alice 양자난수를 복호화 후 내부 메모리에 저장된 Eve 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하고, 역시 Alice QUANTUM SERVER는 Alice QUANTUM 개인키로 Alice QUANTUM 공개키로 암호화된 Eve 양자난수를 복호화 후 내부 메모리에 저장된 Alice 양자난수와 암호화 연산하여 QUANTUM 대칭키를 생성하여 동일한 QUANTUM 대칭키를 생성하는 QUANTUM 대칭키 생성단계;
QUANTUM COLLABO는 내부 데이터를 QUANTUM 대칭키로 암호화한 암호화 데이터를 DUAL MODEM으로 전송하면, DUAL MODEM은 QUANTUM 대칭키로 암호화한 암호화 데이터를 제2 네트워크망을 통해 Alice QUANTUM SERVER로 전송하는 암호화 데이터 전송단계;
Alice QUANTUM SERVER는 제2 네트워크망으로 부터 QUANTUM 대칭키로 암호화한 암호화 데이터를 수신하여 QUANTUM 대칭키로 복호화하는 복호화단계;를 포함하는 Two-Way-Ring Network를 특징으로하는 HYBRID-QUANTUM CHANNEL에 적용된 TWO-WAY-RING NETWORK QUANTUM KEY 분배방법
QUANTUM COLLABO includes an Eve quantum random number generator, and the Eve QUANTUM private key generation step of first generating an Eve quantum random number with the Eve quantum random number generator and generating the Eve QUANTUM private key using the Eve quantum random number as a seed;
QUANTUM COLLABO generates an Eve QUANTUM public key that generates an Eve QUANTUM public key by regenerating a quantum random number with an Eve quantum random number generator and performing an encryption operation with the Eve QUANTUM private key as a random number seed;
DUAL MODEM transmits Eve QUANTUM public key to Alice QUANTUM SERVER through the first network Eve QUANTUM public key transmission step;
Alice QUANTUM SERVER is configured to include an Alice quantum random number generator, generating an Alice QUANTUM private key that initially generates an Alice quantum random number with the Alice quantum random number generator and generates an Alice QUANTUM private key using the Alice quantum random number as a seed;
Alice QUANTUM SERVER generates an Alice QUANTUM public key generating an Alice QUANTUM public key that generates an Alice QUANTUM public key by regenerating a quantum random number with an Alice quantum random number generator and performing an encryption operation with the Alice QUANTUM private key as a random number seed;
Alice QUANTUM SERVER, Alice QUANTUM public key transmission step of transmitting the Alice QUANTUM public key to QUANTUM COLLABO through the first network;
QUANTUM COLLABO encrypts Eve quantum random number with Alice QUANTUM public key and transmits it to Alice QUANTUM SERVER through the first network, and Alice QUANTUM SERVER encrypts Alice quantum random number with Eve QUANTUM public key and transmits it to QUANTUM COLLABO through the first network a quantum random number exchange step;
QUANTUM COLLABO decrypts Alice quantum random number encrypted with Eve QUANTUM public key with Eve QUANTUM private key and performs encryption operation with Eve quantum random number stored in internal memory to generate QUANTUM symmetric key. Also, Alice QUANTUM SERVER uses Alice QUANTUM private key with Alice QUANTUM public key A QUANTUM symmetric key generation step of generating the same QUANTUM symmetric key by decrypting the encrypted Eve quantum random number and performing an encryption operation with the Alice quantum random number stored in the internal memory;
When QUANTUM COLLABO transmits encrypted data encrypted with QUANTUM symmetric key to DUAL MODEM, DUAL MODEM transmits encrypted data encrypted with QUANTUM symmetric key to Alice QUANTUM SERVER through a second network;
Alice QUANTUM SERVER receives the encrypted data encrypted with the QUANTUM symmetric key from the second network and decrypts it with the QUANTUM symmetric key. -RING NETWORK QUANTUM KEY distribution method
Priority Applications (7)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020200000001A KR102315725B1 (en) | 2020-01-01 | 2020-01-01 | The QRN KEY distribution and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020200147178A KR20210086947A (en) | 2020-01-01 | 2020-11-05 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054785A KR20210086996A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054788A KR20210086997A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054789A KR20210086998A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054793A KR20210087000A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054791A KR20210086999A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020200000001A KR102315725B1 (en) | 2020-01-01 | 2020-01-01 | The QRN KEY distribution and The hybrid quantum communication closure net system distributing different kinds of key |
Related Child Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020200147178A Division KR20210086947A (en) | 2020-01-01 | 2020-11-05 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20210087127A true KR20210087127A (en) | 2021-07-12 |
KR102315725B1 KR102315725B1 (en) | 2021-10-22 |
Family
ID=76859011
Family Applications (7)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020200000001A KR102315725B1 (en) | 2020-01-01 | 2020-01-01 | The QRN KEY distribution and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020200147178A KR20210086947A (en) | 2020-01-01 | 2020-11-05 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054791A KR20210086999A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054793A KR20210087000A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054789A KR20210086998A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054788A KR20210086997A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054785A KR20210086996A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
Family Applications After (6)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020200147178A KR20210086947A (en) | 2020-01-01 | 2020-11-05 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054791A KR20210086999A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054793A KR20210087000A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054789A KR20210086998A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054788A KR20210086997A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
KR1020210054785A KR20210086996A (en) | 2020-01-01 | 2021-04-28 | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key |
Country Status (1)
Country | Link |
---|---|
KR (7) | KR102315725B1 (en) |
Families Citing this family (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR102484127B1 (en) * | 2022-02-09 | 2023-01-04 | 주식회사 대흥솔루션 | The D.A.D one-side data transmission net separation system integrating anti-disaster panels and the integration anti-disaster system for indoor and outdoor and the IP speaker operating system of anti-disaster panels and the way to make newOPEN API DATA through COPYLEFT CRAWLING SERVER |
KR102564375B1 (en) | 2022-05-23 | 2023-08-09 | 서울과학기술대학교 산학협력단 | BLOCKCHAIN BASED DISTRIBUTED QUANTUM NETWORK SYSTEM AND METHOD FOR IoT NETWORK |
Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20110110236A (en) * | 2009-01-26 | 2011-10-06 | 제말토 에스에이 | Method for establishing a secured communication without preliminary information share |
KR20120042383A (en) | 2010-10-25 | 2012-05-03 | 주식회사 원익아이피에스 | Substrate tray and substrate processing equipment using the substrate tray |
KR20120089227A (en) | 2004-10-22 | 2012-08-09 | 도판 인사츠 가부시키가이샤 | Photomask-blank, photomask and fabrication method thereof |
KR20150096606A (en) | 2014-02-14 | 2015-08-25 | 주식회사 엘지생활건강 | Cosmetic vessel |
-
2020
- 2020-01-01 KR KR1020200000001A patent/KR102315725B1/en active
- 2020-11-05 KR KR1020200147178A patent/KR20210086947A/en not_active Application Discontinuation
-
2021
- 2021-04-28 KR KR1020210054791A patent/KR20210086999A/en not_active Application Discontinuation
- 2021-04-28 KR KR1020210054793A patent/KR20210087000A/en not_active Application Discontinuation
- 2021-04-28 KR KR1020210054789A patent/KR20210086998A/en not_active Application Discontinuation
- 2021-04-28 KR KR1020210054788A patent/KR20210086997A/en not_active Application Discontinuation
- 2021-04-28 KR KR1020210054785A patent/KR20210086996A/en not_active Application Discontinuation
Patent Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20120089227A (en) | 2004-10-22 | 2012-08-09 | 도판 인사츠 가부시키가이샤 | Photomask-blank, photomask and fabrication method thereof |
KR20110110236A (en) * | 2009-01-26 | 2011-10-06 | 제말토 에스에이 | Method for establishing a secured communication without preliminary information share |
KR20120042383A (en) | 2010-10-25 | 2012-05-03 | 주식회사 원익아이피에스 | Substrate tray and substrate processing equipment using the substrate tray |
KR20150096606A (en) | 2014-02-14 | 2015-08-25 | 주식회사 엘지생활건강 | Cosmetic vessel |
Non-Patent Citations (2)
Title |
---|
1. 출원번호(일자): PCT/SG2012/000118(2012.04.04) / 발명의 명칭: METHOD AND SYSTEM FOR FORMING A VIRTUAL PRIVATE NETWORK / 출원인: ITWIN PTE LTD 등 |
5. 출원번호(일자): PCT/EP2016/076200(2016.10.31) / 발명의 명칭: METHOD AND DEVICE FOR OPTICS BASED QUANTUM RANDOM NUMBER GENERATION / 출원인: ID QUANTIQUE |
Also Published As
Publication number | Publication date |
---|---|
KR102315725B1 (en) | 2021-10-22 |
KR20210086999A (en) | 2021-07-09 |
KR20210086998A (en) | 2021-07-09 |
KR20210086997A (en) | 2021-07-09 |
KR20210086996A (en) | 2021-07-09 |
KR20210087000A (en) | 2021-07-09 |
KR20210086947A (en) | 2021-07-09 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR101888629B1 (en) | The PUF-QRNG security terminal system | |
KR102172688B1 (en) | The multi-function matrix hash function block chain smart block panel its system | |
KR101993885B1 (en) | The PUF-QRANG quantum system with security chips | |
KR20210086998A (en) | The one-way-ring/two-way-ring network QRN KEY distribution way adopted to hybrid-quantum channel and The hybrid quantum communication unit and The hybrid quantum communication closure net system distributing different kinds of key | |
KR102172693B1 (en) | The Quantum code block chain of the matrix hash function the smart greed panel anti-disaster CCTV and its controlling system | |
KR20190049006A (en) | The PUF-QRNG remote meter reader | |
KR20190102960A (en) | The PUF-QRANG quantum security system and the way to do anti-crime CCTV-QRNG communication and its panel | |
KR102236235B1 (en) | The disaster broadcasting PA in public facility, the remotely functioning A/V smart broadcasting device, a closed network system | |
KR20190138300A (en) | The multi-function matrix hash function block chain (smart block panel, TTS broadcasting system, video-audio broadcasting system in premises, CCTV retaining coded image, NB-IoT maintainer on CCTV in blackbox type, solar ray generator of blockchain metering, LED streetlamp controlling dimming, panel generating solar ray and LED board monitoring thermal burn with processed image of CCTV, controlling apparatus of parking and coding a plate) CCTV monitoring early fire and its system | |
KR20190120129A (en) | The QUANTUM number smartphone transmitted from CCTV's recorded information | |
KR102257607B1 (en) | The way to control ONE-WAY-RING/TWO-WAY-RING NETWORK adapted to hybrid quantum communication channel and its system | |
KR102216671B1 (en) | The Quantum code block chain of the matrix hash function video-audio broadcasting system in premises anti-disaster CCTV and its controlling system | |
KR102182053B1 (en) | The Quantum code block chain of the matrix hash function the LED streetlamp controlling dimming anti-disaster CCTV and its controlling system | |
KR20190102961A (en) | The PUF-QRANG quantum security system and the way to do anti-crime CCTV-QRNG communication and its panel | |
KR20200115437A (en) | The multi-function matrix hash function block chain (smart block panel, TTS broadcasting system, video-audio broadcasting system in premises, CCTV retaining coded image, NB-IoT maintainer on CCTV in blackbox type, solar ray generator of blockchain metering, LED streetlamp controlling dimming, panel generating solar ray and LED board monitoring thermal burn with processed image of CCTV, controlling apparatus of parking and coding a plate) CCTV monitoring early fire and its system | |
KR20200115436A (en) | The multi-function matrix hash function block chain (smart block panel, TTS broadcasting system, video-audio broadcasting system in premises, CCTV retaining coded image, NB-IoT maintainer on CCTV in blackbox type, solar ray generator of blockchain metering, LED streetlamp controlling dimming, panel generating solar ray and LED board monitoring thermal burn with processed image of CCTV, controlling apparatus of parking and coding a plate) CCTV monitoring early fire and its system | |
KR20190102950A (en) | The leakage prevention-remote inspection LPWAN commonication service system loaded Quantum-security chip by anti-CCTV selt networking | |
KR101993882B1 (en) | The PUF-QRNG Quantum-security system | |
KR102216683B1 (en) | The Quantum code block chain of the matrix hash function CCTV retaining coded image anti-disaster CCTV and its controlling system | |
KR102216688B1 (en) | The Quantum code block chain of the matrix hash function solar panel anti-disaster CCTV and its controlling system | |
KR102182062B1 (en) | The Quantum code block chain of the matrix hash function TTS broadcast system anti-disaster CCTV and its controlling system | |
KR20190049069A (en) | The CCTV nonitor loaded the PUF-QRNG security monitor | |
KR20190049332A (en) | The CCTV nonitor loaded the PUF-QRNG security monitor | |
KR20180109652A (en) | The CCTV monitoring system by certifying security system with mixed quantum random numbers and pseudo random numbers | |
KR20190102962A (en) | The PUF-QRANG quantum security system and the way to do anti-crime CCTV-QRNG communication and its panel |