KR20170134260A - 유기 발광 소자 - Google Patents
유기 발광 소자 Download PDFInfo
- Publication number
- KR20170134260A KR20170134260A KR1020170065415A KR20170065415A KR20170134260A KR 20170134260 A KR20170134260 A KR 20170134260A KR 1020170065415 A KR1020170065415 A KR 1020170065415A KR 20170065415 A KR20170065415 A KR 20170065415A KR 20170134260 A KR20170134260 A KR 20170134260A
- Authority
- KR
- South Korea
- Prior art keywords
- group
- substituted
- unsubstituted
- formula
- same
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 131
- 125000003118 aryl group Chemical group 0.000 claims description 71
- 125000001072 heteroaryl group Chemical group 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 32
- 239000011368 organic material Substances 0.000 claims description 31
- 125000003277 amino group Chemical group 0.000 claims description 25
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 19
- 125000004104 aryloxy group Chemical group 0.000 claims description 19
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 claims description 19
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 125000002560 nitrile group Chemical group 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 17
- UFHFLCQGNIYNRP-VVKOMZTBSA-N Dideuterium Chemical compound [2H][2H] UFHFLCQGNIYNRP-VVKOMZTBSA-N 0.000 claims description 16
- 125000000623 heterocyclic group Chemical group 0.000 claims description 15
- 125000002950 monocyclic group Chemical group 0.000 claims description 15
- 239000000126 substance Substances 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000000732 arylene group Chemical group 0.000 claims description 9
- 230000000903 blocking effect Effects 0.000 claims description 9
- 125000005549 heteroarylene group Chemical group 0.000 claims description 8
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 claims description 4
- 125000006267 biphenyl group Chemical group 0.000 claims description 3
- 239000010410 layer Substances 0.000 abstract description 109
- 239000012044 organic layer Substances 0.000 abstract description 29
- 230000000052 comparative effect Effects 0.000 description 124
- -1 n-octyl Chemical group 0.000 description 51
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 46
- 239000000463 material Substances 0.000 description 30
- 238000002347 injection Methods 0.000 description 20
- 239000007924 injection Substances 0.000 description 20
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 16
- 239000000758 substrate Substances 0.000 description 12
- AWXGSYPUMWKTBR-UHFFFAOYSA-N 4-carbazol-9-yl-n,n-bis(4-carbazol-9-ylphenyl)aniline Chemical compound C12=CC=CC=C2C2=CC=CC=C2N1C1=CC=C(N(C=2C=CC(=CC=2)N2C3=CC=CC=C3C3=CC=CC=C32)C=2C=CC(=CC=2)N2C3=CC=CC=C3C3=CC=CC=C32)C=C1 AWXGSYPUMWKTBR-UHFFFAOYSA-N 0.000 description 11
- 125000003367 polycyclic group Chemical group 0.000 description 11
- 101000837344 Homo sapiens T-cell leukemia translocation-altered gene protein Proteins 0.000 description 10
- 102100028692 T-cell leukemia translocation-altered gene protein Human genes 0.000 description 10
- 229910052782 aluminium Inorganic materials 0.000 description 10
- 239000012153 distilled water Substances 0.000 description 10
- 230000005525 hole transport Effects 0.000 description 10
- 230000032258 transport Effects 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000000151 deposition Methods 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- LCPYTQFVQRPZCV-UHFFFAOYSA-N n-[4-(4-carbazol-9-ylphenyl)phenyl]-4-phenyl-n-(4-phenylphenyl)aniline Chemical compound C1=CC=CC=C1C1=CC=C(N(C=2C=CC(=CC=2)C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N2C3=CC=CC=C3C3=CC=CC=C32)C=C1 LCPYTQFVQRPZCV-UHFFFAOYSA-N 0.000 description 6
- 125000005264 aryl amine group Chemical group 0.000 description 5
- 239000010406 cathode material Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000005241 heteroarylamino group Chemical group 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- IMKMFBIYHXBKRX-UHFFFAOYSA-M lithium;quinoline-2-carboxylate Chemical compound [Li+].C1=CC=CC2=NC(C(=O)[O-])=CC=C21 IMKMFBIYHXBKRX-UHFFFAOYSA-M 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 0 *C1(*)c(cccc2)c2C2=C1CCC=C2N(*)* Chemical compound *C1(*)c(cccc2)c2C2=C1CCC=C2N(*)* 0.000 description 4
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 4
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- JAWMENYCRQKKJY-UHFFFAOYSA-N [3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-ylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]methanone Chemical compound N1N=NC=2CN(CCC=21)CC1=NOC2(C1)CCN(CC2)C(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F JAWMENYCRQKKJY-UHFFFAOYSA-N 0.000 description 4
- 239000010405 anode material Substances 0.000 description 4
- 150000004982 aromatic amines Chemical class 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 239000003599 detergent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000010409 thin film Substances 0.000 description 4
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 3
- DMEVMYSQZPJFOK-UHFFFAOYSA-N 3,4,5,6,9,10-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8(13),9,11,14,16-nonaene Chemical group N1=NN=C2C3=CC=CC=C3C3=CC=NN=C3C2=N1 DMEVMYSQZPJFOK-UHFFFAOYSA-N 0.000 description 3
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 3
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 229910045601 alloy Inorganic materials 0.000 description 3
- 239000000956 alloy Substances 0.000 description 3
- 125000001769 aryl amino group Chemical group 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 229920001940 conductive polymer Polymers 0.000 description 3
- 238000004770 highest occupied molecular orbital Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- SFMJNHNUOVADRW-UHFFFAOYSA-N n-[5-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-enamide Chemical compound C1=C(NC(=O)C=C)C(C)=CC=C1N1C(=O)C=CC2=C1C1=CC(C=3C=CC(NS(C)(=O)=O)=CC=3)=CC=C1N=C2 SFMJNHNUOVADRW-UHFFFAOYSA-N 0.000 description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- VQGHOUODWALEFC-UHFFFAOYSA-N 2-phenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CC=N1 VQGHOUODWALEFC-UHFFFAOYSA-N 0.000 description 2
- QENGPZGAWFQWCZ-UHFFFAOYSA-N 3-Methylthiophene Chemical compound CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 description 2
- JDGDLKDQACLMQC-UHFFFAOYSA-N 3-bromo-9-(2-phenylphenyl)carbazole Chemical compound C1(=C(C=CC=C1)N1C2=CC=CC=C2C=2C=C(C=CC1=2)Br)C1=CC=CC=C1 JDGDLKDQACLMQC-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical group C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 description 2
- 125000006614 N-arylalkylamine group Chemical group 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 125000003609 aryl vinyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 2
- 150000004696 coordination complex Chemical class 0.000 description 2
- 239000002019 doping agent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000005240 physical vapour deposition Methods 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000553 poly(phenylenevinylene) Polymers 0.000 description 2
- 229920000767 polyaniline Polymers 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- UWRZIZXBOLBCON-VOTSOKGWSA-N (e)-2-phenylethenamine Chemical compound N\C=C\C1=CC=CC=C1 UWRZIZXBOLBCON-VOTSOKGWSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical group C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- WONYVCKUEUULQN-UHFFFAOYSA-N 2-methyl-n-(2-methylphenyl)aniline Chemical group CC1=CC=CC=C1NC1=CC=CC=C1C WONYVCKUEUULQN-UHFFFAOYSA-N 0.000 description 1
- JTMODJXOTWYBOZ-UHFFFAOYSA-N 2-methyl-n-phenylaniline Chemical group CC1=CC=CC=C1NC1=CC=CC=C1 JTMODJXOTWYBOZ-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- DDTHMESPCBONDT-UHFFFAOYSA-N 4-(4-oxocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-one Chemical compound C1=CC(=O)C=CC1=C1C=CC(=O)C=C1 DDTHMESPCBONDT-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 1
- NWSNKDVRPGMTBN-UHFFFAOYSA-N CC1(C)c(cc(cc2)N(c(cc3)ccc3-c(cc3)ccc3-c(cc3)ccc3-[n]3c4ccccc4c4c3cccc4)c(cc3)ccc3-c(cc3)ccc3-c(cc3)ccc3-[n]3c4ccccc4c4c3cccc4)c2-c2c1cccc2 Chemical compound CC1(C)c(cc(cc2)N(c(cc3)ccc3-c(cc3)ccc3-c(cc3)ccc3-[n]3c4ccccc4c4c3cccc4)c(cc3)ccc3-c(cc3)ccc3-c(cc3)ccc3-[n]3c4ccccc4c4c3cccc4)c2-c2c1cccc2 NWSNKDVRPGMTBN-UHFFFAOYSA-N 0.000 description 1
- FXOLQEOUUBSKIF-UHFFFAOYSA-N CC1(C)c2cc(-[n](c(c(c3c4)c5)ccc5-c(cc5)ccc5-c(cc5)ccc5-[n]5c(cccc6)c6c6c5cccc6)c3ccc4-c(cc3)ccc3-c(cc3)ccc3-[n]3c4ccccc4c4c3cccc4)ccc2-c2c1cccc2 Chemical compound CC1(C)c2cc(-[n](c(c(c3c4)c5)ccc5-c(cc5)ccc5-c(cc5)ccc5-[n]5c(cccc6)c6c6c5cccc6)c3ccc4-c(cc3)ccc3-c(cc3)ccc3-[n]3c4ccccc4c4c3cccc4)ccc2-c2c1cccc2 FXOLQEOUUBSKIF-UHFFFAOYSA-N 0.000 description 1
- IEMHUPRJYZKRKX-UHFFFAOYSA-N CC1(C)c2cc(N(c(cc3)cc4c3-c3ccccc3C4(c3ccc4)c5ccccc5-[n]5c3c4c3c5cccc3)c(cccc3)c3-c3ccccc3)ccc2-c2ccccc12 Chemical compound CC1(C)c2cc(N(c(cc3)cc4c3-c3ccccc3C4(c3ccc4)c5ccccc5-[n]5c3c4c3c5cccc3)c(cccc3)c3-c3ccccc3)ccc2-c2ccccc12 IEMHUPRJYZKRKX-UHFFFAOYSA-N 0.000 description 1
- JVXTVOPMWPEUFX-UHFFFAOYSA-N CC1(C)c2cc(N(c(cc3)ccc3-c3ccccc3)c(cc3)cc4c3-c3ccccc3C43c4ccccc4-[n]4c5c3cccc5c3c4cccc3)ccc2-c2ccccc12 Chemical compound CC1(C)c2cc(N(c(cc3)ccc3-c3ccccc3)c(cc3)cc4c3-c3ccccc3C43c4ccccc4-[n]4c5c3cccc5c3c4cccc3)ccc2-c2ccccc12 JVXTVOPMWPEUFX-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910052688 Gadolinium Inorganic materials 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- NFTRAGGUIJBGHD-UHFFFAOYSA-N N-(9H-fluoren-1-yl)phenanthren-1-amine Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC1=2)NC1=CC=CC=2C3=CC=CC=C3CC1=2 NFTRAGGUIJBGHD-UHFFFAOYSA-N 0.000 description 1
- ACYWVHCCUGTDEW-UHFFFAOYSA-N N-naphthalen-1-yl-9H-fluoren-1-amine Chemical group C1(=CC=CC2=CC=CC=C12)NC1=CC=CC=2C3=CC=CC=C3CC12 ACYWVHCCUGTDEW-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- YXLXNENXOJSQEI-UHFFFAOYSA-L Oxine-copper Chemical compound [Cu+2].C1=CN=C2C([O-])=CC=CC2=C1.C1=CN=C2C([O-])=CC=CC2=C1 YXLXNENXOJSQEI-UHFFFAOYSA-L 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 1
- 229910052772 Samarium Inorganic materials 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052769 Ytterbium Inorganic materials 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 125000005332 alkyl sulfoxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- YUENFNPLGJCNRB-UHFFFAOYSA-N anthracen-1-amine Chemical compound C1=CC=C2C=C3C(N)=CC=CC3=CC2=C1 YUENFNPLGJCNRB-UHFFFAOYSA-N 0.000 description 1
- 150000001454 anthracenes Chemical class 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- DMVOXQPQNTYEKQ-UHFFFAOYSA-N biphenyl-4-amine Chemical compound C1=CC(N)=CC=C1C1=CC=CC=C1 DMVOXQPQNTYEKQ-UHFFFAOYSA-N 0.000 description 1
- UFVXQDWNSAGPHN-UHFFFAOYSA-K bis[(2-methylquinolin-8-yl)oxy]-(4-phenylphenoxy)alumane Chemical compound [Al+3].C1=CC=C([O-])C2=NC(C)=CC=C21.C1=CC=C([O-])C2=NC(C)=CC=C21.C1=CC([O-])=CC=C1C1=CC=CC=C1 UFVXQDWNSAGPHN-UHFFFAOYSA-K 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- UHUUKDVZQCHKRZ-UHFFFAOYSA-N c(cc1)cc(cc2)c1cc2-[n](c(ccc(-c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Sc2c1cccc2)c1)c1c1c2)c1ccc2-c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Sc2ccccc12 Chemical compound c(cc1)cc(cc2)c1cc2-[n](c(ccc(-c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Sc2c1cccc2)c1)c1c1c2)c1ccc2-c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Sc2ccccc12 UHUUKDVZQCHKRZ-UHFFFAOYSA-N 0.000 description 1
- GJODZDYFWBQQHY-UHFFFAOYSA-N c(cc1)cc(cc2)c1cc2N(c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Sc2c1cccc2)c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Sc2c1cccc2 Chemical compound c(cc1)cc(cc2)c1cc2N(c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Sc2c1cccc2)c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Sc2c1cccc2 GJODZDYFWBQQHY-UHFFFAOYSA-N 0.000 description 1
- VSNOVYYTZYLGPD-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1-[n](c(c(c1c2)c3)ccc3-c(cc3)ccc3-c(cc3)ccc3-[n]3c(cccc4)c4c4c3cccc4)c1ccc2-c(cc1)ccc1-c(cc1)ccc1-[n]1c2ccccc2c2c1cccc2 Chemical compound c(cc1)ccc1-c(cc1)ccc1-[n](c(c(c1c2)c3)ccc3-c(cc3)ccc3-c(cc3)ccc3-[n]3c(cccc4)c4c4c3cccc4)c1ccc2-c(cc1)ccc1-c(cc1)ccc1-[n]1c2ccccc2c2c1cccc2 VSNOVYYTZYLGPD-UHFFFAOYSA-N 0.000 description 1
- YKDRFLACKIDPJV-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1-[n]1c(ccc(-c(cc2)ccc2-c(cc2c3ccccc33)ccc2[n]3-c2ccccc2)c2)c2c2c1ccc(-c(cc1)ccc1-c(cc1)cc(c3ccccc33)c1[n]3-c1ccccc1)c2 Chemical compound c(cc1)ccc1-c(cc1)ccc1-[n]1c(ccc(-c(cc2)ccc2-c(cc2c3ccccc33)ccc2[n]3-c2ccccc2)c2)c2c2c1ccc(-c(cc1)ccc1-c(cc1)cc(c3ccccc33)c1[n]3-c1ccccc1)c2 YKDRFLACKIDPJV-UHFFFAOYSA-N 0.000 description 1
- WRFWOMVUVBOPSU-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C2(c1ccc2)c3ccccc3-[n]3c1c2c1c3cccc1)c(cccc1)c1-c1ccccc1 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C2(c1ccc2)c3ccccc3-[n]3c1c2c1c3cccc1)c(cccc1)c1-c1ccccc1 WRFWOMVUVBOPSU-UHFFFAOYSA-N 0.000 description 1
- BKIABOFWJPXEHU-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C21c2ccccc2-[n]2c3c1cccc3c1c2cccc1)c1ccc(c2ccccc2c2c3cccc2)c3c1 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C21c2ccccc2-[n]2c3c1cccc3c1c2cccc1)c1ccc(c2ccccc2c2c3cccc2)c3c1 BKIABOFWJPXEHU-UHFFFAOYSA-N 0.000 description 1
- PSEXBHGMEARDEO-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1-c(cc1)cc(c2ccccc22)c1[n]2-c1ccccc1)c(cc1)ccc1-c(cc1)ccc1-c(cc1c2c3cccc2)ccc1[n]3-c1ccccc1 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1-c(cc1)cc(c2ccccc22)c1[n]2-c1ccccc1)c(cc1)ccc1-c(cc1)ccc1-c(cc1c2c3cccc2)ccc1[n]3-c1ccccc1 PSEXBHGMEARDEO-UHFFFAOYSA-N 0.000 description 1
- AAHWCADBXVZHMK-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1-[n]1c2ccccc2c2c1cccc2)c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1-[n]1c2ccccc2c2c1cccc2 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1-[n]1c2ccccc2c2c1cccc2)c(cc1)ccc1-c(cc1)ccc1-c(cc1)ccc1-[n]1c2ccccc2c2c1cccc2 AAHWCADBXVZHMK-UHFFFAOYSA-N 0.000 description 1
- IHSSEGURHZOJRB-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Oc2c1cccc2)c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Oc2c1cccc2 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Oc2c1cccc2)c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Oc2c1cccc2 IHSSEGURHZOJRB-UHFFFAOYSA-N 0.000 description 1
- BTOFMEGNWGVZSD-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Sc2ccccc12)c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Sc2ccccc12 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c(cc1)ccc1N1c2ccccc2Sc2ccccc12)c(cc1)ccc1-c(cc1)ccc1N1c(cccc2)c2Sc2ccccc12 BTOFMEGNWGVZSD-UHFFFAOYSA-N 0.000 description 1
- AZZYDSDRQRDNNE-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c1ccccc1)c(cc1)cc2c1-c1ccccc1C2(c1ccc2)c3ccccc3-[n]3c1c2c1c3cccc1 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c(cc1)ccc1-c1ccccc1)c(cc1)cc2c1-c1ccccc1C2(c1ccc2)c3ccccc3-[n]3c1c2c1c3cccc1 AZZYDSDRQRDNNE-UHFFFAOYSA-N 0.000 description 1
- ZRUPBKFPAKQNLI-UHFFFAOYSA-N c(cc1)ccc1-c(cc1)ccc1N(c1ccccc1)c(cc1)cc2c1-c1ccccc1C21c2ccccc2-[n]2c3c1cccc3c1c2cccc1 Chemical compound c(cc1)ccc1-c(cc1)ccc1N(c1ccccc1)c(cc1)cc2c1-c1ccccc1C21c2ccccc2-[n]2c3c1cccc3c1c2cccc1 ZRUPBKFPAKQNLI-UHFFFAOYSA-N 0.000 description 1
- BLASGQNECKPHQB-UHFFFAOYSA-N c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C21c2ccccc2-[n]2c3c1cccc3c1c2cccc1)c1ccc(c2ccccc2c2c3cccc2)c3c1 Chemical compound c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C21c2ccccc2-[n]2c3c1cccc3c1c2cccc1)c1ccc(c2ccccc2c2c3cccc2)c3c1 BLASGQNECKPHQB-UHFFFAOYSA-N 0.000 description 1
- HRFOVEBPDKNJJS-UHFFFAOYSA-N c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C21c2ccccc2N(c2ccccc2)c2c1cccc2)c1ccc(c2ccccc2c2ccccc22)c2c1 Chemical compound c(cc1)ccc1N(c(cc1)cc2c1-c1ccccc1C21c2ccccc2N(c2ccccc2)c2c1cccc2)c1ccc(c2ccccc2c2ccccc22)c2c1 HRFOVEBPDKNJJS-UHFFFAOYSA-N 0.000 description 1
- BSDKGODDMMJYOG-UHFFFAOYSA-N c(cc1)ccc1N(c1ccccc1)c(cc1)cc2c1-c1ccccc1C2(c1ccc2)c3ccccc3-[n]3c1c2c1c3cccc1 Chemical compound c(cc1)ccc1N(c1ccccc1)c(cc1)cc2c1-c1ccccc1C2(c1ccc2)c3ccccc3-[n]3c1c2c1c3cccc1 BSDKGODDMMJYOG-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 150000001716 carbazoles Chemical class 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- XOYLJNJLGBYDTH-UHFFFAOYSA-M chlorogallium Chemical compound [Ga]Cl XOYLJNJLGBYDTH-UHFFFAOYSA-M 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 150000004826 dibenzofurans Chemical class 0.000 description 1
- IYYZUPMFVPLQIF-ALWQSETLSA-N dibenzothiophene Chemical group C1=CC=CC=2[34S]C3=C(C=21)C=CC=C3 IYYZUPMFVPLQIF-ALWQSETLSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical group C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000002219 fluoranthenes Chemical class 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 150000002240 furans Chemical class 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 230000005283 ground state Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000007641 inkjet printing Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- NJVSFOMTEFOHMI-UHFFFAOYSA-N n,2-diphenylaniline Chemical group C=1C=CC=C(C=2C=CC=CC=2)C=1NC1=CC=CC=C1 NJVSFOMTEFOHMI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- HCISEFFYVMEPNF-UHFFFAOYSA-N n-phenyl-9h-fluoren-1-amine Chemical group C=12CC3=CC=CC=C3C2=CC=CC=1NC1=CC=CC=C1 HCISEFFYVMEPNF-UHFFFAOYSA-N 0.000 description 1
- UMGBMWFOGBJCJA-UHFFFAOYSA-N n-phenylphenanthren-1-amine Chemical group C=1C=CC(C2=CC=CC=C2C=C2)=C2C=1NC1=CC=CC=C1 UMGBMWFOGBJCJA-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 150000002964 pentacenes Chemical class 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N perylene Chemical compound C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 1
- FVDOBFPYBSDRKH-UHFFFAOYSA-N perylene-3,4,9,10-tetracarboxylic acid Chemical compound C=12C3=CC=C(C(O)=O)C2=C(C(O)=O)C=CC=1C1=CC=C(C(O)=O)C2=C1C3=CC=C2C(=O)O FVDOBFPYBSDRKH-UHFFFAOYSA-N 0.000 description 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 1
- 125000001828 phenalenyl group Chemical group C1(C=CC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 150000002987 phenanthrenes Chemical class 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920002098 polyfluorene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000128 polypyrrole Polymers 0.000 description 1
- 229920000123 polythiophene Polymers 0.000 description 1
- 150000004032 porphyrins Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003220 pyrenes Chemical class 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- YYMBJDOZVAITBP-UHFFFAOYSA-N rubrene Chemical compound C1=CC=CC=C1C(C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C(C=2C=CC=CC=2)=C11)=C(C=CC=C2)C2=C1C1=CC=CC=C1 YYMBJDOZVAITBP-UHFFFAOYSA-N 0.000 description 1
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 150000003413 spiro compounds Chemical class 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010345 tape casting Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- TVIVIEFSHFOWTE-UHFFFAOYSA-K tri(quinolin-8-yloxy)alumane Chemical compound [Al+3].C1=CN=C2C([O-])=CC=CC2=C1.C1=CN=C2C([O-])=CC=CC2=C1.C1=CN=C2C([O-])=CC=CC2=C1 TVIVIEFSHFOWTE-UHFFFAOYSA-K 0.000 description 1
- KWQNQSDKCINQQP-UHFFFAOYSA-K tri(quinolin-8-yloxy)gallane Chemical compound C1=CN=C2C(O[Ga](OC=3C4=NC=CC=C4C=CC=3)OC=3C4=NC=CC=C4C=CC=3)=CC=CC2=C1 KWQNQSDKCINQQP-UHFFFAOYSA-K 0.000 description 1
- 125000005259 triarylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000006617 triphenylamine group Chemical group 0.000 description 1
- 125000003960 triphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C3=CC=CC=C3C12)* 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- NAWDYIZEMPQZHO-UHFFFAOYSA-N ytterbium Chemical compound [Yb] NAWDYIZEMPQZHO-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- YVTHLONGBIQYBO-UHFFFAOYSA-N zinc indium(3+) oxygen(2-) Chemical compound [O--].[Zn++].[In+3] YVTHLONGBIQYBO-UHFFFAOYSA-N 0.000 description 1
- HTPBWAPZAJWXKY-UHFFFAOYSA-L zinc;quinolin-8-olate Chemical compound [Zn+2].C1=CN=C2C([O-])=CC=CC2=C1.C1=CN=C2C([O-])=CC=CC2=C1 HTPBWAPZAJWXKY-UHFFFAOYSA-L 0.000 description 1
Images
Classifications
-
- H01L51/5056—
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/06—Luminescent, e.g. electroluminescent, chemiluminescent materials containing organic luminescent materials
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/66—Arsenic compounds
- C07F9/70—Organo-arsenic compounds
- C07F9/74—Aromatic compounds
- C07F9/78—Aromatic compounds containing amino groups
-
- H01L51/006—
-
- H01L51/0072—
-
- H01L51/5096—
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K85/00—Organic materials used in the body or electrodes of devices covered by this subclass
- H10K85/60—Organic compounds having low molecular weight
- H10K85/631—Amine compounds having at least two aryl rest on at least one amine-nitrogen atom, e.g. triphenylamine
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K85/00—Organic materials used in the body or electrodes of devices covered by this subclass
- H10K85/60—Organic compounds having low molecular weight
- H10K85/631—Amine compounds having at least two aryl rest on at least one amine-nitrogen atom, e.g. triphenylamine
- H10K85/633—Amine compounds having at least two aryl rest on at least one amine-nitrogen atom, e.g. triphenylamine comprising polycyclic condensed aromatic hydrocarbons as substituents on the nitrogen atom
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K85/00—Organic materials used in the body or electrodes of devices covered by this subclass
- H10K85/60—Organic compounds having low molecular weight
- H10K85/631—Amine compounds having at least two aryl rest on at least one amine-nitrogen atom, e.g. triphenylamine
- H10K85/636—Amine compounds having at least two aryl rest on at least one amine-nitrogen atom, e.g. triphenylamine comprising heteroaromatic hydrocarbons as substituents on the nitrogen atom
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K85/00—Organic materials used in the body or electrodes of devices covered by this subclass
- H10K85/60—Organic compounds having low molecular weight
- H10K85/649—Aromatic compounds comprising a hetero atom
- H10K85/657—Polycyclic condensed heteroaromatic hydrocarbons
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K85/00—Organic materials used in the body or electrodes of devices covered by this subclass
- H10K85/60—Organic compounds having low molecular weight
- H10K85/649—Aromatic compounds comprising a hetero atom
- H10K85/657—Polycyclic condensed heteroaromatic hydrocarbons
- H10K85/6572—Polycyclic condensed heteroaromatic hydrocarbons comprising only nitrogen in the heteroaromatic polycondensed ring system, e.g. phenanthroline or carbazole
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K50/00—Organic light-emitting devices
- H10K50/10—OLEDs or polymer light-emitting diodes [PLED]
- H10K50/14—Carrier transporting layers
- H10K50/15—Hole transporting layers
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K50/00—Organic light-emitting devices
- H10K50/10—OLEDs or polymer light-emitting diodes [PLED]
- H10K50/14—Carrier transporting layers
- H10K50/15—Hole transporting layers
- H10K50/156—Hole transporting layers comprising a multilayered structure
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10K—ORGANIC ELECTRIC SOLID-STATE DEVICES
- H10K50/00—Organic light-emitting devices
- H10K50/10—OLEDs or polymer light-emitting diodes [PLED]
- H10K50/18—Carrier blocking layers
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Organic Chemistry (AREA)
- Electroluminescent Light Sources (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
Description
도 2는 본 명세서의 또 하나의 실시상태에 따르는 유기 발광 소자의 적층 구조를 예시한 것이다.
화학식 (정공수송층) |
화학식 (전자 저지층) |
전압 (V@10mA/cm2) |
효율 (cd/A@10mA/cm2) |
색좌표 (x,y) |
|
비교예 1-1 | HT 1 | TCTA | 4.38 | 5.25 | (0.138, 0.127) |
비교예 1-2 | HT 1 | HT 2-2 | 4.35 | 5.26 | (0.138, 0.126) |
비교예 1-3 | HT 1 | - | 5.8 | 2.8 | (0.139, 0.126) |
비교예 1-4 | - | HT 2-2 | 5.9 | 3.2 | (0.137, 0.126) |
비교예 1-5 | HT-1-1 | - | 5.85 | 3.0 | (0.138, 0.125) |
비교예 1-6 | - | HT 2-4 | 6.2 | 2.98 | (0.137, 0.125) |
비교예 1-7 | - | HT 2-6 | 6.0 | 3.19 | (0.136, 0.128) |
실험예 1-1 | HT 1-1 | HT 2-2 | 3.85 | 5.45 | (0.139, 0.125) |
실험예 1-2 | HT 1-2 | HT 2-2 | 3.86 | 5.46 | (0.138, 0.125) |
실험예 1-3 | HT 1-3 | HT 2-2 | 3.84 | 5.46 | (0.138, 0.125) |
실험예 1-4 | HT 1-4 | HT 2-2 | 3.84 | 5.45 | (0.137, 0.127) |
실험예 1-5 | HT 1-5 | HT 2-2 | 3.80 | 5.47 | (0.136, 0.127) |
실험예 1-6 | HT 1-6 | HT 2-2 | 3.83 | 5.47 | (0.135, 0.127) |
실험예 1-7 | HT 1-7 | HT 2-2 | 3.82 | 5.46 | (0.136, 0.126) |
실험예 1-8 | HT 1-8 | HT 2-2 | 3.81 | 5.47 | (0.137, 0.126) |
실험예 1-9 | HT 1-9 | HT 2-2 | 3.86 | 5.49 | (0.138, 0.127) |
실험예 1-10 | HT 1-10 | HT 2-2 | 3.87 | 5.48 | (0.136, 0.126) |
실험예 1-11 | HT 1-11 | HT 2-2 | 3.85 | 5.48 | (0.137, 0.126) |
실험예 1-12 | HT 1-12 | HT 2-2 | 3.85 | 5.50 | (0.136, 0.127) |
실험예 1-13 | HT 1-13 | HT 2-2 | 3.83 | 5.47 | (0.138, 0.127) |
실험예 1-14 | HT 1-14 | HT 2-2 | 3.84 | 5.46 | (0.137, 0.126) |
실험예 1-15 | HT 1-15 | HT 2-2 | 3.84 | 5.47 | (0.136, 0.127) |
실험예 1-16 | HT 1-16 | HT 2-2 | 3.90 | 5.44 | (0.136, 0.126) |
실험예 1-17 | HT 1-17 | HT 2-2 | 3.91 | 5.43 | (0.138, 0.126) |
실험예 1-18 | HT 1-18 | HT 2-2 | 3.90 | 5.45 | (0.137, 0.126) |
실험예 1-19 | HT 1-19 | HT 2-2 | 3.89 | 5.44 | (0.137, 0.127) |
실험예 1-20 | HT 1-20 | HT 2-2 | 3.91 | 5.44 | (0.136, 0.126) |
실험예 1-21 | HT 1-21 | HT 2-2 | 3.92 | 5.46 | (0.136, 0.127) |
실험예 1-22 | HT 1-22 | HT 2-2 | 3.90 | 5.45 | (0.138, 0.127) |
화학식 (정공수송층) |
화학식 (전자 저지층) |
전압 (V@10mA/cm2) |
효율 (cd/A@10mA/cm2) |
색좌표 (x,y) |
|
비교예 1-8 | HT 1 | TCTA | 4.25 | 5.10 | (0.320, 0.611) |
비교예 1-9 | HT 1 | HT 2-2 | 4.35 | 5.12 | (0.321, 0.611) |
비교예 1-10 | HT 2-2 | 5.80 | 3.24 | (0.318, 0.613) | |
비교예 1-11 | HT 1 | - | 6.0 | 3.00 | (0.317, 0.612) |
비교예 1-12 | HT 1-1 | - | 5.93 | 3.05 | (0.319, 0.610) |
비교예 1-13 | - | HT 2-4 | 6.02 | 3.01 | (0.320, 0.615) |
비교예 1-14 | - | HT 2-6 | 6.0 | 3.10 | (0.321, 0.616) |
실험예 1-23 | HT 1-1 | HT 2-2 | 3.78 | 5.30 | (0.320, 0.612) |
실험예 1-24 | HT 1-2 | HT 2-2 | 3.77 | 5.31 | (0.320, 0.611) |
실험예 1-25 | HT 1-3 | HT 2-2 | 3.75 | 5.28 | (0.322, 0.610) |
실험예 1-26 | HT 1-4 | HT 2-2 | 3.74 | 5.29 | (0.319, 0.611) |
실험예 1-27 | HT 1-5 | HT 2-2 | 3.65 | 5.35 | (0.321, 0.610) |
실험예 1-28 | HT 1-6 | HT 2-2 | 3.68 | 5.47 | (0.320, 0.611) |
실험예 1-29 | HT 1-7 | HT 2-2 | 3.69 | 5.46 | (0.318, 0.613) |
실험예 1-30 | HT 1-8 | HT 2-2 | 3.70 | 5.47 | (0.320, 0.611) |
실험예 1-31 | HT 1-9 | HT 2-2 | 3.80 | 5.35 | (0.319, 0.612) |
실험예 1-32 | HT 1-10 | HT 2-2 | 3.82 | 5.37 | (0.320, 0.611) |
실험예 1-33 | HT 1-11 | HT 2-2 | 3.81 | 5.36 | (0.320, 0.613) |
실험예 1-34 | HT 1-12 | HT 2-2 | 3.83 | 5.39 | (0.321, 0.610) |
실험예 1-35 | HT 1-13 | HT 2-2 | 3.75 | 5.30 | (0.319, 0.613) |
실험예 1-36 | HT 1-14 | HT 2-2 | 3.76 | 5.31 | (0.321, 0.611) |
실험예 1-37 | HT 1-15 | HT 2-2 | 3.78 | 5.29 | (0.320, 0.612) |
실험예 1-38 | HT 1-16 | HT 2-2 | 3.76 | 5.30 | (0.318, 0.613) |
실험예 1-39 | HT 1-17 | HT 2-2 | 3.85 | 5.30 | (0.322, 0.610) |
실험예 1-40 | HT 1-18 | HT 2-2 | 3.84 | 5.28 | (0.321, 0.611) |
실험예 1-41 | HT 1-19 | HT 2-2 | 3.86 | 5.29 | (0.320, 0.610) |
실험예 1-42 | HT 1-20 | HT 2-2 | 3.84 | 5.30 | (0.319, 0.611) |
실험예 1-43 | HT 1-21 | HT 2-2 | 3.87 | 5.31 | (0.318, 0.612) |
실험예 1-44 | HT 1-22 | HT 2-2 | 3.87 | 5.30 | (0.319, 0.610) |
101: 애노드
201: 제1 유기물층
202: 제2 유기물층
301: 발광층
401: 음극
501: 전자수송층
502: 전자주입층
Claims (15)
- 캐소드; 애노드; 상기 캐소드와 상기 애노드 사이에 구비된 발광층; 상기 애노드와 상기 발광층 사이에 구비되고, 하기 화학식 1의 화합물을 포함하는 제1 유기물층; 및 상기 제1 유기물층과 상기 발광층 사이에 구비되고, 하기 화학식 2의 화합물을 포함하는 제2 유기물층을 포함하는 유기 발광 소자:
[화학식 1]
화학식 1에 있어서,
L1 내지 L3는 서로 같거나 상이하고, 각각 독립적으로 직접결합; 치환 또는 비치환된 아릴렌기; 또는 치환 또는 비치환된 헤테로아릴렌기이며, a 내지 c는 각각 0 내지 3의 정수이고, a 내지 c가 각각 2 이상인 경우 괄호내의 구조는 서로 같거나 상이하며,
Ar1 내지 Ar6는 서로 같거나 상이하고, 각각 독립적으로 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이거나, Ar1과 Ar2; Ar3와 Ar4; Ar5와 Ar6; Ar1과 L1; Ar3와 L2; 또는 Ar5와 L3가 서로 결합하여 단환 또는 다환의 방향족 또는 지방족의 탄화수소 고리 또는 헤테로 고리를 형성하고, l 내지 n은 각각 0 내지 2의 정수이고, l 내지 n가 각각 2인 경우 괄호내의 구조는 서로 같거나 상이하며, l 내지 n가 각각 0인 경우 L1 내지 L3에는 각각 -NAr1Ar2, -NAr3Ar4 및 -NAr5Ar6 대신 수소가 결합되고,
X는 NR’; O; 또는 S이며, p는 0 또는 1이고, p가 0인 경우 X에 결합된 2개의 탄소가 직접 결합하며,
R 및 R’는 서로 같거나 상이하고, 각각 독립적으로 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이다.
[화학식 2]
화학식 2에 있어서,
Ar7 및 Ar8은 서로 같거나 상이하고, 각각 독립적으로 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이며,
R1 및 R2는 서로 같거나 상이하고, 각각 독립적으로 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이거나, 서로 결합하여 단환 또는 다환의 방향족 또는 지방족의 탄화수소 고리 또는 헤테로 고리를 형성하고,
R3 및 R4는 서로 같거나 상이하고, 각각 독립적으로 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, e는 0 내지 4의 정수이고, e가 2 이상인 경우 R3는 서로 같거나 상이하고, f는 0 내지 3의 정수이고, f가 2 이상인 경우 R4는 서로 같거나 상이하다. - 청구항 1에 있어서, 상기 화학식 1의 l+m+n은 1 이상인 것인 유기 발광 소자.
- 청구항 1에 있어서, 상기 화학식 1의 m+n은 1 이상인 것인 유기 발광 소자.
- 청구항 1에 있어서, 상기 화학식 1의 p는 0인 것인 유기 발광 소자.
- 청구항 1에 있어서, 상기 화학식 1의 a는 1 내지 3의 정수인 것인 유기 발광 소자.
- 청구항 1에 있어서, 상기 화학식 1에 있어서, -NAr1Ar2, -NAr3Ar4 및 -NAr5Ar6 중 적어도 하나는 하기 구조식으로 표시되는 것인 유기 발광 소자:
상기 구조식에 있어서,
Xa는 NRc; O; 또는 S이며, r은 0 또는 1이고, r이 0인 경우 Xa에 결합된 2개의 탄소가 직접 결합하며,
Ra 및 Rc는 서로 같거나 상이하고, 각각 독립적으로 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, g는 0 내지 8의 정수이며, g가 2 이상인 경우 Ra는 서로 같거나 상이하다. - 청구항 1에 있어서, 상기 화학식 1은 하기 화학식 4로 표시되는 것인 유기 발광 소자:
[화학식 4]
화학식 4에 있어서, Ar1, Ar2, L1 내지 L3, R, X, a, b, c, d, l 및 p는 화학식 1에서 정의한 바와 같고,
Xa 및 Xb는 서로 같거나 상이하고, 각각 독립적으로 NRc; O; 또는 S이며, r 및 q는 각각 0 또는 1이고, r 및 q가 각각 0인 경우 Xa 및 Xb 각각에 결합된 2개의 탄소가 직접 결합하며,
Ra 내지 Rc는 서로 같거나 상이하고, 각각 독립적으로 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, g 및 h는 각각 0 내지 8의 정수이며, g 또는 h가 2 이상인 경우 괄호내의 구조는 서로 같거나 상이하다. - 청구항 1에 있어서, 상기 화학식 1에 있어서, -(L1)a-NAr1Ar2, -(L2)b-NAr3Ar4 및 -(L3)c-NAr5Ar6 중 적어도 하나는 하기 구조식으로 표시되는 것인 유기 발광 소자:
상기 구조식에 있어서, L4는 직접결합; 치환 또는 비치환된 아릴렌기; 또는 치환 또는 비치환된 헤테로아릴렌기이며, i는 0 내지 2의 정수이고, i가 2인 경우 L4는 서로 같거나 상이하며, Ar9는 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, Rd는 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, k는 0 내지 7의 정수이고, k가 2 이상인 경우 Rd는 서로 같거나 상이하다. - 청구항 1에 있어서, 상기 화학식 1은 하기 화학식 6으로 표시되는 것인 유기 발광 소자:
[화학식 6]
화학식 6에 있어서, Ar1, Ar2, L1, R, X, a, d, l 및 p는 화학식 1에서 정의한 바와 같고,
L4 및 L5는 서로 같거나 상이하고, 각각 독립적으로 직접결합; 치환 또는 비치환된 아릴렌기; 또는 치환 또는 비치환된 헤테로아릴렌기이며, i 및 j는 각각 0 내지 2의 정수이고, i 및 j가 각각 2인 경우 괄호내의 구조는 서로 같거나 상이하며, Ar9 및 Ar10은 서로 같거나 상이하고, 독립적으로 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, Rd 및 Re는 서로 같거나 상이하고, 각각 독립적으로 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, k 및 o는 각각 0 내지 7의 정수이고, k 또는 o가 2 이상인 경우 괄호 내의 구조는 서로 같거나 상이하다. - 청구항 1에 있어서, 상기 화학식 1에서 l은 0이고, L1은 페닐기, 바이페닐릴기, 나프틸기, 또는 알킬기로 치환 또는 비치환된 플루오레닐레닐기인 것인 유기 발광 소자.
- 청구항 1에 있어서, 상기 화학식 2는 하기 화학식 12로 표시되는 것인 유기 발광 소자:
[화학식 12]
화학식 12에 있어서, R3, R4, Ar7, Ar8, e 및 f는 화학식 2에서 정의한 바와 같고, R5는 수소; 중수소; 니트릴기; 치환 또는 비치환된 알킬기; 치환 또는 비치환된 시클로알킬기; 치환 또는 비치환된 알콕시기; 치환 또는 비치환된 아릴옥시기; 치환 또는 비치환된 알케닐기; 치환 또는 비치환된 실릴기; 치환 또는 비치환된 아민기; 치환 또는 비치환된 아릴기; 또는 치환 또는 비치환된 헤테로아릴기이고, x는 0 내지 8의 정수이며, x가 2 이상인 경우 R5는 서로 같거나 상이하다. - 청구항 1에 있어서, 상기 제1 유기물층은 정공수송층이고, 상기 제2 유기물층은 전자차단층인 것인 유기 발광 소자.
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR20160065970 | 2016-05-27 | ||
KR1020160065970 | 2016-05-27 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20170134260A true KR20170134260A (ko) | 2017-12-06 |
KR101997057B1 KR101997057B1 (ko) | 2019-07-08 |
Family
ID=60411815
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020170065415A KR101997057B1 (ko) | 2016-05-27 | 2017-05-26 | 유기 발광 소자 |
Country Status (7)
Country | Link |
---|---|
US (1) | US20190148650A1 (ko) |
EP (1) | EP3439062B1 (ko) |
JP (2) | JP6806312B2 (ko) |
KR (1) | KR101997057B1 (ko) |
CN (1) | CN109075261B (ko) |
TW (1) | TWI619701B (ko) |
WO (1) | WO2017204594A1 (ko) |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US10658594B2 (en) | 2017-12-06 | 2020-05-19 | Idemitsu Kosan Co., Ltd. | Organic electroluminescence device and novel compound |
US11856852B2 (en) | 2018-06-08 | 2023-12-26 | Lg Chem, Ltd. | Organic light-emitting device |
Families Citing this family (18)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2019101719A1 (de) * | 2017-11-23 | 2019-05-31 | Merck Patent Gmbh | Materialien für elektronische vorrichtungen |
CN109928962A (zh) * | 2017-12-18 | 2019-06-25 | 江苏三月光电科技有限公司 | 一种以咔唑为核心的化合物、制备方法及其在有机电致发光器件上的应用 |
KR102164775B1 (ko) * | 2018-05-24 | 2020-10-13 | 주식회사 엘지화학 | 유기 발광 소자 |
KR102221978B1 (ko) * | 2018-06-11 | 2021-03-04 | 주식회사 엘지화학 | 유기 발광 소자 |
CN111602258B (zh) * | 2018-06-11 | 2023-11-07 | 株式会社Lg化学 | 有机发光器件 |
KR102245926B1 (ko) * | 2018-09-20 | 2021-04-29 | 주식회사 엘지화학 | 유기 발광 소자 |
US10593889B1 (en) | 2018-09-26 | 2020-03-17 | Idemitsu Kosan Co., Ltd. | Compound and organic electroluminescence device |
KR102247684B1 (ko) * | 2018-10-10 | 2021-05-03 | 주식회사 엘지화학 | 신규한 화합물 및 이를 포함하는 유기발광 소자 |
KR102753618B1 (ko) * | 2019-05-27 | 2025-01-14 | 주식회사 동진쎄미켐 | 캡핑층용 유기 화합물 및 이를 포함하는 유기 발광 소자 |
KR102315480B1 (ko) | 2019-06-28 | 2021-10-20 | 이데미쓰 고산 가부시키가이샤 | 화합물, 유기 전기발광 소자용 재료, 유기 전기발광 소자 및 전자 기기 |
CN113196515B (zh) * | 2019-07-31 | 2023-08-22 | 株式会社Lg化学 | 有机发光器件 |
WO2021020948A1 (ko) * | 2019-08-01 | 2021-02-04 | 주식회사 엘지화학 | 유기 발광 소자 |
KR102437213B1 (ko) * | 2019-11-29 | 2022-08-29 | 주식회사 엘지화학 | 유기 발광 소자 |
KR102441139B1 (ko) * | 2019-11-29 | 2022-09-07 | 주식회사 엘지화학 | 유기 발광 소자 |
KR102651334B1 (ko) * | 2020-01-16 | 2024-03-26 | 주식회사 엘지화학 | 유기 발광 소자 |
CN113906582B (zh) * | 2020-02-28 | 2024-04-26 | 株式会社Lg化学 | 有机发光器件 |
KR102680194B1 (ko) | 2020-09-10 | 2024-07-01 | 주식회사 엘지화학 | 유기 발광 소자 |
CN119118849A (zh) | 2021-03-31 | 2024-12-13 | 出光兴产株式会社 | 化合物、有机电致发光元件用材料、有机电致发光元件和电子设备 |
Citations (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPH09310066A (ja) * | 1996-05-23 | 1997-12-02 | Idemitsu Kosan Co Ltd | 有機電界発光素子 |
US20040251816A1 (en) | 2001-07-20 | 2004-12-16 | Karl Leo | Light emitting component with organic layers |
KR20090028943A (ko) * | 2007-09-17 | 2009-03-20 | (주)루디스 | 정공주입층/정공수송층 물질 및 이를 포함하는유기전계발광소자 |
KR20130099098A (ko) * | 2010-09-15 | 2013-09-05 | 메르크 파텐트 게엠베하 | 유기 전계발광 소자용 재료 |
KR20150038193A (ko) * | 2012-07-23 | 2015-04-08 | 메르크 파텐트 게엠베하 | 2-디아릴아미노플루오렌의 유도체 및 이를 함유하는 유기 전자 화합물 |
KR20180035917A (ko) * | 2015-08-14 | 2018-04-06 | 메르크 파텐트 게엠베하 | 유기 전계발광 소자용 페녹사진 유도체 |
Family Cites Families (23)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP4140986B2 (ja) * | 1997-02-14 | 2008-08-27 | 出光興産株式会社 | 有機電界発光素子 |
US6660410B2 (en) * | 2000-03-27 | 2003-12-09 | Idemitsu Kosan Co., Ltd. | Organic electroluminescence element |
CN1221268C (zh) * | 2002-10-11 | 2005-10-05 | 兰为民 | 镁钙离子复合制剂及其生产工艺 |
JP4707082B2 (ja) * | 2002-11-26 | 2011-06-22 | コニカミノルタホールディングス株式会社 | 有機エレクトロルミネッセンス素子および表示装置 |
EP1930964A1 (en) * | 2005-09-30 | 2008-06-11 | Idemitsu Kosan Co., Ltd. | Organic electroluminescent device |
JP5616582B2 (ja) * | 2006-06-22 | 2014-10-29 | 出光興産株式会社 | 複素環含有アリールアミン誘導体を用いた有機エレクトロルミネッセンス素子 |
US7723722B2 (en) * | 2007-03-23 | 2010-05-25 | Semiconductor Energy Laboratory Co., Ltd. | Organic compound, anthracene derivative, and light-emitting element, light-emitting device, and electronic device using anthracene derivative |
KR101598931B1 (ko) * | 2008-03-24 | 2016-03-02 | 신닛테츠 수미킨 가가쿠 가부시키가이샤 | 유기 전계 발광 소자용 화합물 및 이것을 이용한 유기 전계 발광 소자 |
CN104617229B (zh) * | 2008-05-16 | 2017-09-08 | 保土谷化学工业株式会社 | 有机电致发光器件 |
US20100295444A1 (en) * | 2009-05-22 | 2010-11-25 | Idemitsu Kosan Co., Ltd. | Organic electroluminescence device |
JPWO2011040607A1 (ja) * | 2009-10-02 | 2013-02-28 | 出光興産株式会社 | 芳香族アミン誘導体及び有機エレクトロルミネッセンス素子 |
US20110309344A1 (en) * | 2010-06-18 | 2011-12-22 | Basf Se | Organic electronic devices comprising a layer of a pyridine compound and a 8-hydroxypquinolinolato earth alkaline metal, or alkali metal complex |
KR101432599B1 (ko) * | 2010-08-04 | 2014-08-21 | 제일모직주식회사 | 유기광전소자용 화합물 및 이를 포함하는 유기광전소자 |
WO2012077902A2 (ko) * | 2010-12-08 | 2012-06-14 | 제일모직 주식회사 | 유기광전자소자용 화합물, 이를 포함하는 유기발광소자 및 상기 유기발광소자를 포함하는 표시장치 |
KR101550485B1 (ko) * | 2011-06-27 | 2015-09-18 | 주식회사 엘지화학 | 새로운 화합물 및 이를 포함한 유기 발광 소자 |
KR20220005650A (ko) * | 2012-02-14 | 2022-01-13 | 메르크 파텐트 게엠베하 | 유기 전계발광 소자용 스피로비플루오렌 화합물 |
KR20210068605A (ko) * | 2012-03-15 | 2021-06-09 | 메르크 파텐트 게엠베하 | 전자 소자 |
JP2014049539A (ja) * | 2012-08-30 | 2014-03-17 | Idemitsu Kosan Co Ltd | 有機エレクトロルミネッセンス素子 |
KR101684979B1 (ko) * | 2012-12-31 | 2016-12-09 | 제일모직 주식회사 | 유기광전자소자 및 이를 포함하는 표시장치 |
KR101738607B1 (ko) * | 2014-02-28 | 2017-05-22 | 머티어리얼사이언스 주식회사 | 유기전계발광소자 |
EP2978040B1 (en) * | 2014-07-22 | 2017-12-27 | Samsung Display Co., Ltd. | Organic light-emitting device |
KR102318417B1 (ko) * | 2014-10-22 | 2021-10-28 | 삼성디스플레이 주식회사 | 유기 발광 소자 |
EP3334732B1 (en) * | 2015-08-14 | 2024-03-06 | Merck Patent GmbH | Phenoxazine derivatives for organic electroluminescent devices |
-
2017
- 2017-05-26 TW TW106117702A patent/TWI619701B/zh active
- 2017-05-26 JP JP2018553124A patent/JP6806312B2/ja active Active
- 2017-05-26 CN CN201780029487.8A patent/CN109075261B/zh active Active
- 2017-05-26 WO PCT/KR2017/005520 patent/WO2017204594A1/ko active Application Filing
- 2017-05-26 US US16/304,426 patent/US20190148650A1/en active Pending
- 2017-05-26 KR KR1020170065415A patent/KR101997057B1/ko active IP Right Grant
- 2017-05-26 EP EP17803112.6A patent/EP3439062B1/en active Active
-
2020
- 2020-01-29 JP JP2020012666A patent/JP6933324B2/ja active Active
Patent Citations (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPH09310066A (ja) * | 1996-05-23 | 1997-12-02 | Idemitsu Kosan Co Ltd | 有機電界発光素子 |
US20040251816A1 (en) | 2001-07-20 | 2004-12-16 | Karl Leo | Light emitting component with organic layers |
KR20090028943A (ko) * | 2007-09-17 | 2009-03-20 | (주)루디스 | 정공주입층/정공수송층 물질 및 이를 포함하는유기전계발광소자 |
KR20130099098A (ko) * | 2010-09-15 | 2013-09-05 | 메르크 파텐트 게엠베하 | 유기 전계발광 소자용 재료 |
KR20150038193A (ko) * | 2012-07-23 | 2015-04-08 | 메르크 파텐트 게엠베하 | 2-디아릴아미노플루오렌의 유도체 및 이를 함유하는 유기 전자 화합물 |
KR20180035917A (ko) * | 2015-08-14 | 2018-04-06 | 메르크 파텐트 게엠베하 | 유기 전계발광 소자용 페녹사진 유도체 |
Cited By (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US10658594B2 (en) | 2017-12-06 | 2020-05-19 | Idemitsu Kosan Co., Ltd. | Organic electroluminescence device and novel compound |
US10672989B2 (en) | 2017-12-06 | 2020-06-02 | Idemitsu Kosan Co., Ltd. | Organic electroluminescence device and novel compound |
US11856852B2 (en) | 2018-06-08 | 2023-12-26 | Lg Chem, Ltd. | Organic light-emitting device |
Also Published As
Publication number | Publication date |
---|---|
CN109075261B (zh) | 2020-06-02 |
CN109075261A (zh) | 2018-12-21 |
EP3439062A1 (en) | 2019-02-06 |
EP3439062B1 (en) | 2021-09-08 |
US20190148650A1 (en) | 2019-05-16 |
JP2020098916A (ja) | 2020-06-25 |
KR101997057B1 (ko) | 2019-07-08 |
JP2019515488A (ja) | 2019-06-06 |
JP6806312B2 (ja) | 2021-01-06 |
EP3439062A4 (en) | 2019-04-10 |
JP6933324B2 (ja) | 2021-09-08 |
WO2017204594A1 (ko) | 2017-11-30 |
TW201808899A (zh) | 2018-03-16 |
TWI619701B (zh) | 2018-04-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR101997057B1 (ko) | 유기 발광 소자 | |
KR101956790B1 (ko) | 다중고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101832084B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101991049B1 (ko) | 스피로형 화합물 및 이를 포함하는 유기 발광 소자 | |
KR102005010B1 (ko) | 화합물 및 이를 포함하는 유기전자소자 | |
KR101928935B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101872580B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR102005012B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101981245B1 (ko) | 고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR20180093819A (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR20180131963A (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR20170041119A (ko) | 스피로형 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101873157B1 (ko) | 유기 발광 소자 | |
KR20170100452A (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR20190062150A (ko) | 유기 발광 소자 | |
KR101928934B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101764002B1 (ko) | 헤테로환 화합물 및 이를 포함하는 유기발광소자 | |
KR101615816B1 (ko) | 헤테로환 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101964607B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101784606B1 (ko) | 이중스피로형 화합물 및 이를 포함하는 유기 발광 소자 | |
KR101914380B1 (ko) | 화합물 및 이를 포함하는 유기 전자 소자 | |
KR101913504B1 (ko) | 화합물 및 이를 포함하는 유기 전자 소자 | |
KR101850242B1 (ko) | 화합물 및 이를 포함하는 유기 전자 소자 | |
KR20190088158A (ko) | 아크리딘 유도체 및 이를 포함하는 유기 발광 소자 | |
KR101945347B1 (ko) | 헤테로고리 화합물 및 이를 포함하는 유기 발광 소자 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 20170526 |
|
A201 | Request for examination | ||
PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20170529 Comment text: Request for Examination of Application Patent event code: PA02011R01I Patent event date: 20170526 Comment text: Patent Application |
|
PG1501 | Laying open of application | ||
E902 | Notification of reason for refusal | ||
PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20181205 Patent event code: PE09021S01D |
|
E701 | Decision to grant or registration of patent right | ||
PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20190624 |
|
GRNT | Written decision to grant | ||
PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20190701 Patent event code: PR07011E01D |
|
PR1002 | Payment of registration fee |
Payment date: 20190702 End annual number: 3 Start annual number: 1 |
|
PG1601 | Publication of registration | ||
PR1001 | Payment of annual fee |
Payment date: 20220622 Start annual number: 4 End annual number: 4 |
|
PR1001 | Payment of annual fee |
Payment date: 20230627 Start annual number: 5 End annual number: 5 |