KR102669988B1 - 안정성이 높은 성분을 포함하는 화장조성물 - Google Patents
안정성이 높은 성분을 포함하는 화장조성물 Download PDFInfo
- Publication number
- KR102669988B1 KR102669988B1 KR1020220016831A KR20220016831A KR102669988B1 KR 102669988 B1 KR102669988 B1 KR 102669988B1 KR 1020220016831 A KR1020220016831 A KR 1020220016831A KR 20220016831 A KR20220016831 A KR 20220016831A KR 102669988 B1 KR102669988 B1 KR 102669988B1
- Authority
- KR
- South Korea
- Prior art keywords
- extract
- weight
- parts
- cosmetic composition
- ingredients
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 48
- 239000002537 cosmetic Substances 0.000 title claims abstract description 39
- 239000004615 ingredient Substances 0.000 title claims abstract description 31
- 239000000284 extract Substances 0.000 claims abstract description 84
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims abstract description 25
- 235000011187 glycerol Nutrition 0.000 claims abstract description 13
- 239000008213 purified water Substances 0.000 claims abstract description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000000230 xanthan gum Substances 0.000 claims abstract description 11
- 229920001285 xanthan gum Polymers 0.000 claims abstract description 11
- 229940082509 xanthan gum Drugs 0.000 claims abstract description 11
- 235000010493 xanthan gum Nutrition 0.000 claims abstract description 11
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229940015975 1,2-hexanediol Drugs 0.000 claims abstract description 10
- NCZPCONIKBICGS-UHFFFAOYSA-N 3-(2-ethylhexoxy)propane-1,2-diol Chemical compound CCCCC(CC)COCC(O)CO NCZPCONIKBICGS-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229940100524 ethylhexylglycerin Drugs 0.000 claims abstract description 10
- FHKSXSQHXQEMOK-UHFFFAOYSA-N hexane-1,2-diol Chemical compound CCCCC(O)CO FHKSXSQHXQEMOK-UHFFFAOYSA-N 0.000 claims abstract description 10
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229960000281 trometamol Drugs 0.000 claims abstract description 10
- PHOQVHQSTUBQQK-SQOUGZDYSA-N D-glucono-1,5-lactone Chemical compound OC[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@@H]1O PHOQVHQSTUBQQK-SQOUGZDYSA-N 0.000 claims abstract description 8
- 239000003205 fragrance Substances 0.000 claims abstract description 8
- 235000012209 glucono delta-lactone Nutrition 0.000 claims abstract description 8
- 229960003681 gluconolactone Drugs 0.000 claims abstract description 8
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229920001908 Hydrogenated starch hydrolysate Polymers 0.000 claims abstract description 7
- 150000001413 amino acids Chemical class 0.000 claims abstract description 7
- 235000013399 edible fruits Nutrition 0.000 claims description 20
- 235000013500 Melia azadirachta Nutrition 0.000 claims description 14
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 10
- 235000004072 Ocimum sanctum Nutrition 0.000 claims description 8
- 240000002837 Ocimum tenuiflorum Species 0.000 claims description 8
- 239000004475 Arginine Substances 0.000 claims description 7
- 240000005343 Azadirachta indica Species 0.000 claims description 7
- 235000006200 Glycyrrhiza glabra Nutrition 0.000 claims description 7
- 244000303040 Glycyrrhiza glabra Species 0.000 claims description 7
- 235000017945 Matricaria Nutrition 0.000 claims description 7
- 235000007232 Matricaria chamomilla Nutrition 0.000 claims description 7
- 240000005125 Myrtus communis Species 0.000 claims description 7
- 235000013418 Myrtus communis Nutrition 0.000 claims description 7
- 244000061458 Solanum melongena Species 0.000 claims description 7
- 235000002597 Solanum melongena Nutrition 0.000 claims description 7
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 claims description 7
- 235000009697 arginine Nutrition 0.000 claims description 7
- WSGCRSMLXFHGRM-DEVHWETNSA-N (2s)-2-[[(2s)-6-amino-2-[[(2s,3r)-2-[[(2s,3r)-2-[[(2s)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid Chemical compound CCCCCCCCCCCCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(O)=O WSGCRSMLXFHGRM-DEVHWETNSA-N 0.000 claims description 6
- BYUQATUKPXLFLZ-UIOOFZCWSA-N CCCCCCCCCCCCCCCC(=O)NCC(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(O)=O)CC1=CN=CN1 Chemical compound CCCCCCCCCCCCCCCC(=O)NCC(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(O)=O)CC1=CN=CN1 BYUQATUKPXLFLZ-UIOOFZCWSA-N 0.000 claims description 6
- 244000132059 Carica parviflora Species 0.000 claims description 6
- 235000014653 Carica parviflora Nutrition 0.000 claims description 6
- 244000192528 Chrysanthemum parthenium Species 0.000 claims description 6
- MVORZMQFXBLMHM-QWRGUYRKSA-N Gly-His-Lys Chemical compound NCCCC[C@@H](C(O)=O)NC(=O)[C@@H](NC(=O)CN)CC1=CN=CN1 MVORZMQFXBLMHM-QWRGUYRKSA-N 0.000 claims description 6
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 6
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 claims description 6
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 claims description 6
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 claims description 6
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 claims description 6
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 claims description 6
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 claims description 6
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 claims description 6
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 claims description 6
- 239000004472 Lysine Substances 0.000 claims description 6
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 6
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 claims description 6
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 claims description 6
- 239000004473 Threonine Substances 0.000 claims description 6
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 claims description 6
- 235000001014 amino acid Nutrition 0.000 claims description 6
- 229940024606 amino acid Drugs 0.000 claims description 6
- 229940059958 centella asiatica extract Drugs 0.000 claims description 6
- 239000001649 glycyrrhiza glabra l. absolute Substances 0.000 claims description 6
- 235000020688 green tea extract Nutrition 0.000 claims description 6
- 229940094952 green tea extract Drugs 0.000 claims description 6
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 claims description 6
- 229960000310 isoleucine Drugs 0.000 claims description 6
- 229940051810 licorice root extract Drugs 0.000 claims description 6
- 229930182817 methionine Natural products 0.000 claims description 6
- 229940093441 palmitoyl oligopeptide Drugs 0.000 claims description 6
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 claims description 6
- 239000001331 rosmarinus officinalis leaf Substances 0.000 claims description 6
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 claims description 6
- 239000004474 valine Substances 0.000 claims description 6
- AJLNZWYOJAWBCR-OOPVGHQCSA-N (4s)-4-acetamido-5-[[(2s)-1-[[(2s)-1-[[(2s)-5-amino-1-[[(2s)-1-[[(2s)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-car Chemical compound OC(=O)CC[C@H](NC(C)=O)C(=C)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O AJLNZWYOJAWBCR-OOPVGHQCSA-N 0.000 claims description 5
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 claims description 5
- 239000004471 Glycine Substances 0.000 claims description 5
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 claims description 5
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 5
- 240000001341 Reynoutria japonica Species 0.000 claims description 5
- 235000018167 Reynoutria japonica Nutrition 0.000 claims description 5
- 229940095094 acetyl hexapeptide-8 Drugs 0.000 claims description 5
- 108010006338 acetyl-glutamyl-glutamyl-methionyl-glutaminyl-arginyl-argininamide Proteins 0.000 claims description 5
- 235000004279 alanine Nutrition 0.000 claims description 5
- 229940120275 aloe vera flower extract Drugs 0.000 claims description 5
- 235000003704 aspartic acid Nutrition 0.000 claims description 5
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 claims description 5
- QMIFIFIYYPUVNU-ACMTZBLWSA-L copper (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-imidazol-1-id-4-ylpropanoyl]amino]hexanoate Chemical compound [Cu+2].NCCCC[C@@H](C([O-])=O)NC(=O)[C@@H](NC(=O)CN)CC1=C[N-]C=N1 QMIFIFIYYPUVNU-ACMTZBLWSA-L 0.000 claims description 5
- 239000002454 curcuma longa l. root extract Substances 0.000 claims description 5
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 claims description 5
- 235000018417 cysteine Nutrition 0.000 claims description 5
- 235000013922 glutamic acid Nutrition 0.000 claims description 5
- 239000004220 glutamic acid Substances 0.000 claims description 5
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 claims description 5
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 claims description 4
- OGNHOGPWQTWKGQ-VGWMRTNUSA-N (2S)-5-amino-2-[[(2S)-1-[2-[[(2S)-5-amino-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid Chemical compound NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N1[C@H](C(=O)N[C@@H](CCC(N)=O)C(O)=O)CCC1 OGNHOGPWQTWKGQ-VGWMRTNUSA-N 0.000 claims description 4
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 claims description 4
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 claims description 4
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 claims description 4
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 claims description 3
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims description 3
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 claims description 3
- 230000003020 moisturizing effect Effects 0.000 abstract description 9
- 206010020751 Hypersensitivity Diseases 0.000 abstract description 7
- 239000003963 antioxidant agent Substances 0.000 abstract description 5
- 230000003078 antioxidant effect Effects 0.000 abstract description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 abstract description 4
- 208000026935 allergic disease Diseases 0.000 abstract description 3
- 230000009610 hypersensitivity Effects 0.000 abstract description 3
- 108010009736 Protein Hydrolysates Proteins 0.000 abstract description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 abstract description 2
- TVEXGJYMHHTVKP-UHFFFAOYSA-N 6-oxabicyclo[3.2.1]oct-3-en-7-one Chemical compound C1C2C(=O)OC1C=CC2 TVEXGJYMHHTVKP-UHFFFAOYSA-N 0.000 description 11
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 244000237986 Melia azadirachta Species 0.000 description 7
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 5
- 229940097941 polyglyceryl-10 laurate Drugs 0.000 description 5
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 235000006708 antioxidants Nutrition 0.000 description 4
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 4
- -1 skin Substances 0.000 description 4
- HDTRYLNUVZCQOY-UHFFFAOYSA-N α-D-glucopyranosyl-α-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OC1C(O)C(O)C(O)C(CO)O1 HDTRYLNUVZCQOY-UHFFFAOYSA-N 0.000 description 3
- HDTRYLNUVZCQOY-WSWWMNSNSA-N Trehalose Natural products O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 HDTRYLNUVZCQOY-WSWWMNSNSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000001172 regenerating effect Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 235000013599 spices Nutrition 0.000 description 3
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 108010024636 Glutathione Proteins 0.000 description 2
- DUKURNFHYQXCJG-UHFFFAOYSA-N Lewis A pentasaccharide Natural products OC1C(O)C(O)C(C)OC1OC1C(OC2C(C(O)C(O)C(CO)O2)O)C(NC(C)=O)C(OC2C(C(OC3C(OC(O)C(O)C3O)CO)OC(CO)C2O)O)OC1CO DUKURNFHYQXCJG-UHFFFAOYSA-N 0.000 description 2
- 239000004909 Moisturizer Substances 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 2
- OVRNDRQMDRJTHS-FMDGEEDCSA-N N-acetyl-beta-D-glucosamine Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O OVRNDRQMDRJTHS-FMDGEEDCSA-N 0.000 description 2
- 229920002385 Sodium hyaluronate Polymers 0.000 description 2
- OENHQHLEOONYIE-UKMVMLAPSA-N all-trans beta-carotene Natural products CC=1CCCC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C OENHQHLEOONYIE-UKMVMLAPSA-N 0.000 description 2
- HDTRYLNUVZCQOY-LIZSDCNHSA-N alpha,alpha-trehalose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 HDTRYLNUVZCQOY-LIZSDCNHSA-N 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 235000013734 beta-carotene Nutrition 0.000 description 2
- 239000011648 beta-carotene Substances 0.000 description 2
- TUPZEYHYWIEDIH-WAIFQNFQSA-N beta-carotene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C=CC=C(/C)C=CC2=CCCCC2(C)C TUPZEYHYWIEDIH-WAIFQNFQSA-N 0.000 description 2
- 229960002747 betacarotene Drugs 0.000 description 2
- 229960003237 betaine Drugs 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- RMRCNWBMXRMIRW-BYFNXCQMSA-M cyanocobalamin Chemical compound N#C[Co+]N([C@]1([H])[C@H](CC(N)=O)[C@]\2(CCC(=O)NC[C@H](C)OP(O)(=O)OC3[C@H]([C@H](O[C@@H]3CO)N3C4=CC(C)=C(C)C=C4N=C3)O)C)C/2=C(C)\C([C@H](C/2(C)C)CCC(N)=O)=N\C\2=C\C([C@H]([C@@]/2(CC(N)=O)C)CCC(N)=O)=N\C\2=C(C)/C2=N[C@]1(C)[C@@](C)(CC(N)=O)[C@@H]2CCC(N)=O RMRCNWBMXRMIRW-BYFNXCQMSA-M 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229960003180 glutathione Drugs 0.000 description 2
- 235000008216 herbs Nutrition 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 229940116598 kakadu plum extract Drugs 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 230000001333 moisturizer Effects 0.000 description 2
- 229950006780 n-acetylglucosamine Drugs 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 210000002374 sebum Anatomy 0.000 description 2
- 230000037380 skin damage Effects 0.000 description 2
- 229940010747 sodium hyaluronate Drugs 0.000 description 2
- YWIVKILSMZOHHF-QJZPQSOGSA-N sodium;(2s,3s,4s,5r,6r)-6-[(2s,3r,4r,5s,6r)-3-acetamido-2-[(2s,3s,4r,5r,6r)-6-[(2r,3r,4r,5s,6r)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2- Chemical compound [Na+].CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 YWIVKILSMZOHHF-QJZPQSOGSA-N 0.000 description 2
- LADGBHLMCUINGV-UHFFFAOYSA-N tricaprin Chemical compound CCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC LADGBHLMCUINGV-UHFFFAOYSA-N 0.000 description 2
- OENHQHLEOONYIE-JLTXGRSLSA-N β-Carotene Chemical compound CC=1CCCC(C)(C)C=1\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C OENHQHLEOONYIE-JLTXGRSLSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical class CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- 244000144927 Aloe barbadensis Species 0.000 description 1
- 235000002961 Aloe barbadensis Nutrition 0.000 description 1
- 206010003645 Atopy Diseases 0.000 description 1
- 241001474374 Blennius Species 0.000 description 1
- 235000003392 Curcuma domestica Nutrition 0.000 description 1
- 244000008991 Curcuma longa Species 0.000 description 1
- 208000001840 Dandruff Diseases 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- 240000003759 Erodium cicutarium Species 0.000 description 1
- 235000009967 Erodium cicutarium Nutrition 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 244000197975 Solidago virgaurea Species 0.000 description 1
- 235000000914 Solidago virgaurea Nutrition 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 241000234299 Zingiberaceae Species 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 235000011399 aloe vera Nutrition 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000003064 anti-oxidating effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229960003563 calcium carbonate Drugs 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 230000032677 cell aging Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000003373 curcuma longa Nutrition 0.000 description 1
- 229960002104 cyanocobalamin Drugs 0.000 description 1
- 235000000639 cyanocobalamin Nutrition 0.000 description 1
- 239000011666 cyanocobalamin Substances 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 239000000686 essence Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 229960005150 glycerol Drugs 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- XSEOYPMPHHCUBN-FGYWBSQSSA-N hydroxylated lecithin Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC(COP([O-])(=O)OCC[N+](C)(C)C)COC(=O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCCC XSEOYPMPHHCUBN-FGYWBSQSSA-N 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 230000036039 immunity Effects 0.000 description 1
- 230000005722 itchiness Effects 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 230000037307 sensitive skin Effects 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 230000009759 skin aging Effects 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 230000036559 skin health Effects 0.000 description 1
- 230000036560 skin regeneration Effects 0.000 description 1
- 230000036555 skin type Effects 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229940074410 trehalose Drugs 0.000 description 1
- 235000013976 turmeric Nutrition 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/96—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution
- A61K8/97—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution from algae, fungi, lichens or plants; from derivatives thereof
- A61K8/9783—Angiosperms [Magnoliophyta]
- A61K8/9794—Liliopsida [monocotyledons]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/33—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing oxygen
- A61K8/34—Alcohols
- A61K8/345—Alcohols containing more than one hydroxy group
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/44—Aminocarboxylic acids or derivatives thereof, e.g. aminocarboxylic acids containing sulfur; Salts; Esters or N-acylated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/60—Sugars; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/72—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds
- A61K8/73—Polysaccharides
- A61K8/731—Cellulose; Quaternized cellulose derivatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/96—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution
- A61K8/97—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution from algae, fungi, lichens or plants; from derivatives thereof
- A61K8/9706—Algae
- A61K8/9717—Rhodophycota or Rhodophyta [red algae], e.g. Porphyra
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/96—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution
- A61K8/97—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution from algae, fungi, lichens or plants; from derivatives thereof
- A61K8/9783—Angiosperms [Magnoliophyta]
- A61K8/9789—Magnoliopsida [dicotyledons]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q19/00—Preparations for care of the skin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2800/00—Properties of cosmetic compositions or active ingredients thereof or formulation aids used therein and process related aspects
- A61K2800/40—Chemical, physico-chemical or functional or structural properties of particular ingredients
- A61K2800/52—Stabilizers
- A61K2800/522—Antioxidants; Radical scavengers
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Birds (AREA)
- Biotechnology (AREA)
- Engineering & Computer Science (AREA)
- Mycology (AREA)
- Microbiology (AREA)
- Botany (AREA)
- Emergency Medicine (AREA)
- Dermatology (AREA)
- Cosmetics (AREA)
Abstract
본 발명은 안정성이 높은 성분을 포함하는 화장조성물에 있어서, 정제수, 글리세린, 부틸렌글라이콜, 1,2-헥산다이올, 프로판다이올, 글루코노락톤, 폴리글리세릴-10라우레이드, 글라이코실트레할로오스, 하이드로제네이티드스타치하이드롤리세이트, 트로메타민, 잔탄검, 에틸헥실글리세린, 향료, 천연추출물 및 아미노산을 포함하는 것을 기술적 요지로 한다. 이에 의해 화장조성물은 EWG등급을 기초로 하여 안정성이 높은 것이 확인된 성분을 포함함에 의해 성분의 거부반응이나 과민반응을 최소화할 수 있으며, 항산화 및 보습 기능이 뛰어난 효과를 얻을 수 있다.
Description
본 발명은 안정성이 높은 성분을 포함하는 화장조성물에 관한 것으로, 보다 상세하게는 EWG등급을 기초로 하여 안정성이 높은 것이 확인된 성분을 포함함에 의해 성분의 거부반응이나 과민반응을 최소화할 수 있으며, 항산화 및 보습 기능이 뛰어난 화장조성물에 관한 것이다.
일반적으로 화장조성물은 신체를 청결하게 만들고 미적인 관리를 통해 용모를 밟게 변화시키거나, 피부의 건강을 유지 및 증진시키기 위해 신체에 사용되는 조성물을 의미한다. 이러한 화장조성물의 사용과 관련한 주요 타켓층은 여성이라고 할 수 있으나, 최근에는 남성 전용으로 하는 제품들도 보편화되고 있는 추세이다. 이와 같은 화장 조성물은 스킨, 로션, 에센스, 크림, 미스트, 앰플, 비누, 샴푸 등 매우 다양하게 구성되고 있다.
화장조성물의 경우 피부에 직접 분포되어 여러 작용을 하기 때문에 피부 타입이 상이한 개인별로 화장조성물 사용에 많은 주의가 필요하게 되며, 최근 환경호르몬, 환경오염 등의 영향으로 아토피와 같은 피부질환이 자주 발생하고 있고 화장조성물의 특정 성분에 과민 반응을 보이는 경우도 있기 때문에 화장조성물의 사용에 더욱 세심한 주의가 요구되고 있다.
그러나 소비자의 경우 자신 또는 가족에게 각종 거부반응이나 과민반응을 유발하는 성분을 정확히 모를 수 있을 뿐 아니라 화장조성물마다 표시 형태가 상이할 수 있으므로 EWG(Environmental Working Group) 등급이 우수한 성분을 포함하는 화장조성물이 필요한 실정이다.
본 발명은 상기와 같은 문제점을 해결하기 위해 안출된 것으로, EWG등급을 기초로 하여 안정성이 높은 것이 확인된 성분을 포함함에 의해 성분의 거부반응이나 과민반응을 최소화할 수 있으며, 항산화 및 보습 기능이 뛰어난 화장조성물을 제공하는 것을 목적으로 한다.
상기한 목적은, 정제수, 글리세린, 부틸렌글라이콜, 1,2-헥산다이올, 프로판다이올, 글루코노락톤, 폴리글리세릴-10라우레이드, 글라이코실트레할로오스, 하이드로제네이티드스타치하이드롤리세이트, 트로메타민, 잔탄검, 에틸헥실글리세린, 향료, 천연추출물 및 아미노산을 포함하는 것을 특징으로 하는 안정성이 높은 성분을 포함하는 화장조성물에 의해 달성된다.
여기서, 상기 천연추출물은, 알로에베라꽃추출물, 아이비고드열매추출물, 참산호말추출물, 울금뿌리추출물, 인도멀구슬나무꽃추출물, 인도멀구슬나무잎추출물, 홀리바질잎추출물, 도금양열매추출물, 가지열매추출물, 병풀추출물, 호장근뿌리추출물, 황금추출물, 녹차추출물, 스페인감초뿌리추출물, 마트리카리아꽃추출물, 로즈마리잎추출물 및 이의 혼합으로 이루어진 군으로부터 선택되는 것이 바람직하다.
또한, 상기 아미노산은, 발린, 타이로신, 트라이펩타이드-1, 트레오닌, 세린, 프롤린, 페닐알라닌, 팔미토일트라이펩타이드-1, 팔미토일펜타펩타이드-4, 메티오닌, 라이신, 류신, 아이소류신, 히스티딘, 헥사펩타이드-9, 글라이신, 시스테인, 카퍼트라이펩타이드-1, 아스파틱에시드, 알지닌, 알라닌, 아세틸헥사펩타이드-8, 글루타믹에시드 및 이의 혼합으로 이루어진 군으로부터 선택되는 것이 바람직하다.
상기한 목적은 또한, 정제수, 베타인, 1,2-헥산다이올, 트레할로오스, 글리세린, 카카두플럼추출물, 소듐하이알루로네이트, 카프릴릭/카프릭트라이글리세라이드, 시트릭에시드, 하이드록제네이티드레시틴, 글루코오스, 알지닌, 하이드록시프로필메틸셀룰로오스, 칼슘카보네이트, 아세틸글루코사민, 아스코빅에시드, 글루타치온 및 에틸헥실글리세린을 포함하는 것을 특징으로 하는 안정성이 높은 성분을 포함하는 화장조성물에 의해서도 달성된다.
상술한 바와 같이 본 발명에 따르면, 화장조성물은 EWG등급을 기초로 하여 안정성이 높은 것이 확인된 성분을 포함함에 의해 성분의 거부반응이나 과민반응을 최소화할 수 있으며, 항산화 및 보습 기능이 뛰어난 효과를 얻을 수 있다.
도 1은 본 발명의 실시예에 따른 화장조성물을 피부에 테스트한 결과를 나타낸 사진이다.
이하, 본 발명의 기술적 사상을 첨부된 도면을 사용하여 더욱 구체적으로 설명한다. 첨부된 도면은 본 발명의 기술적 사상을 더욱 구체적으로 설명하기 위하여 도시한 일예에 불과하므로 본 발명의 기술적 사상이 첨부된 도면의 형태에 한정되는 것은 아니다.
본 발명에 따른 안정성이 높은 성분을 포함하는 화장조성물은, 정제수, 글리세린, 부틸렌글라이콜, 1,2-헥산다이올, 프로판다이올, 글루코노락톤, 폴리글리세릴-10라우레이드, 글라이코실트레할로오스, 하이드로제네이티드스타치하이드롤리세이트, 트로메타민, 잔탄검, 에틸헥실글리세린, 향료, 천연추출물 및 아미노산을 포함한다.
여기서 정제수는 화장조성물의 베이스인 용제역할을 하는 것으로, 수분감이 높은 화장조성물을 형성가능하도록 70 내지 72중량부를 포함한다. 글리세린은 보습감을 증가시키기 위한 것으로 화장조성물을 피부에 도포하게 되면 정제수는 대부분 증발하는데 비해 글리세린은 증발하지 않고 피부에 흡수되도록 구성된다. 이러한 글리세린은 3 내지 4중량부 포함될 수 있다. 부틸렌글라이콜은 글리세린과 마찬가지로 보습제역할을 함과 동시에 점도가 낮기 때문에 용제역할도 수행한다. 이러한 부틸렌글라이콜은 2 내지 3중량부 포함될 수 있다.
1,2-헥산다이올은 화장조성물이 장기간 보관 또는 세균 침투에 의해 변질되지 않도록 보존하는 보존제로 첨가되며, 이는 2 내지 3중량부 포함되는 것이 바람직하다. 프로판다이올은 보습 기능을 증가시키기 위해 추가로 첨가되는 것으로 2 내지 3중량부 포함된다. 글루코노락톤의 경우 피부컨디셔닝제 역할을 위해 첨가되며, 이는 2 내지 3중량부 포함될 수 있다. 폴리글리세릴-10라우레이트는 수용성 유화제로 이는 화장조성물 중 친수성 성분과 소수성 성분이 서로 분리되지 않고 균일하게 섞이도록 하는 계면활성제 역할을 한다. 이러한 폴리글리세릴-10라우레이트는 2 내지3중량부 포함되는 것이 바람직하다.
글라이코실트레할로오스는 수용성 유화제 및 보습제 역할을 하는 구성으로, 이러한 글라이코실트레할로오스는 1 내지 2중량부 포함되는 것이 바람직하다. 하이드로제네이티드스타치하이드롤리세이트는 피부에 흡수되어 보습능력을 증가시키기 위한 것으로 0.5 내지 1중량부 첨가될 수 있다. 트로메타민은 산도조절제로 이러한 트로메타민의 첨가량을 조절하여 화장조성물의 pH를 피부에 알맞게 조절할 수 있다. 여기서 트로메타민은 0.5 내지 1중량부 내에서 피부 pH에 맞게 적절하게 조절하는 것이 바람직하다.
잔탄검은 점도조절제로 첨가되는 것으로 화장조성물이 점도가 낮은 스킨, 로션 등으로 이용될 경우에는 잔탄검의 첨가량을 낮게 하고, 화장조성물이 점도가 높은 앰플, 크림 등으로 이용될 경우에는 잔탄검의 첨가량을 높여 점도를 조절할 수 있다. 이에 잔탄검은 0.5 내지 1중량부 내에서 원하는 점도에 맞게 첨가하는 것이 바람직하다.
에틸헥실글리세린은 용제 역할을 하는 것으로 0.5 내지 1중량부 첨가되는 것이 바람직하다. 향료의 경우 화장조성물의 피부에 도포할 때 향을 느낄 수 있도록 첨가되는 것으로, 향료는 허브 또는 꽃 향을 가지는 것이면 어느 것이든 제한없이 사용 가능하다. 이러한 향료는 0.2 내지 0.5중량부가 첨가될 수 있다.
천연추출물은 자연에서 얻을 수 있는 식물로부터 유용한 성분을 추출하는 추출물을 의미하며, 이러한 천연추출물은 알로에베라꽃추출물, 아이비고드열매추출물, 참산호말추출물, 울금뿌리추출물, 인도멀구슬나무꽃추출물, 인도멀구슬나무잎추출물, 홀리바질잎추출물, 도금양열매추출물, 가지열매추출물, 병풀추출물, 호장근뿌리추출물, 황금추출물, 녹차추출물, 스페인감초뿌리추출물, 마트리카리아꽃추출물, 로즈마리잎추출물 및 이의 혼합으로 이루어진 군으로부터 선택된다.
알로에베라꽃추출물은 항균 능력과 세포 재생능력을 가지고 있는 알로에베라로부터 피는 꽃을 추출한 구성으로, 이는 피부컨디셔닝을 위해 1 내지 2중량부 정도 첨가될 수 있다. 아비고드열매추출물은 피부의 수분 유지 및 피부의 표면을 매끄럽게 해주는 역할을 하는 구성으로, 1 내지 2중량부 첨가되는 것이 바람직하다. 참산호말추출물은 바닷속에 사는 붉은줄기를 가진 해조류인 참산호말을 추출한 추출물로, 항산화, 피부 재생, 아토피나 트러블 완화 효과를 가지고 있어 이를 화장조성물에 첨가할 경우 피부에 유익한 효과를 제공하게 된다. 이러한 참산호말추출물은 1 내지 2중량부 첨가되는 것이 바람직하다.
울금뿌리추출물은 생강과에 속하는 울금의 뿌리로부터 얻어지는 것으로, 항염효과를 통해 피부의 트러블을 진정시키는 역할을 할 수 있으며, 이는 1 내지 2중량부 첨가된다. 인도멀구슬나무꽃추출물 및 인도멀구슬나무잎추출물은 인도에서 자라는 멀구슬나무의 꽃과 잎을 추출한 것으로, 피부 가려움증, 트러블, 비듬 등을 완화시키며, 피부 또는 머릿결을 부드럽게 하는 효과가 있다. 이러한 인도멀구슬나무꽃추출물은 0.5 내지 1중량부, 인도멀구슬나무잎추출물은 0.5 내지 1중량부 첨가되는 것이 바람직하다.
홀리바질잎추출물은 홀리바질의 잎으로부터 유효성분을 추출한 것으로, 홀리바질잎의 경우 면역체계 강화를 위해 사용되고 있기 때문에 이의 추출물을 화장조성물에 첨가할 경우 피부를 진정시킬 뿐 아니라 면역강화가 가능하다. 이러한 홀리바질잎추출물은 0.5 내지 1중량부 첨가된다. 도금양열매추출물은 남아시아와 동남아시아가 원산지인 도금양의 열매로부터 얻어지는 것으로, 피부의 수분을 유지하는 보습효과 및 과다 피지 분비를 방지하는 역할을 통해 촉촉한 피부로 가꾸어주는 역할을 한다. 이러한 도금양열매추출물은 0.5 내지 1중량부 포함되는 것이 바람직하다.
가지열매추출물은 베타카로틴이 풍부한 가지열매로부터 추출한 것으로, 베타카로틴은 세포를 활성화 및 재생시키는 역할을 하기 때문에 화장조성물에 포함될 경우 피부 재생에 효능을 보이게 된다. 이러한 가지열매추출물은 0.5 내지 1중량부 첨가되는 것이 바람직하다.
병풀추출물은 상처 치유 및 피부손상 개선이 가능하다고 알려진 성분으로, 1 내지 2중량부 첨가된다. 호장근뿌리추출물은 세포의 노화를 방지하는 유효성분을 추출하여 얻은 구성으로, 1 내지 2중량부 포함된다. 황금추출물은 황금이라는 식물로부터 염증 억제 성분을 추출한 것으로, 1 내지 2중량부 포함되는 것이 바람직하다. 녹차추출물은 활성 산소를 억제하여 피부의 노화를 방지하는 역할을 하는 성분을 포함하는 추출물로, 1 내지 2중량부를 함유한다. 이러한 병풀추출물, 호장근뿌리추출물, 황금추출물 및 녹차추출물은 동양 허브의 일종으로 피부 데미지 케어 및 피지 조절에 유용한 추출물이다.
스페인감초뿌리추출물은 중동 허브의 일종인 스페인감초의 추출물로 다양한 성분들과 배합이 용이하여 중화작용에 효과적인 추출물이다. 이러한 스페인감초뿌리추출물은 0.5 내지 1중량부 첨가될 수 있다.
마트리카리아꽃추출물 및 로즈마리잎추출물은 서양 허브인 마트리카리아꽃과 로즈마리잎으로부터 유효성분을 추출한 것으로, 데미지를 받아 예민해진 피부의 진정작용 및 수딩효과를 보인다. 이러한 마트리카리아꽃추출물 및 로즈마리잎추출물은 각각 0.5 중량부 내지 1중량부 포함되는 것이 바람직하다.
아미노산은 발린, 타이로신, 트라이펩타이드-1, 트레오닌, 세린, 프롤린, 페닐알라닌, 팔미토일트라이펩타이드-1, 팔미토일펜타펩타이드-4, 메티오닌, 라이신, 류신, 아이소류신, 히스티딘, 헥사펩타이드-9, 글라이신, 시스테인, 카퍼트라이펩타이드-1, 아스파틱에시드, 알지닌, 알라닌, 아세틸헥사펩타이드-8, 글루타믹에시드 및 이의 혼합으로 이루어진 군으로부터 선택 첨가된다.
상세한 첨가량의 경우 발린 0.5 내지 1중량부, 타이로신 0.5 내지 1중량부, 트라이펩타이드-1 0.5 내지 1중량부, 트레오닌 0.5 내지 1중량부, 세린 0.5 내지 1중량부, 프롤린 0.5 내지 1중량부, 페닐알라닌 0.5 내지 1중량부, 팔미토일트라이펩타이드-1 0.5 내지 1중량부, 팔미토일펜타펩타이드-4 0.5 내지 1중량부, 메티오닌 0.5 내지 1중량부 포함하는 것이 바람직하며, 이때 발린, 타이로신, 트라이펩타이드-1, 트레오닌, 세린, 프롤린, 페닐알라닌, 팔미토일트라이펩타이드-1, 팔미토일펜타펩타이드-4 및 메티오닌은 서로 동일한 양으로 첨가되는 것이 바람직하다.
또한 라이신 0.5 내지 1중량부, 류신 0.5 내지 1중량부, 아이소류신 0.5 내지 1중량부 포함되며, 라이신, 류신 및 아이소류신은 서로 동일한 양으로 첨가될 수 있다.
이뿐만 아니라 히스티딘 0.3 내지 0.5중량부, 헥사펩타이드-9 0.3 내지 0.5중량부, 글라이신 0.3 내지 0.5중량부, 시스테인 0.3 내지 0.5중량부, 카퍼트라이펩타이드-1 0.3 내지 0.5중량부, 아스파틱에시드 0.3 내지 0.5중량부, 알지닌 0.3 내지 0.5중량부, 알라닌 0.3 내지 0.5중량부, 아세틸헥사펩타이드-8 0.3 내지 0.5중량부, 글루타믹에시드 0.3 내지 0.5중량부 포함되는 것이 바람직하다.
이와 같이 본 발명의 화장조성물에 첨가되는 성분들은 EWG 등급이 우수한 성분들이 포함되며, 본 발명에 첨가되는 성분들의 EWG 등급 및 최적의 조성비는 다음과 같이 표 1 내지 표 3을 통해 확인 가능하다. 또한 표 4는 표 1 내지 표 3의 화장조성물과 함께 사용할 경우 시너지 효과를 낼 수 있는 화장조성물에 해당한다.
| 성분명 | 중량부 | EWG 등급 |
| 정제수 | 70.1 | 1 |
| 글리세린 | 3.2 | 1 |
| 부틸렌글라이콜 | 2.7 | 1 |
| 1,2-헥산다이올 | 2.6 | 1 |
| 프로판다이올 | 2.4 | 1 |
| 글루코노락톤 | 2.3 | 1 |
| 폴리글리세릴-10라우레이트 | 2.1 | 1 |
| 알로에베라꽃추출물 | 1.9 | 2 |
| 아이비고드열매추출물 | 1.8 | 1 |
| 참산호말추출물 | 1.6 | 1 |
| 울금뿌리추출물 | 1.3 | 1 |
| 글라이코실트레할로오스 | 1.1 | 1 |
| 인도멀구슬나무꽃추출물 | 0.9 | 1 |
| 인도멀구슬나무잎추출물 | 0.9 | 1 |
| 홀리바질잎추출물 | 0.8 | 1 |
| 도금양열매추출물 | 0.8 | 1 |
| 가지열매추출물 | 0.8 | 1 |
| 하이드로제네이티드스타치하이드롤리세이트 | 0.7 | 1 |
| 트로메타민 | 0.6 | 2 |
| 잔탄검 | 0.6 | 1 |
| 에틸헥실글리세린 | 0.5 | 1 |
| 향료 | 0.3 | 2 |
| 성분명 | 중량부 | EWG 등급 |
| 정제수 | 70.1 | 1 |
| 글리세린 | 3.2 | 1 |
| 부틸렌글라이콜 | 2.7 | 1 |
| 1,2-헥산다이올 | 2.4 | 1 |
| 폴리글리세릴-10라우레이트 | 2.3 | 1 |
| 프로판다이올 | 1.5 | 1 |
| 글루코노락톤 | 0.9 | 1 |
| 발린 | 0.8 | 1 |
| 타이로신 | 0.8 | 1 |
| 트라이펩타이드-1 | 0.8 | 1 |
| 트레오닌 | 0.8 | 1 |
| 세린 | 0.8 | 1 |
| 프롤린 | 0.8 | 1 |
| 페닐알라닌 | 0.8 | 1 |
| 팔미토일트라이펩타이드-1 | 0.8 | 1 |
| 팔미토일펜타펩타이드-4 | 0.8 | 1 |
| 메티오닌 | 0.8 | 1 |
| 인도멀구슬나무꽃추출물 | 0.7 | 1 |
| 라이신 | 0.6 | 1 |
| 류신 | 0.6 | 1 |
| 아이소류신 | 0.6 | 1 |
| 하이드로제네이티드스타치하이드롤리세이트 | 0.6 | 1 |
| 히스티딘 | 0.5 | 1 |
| 헥사펩타이드-9 | 0.5 | 1 |
| 글라이코실트레할로오스 | 0.5 | 1 |
| 글라이신 | 0.5 | 1 |
| 시스테인 | 0.4 | 1 |
| 카퍼트라이펩타이드-1 | 0.4 | 1 |
| 아이비고드열매추출물 | 0.3 | 1 |
| 아스파틱에시드 | 0.3 | 1 |
| 알지닌 | 0.3 | 1 |
| 알라닌 | 0.3 | 1 |
| 아세틸헥사펩타이드-8 | 0.3 | 1 |
| 글루타믹에시드 | 0.3 | 1 |
| 잔탄검 | 0.3 | 1 |
| 트로메타민 | 0.3 | 1 |
| 에틸헥실글리세린 | 0.3 | 2 |
| 향료 | 0.3 | 2 |
| 성분명 | 중량부 | EWG 등급 |
| 정제수 | 70.1 | 1 |
| 글리세린 | 3.2 | 1 |
| 말토데스트린 | 2.7 | 1 |
| 부틸렌글라이콜 | 2.6 | 1 |
| 1,2-헥산다이올 | 2.4 | 1 |
| 글루코노락톤 | 2.3 | 1 |
| 프로판다이올 | 2.2 | 1 |
| 폴리글리세릴-10라우레이트 | 2.1 | 1 |
| 병풀추출물 | 1.6 | 1 |
| 호장근뿌리추출물 | 1.4 | 1 |
| 황금추출물 | 1.2 | 1 |
| 녹차추출물 | 1.1 | 2 |
| 스페인감초뿌리추출물 | 0.9 | 1 |
| 마트리카리아꽃추출물 | 0.8 | 1 |
| 로즈마리잎추출물 | 0.7 | 1 |
| 사이아노코발아민 | 0.7 | 1 |
| 하이드로제네이티드스타치하이드롤리세이트 | 0.7 | 1 |
| 글라이코실트레할로오스 | 0.7 | 1 |
| 잔탄검 | 0.6 | 1 |
| 시트릭에시드 | 0.6 | 2 |
| 소듐시트레이트 | 0.5 | 1 |
| 트로메타민 | 0.3 | 2 |
| 에틸헥실글리세린 | 0.3 | 1 |
| 향료 | 0.3 | 1 |
| 성분명 | 중량부 | EWG 등급 |
| 정제수 | 70.1 | 1 |
| 부틸렌글라이콜 | 3.2 | 1 |
| 베타인 | 3.0 | 1 |
| 1,2-헥산다이올 | 2.8 | 1 |
| 트레할로오스 | 2.7 | 1 |
| 글리세린 | 2.6 | 1 |
| 카카두플럼추출물 | 2.5 | 1 |
| 소듐하이알루로네이트 | 1.7 | 1 |
| 카프릴릭/카프릭트라이글리세라이드 | 1.6 | 1 |
| 시트릭에시드 | 1.6 | 2 |
| 하이드록제네이티드레시틴 | 1.5 | 1 |
| 글루코오스 | 1.5 | 1 |
| 알지닌 | 1.5 | 1 |
| 하이드록시프로필메틸셀룰로오스 | 1.5 | 1 |
| 칼슘카보네이트 | 0.9 | 1 |
| 아세틸글루코사민 | 0.4 | 1 |
| 아스코빅에시드 | 0.3 | 1 |
| 글루타치온 | 0.3 | 1 |
| 에틸헥실글리세린 | 0.3 | 1 |
이와 같은 성분을 포함하는 안정성이 높은 성분을 포함하는 화장조성물은, EWG등급을 기초로 하여 안정성이 높은 것이 확인된 성분을 포함함에 의해 성분의 거부반응이나 과민반응을 최소화할 수 있으며, 항산화 및 보습 기능이 뛰어난 효과를 가지고 있다.
본 발명에 따른 화장조성물을 피부에 테스트한 결과는 도 1을 통해 확인할 수 있다. 도 1에 도시된 바와 같이 화장조성물을 사용하기 전 피부의 경우 수분이 15.8%였으며, 유분은 7.1%인 것으로 측정되었다. 이는 피부에 수분 및 유분이 부족한 건조한 상태임을 의미한다.
이 상태에서 본 발명에 따른 화장조성물을 피부에 1회 도포하고 다시 피부의 수분 및 유분을 측정한 결과, 수분은 50.7%로 이전보다 34.9%가 증가하였으며, 유분은 22.8%로 이전보다 15.7%가 증가한 것을 확인할 수 있었다. 특히 본 발명의 화장조성물을 피부에 1회만 도포하더라도 수분 및 유분의 밸런스가 정상적으로 유지되는 것을 확인할 수 있었다.
본 발명은 상기한 실시예에 한정되지 아니하며, 적용범위가 다양함은 물론이고, 청구범위에서 청구하는 본 발명의 요지를 벗어남이 없이 다양한 변형 실시가 가능한 것은 물론이다.
Claims (4)
- 정제수 70.1중량부, 글리세린 3.2중량부, 부틸렌글라이콜 2.7중량부, 1,2-헥산다이올 2.4중량부, 프로판다이올 1.5중량부, 글루코노락톤 0.9중량부, 폴리글리세릴-10라우레이드 2.3중량부, 글라이코실트레할로오스 0.5중량부, 하이드로제네이티드스타치하이드롤리세이트 0.6중량부, 트로메타민 0.3중량부, 잔탄검 0.3중량부, 에틸헥실글리세린 0.3중량부, 향료, 천연추출물 및 아미노산을 포함하며,
상기 천연추출물은,
알로에베라꽃추출물, 아이비고드열매추출물, 참산호말추출물, 울금뿌리추출물, 인도멀구슬나무꽃추출물, 인도멀구슬나무잎추출물, 홀리바질잎추출물, 도금양열매추출물, 가지열매추출물, 병풀추출물, 호장근뿌리추출물, 황금추출물, 녹차추출물, 스페인감초뿌리추출물, 마트리카리아꽃추출물, 로즈마리잎추출물 및 이의 혼합으로 이루어진 군으로부터 선택되고,
상기 아미노산은,
발린, 타이로신, 트라이펩타이드-1, 트레오닌, 세린, 프롤린, 페닐알라닌, 팔미토일트라이펩타이드-1, 팔미토일펜타펩타이드-4, 메티오닌, 라이신, 류신, 아이소류신, 히스티딘, 헥사펩타이드-9, 글라이신, 시스테인, 카퍼트라이펩타이드-1, 아스파틱에시드, 알지닌, 알라닌, 아세틸헥사펩타이드-8, 글루타믹에시드 및 이의 혼합으로 이루어진 군으로부터 선택되는 것을 특징으로 하는 안정성이 높은 성분을 포함하는 화장조성물. - 삭제
- 삭제
- 삭제
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020220016831A KR102669988B1 (ko) | 2022-02-09 | 2022-02-09 | 안정성이 높은 성분을 포함하는 화장조성물 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020220016831A KR102669988B1 (ko) | 2022-02-09 | 2022-02-09 | 안정성이 높은 성분을 포함하는 화장조성물 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR20230120358A KR20230120358A (ko) | 2023-08-17 |
| KR102669988B1 true KR102669988B1 (ko) | 2024-05-29 |
Family
ID=87800300
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020220016831A KR102669988B1 (ko) | 2022-02-09 | 2022-02-09 | 안정성이 높은 성분을 포함하는 화장조성물 |
Country Status (1)
| Country | Link |
|---|---|
| KR (1) | KR102669988B1 (ko) |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102165559B1 (ko) * | 2019-07-22 | 2020-10-14 | 주식회사 오퍼스아시아 | 여드름 개선 효과가 우수한 화장료 조성물 |
| KR102165567B1 (ko) * | 2019-07-22 | 2020-10-14 | 주식회사 오퍼스아시아 | 피부 보습 효과가 우수한 화장료 조성물 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2542964T3 (es) * | 2006-01-19 | 2015-08-13 | Mary Kay, Inc. | Composiciones que comprenden extracto de ciruela kakadu y extracto de cereza morada de acai |
| KR20200003563A (ko) | 2018-07-02 | 2020-01-10 | 김효정 | 화장품 성분의 ewg 등급 가이딩 시스템, ewg 등급을 포함한 화장품 패키지의 전성분 표기방법 및 ewg 등급을 포함한 화장품 전성분이 표기된 화장품 패키지 |
-
2022
- 2022-02-09 KR KR1020220016831A patent/KR102669988B1/ko active IP Right Grant
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102165559B1 (ko) * | 2019-07-22 | 2020-10-14 | 주식회사 오퍼스아시아 | 여드름 개선 효과가 우수한 화장료 조성물 |
| KR102165567B1 (ko) * | 2019-07-22 | 2020-10-14 | 주식회사 오퍼스아시아 | 피부 보습 효과가 우수한 화장료 조성물 |
Also Published As
| Publication number | Publication date |
|---|---|
| KR20230120358A (ko) | 2023-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2277213C (en) | Cosmetic formulations containing extracts from phyllantus emblica and centella asiatica and/or bacopa monnieri | |
| US10016347B2 (en) | Hair-conditioning mask | |
| CN104586695A (zh) | 含仙人掌精华具有深度补水保湿功效的护肤品 | |
| CN105380843A (zh) | 一种天然植物保湿化妆水及其制备方法 | |
| CN108324674A (zh) | 一种含有肌动蛋白的化妆品复合物的霜剂及其制备方法 | |
| KR101274778B1 (ko) | 천연 식물 추출물을 함유하는 기능성 화장료 조성물 | |
| KR101909980B1 (ko) | 보습 복합물을 함유하는 피부 보습용 화장료 조성물 | |
| KR102181279B1 (ko) | 피부 노화 예방, 피부 주름 개선, 유연 증진, 및 탄력 개선용 화장료 조성물 | |
| KR20170009164A (ko) | 피부미용 마스크팩 조성물 및 이를 포함하는 피부미용 마스크팩 | |
| US20150086522A1 (en) | Formulation containing herb infused aloe | |
| KR102015173B1 (ko) | 저자극성 피부 미백용 화장료 조성물 | |
| CN104606101A (zh) | 一种辣木面膜 | |
| KR102132469B1 (ko) | 두피 및 모발 상태 개선용 조성물 | |
| KR101749690B1 (ko) | 배초향을 함유하는 피지관리 및 모공개선 화장료 조성물 | |
| KR102320497B1 (ko) | 립밤 조성물 및 그 제조방법 | |
| KR20200073970A (ko) | 수딩 크림 및 이의 제조 방법 | |
| CN106344458A (zh) | 一种含人参和鹿茸的美白霜 | |
| KR102669988B1 (ko) | 안정성이 높은 성분을 포함하는 화장조성물 | |
| CN109803638A (zh) | 葡萄藤露在制备化妆品组合物方面的新应用 | |
| KR102062230B1 (ko) | 비타민 나무 추출물을 포함하는 피부 진정 효과를 가지는 화장료 조성물 및 그 제조방법 | |
| KR20180092599A (ko) | 알콜발효 산양산삼을 이용한 화장료 조성물 | |
| CN111973523A (zh) | 一种马齿苋抗敏修护面膜及其制备方法 | |
| CN110237002A (zh) | 一种含香莲提取物的保湿面膜及其制备方法 | |
| KR101753559B1 (ko) | 헤어 수분 크림 조성물 | |
| CN109602653B (zh) | 具有美白功效的组合物、化妆品、精华液及其制备方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E902 | Notification of reason for refusal | ||
| E701 | Decision to grant or registration of patent right |