KR100448552B1 - 산삼 배양근 추출물을 함유하는 간 섬유화 치료용 조성물 - Google Patents
산삼 배양근 추출물을 함유하는 간 섬유화 치료용 조성물 Download PDFInfo
- Publication number
- KR100448552B1 KR100448552B1 KR1020030071317A KR20030071317A KR100448552B1 KR 100448552 B1 KR100448552 B1 KR 100448552B1 KR 1020030071317 A KR1020030071317 A KR 1020030071317A KR 20030071317 A KR20030071317 A KR 20030071317A KR 100448552 B1 KR100448552 B1 KR 100448552B1
- Authority
- KR
- South Korea
- Prior art keywords
- wild ginseng
- root
- extract
- cultured
- mouse
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000284 extract Substances 0.000 title claims abstract description 48
- 229940107131 ginseng root Drugs 0.000 title description 11
- 206010019668 Hepatic fibrosis Diseases 0.000 title description 10
- 235000005035 Panax pseudoginseng ssp. pseudoginseng Nutrition 0.000 claims abstract description 77
- 235000003140 Panax quinquefolius Nutrition 0.000 claims abstract description 77
- 235000008434 ginseng Nutrition 0.000 claims abstract description 77
- 208000019425 cirrhosis of liver Diseases 0.000 claims abstract description 14
- 239000000203 mixture Substances 0.000 claims abstract description 9
- 241000208340 Araliaceae Species 0.000 claims abstract 9
- 210000001519 tissue Anatomy 0.000 claims description 20
- 241000589158 Agrobacterium Species 0.000 claims description 8
- 210000004209 hair Anatomy 0.000 claims description 8
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 claims description 5
- 210000003205 muscle Anatomy 0.000 claims description 5
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 244000241257 Cucumis melo Species 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 11
- 240000004371 Panax ginseng Species 0.000 description 69
- 241000699666 Mus <mouse, genus> Species 0.000 description 40
- 102000008186 Collagen Human genes 0.000 description 17
- 108010035532 Collagen Proteins 0.000 description 17
- 229920001436 collagen Polymers 0.000 description 17
- 239000002609 medium Substances 0.000 description 17
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 16
- SEBFKMXJBCUCAI-UHFFFAOYSA-N NSC 227190 Natural products C1=C(O)C(OC)=CC(C2C(OC3=CC=C(C=C3O2)C2C(C(=O)C3=C(O)C=C(O)C=C3O2)O)CO)=C1 SEBFKMXJBCUCAI-UHFFFAOYSA-N 0.000 description 15
- 230000035876 healing Effects 0.000 description 15
- SEBFKMXJBCUCAI-HKTJVKLFSA-N silibinin Chemical compound C1=C(O)C(OC)=CC([C@@H]2[C@H](OC3=CC=C(C=C3O2)[C@@H]2[C@H](C(=O)C3=C(O)C=C(O)C=C3O2)O)CO)=C1 SEBFKMXJBCUCAI-HKTJVKLFSA-N 0.000 description 15
- 229960004245 silymarin Drugs 0.000 description 15
- 235000017700 silymarin Nutrition 0.000 description 15
- 102000004169 proteins and genes Human genes 0.000 description 11
- 108090000623 proteins and genes Proteins 0.000 description 11
- 241000699670 Mus sp. Species 0.000 description 9
- 239000003814 drug Substances 0.000 description 9
- JTEDVYBZBROSJT-UHFFFAOYSA-N indole-3-butyric acid Chemical compound C1=CC=C2C(CCCC(=O)O)=CNC2=C1 JTEDVYBZBROSJT-UHFFFAOYSA-N 0.000 description 8
- 239000008280 blood Substances 0.000 description 7
- 210000004369 blood Anatomy 0.000 description 7
- 102000007469 Actins Human genes 0.000 description 6
- 108010085238 Actins Proteins 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 238000001647 drug administration Methods 0.000 description 6
- 208000006454 hepatitis Diseases 0.000 description 6
- 231100000283 hepatitis Toxicity 0.000 description 6
- 230000035945 sensitivity Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 5
- 241000219112 Cucumis Species 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 230000006698 induction Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 208000019423 liver disease Diseases 0.000 description 4
- 238000012258 culturing Methods 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 239000001963 growth medium Substances 0.000 description 3
- 230000002443 hepatoprotective effect Effects 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 230000003908 liver function Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 206010016654 Fibrosis Diseases 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000012136 culture method Methods 0.000 description 2
- 230000004761 fibrosis Effects 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 230000003779 hair growth Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000009630 liquid culture Methods 0.000 description 2
- 210000005228 liver tissue Anatomy 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 238000013424 sirius red staining Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 241000723346 Cinnamomum camphora Species 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 206010020649 Hyperkeratosis Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 229910019093 NaOCl Inorganic materials 0.000 description 1
- 235000002791 Panax Nutrition 0.000 description 1
- 241000208343 Panax Species 0.000 description 1
- 235000002789 Panax ginseng Nutrition 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000003925 brain function Effects 0.000 description 1
- 229960000846 camphor Drugs 0.000 description 1
- 229930008380 camphor Natural products 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 210000001339 epidermal cell Anatomy 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000007661 gastrointestinal function Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 230000002008 hemorrhagic effect Effects 0.000 description 1
- 231100000334 hepatotoxic Toxicity 0.000 description 1
- 230000003082 hepatotoxic effect Effects 0.000 description 1
- 230000013632 homeostatic process Effects 0.000 description 1
- 230000036737 immune function Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 1
- 229960000367 inositol Drugs 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002402 nanowire electron scattering Methods 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 238000004161 plant tissue culture Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 229960003495 thiamine Drugs 0.000 description 1
- DPJRMOMPQZCRJU-UHFFFAOYSA-M thiamine hydrochloride Chemical compound Cl.[Cl-].CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N DPJRMOMPQZCRJU-UHFFFAOYSA-M 0.000 description 1
- 235000019190 thiamine hydrochloride Nutrition 0.000 description 1
- 239000011747 thiamine hydrochloride Substances 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K36/00—Medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicines
- A61K36/18—Magnoliophyta (angiosperms)
- A61K36/185—Magnoliopsida (dicotyledons)
- A61K36/25—Araliaceae (Ginseng family), e.g. ivy, aralia, schefflera or tetrapanax
- A61K36/258—Panax (ginseng)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2236/00—Isolation or extraction methods of medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicine
- A61K2236/10—Preparation or pretreatment of starting material
- A61K2236/11—Preparation or pretreatment of starting material involving culturing conditions, e.g. cultivation in the dark or under defined water stress
Landscapes
- Health & Medical Sciences (AREA)
- Natural Medicines & Medicinal Plants (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Alternative & Traditional Medicine (AREA)
- Biotechnology (AREA)
- Botany (AREA)
- Medical Informatics (AREA)
- Medicinal Chemistry (AREA)
- Microbiology (AREA)
- Mycology (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicines Containing Plant Substances (AREA)
Abstract
Description
| 배지 성분 | mg/L | 배지 성분 | mg/L |
| KNO3 | 1900 | KI | 0.83 |
| NH4NO3 | 1650 | Na2MoO4. 2H2O | 0.25 |
| CaCl22H2O | 440 | FeSO4. 7H2O | 27.8 |
| MgSO4. 7H2O | 370 | Na2. EDTA | 37.3 |
| KH2PO4 | 170 | Thiamine-HCl | 0.4 |
| MnSO4. 4H2O | 22.3 | Myo-Inositol | 100 |
| ZnSO4. 4 H2O | 8.6 | Sucrose | 30,000 |
| H3BO3 | 6.2 | Agar | 7,000 |
| CCl4투여전 | CCl4투여후1일 | CCl4투여후3일 | CCl4투여후5일 | |||||
| GOT | GPT | GOT | GPT | GOT | GPT | GOT | GPT | |
| 미처리 | 0.044 | 0.009 | 0.117 | 0.144 | 0.099 | 0.111 | 0.064 | 0.045 |
| 0.049 | 0.005 | 0.116 | 0.140 | 0.091 | 0.101 | 0.057 | 0.041 | |
| 0.065 | 0.012 | 0.121 | 0.139 | 0.100 | 0.109 | 0.061 | 0.058 | |
| 0.052 | 0.011 | 0.099 | 0.139 | 0.089 | 0.121 | 0.059 | 0.051 | |
| 0.058 | 0.005 | 0.100 | 0.135 | 0.082 | 0.121 | 0.061 | 0.036 | |
| 0.039 | 0.010 | 0.120 | 0.149 | 0.101 | 0.116 | 0.067 | 0.041 | |
| 0.042 | 0.017 | 0.116 | 0.148 | 0.109 | 0.101 | 0.055 | 0.039 | |
| 0.047 | 0.006 | 0.111 | 0.152 | 0.099 | 0.099 | 0.056 | 0.044 | |
| 0.045 | 0.008 | 0.117 | 0.143 | 0.087 | 0.130 | 0.059 | 0.049 | |
| 0.045 | 0.008 | 0.116 | 0.145 | 0.089 | 0.102 | 0.063 | 0.036 | |
| 평균 | 0.049 | 0.010 | 0.113 | 0.143 | 0.095 | 0.110 | 0.060 | 0.044 |
| silymarin | 0.051 | 0.009 | 0.111 | 0.147 | 0.065 | 0.060 | 마우스 사망 | |
| 0.049 | 0.005 | 0.121 | 0.130 | 0.068 | 0.066 | 0.059 | 0.040 | |
| 0.068 | 0.012 | 0.121 | 0.137 | 0.071 | 0.064 | 0.064 | 0.036 | |
| 0.050 | 0.011 | 0.114 | 0.136 | 0.073 | 0.059 | 0.049 | 0.039 | |
| 0.049 | 0.005 | 0.105 | 0.141 | 0.055 | 0.072 | 0.060 | 0.049 | |
| 0.044 | 0.010 | 마우스 사망 | ||||||
| 0.039 | 0.017 | 0.100 | 0.138 | 0.067 | 0.070 | 0.057 | 0.039 | |
| 0.049 | 0.006 | 0.121 | 0.151 | 0.060 | 0.079 | 0.055 | 0.034 | |
| 0.050 | 0.008 | 0.116 | 0.139 | 0.077 | 0.069 | 0.048 | 0.046 | |
| 0.062 | 0.008 | 0.116 | 0.144 | 0.059 | 0.087 | 0.059 | 0.049 | |
| 평균 | 0.051 | 0.009 | 0.114 | 0.140 | 0.066 | 0.070 | 0.056 | 0.042 |
| 산삼배양근 추출물 | 0.044 | 0.012 | 0.099 | 0.130 | 0.075 | 0.088 | 0.052 | 0.038 |
| 0.039 | 0.004 | 0.125 | 0.139 | 0.088 | 0.089 | 0.069 | 0.044 | |
| 0.071 | 0.010 | 0.127 | 0.157 | 마우스 사망 | ||||
| 0.048 | 0.008 | 0.119 | 0.140 | 0.099 | 0.079 | 0.040 | 0.041 | |
| 0.039 | 0.008 | 0.100 | 0.139 | 0.079 | 0.090 | 0.059 | 0.044 | |
| 0.049 | 0.007 | 0.126 | 0.137 | 0.087 | 0.079 | 0.056 | 0.070 | |
| 0.035 | 0.009 | 0.111 | 0.147 | 0.076 | 0.076 | 0.070 | 0.037 | |
| 0.047 | 0.006 | 0.119 | 0.139 | 0.080 | 0.099 | 0.052 | 0.043 | |
| 0.048 | 0.007 | 0.119 | 0.149 | 0.069 | 0.079 | 0.050 | 0.048 | |
| 0.047 | 0.014 | 0.121 | 0.150 | 0.078 | 0.087 | 0.049 | 0.050 | |
| 평균 | 0.046 | 0.009 | 0.117 | 0.143 | 0.081 | 0.085 | 0.055 | 0.046 |
| CCl4투여전 | CCl4투여후 4일 | |||
| GOT | GPT | GOT | GPT | |
| Control | 0.054 | 0.021 | 0.085 | 0.099 |
| 0.050 | 0.027 | 0.088 | 0.091 | |
| 0.049 | 0.025 | 0.072 | 0.090 | |
| 0.062 | 0.031 | 0.066 | 0.101 | |
| 0.049 | 0.020 | 0.069 | 0.088 | |
| 0.061 | 0.026 | 마우스 사망 | ||
| 0.053 | 0.019 | 0.082 | 0.111 | |
| 평균 | 0.054 | 0.024 | 0.077 | 0.097 |
| silymarin | 0.057 | 0.027 | 0.065 | 0.065 |
| 0.044 | 0.024 | 0.061 | 0.092 | |
| 0.052 | 0.039 | 0.077 | 0.077 | |
| 0.069 | 0.033 | 0.069 | 0.071 | |
| 0.039 | 0.029 | 0.060 | 0.080 | |
| 0.055 | 0.021 | 0.087 | 0.088 | |
| 0.059 | 0.011 | 0.060 | 0.076 | |
| 평균 | 0.054 | 0.026 | 0.068 | 0.078 |
| 산삼배양근추출물(3mg/M) | 0.050 | 0.020 | 0.075 | 0.083 |
| 0.049 | 0.027 | 0.071 | 0.087 | |
| 0.050 | 0.031 | 0.070 | 0.089 | |
| 0.059 | 0.021 | 0.074 | 0.091 | |
| 0.055 | 0.022 | 0.080 | 0.080 | |
| 0.031 | 0.014 | 0.076 | 0.088 | |
| 0.057 | 0.021 | 0.083 | 0.085 | |
| 평균 | 0.050 | 0.022 | 0.076 | 0.086 |
| CCl4투여전 | CCl4투여후(4일) | |||
| GOT | GPT | GOT | GPT | |
| 미처리군 | 0.044 | 0.011 | 0.066 | 0.099 |
| 0.031 | 0.020 | 0.058 | 0.083 | |
| 0.028 | 0.009 | 0.059 | 0.091 | |
| 0.027 | 0.020 | 0.090 | 0.090 | |
| 0.034 | 0.017 | 0.082 | 0.121 | |
| 0.029 | 0.010 | 0.057 | 0.071 | |
| 0.049 | 0.011 | 마우스 사망 | ||
| 0.044 | 0.017 | 0.071 | 0.088 | |
| 0.038 | 0.016 | 0.048 | 0.116 | |
| 0.029 | 0.020 | 0.065 | 0.099 | |
| 평균 | 0.035 | 0.015 | 0.066 | 0.095 |
| Silymarin 투여군(50mg/kg) | 0.039 | 0.021 | 0.048 | 0.063 |
| 0.041 | 0.027 | 0.055 | 0.068 | |
| 0.020 | 0.017 | 0.038 | 0.079 | |
| 0.039 | 0.019 | 0.053 | 0.080 | |
| 0.037 | 0.017 | 0.047 | 0.055 | |
| 0.033 | 0.018 | 0.044 | 0.072 | |
| 0.047 | 0.021 | 0.065 | 0.060 | |
| 0.048 | 0.020 | 0.040 | 0.061 | |
| 0.032 | 0.007 | 마우스 사망 | ||
| 0.035 | 0.011 | 0.052 | 0.063 | |
| 평균 | 0.037 | 0.018 | 0.049 | 0.067 |
| 산삼배양근 추출물 (20mg/mouse) | 0.037 | 0.013 | 마우스 사망 | |
| 0.033 | 0.017 | 0.059 | 0.094 | |
| 0.030 | 0.022 | 0.071 | 0.081 | |
| 0.031 | 0.019 | 0.050 | 0.079 | |
| 0.039 | 0.009 | 0.049 | 0.083 | |
| 0.041 | 0.027 | 0.063 | 0.060 | |
| 0.036 | 0.016 | 0.049 | 0.077 | |
| 0.037 | 0.014 | 마우스 사망 | ||
| 0.030 | 0.014 | 0.056 | 0.076 | |
| 0.037 | 0.017 | 0.052 | 0.080 | |
| 평균 | 0.035 | 0.016 | 0.056 | 0.079 |
| CCl4미투여 정상마우스 | ||
| 알파-SM-actin(비 감광도) | Collagen(㎍/mg 총단백질) | |
| CCl4투여전정상 마우스 | +/- | 0.0025 |
| +/- | 0.0028 | |
| + | 0.0019 | |
| + | 0.0020 | |
| +/- | 0.0028 | |
| +/- | 0.0014 | |
| +/- | 0.0011 | |
| +/- | 0.0028 | |
| +/- | 0.0022 | |
| + | 0.0017 | |
| 평균 | 0.3 | 0.0021 |
| 약물 투여전(CCl4-4회투여) | 약물 투여후 | |||
| 알파-SM-actin(비 감광도) | Collagen(㎍/mg 총단백질) | 알파-SM-actin(비 감광도) | Collagen(㎍/mg 총단백질) | |
| 미처리군 | ++ | 0.0137 | 마우스 사망 | |
| +++ | 0.0129 | ++ | 0.0116 | |
| ++ | 0.0122 | ++ | 0.0117 | |
| 마우스 사망 | + | 0.0103 | ||
| ++ | 0.0148 | +++ | 0.0173 | |
| +/- | 0.0138 | + | 0.0095 | |
| ++ | 0.0126 | ++ | 0.0101 | |
| +++ | 0.0130 | ++ | 0.0099 | |
| + | 0.0098 | ++ | 0.0101 | |
| ++ | 0.0106 | +/- | 0.0096 | |
| 평균 | 1.9 | 0.0126 | 1.7 | 0.0112 |
| silymarin(25mg/kg) | 마우스 사망 | |||
| + | 0.0138 | |||
| ++ | 0.0129 | |||
| + | 0.0132 | |||
| ++ | 0.0111 | |||
| ++ | 0.0101 | |||
| +++ | 0.0069 | |||
| ++ | 0.0129 | |||
| ++ | 0.0099 | |||
| + | 0.0119 | |||
| 평균 | 1.6 | 0.0114 | ||
| 산삼배양근추출물(3mg/mouse) | + | 0.0098 | ||
| ++ | 0.0078 | |||
| ++ | 0.0090 | |||
| + | 0.0132 | |||
| + | 0.0121 | |||
| + | 0.0089 | |||
| ++ | 0.0095 | |||
| + | 0.0114 | |||
| ++ | 0.0096 | |||
| ++ | 0.0121 | |||
| 평균 | 1.5 | 0.0103 |
| CCl4미투여 정상마우스 | ||
| 알파-SM-actin(비 감광도) | Collagen(㎍/mg 총단백질) | |
| CCl4투여전정상 마우스 | +/- | 0.0019 |
| +/- | 0.0021 | |
| + | 0.0020 | |
| + | 0.0017 | |
| ++ | 0.0031 | |
| +/- | 0.0019 | |
| +/- | 0.0016 | |
| + | 0.0022 | |
| +/- | 0.0026 | |
| +/- | 0.0015 | |
| 평균 | 0.5 | 0.0022 |
| 약물 투여전(CCl4-4회투여-4주) | 약물 투여후(5주) | |||
| 알파-SM-actin(비 감광도) | Collagen(㎍/mg 총단백질) | 알파-SM-actin(비 감광도) | Collagen(㎍/mg 총단백질) | |
| 미처리군 | +++ | 0.0127 | ++ | 0.0119 |
| ++ | 0.0149 | ++ | 0.0121 | |
| ++ | 0.0133 | +/- | 0.0099 | |
| ++ | 0.0098 | ++ | 0.0138 | |
| ++ | 0.0123 | + | 0.0126 | |
| ++ | 0.0151 | ++ | 0.0147 | |
| + | 0.0132 | ++ | 0.0106 | |
| ++ | 0.0131 | + | 0.0102 | |
| + | 0.0123 | ++ | 0.0099 | |
| +++ | 0.0126 | ++ | 0.0103 | |
| 평균 | 2.0 | 0.0129 | 1.6 | 0.0116 |
| silymarin(50mg/kg) | 마우스 사망 | |||
| ++ | 0.0103 | |||
| + | 0.0131 | |||
| +++ | 0.0129 | |||
| + | 0.0127 | |||
| + | 0.0100 | |||
| + | 0.0103 | |||
| + | 0.0117 | |||
| ++ | 0.0101 | |||
| + | 0.0120 | |||
| 평균 | 1.3 | 0.0114 | ||
| 산삼배양근 추출물(20mg/mouse) | ++ | 0.0131 | ||
| 마우스 사망 | ||||
| +/- | 0.0058 | |||
| ++ | 0.0127 | |||
| + | 0.0101 | |||
| + | 0.0078 | |||
| 마우스 사망 | ||||
| ++ | 0.0086 | |||
| + | 0.0077 | |||
| ++ | 0.0100 | |||
| 평균 | 1.1 | 0.0095 |
Claims (6)
- 산삼 배양근 추출물을 유효량 함유하는 것을 특징으로 하는 간 섬유화 치료용 조성물.
- 삭제
- 삭제
- 제1항에 있어서, 상기 추출물은 산삼배양근을 101℃-200℃에서 1-24시간 동안 가압 추출한 것임을 특징으로 하는 조성물.
- 제1항에 있어서, 상기 산삼 배양근은 자연산 산삼의 뿌리를 메론에서 분리한 아그로박테리움(Agrobacterium)에 감염시켜 뿌리털을 유도한 후 배양한 모상근 또는 자연산 산삼의 뿌리를 조직배양으로 배양한 부정근인 것을 특징으로 하는 조성물.
- 삭제
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020030071317A KR100448552B1 (ko) | 2003-10-14 | 2003-10-14 | 산삼 배양근 추출물을 함유하는 간 섬유화 치료용 조성물 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020030071317A KR100448552B1 (ko) | 2003-10-14 | 2003-10-14 | 산삼 배양근 추출물을 함유하는 간 섬유화 치료용 조성물 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020040041491A Division KR100472220B1 (ko) | 2004-06-07 | 2004-06-07 | 산삼 배양근 추출물을 함유하는 간 섬유화 개선용 식품 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR100448552B1 true KR100448552B1 (ko) | 2004-09-16 |
Family
ID=37366726
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020030071317A Expired - Lifetime KR100448552B1 (ko) | 2003-10-14 | 2003-10-14 | 산삼 배양근 추출물을 함유하는 간 섬유화 치료용 조성물 |
Country Status (1)
| Country | Link |
|---|---|
| KR (1) | KR100448552B1 (ko) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010019016A3 (ko) * | 2008-08-14 | 2010-06-17 | 주식회사 운화바이오텍 | 산삼 또는 인삼을 포함한 인삼류의 형성층 유래 식물줄기세포주를 유효성분으로 함유하는 간질환의 예방 또는 치료용 조성물 |
| KR20160093163A (ko) | 2015-01-28 | 2016-08-08 | (주)에이씨티 | 산삼배양근 청 및 이의 제조방법 |
-
2003
- 2003-10-14 KR KR1020030071317A patent/KR100448552B1/ko not_active Expired - Lifetime
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010019016A3 (ko) * | 2008-08-14 | 2010-06-17 | 주식회사 운화바이오텍 | 산삼 또는 인삼을 포함한 인삼류의 형성층 유래 식물줄기세포주를 유효성분으로 함유하는 간질환의 예방 또는 치료용 조성물 |
| CN102316883B (zh) * | 2008-08-14 | 2014-10-29 | 云火公司 | 含有包括野山参或人参的人参类的形成层来源的植物干细胞系作为有效成分的肝疾病的预防或治疗用组合物 |
| US9289457B2 (en) | 2008-08-14 | 2016-03-22 | Unhwa Coproration | Composition for preventing or treating liver diseases, containing plant stem cell lines derived from the cambium of Panax ginseng including mountain ginseng or ginseng as active ingredient |
| KR20160093163A (ko) | 2015-01-28 | 2016-08-08 | (주)에이씨티 | 산삼배양근 청 및 이의 제조방법 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Cambie et al. | Fijian medicinal plants | |
| Halpern | Healing mushrooms | |
| WO2009145345A1 (ja) | 冬虫夏草菌セミタケを含む外用剤 | |
| Mathivanan et al. | Morinda pubescens JE Smith (Morinda tinctoria Roxb.) fruit extract accelerates wound healing in rats | |
| KR101769755B1 (ko) | 엘라스테이즈 저해 효능이 향상된 류코노스톡 메센테로이데스 gfc 160704 균주, 상기 균주 또는 이의 배양액을 포함하는 주름 개선용 화장료 조성물 및 이의 제조 방법 | |
| KR102249711B1 (ko) | 콩과 식물 배양근의 효소 처리 추출물을 함유하는 피부 탄력 증진용 또는 피부 주름 개선용 조성물 | |
| Stengler | Health benefits of medicinal mushrooms | |
| KR100448552B1 (ko) | 산삼 배양근 추출물을 함유하는 간 섬유화 치료용 조성물 | |
| KR101957424B1 (ko) | 유인제를 처리하여 에키네시아 속 식물체의 부정근의 유용성분 함량을 증가시키는 방법 | |
| KR100472220B1 (ko) | 산삼 배양근 추출물을 함유하는 간 섬유화 개선용 식품 | |
| KR101013527B1 (ko) | 오가피-버섯 균사체 발효물을 포함하는 위염예방 및 치료용 약학 조성물과 그로부터 추출된 오가피-버섯 균사체 발효추출물을 유효성분으로 하는 위염예방 및 치료용 약제 | |
| CN107522536A (zh) | 一种平菇栽培的营养基质及其栽培平菇的方法 | |
| Jha et al. | Phytochemical and pharmacology activity of Bhringraj: A review | |
| KR100442766B1 (ko) | 코르다이세프스 큐슈엔시스 와이 코바야시의 인공 배양방법 및 그의 포자낭과의 용도 | |
| KR101988295B1 (ko) | 한약재 혼합 추출물을 유효성분으로 함유하는 피부 보습 및 주름 개선용 조성물 | |
| KR20170040555A (ko) | 녹용 배양액을 이용한 시알산 함유 콩나물 및 이의 재배 방법 | |
| KR100573375B1 (ko) | 으름덩굴 종자 추출물을 포함하는 항암 조성물 및 그의제조방법 | |
| KR20110058928A (ko) | 식용 또는 약용버섯균을 배양한 수세미 | |
| KR101062003B1 (ko) | 사방오리나무 추출물 또는 그로부터 분리된 화합물을 유효성분으로 하는 당뇨병 예방 및 치료용 조성물 | |
| KR20170040659A (ko) | 고염 미생물의 발효 추출물을 포함하는 조성물 | |
| KR20190119020A (ko) | 지칭개 추출물을 유효성분으로 함유하는 항염증 조성물 | |
| KR20170051926A (ko) | 붉은토끼풀(red clover, Trifolium pratense) 유래 Biochanin-A를 유효성분으로 하는 퇴행성관절염 예방 기능성 식품 조성물 | |
| Bakhshullayevich et al. | New information about the characteristics of medicinal plants | |
| KR102112963B1 (ko) | 산양산삼 식초를 이용한 피부 치료 및 개선용 조성물 | |
| CN108837029A (zh) | 一种防治水产动物水霉病的药物组合物及其制备方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A201 | Request for examination | ||
| PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 20031014 |
|
| PA0201 | Request for examination | ||
| A302 | Request for accelerated examination | ||
| PA0302 | Request for accelerated examination |
Patent event date: 20031212 Patent event code: PA03022R01D Comment text: Request for Accelerated Examination Patent event date: 20031014 Patent event code: PA03021R01I Comment text: Patent Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20040226 Patent event code: PE09021S01D |
|
| AMND | Amendment | ||
| E601 | Decision to refuse application | ||
| PE0601 | Decision on rejection of patent |
Patent event date: 20040531 Comment text: Decision to Refuse Application Patent event code: PE06012S01D Patent event date: 20040226 Comment text: Notification of reason for refusal Patent event code: PE06011S01I |
|
| A107 | Divisional application of patent | ||
| AMND | Amendment | ||
| J201 | Request for trial against refusal decision | ||
| PA0107 | Divisional application |
Comment text: Divisional Application of Patent Patent event date: 20040607 Patent event code: PA01071R01D |
|
| PJ0201 | Trial against decision of rejection |
Patent event date: 20040607 Comment text: Request for Trial against Decision on Refusal Patent event code: PJ02012R01D Patent event date: 20040531 Comment text: Decision to Refuse Application Patent event code: PJ02011S01I Appeal kind category: Appeal against decision to decline refusal Decision date: 20040805 Appeal identifier: 2004101002479 Request date: 20040607 |
|
| PB0901 | Examination by re-examination before a trial |
Comment text: Amendment to Specification, etc. Patent event date: 20040607 Patent event code: PB09011R02I Comment text: Request for Trial against Decision on Refusal Patent event date: 20040607 Patent event code: PB09011R01I Comment text: Amendment to Specification, etc. Patent event date: 20040329 Patent event code: PB09011R02I |
|
| B701 | Decision to grant | ||
| PB0701 | Decision of registration after re-examination before a trial |
Patent event date: 20040805 Comment text: Decision to Grant Registration Patent event code: PB07012S01D Patent event date: 20040712 Comment text: Transfer of Trial File for Re-examination before a Trial Patent event code: PB07011S01I |
|
| GRNT | Written decision to grant | ||
| PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20040903 Patent event code: PR07011E01D |
|
| PR1002 | Payment of registration fee |
Payment date: 20040906 End annual number: 3 Start annual number: 1 |
|
| PG1601 | Publication of registration | ||
| PR1001 | Payment of annual fee |
Payment date: 20070903 Start annual number: 4 End annual number: 4 |
|
| PR1001 | Payment of annual fee |
Payment date: 20080903 Start annual number: 5 End annual number: 5 |
|
| PR1001 | Payment of annual fee |
Payment date: 20090903 Start annual number: 6 End annual number: 6 |
|
| PR1001 | Payment of annual fee |
Payment date: 20100903 Start annual number: 7 End annual number: 7 |
|
| PR1001 | Payment of annual fee |
Payment date: 20110902 Start annual number: 8 End annual number: 8 |
|
| FPAY | Annual fee payment |
Payment date: 20120903 Year of fee payment: 9 |
|
| PR1001 | Payment of annual fee |
Payment date: 20120903 Start annual number: 9 End annual number: 9 |
|
| FPAY | Annual fee payment |
Payment date: 20130909 Year of fee payment: 10 |
|
| PR1001 | Payment of annual fee |
Payment date: 20130909 Start annual number: 10 End annual number: 10 |
|
| FPAY | Annual fee payment |
Payment date: 20140903 Year of fee payment: 11 |
|
| PR1001 | Payment of annual fee |
Payment date: 20140903 Start annual number: 11 End annual number: 11 |
|
| FPAY | Annual fee payment |
Payment date: 20150901 Year of fee payment: 12 |
|
| PR1001 | Payment of annual fee |
Payment date: 20150901 Start annual number: 12 End annual number: 12 |
|
| FPAY | Annual fee payment |
Payment date: 20160902 Year of fee payment: 13 |
|
| PR1001 | Payment of annual fee |
Payment date: 20160902 Start annual number: 13 End annual number: 13 |
|
| FPAY | Annual fee payment |
Payment date: 20190809 Year of fee payment: 16 |
|
| PR1001 | Payment of annual fee |
Payment date: 20190809 Start annual number: 16 End annual number: 16 |
|
| PR1001 | Payment of annual fee |
Payment date: 20200729 Start annual number: 17 End annual number: 17 |
|
| PR1001 | Payment of annual fee |
Payment date: 20210729 Start annual number: 18 End annual number: 18 |
|
| PR1001 | Payment of annual fee |
Payment date: 20220725 Start annual number: 19 End annual number: 19 |
|
| PR1001 | Payment of annual fee |
Payment date: 20230831 Start annual number: 20 End annual number: 20 |
|
| PC1801 | Expiration of term |
Termination date: 20240414 Termination category: Expiration of duration |