JPWO2020219778A5 - - Google Patents
Download PDFInfo
- Publication number
- JPWO2020219778A5 JPWO2020219778A5 JP2021563172A JP2021563172A JPWO2020219778A5 JP WO2020219778 A5 JPWO2020219778 A5 JP WO2020219778A5 JP 2021563172 A JP2021563172 A JP 2021563172A JP 2021563172 A JP2021563172 A JP 2021563172A JP WO2020219778 A5 JPWO2020219778 A5 JP WO2020219778A5
- Authority
- JP
- Japan
- Prior art keywords
- antibody
- seq
- amino acid
- antigen
- variable region
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 102000004965 antibodies Human genes 0.000 claims description 785
- 108090001123 antibodies Proteins 0.000 claims description 785
- 230000027455 binding Effects 0.000 claims description 335
- 125000003275 alpha amino acid group Chemical group 0.000 claims description 284
- 239000000427 antigen Substances 0.000 claims description 284
- 108091007172 antigens Proteins 0.000 claims description 284
- 102000038129 antigens Human genes 0.000 claims description 284
- 210000004027 cells Anatomy 0.000 claims description 178
- 239000000611 antibody drug conjugate Substances 0.000 claims description 141
- 108091008116 antibody drug conjugates Proteins 0.000 claims description 141
- 230000035772 mutation Effects 0.000 claims description 101
- 102100016985 KIT Human genes 0.000 claims description 94
- 101710009391 KIT Proteins 0.000 claims description 94
- -1 p-aminobenzyl Chemical group 0.000 claims description 87
- 230000001603 reducing Effects 0.000 claims description 81
- 210000003958 Hematopoietic Stem Cells Anatomy 0.000 claims description 66
- 125000001424 substituent group Chemical group 0.000 claims description 58
- 150000001413 amino acids Chemical class 0.000 claims description 44
- HXCHCVDVKSCDHU-LULTVBGHSA-N Calicheamicin Chemical compound C1[C@H](OC)[C@@H](NCC)CO[C@H]1O[C@H]1[C@H](O[C@@H]2C\3=C(NC(=O)OC)C(=O)C[C@](C/3=C/CSSSC)(O)C#C\C=C/C#C2)O[C@H](C)[C@@H](NO[C@@H]2O[C@H](C)[C@@H](SC(=O)C=3C(=C(OC)C(O[C@H]4[C@@H]([C@H](OC)[C@@H](O)[C@H](C)O4)O)=C(I)C=3C)OC)[C@@H](O)C2)[C@@H]1O HXCHCVDVKSCDHU-LULTVBGHSA-N 0.000 claims description 38
- 201000011510 cancer Diseases 0.000 claims description 35
- 239000000126 substance Substances 0.000 claims description 34
- 125000001072 heteroaryl group Chemical group 0.000 claims description 30
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 29
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 24
- 125000003118 aryl group Chemical group 0.000 claims description 22
- 230000003750 conditioning Effects 0.000 claims description 22
- 210000000130 stem cell Anatomy 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 150000002019 disulfides Chemical class 0.000 claims description 17
- 125000005842 heteroatoms Chemical group 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 15
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 claims description 14
- 125000006711 (C2-C12) alkynyl group Chemical group 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 14
- 125000000304 alkynyl group Chemical group 0.000 claims description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 14
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 14
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 13
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 13
- 206010003816 Autoimmune disease Diseases 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- 238000002054 transplantation Methods 0.000 claims description 12
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- 125000005418 aryl aryl group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- 238000005859 coupling reaction Methods 0.000 claims description 8
- FTJHKZQHQDKPFJ-UHFFFAOYSA-M NC(=O)NNC([O-])=O Chemical compound NC(=O)NNC([O-])=O FTJHKZQHQDKPFJ-UHFFFAOYSA-M 0.000 claims description 7
- 125000004442 acylamino group Chemical group 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 claims description 7
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 7
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 7
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 7
- 201000009596 autoimmune hypersensitivity disease Diseases 0.000 claims description 6
- 201000005787 hematologic cancer Diseases 0.000 claims description 6
- 150000002429 hydrazines Chemical class 0.000 claims description 6
- 150000003568 thioethers Chemical class 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000004367 cycloalkylaryl group Chemical group 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 201000003793 myelodysplastic syndrome Diseases 0.000 claims description 4
- 206010028549 Myeloid leukaemia Diseases 0.000 claims description 2
- 125000005647 linker group Chemical group 0.000 description 153
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 102
- 235000001014 amino acid Nutrition 0.000 description 71
- 238000006722 reduction reaction Methods 0.000 description 71
- 108010047041 Complementarity Determining Regions Proteins 0.000 description 62
- 239000002619 cytotoxin Substances 0.000 description 55
- 231100000599 cytotoxic agent Toxicity 0.000 description 54
- 101700027111 3SA0 Proteins 0.000 description 46
- 101700067609 ctx Proteins 0.000 description 46
- 201000010099 disease Diseases 0.000 description 38
- 238000000034 method Methods 0.000 description 37
- 239000000203 mixture Substances 0.000 description 34
- 125000000539 amino acid group Chemical group 0.000 description 32
- 239000000562 conjugate Substances 0.000 description 32
- 239000003814 drug Substances 0.000 description 31
- 229940024606 Amino Acids Drugs 0.000 description 28
- 150000001875 compounds Chemical class 0.000 description 27
- 238000004166 bioassay Methods 0.000 description 26
- 238000006467 substitution reaction Methods 0.000 description 26
- 238000002560 therapeutic procedure Methods 0.000 description 25
- 125000004432 carbon atoms Chemical group C* 0.000 description 24
- 230000000875 corresponding Effects 0.000 description 23
- 102000004169 proteins and genes Human genes 0.000 description 23
- 108090000623 proteins and genes Proteins 0.000 description 23
- 210000001772 Blood Platelets Anatomy 0.000 description 22
- 102000037080 NR1 subfamily Human genes 0.000 description 22
- 108020001305 NR1 subfamily Proteins 0.000 description 22
- 230000021615 conjugation Effects 0.000 description 22
- 108010070144 Single-Chain Antibodies Proteins 0.000 description 21
- 102000005632 Single-Chain Antibodies Human genes 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 238000000338 in vitro Methods 0.000 description 20
- 102000018358 Immunoglobulins Human genes 0.000 description 19
- 108060003951 Immunoglobulins Proteins 0.000 description 19
- 238000011134 hematopoietic stem cell transplantation Methods 0.000 description 19
- 235000018102 proteins Nutrition 0.000 description 19
- 210000000138 Mast Cells Anatomy 0.000 description 18
- 230000036499 Half live Effects 0.000 description 16
- 102000004851 Immunoglobulin G Human genes 0.000 description 16
- 235000018417 cysteine Nutrition 0.000 description 16
- 229940079593 drugs Drugs 0.000 description 16
- 230000001363 autoimmune Effects 0.000 description 15
- 125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 15
- 230000004048 modification Effects 0.000 description 15
- 238000006011 modification reaction Methods 0.000 description 15
- 230000002829 reduced Effects 0.000 description 15
- 230000000694 effects Effects 0.000 description 14
- 230000001264 neutralization Effects 0.000 description 14
- 229920001184 polypeptide Polymers 0.000 description 14
- 210000001616 Monocytes Anatomy 0.000 description 13
- 108010029485 Protein Isoforms Proteins 0.000 description 13
- 102000001708 Protein Isoforms Human genes 0.000 description 13
- 150000007523 nucleic acids Chemical class 0.000 description 13
- 230000000269 nucleophilic Effects 0.000 description 13
- 238000002823 phage display Methods 0.000 description 13
- 230000001419 dependent Effects 0.000 description 12
- 230000014509 gene expression Effects 0.000 description 12
- 108020004707 nucleic acids Proteins 0.000 description 12
- 238000003127 radioimmunoassay Methods 0.000 description 12
- 210000001519 tissues Anatomy 0.000 description 12
- 102100016492 CD34 Human genes 0.000 description 11
- 108060001251 CD34 Proteins 0.000 description 11
- 210000003743 Erythrocytes Anatomy 0.000 description 11
- 210000001744 T-Lymphocytes Anatomy 0.000 description 11
- 238000004458 analytical method Methods 0.000 description 11
- 229910052799 carbon Inorganic materials 0.000 description 11
- 210000002540 Macrophages Anatomy 0.000 description 10
- 238000002838 bio layer interferometry Methods 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- DHMQDGOQFOQNFH-UHFFFAOYSA-N glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 10
- 230000001225 therapeutic Effects 0.000 description 10
- NFGXHKASABOEEW-UHFFFAOYSA-N (+)-methoprene Chemical compound COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C NFGXHKASABOEEW-UHFFFAOYSA-N 0.000 description 9
- 210000003719 B-Lymphocytes Anatomy 0.000 description 9
- 210000004443 Dendritic Cells Anatomy 0.000 description 9
- 230000035693 Fab Effects 0.000 description 9
- 241000282412 Homo Species 0.000 description 9
- 210000000440 Neutrophils Anatomy 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- 125000003277 amino group Chemical group 0.000 description 9
- 230000001472 cytotoxic Effects 0.000 description 9
- 230000002950 deficient Effects 0.000 description 9
- 230000003834 intracellular Effects 0.000 description 9
- 235000018977 lysine Nutrition 0.000 description 9
- 238000000159 protein binding assay Methods 0.000 description 9
- 239000012453 solvate Substances 0.000 description 9
- 108010016626 Dipeptides Chemical group 0.000 description 8
- 238000002965 ELISA Methods 0.000 description 8
- 210000003979 Eosinophils Anatomy 0.000 description 8
- 108010087819 Fc receptors Proteins 0.000 description 8
- 102000009109 Fc receptors Human genes 0.000 description 8
- 108010073807 IgG Receptors Proteins 0.000 description 8
- 102000009490 IgG Receptors Human genes 0.000 description 8
- 210000003593 Megakaryocytes Anatomy 0.000 description 8
- 208000007056 Sickle Cell Anemia Diseases 0.000 description 8
- 125000002947 alkylene group Chemical group 0.000 description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 8
- 230000002860 competitive Effects 0.000 description 8
- 231100000433 cytotoxic Toxicity 0.000 description 8
- 230000003394 haemopoietic Effects 0.000 description 8
- 230000001965 increased Effects 0.000 description 8
- 125000002950 monocyclic group Chemical group 0.000 description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 210000003651 Basophils Anatomy 0.000 description 7
- 210000003714 Granulocytes Anatomy 0.000 description 7
- 210000000822 Killer Cells, Natural Anatomy 0.000 description 7
- 210000004698 Lymphocytes Anatomy 0.000 description 7
- 239000004472 Lysine Substances 0.000 description 7
- 210000002997 Osteoclasts Anatomy 0.000 description 7
- FADYJNXDPBKVCA-UHFFFAOYSA-N Phenylalanyl-Lysine Chemical compound NCCCCC(C(O)=O)NC(=O)C(N)CC1=CC=CC=C1 FADYJNXDPBKVCA-UHFFFAOYSA-N 0.000 description 7
- 150000001299 aldehydes Chemical class 0.000 description 7
- 238000005804 alkylation reaction Methods 0.000 description 7
- 125000000732 arylene group Chemical group 0.000 description 7
- 125000002619 bicyclic group Chemical group 0.000 description 7
- 238000003776 cleavage reaction Methods 0.000 description 7
- 230000004540 complement-dependent cytotoxicity Effects 0.000 description 7
- 230000001268 conjugating Effects 0.000 description 7
- 125000000524 functional group Chemical group 0.000 description 7
- 125000006588 heterocycloalkylene group Chemical group 0.000 description 7
- 230000003993 interaction Effects 0.000 description 7
- 239000003446 ligand Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 102000005614 monoclonal antibodies Human genes 0.000 description 7
- 108010045030 monoclonal antibodies Proteins 0.000 description 7
- 230000002148 osteoclast Effects 0.000 description 7
- 229920002857 polybutadiene Polymers 0.000 description 7
- 210000004369 Blood Anatomy 0.000 description 6
- 210000000601 Blood Cells Anatomy 0.000 description 6
- 231100000023 Cell-mediated cytotoxicity Toxicity 0.000 description 6
- 206010057250 Cell-mediated cytotoxicity Diseases 0.000 description 6
- 210000002397 Granulocyte Precursor Cells Anatomy 0.000 description 6
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 6
- 102000035443 Peptidases Human genes 0.000 description 6
- 108091005771 Peptidases Proteins 0.000 description 6
- 206010035226 Plasma cell myeloma Diseases 0.000 description 6
- JKHXYJKMNSSFFL-IUCAKERBSA-N Val-Lys Chemical compound CC(C)[C@H](N)C(=O)N[C@H](C(O)=O)CCCCN JKHXYJKMNSSFFL-IUCAKERBSA-N 0.000 description 6
- 125000004450 alkenylene group Chemical group 0.000 description 6
- 125000004429 atoms Chemical group 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- 210000003995 blood forming stem cell Anatomy 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M buffer Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000002866 fluorescence resonance energy transfer Methods 0.000 description 6
- 125000004474 heteroalkylene group Chemical group 0.000 description 6
- 125000005549 heteroarylene group Chemical group 0.000 description 6
- 239000002773 nucleotide Substances 0.000 description 6
- 125000003729 nucleotide group Chemical group 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 108010073969 valyllysine Proteins 0.000 description 6
- 229960005261 Aspartic Acid Drugs 0.000 description 5
- 210000001185 Bone Marrow Anatomy 0.000 description 5
- 206010053138 Congenital aplastic anaemia Diseases 0.000 description 5
- 229920000453 Consensus sequence Polymers 0.000 description 5
- 101710044656 FCGR3A Proteins 0.000 description 5
- 102100015541 FCGR3A Human genes 0.000 description 5
- 101710044657 FCGR3B Proteins 0.000 description 5
- 239000004471 Glycine Substances 0.000 description 5
- 208000001284 Hemoglobinopathy Diseases 0.000 description 5
- 229940072221 IMMUNOGLOBULINS Drugs 0.000 description 5
- 102000001706 Immunoglobulin Fab Fragments Human genes 0.000 description 5
- 108010054477 Immunoglobulin Fab Fragments Proteins 0.000 description 5
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 5
- 210000000274 Microglia Anatomy 0.000 description 5
- 241000699666 Mus <mouse, genus> Species 0.000 description 5
- 239000002202 Polyethylene glycol Substances 0.000 description 5
- 125000004419 alkynylene group Chemical group 0.000 description 5
- 230000004075 alteration Effects 0.000 description 5
- 230000003042 antagnostic Effects 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 235000003704 aspartic acid Nutrition 0.000 description 5
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 210000003008 brain-resident macrophage Anatomy 0.000 description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 5
- 210000004602 germ cell Anatomy 0.000 description 5
- 201000003923 hemoglobinopathy Diseases 0.000 description 5
- 230000011132 hemopoiesis Effects 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 5
- 201000011442 metachromatic leukodystrophy Diseases 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 229920000023 polynucleotide Polymers 0.000 description 5
- 239000002157 polynucleotide Substances 0.000 description 5
- 238000002198 surface plasmon resonance spectroscopy Methods 0.000 description 5
- VHJLVAABSRFDPM-UHFFFAOYSA-N 1,4-dimercaptobutane-2,3-diol Chemical compound SCC(O)C(O)CS VHJLVAABSRFDPM-UHFFFAOYSA-N 0.000 description 4
- 210000000612 Antigen-Presenting Cells Anatomy 0.000 description 4
- 241000282693 Cercopithecidae Species 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical group C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 4
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 4
- 206010024324 Leukaemias Diseases 0.000 description 4
- 210000004335 Megakaryocyte Progenitor Cells Anatomy 0.000 description 4
- 208000008466 Metabolic Disease Diseases 0.000 description 4
- 206010029592 Non-Hodgkin's lymphomas Diseases 0.000 description 4
- 206010057249 Phagocytosis Diseases 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- 208000006110 Wiskott-Aldrich Syndrome Diseases 0.000 description 4
- 102000001392 Wiskott-Aldrich Syndrome Protein Human genes 0.000 description 4
- 108010093528 Wiskott-Aldrich Syndrome Protein Proteins 0.000 description 4
- 230000002378 acidificating Effects 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 239000005557 antagonist Substances 0.000 description 4
- 229960000070 antineoplastic Monoclonal antibodies Drugs 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000001580 bacterial Effects 0.000 description 4
- 210000002798 bone marrow cell Anatomy 0.000 description 4
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 4
- 239000000306 component Substances 0.000 description 4
- 125000002993 cycloalkylene group Chemical group 0.000 description 4
- 239000002254 cytotoxic agent Substances 0.000 description 4
- 229920003013 deoxyribonucleic acid Polymers 0.000 description 4
- 238000001514 detection method Methods 0.000 description 4
- 230000002708 enhancing Effects 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 125000001188 haloalkyl group Chemical group 0.000 description 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 4
- 125000005349 heteroarylcycloalkyl group Chemical group 0.000 description 4
- 150000004677 hydrates Chemical class 0.000 description 4
- 150000007857 hydrazones Chemical class 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 230000002147 killing Effects 0.000 description 4
- PEEHTFAAVSWFBL-UHFFFAOYSA-N maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 4
- 229960000060 monoclonal antibodies Drugs 0.000 description 4
- 201000006417 multiple sclerosis Diseases 0.000 description 4
- 210000001167 myeloblast Anatomy 0.000 description 4
- 230000008782 phagocytosis Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 235000019833 protease Nutrition 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 210000001995 reticulocyte Anatomy 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 230000002459 sustained Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- VRDGQQTWSGDXCU-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 2-iodoacetate Chemical compound ICC(=O)ON1C(=O)CCC1=O VRDGQQTWSGDXCU-UHFFFAOYSA-N 0.000 description 3
- 101710039338 ATP2A2 Proteins 0.000 description 3
- 206010000565 Acquired immunodeficiency syndrome Diseases 0.000 description 3
- 206010000880 Acute myeloid leukaemia Diseases 0.000 description 3
- 206010002967 Aplastic anaemia Diseases 0.000 description 3
- 239000004475 Arginine Substances 0.000 description 3
- 108010071919 Bispecific Antibodies Proteins 0.000 description 3
- 102100013077 CD4 Human genes 0.000 description 3
- 101700022938 CD4 Proteins 0.000 description 3
- 206010008958 Chronic lymphocytic leukaemia Diseases 0.000 description 3
- 206010012818 Diffuse large B-cell lymphoma Diseases 0.000 description 3
- 229940088598 Enzyme Drugs 0.000 description 3
- 101710003440 FCGR1A Proteins 0.000 description 3
- 102100015540 FCGR1A Human genes 0.000 description 3
- 102100015544 FCGR2C Human genes 0.000 description 3
- 201000004939 Fanconi anemia Diseases 0.000 description 3
- 206010018048 Gaucher's disease Diseases 0.000 description 3
- 229960002989 Glutamic Acid Drugs 0.000 description 3
- 208000007345 Glycogen Storage Disease Diseases 0.000 description 3
- 102000015434 Humanized Monoclonal Antibodies Human genes 0.000 description 3
- 108010064750 Humanized Monoclonal Antibodies Proteins 0.000 description 3
- 101710006572 ITGAM Proteins 0.000 description 3
- 102100019441 ITGAM Human genes 0.000 description 3
- 210000000987 Immune System Anatomy 0.000 description 3
- 206010061598 Immunodeficiency Diseases 0.000 description 3
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 3
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 3
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 3
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 3
- 208000000429 Leukemia, Lymphocytic, Chronic, B-Cell Diseases 0.000 description 3
- 208000008456 Leukemia, Myelogenous, Chronic, BCR-ABL Positive Diseases 0.000 description 3
- 208000007046 Leukemia, Myeloid, Acute Diseases 0.000 description 3
- 208000002678 Mucopolysaccharidosis Diseases 0.000 description 3
- 206010028093 Mucopolysaccharidosis Diseases 0.000 description 3
- 206010056886 Mucopolysaccharidosis I Diseases 0.000 description 3
- 108091007229 NSP3 Papain-like protease domain Proteins 0.000 description 3
- 206010029260 Neuroblastoma Diseases 0.000 description 3
- 241000282520 Papio Species 0.000 description 3
- 210000003819 Peripheral blood mononuclear cell Anatomy 0.000 description 3
- 229960005190 Phenylalanine Drugs 0.000 description 3
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 241000580858 Simian-Human immunodeficiency virus Species 0.000 description 3
- 208000010346 Sphingolipidosis Diseases 0.000 description 3
- 102100008333 THY1 Human genes 0.000 description 3
- 101700026084 THY1 Proteins 0.000 description 3
- 208000002903 Thalassemia Diseases 0.000 description 3
- HSRXSKHRSXRCFC-WDSKDSINSA-N Val-Ala Chemical compound CC(C)[C@H](N)C(=O)N[C@@H](C)C(O)=O HSRXSKHRSXRCFC-WDSKDSINSA-N 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 201000005510 acute lymphocytic leukemia Diseases 0.000 description 3
- 150000001345 alkine derivatives Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 235000009697 arginine Nutrition 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 230000001413 cellular Effects 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 201000006934 chronic myeloid leukemia Diseases 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 230000009089 cytolysis Effects 0.000 description 3
- 238000002784 cytotoxicity assay Methods 0.000 description 3
- 231100000263 cytotoxicity test Toxicity 0.000 description 3
- 230000004059 degradation Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000010494 dissociation reaction Methods 0.000 description 3
- 230000005593 dissociations Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 238000001502 gel electrophoresis Methods 0.000 description 3
- 238000002523 gelfiltration Methods 0.000 description 3
- 235000013922 glutamic acid Nutrition 0.000 description 3
- 108010062266 glycyl-glycyl-argininal Proteins 0.000 description 3
- 235000014304 histidine Nutrition 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 description 3
- 210000002865 immune cell Anatomy 0.000 description 3
- 230000001900 immune effect Effects 0.000 description 3
- 230000002163 immunogen Effects 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical group C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- 210000003292 kidney cell Anatomy 0.000 description 3
- 230000002934 lysing Effects 0.000 description 3
- 230000036210 malignancy Effects 0.000 description 3
- 210000004962 mammalian cells Anatomy 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 230000002025 microglial Effects 0.000 description 3
- 230000000051 modifying Effects 0.000 description 3
- 201000009251 multiple myeloma Diseases 0.000 description 3
- 238000002703 mutagenesis Methods 0.000 description 3
- 231100000350 mutagenesis Toxicity 0.000 description 3
- 201000000050 myeloid neoplasm Diseases 0.000 description 3
- 230000003287 optical Effects 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 230000002062 proliferating Effects 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 230000011664 signaling Effects 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 201000001307 sphingolipidosis Diseases 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 230000004083 survival Effects 0.000 description 3
- 201000010874 syndrome Diseases 0.000 description 3
- 230000035897 transcription Effects 0.000 description 3
- 239000004474 valine Substances 0.000 description 3
- 235000014393 valine Nutrition 0.000 description 3
- VQZYZXLBKBUOHE-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 3-(pyridin-2-yldisulfanyl)butanoate Chemical compound C=1C=CC=NC=1SSC(C)CC(=O)ON1C(=O)CCC1=O VQZYZXLBKBUOHE-UHFFFAOYSA-N 0.000 description 2
- JWDFQMWEFLOOED-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 3-(pyridin-2-yldisulfanyl)propanoate Chemical compound O=C1CCC(=O)N1OC(=O)CCSSC1=CC=CC=N1 JWDFQMWEFLOOED-UHFFFAOYSA-N 0.000 description 2
- GKSPIZSKQWTXQG-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 4-[1-(pyridin-2-yldisulfanyl)ethyl]benzoate Chemical compound C=1C=C(C(=O)ON2C(CCC2=O)=O)C=CC=1C(C)SSC1=CC=CC=N1 GKSPIZSKQWTXQG-UHFFFAOYSA-N 0.000 description 2
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N (E)-but-2-enedioate;hydron Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- FNHIEZKOCYDCOH-UHFFFAOYSA-N 4-(4-acetylphenoxy)butanoic acid Chemical group CC(=O)C1=CC=C(OCCCC(O)=O)C=C1 FNHIEZKOCYDCOH-UHFFFAOYSA-N 0.000 description 2
- 229960001230 Asparagine Drugs 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000036868 Blood Concentration Effects 0.000 description 2
- 101700034624 CASP3 Proteins 0.000 description 2
- 102100003814 CASP3 Human genes 0.000 description 2
- 229920002574 CR-39 Polymers 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N Catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229920001405 Coding region Polymers 0.000 description 2
- 206010009900 Colitis ulcerative Diseases 0.000 description 2
- 241000699802 Cricetulus griseus Species 0.000 description 2
- 206010011401 Crohn's disease Diseases 0.000 description 2
- 150000008574 D-amino acids Chemical class 0.000 description 2
- QIVBCDIJIAJPQS-SECBINFHSA-N D-tryptophane Chemical compound C1=CC=C2C(C[C@@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-SECBINFHSA-N 0.000 description 2
- 206010012601 Diabetes mellitus Diseases 0.000 description 2
- 201000004449 Diamond-Blackfan anemia Diseases 0.000 description 2
- 238000006117 Diels-Alder cycloaddition reaction Methods 0.000 description 2
- VQNATVDKACXKTF-XELLLNAOSA-N Duocarmycin Chemical compound COC1=C(OC)C(OC)=C2NC(C(=O)N3C4=CC(=O)C5=C([C@@]64C[C@@H]6C3)C=C(N5)C(=O)OC)=CC2=C1 VQNATVDKACXKTF-XELLLNAOSA-N 0.000 description 2
- 101710044640 FCGR2A Proteins 0.000 description 2
- 101710044641 FCGR2B Proteins 0.000 description 2
- 101710044642 FCGR2C Proteins 0.000 description 2
- 108091006004 Fc-tagged proteins Proteins 0.000 description 2
- 101700009480 Fcgr3 Proteins 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N Gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- 229940093915 Gynecological Organic acids Drugs 0.000 description 2
- 238000006736 Huisgen cycloaddition reaction Methods 0.000 description 2
- 210000004408 Hybridomas Anatomy 0.000 description 2
- 229960000310 ISOLEUCINE Drugs 0.000 description 2
- 206010022114 Injury Diseases 0.000 description 2
- 208000003456 Juvenile Arthritis Diseases 0.000 description 2
- 206010059176 Juvenile idiopathic arthritis Diseases 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- TYQCGQRIZGCHNB-JLAZNSOCSA-N L-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 2
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 2
- RHGKLRLOHDJJDR-BYPYZUCNSA-N L-citrulline zwitterion Chemical compound NC(=O)NCCC[C@H]([NH3+])C([O-])=O RHGKLRLOHDJJDR-BYPYZUCNSA-N 0.000 description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 2
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 2
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N Lauric acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 210000000265 Leukocytes Anatomy 0.000 description 2
- 101700052785 Ly6a Proteins 0.000 description 2
- 206010025323 Lymphomas Diseases 0.000 description 2
- 241000282560 Macaca mulatta Species 0.000 description 2
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 2
- 108020004999 Messenger RNA Proteins 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 229920001850 Nucleic acid sequence Polymers 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N Oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 206010031243 Osteogenesis imperfecta Diseases 0.000 description 2
- 208000002865 Osteopetrosis Diseases 0.000 description 2
- 206010025310 Other lymphomas Diseases 0.000 description 2
- 210000001672 Ovary Anatomy 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N Palmitic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- MIDZLCFIAINOQN-WPRPVWTQSA-N Phe-Ala Chemical compound OC(=O)[C@H](C)NC(=O)[C@@H](N)CC1=CC=CC=C1 MIDZLCFIAINOQN-WPRPVWTQSA-N 0.000 description 2
- 210000002381 Plasma Anatomy 0.000 description 2
- 102100018787 RPS19 Human genes 0.000 description 2
- 101710007829 RPS19 Proteins 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N Resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 101700068919 SCAL1 Proteins 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 108010084592 Saporins Proteins 0.000 description 2
- 239000002262 Schiff base Substances 0.000 description 2
- 150000004753 Schiff bases Chemical class 0.000 description 2
- 206010039710 Scleroderma Diseases 0.000 description 2
- 210000002966 Serum Anatomy 0.000 description 2
- 208000002491 Severe Combined Immunodeficiency Diseases 0.000 description 2
- 208000009642 Severe combined immunodeficiency due to adenosine deaminase deficiency Diseases 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N Stearic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 206010042953 Systemic sclerosis Diseases 0.000 description 2
- 206010043391 Thalassaemia beta Diseases 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- 231100000765 Toxin Toxicity 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- IBIDRSSEHFLGSD-YUMQZZPRSA-N Val-Arg Chemical compound CC(C)[C@H](N)C(=O)N[C@H](C(O)=O)CCCN=C(N)N IBIDRSSEHFLGSD-YUMQZZPRSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N Valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 235000004279 alanine Nutrition 0.000 description 2
- 230000000735 allogeneic Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 150000007854 aminals Chemical class 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 235000009582 asparagine Nutrition 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 201000002393 blood protein disease Diseases 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000010322 bone marrow transplantation Methods 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 125000000837 carbohydrate group Chemical group 0.000 description 2
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000006143 cell culture media Substances 0.000 description 2
- 230000030833 cell death Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 238000001516 cell proliferation assay Methods 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- 229960002173 citrulline Drugs 0.000 description 2
- 235000013477 citrulline Nutrition 0.000 description 2
- 230000000295 complement Effects 0.000 description 2
- 238000005094 computer simulation Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000006352 cycloaddition reaction Methods 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- 230000003247 decreasing Effects 0.000 description 2
- 229910003460 diamond Inorganic materials 0.000 description 2
- 239000010432 diamond Substances 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 229940042396 direct acting antivirals Thiosemicarbazones Drugs 0.000 description 2
- 238000007876 drug discovery Methods 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N edta Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 230000002255 enzymatic Effects 0.000 description 2
- 230000001586 eradicative Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000000684 flow cytometry Methods 0.000 description 2
- 238000001943 fluorescence-activated cell sorting Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 108020001507 fusion proteins Proteins 0.000 description 2
- 102000037240 fusion proteins Human genes 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- 235000004554 glutamine Nutrition 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 230000003899 glycosylation Effects 0.000 description 2
- 238000006206 glycosylation reaction Methods 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 150000002373 hemiacetals Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000000126 in silico method Methods 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 201000002215 juvenile rheumatoid arthritis Diseases 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 230000000670 limiting Effects 0.000 description 2
- 230000002132 lysosomal Effects 0.000 description 2
- 230000003211 malignant Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000002609 media Substances 0.000 description 2
- 229920002106 messenger RNA Polymers 0.000 description 2
- 230000002503 metabolic Effects 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 230000003472 neutralizing Effects 0.000 description 2
- 238000007339 nucleophilic aromatic substitution reaction Methods 0.000 description 2
- 229920001542 oligosaccharide Polymers 0.000 description 2
- 150000002482 oligosaccharides Polymers 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000002891 organic anions Chemical class 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 210000000056 organs Anatomy 0.000 description 2
- 230000036961 partial Effects 0.000 description 2
- 238000010647 peptide synthesis reaction Methods 0.000 description 2
- 239000000546 pharmaceutic aid Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 108010024607 phenylalanylalanine Proteins 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 238000006303 photolysis reaction Methods 0.000 description 2
- 230000015843 photosynthesis, light reaction Effects 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical group C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 210000004765 promyelocyte Anatomy 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000002797 proteolythic Effects 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N pyrrole Chemical group C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive Effects 0.000 description 2
- 238000003259 recombinant expression Methods 0.000 description 2
- 239000003638 reducing agent Substances 0.000 description 2
- 230000001172 regenerating Effects 0.000 description 2
- 230000002629 repopulating Effects 0.000 description 2
- 125000003616 serine group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 2
- 230000001743 silencing Effects 0.000 description 2
- 238000002741 site-directed mutagenesis Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000009168 stem cell therapy Methods 0.000 description 2
- 238000009580 stem-cell therapy Methods 0.000 description 2
- 150000008163 sugars Chemical class 0.000 description 2
- 125000004434 sulfur atoms Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 2
- 201000009594 systemic scleroderma Diseases 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 2
- 150000003555 thioacetals Chemical class 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 150000003584 thiosemicarbazones Chemical class 0.000 description 2
- 239000003053 toxin Substances 0.000 description 2
- 108020003112 toxins Proteins 0.000 description 2
- 238000001890 transfection Methods 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 2
- 230000001960 triggered Effects 0.000 description 2
- 201000006704 ulcerative colitis Diseases 0.000 description 2
- 210000000689 upper leg Anatomy 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000035899 viability Effects 0.000 description 2
- FLCQLSRLQIPNLM-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate Chemical compound CC(=O)SCC(=O)ON1C(=O)CCC1=O FLCQLSRLQIPNLM-UHFFFAOYSA-N 0.000 description 1
- QXRNAOYBCYVZCD-BQBZGAKWSA-N (2S)-6-amino-2-[[(2S)-2-aminopropanoyl]amino]hexanoic acid Chemical compound C[C@H](N)C(=O)N[C@H](C(O)=O)CCCCN QXRNAOYBCYVZCD-BQBZGAKWSA-N 0.000 description 1
- FRYZZSHLYIZKCQ-UHFFFAOYSA-N (4-aminophenyl)methylazanide Chemical group NC1=CC=C(C[NH-])C=C1 FRYZZSHLYIZKCQ-UHFFFAOYSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (E)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- SJSYJHLLBBSLIH-SDNWHVSQSA-N (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoic acid Chemical compound COC1=CC=CC=C1\C=C(\C(O)=O)C1=CC=CC=C1 SJSYJHLLBBSLIH-SDNWHVSQSA-N 0.000 description 1
- AZFZKANGXPSDEA-NVNXTCNLSA-N (Z)-3-(4-bromophenyl)-N-methyl-3-pyridin-3-ylprop-2-en-1-amine Chemical compound C=1C=CN=CC=1C(=C/CNC)\C1=CC=C(Br)C=C1 AZFZKANGXPSDEA-NVNXTCNLSA-N 0.000 description 1
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N 1,2-ethanediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- YYSJNACCWYRKMK-UHFFFAOYSA-N 1,5-didehydro-2,4-dihydroimidazol-1-ium-3-ide Chemical compound C1[N-]C[N+]#C1 YYSJNACCWYRKMK-UHFFFAOYSA-N 0.000 description 1
- DIYPCWKHSODVAP-UHFFFAOYSA-N 1-[3-(2,5-dioxopyrrol-1-yl)benzoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid Chemical compound O=C1C(S(=O)(=O)O)CC(=O)N1OC(=O)C1=CC=CC(N2C(C=CC2=O)=O)=C1 DIYPCWKHSODVAP-UHFFFAOYSA-N 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- DEPDDPLQZYCHOH-UHFFFAOYSA-N 1H-imidazol-2-amine Chemical class NC1=NC=CN1 DEPDDPLQZYCHOH-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical group C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- KEQTWHPMSVAFDA-UHFFFAOYSA-N 2,3-dihydro-1H-pyrazole Chemical group C1NNC=C1 KEQTWHPMSVAFDA-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N 2-Imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- BMUXBWLKTHLRQC-UHFFFAOYSA-N 2-azanylethanoic acid Chemical compound NCC(O)=O.NCC(O)=O.NCC(O)=O BMUXBWLKTHLRQC-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical group [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N 289-95-2 Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K 2qpq Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 108020005345 3' Untranslated Regions Proteins 0.000 description 1
- AQIXEPGDORPWBJ-UHFFFAOYSA-N 3-Pentanol Chemical compound CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 1
- FJNPVFKEOJTNEO-UHFFFAOYSA-N 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]disulfanyl]butanoic acid Chemical compound OC(=O)CC(C)SSC1C=CC=CN1N1C(=O)CCC1=O FJNPVFKEOJTNEO-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical compound C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 1
- MCGBIXXDQFWVDW-UHFFFAOYSA-N 4,5-dihydro-1H-pyrazole Chemical group C1CC=NN1 MCGBIXXDQFWVDW-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 108020003589 5' Untranslated Regions Proteins 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- WOJKKJKETHYEAC-UHFFFAOYSA-N 6-(2,5-dioxopyrrol-1-yl)hexanoic acid Chemical compound OC(=O)CCCCCN1C(=O)C=CC1=O WOJKKJKETHYEAC-UHFFFAOYSA-N 0.000 description 1
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-M AC1L4ZKD Chemical compound [O-]I(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-M 0.000 description 1
- 229960000583 Acetic Acid Drugs 0.000 description 1
- 206010069754 Acquired gene mutation Diseases 0.000 description 1
- 102000009914 Adenosine deaminases Human genes 0.000 description 1
- 108091022188 Adenosine deaminases Proteins 0.000 description 1
- OMNVYXHOSHNURL-WPRPVWTQSA-N Ala-Phe Chemical compound C[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 OMNVYXHOSHNURL-WPRPVWTQSA-N 0.000 description 1
- LIWMQSWFLXEGMA-WDSKDSINSA-N Ala-Val Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)[C@H](C)N LIWMQSWFLXEGMA-WDSKDSINSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N Aminothiazole Chemical group NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- 210000004381 Amniotic Fluid Anatomy 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N Ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 208000007502 Anemia Diseases 0.000 description 1
- 229940064005 Antibiotic throat preparations Drugs 0.000 description 1
- 229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 description 1
- 229940042052 Antibiotics for systemic use Drugs 0.000 description 1
- 229940019746 Antifibrinolytic amino acids Drugs 0.000 description 1
- 229940042786 Antitubercular Antibiotics Drugs 0.000 description 1
- 229920002395 Aptamer Polymers 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N Azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 229960000686 Benzalkonium Chloride Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N Benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229960001950 Benzethonium Chloride Drugs 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M Benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N Benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 206010061590 Blood disease Diseases 0.000 description 1
- 229940098773 Bovine Serum Albumin Drugs 0.000 description 1
- 108091003117 Bovine Serum Albumin Proteins 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 description 1
- 102100005826 CD19 Human genes 0.000 description 1
- 101700087100 CD19 Proteins 0.000 description 1
- 102100019453 CD7 Human genes 0.000 description 1
- 101700063101 CD7 Proteins 0.000 description 1
- 102100008191 CD8A Human genes 0.000 description 1
- 101700054655 CD8A Proteins 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N Camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- UJOBWOGCFQCDNV-UHFFFAOYSA-N Carbazole Natural products C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 108090000712 Cathepsin B Proteins 0.000 description 1
- 102000004225 Cathepsin B Human genes 0.000 description 1
- 206010057248 Cell death Diseases 0.000 description 1
- 210000001175 Cerebrospinal Fluid Anatomy 0.000 description 1
- 206010008342 Cervix carcinoma Diseases 0.000 description 1
- 108010019670 Chimeric Antigen Receptors Proteins 0.000 description 1
- VDQQXEISLMTGAB-UHFFFAOYSA-N Chloramine-T Chemical compound [Na+].CC1=CC=C(S(=O)(=O)[N-]Cl)C=C1 VDQQXEISLMTGAB-UHFFFAOYSA-N 0.000 description 1
- 229960005091 Chloramphenicol Drugs 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N Chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- 241000282552 Chlorocebus aethiops Species 0.000 description 1
- 229960001231 Choline Drugs 0.000 description 1
- 210000004252 Chorionic Villi Anatomy 0.000 description 1
- 241000222239 Colletotrichum truncatum Species 0.000 description 1
- 229920002676 Complementary DNA Polymers 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N Cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N D-Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- FBPFZTCFMRRESA-KAZBKCHUSA-N D-Mannitol Natural products OC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KAZBKCHUSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- MTCFGRXMJLQNBG-UWTATZPHSA-N D-serine Chemical compound OC[C@@H](N)C(O)=O MTCFGRXMJLQNBG-UWTATZPHSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N D-sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 210000004207 Dermis Anatomy 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N Diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N Diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- YWHLKYXPLRWGSE-UHFFFAOYSA-N Dimethyl trisulfide Chemical group CSSSC YWHLKYXPLRWGSE-UHFFFAOYSA-N 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- 230000036947 Dissociation constant Effects 0.000 description 1
- 229960001484 Edetic Acid Drugs 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N Ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 230000036081 Excretion rate Effects 0.000 description 1
- 229920001272 Exogenous DNA Polymers 0.000 description 1
- 102100015545 FCGR2A Human genes 0.000 description 1
- 102100015543 FCGR2B Human genes 0.000 description 1
- 102100015542 FCGR3B Human genes 0.000 description 1
- 101710003435 FCGRT Proteins 0.000 description 1
- 102100014838 FCGRT Human genes 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- 206010016256 Fatigue Diseases 0.000 description 1
- 108010021468 Fc gamma receptor IIA Proteins 0.000 description 1
- 108010021472 Fc gamma receptor IIB Proteins 0.000 description 1
- 108010021470 Fc gamma receptor IIC Proteins 0.000 description 1
- 101700050236 Fcgr4 Proteins 0.000 description 1
- 108010060309 Glucuronidase Proteins 0.000 description 1
- 229940049906 Glutamate Drugs 0.000 description 1
- 229940093922 Gynecological Antibiotics Drugs 0.000 description 1
- 206010020243 Hodgkin's disease Diseases 0.000 description 1
- 201000006743 Hodgkin's lymphoma Diseases 0.000 description 1
- 229940042795 Hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 229940021015 I.V. solution additive Amino Acids Drugs 0.000 description 1
- 206010027665 Immune disorder Diseases 0.000 description 1
- 206010021425 Immune system disease Diseases 0.000 description 1
- 108010027440 Immunoconjugates Proteins 0.000 description 1
- 102000018748 Immunoconjugates Human genes 0.000 description 1
- 206010021450 Immunodeficiency congenital Diseases 0.000 description 1
- 102000009786 Immunoglobulin Constant Regions Human genes 0.000 description 1
- 108010009817 Immunoglobulin Constant Regions Proteins 0.000 description 1
- 229940045996 Isethionic Acid Drugs 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N Isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N Isoindoline Chemical group C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N Isothiazole Chemical group C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- SBUJHOSQTJFQJX-NOAMYHISSA-N Kanamycin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 1
- 210000003734 Kidney Anatomy 0.000 description 1
- DSLZVSRJTYRBFB-ZNIBRBMXSA-N L-mannaric acid Chemical compound OC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(O)=O DSLZVSRJTYRBFB-ZNIBRBMXSA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- 229960000448 Lactic acid Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N Lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- 210000001821 Langerhans Cells Anatomy 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 229920001320 Leader sequence (mRNA) Polymers 0.000 description 1
- 210000004185 Liver Anatomy 0.000 description 1
- 210000004072 Lung Anatomy 0.000 description 1
- 206010049646 Lymphohistiocytosis Diseases 0.000 description 1
- 210000003712 Lysosomes Anatomy 0.000 description 1
- 108090000028 MMP12 Proteins 0.000 description 1
- 102100000165 MS4A1 Human genes 0.000 description 1
- 101710010909 MS4A1 Proteins 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N Malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229960003194 Meglumine Drugs 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N Meglumine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000187722 Micromonospora echinospora Species 0.000 description 1
- 210000004688 Microtubules Anatomy 0.000 description 1
- 102000028664 Microtubules Human genes 0.000 description 1
- 108091022031 Microtubules Proteins 0.000 description 1
- 102000014171 Milk Proteins Human genes 0.000 description 1
- 108010011756 Milk Proteins Proteins 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 210000000066 Myeloid Cells Anatomy 0.000 description 1
- 206010028576 Myeloproliferative disease Diseases 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N N-Butylamine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- OWIUPIRUAQMTTK-UHFFFAOYSA-M N-aminocarbamate Chemical class NNC([O-])=O OWIUPIRUAQMTTK-UHFFFAOYSA-M 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N N-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- SQDFHQJTAWCFIB-UHFFFAOYSA-N N-methylidenehydroxylamine Chemical group ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 1
- 102100007544 NCAM1 Human genes 0.000 description 1
- 101700077124 NCAM1 Proteins 0.000 description 1
- 102000003729 Neprilysin Human genes 0.000 description 1
- 208000004235 Neutropenia Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- 108020005187 Oligonucleotide Probes Proteins 0.000 description 1
- 229910018828 PO3H2 Inorganic materials 0.000 description 1
- 102100005499 PTPRC Human genes 0.000 description 1
- 101700059076 PTPRC Proteins 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N Pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 210000001819 Pancreatic Juice Anatomy 0.000 description 1
- 229940055726 Pantothenic Acid Drugs 0.000 description 1
- 229940055729 Papain Drugs 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 108010067902 Peptide Library Proteins 0.000 description 1
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 description 1
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 description 1
- OZILORBBPKKGRI-RYUDHWBXSA-N Phe-Arg Chemical compound NC(N)=NCCC[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CC=CC=C1 OZILORBBPKKGRI-RYUDHWBXSA-N 0.000 description 1
- JMCOUWKXLXDERB-WMZOPIPTSA-N Phe-Trp Chemical compound C([C@H](N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(O)=O)C1=CC=CC=C1 JMCOUWKXLXDERB-WMZOPIPTSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N Phenylacetic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 210000002826 Placenta Anatomy 0.000 description 1
- 241001272996 Polyphylla fullo Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229940037179 Potassium Ion Drugs 0.000 description 1
- 229940095574 Propionic acid Drugs 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N Propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 description 1
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N Pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N Pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 229940107700 Pyruvic Acid Drugs 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 230000036141 SERUM STABILITY Effects 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 210000003296 Saliva Anatomy 0.000 description 1
- 210000000717 Sertoli cell Anatomy 0.000 description 1
- 230000037165 Serum Concentration Effects 0.000 description 1
- 108010003723 Single-Domain Antibodies Proteins 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M Stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229960004274 Stearic acid Drugs 0.000 description 1
- 210000000603 Stem Cell Niche Anatomy 0.000 description 1
- CZMRCDWAGMRECN-GDQSFJPYSA-N Sucrose Natural products O([C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O1)[C@@]1(CO)[C@H](O)[C@@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-GDQSFJPYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N Sulfanilic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- 102000002663 Surrogate Immunoglobulin Light Chains Human genes 0.000 description 1
- 108010018324 Surrogate Immunoglobulin Light Chains Proteins 0.000 description 1
- 108091008153 T cell receptors Proteins 0.000 description 1
- 102000016266 T-Cell Antigen Receptors Human genes 0.000 description 1
- 229940033123 Tannic Acid Drugs 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N Tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- 229920000401 Three prime untranslated region Polymers 0.000 description 1
- 229940024982 Topical Antifungal Antibiotics Drugs 0.000 description 1
- HDTRYLNUVZCQOY-WSWWMNSNSA-N Trehalose Natural products O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 HDTRYLNUVZCQOY-WSWWMNSNSA-N 0.000 description 1
- HDTRYLNUVZCQOY-LIZSDCNHSA-N Trehalose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 HDTRYLNUVZCQOY-LIZSDCNHSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H Tricalcium phosphate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940035504 Tromethamine Drugs 0.000 description 1
- 230000036462 Unbound Effects 0.000 description 1
- 210000002700 Urine Anatomy 0.000 description 1
- 240000004652 Vaccinium ovalifolium Species 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- NRAUADCLPJTGSF-ZPGVOIKOSA-N [(2R,3S,4R,5R,6R)-6-[[(3aS,7R,7aS)-7-hydroxy-4-oxo-1,3a,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-yl]amino]-5-[[(3S)-3,6-diaminohexanoyl]amino]-4-hydroxy-2-(hydroxymethyl)oxan-3-yl] carbamate Chemical compound NCCC[C@H](N)CC(=O)N[C@@H]1[C@@H](O)[C@H](OC(N)=O)[C@@H](CO)O[C@H]1\N=C/1N[C@H](C(=O)NC[C@H]2O)[C@@H]2N\1 NRAUADCLPJTGSF-ZPGVOIKOSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 230000002730 additional Effects 0.000 description 1
- 230000001270 agonistic Effects 0.000 description 1
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 description 1
- 108010011559 alanylphenylalanine Proteins 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000111 anti-oxidant Effects 0.000 description 1
- 230000000890 antigenic Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 230000002238 attenuated Effects 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 238000002819 bacterial display Methods 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000001588 bifunctional Effects 0.000 description 1
- 230000003115 biocidal Effects 0.000 description 1
- 238000001815 biotherapy Methods 0.000 description 1
- 230000000903 blocking Effects 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 239000012503 blood component Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- FAPWYRCQGJNNSJ-UBKPKTQASA-L calcium D-pantothenic acid Chemical compound [Ca+2].OCC(C)(C)[C@@H](O)C(=O)NCCC([O-])=O.OCC(C)(C)[C@@H](O)C(=O)NCCC([O-])=O FAPWYRCQGJNNSJ-UBKPKTQASA-L 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 229960002079 calcium pantothenate Drugs 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004452 carbocyclyl group Chemical group 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N carbodiimide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000015861 cell surface binding Effects 0.000 description 1
- 239000002458 cell surface marker Substances 0.000 description 1
- 230000003833 cell viability Effects 0.000 description 1
- 230000036755 cellular response Effects 0.000 description 1
- 201000010881 cervical cancer Diseases 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 108091006028 chimera Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- CRBHXDCYXIISFC-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CC[O-] CRBHXDCYXIISFC-UHFFFAOYSA-N 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 230000001143 conditioned Effects 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 150000001925 cycloalkenes Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FHEPZBIUHGLJMP-UHFFFAOYSA-N cyclohexene Chemical group [CH]1CCCC=C1 FHEPZBIUHGLJMP-UHFFFAOYSA-N 0.000 description 1
- QKJSVPBYHKEILK-UHFFFAOYSA-N cyclohexene Chemical group C1CCC=[C]C1 QKJSVPBYHKEILK-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DABYZUWMLUGAGP-UHFFFAOYSA-N cyclopentene Chemical group [CH]1CC=CC1 DABYZUWMLUGAGP-UHFFFAOYSA-N 0.000 description 1
- NRADQUVNXZVPHN-UHFFFAOYSA-N cyclopentene Chemical group C1C[C]=CC1 NRADQUVNXZVPHN-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000002435 cytoreductive Effects 0.000 description 1
- 230000001085 cytostatic Effects 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 239000003398 denaturant Substances 0.000 description 1
- 230000001809 detectable Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000000032 diagnostic agent Substances 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229950006877 dodecanoic acid Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000007345 electrophilic aromatic substitution reaction Methods 0.000 description 1
- 238000007336 electrophilic substitution reaction Methods 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 238000004520 electroporation Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N ethanolamine Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N ethyl amine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 230000001747 exhibiting Effects 0.000 description 1
- 238000000198 fluorescence anisotropy Methods 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 125000004407 fluoroaryl group Chemical group 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229940050411 fumarate Drugs 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N furane Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000004475 gamma-delta T lymphocyte Anatomy 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229950006191 gluconic acid Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-L glutarate(2-) Chemical compound [O-]C(=O)CCCC([O-])=O JFCQEDHGNNZCLN-UHFFFAOYSA-L 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 108010067216 glycyl-glycyl-glycine Proteins 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 125000005216 haloheteroaryl group Chemical group 0.000 description 1
- 201000002138 hematopoietic system disease Diseases 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 230000003284 homeostatic Effects 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 230000000521 hyperimmunizing Effects 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000002463 imido esters Chemical class 0.000 description 1
- 238000002649 immunization Methods 0.000 description 1
- 238000003119 immunoblot Methods 0.000 description 1
- 230000016784 immunoglobulin production Effects 0.000 description 1
- 238000001114 immunoprecipitation Methods 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 230000002452 interceptive Effects 0.000 description 1
- 229940079866 intestinal antibiotics Drugs 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000111 isothermal titration calorimetry Methods 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 230000000155 isotopic Effects 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 229960000318 kanamycin Drugs 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940099563 lactobionic acid Drugs 0.000 description 1
- 229940033355 lauric acid Drugs 0.000 description 1
- 238000001638 lipofection Methods 0.000 description 1
- 238000011068 load Methods 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 230000001868 lysosomic Effects 0.000 description 1
- 238000002824 mRNA display Methods 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-L maleate(2-) Chemical compound [O-]C(=O)\C=C/C([O-])=O VZCYOOQTPOCHFL-UPHRSURJSA-L 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 230000001404 mediated Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 235000021239 milk protein Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 229940113083 morpholine Drugs 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007855 nitrilimines Chemical group 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atoms Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 231100001083 no cytotoxicity Toxicity 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 231100000804 nongenotoxic Toxicity 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000003000 nontoxic Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000030147 nuclear export Effects 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 239000002751 oligonucleotide probe Substances 0.000 description 1
- 229940005935 ophthalmologic Antibiotics Drugs 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical group O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 238000004091 panning Methods 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- GHOKWGTUZJEAQD-ZETCQYMHSA-N pantothenic acid Natural products OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 108010018625 phenylalanylarginine Proteins 0.000 description 1
- 108010083476 phenylalanyltryptophan Proteins 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N phosphine group Chemical group P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical group C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 230000001402 polyadenylating Effects 0.000 description 1
- 108091008117 polyclonal antibodies Proteins 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 230000003389 potentiating Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002335 preservative Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000651 prodrug Chemical group 0.000 description 1
- 229940002612 prodrugs Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 210000001236 prokaryotic cell Anatomy 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 230000036678 protein binding Effects 0.000 description 1
- 238000002818 protein evolution Methods 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 230000005180 public health Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000004944 pyrazin-3-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000004941 pyridazin-5-yl group Chemical group N1=NC=CC(=C1)* 0.000 description 1
- 125000004942 pyridazin-6-yl group Chemical group N1=NC=CC=C1* 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 238000002708 random mutagenesis Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000010837 receptor-mediated endocytosis Effects 0.000 description 1
- 238000010188 recombinant method Methods 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 238000002702 ribosome display Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000002864 sequence alignment Methods 0.000 description 1
- 231100000486 side effect Toxicity 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 238000003530 single readout Methods 0.000 description 1
- 230000003007 single stranded DNA break Effects 0.000 description 1
- 101710044770 sll1951 Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- VUFNRPJNRFOTGK-UHFFFAOYSA-M sodium;1-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3-sulfonate Chemical compound [Na+].O=C1C(S(=O)(=O)[O-])CC(=O)N1OC(=O)C1CCC(CN2C(C=CC2=O)=O)CC1 VUFNRPJNRFOTGK-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003443 succinic acid derivatives Chemical class 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000002128 sulfonyl halide group Chemical group 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005942 tetrahydropyridyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000004927 thianaphthalenyl group Chemical group S1C(C=CC2=CC=CC=C12)* 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- CNHYKKNIIGEXAY-UHFFFAOYSA-N thiolan-2-imine Chemical compound N=C1CCCS1 CNHYKKNIIGEXAY-UHFFFAOYSA-N 0.000 description 1
- ATGUDZODTABURZ-UHFFFAOYSA-N thiolan-2-ylideneazanium;chloride Chemical compound Cl.N=C1CCCS1 ATGUDZODTABURZ-UHFFFAOYSA-N 0.000 description 1
- 125000000341 threoninyl group Chemical group [H]OC([H])(C([H])([H])[H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 231100000730 tolerability Toxicity 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001131 transforming Effects 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- PYIHTIJNCRKDBV-UHFFFAOYSA-L trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;dichloride Chemical compound [Cl-].[Cl-].C[N+](C)(C)CCCCCC[N+](C)(C)C PYIHTIJNCRKDBV-UHFFFAOYSA-L 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 210000004881 tumor cells Anatomy 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 241001430294 unidentified retrovirus Species 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 239000011534 wash buffer Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N β-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- AIFRHYZBTHREPW-UHFFFAOYSA-N β-carboline Chemical group N1=CC=C2C3=CC=CC=C3NC2=C1 AIFRHYZBTHREPW-UHFFFAOYSA-N 0.000 description 1
Images
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201962838286P | 2019-04-24 | 2019-04-24 | |
| US62/838,286 | 2019-04-24 | ||
| PCT/US2020/029664 WO2020219778A2 (en) | 2019-04-24 | 2020-04-23 | Anti-cd117 antibody-drug conjugates and uses thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2022530443A JP2022530443A (ja) | 2022-06-29 |
| JPWO2020219778A5 true JPWO2020219778A5 (es) | 2022-08-23 |
Family
ID=72940692
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2021563172A Withdrawn JP2022530443A (ja) | 2019-04-24 | 2020-04-23 | 抗ｃｄ１１７抗体薬物複合体およびその使用 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US20220177577A1 (es) |
| EP (1) | EP3958899A4 (es) |
| JP (1) | JP2022530443A (es) |
| WO (1) | WO2020219778A2 (es) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3700540A4 (en) | 2017-10-24 | 2021-11-10 | Magenta Therapeutics, Inc. | COMPOSITIONS AND METHODS OF DEPRODUCTION FROM CD117 + CELLS |
| JP2022530442A (ja) * | 2019-04-24 | 2022-06-29 | マジェンタ セラピューティクス インコーポレイテッド | アントラサイクリン抗体薬物複合体およびその使用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP5773650B2 (ja) * | 2008-07-16 | 2015-09-02 | 株式会社医学生物学研究所 | 抗ヒトｃｌｃｐ１抗体とその用途 |
| US9334332B2 (en) * | 2012-07-25 | 2016-05-10 | Kolltan Pharmaceuticals, Inc. | Anti-kit antibodies |
| HRP20220436T1 (hr) * | 2015-11-03 | 2022-05-27 | Janssen Biotech, Inc. | Protutijela koja se specifično vežu na pd-1 i njihove uporabe |
| KR20230066647A (ko) * | 2016-06-17 | 2023-05-16 | 마젠타 테라퓨틱스 인코포레이티드 | Cd117+ 세포의 고갈을 위한 조성물 및 방법 |
| WO2019084067A1 (en) * | 2017-10-24 | 2019-05-02 | Magenta Therapeutics, Inc. | ANTI-CD117 ANTIBODIES AND METHODS OF USE |
| MX2020004140A (es) * | 2017-10-24 | 2020-08-13 | Magenta Therapeutics Inc | Composiciones y metodos para la eliminacion de celulas cd117+. |
| EP3700540A4 (en) * | 2017-10-24 | 2021-11-10 | Magenta Therapeutics, Inc. | COMPOSITIONS AND METHODS OF DEPRODUCTION FROM CD117 + CELLS |
| WO2019234694A2 (en) * | 2018-06-07 | 2019-12-12 | Magenta Therapeutics, Inc. | Therapeutic methods using antibody drug conjugates (adcs) |
| EP3873930A4 (en) * | 2018-10-23 | 2022-12-07 | Magenta Therapeutics, Inc. | ANTIBODY-DRUG CONJUGATE (ADC) TO FC REGION SILENCEMENT AND ASSOCIATED USES |
| MX2021004579A (es) * | 2018-10-30 | 2021-07-06 | Magenta Therapeutics Inc | Métodos para trasplante de células madre hematopoyéticas alogénicas. |
-
2020
- 2020-04-23 JP JP2021563172A patent/JP2022530443A/ja not_active Withdrawn
- 2020-04-23 EP EP20794205.3A patent/EP3958899A4/en not_active Withdrawn
- 2020-04-23 WO PCT/US2020/029664 patent/WO2020219778A2/en unknown
-
2021
- 2021-10-22 US US17/508,759 patent/US20220177577A1/en active Pending
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20220175951A1 (en) | Anti-CD45 Antibody Drug Conjugates and Uses Thereof | |
| US20200407440A1 (en) | Amatoxin antibody-drug conjugates and uses thereof | |
| US20200255523A1 (en) | Fc silenced antibody drug conjugates (adcs) and uses thereof | |
| US20220175944A1 (en) | Anti-cd117 antibody-drug conjugates and uses thereof | |
| CN113302203A (zh) | 抗cd45抗体及其缀合物 | |
| US20240075157A1 (en) | Fc silenced antibody drug conjugates (adcs) and uses thereof | |
| JP2021504412A (ja) | Ｃｄ５＋細胞の枯渇のための組成物および方法 | |
| KR20220091567A (ko) | 항-cd45 항체 및 이의 컨쥬게이트 | |
| US20220177577A1 (en) | Anti-cd117 antibody drug conjugates and uses thereof | |
| JPWO2020219959A5 (es) | ||
| US20220226493A1 (en) | Anthracycline antibody-drug conjugates and uses thereof | |
| JPWO2020092654A5 (es) | ||
| JPWO2020219775A5 (es) | ||
| CN111867621A (zh) | 用于耗尽cd134+细胞的组合物和方法 | |
| JPWO2020219778A5 (es) | ||
| RU2826004C2 (ru) | Аматоксиновые конъюгаты антитела с лекарственным средством и их применение | |
| JPWO2020219774A5 (es) | ||
| JP2022535527A (ja) | 自己免疫疾患を治療するための方法および組成物 | |
| CN112154152A (zh) | 抗cd252抗体、缀合物和使用方法 | |
| JPWO2021087368A5 (es) |