JPWO2020146432A5 - - Google Patents
Download PDFInfo
- Publication number
- JPWO2020146432A5 JPWO2020146432A5 JP2021539400A JP2021539400A JPWO2020146432A5 JP WO2020146432 A5 JPWO2020146432 A5 JP WO2020146432A5 JP 2021539400 A JP2021539400 A JP 2021539400A JP 2021539400 A JP2021539400 A JP 2021539400A JP WO2020146432 A5 JPWO2020146432 A5 JP WO2020146432A5
- Authority
- JP
- Japan
- Prior art keywords
- antibody
- car
- cell
- cells
- antigen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 102000004965 antibodies Human genes 0.000 claims description 420
- 108090001123 antibodies Proteins 0.000 claims description 420
- 108010019670 Chimeric Antigen Receptors Proteins 0.000 claims description 261
- 210000004027 cells Anatomy 0.000 claims description 251
- 230000027455 binding Effects 0.000 claims description 223
- 108091007172 antigens Proteins 0.000 claims description 201
- 102000038129 antigens Human genes 0.000 claims description 201
- 239000000427 antigen Substances 0.000 claims description 200
- 125000005647 linker group Chemical group 0.000 claims description 127
- 239000000611 antibody drug conjugate Substances 0.000 claims description 89
- 108091008116 antibody drug conjugates Proteins 0.000 claims description 89
- 238000002560 therapeutic procedure Methods 0.000 claims description 82
- 125000003275 alpha amino acid group Chemical group 0.000 claims description 80
- 210000002865 immune cell Anatomy 0.000 claims description 80
- -1 NKR-2 Proteins 0.000 claims description 78
- 210000004698 Lymphocytes Anatomy 0.000 claims description 65
- 231100000599 cytotoxic agent Toxicity 0.000 claims description 60
- 239000002619 cytotoxin Substances 0.000 claims description 60
- 231100000729 Amatoxin Toxicity 0.000 claims description 54
- 108010004143 Alpha-amanitin Proteins 0.000 claims description 53
- 239000003814 drug Substances 0.000 claims description 52
- 201000011510 cancer Diseases 0.000 claims description 48
- 230000011664 signaling Effects 0.000 claims description 46
- 101700027111 3SA0 Proteins 0.000 claims description 45
- 101700067609 ctx Proteins 0.000 claims description 45
- 210000001744 T-Lymphocytes Anatomy 0.000 claims description 43
- 230000001086 cytosolic Effects 0.000 claims description 41
- 108010014709 amatoxin Proteins 0.000 claims description 40
- 125000001424 substituent group Chemical group 0.000 claims description 40
- 210000003958 Hematopoietic Stem Cells Anatomy 0.000 claims description 33
- 206010028980 Neoplasm Diseases 0.000 claims description 31
- 231100000765 Toxin Toxicity 0.000 claims description 30
- 239000003053 toxin Substances 0.000 claims description 30
- 108020003112 toxins Proteins 0.000 claims description 30
- 230000000735 allogeneic Effects 0.000 claims description 27
- 229940079593 drugs Drugs 0.000 claims description 27
- 208000003950 B-Cell Lymphoma Diseases 0.000 claims description 26
- 239000000126 substance Substances 0.000 claims description 26
- 102100019461 CD28 Human genes 0.000 claims description 25
- 101700033362 CD28 Proteins 0.000 claims description 25
- 102000004169 proteins and genes Human genes 0.000 claims description 22
- 108090000623 proteins and genes Proteins 0.000 claims description 22
- 230000000779 depleting Effects 0.000 claims description 21
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 21
- 230000002401 inhibitory effect Effects 0.000 claims description 21
- 206010003816 Autoimmune disease Diseases 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 claims description 18
- 201000005510 acute lymphocytic leukemia Diseases 0.000 claims description 18
- 230000036499 Half live Effects 0.000 claims description 17
- 102000018358 Immunoglobulins Human genes 0.000 claims description 17
- 108060003951 Immunoglobulins Proteins 0.000 claims description 17
- 125000001072 heteroaryl group Chemical group 0.000 claims description 17
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 16
- 206010024324 Leukaemias Diseases 0.000 claims description 15
- 206010029592 Non-Hodgkin's lymphomas Diseases 0.000 claims description 15
- 102100009537 TNFRSF9 Human genes 0.000 claims description 15
- 101710040535 TNFRSF9 Proteins 0.000 claims description 15
- 210000000822 Killer Cells, Natural Anatomy 0.000 claims description 14
- 108010044540 auristatin Proteins 0.000 claims description 14
- 239000003112 inhibitor Substances 0.000 claims description 14
- BGFTWECWAICPDG-UHFFFAOYSA-N 2-[bis(4-chlorophenyl)methyl]-4-N-[3-[bis(4-chlorophenyl)methyl]-4-(dimethylamino)phenyl]-1-N,1-N-dimethylbenzene-1,4-diamine Chemical compound C1=C(C(C=2C=CC(Cl)=CC=2)C=2C=CC(Cl)=CC=2)C(N(C)C)=CC=C1NC(C=1)=CC=C(N(C)C)C=1C(C=1C=CC(Cl)=CC=1)C1=CC=C(Cl)C=C1 BGFTWECWAICPDG-UHFFFAOYSA-N 0.000 claims description 13
- 108010008014 B-Cell Maturation Antigen Proteins 0.000 claims description 13
- 102000006942 B-Cell Maturation Antigen Human genes 0.000 claims description 13
- 101700020617 CD22 Proteins 0.000 claims description 13
- 102100000189 CD22 Human genes 0.000 claims description 13
- 102000004127 Cytokines Human genes 0.000 claims description 13
- 108090000695 Cytokines Proteins 0.000 claims description 13
- 125000004419 alkynylene group Chemical group 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 13
- 210000003719 B-Lymphocytes Anatomy 0.000 claims description 12
- 206010052015 Cytokine release syndrome Diseases 0.000 claims description 12
- 208000004235 Neutropenia Diseases 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 12
- 239000002246 antineoplastic agent Substances 0.000 claims description 12
- 230000001965 increased Effects 0.000 claims description 12
- 241000658540 Ora Species 0.000 claims description 11
- 230000001058 adult Effects 0.000 claims description 11
- 201000009596 autoimmune hypersensitivity disease Diseases 0.000 claims description 11
- 229960000390 fludarabine Drugs 0.000 claims description 11
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical group C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 claims description 11
- 101710043956 CEACAM5 Proteins 0.000 claims description 10
- 101710043948 CEACAM7 Proteins 0.000 claims description 10
- 102100017963 PSCA Human genes 0.000 claims description 10
- 101700038464 PSCA Proteins 0.000 claims description 10
- 101700004495 PSG2 Proteins 0.000 claims description 10
- 125000004450 alkenylene group Chemical group 0.000 claims description 10
- 230000001413 cellular Effects 0.000 claims description 10
- 238000005859 coupling reaction Methods 0.000 claims description 10
- 102000017256 epidermal growth factor-activated receptor activity proteins Human genes 0.000 claims description 10
- 108040009258 epidermal growth factor-activated receptor activity proteins Proteins 0.000 claims description 10
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 9
- 229960004397 Cyclophosphamide Drugs 0.000 claims description 9
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 claims description 9
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 claims description 9
- 206010025323 Lymphomas Diseases 0.000 claims description 9
- 210000000440 Neutrophils Anatomy 0.000 claims description 9
- 206010025310 Other lymphomas Diseases 0.000 claims description 9
- 208000008443 Pancreatic Carcinoma Diseases 0.000 claims description 9
- 210000002966 Serum Anatomy 0.000 claims description 9
- 239000004007 alpha amanitin Substances 0.000 claims description 9
- 150000002019 disulfides Chemical class 0.000 claims description 9
- 125000004474 heteroalkylene group Chemical group 0.000 claims description 9
- 201000009251 multiple myeloma Diseases 0.000 claims description 9
- 201000002528 pancreatic cancer Diseases 0.000 claims description 9
- 230000000306 recurrent Effects 0.000 claims description 9
- CIORWBWIBBPXCG-SXZCQOKQSA-N α-amanitin Chemical compound O=C1N[C@@H](CC(N)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)[C@@H](O)CO)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1C[S@@](=O)C1=C2C2=CC=C(O)C=C2N1 CIORWBWIBBPXCG-SXZCQOKQSA-N 0.000 claims description 9
- 125000006716 (C1-C6) heteroalkyl group Chemical group 0.000 claims description 8
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 8
- HXCHCVDVKSCDHU-LULTVBGHSA-N Calicheamicin Chemical compound C1[C@H](OC)[C@@H](NCC)CO[C@H]1O[C@H]1[C@H](O[C@@H]2C\3=C(NC(=O)OC)C(=O)C[C@](C/3=C/CSSSC)(O)C#C\C=C/C#C2)O[C@H](C)[C@@H](NO[C@@H]2O[C@H](C)[C@@H](SC(=O)C=3C(=C(OC)C(O[C@H]4[C@@H]([C@H](OC)[C@@H](O)[C@H](C)O4)O)=C(I)C=3C)OC)[C@@H](O)C2)[C@@H]1O HXCHCVDVKSCDHU-LULTVBGHSA-N 0.000 claims description 8
- 101700010580 FLO11 Proteins 0.000 claims description 8
- 102100006037 MUC1 Human genes 0.000 claims description 8
- 101700052761 MUC1 Proteins 0.000 claims description 8
- 102100002896 PSG2 Human genes 0.000 claims description 8
- 125000004430 oxygen atoms Chemical group O* 0.000 claims description 8
- 230000001737 promoting Effects 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 8
- 102100005826 CD19 Human genes 0.000 claims description 7
- 101700087100 CD19 Proteins 0.000 claims description 7
- 108010016626 Dipeptides Proteins 0.000 claims description 7
- 102100000165 MS4A1 Human genes 0.000 claims description 7
- 238000002512 chemotherapy Methods 0.000 claims description 7
- 102000003735 mesothelin Human genes 0.000 claims description 7
- 108090000015 mesothelin Proteins 0.000 claims description 7
- 125000005017 substituted alkenyl group Chemical group 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- 108010090838 Alemtuzumab Proteins 0.000 claims description 6
- 102100016493 CD33 Human genes 0.000 claims description 6
- 101700017647 CD33 Proteins 0.000 claims description 6
- 102000003814 Interleukin-10 Human genes 0.000 claims description 6
- 108090000174 Interleukin-10 Proteins 0.000 claims description 6
- 101710010909 MS4A1 Proteins 0.000 claims description 6
- 206010027476 Metastasis Diseases 0.000 claims description 6
- DASWEROEPLKSEI-UIJRFTGLSA-N Monomethyl auristatin E Chemical compound CN[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H]([C@@H](C)CC)[C@H](OC)CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)N[C@H](C)[C@@H](O)C1=CC=CC=C1 DASWEROEPLKSEI-UIJRFTGLSA-N 0.000 claims description 6
- MFRNYXJJRJQHNW-NARUGQRUSA-N Monomethyl auristatin F Chemical compound CN[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)C([C@@H](C)CC)[C@H](OC)CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 MFRNYXJJRJQHNW-NARUGQRUSA-N 0.000 claims description 6
- 102000016266 T-Cell Antigen Receptors Human genes 0.000 claims description 6
- 101710040533 TNFRSF8 Proteins 0.000 claims description 6
- 102100009538 TNFRSF8 Human genes 0.000 claims description 6
- 229960000548 alemtuzumab Drugs 0.000 claims description 6
- 125000006588 heterocycloalkylene group Chemical group 0.000 claims description 6
- 108010093470 monomethyl auristatin E Proteins 0.000 claims description 6
- 108010059074 monomethylauristatin F Proteins 0.000 claims description 6
- 201000000050 myeloid neoplasm Diseases 0.000 claims description 6
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 5
- 101700014023 AFP Proteins 0.000 claims description 5
- CIORWBWIBBPXCG-JZTFPUPKSA-N Amanitin Chemical group O=C1N[C@@H](CC(N)=O)C(=O)N2CC(O)C[C@H]2C(=O)N[C@@H](C(C)[C@@H](O)CO)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H](C(C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 CIORWBWIBBPXCG-JZTFPUPKSA-N 0.000 claims description 5
- HFENEIQMWRYNGK-XYDKGUIVSA-N Amanullinic acid Chemical compound O=C1N[C@@H](CC(O)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 HFENEIQMWRYNGK-XYDKGUIVSA-N 0.000 claims description 5
- 208000004736 B-Cell Leukemia Diseases 0.000 claims description 5
- 102100003279 CD38 Human genes 0.000 claims description 5
- 101700044948 CD38 Proteins 0.000 claims description 5
- 102100019453 CD7 Human genes 0.000 claims description 5
- 101700063101 CD7 Proteins 0.000 claims description 5
- 210000004443 Dendritic Cells Anatomy 0.000 claims description 5
- 101710037116 GAPC3 Proteins 0.000 claims description 5
- 102100007996 GPC3 Human genes 0.000 claims description 5
- 101700044749 GPC3 Proteins 0.000 claims description 5
- 101700025474 ISP2 Proteins 0.000 claims description 5
- 101710036390 KLRK1 Proteins 0.000 claims description 5
- 102100012223 KLRK1 Human genes 0.000 claims description 5
- 210000004185 Liver Anatomy 0.000 claims description 5
- 208000009285 Lymphoma, Large B-Cell, Diffuse Diseases 0.000 claims description 5
- 108060009214 NRK Proteins 0.000 claims description 5
- 102100017732 ROR2 Human genes 0.000 claims description 5
- 206010038038 Rectal cancer Diseases 0.000 claims description 5
- 108091008153 T cell receptors Proteins 0.000 claims description 5
- 101710030909 TNFRSF13B Proteins 0.000 claims description 5
- 101710040448 TNFRSF4 Proteins 0.000 claims description 5
- 102100013135 TNFRSF4 Human genes 0.000 claims description 5
- 102100000184 TRIM26 Human genes 0.000 claims description 5
- 101710021280 TRIM26 Proteins 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 239000003080 antimitotic agent Substances 0.000 claims description 5
- 108091006028 chimera Proteins 0.000 claims description 5
- 201000011231 colorectal cancer Diseases 0.000 claims description 5
- 201000008325 diseases of cellular proliferation Diseases 0.000 claims description 5
- 108010087914 epidermal growth factor receptor VIII Proteins 0.000 claims description 5
- 201000003444 follicular lymphoma Diseases 0.000 claims description 5
- 125000005549 heteroarylene group Chemical group 0.000 claims description 5
- 150000007857 hydrazones Chemical class 0.000 claims description 5
- 201000001275 rectum cancer Diseases 0.000 claims description 5
- 125000005717 substituted cycloalkylene group Chemical group 0.000 claims description 5
- 101700065995 AFP1 Proteins 0.000 claims description 4
- 101700061082 ANPX Proteins 0.000 claims description 4
- 101700082057 ANPY Proteins 0.000 claims description 4
- 101700077278 ANTF Proteins 0.000 claims description 4
- QCZXQEYEVLCQHL-MIBTZWEZSA-N Amanin Chemical compound O=C1N[C@@H](CC(O)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)[C@@H](O)CO)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=CC=C2N1 QCZXQEYEVLCQHL-MIBTZWEZSA-N 0.000 claims description 4
- BOHCOUQZNDPURZ-MIBTZWEZSA-N Amaninamide Chemical compound O=C1N[C@@H](CC(N)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)[C@@H](O)CO)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=CC=C2N1 BOHCOUQZNDPURZ-MIBTZWEZSA-N 0.000 claims description 4
- YTKUWDBFDASYHO-UHFFFAOYSA-N Bendamustine Chemical compound ClCCN(CCCl)C1=CC=C2N(C)C(CCCC(O)=O)=NC2=C1 YTKUWDBFDASYHO-UHFFFAOYSA-N 0.000 claims description 4
- 101800001350 Beta-amanitin Proteins 0.000 claims description 4
- 206010006187 Breast cancer Diseases 0.000 claims description 4
- 102100016662 ERBB2 Human genes 0.000 claims description 4
- 101700025368 ERBB2 Proteins 0.000 claims description 4
- 206010073071 Hepatocellular carcinoma Diseases 0.000 claims description 4
- 108010002586 Interleukin-7 Proteins 0.000 claims description 4
- 210000004072 Lung Anatomy 0.000 claims description 4
- 229950001474 Maitansine Drugs 0.000 claims description 4
- 241000283973 Oryctolagus cuniculus Species 0.000 claims description 4
- 229960002340 Pentostatin Drugs 0.000 claims description 4
- FPVKHBSQESCIEP-JQCXWYLXSA-N Pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 claims description 4
- 101710037934 QRSL1 Proteins 0.000 claims description 4
- 102100018522 SNCA Human genes 0.000 claims description 4
- 108060007796 SPATA2 Proteins 0.000 claims description 4
- 102100009744 TNFRSF13B Human genes 0.000 claims description 4
- 101710004777 afgp8 Proteins 0.000 claims description 4
- 108010004258 amaninamide Proteins 0.000 claims description 4
- 125000000732 arylene group Chemical group 0.000 claims description 4
- 229960002707 bendamustine Drugs 0.000 claims description 4
- 239000004080 beta amanitin Substances 0.000 claims description 4
- 230000000112 colonic Effects 0.000 claims description 4
- 230000003394 haemopoietic Effects 0.000 claims description 4
- 231100000844 hepatocellular carcinoma Toxicity 0.000 claims description 4
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 4
- 101700024633 ibp Proteins 0.000 claims description 4
- 125000004426 substituted alkynyl group Chemical group 0.000 claims description 4
- IEQCUEXVAPAFMQ-JAXJKTSHSA-N β-Amanitin Chemical compound O=C1N[C@@H](CC(O)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)[C@@H](O)CO)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 IEQCUEXVAPAFMQ-JAXJKTSHSA-N 0.000 claims description 4
- WVHGJJRMKGDTEC-ZUROAWGWSA-N γ-Amanitin Chemical compound O=C1N[C@@H](CC(N)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)[C@H](C)O)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 WVHGJJRMKGDTEC-ZUROAWGWSA-N 0.000 claims description 4
- OFILNAORONITPV-ZUROAWGWSA-N ε-Amanitin Chemical compound O=C1N[C@@H](CC(O)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)[C@H](C)O)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 OFILNAORONITPV-ZUROAWGWSA-N 0.000 claims description 4
- 206010000830 Acute leukaemia Diseases 0.000 claims description 3
- 206010000880 Acute myeloid leukaemia Diseases 0.000 claims description 3
- QQLVIKWYAVVKKF-XYDKGUIVSA-N Amanullin Chemical compound O=C1N[C@@H](CC(N)=O)C(=O)N2C[C@H](O)C[C@H]2C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 QQLVIKWYAVVKKF-XYDKGUIVSA-N 0.000 claims description 3
- 206010007953 Central nervous system lymphoma Diseases 0.000 claims description 3
- 102000000013 Chemokine CCL3 Human genes 0.000 claims description 3
- 108010055205 Chemokine CCL3 Proteins 0.000 claims description 3
- 102000001326 Chemokine CCL4 Human genes 0.000 claims description 3
- 108010055165 Chemokine CCL4 Proteins 0.000 claims description 3
- 206010009944 Colon cancer Diseases 0.000 claims description 3
- 206010017758 Gastric cancer Diseases 0.000 claims description 3
- 208000005017 Glioblastoma Diseases 0.000 claims description 3
- 208000002250 Hematologic Neoplasms Diseases 0.000 claims description 3
- 206010020243 Hodgkin's disease Diseases 0.000 claims description 3
- 201000006743 Hodgkin's lymphoma Diseases 0.000 claims description 3
- 101700086956 IFNG Proteins 0.000 claims description 3
- 102100016020 IFNG Human genes 0.000 claims description 3
- 108090001005 Interleukin-6 Proteins 0.000 claims description 3
- 102000004889 Interleukin-6 Human genes 0.000 claims description 3
- 108090001007 Interleukin-8 Proteins 0.000 claims description 3
- 102000004890 Interleukin-8 Human genes 0.000 claims description 3
- 208000007046 Leukemia, Myeloid, Acute Diseases 0.000 claims description 3
- 101710006307 MVA110L Proteins 0.000 claims description 3
- WKPWGQKGSOKKOO-RSFHAFMBSA-N Maitansine Chemical group CO[C@@H]([C@@]1(O)C[C@](OC(=O)N1)([C@H]([C@@H]1O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(C)=O)CC(=O)N1C)C)[H])\C=C\C=C(C)\CC2=CC(OC)=C(Cl)C1=C2 WKPWGQKGSOKKOO-RSFHAFMBSA-N 0.000 claims description 3
- 206010026798 Mantle cell lymphomas Diseases 0.000 claims description 3
- 206010061289 Metastatic neoplasm Diseases 0.000 claims description 3
- 208000002154 Non-Small-Cell Lung Carcinoma Diseases 0.000 claims description 3
- 108009000071 Non-small cell lung cancer Proteins 0.000 claims description 3
- 206010033128 Ovarian cancer Diseases 0.000 claims description 3
- CTYHFRWAIRSHQT-YRDOMICZSA-N Proamanullin Chemical compound O=C1N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C2)C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@H]1CS(=O)C1=C2C2=CC=C(O)C=C2N1 CTYHFRWAIRSHQT-YRDOMICZSA-N 0.000 claims description 3
- 208000006265 Renal Cell Carcinoma Diseases 0.000 claims description 3
- 208000000587 Small Cell Lung Carcinoma Diseases 0.000 claims description 3
- 206010041067 Small cell lung cancer Diseases 0.000 claims description 3
- 208000003721 Triple Negative Breast Neoplasms Diseases 0.000 claims description 3
- 101710042748 UL80 Proteins 0.000 claims description 3
- 210000001635 Urinary Tract Anatomy 0.000 claims description 3
- 230000001154 acute Effects 0.000 claims description 3
- 230000001394 metastastic Effects 0.000 claims description 3
- 201000006845 reticulosarcoma Diseases 0.000 claims description 3
- 201000011549 stomach cancer Diseases 0.000 claims description 3
- 210000000988 Bone and Bones Anatomy 0.000 claims description 2
- 230000001494 anti-thymocyte Effects 0.000 claims description 2
- 230000001684 chronic Effects 0.000 claims description 2
- 201000003793 myelodysplastic syndrome Diseases 0.000 claims description 2
- 230000003213 activating Effects 0.000 claims 1
- 230000002927 anti-mitotic Effects 0.000 claims 1
- 230000003211 malignant Effects 0.000 claims 1
- 230000001568 sexual Effects 0.000 claims 1
- 102100005499 PTPRC Human genes 0.000 description 90
- 101700059076 PTPRC Proteins 0.000 description 90
- 230000035772 mutation Effects 0.000 description 82
- 239000000203 mixture Substances 0.000 description 76
- 235000001014 amino acid Nutrition 0.000 description 69
- 150000001413 amino acids Chemical class 0.000 description 35
- 150000001875 compounds Chemical class 0.000 description 34
- 238000006467 substitution reaction Methods 0.000 description 34
- 238000004166 bioassay Methods 0.000 description 33
- 238000000034 method Methods 0.000 description 30
- 238000002659 cell therapy Methods 0.000 description 29
- 239000000562 conjugate Substances 0.000 description 29
- 230000004048 modification Effects 0.000 description 27
- 238000006011 modification reaction Methods 0.000 description 27
- 108010079723 Shiga Toxin Proteins 0.000 description 26
- 230000003750 conditioning Effects 0.000 description 26
- 108010047041 Complementarity Determining Regions Proteins 0.000 description 24
- 125000004432 carbon atoms Chemical group C* 0.000 description 23
- 230000000694 effects Effects 0.000 description 22
- 229920001184 polypeptide Polymers 0.000 description 21
- 230000021615 conjugation Effects 0.000 description 20
- 238000000338 in vitro Methods 0.000 description 19
- 235000018102 proteins Nutrition 0.000 description 17
- 108010045030 monoclonal antibodies Proteins 0.000 description 16
- 102000005614 monoclonal antibodies Human genes 0.000 description 16
- 239000003446 ligand Substances 0.000 description 15
- 210000004369 Blood Anatomy 0.000 description 14
- 125000000539 amino acid group Chemical group 0.000 description 14
- 239000008280 blood Substances 0.000 description 14
- 230000001472 cytotoxic Effects 0.000 description 14
- 201000010099 disease Diseases 0.000 description 14
- 230000002829 reduced Effects 0.000 description 14
- 230000004068 intracellular signaling Effects 0.000 description 13
- 230000001225 therapeutic Effects 0.000 description 13
- STQGQHZAVUOBTE-VGBVRHCVSA-N DAUNOMYCIN Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 12
- 210000000138 Mast Cells Anatomy 0.000 description 12
- 108090000829 Ribosome Inactivating Proteins Proteins 0.000 description 12
- 235000018417 cysteine Nutrition 0.000 description 12
- 241000588724 Escherichia coli Species 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- 125000003118 aryl group Chemical group 0.000 description 11
- 231100000433 cytotoxic Toxicity 0.000 description 11
- 229920003013 deoxyribonucleic acid Polymers 0.000 description 11
- AOJJSUZBOXZQNB-TZSSRYMLSA-N ADRIAMYCIN Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 10
- 102100008191 CD8A Human genes 0.000 description 10
- 101700054655 CD8A Proteins 0.000 description 10
- 241000282412 Homo Species 0.000 description 10
- 102000004851 Immunoglobulin G Human genes 0.000 description 10
- 238000004458 analytical method Methods 0.000 description 10
- 230000003013 cytotoxicity Effects 0.000 description 10
- 231100000135 cytotoxicity Toxicity 0.000 description 10
- 230000003834 intracellular Effects 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 239000012453 solvate Substances 0.000 description 10
- 125000005842 heteroatoms Chemical group 0.000 description 9
- 238000011160 research Methods 0.000 description 9
- 206010012818 Diffuse large B-cell lymphoma Diseases 0.000 description 8
- 229960004679 Doxorubicin Drugs 0.000 description 8
- 108010087819 Fc receptors Proteins 0.000 description 8
- 102000009109 Fc receptors Human genes 0.000 description 8
- 102000028664 Microtubules Human genes 0.000 description 8
- 108091022031 Microtubules Proteins 0.000 description 8
- 210000004688 Microtubules Anatomy 0.000 description 8
- 230000010056 antibody-dependent cellular cytotoxicity Effects 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 150000007523 nucleic acids Chemical group 0.000 description 8
- 239000002773 nucleotide Substances 0.000 description 8
- 125000003729 nucleotide group Chemical group 0.000 description 8
- 229910052717 sulfur Inorganic materials 0.000 description 8
- 125000003396 thiol group Chemical group [H]S* 0.000 description 8
- NFGXHKASABOEEW-UHFFFAOYSA-N (+)-methoprene Chemical compound COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C NFGXHKASABOEEW-UHFFFAOYSA-N 0.000 description 7
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 7
- 241000282693 Cercopithecidae Species 0.000 description 7
- 230000035693 Fab Effects 0.000 description 7
- 108010073807 IgG Receptors Proteins 0.000 description 7
- 102000009490 IgG Receptors Human genes 0.000 description 7
- 239000004472 Lysine Substances 0.000 description 7
- 108010029485 Protein Isoforms Proteins 0.000 description 7
- 102000001708 Protein Isoforms Human genes 0.000 description 7
- 101700027726 SPE1 Proteins 0.000 description 7
- 101710025952 adhT Proteins 0.000 description 7
- 229960000070 antineoplastic Monoclonal antibodies Drugs 0.000 description 7
- 239000012472 biological sample Substances 0.000 description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
- 230000000875 corresponding Effects 0.000 description 7
- 125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 7
- 238000005516 engineering process Methods 0.000 description 7
- 229960000060 monoclonal antibodies Drugs 0.000 description 7
- 108020004707 nucleic acids Proteins 0.000 description 7
- 238000002823 phage display Methods 0.000 description 7
- 238000000159 protein binding assay Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- 210000001185 Bone Marrow Anatomy 0.000 description 6
- 238000002965 ELISA Methods 0.000 description 6
- 101710044656 FCGR3A Proteins 0.000 description 6
- 102100015541 FCGR3A Human genes 0.000 description 6
- 101710044657 FCGR3B Proteins 0.000 description 6
- 210000000987 Immune System Anatomy 0.000 description 6
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 6
- 229920001850 Nucleic acid sequence Polymers 0.000 description 6
- 125000000304 alkynyl group Chemical group 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 201000009910 diseases by infectious agent Diseases 0.000 description 6
- 230000002708 enhancing Effects 0.000 description 6
- 125000000623 heterocyclic group Chemical group 0.000 description 6
- 230000003993 interaction Effects 0.000 description 6
- 230000000670 limiting Effects 0.000 description 6
- 238000002703 mutagenesis Methods 0.000 description 6
- 231100000350 mutagenesis Toxicity 0.000 description 6
- 229910052698 phosphorus Inorganic materials 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- 231100000486 side effect Toxicity 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 101700072359 stxA Proteins 0.000 description 6
- 229960000684 Cytarabine Drugs 0.000 description 5
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytosar Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 5
- 210000004408 Hybridomas Anatomy 0.000 description 5
- 101710002465 IZUMO1R Proteins 0.000 description 5
- XUJNEKJLAYXESH-REOHCLBHSA-N L-cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 5
- 241000282567 Macaca fascicularis Species 0.000 description 5
- 108010091769 Shiga Toxin 1 Proteins 0.000 description 5
- 108010087748 Shiga toxin subunit A Proteins 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 238000002838 bio layer interferometry Methods 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 230000022534 cell killing Effects 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 230000002860 competitive Effects 0.000 description 5
- 239000000306 component Substances 0.000 description 5
- 125000000753 cycloalkyl group Chemical group 0.000 description 5
- 238000001514 detection method Methods 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- 230000003053 immunization Effects 0.000 description 5
- 230000002147 killing Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000001404 mediated Effects 0.000 description 5
- 239000001301 oxygen Chemical group 0.000 description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical group O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 5
- 229920000023 polynucleotide Polymers 0.000 description 5
- 239000002157 polynucleotide Substances 0.000 description 5
- 230000035755 proliferation Effects 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 238000009958 sewing Methods 0.000 description 5
- 230000014616 translation Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N (E)-but-2-enedioate;hydron Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 210000004556 Brain Anatomy 0.000 description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 4
- 210000000170 Cell Membrane Anatomy 0.000 description 4
- 229940072221 IMMUNOGLOBULINS Drugs 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 4
- 102000017095 Leukocyte Common Antigens Human genes 0.000 description 4
- 108010013709 Leukocyte Common Antigens Proteins 0.000 description 4
- 108091007229 NSP3 Papain-like protease domain Proteins 0.000 description 4
- 206010029379 Neutrophilia Diseases 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- 101700057439 TOXA Proteins 0.000 description 4
- 229950002376 Tirapazamine Drugs 0.000 description 4
- QVMPZNRFXAKISM-UHFFFAOYSA-N Tirapazamine Chemical compound C1=CC=C2[N+]([O-])=NC(=N)N(O)C2=C1 QVMPZNRFXAKISM-UHFFFAOYSA-N 0.000 description 4
- 108060009220 USE1 Proteins 0.000 description 4
- 102100003921 USE1 Human genes 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 125000004429 atoms Chemical group 0.000 description 4
- XZMCDFZZKTWFGF-UHFFFAOYSA-N carbodiimide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 230000001419 dependent Effects 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 4
- 125000005349 heteroarylcycloalkyl group Chemical group 0.000 description 4
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 210000003292 kidney cell Anatomy 0.000 description 4
- 150000003951 lactams Chemical class 0.000 description 4
- 210000004962 mammalian cells Anatomy 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 238000001243 protein synthesis Methods 0.000 description 4
- 238000003127 radioimmunoassay Methods 0.000 description 4
- 230000004083 survival Effects 0.000 description 4
- 230000002194 synthesizing Effects 0.000 description 4
- 210000001519 tissues Anatomy 0.000 description 4
- 230000035897 transcription Effects 0.000 description 4
- 239000004474 valine Substances 0.000 description 4
- 101700023105 3L21 Proteins 0.000 description 3
- 101700012833 3S11 Proteins 0.000 description 3
- 102100010879 AGFG1 Human genes 0.000 description 3
- 229960005261 Aspartic Acid Drugs 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- CIUUIPMOFZIWIZ-UHFFFAOYSA-N Bropirimine Chemical compound NC1=NC(O)=C(Br)C(C=2C=CC=CC=2)=N1 CIUUIPMOFZIWIZ-UHFFFAOYSA-N 0.000 description 3
- 229950009494 Bropirimine Drugs 0.000 description 3
- 102100019289 CD2 Human genes 0.000 description 3
- 101700024689 CD2 Proteins 0.000 description 3
- QIVBCDIJIAJPQS-SECBINFHSA-N D-tryptophane Chemical compound C1=CC=C2C(C[C@@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-SECBINFHSA-N 0.000 description 3
- 229960000975 Daunorubicin Drugs 0.000 description 3
- AOJJSUZBOXZQNB-VTZDEGQISA-N EPIRUBICIN Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 3
- 210000002472 Endoplasmic Reticulum Anatomy 0.000 description 3
- 229940088598 Enzyme Drugs 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 101710003440 FCGR1A Proteins 0.000 description 3
- 102100015540 FCGR1A Human genes 0.000 description 3
- 102100015544 FCGR2C Human genes 0.000 description 3
- 108010064750 Humanized Monoclonal Antibodies Proteins 0.000 description 3
- 102000015434 Humanized Monoclonal Antibodies Human genes 0.000 description 3
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin hydrochloride Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 3
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 3
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 3
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 3
- 229950008745 Losoxantrone Drugs 0.000 description 3
- YROQEQPFUCPDCP-UHFFFAOYSA-N Losoxantrone Chemical compound OCCNCCN1N=C2C3=CC=CC(O)=C3C(=O)C3=C2C1=CC=C3NCCNCCO YROQEQPFUCPDCP-UHFFFAOYSA-N 0.000 description 3
- 241000282560 Macaca mulatta Species 0.000 description 3
- 210000002540 Macrophages Anatomy 0.000 description 3
- 108020004999 Messenger RNA Proteins 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 210000004693 NK cell Anatomy 0.000 description 3
- 229950010159 Nemorubicin Drugs 0.000 description 3
- 229960005190 Phenylalanine Drugs 0.000 description 3
- 210000002381 Plasma Anatomy 0.000 description 3
- 101700023970 SLT2 Proteins 0.000 description 3
- 108010084592 Saporins Proteins 0.000 description 3
- 108010090763 Shiga Toxin 2 Proteins 0.000 description 3
- 108010017898 Shiga Toxins Proteins 0.000 description 3
- VWDWKYIASSYTQR-UHFFFAOYSA-N Sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 3
- 241000700605 Viruses Species 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 230000000240 adjuvant Effects 0.000 description 3
- 125000006193 alkinyl group Chemical group 0.000 description 3
- 235000003704 aspartic acid Nutrition 0.000 description 3
- 239000011324 bead Substances 0.000 description 3
- 230000003115 biocidal Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002648 combination therapy Methods 0.000 description 3
- 230000000295 complement Effects 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 230000000139 costimulatory Effects 0.000 description 3
- 230000001808 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 101700041767 ctxA Proteins 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 239000000539 dimer Substances 0.000 description 3
- 229930013356 epothilones Natural products 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000002866 fluorescence resonance energy transfer Methods 0.000 description 3
- 238000001943 fluorescence-activated cell sorting Methods 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 230000004927 fusion Effects 0.000 description 3
- 108020001507 fusion proteins Proteins 0.000 description 3
- 102000037240 fusion proteins Human genes 0.000 description 3
- 150000002373 hemiacetals Chemical class 0.000 description 3
- 150000004677 hydrates Chemical class 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 230000028993 immune response Effects 0.000 description 3
- 238000002649 immunization Methods 0.000 description 3
- 238000009169 immunotherapy Methods 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 3
- PEEHTFAAVSWFBL-UHFFFAOYSA-N maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 3
- 229920002106 messenger RNA Polymers 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- CTMCWCONSULRHO-UHQPFXKFSA-N nemorubicin Chemical compound C1CO[C@H](OC)CN1[C@@H]1[C@H](O)[C@H](C)O[C@@H](O[C@@H]2C3=C(O)C=4C(=O)C5=C(OC)C=CC=C5C(=O)C=4C(O)=C3C[C@](O)(C2)C(=O)CO)C1 CTMCWCONSULRHO-UHQPFXKFSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical Effects 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 230000036961 partial Effects 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 230000036470 plasma concentration Effects 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N precursor Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 3
- YUOCYTRGANSSRY-UHFFFAOYSA-N pyrrolo[2,3-i][1,2]benzodiazepine Chemical compound C1=CN=NC2=C3C=CN=C3C=CC2=C1 YUOCYTRGANSSRY-UHFFFAOYSA-N 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 230000001743 silencing Effects 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000002054 transplantation Methods 0.000 description 3
- 230000035899 viability Effects 0.000 description 3
- GJNXBNATEDXMAK-PFLSVRRQSA-N (2S)-1-[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-6-[bi Chemical compound C([C@@H](C(=O)N[C@H](CCCCN=C(NCC)NCC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN=C(NCC)NCC)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)C1=CC=C(O)C=C1 GJNXBNATEDXMAK-PFLSVRRQSA-N 0.000 description 2
- XOZIUKBZLSUILX-GIQCAXHBSA-N (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione Chemical compound O1C(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC\C(C)=C/C[C@H]1C(\C)=C\C1=CSC(C)=N1 XOZIUKBZLSUILX-GIQCAXHBSA-N 0.000 description 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 2
- VHJLVAABSRFDPM-UHFFFAOYSA-N 1,4-dimercaptobutane-2,3-diol Chemical compound SCC(O)C(O)CS VHJLVAABSRFDPM-UHFFFAOYSA-N 0.000 description 2
- CGFVUVWMYIHGHS-UHFFFAOYSA-M 2,4,7,9-tetrahydroxy-6,11-dioxotetracen-5-olate Chemical compound C1=C(O)C=C2C=C(C(=O)C=3C(=C(O)C=C(C=3)O)C3=O)C3=C([O-])C2=C1O CGFVUVWMYIHGHS-UHFFFAOYSA-M 0.000 description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 2
- MOCVYVBNJQIVOV-TVQRCGJNSA-N 5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-2-methylchromen-4-one Chemical compound O[C@@H]1CN(C)CC[C@@H]1C1=C(O)C=C(O)C2=C1OC(C)=CC2=O MOCVYVBNJQIVOV-TVQRCGJNSA-N 0.000 description 2
- OVMSOCFBDVBLFW-VHLOTGQHSA-N 5β,20-epoxy-1,7β,13α-trihydroxy-9-oxotax-11-ene-2α,4α,10β-triyl 4,10-diacetate 2-benzoate Chemical compound O([C@@H]1[C@@]2(C[C@H](O)C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)O)C(=O)C1=CC=CC=C1 OVMSOCFBDVBLFW-VHLOTGQHSA-N 0.000 description 2
- ATCGGEJZONJOCL-UHFFFAOYSA-N 6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(C=2C(=CC=C(Cl)C=2)Cl)=N1 ATCGGEJZONJOCL-UHFFFAOYSA-N 0.000 description 2
- 229940022659 Acetaminophen Drugs 0.000 description 2
- 241000948470 Amanita phalloides Species 0.000 description 2
- JKOQGQFVAUAYPM-UHFFFAOYSA-N Amifostine Chemical compound NCCCNCCSP(O)(O)=O JKOQGQFVAUAYPM-UHFFFAOYSA-N 0.000 description 2
- 229960001097 Amifostine Drugs 0.000 description 2
- 229940064005 Antibiotic throat preparations Drugs 0.000 description 2
- 229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 description 2
- 229940042052 Antibiotics for systemic use Drugs 0.000 description 2
- 229940042786 Antitubercular Antibiotics Drugs 0.000 description 2
- 206010059512 Apoptosis Diseases 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- PICZCWCKOLHDOJ-GHTSNYPWSA-N Axinastatin 1 Chemical compound C([C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1)=O)C(C)C)C(C)C)C(C)C)C1=CC=CC=C1 PICZCWCKOLHDOJ-GHTSNYPWSA-N 0.000 description 2
- HONIICLYMWZJFZ-UHFFFAOYSA-N Azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 2
- 101710039869 BC_0920 Proteins 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 210000001772 Blood Platelets Anatomy 0.000 description 2
- 102100019459 CD27 Human genes 0.000 description 2
- 101700056583 CD27 Proteins 0.000 description 2
- 108060001251 CD34 Proteins 0.000 description 2
- 102100016492 CD34 Human genes 0.000 description 2
- 229920002574 CR-39 Polymers 0.000 description 2
- 101700083500 CTX1 Proteins 0.000 description 2
- 101700017076 CTX2 Proteins 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N Carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- 241000699802 Cricetulus griseus Species 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N Diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 108010053187 Diphtheria Toxin Proteins 0.000 description 2
- 102000016607 Diphtheria Toxin Human genes 0.000 description 2
- AADVCYNFEREWOS-OBRABYBLSA-N Discodermolide Chemical compound C=C\C=C/[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C\C(C)=C/[C@H](C)[C@@H](O)[C@@H](C)\C=C/[C@@H](O)C[C@@H]1OC(=O)[C@H](C)[C@@H](O)[C@H]1C AADVCYNFEREWOS-OBRABYBLSA-N 0.000 description 2
- 230000036947 Dissociation constant Effects 0.000 description 2
- NOPFSRXAKWQILS-UHFFFAOYSA-N Docosanol Chemical compound CCCCCCCCCCCCCCCCCCCCCCO NOPFSRXAKWQILS-UHFFFAOYSA-N 0.000 description 2
- VQNATVDKACXKTF-XELLLNAOSA-N Duocarmycin Chemical compound COC1=C(OC)C(OC)=C2NC(C(=O)N3C4=CC(=O)C5=C([C@@]64C[C@@H]6C3)C=C(N5)C(=O)OC)=CC2=C1 VQNATVDKACXKTF-XELLLNAOSA-N 0.000 description 2
- 229950011461 EDELFOSINE Drugs 0.000 description 2
- 229960001904 EPIRUBICIN Drugs 0.000 description 2
- MHFRGQHAERHWKZ-UHFFFAOYSA-N Edelfosine Chemical compound CCCCCCCCCCCCCCCCCCOCC(OC)COP([O-])(=O)OCC[N+](C)(C)C MHFRGQHAERHWKZ-UHFFFAOYSA-N 0.000 description 2
- 108010070635 Edrecolomab Proteins 0.000 description 2
- 101710044640 FCGR2A Proteins 0.000 description 2
- 101710044641 FCGR2B Proteins 0.000 description 2
- 101710044642 FCGR2C Proteins 0.000 description 2
- 102100008658 FN1 Human genes 0.000 description 2
- 101700009480 Fcgr3 Proteins 0.000 description 2
- 108010067306 Fibronectins Proteins 0.000 description 2
- CHPZKNULDCNCBW-UHFFFAOYSA-N Gallium nitrate Chemical compound [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O CHPZKNULDCNCBW-UHFFFAOYSA-N 0.000 description 2
- 229940093922 Gynecological Antibiotics Drugs 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 210000000777 Hematopoietic System Anatomy 0.000 description 2
- 229950006905 ILMOFOSINE Drugs 0.000 description 2
- 229960000310 ISOLEUCINE Drugs 0.000 description 2
- 229960000908 Idarubicin Drugs 0.000 description 2
- 229950009926 Idramantone Drugs 0.000 description 2
- 102000009786 Immunoglobulin Constant Regions Human genes 0.000 description 2
- 108010009817 Immunoglobulin Constant Regions Proteins 0.000 description 2
- 108010054477 Immunoglobulin Fab Fragments Proteins 0.000 description 2
- 102000001706 Immunoglobulin Fab Fragments Human genes 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N Intaxel Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- UWKQSNNFCGGAFS-XIFFEERXSA-N Irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 2
- 229950010984 Irsogladine Drugs 0.000 description 2
- 210000003734 Kidney Anatomy 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 2
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 2
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- 210000001165 Lymph Nodes Anatomy 0.000 description 2
- 210000004379 Membranes Anatomy 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 210000001616 Monocytes Anatomy 0.000 description 2
- 101700051754 NA11 Proteins 0.000 description 2
- GYAVMUDJCHAASE-UHFFFAOYSA-M Nedaplatin Chemical compound [H][N]([H])([H])[Pt]1([N]([H])([H])[H])OCC(=O)O1 GYAVMUDJCHAASE-UHFFFAOYSA-M 0.000 description 2
- 229950007221 Nedaplatin Drugs 0.000 description 2
- 101710003000 ORF1/ORF2 Proteins 0.000 description 2
- 229920000272 Oligonucleotide Polymers 0.000 description 2
- FELGMEQIXOGIFQ-UHFFFAOYSA-N Ondansetron Chemical compound CC1=NC=CN1CC1C(=O)C(C=2C(=CC=CC=2)N2C)=C2CC1 FELGMEQIXOGIFQ-UHFFFAOYSA-N 0.000 description 2
- 229960005343 Ondansetron Drugs 0.000 description 2
- 210000001672 Ovary Anatomy 0.000 description 2
- 241000283898 Ovis Species 0.000 description 2
- 229960001592 Paclitaxel Drugs 0.000 description 2
- RDIMTXDFGHNINN-IKGGRYGDSA-N Panaxytriol Chemical compound CCCCCCC[C@H](O)[C@@H](O)CC#CC#C[C@H](O)C=C RDIMTXDFGHNINN-IKGGRYGDSA-N 0.000 description 2
- RDIMTXDFGHNINN-BRWVUGGUSA-N Panaxytriol Natural products CCCCCCC[C@@H](O)[C@H](O)CC#CC#C[C@H](O)C=C RDIMTXDFGHNINN-BRWVUGGUSA-N 0.000 description 2
- FADYJNXDPBKVCA-UHFFFAOYSA-N Phenylalanyl-Lysine Chemical compound NCCCCC(C(O)=O)NC(=O)C(N)CC1=CC=CC=C1 FADYJNXDPBKVCA-UHFFFAOYSA-N 0.000 description 2
- 231100000654 Protein toxin Toxicity 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- DNXIASIHZYFFRO-UHFFFAOYSA-N Pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 2
- 241000283984 Rodentia Species 0.000 description 2
- 229950008902 SAFINGOL Drugs 0.000 description 2
- 101700001720 SIX2 Proteins 0.000 description 2
- 101700008007 STX1A Proteins 0.000 description 2
- OTKJDMGTUTTYMP-ROUUACIJSA-N Safingol Chemical compound CCCCCCCCCCCCCCC[C@H](O)[C@@H](N)CO OTKJDMGTUTTYMP-ROUUACIJSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 241000607768 Shigella Species 0.000 description 2
- 206010040550 Shigella infection Diseases 0.000 description 2
- 241000705082 Sialia Species 0.000 description 2
- 210000000952 Spleen Anatomy 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 101700024472 TXAA2 Proteins 0.000 description 2
- 101700055586 TXT1 Proteins 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- 229940024982 Topical Antifungal Antibiotics Drugs 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical class [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- 102000007537 Type II DNA Topoisomerases Human genes 0.000 description 2
- 108010046308 Type II DNA Topoisomerases Proteins 0.000 description 2
- 101700039798 VKT1 Proteins 0.000 description 2
- 229960003048 Vinblastine Drugs 0.000 description 2
- HOFQVRTUGATRFI-XQKSVPLYSA-N Vinblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 HOFQVRTUGATRFI-XQKSVPLYSA-N 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- URRBLVUOXIGNQR-HXUWFJFHSA-N [(1R)-1-phenylethyl] N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]carbamate Chemical compound C1([C@@H](C)OC(=O)N(CCN)CC=2C=C(C(=CC=2)OCC=2C=CC=CC=2)OC)=CC=CC=C1 URRBLVUOXIGNQR-HXUWFJFHSA-N 0.000 description 2
- ODEDPKNSRBCSDO-UHFFFAOYSA-N [2-(hexadecylsulfanylmethyl)-3-methoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate Chemical compound CCCCCCCCCCCCCCCCSCC(COC)COP([O-])(=O)OCC[N+](C)(C)C ODEDPKNSRBCSDO-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 235000004279 alanine Nutrition 0.000 description 2
- 229930013930 alkaloids Natural products 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000007854 aminals Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000001093 anti-cancer Effects 0.000 description 2
- 239000000739 antihistaminic agent Substances 0.000 description 2
- 230000006907 apoptotic process Effects 0.000 description 2
- 108010093161 axinastatin 1 Proteins 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- 230000001580 bacterial Effects 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 125000004452 carbocyclyl group Chemical group 0.000 description 2
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000030833 cell death Effects 0.000 description 2
- 239000002458 cell surface marker Substances 0.000 description 2
- 238000007385 chemical modification Methods 0.000 description 2
- 230000000973 chemotherapeutic Effects 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- 238000005094 computer simulation Methods 0.000 description 2
- 239000003246 corticosteroid Substances 0.000 description 2
- QKJSVPBYHKEILK-UHFFFAOYSA-N cyclohexene Chemical group C1CCC=[C]C1 QKJSVPBYHKEILK-UHFFFAOYSA-N 0.000 description 2
- 230000016396 cytokine production Effects 0.000 description 2
- 230000001461 cytolytic Effects 0.000 description 2
- 239000002254 cytotoxic agent Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 229960000520 diphenhydramine Drugs 0.000 description 2
- 229960000735 docosanol Drugs 0.000 description 2
- 229960001776 edrecolomab Drugs 0.000 description 2
- 238000000855 fermentation Methods 0.000 description 2
- 230000004151 fermentation Effects 0.000 description 2
- 230000037320 fibronectin Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 229960003794 ganirelix Drugs 0.000 description 2
- 238000001502 gel electrophoresis Methods 0.000 description 2
- 238000002523 gelfiltration Methods 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- TZBDEVBNMSLVKT-UHFFFAOYSA-N idramantone Chemical compound C1C(C2)CC3CC1(O)CC2C3=O TZBDEVBNMSLVKT-UHFFFAOYSA-N 0.000 description 2
- 230000001900 immune effect Effects 0.000 description 2
- 230000016784 immunoglobulin production Effects 0.000 description 2
- 230000003308 immunostimulating Effects 0.000 description 2
- 230000001976 improved Effects 0.000 description 2
- 238000000126 in silico method Methods 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000002687 intercalation Effects 0.000 description 2
- 238000009830 intercalation Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229940079866 intestinal antibiotics Drugs 0.000 description 2
- 229960004768 irinotecan Drugs 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 238000011068 load Methods 0.000 description 2
- 230000035800 maturation Effects 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 230000000051 modifying Effects 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 230000000269 nucleophilic Effects 0.000 description 2
- 229940005935 ophthalmologic Antibiotics Drugs 0.000 description 2
- 150000002891 organic anions Chemical class 0.000 description 2
- 210000000056 organs Anatomy 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N p-acetaminophenol Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- 229960005489 paracetamol Drugs 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 101710031800 phtx Proteins 0.000 description 2
- 101710043201 phtx2 Proteins 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 108091008117 polyclonal antibodies Proteins 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 230000001681 protective Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N pyrrole Chemical group C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 238000002741 site-directed mutagenesis Methods 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 210000000130 stem cell Anatomy 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000004434 sulfur atoms Chemical group 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 230000020382 suppression by virus of host antigen processing and presentation of peptide antigen via MHC class I Effects 0.000 description 2
- 238000002198 surface plasmon resonance spectroscopy Methods 0.000 description 2
- 238000010189 synthetic method Methods 0.000 description 2
- 238000009121 systemic therapy Methods 0.000 description 2
- 229930003347 taxol Natural products 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 2
- 150000003555 thioacetals Chemical class 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 230000026683 transduction Effects 0.000 description 2
- 238000010361 transduction Methods 0.000 description 2
- 102000035402 transmembrane proteins Human genes 0.000 description 2
- 108091005683 transmembrane proteins Proteins 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 2
- 210000004881 tumor cells Anatomy 0.000 description 2
- HFQKBOPMAOTAIR-TZSVBWBLSA-N α-D-galactosyl-(1->4)-β-D-galactosyl-(1->4)-β-D-glucosylceramide Chemical compound O[C@@H]1[C@@H](O)[C@H](OC[C@@H]([C@H](O)/C=C/CCCCCCCCCCCCC)NC(C)=O)O[C@H](CO)[C@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O2)O)[C@@H](CO)O1 HFQKBOPMAOTAIR-TZSVBWBLSA-N 0.000 description 2
- GCPUVEMWOWMALU-HZMBPMFUSA-N (1S,3S)-1-hydroxy-8-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione Chemical compound C1[C@H](C)C[C@H](O)C2=C1C=CC1=C2C(=O)C(C=CC=C2OC)=C2C1=O GCPUVEMWOWMALU-HZMBPMFUSA-N 0.000 description 1
- FXPSZLHFJDHOMI-DHZHZOJOSA-N (2E)-4-methoxy-3-methylsulfanyl-2-(nitrosomethylidene)-6-pyridin-2-yl-1H-pyridine Chemical compound COC1=C(SC)\C(=C/N=O)NC(C=2N=CC=CC=2)=C1 FXPSZLHFJDHOMI-DHZHZOJOSA-N 0.000 description 1
- BUSGWUFLNHIBPT-XYBORKQMSA-N (2E,4E,6E)-7-[(1R,5R,6S)-3-[[(2E,4E)-5-cyclohexylpenta-2,4-dienoyl]amino]-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-5-yl]hepta-2,4,6-trienoic acid Chemical compound C([C@]([C@H]1O[C@H]1C1=O)(O)/C=C/C=C/C=C/C(=O)O)=C1NC(=O)\C=C\C=C\C1CCCCC1 BUSGWUFLNHIBPT-XYBORKQMSA-N 0.000 description 1
- SWTGJCNCBUCXSS-ISUZDFFFSA-N (2R)-3,4-dihydroxy-2-[(4S)-2-phenyl-1,3-dioxolan-4-yl]-2H-furan-5-one Chemical compound OC1=C(O)C(=O)O[C@@H]1[C@H]1OC(C=2C=CC=CC=2)OC1 SWTGJCNCBUCXSS-ISUZDFFFSA-N 0.000 description 1
- VPAWVRUHMJVRHU-VGDKGRGNSA-N (2R,4R)-N,N-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2$l^{5}-oxazaphosphinan-2-amine Chemical compound OO[C@@H]1CCO[P@@](=O)(N(CCCl)CCCl)N1 VPAWVRUHMJVRHU-VGDKGRGNSA-N 0.000 description 1
- ZUQBAQVRAURMCL-DOMZBBRYSA-N (2S)-2-[[4-[2-[(6R)-2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl]amino]pentanedioic acid Chemical compound C([C@@H]1CC=2C(=O)N=C(NC=2NC1)N)CC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 ZUQBAQVRAURMCL-DOMZBBRYSA-N 0.000 description 1
- YOZSEGPJAXTSFZ-ZETCQYMHSA-N (2S)-2-amino-3-(5-hydroxypyridin-2-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=N1 YOZSEGPJAXTSFZ-ZETCQYMHSA-N 0.000 description 1
- RWHUEXWOYVBUCI-ITQXDASVSA-N (2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-1-[(2S)-2-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-3-( Chemical compound C([C@@H](C(=O)N[C@H](CC=1C=C2C=CC=CC2=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 RWHUEXWOYVBUCI-ITQXDASVSA-N 0.000 description 1
- GJKXGJCSJWBJEZ-XRSSZCMZSA-N (2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl Chemical compound CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CNC2=CC=CC=C12 GJKXGJCSJWBJEZ-XRSSZCMZSA-N 0.000 description 1
- HWMMBHOXHRVLCU-QOUANJGESA-N (2S,4S,5S)-4-[(1E,3E,5E)-7-[(2R,6R)-6-[(2R,3S,4aR,12bS)-2,3,4a,8,12b-pentahydroxy-3-methyl-1,7,12-trioxo-2,4-dihydrobenzo[a]anthracen-9-yl]-2-methyloxan-3-yl]oxy-7-oxohepta-1,3,5-trienyl]-2,5-dimethyl-1,3-dioxolane-2-carboxylic acid Chemical compound C[C@@H]1O[C@](C)(C(O)=O)O[C@H]1\C=C\C=C\C=C\C(=O)OC1[C@@H](C)O[C@@H](C=2C(=C3C(=O)C4=C([C@]5(C(=O)[C@H](O)[C@@](C)(O)C[C@@]5(O)C=C4)O)C(=O)C3=CC=2)O)CC1 HWMMBHOXHRVLCU-QOUANJGESA-N 0.000 description 1
- UYRMXZIBPZVBNO-QPJJXVBHSA-N (4E)-4-[amino-(hydroxyamino)methylidene]-2-hydroxycyclohexa-2,5-dien-1-one Chemical compound ONC(/N)=C1\C=CC(=O)C(O)=C1 UYRMXZIBPZVBNO-QPJJXVBHSA-N 0.000 description 1
- DEQANNDTNATYII-OULOTJBUSA-N (4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-19-[[(2R)-2-amino-3-phenylpropanoyl]amino]-16-benzyl-N-[(2R,3R)-1,3-dihydroxybutan-2-yl]-7-[(1R)-1-hydroxyethyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxa Chemical compound C([C@@H](N)C(=O)N[C@H]1CSSC[C@H](NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC=2C3=CC=CC=C3NC=2)NC(=O)[C@H](CC=2C=CC=CC=2)NC1=O)C(=O)N[C@H](CO)[C@H](O)C)C1=CC=CC=C1 DEQANNDTNATYII-OULOTJBUSA-N 0.000 description 1
- NRUKOCRGYNPUPR-QBPJDGROSA-N (5S,5aR,8aR,9R)-5-[[(2R,4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-thiophen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
- WTSKMKRYHATLLL-UHFFFAOYSA-N (6-benzoyloxy-3-cyanopyridin-2-yl) 3-[3-(ethoxymethyl)-5-fluoro-2,6-dioxopyrimidine-1-carbonyl]benzoate Chemical compound O=C1N(COCC)C=C(F)C(=O)N1C(=O)C1=CC=CC(C(=O)OC=2C(=CC=C(OC(=O)C=3C=CC=CC=3)N=2)C#N)=C1 WTSKMKRYHATLLL-UHFFFAOYSA-N 0.000 description 1
- SQTCTJUGYBKNCX-UHFFFAOYSA-N (6-hydroxy-1H-indol-3-yl)-[5-(1H-indol-2-yl)-1H-imidazol-2-yl]methanone Chemical compound C1=CC=C2NC(C=3N=C(NC=3)C(=O)C=3C4=CC=C(C=C4NC=3)O)=CC2=C1 SQTCTJUGYBKNCX-UHFFFAOYSA-N 0.000 description 1
- PTBPQBZWBIRISO-IAGVQPJWSA-N (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-[(E)-N-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)amino]-C-methylcarbonimidoyl]-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical group O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\N=C1CC(C)(C)N(O)C(C)(C)C1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 PTBPQBZWBIRISO-IAGVQPJWSA-N 0.000 description 1
- KMSKQZKKOZQFFG-YXRRJAAWSA-N (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-6-methyl-5-[(2R)-oxan-2-yl]oxyoxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical compound O([C@H]1[C@@H](N)C[C@@H](O[C@H]1C)O[C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@@H]1CCCCO1 KMSKQZKKOZQFFG-YXRRJAAWSA-N 0.000 description 1
- SLURUCSFDHKXFR-WWMWMSKMSA-N (7S,9S)-7-[[(1S,3R,4aS,9S,9aR,10aS)-9-methoxy-1-methyl-3,4,4a,6,7,9,9a,10a-octahydro-1H-pyrano[1,2][1,3]oxazolo[3,4-b][1,4]oxazin-3-yl]oxy]-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical compound O=C1C2=CC=CC(OC)=C2C(=O)C(C(O)=C23)=C1C(O)=C3C[C@@](O)(C(=O)CO)C[C@@H]2O[C@H]1C[C@@H]2N3CCO[C@H](OC)[C@H]3O[C@@H]2[C@H](C)O1 SLURUCSFDHKXFR-WWMWMSKMSA-N 0.000 description 1
- IEXUMDBQLIVNHZ-YOUGDJEHSA-N (8S,11R,13R,14S,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(O)CCCO)[C@@]2(C)C1 IEXUMDBQLIVNHZ-YOUGDJEHSA-N 0.000 description 1
- VAPSMQAHNAZRKC-PQWRYPMOSA-N (8S,9S,10R,13S,14S,17S)-17-(tert-butylcarbamoyl)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid Chemical compound C1C=C2C=C(C(O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)NC(C)(C)C)[C@@]1(C)CC2 VAPSMQAHNAZRKC-PQWRYPMOSA-N 0.000 description 1
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 description 1
- 125000006711 (C2-C12) alkynyl group Chemical group 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (E)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- SJSYJHLLBBSLIH-SDNWHVSQSA-N (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoic acid Chemical compound COC1=CC=CC=C1\C=C(\C(O)=O)C1=CC=CC=C1 SJSYJHLLBBSLIH-SDNWHVSQSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N 1,2-ethanediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- FONKWHRXTPJODV-DNQXCXABSA-N 1,3-bis[2-[(8S)-8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea Chemical compound C1([C@H](CCl)CN2C(=O)C=3NC4=CC=C(C=C4C=3)NC(=O)NC=3C=C4C=C(NC4=CC=3)C(=O)N3C4=CC(O)=C5NC=C(C5=C4[C@H](CCl)C3)C)=C2C=C(O)C2=C1C(C)=CN2 FONKWHRXTPJODV-DNQXCXABSA-N 0.000 description 1
- YQYBWJPESSJLTK-HXFLIBJXSA-N 1-(2-chloroethyl)-3-[(2R,3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-nitrosourea Chemical compound CO[C@@H]1C[C@@H](NC(=O)N(CCCl)N=O)[C@H](O)[C@@H](CO)O1 YQYBWJPESSJLTK-HXFLIBJXSA-N 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- HAWSQZCWOQZXHI-FQEVSTJZSA-N 10-Hydroxycamptothecin Chemical compound C1=C(O)C=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 HAWSQZCWOQZXHI-FQEVSTJZSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- NKUWPVYXJNSCQL-UHFFFAOYSA-L 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylate;platinum(2+) Chemical compound [Pt+2].NCC(CN)(CO)CO.[O-]C(=O)C1(C([O-])=O)CCC1 NKUWPVYXJNSCQL-UHFFFAOYSA-L 0.000 description 1
- KEQTWHPMSVAFDA-UHFFFAOYSA-N 2,3-dihydro-1H-pyrazole Chemical compound C1NNC=C1 KEQTWHPMSVAFDA-UHFFFAOYSA-N 0.000 description 1
- FFMBYMANYCDCMK-UHFFFAOYSA-N 2,5-dihydro-1H-imidazole Chemical compound C1NCN=C1 FFMBYMANYCDCMK-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N 2-Imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- XXVLKDRPHSFIIB-UHFFFAOYSA-N 2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N(CCN(C)C)C2=O)=O)=C3C2=CC=CC3=C1 XXVLKDRPHSFIIB-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- NIXVOFULDIFBLB-QVRNUERCSA-N 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-sulfinamide Chemical compound C12=NC(N)=NC(S(N)=O)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NIXVOFULDIFBLB-QVRNUERCSA-N 0.000 description 1
- HVXBOLULGPECHP-WAYWQWQTSA-N 2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol Chemical compound C1=C(O)C(OC)=CC=C1\C=C/C1=CC(OC)=C(OC)C(OC)=C1 HVXBOLULGPECHP-WAYWQWQTSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229920002652 28S ribosomal RNA Polymers 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- 108020005345 3' Untranslated Regions Proteins 0.000 description 1
- QNKJFXARIMSDBR-UHFFFAOYSA-N 3-[2-[bis(2-chloroethyl)amino]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCN(CCCl)CCCl)C(=O)NC11CCCCC1 QNKJFXARIMSDBR-UHFFFAOYSA-N 0.000 description 1
- WELIVEBWRWAGOM-UHFFFAOYSA-N 3-amino-N-[2-[2-(3-aminopropanoylamino)ethyldisulfanyl]ethyl]propanamide Chemical compound NCCC(=O)NCCSSCCNC(=O)CCN WELIVEBWRWAGOM-UHFFFAOYSA-N 0.000 description 1
- XSCKKKKCZBNKQZ-UHFFFAOYSA-N 3-chloroquinoxaline-2-sulfonamide Chemical compound C1=CC=C2N=C(Cl)C(S(=O)(=O)N)=NC2=C1 XSCKKKKCZBNKQZ-UHFFFAOYSA-N 0.000 description 1
- HXZRMADPDYFMEB-MLTUFRGDSA-N 3-hydroxy-N-[3-[8-[(E)-6-hydroxy-3,5-dimethylhept-4-enyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl]-2-methyl-4-[[2-[3-methyl-6-[(Z)-2-oxopent-3-enyl]oxan-2-yl]acetyl]amino]butanamide Chemical compound O1C(CC(=O)\C=C/C)CCC(C)C1CC(=O)NCC(O)C(C)C(=O)NCCCC1C(C)CCC2(OC(CCC(C)\C=C(/C)C(C)O)CCC2)O1 HXZRMADPDYFMEB-MLTUFRGDSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical compound C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 1
- PDQGEKGUTOTUNV-TZSSRYMLSA-N 4'-deoxy-4'-iododoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](I)[C@H](C)O1 PDQGEKGUTOTUNV-TZSSRYMLSA-N 0.000 description 1
- MCGBIXXDQFWVDW-UHFFFAOYSA-N 4,5-dihydro-1H-pyrazole Chemical compound C1CC=NN1 MCGBIXXDQFWVDW-UHFFFAOYSA-N 0.000 description 1
- 108010082808 4-1BB Ligand Proteins 0.000 description 1
- OUQPTBCOEKUHBH-LSDHQDQOSA-N 4-[2-[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethyl]morpholine Chemical compound C=1C=C(C(CCC2(C)C)(C)C)C2=CC=1C(/C)=C/C(C=C1)=CC=C1OCCN1CCOCC1 OUQPTBCOEKUHBH-LSDHQDQOSA-N 0.000 description 1
- NMUSYJAQQFHJEW-ARQDHWQXSA-N 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-ARQDHWQXSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 108020003589 5' Untranslated Regions Proteins 0.000 description 1
- APNRZHLOPQFNMR-WEIUTZTHSA-N 5-[(E)-5-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enyl]phenazin-1-one Chemical compound C12=CC=CC=C2N=C(C(C=CC=2)=O)C=2N1C\C=C(/C)CC[C@@H]1C(=C)CCCC1(C)C APNRZHLOPQFNMR-WEIUTZTHSA-N 0.000 description 1
- JOZGNYDSEBIJDH-UHFFFAOYSA-N 5-ethynyl-1H-pyrimidine-2,4-dione Chemical compound O=C1NC=C(C#C)C(=O)N1 JOZGNYDSEBIJDH-UHFFFAOYSA-N 0.000 description 1
- PXBZKHOQHTVCSQ-QZTJIDSGSA-N 5-nitro-2-[(2R)-1-[2-[[(2R)-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]amino]ethylamino]propan-2-yl]benzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N([C@@H](CNCCNC[C@@H](C)N2C(C=3C=C(C=C4C=CC=C(C=34)C2=O)[N+]([O-])=O)=O)C)C2=O)=O)=C3C2=CC=CC3=C1 PXBZKHOQHTVCSQ-QZTJIDSGSA-N 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- VJXSSYDSOJBUAV-UHFFFAOYSA-N 6-(2,5-Dimethoxy-Benzyl)-5-Methyl-Pyrido[2,3-D]Pyrimidine-2,4-Diamine Chemical compound COC1=CC=C(OC)C(CC=2C(=C3C(N)=NC(N)=NC3=NC=2)C)=C1 VJXSSYDSOJBUAV-UHFFFAOYSA-N 0.000 description 1
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 1
- FJHBVJOVLFPMQE-QFIPXVFZSA-N 7-Ethyl-10-Hydroxy-Camptothecin Chemical compound C1=C(O)C=C2C(CC)=C(CN3C(C4=C([C@@](C(=O)OC4)(O)CC)C=C33)=O)C3=NC2=C1 FJHBVJOVLFPMQE-QFIPXVFZSA-N 0.000 description 1
- TWHSQQYCDVSBRK-UHFFFAOYSA-N 9-[4-(methanesulfonamido)-2-methoxyanilino]-N,5-dimethylacridine-4-carboxamide Chemical compound C12=CC=CC(C)=C2N=C2C(C(=O)NC)=CC=CC2=C1NC1=CC=C(NS(C)(=O)=O)C=C1OC TWHSQQYCDVSBRK-UHFFFAOYSA-N 0.000 description 1
- MSNVESLISHTIRS-UHFFFAOYSA-N 9H-pyrrolo[2,1-c][1,4]benzodiazepine Chemical class N1=C2C=CC=CC2=CN2CC=CC2=C1 MSNVESLISHTIRS-UHFFFAOYSA-N 0.000 description 1
- 101710026914 AAG Proteins 0.000 description 1
- 229950004955 ADOZELESIN Drugs 0.000 description 1
- 101700036849 AMBP Proteins 0.000 description 1
- 102100016604 AMBP Human genes 0.000 description 1
- 229950004810 ATAMESTANE Drugs 0.000 description 1
- 108010066676 Abrin Proteins 0.000 description 1
- 229960000583 Acetic Acid Drugs 0.000 description 1
- 108010042708 Acetylmuramyl-Alanyl-Isoglutamine Proteins 0.000 description 1
- 241000186361 Actinobacteria <class> Species 0.000 description 1
- DPGOLRILOKERAV-AAWJQDODSA-N Adecypenol Chemical compound OC1C(CO)=CCC1(O)N1C(N=CNC[C@H]2O)C2N=C1 DPGOLRILOKERAV-AAWJQDODSA-N 0.000 description 1
- 229960000643 Adenine Drugs 0.000 description 1
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Natural products NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 1
- OIRDTQYFTABQOQ-SXVXDFOESA-N Adenosine Natural products Nc1ncnc2c1ncn2[C@@H]3O[C@@H](CO)[C@H](O)[C@@H]3O OIRDTQYFTABQOQ-SXVXDFOESA-N 0.000 description 1
- BYRVKDUQDLJUBX-UHFFFAOYSA-N Adozelesin Chemical compound C1=CC=C2OC(C(=O)NC=3C=C4C=C(NC4=CC=3)C(=O)N3CC4CC44C5=C(C(C=C43)=O)NC=C5C)=CC2=C1 BYRVKDUQDLJUBX-UHFFFAOYSA-N 0.000 description 1
- 229940009456 Adriamycin Drugs 0.000 description 1
- 229950010949 Ambamustine Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N Ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- OTBXOEAOVRKTNQ-UHFFFAOYSA-N Anagrelide Chemical compound N1=C2NC(=O)CN2CC2=C(Cl)C(Cl)=CC=C21 OTBXOEAOVRKTNQ-UHFFFAOYSA-N 0.000 description 1
- YBBLVLTVTVSKRW-UHFFFAOYSA-N Anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 1
- VGQOVCHZGQWAOI-HYUHUPJXSA-N Anthramycin Chemical compound N1[C@@H](O)[C@@H]2CC(\C=C\C(N)=O)=CN2C(=O)C2=CC=C(C)C(O)=C12 VGQOVCHZGQWAOI-HYUHUPJXSA-N 0.000 description 1
- 210000000612 Antigen-Presenting Cells Anatomy 0.000 description 1
- 108020000948 Antisense Oligonucleotides Proteins 0.000 description 1
- SGPJMFVJKNVPLI-CJXLBUIWSA-N AphiG Chemical compound Cl.C1[C@@]23[C@@]4(C)CC[C@@H](O)[C@@](C)(CO)[C@@H]4CC[C@H]3C[C@H]1[C@](COC(=O)CN)(O)CC2 SGPJMFVJKNVPLI-CJXLBUIWSA-N 0.000 description 1
- 229920002395 Aptamer Polymers 0.000 description 1
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 1
- 229960001230 Asparagine Drugs 0.000 description 1
- PEPMWUSGRKINHX-TXTPUJOMSA-N Atamestane Chemical compound C1C[C@@H]2[C@@]3(C)C(C)=CC(=O)C=C3CC[C@H]2[C@@H]2CCC(=O)[C@]21C PEPMWUSGRKINHX-TXTPUJOMSA-N 0.000 description 1
- 229950006933 Atrimustine Drugs 0.000 description 1
- OXNAATCTZCSVKR-AVGVIDKOSA-N Axinastatin 2 Chemical compound C([C@H]1C(=O)N[C@H](C(=O)N[C@H](C(N2CCC[C@H]2C(=O)N[C@@H](C(=O)N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1)C(C)C)=O)CC(C)C)C(C)C)C1=CC=CC=C1 OXNAATCTZCSVKR-AVGVIDKOSA-N 0.000 description 1
- ANLDPEXRVVIABH-WUUSPZRJSA-N Axinastatin 3 Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=O)N[C@@H](C(=O)N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1)C(C)C)=O)[C@@H](C)CC)C1=CC=CC=C1 ANLDPEXRVVIABH-WUUSPZRJSA-N 0.000 description 1
- MIXLRUYCYZPSOQ-HXPMCKFVSA-N Azatoxin Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=C(C4=CC=CC=C4N3)C[C@@H]3N2C(OC3)=O)=C1 MIXLRUYCYZPSOQ-HXPMCKFVSA-N 0.000 description 1
- 102000019260 B-Cell Antigen Receptors Human genes 0.000 description 1
- 108010012919 B-Cell Antigen Receptors Proteins 0.000 description 1
- 210000000649 B-Lymphocyte Subsets Anatomy 0.000 description 1
- 229950002370 BISNAFIDE Drugs 0.000 description 1
- 229950006844 BIZELESIN Drugs 0.000 description 1
- 231100000699 Bacterial toxin Toxicity 0.000 description 1
- XYUFCXJZFZPEJD-PGRDOPGGSA-N Balanol Chemical compound OC(=O)C1=CC=CC(O)=C1C(=O)C1=C(O)C=C(C(=O)O[C@H]2[C@H](CNCCC2)NC(=O)C=2C=CC(O)=CC=2)C=C1O XYUFCXJZFZPEJD-PGRDOPGGSA-N 0.000 description 1
- XFILPEOLDIKJHX-QYZOEREBSA-N Batimastat Chemical compound C([C@@H](C(=O)NC)NC(=O)[C@H](CC(C)C)[C@H](CSC=1SC=CC=1)C(=O)NO)C1=CC=CC=C1 XFILPEOLDIKJHX-QYZOEREBSA-N 0.000 description 1
- 229950001858 Batimastat Drugs 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N Benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 108010071919 Bispecific Antibodies Proteins 0.000 description 1
- 206010065553 Bone marrow failure Diseases 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 description 1
- BBZDXMBRAFTCAA-AREMUKBSSA-N CARZELESIN Chemical compound C1=2NC=C(C)C=2C([C@H](CCl)CN2C(=O)C=3NC4=CC=C(C=C4C=3)NC(=O)C3=CC4=CC=C(C=C4O3)N(CC)CC)=C2C=C1OC(=O)NC1=CC=CC=C1 BBZDXMBRAFTCAA-AREMUKBSSA-N 0.000 description 1
- PUDHBTGHUJUUFI-PURAGXGVSA-N CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC2=CNC3=C2C=CC=C3)NC(=O)[C@H](CC2=CC=C(O)C=C2)NC(=O)[C@H](CSSC[C@H](NC1=O)C(=O)N[C@@H]([C@@H](C)O)C(N)=O)NC(=O)[C@@H](N)CC1=CC=C2C=CC=CC2=C1 Chemical compound CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC2=CNC3=C2C=CC=C3)NC(=O)[C@H](CC2=CC=C(O)C=C2)NC(=O)[C@H](CSSC[C@H](NC1=O)C(=O)N[C@@H]([C@@H](C)O)C(N)=O)NC(=O)[C@@H](N)CC1=CC=C2C=CC=CC2=C1 PUDHBTGHUJUUFI-PURAGXGVSA-N 0.000 description 1
- 102100016530 CD37 Human genes 0.000 description 1
- 101700044364 CD37 Proteins 0.000 description 1
- 102100013077 CD4 Human genes 0.000 description 1
- 101700022938 CD4 Proteins 0.000 description 1
- 102100019451 CD80 Human genes 0.000 description 1
- 101700080477 CD80 Proteins 0.000 description 1
- 102100016531 CD9 Human genes 0.000 description 1
- 101700017162 CD9 Proteins 0.000 description 1
- 101710043954 CEACAM3 Proteins 0.000 description 1
- 102100011836 CEACAM3 Human genes 0.000 description 1
- 102100009368 CR2 Human genes 0.000 description 1
- 101700020447 CR2 Proteins 0.000 description 1
- 102100006400 CSF2 Human genes 0.000 description 1
- LUEYTMPPCOCKBX-KWYHTCOPSA-N CURACIN-A Chemical compound C=CC[C@H](OC)CC\C(C)=C\C=C\CC\C=C/[C@@H]1CSC([C@H]2[C@H](C2)C)=N1 LUEYTMPPCOCKBX-KWYHTCOPSA-N 0.000 description 1
- LWQQLNNNIPYSNX-UROSTWAQSA-N Calcipotriol Chemical compound C1([C@H](O)/C=C/[C@@H](C)[C@@H]2[C@]3(CCCC(/[C@@H]3CC2)=C\C=C\2C([C@@H](O)C[C@H](O)C/2)=C)C)CC1 LWQQLNNNIPYSNX-UROSTWAQSA-N 0.000 description 1
- DSSYKIVIOFKYAU-UHFFFAOYSA-N Camphor Chemical compound C1CC2(C)C(=O)CC1C2(C)C DSSYKIVIOFKYAU-UHFFFAOYSA-N 0.000 description 1
- 229960000846 Camphor Drugs 0.000 description 1
- VSJKWCGYPAHWDS-FQEVSTJZSA-N Camptothecin Chemical class C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 1
- 229960004117 Capecitabine Drugs 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229950007509 Carzelesin Drugs 0.000 description 1
- JDVVGAQPNNXQDW-WCMLQCRESA-N Castanospermine Natural products O[C@H]1[C@@H](O)[C@H]2[C@@H](O)CCN2C[C@H]1O JDVVGAQPNNXQDW-WCMLQCRESA-N 0.000 description 1
- JDVVGAQPNNXQDW-TVNFTVLESA-N Castinospermine Chemical compound C1[C@H](O)[C@@H](O)[C@H](O)[C@H]2[C@@H](O)CCN21 JDVVGAQPNNXQDW-TVNFTVLESA-N 0.000 description 1
- 108050004290 Cecropins Proteins 0.000 description 1
- 210000001175 Cerebrospinal Fluid Anatomy 0.000 description 1
- 206010008342 Cervix carcinoma Diseases 0.000 description 1
- 206010068051 Chimerism Diseases 0.000 description 1
- 229960005091 Chloramphenicol Drugs 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N Chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- 241000282552 Chlorocebus aethiops Species 0.000 description 1
- 229960001231 Choline Drugs 0.000 description 1
- 210000004252 Chorionic Villi Anatomy 0.000 description 1
- 206010008958 Chronic lymphocytic leukaemia Diseases 0.000 description 1
- 241000723346 Cinnamomum camphora Species 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- 210000001072 Colon Anatomy 0.000 description 1
- 229920002676 Complementary DNA Polymers 0.000 description 1
- 229920000453 Consensus sequence Polymers 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 206010011401 Crohn's disease Diseases 0.000 description 1
- PSNOPSMXOBPNNV-VVCTWANISA-N Cryptophycin 1 Chemical compound C1=C(Cl)C(OC)=CC=C1C[C@@H]1C(=O)NC[C@@H](C)C(=O)O[C@@H](CC(C)C)C(=O)O[C@H]([C@H](C)[C@@H]2[C@H](O2)C=2C=CC=CC=2)C/C=C/C(=O)N1 PSNOPSMXOBPNNV-VVCTWANISA-N 0.000 description 1
- 210000000172 Cytosol Anatomy 0.000 description 1
- 150000008574 D-amino acids Chemical class 0.000 description 1
- MTCFGRXMJLQNBG-UWTATZPHSA-N D-serine Chemical compound OC[C@@H](N)C(O)=O MTCFGRXMJLQNBG-UWTATZPHSA-N 0.000 description 1
- XAUDJQYHKZQPEU-KVQBGUIXSA-N Decitabine Chemical compound O=C1N=C(N)N=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 XAUDJQYHKZQPEU-KVQBGUIXSA-N 0.000 description 1
- 208000006558 Dental Calculus Diseases 0.000 description 1
- 102000016911 Deoxyribonucleases Human genes 0.000 description 1
- 108010053770 Deoxyribonucleases Proteins 0.000 description 1
- BMKDZUISNHGIBY-ZETCQYMHSA-N Dexrazoxane Chemical compound C([C@H](C)N1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 BMKDZUISNHGIBY-ZETCQYMHSA-N 0.000 description 1
- 229960000605 Dexrazoxane Drugs 0.000 description 1
- 229950005878 Dexverapamil Drugs 0.000 description 1
- 206010012601 Diabetes mellitus Diseases 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N Diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N Diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N Dihydroxyacetone Chemical group OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 1
- YWHLKYXPLRWGSE-UHFFFAOYSA-N Dimethyl trisulfide Chemical group CSSSC YWHLKYXPLRWGSE-UHFFFAOYSA-N 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N Diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N Docetaxel Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- 229960002918 Doxorubicin Hydrochloride Drugs 0.000 description 1
- CYQFCXCEBYINGO-DLBZAZTESA-N Dronabinol Natural products C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@H]21 CYQFCXCEBYINGO-DLBZAZTESA-N 0.000 description 1
- 229950010033 Ebselen Drugs 0.000 description 1
- DYEFUKCXAQOFHX-UHFFFAOYSA-N Ebselenum Chemical compound [se]1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1 DYEFUKCXAQOFHX-UHFFFAOYSA-N 0.000 description 1
- 229950005678 Ecomustine Drugs 0.000 description 1
- 229940087477 Ellence Drugs 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 229950005450 Emitefur Drugs 0.000 description 1
- 210000003979 Eosinophils Anatomy 0.000 description 1
- QXRSDHAAWVKZLJ-TYFQHMATSA-N Epothilone B Chemical compound C/C([C@@H]1C[C@@H]2O[C@@]2(C)CCC[C@@H]([C@H]([C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)O1)O)C)=C\C1=CSC(C)=N1 QXRSDHAAWVKZLJ-TYFQHMATSA-N 0.000 description 1
- QXRSDHAAWVKZLJ-OXZHEXMSSA-N Epothilone B Natural products O=C1[C@H](C)[C@H](O)[C@@H](C)CCC[C@@]2(C)O[C@H]2C[C@@H](/C(=C\c2nc(C)sc2)/C)OC(=O)C[C@H](O)C1(C)C QXRSDHAAWVKZLJ-OXZHEXMSSA-N 0.000 description 1
- 229950009537 Epristeride Drugs 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 229960001842 Estramustine Drugs 0.000 description 1
- FRPJXPJMRWBBIH-RBRWEJTLSA-N Estramustine Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 FRPJXPJMRWBBIH-RBRWEJTLSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000206602 Eukaryota Species 0.000 description 1
- 231100000776 Exotoxin Toxicity 0.000 description 1
- 210000001723 Extracellular Space Anatomy 0.000 description 1
- 229950005096 FAZARABINE Drugs 0.000 description 1
- 102100015545 FCGR2A Human genes 0.000 description 1
- 102100015543 FCGR2B Human genes 0.000 description 1
- 102100015542 FCGR3B Human genes 0.000 description 1
- 101710003435 FCGRT Proteins 0.000 description 1
- 102100014838 FCGRT Human genes 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- 108010021468 Fc gamma receptor IIA Proteins 0.000 description 1
- 108010021472 Fc gamma receptor IIB Proteins 0.000 description 1
- 108010021470 Fc gamma receptor IIC Proteins 0.000 description 1
- 108091006004 Fc-tagged proteins Proteins 0.000 description 1
- 101700050236 Fcgr4 Proteins 0.000 description 1
- DBEPLOCGEIEOCV-WSBQPABSSA-N Finasteride Chemical compound N([C@@H]1CC2)C(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)NC(C)(C)C)[C@@]2(C)CC1 DBEPLOCGEIEOCV-WSBQPABSSA-N 0.000 description 1
- OSVMTWJCGUFAOD-KZQROQTASA-N Formestane Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1O OSVMTWJCGUFAOD-KZQROQTASA-N 0.000 description 1
- 229960002598 Fumaric acid Drugs 0.000 description 1
- 241001562173 Galerina marginata Species 0.000 description 1
- 108010089239 Gelonium multiflorum GEL protein Proteins 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- AEMOLEFTQBMNLQ-WAXACMCWSA-N Glucuronic acid Chemical class O[C@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-WAXACMCWSA-N 0.000 description 1
- 229960002989 Glutamic Acid Drugs 0.000 description 1
- BCCRXDTUTZHDEU-VKHMYHEASA-N Gly-Ser Chemical compound NCC(=O)N[C@@H](CO)C(O)=O BCCRXDTUTZHDEU-VKHMYHEASA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 108020005128 Glycosidases Proteins 0.000 description 1
- 210000002288 Golgi Apparatus Anatomy 0.000 description 1
- 210000003714 Granulocytes Anatomy 0.000 description 1
- XKMLYUALXHKNFT-UUOKFMHZSA-N Guanosine-5'-triphosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XKMLYUALXHKNFT-UUOKFMHZSA-N 0.000 description 1
- 229940093915 Gynecological Organic acids Drugs 0.000 description 1
- 101700079958 HCST Proteins 0.000 description 1
- 102100004898 HCST Human genes 0.000 description 1
- 208000006454 Hepatitis Diseases 0.000 description 1
- 208000003806 Hereditary Hemorrhagic Telangiectasia Diseases 0.000 description 1
- MPGWGYQTRSNGDD-UHFFFAOYSA-N Hypericin Chemical compound OC1=CC(O)=C(C2=O)C3=C1C1C(O)=CC(=O)C(C4=O)=C1C1=C3C3=C2C(O)=CC(C)=C3C2=C1C4=C(O)C=C2C MPGWGYQTRSNGDD-UHFFFAOYSA-N 0.000 description 1
- BTXNYTINYBABQR-UHFFFAOYSA-N Hypericin Natural products C12=C(O)C=C(O)C(C(C=3C(O)=CC(C)=C4C=33)=O)=C2C3=C2C3=C4C(C)=CC(O)=C3C(=O)C3=C(O)C=C(O)C1=C32 BTXNYTINYBABQR-UHFFFAOYSA-N 0.000 description 1
- 102100014194 IL7R Human genes 0.000 description 1
- 101710025228 IL7R Proteins 0.000 description 1
- 102100001475 ITGB2 Human genes 0.000 description 1
- 229940099279 Idamycin Drugs 0.000 description 1
- 102000004854 Immunoglobulin M Human genes 0.000 description 1
- PDWUPXJEEYOOTR-UHFFFAOYSA-N Iobenguane Chemical compound NC(=N)NCC1=CC=CC(I)=C1 PDWUPXJEEYOOTR-UHFFFAOYSA-N 0.000 description 1
- 229950000855 Iroplact Drugs 0.000 description 1
- 229940045996 Isethionic Acid Drugs 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N Isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N Isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- AWJUIBRHMBBTKR-UHFFFAOYSA-N Isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N Isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N Isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- SBUJHOSQTJFQJX-NOAMYHISSA-N Kanamycin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 1
- TYQCGQRIZGCHNB-JLAZNSOCSA-N L-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- 108010043135 L-methionine gamma-lyase Proteins 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- 101700021338 LEC Proteins 0.000 description 1
- 101700048515 LEC1 Proteins 0.000 description 1
- 101700046135 LEC2 Proteins 0.000 description 1
- 101700077545 LECC Proteins 0.000 description 1
- 101700028499 LECG Proteins 0.000 description 1
- 101700028593 LECH Proteins 0.000 description 1
- 101700063913 LECT Proteins 0.000 description 1
- ZHTRILQJTPJGNK-FYBAATNNSA-N LEINAMYCIN Chemical compound N([C@@H](C=1SC=C(N=1)\C=C/C=C/C(=O)[C@H](O)/C=C(C)/CC1)C)C(=O)C[C@@]21S(=O)SC(=O)[C@]2(C)O ZHTRILQJTPJGNK-FYBAATNNSA-N 0.000 description 1
- POCZBHBFCIWCCV-UHFFFAOYSA-N Lamellarin N Chemical compound C1=C(O)C(OC)=CC=C1C1=C2C3=CC(OC)=C(O)C=C3C=CN2C2=C1C(C=C(OC)C(O)=C1)=C1OC2=O POCZBHBFCIWCCV-UHFFFAOYSA-N 0.000 description 1
- 210000001821 Langerhans Cells Anatomy 0.000 description 1
- 229920001320 Leader sequence (mRNA) Polymers 0.000 description 1
- 229920001491 Lentinan Polymers 0.000 description 1
- 241001157060 Lepiota brunneoincarnata Species 0.000 description 1
- 208000000429 Leukemia, Lymphocytic, Chronic, B-Cell Diseases 0.000 description 1
- 229950008991 Lobaplatin Drugs 0.000 description 1
- 229950000909 Lometrexol Drugs 0.000 description 1
- WDRYRZXSPDWGEB-UHFFFAOYSA-N Lonidamine Chemical compound C12=CC=CC=C2C(C(=O)O)=NN1CC1=CC=C(Cl)C=C1Cl WDRYRZXSPDWGEB-UHFFFAOYSA-N 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 108010064548 Lymphocyte Function-Associated Antigen-1 Proteins 0.000 description 1
- 102100012644 MIF Human genes 0.000 description 1
- 229940041033 Macrolides Drugs 0.000 description 1
- WKPWGQKGSOKKOO-WLNOZUDTSA-N Maitansine Chemical compound CO[C@@H]([C@@]1(O)C[C@H](OC(=O)N1)[C@@H](C)[C@@H]1O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(C)=O)CC(=O)N1C)C=C\C=C(C)\CC2=CC(OC)=C(Cl)C1=C2 WKPWGQKGSOKKOO-WLNOZUDTSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N Malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 210000002264 Mammary Glands, Animal Anatomy 0.000 description 1
- 210000004293 Mammary Glands, Human Anatomy 0.000 description 1
- 229960003951 Masoprocol Drugs 0.000 description 1
- HCZKYJDFEPMADG-TXEJJXNPSA-N Masoprocol Chemical compound C([C@H](C)[C@H](C)CC=1C=C(O)C(O)=CC=1)C1=CC=C(O)C(O)=C1 HCZKYJDFEPMADG-TXEJJXNPSA-N 0.000 description 1
- 102000001544 Maspin Human genes 0.000 description 1
- 241001441512 Maytenus serrata Species 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N Meglumine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 1
- 206010027457 Metastases to liver Diseases 0.000 description 1
- HRHKSTOGXBBQCB-VFWICMBZSA-N Methylmitomycin Chemical compound O=C1C(N)=C(C)C(=O)C2=C1[C@@H](COC(N)=O)[C@@]1(OC)[C@H]3N(C)[C@H]3CN12 HRHKSTOGXBBQCB-VFWICMBZSA-N 0.000 description 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N Metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 1
- VKHAHZOOUSRJNA-GCNJZUOMSA-N Mifepristone Chemical compound C1([C@@H]2C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]3CC[C@@]([C@]3(C2)C)(O)C#CC)=CC=C(N(C)C)C=C1 VKHAHZOOUSRJNA-GCNJZUOMSA-N 0.000 description 1
- PQLXHQMOHUQAKB-UHFFFAOYSA-N Miltefosine Chemical compound CCCCCCCCCCCCCCCCOP([O-])(=O)OCC[N+](C)(C)C PQLXHQMOHUQAKB-UHFFFAOYSA-N 0.000 description 1
- 229960004857 Mitomycin Drugs 0.000 description 1
- 229950001745 Mitonafide Drugs 0.000 description 1
- 229960001156 Mitoxantrone Drugs 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N Mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- 229950008012 Mofarotene Drugs 0.000 description 1
- VAZLWPAHMORDGR-UHFFFAOYSA-L Motexafin gadolinium Chemical compound C1=C(OCCOCCOCCOC)C(OCCOCCOCCOC)=CC2=C1[N]1=CC3=[N]4[Gd]11(N56)(OC(=O)C)(OC(=O)C)[N]2=CC(C(C)=C2CCCO)=[N]1C2=CC6=C(CC)C(CC)=C5C=C4C(CCCO)=C3C VAZLWPAHMORDGR-UHFFFAOYSA-L 0.000 description 1
- 241001502127 Mullus barbatus Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N N-Butylamine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- NJSMWLQOCQIOPE-OCHFTUDZSA-N N-[(E)-[10-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine Chemical compound N1CCN=C1N\N=C\C(C1=CC=CC=C11)=C(C=CC=C2)C2=C1\C=N\NC1=NCCN1 NJSMWLQOCQIOPE-OCHFTUDZSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N N-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 101700080605 NUC1 Proteins 0.000 description 1
- 229960002333 Nafarelin Drugs 0.000 description 1
- 108010021717 Nafarelin Proteins 0.000 description 1
- JZGDNMXSOCDEFQ-UHFFFAOYSA-N Napavin Chemical compound C1C(CC)(O)CC(C2)CN1CCC(C1=CC=CC=C1N1)=C1C2(C(=O)OC)C(C(=C1)OC)=CC2=C1N(C)C1C2(C23)CCN3CC=CC2(CC)C(O)C1(O)C(=O)NCCNC1=CC=C(N=[N+]=[N-])C=C1[N+]([O-])=O JZGDNMXSOCDEFQ-UHFFFAOYSA-N 0.000 description 1
- 229950010676 Nartograstim Drugs 0.000 description 1
- 108010016076 Octreotide Proteins 0.000 description 1
- 229960002700 Octreotide Drugs 0.000 description 1
- 108020005187 Oligonucleotide Probes Proteins 0.000 description 1
- 229950011093 Onapristone Drugs 0.000 description 1
- 101710034340 Os04g0173800 Proteins 0.000 description 1
- 206010061328 Ovarian epithelial cancer Diseases 0.000 description 1
- UKLQXHUGTKWPSR-UHFFFAOYSA-M Oxyphenonium bromide Chemical compound [Br-].C=1C=CC=CC=1C(O)(C(=O)OCC[N+](C)(CC)CC)C1CCCCC1 UKLQXHUGTKWPSR-UHFFFAOYSA-M 0.000 description 1
- 102100012884 PF4 Human genes 0.000 description 1
- 101710014074 PF4 Proteins 0.000 description 1
- ZFYKZAKRJRNXGF-XRZRNGJYSA-N Palmitoyl rhizoxin Chemical compound O1C(=O)C2OC2CC(CC(=O)O2)CC2C(C)\C=C\C2OC2(C)C(OC(=O)CCCCCCCCCCCCCCC)CC1C(C)C(OC)C(\C)=C\C=C\C(\C)=C\C1=COC(C)=N1 ZFYKZAKRJRNXGF-XRZRNGJYSA-N 0.000 description 1
- WRUUGTRCQOWXEG-UHFFFAOYSA-N Pamidronic acid Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 1
- 229940055729 Papain Drugs 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 108010067902 Peptide Library Proteins 0.000 description 1
- WTWWXOGTJWMJHI-UHFFFAOYSA-N Perflubron Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br WTWWXOGTJWMJHI-UHFFFAOYSA-N 0.000 description 1
- 229950009351 Perfosfamide Drugs 0.000 description 1
- 210000003819 Peripheral blood mononuclear cell Anatomy 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N Phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- 229950000688 Phenothiazine Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N Phenylacetic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 229950001030 Piritrexim Drugs 0.000 description 1
- 210000002826 Placenta Anatomy 0.000 description 1
- YJGVMLPVUAXIQN-XVVDYKMHSA-N Podophyllotoxin Chemical compound COC1=C(OC)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@H](O)[C@@H]3[C@@H]2C(OC3)=O)=C1 YJGVMLPVUAXIQN-XVVDYKMHSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229950004406 Porfiromycin Drugs 0.000 description 1
- 229940037179 Potassium Ion Drugs 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N Propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 101800001295 Putative ATP-dependent helicase Proteins 0.000 description 1
- 101800001006 Putative helicase Proteins 0.000 description 1
- 210000003324 RBC Anatomy 0.000 description 1
- 108060007057 RIPPLY Proteins 0.000 description 1
- 102000009572 RNA Polymerase II Human genes 0.000 description 1
- 108010009460 RNA Polymerase II Proteins 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 206010072736 Rheumatic disease Diseases 0.000 description 1
- 206010039073 Rheumatoid arthritis Diseases 0.000 description 1
- OWPCHSCAPHNHAV-LMONGJCWSA-N Rhizoxin Chemical compound C/C([C@H](OC)[C@@H](C)[C@@H]1C[C@H](O)[C@]2(C)O[C@@H]2/C=C/[C@@H](C)[C@]2([H])OC(=O)C[C@@](C2)(C[C@@H]2O[C@H]2C(=O)O1)[H])=C\C=C\C(\C)=C\C1=COC(C)=N1 OWPCHSCAPHNHAV-LMONGJCWSA-N 0.000 description 1
- 210000003705 Ribosomes Anatomy 0.000 description 1
- 108010039491 Ricin Proteins 0.000 description 1
- 108060007040 Rilpl Proteins 0.000 description 1
- 108010005173 SERPIN-B5 Proteins 0.000 description 1
- 210000003296 Saliva Anatomy 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 230000037165 Serum Concentration Effects 0.000 description 1
- 241000446766 Shigella dysenteriae 1 Species 0.000 description 1
- 108010070144 Single-Chain Antibodies Proteins 0.000 description 1
- 102000005632 Single-Chain Antibodies Human genes 0.000 description 1
- 210000003491 Skin Anatomy 0.000 description 1
- JXKPEJDQGNYQSM-UHFFFAOYSA-M Sodium propionate Chemical compound [Na+].CCC([O-])=O JXKPEJDQGNYQSM-UHFFFAOYSA-M 0.000 description 1
- 229950004225 Sonermin Drugs 0.000 description 1
- 229950006050 Spiromustine Drugs 0.000 description 1
- 229960005137 Succinic Acid Drugs 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N Sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 108010092262 T-Cell Antigen Receptors Proteins 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N THP Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 102100008333 THY1 Human genes 0.000 description 1
- 101700026084 THY1 Proteins 0.000 description 1
- 102100003084 TNFSF9 Human genes 0.000 description 1
- 108060008723 TYROBP Proteins 0.000 description 1
- 102100008188 TYROBP Human genes 0.000 description 1
- 229940033123 Tannic Acid Drugs 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N Tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temodal Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 1
- 229960001278 Teniposide Drugs 0.000 description 1
- 241000270666 Testudines Species 0.000 description 1
- 229940033529 Tetrahydrocannabinol Drugs 0.000 description 1
- 229920000401 Three prime untranslated region Polymers 0.000 description 1
- UCFGDBYHRUNTLO-QHCPKHFHSA-N Topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 1
- 238000008050 Total Bilirubin Reagent Methods 0.000 description 1
- PVNIQBQSYATKKL-UHFFFAOYSA-N Tripalmitin Chemical compound CCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC PVNIQBQSYATKKL-UHFFFAOYSA-N 0.000 description 1
- 229940035504 Tromethamine Drugs 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 102000003298 Tumor Necrosis Factor Receptors Human genes 0.000 description 1
- 108060008683 Tumor Necrosis Factor Receptors Proteins 0.000 description 1
- 102100015905 UCHL1 Human genes 0.000 description 1
- 101700013385 UCHL1 Proteins 0.000 description 1
- 210000002700 Urine Anatomy 0.000 description 1
- 229950000302 Vadastuximab Drugs 0.000 description 1
- HSRXSKHRSXRCFC-WDSKDSINSA-N Val-Ala Chemical compound CC(C)[C@H](N)C(=O)N[C@@H](C)C(O)=O HSRXSKHRSXRCFC-WDSKDSINSA-N 0.000 description 1
- JKHXYJKMNSSFFL-IUCAKERBSA-N Val-Lys Chemical compound CC(C)[C@H](N)C(=O)N[C@H](C(O)=O)CCCCN JKHXYJKMNSSFFL-IUCAKERBSA-N 0.000 description 1
- 210000003501 Vero Cells Anatomy 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 241000863480 Vinca Species 0.000 description 1
- 229960004528 Vincristine Drugs 0.000 description 1
- 229960002110 Vincristine Sulfate Drugs 0.000 description 1
- AQTQHPDCURKLKT-PNYVAJAMSA-N Vincristine sulfate Chemical compound OS(O)(=O)=O.C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 AQTQHPDCURKLKT-PNYVAJAMSA-N 0.000 description 1
- XLMPPFTZALNBFS-INIZCTEOSA-N Vorozole Chemical compound C1([C@@H](C2=CC=C3N=NN(C3=C2)C)N2N=CN=C2)=CC=C(Cl)C=C1 XLMPPFTZALNBFS-INIZCTEOSA-N 0.000 description 1
- 108010034652 YAML568 monoclonal antibody Proteins 0.000 description 1
- 229950003017 Zeniplatin Drugs 0.000 description 1
- ZZWKZQDOSJAGGF-BVTJJHQYSA-N [(1S,2Z,7S,10Z,12R,13R,15S)-12-hydroxy-7-methyl-9-oxo-8-oxabicyclo[11.3.0]hexadeca-2,10-dien-15-yl] 2-(dimethylamino)acetate Chemical compound O[C@@H]1\C=C/C(=O)O[C@@H](C)CCC\C=C/[C@@H]2C[C@H](OC(=O)CN(C)C)C[C@H]21 ZZWKZQDOSJAGGF-BVTJJHQYSA-N 0.000 description 1
- NRAUADCLPJTGSF-ZPGVOIKOSA-N [(2R,3S,4R,5R,6R)-6-[[(3aS,7R,7aS)-7-hydroxy-4-oxo-1,3a,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-yl]amino]-5-[[(3S)-3,6-diaminohexanoyl]amino]-4-hydroxy-2-(hydroxymethyl)oxan-3-yl] carbamate Chemical compound NCCC[C@H](N)CC(=O)N[C@@H]1[C@@H](O)[C@H](OC(N)=O)[C@@H](CO)O[C@H]1\N=C/1N[C@H](C(=O)NC[C@H]2O)[C@@H]2N\1 NRAUADCLPJTGSF-ZPGVOIKOSA-N 0.000 description 1
- PQNNIEWMPIULRS-SUTYWZMXSA-N [(8E,10E,12E)-7-hydroxy-6-methyl-2-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)tetradeca-8,10,12-trien-5-yl] dihydrogen phosphate Chemical compound C\C=C\C=C\C=C\C(O)C(C)C(OP(O)(O)=O)CCC(C)C1OC(=O)C=CC1C PQNNIEWMPIULRS-SUTYWZMXSA-N 0.000 description 1
- IFJUINDAXYAPTO-UUBSBJJBSA-N [(8R,9S,13S,14S,17S)-17-[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate Chemical compound C([C@@H]1[C@@H](C2=CC=3)CC[C@]4([C@H]1CC[C@@H]4OC(=O)COC(=O)CCCC=1C=CC(=CC=1)N(CCCl)CCCl)C)CC2=CC=3OC(=O)C1=CC=CC=C1 IFJUINDAXYAPTO-UUBSBJJBSA-N 0.000 description 1
- XSMVECZRZBFTIZ-UHFFFAOYSA-M [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) Chemical compound [Pt+4].CC([O-])C([O-])=O.NCC1CCC1CN XSMVECZRZBFTIZ-UHFFFAOYSA-M 0.000 description 1
- OCOKWVBYZHBHLU-UHFFFAOYSA-N [4-[2-[4-(2-methylpropoxycarbonyloxymethyl)-3,5-dioxopiperazin-1-yl]ethyl]-2,6-dioxopiperazin-1-yl]methyl 2-methylpropyl carbonate Chemical compound C1C(=O)N(COC(=O)OCC(C)C)C(=O)CN1CCN1CC(=O)N(COC(=O)OCC(C)C)C(=O)C1 OCOKWVBYZHBHLU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 1
- 239000000910 agglutinin Substances 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 201000010000 agranulocytosis Diseases 0.000 description 1
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229960005310 aldesleukin Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 229960001694 anagrelide Drugs 0.000 description 1
- 229960002932 anastrozole Drugs 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 229940121369 angiogenesis inhibitors Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 230000003042 antagnostic Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000003817 anthracycline antibiotic agent Substances 0.000 description 1
- 230000001833 anti-estrogenic Effects 0.000 description 1
- 230000000843 anti-fungal Effects 0.000 description 1
- 230000003409 anti-rejection Effects 0.000 description 1
- 230000001065 anti-restriction Effects 0.000 description 1
- 229940045698 antineoplastic Taxanes Drugs 0.000 description 1
- 239000003972 antineoplastic antibiotic Substances 0.000 description 1
- 239000000074 antisense oligonucleotide Substances 0.000 description 1
- 230000001640 apoptogenic Effects 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000009582 asparagine Nutrition 0.000 description 1
- 229910052789 astatine Inorganic materials 0.000 description 1
- 229950011088 asulacrine Drugs 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 108010093000 axinastatin 2 Proteins 0.000 description 1
- 108010092978 axinastatin 3 Proteins 0.000 description 1
- OPWOOOGFNULJAQ-UHFFFAOYSA-L azane;cyclopentanamine;2-hydroxybutanedioate;platinum(2+) Chemical compound N.[Pt+2].NC1CCCC1.[O-]C(=O)C(O)CC([O-])=O OPWOOOGFNULJAQ-UHFFFAOYSA-L 0.000 description 1
- 229930014667 baccatin III Natural products 0.000 description 1
- 238000002819 bacterial display Methods 0.000 description 1
- 239000000688 bacterial toxin Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- LKJPYSCBVHEWIU-KRWDZBQOSA-N bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 1
- 229960000997 bicalutamide Drugs 0.000 description 1
- 229950008548 bisantrene Drugs 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 239000012503 blood component Substances 0.000 description 1
- MPBVHIBUJCELCL-UHFFFAOYSA-N bondronat Chemical compound CCCCCN(C)CCC(O)(P(O)(O)=O)P(O)(O)=O MPBVHIBUJCELCL-UHFFFAOYSA-N 0.000 description 1
- 201000006491 bone marrow cancer Diseases 0.000 description 1
- 210000002798 bone marrow cell Anatomy 0.000 description 1
- 235000008984 brauner Senf Nutrition 0.000 description 1
- 244000275904 brauner Senf Species 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229960004649 calcipotriene Drugs 0.000 description 1
- 229960002882 calcipotriol Drugs 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- LSUTUUOITDQYNO-UHFFFAOYSA-N calphostin C Chemical compound C=12C3=C4C(CC(C)OC(=O)C=5C=CC=CC=5)=C(OC)C(O)=C(C(C=C5OC)=O)C4=C5C=1C(OC)=CC(=O)C2=C(O)C(OC)=C3CC(C)OC(=O)OC1=CC=C(O)C=C1 LSUTUUOITDQYNO-UHFFFAOYSA-N 0.000 description 1
- 229930007890 camphor Natural products 0.000 description 1
- 230000000711 cancerogenic Effects 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 229930016259 castanospermine Natural products 0.000 description 1
- 230000024881 catalytic activity Effects 0.000 description 1
- 230000020411 cell activation Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 230000036755 cellular response Effects 0.000 description 1
- 201000010881 cervical cancer Diseases 0.000 description 1
- 229960003230 cetrorelix Drugs 0.000 description 1
- SBNPWPIBESPSIF-MHWMIDJBSA-N cetrorelix Chemical compound C([C@@H](C(=O)N[C@H](CCCNC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)C1=CC=C(O)C=C1 SBNPWPIBESPSIF-MHWMIDJBSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000004035 chlorins Chemical class 0.000 description 1
- CRBHXDCYXIISFC-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CC[O-] CRBHXDCYXIISFC-UHFFFAOYSA-N 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 101700067277 chxA Proteins 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- VNFPBHJOKIVQEB-UHFFFAOYSA-N clotrimazole Chemical compound ClC1=CC=CC=C1C(N1C=NC=C1)(C=1C=CC=CC=1)C1=CC=CC=C1 VNFPBHJOKIVQEB-UHFFFAOYSA-N 0.000 description 1
- 229960004022 clotrimazole Drugs 0.000 description 1
- 150000004814 combretastatins Chemical class 0.000 description 1
- 108010047295 complement receptors Proteins 0.000 description 1
- 102000006834 complement receptors Human genes 0.000 description 1
- 230000004154 complement system Effects 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 108010006226 cryptophycin Proteins 0.000 description 1
- 108010090203 cryptophycin 8 Proteins 0.000 description 1
- 238000010192 crystallographic characterization Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DABYZUWMLUGAGP-UHFFFAOYSA-N cyclopentene Chemical group [CH]1CC=CC1 DABYZUWMLUGAGP-UHFFFAOYSA-N 0.000 description 1
- NRADQUVNXZVPHN-UHFFFAOYSA-N cyclopentene Chemical group C1C[C]=CC1 NRADQUVNXZVPHN-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 231100000050 cytotoxic potential Toxicity 0.000 description 1
- 238000002784 cytotoxicity assay Methods 0.000 description 1
- 231100000263 cytotoxicity test Toxicity 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 229960003603 decitabine Drugs 0.000 description 1
- CYQFCXCEBYINGO-IAGOWNOFSA-N delta1-THC Chemical compound C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@@H]21 CYQFCXCEBYINGO-IAGOWNOFSA-N 0.000 description 1
- 230000027832 depurination Effects 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 229960005408 deslorelin Drugs 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000001809 detectable Effects 0.000 description 1
- SGTNSNPWRIOYBX-HHHXNRCGSA-N dexverapamil Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCC[C@@](C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-HHHXNRCGSA-N 0.000 description 1
- 229950002389 diaziquone Drugs 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 230000003292 diminished Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- UWLPCYBIJSLGQO-UHFFFAOYSA-N dodecanoic acid;propane-1,2,3-triol Chemical compound OCC(O)CO.CCCCCCCCCCCC(O)=O UWLPCYBIJSLGQO-UHFFFAOYSA-N 0.000 description 1
- 229960004242 dronabinol Drugs 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002255 enzymatic Effects 0.000 description 1
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 1
- 229930013349 epothilone B Natural products 0.000 description 1
- 150000003883 epothilone derivatives Chemical class 0.000 description 1
- 230000001586 eradicative Effects 0.000 description 1
- 239000003797 essential amino acid Substances 0.000 description 1
- 235000020776 essential amino acid Nutrition 0.000 description 1
- 239000000328 estrogen antagonist Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N ethanolamine Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- XPGDODOEEWLHOI-GSDHBNRESA-N ethyl (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-fluorophenyl)propanoyl]amino]-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)OCC)NC(=O)[C@@H](N)CC=1C=CC(F)=CC=1)C1=CC=CC(N(CCCl)CCCl)=C1 XPGDODOEEWLHOI-GSDHBNRESA-N 0.000 description 1
- WVYXNIXAMZOZFK-UHFFFAOYSA-N ethyl N-[2,5-bis(aziridin-1-yl)-4-(ethoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]carbamate Chemical compound O=C1C(NC(=O)OCC)=C(N2CC2)C(=O)C(NC(=O)OCC)=C1N1CC1 WVYXNIXAMZOZFK-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N ethyl amine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 229960000255 exemestane Drugs 0.000 description 1
- 230000001747 exhibiting Effects 0.000 description 1
- 239000002095 exotoxin Substances 0.000 description 1
- 230000001605 fetal Effects 0.000 description 1
- 229960004039 finasteride Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229960004421 formestane Drugs 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N furane Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229940044658 gallium nitrate Drugs 0.000 description 1
- 210000004475 gamma-delta T lymphocyte Anatomy 0.000 description 1
- 210000004602 germ cell Anatomy 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 150000002306 glutamic acid derivatives Chemical class 0.000 description 1
- 230000003899 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 108010062266 glycyl-glycyl-argininal Proteins 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 150000002374 hemiaminals Chemical class 0.000 description 1
- 231100000283 hepatitis Toxicity 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000000710 homodimer Substances 0.000 description 1
- KLGZELKXQMTEMM-UHFFFAOYSA-N hydride Chemical compound [H-] KLGZELKXQMTEMM-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229940005608 hypericin Drugs 0.000 description 1
- 230000003463 hyperproliferative Effects 0.000 description 1
- 229960005236 ibandronic acid Drugs 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000003119 immunoblot Methods 0.000 description 1
- 230000002163 immunogen Effects 0.000 description 1
- 238000001114 immunoprecipitation Methods 0.000 description 1
- 230000001506 immunosuppresive Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 230000016507 interphase Effects 0.000 description 1
- 229960003795 iobenguane (123I) Drugs 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000004936 isatinoyl group Chemical group N1(C(=O)C(=O)C2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 230000000155 isotopic Effects 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 229960000318 kanamycin Drugs 0.000 description 1
- 108010021336 lanreotide Proteins 0.000 description 1
- 229960002437 lanreotide Drugs 0.000 description 1
- 101700036391 lecA Proteins 0.000 description 1
- 229940115286 lentinan Drugs 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 229960003538 lonidamine Drugs 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 238000002824 mRNA display Methods 0.000 description 1
- 239000003120 macrolide antibiotic agent Substances 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 201000011614 malignant glioma Diseases 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000003771 matrix metalloproteinase inhibitor Substances 0.000 description 1
- 229940121386 matrix metalloproteinase inhibitors Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 210000003071 memory T lymphocyte Anatomy 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- DJGAAPFSPWAYTJ-UHFFFAOYSA-M metamizole sodium Chemical compound [Na+].O=C1C(N(CS([O-])(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 DJGAAPFSPWAYTJ-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- GIYXAJPCNFJEHY-UHFFFAOYSA-N methyl-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]azanium;chloride Chemical compound Cl.C=1C=CC=CC=1C(CCNC)OC1=CC=C(C(F)(F)F)C=C1 GIYXAJPCNFJEHY-UHFFFAOYSA-N 0.000 description 1
- 229960004503 metoclopramide Drugs 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 230000008880 microtubule cytoskeleton organization Effects 0.000 description 1
- BMGQWWVMWDBQGC-IIFHNQTCSA-N midostaurin Chemical compound CN([C@H]1[C@H]([C@]2(C)O[C@@H](N3C4=CC=CC=C4C4=C5C(=O)NCC5=C5C6=CC=CC=C6N2C5=C43)C1)OC)C(=O)C1=CC=CC=C1 BMGQWWVMWDBQGC-IIFHNQTCSA-N 0.000 description 1
- 229960003248 mifepristone Drugs 0.000 description 1
- 229960003775 miltefosine Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000035773 mitosis phase Effects 0.000 description 1
- 230000000394 mitotic Effects 0.000 description 1
- 238000000302 molecular modelling Methods 0.000 description 1
- 229960003063 molgramostim Drugs 0.000 description 1
- 108010032806 molgramostim Proteins 0.000 description 1
- 230000001002 morphogenetic Effects 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- BSOQXXWZTUDTEL-ZUYCGGNHSA-N muramyl dipeptide Chemical compound OC(=O)CC[C@H](C(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O)[C@@H]1NC(C)=O BSOQXXWZTUDTEL-ZUYCGGNHSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 108010032539 nartograstim Proteins 0.000 description 1
- 239000005445 natural product Substances 0.000 description 1
- 229930014626 natural products Natural products 0.000 description 1
- 230000035407 negative regulation of cell proliferation Effects 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000002829 nitrogen Chemical group 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100001083 no cytotoxicity Toxicity 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 101700006494 nucA Proteins 0.000 description 1
- 230000030147 nuclear export Effects 0.000 description 1
- 238000001668 nucleic acid synthesis Methods 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- 239000002751 oligonucleotide probe Substances 0.000 description 1
- 229920001542 oligosaccharide Polymers 0.000 description 1
- 150000002482 oligosaccharides Polymers 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 201000006588 ovary adenocarcinoma Diseases 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229960003978 pamidronic acid Drugs 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 229960001217 perflubron Drugs 0.000 description 1
- 230000002093 peripheral Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 210000001539 phagocyte Anatomy 0.000 description 1
- 230000000275 pharmacokinetic Effects 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229960001221 pirarubicin Drugs 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- 229960001237 podophyllotoxin Drugs 0.000 description 1
- 229930001140 podophyllotoxin Natural products 0.000 description 1
- 230000001402 polyadenylating Effects 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating Effects 0.000 description 1
- 230000000770 pro-inflamatory Effects 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrugs Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 210000001236 prokaryotic cell Anatomy 0.000 description 1
- 230000002062 proliferating Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000002818 protein evolution Methods 0.000 description 1
- 239000000007 protein synthesis inhibitor Substances 0.000 description 1
- 201000004681 psoriasis Diseases 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 230000005180 public health Effects 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000004944 pyrazin-3-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000004941 pyridazin-5-yl group Chemical group N1=NC=CC(=C1)* 0.000 description 1
- 125000004942 pyridazin-6-yl group Chemical group N1=NC=CC=C1* 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000002285 radioactive Effects 0.000 description 1
- 230000010837 receptor-mediated endocytosis Effects 0.000 description 1
- 238000010188 recombinant method Methods 0.000 description 1
- 239000003638 reducing agent Substances 0.000 description 1
- 230000001105 regulatory Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 238000002702 ribosome display Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000003248 secreting Effects 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000003530 single readout Methods 0.000 description 1
- 230000003007 single stranded DNA break Effects 0.000 description 1
- 101710044770 sll1951 Proteins 0.000 description 1
- 229950010372 sobuzoxane Drugs 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical class NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229960001663 sulfanilamide Drugs 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N sulfonic acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 201000010874 syndrome Diseases 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 229960004964 temozolomide Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- ZCTJIMXXSXQXRI-KYJUHHDHSA-N thalicarpine Chemical compound CN1CCC2=CC(OC)=C(OC)C3=C2[C@@H]1CC1=C3C=C(OC)C(OC2=C(C[C@H]3C4=CC(OC)=C(OC)C=C4CCN3C)C=C(C(=C2)OC)OC)=C1 ZCTJIMXXSXQXRI-KYJUHHDHSA-N 0.000 description 1
- 125000004927 thianaphthalenyl group Chemical group S1C(C=CC2=CC=CC=C12)* 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 108010078373 tisagenlecleucel Proteins 0.000 description 1
- 229950007137 tisagenlecleucel Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 230000000699 topical Effects 0.000 description 1
- 229960000303 topotecan Drugs 0.000 description 1
- 230000002588 toxic Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 230000001960 triggered Effects 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 201000006704 ulcerative colitis Diseases 0.000 description 1
- 108010073969 valyllysine Proteins 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229960001771 vorozole Drugs 0.000 description 1
- 239000011534 wash buffer Substances 0.000 description 1
- AIFRHYZBTHREPW-UHFFFAOYSA-N β-carboline Chemical compound N1=CC=C2C3=CC=CC=C3NC2=C1 AIFRHYZBTHREPW-UHFFFAOYSA-N 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Images
Applications Claiming Priority (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201962789462P | 2019-01-07 | 2019-01-07 | |
US62/789,462 | 2019-01-07 | ||
US201962845829P | 2019-05-09 | 2019-05-09 | |
US62/845,829 | 2019-05-09 | ||
PCT/US2020/012637 WO2020146432A1 (en) | 2019-01-07 | 2020-01-07 | Use of an anti-cd45 antibody drug conjugate (adc) in cell therapy |
Publications (2)
Publication Number | Publication Date |
---|---|
JP2022518150A JP2022518150A (ja) | 2022-03-14 |
JPWO2020146432A5 true JPWO2020146432A5 (pt) | 2023-01-19 |
Family
ID=71520485
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2021539400A Pending JP2022518150A (ja) | 2019-01-07 | 2020-01-07 | 細胞療法での抗cd45抗体-薬物結合体(adc)の使用経験 |
Country Status (7)
Country | Link |
---|---|
US (1) | US20220062339A1 (pt) |
EP (1) | EP3908296A4 (pt) |
JP (1) | JP2022518150A (pt) |
CN (1) | CN113490504A (pt) |
AU (1) | AU2020206117A1 (pt) |
CA (1) | CA3125751A1 (pt) |
WO (1) | WO2020146432A1 (pt) |
Families Citing this family (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2022040088A2 (en) * | 2020-08-21 | 2022-02-24 | Synthekine, Inc. | Cd45 binding molecules and methods of use |
GB202015235D0 (en) | 2020-09-25 | 2020-11-11 | Ucl Business Plc | Anti-CD45 antibodies and related therapeutics |
GB202015226D0 (en) | 2020-09-25 | 2020-11-11 | Adc Therapeutics S A | Pyrrol obenzodiazepine-antibody conugates and uses thereof |
Family Cites Families (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP4249916A3 (en) * | 2015-04-06 | 2023-11-01 | President and Fellows of Harvard College | Compositions and methods for non-myeloablative conditioning |
EP3307282A4 (en) * | 2015-06-12 | 2019-05-01 | Immunomedics, Inc. | TREATMENT OF DISEASES WITH CHIMERIC ANTIGEN RECEPTOR (CAR) AND T-CELL (T-CAR) OR NK (CAR-NK) CELL EXPRESSION CONSTRUCTIONS CAR CONSTRUCTIONS |
KR20230082055A (ko) * | 2016-06-17 | 2023-06-08 | 마젠타 테라퓨틱스 인코포레이티드 | 세포의 고갈을 위한 조성물 및 방법 |
-
2020
- 2020-01-07 JP JP2021539400A patent/JP2022518150A/ja active Pending
- 2020-01-07 CA CA3125751A patent/CA3125751A1/en active Pending
- 2020-01-07 EP EP20739127.7A patent/EP3908296A4/en active Pending
- 2020-01-07 WO PCT/US2020/012637 patent/WO2020146432A1/en unknown
- 2020-01-07 AU AU2020206117A patent/AU2020206117A1/en active Pending
- 2020-01-07 CN CN202080017259.0A patent/CN113490504A/zh active Pending
-
2021
- 2021-07-06 US US17/368,815 patent/US20220062339A1/en active Pending
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US20200255523A1 (en) | Fc silenced antibody drug conjugates (adcs) and uses thereof | |
AU2018354189A1 (en) | Compositions and methods for the depletion of CD117+ cells | |
US20210371524A1 (en) | Anti-cd45 antibodies and conjugates thereof | |
US20220062339A1 (en) | Use of an anti-cd45 antibody drug conjugate (adc) in cell therapy | |
KR20210086683A (ko) | 동종이형 조혈 줄기 세포 이식 방법 | |
CN114174317A (zh) | 鹅膏毒素抗体-药物缀合物及其用途 | |
US20240075157A1 (en) | Fc silenced antibody drug conjugates (adcs) and uses thereof | |
JP2021530545A (ja) | 同種異系の細胞療法における抗−cd2抗体薬物コンジュゲート(adc)の使用 | |
JP2021532116A (ja) | 同種異系の細胞療法における抗−cd5抗体薬物コンジュゲート(adc)の使用 | |
TW202132339A (zh) | 抗cd45抗體及其結合物 | |
US20210228696A1 (en) | Use of anti-cd137 antibody drug conjugate (adc) in allogeneic cell therapy | |
JPWO2020146432A5 (pt) | ||
JPWO2020092654A5 (pt) | ||
US20220273811A1 (en) | Methods and compositions for treating autoimmune diseases | |
CA3168039A1 (en) | Compositions and methods for allogeneic transplantation | |
JPWO2020219748A5 (pt) | ||
JPWO2021087368A5 (pt) | ||
JPWO2020219770A5 (pt) |