JPS6255627B2 - - Google Patents
Info
- Publication number
- JPS6255627B2 JPS6255627B2 JP54081982A JP8198279A JPS6255627B2 JP S6255627 B2 JPS6255627 B2 JP S6255627B2 JP 54081982 A JP54081982 A JP 54081982A JP 8198279 A JP8198279 A JP 8198279A JP S6255627 B2 JPS6255627 B2 JP S6255627B2
- Authority
- JP
- Japan
- Prior art keywords
- composition
- pertechnetate
- acid
- reducing agent
- hydroquinone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 79
- 239000000203 mixture Substances 0.000 claims description 61
- 239000003795 chemical substances by application Substances 0.000 claims description 59
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 50
- 239000002253 acid Substances 0.000 claims description 45
- 150000003839 salts Chemical class 0.000 claims description 40
- 239000003381 stabilizer Substances 0.000 claims description 40
- 239000003638 chemical reducing agent Substances 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 32
- 239000000243 solution Substances 0.000 claims description 30
- 210000000056 organ Anatomy 0.000 claims description 21
- 229910052713 technetium Inorganic materials 0.000 claims description 18
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 13
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 claims description 10
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical group OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 claims description 10
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 10
- 230000002285 radioactive effect Effects 0.000 claims description 10
- 235000011150 stannous chloride Nutrition 0.000 claims description 10
- 239000001119 stannous chloride Substances 0.000 claims description 10
- 239000004615 ingredient Substances 0.000 claims description 9
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 claims description 8
- GKLVYJBZJHMRIY-OUBTZVSYSA-N Technetium-99 Chemical compound [99Tc] GKLVYJBZJHMRIY-OUBTZVSYSA-N 0.000 claims description 7
- 159000000000 sodium salts Chemical group 0.000 claims description 7
- 230000000087 stabilizing effect Effects 0.000 claims description 7
- 229940056501 technetium 99m Drugs 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 claims description 5
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 4
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical compound OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 claims description 4
- ACSIXWWBWUQEHA-UHFFFAOYSA-N clodronic acid Chemical compound OP(O)(=O)C(Cl)(Cl)P(O)(O)=O ACSIXWWBWUQEHA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052816 inorganic phosphate Inorganic materials 0.000 claims description 3
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 claims description 2
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 claims description 2
- 229940109126 chromous chloride Drugs 0.000 claims description 2
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000011790 ferrous sulphate Substances 0.000 claims description 2
- 235000003891 ferrous sulphate Nutrition 0.000 claims description 2
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical group [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 claims 1
- 229940048086 sodium pyrophosphate Drugs 0.000 claims 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 claims 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims 1
- 239000010936 titanium Substances 0.000 claims 1
- 229910052719 titanium Inorganic materials 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 21
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 20
- 210000000988 bone and bone Anatomy 0.000 description 18
- -1 quinone compound Chemical class 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 9
- 229910052700 potassium Inorganic materials 0.000 description 9
- 239000011591 potassium Substances 0.000 description 9
- 238000007254 oxidation reaction Methods 0.000 description 8
- 230000003647 oxidation Effects 0.000 description 7
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 5
- 235000011180 diphosphates Nutrition 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 210000004872 soft tissue Anatomy 0.000 description 5
- 241000894007 species Species 0.000 description 5
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 238000010253 intravenous injection Methods 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 235000011167 hydrochloric acid Nutrition 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000004053 quinones Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RHWUIRMVPYNGIV-UHFFFAOYSA-N 1,3,4-triphosphonobutan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O RHWUIRMVPYNGIV-UHFFFAOYSA-N 0.000 description 2
- SXGRAKNNKBAFML-UHFFFAOYSA-N 1,3-diphosphonopropan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)CP(O)(O)=O SXGRAKNNKBAFML-UHFFFAOYSA-N 0.000 description 2
- LJHKZAQSNTWOLY-UHFFFAOYSA-N 1-[bis(1-phosphonopentyl)amino]pentylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)N(C(CCCC)P(O)(O)=O)C(CCCC)P(O)(O)=O LJHKZAQSNTWOLY-UHFFFAOYSA-N 0.000 description 2
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 229940072107 ascorbate Drugs 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical class N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 2
- 238000007469 bone scintigraphy Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229940039227 diagnostic agent Drugs 0.000 description 2
- 239000000032 diagnostic agent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 230000003902 lesion Effects 0.000 description 2
- 239000008176 lyophilized powder Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical class OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000003608 radiolysis reaction Methods 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 230000008685 targeting Effects 0.000 description 2
- ZWVMLYRJXORSEP-LURJTMIESA-N (2s)-hexane-1,2,6-triol Chemical compound OCCCC[C@H](O)CO ZWVMLYRJXORSEP-LURJTMIESA-N 0.000 description 1
- SGEIJOYKWVBLCO-UHFFFAOYSA-N (3,3,4,4,5,5,6,6-octafluoro-2-phosphonocyclohexen-1-yl)phosphonic acid Chemical compound OP(O)(=O)C1=C(P(O)(O)=O)C(F)(F)C(F)(F)C(F)(F)C1(F)F SGEIJOYKWVBLCO-UHFFFAOYSA-N 0.000 description 1
- DFTADKFLALRADR-UHFFFAOYSA-N (3,3,4,4,5,5-hexafluoro-2-phosphonocyclopenten-1-yl)phosphonic acid Chemical compound OP(O)(=O)C1=C(P(O)(O)=O)C(F)(F)C(F)(F)C1(F)F DFTADKFLALRADR-UHFFFAOYSA-N 0.000 description 1
- ZXSGWIQMDUZFAW-UHFFFAOYSA-N (3,3,4,4-tetrafluoro-2-phosphonocyclobuten-1-yl)phosphonic acid Chemical compound OP(O)(=O)C1=C(P(O)(O)=O)C(F)(F)C1(F)F ZXSGWIQMDUZFAW-UHFFFAOYSA-N 0.000 description 1
- HQKLCKVZNONSNP-UHFFFAOYSA-N (3-phenyl-1-phosphonoprop-2-enyl)phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)C=CC1=CC=CC=C1 HQKLCKVZNONSNP-UHFFFAOYSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- TXIYCOOGLDUYCA-UHFFFAOYSA-N 1,2,3,4,6,7,8,9-octaphosphonononan-5-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O TXIYCOOGLDUYCA-UHFFFAOYSA-N 0.000 description 1
- CCSPRGDNSSMNIH-UHFFFAOYSA-N 1,2,4,5,6-pentaphosphonohexan-3-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O CCSPRGDNSSMNIH-UHFFFAOYSA-N 0.000 description 1
- UWOPXOPPISBKGY-UHFFFAOYSA-N 1,2,4,5-tetraphosphonopentan-3-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O UWOPXOPPISBKGY-UHFFFAOYSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- YVPHSTVRTGSOSK-UHFFFAOYSA-N 1,3,3-triphosphonopropylphosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)CC(P(O)(O)=O)P(O)(O)=O YVPHSTVRTGSOSK-UHFFFAOYSA-N 0.000 description 1
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- JEZUNPWQNIOAAC-UHFFFAOYSA-N 1-[bis(1-phosphonoethyl)amino]ethylphosphonic acid Chemical compound OP(=O)(O)C(C)N(C(C)P(O)(O)=O)C(C)P(O)(O)=O JEZUNPWQNIOAAC-UHFFFAOYSA-N 0.000 description 1
- KUYBGCRIZFABHO-UHFFFAOYSA-N 1-[bis(phosphonomethyl)amino]ethylphosphonic acid Chemical compound OP(=O)(O)C(C)N(CP(O)(O)=O)CP(O)(O)=O KUYBGCRIZFABHO-UHFFFAOYSA-N 0.000 description 1
- HFDKJNXFZSYGLU-UHFFFAOYSA-N 1-phosphonododecylphosphonic acid Chemical compound CCCCCCCCCCCC(P(O)(O)=O)P(O)(O)=O HFDKJNXFZSYGLU-UHFFFAOYSA-N 0.000 description 1
- CCBUTSCPNFSHKC-UHFFFAOYSA-N 1-phosphonohexadecylphosphonic acid Chemical compound CCCCCCCCCCCCCCCC(P(O)(O)=O)P(O)(O)=O CCBUTSCPNFSHKC-UHFFFAOYSA-N 0.000 description 1
- OZKFUXZUWPRXHB-UHFFFAOYSA-N 1-phosphonononylphosphonic acid Chemical compound CCCCCCCCC(P(O)(O)=O)P(O)(O)=O OZKFUXZUWPRXHB-UHFFFAOYSA-N 0.000 description 1
- ROKLPPRTPHAGFK-UHFFFAOYSA-N 1-phosphonooctylphosphonic acid Chemical compound CCCCCCCC(P(O)(O)=O)P(O)(O)=O ROKLPPRTPHAGFK-UHFFFAOYSA-N 0.000 description 1
- IRYOZLKMXHUGKP-UHFFFAOYSA-N 1-phosphonopentylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)P(O)(O)=O IRYOZLKMXHUGKP-UHFFFAOYSA-N 0.000 description 1
- VUITVRLCDCMTNK-UHFFFAOYSA-N 2-[bis(2-phosphonopropan-2-yl)amino]propan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)N(C(C)(C)P(O)(O)=O)C(C)(C)P(O)(O)=O VUITVRLCDCMTNK-UHFFFAOYSA-N 0.000 description 1
- CXXHAWBRXRFSFA-UHFFFAOYSA-N 2-[bis(phosphonomethyl)amino]hexan-2-ylphosphonic acid Chemical compound CCCCC(C)(P(O)(O)=O)N(CP(O)(O)=O)CP(O)(O)=O CXXHAWBRXRFSFA-UHFFFAOYSA-N 0.000 description 1
- QENHYFFLZQXXCB-UHFFFAOYSA-N 2-[bis(phosphonomethyl)amino]propan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)N(CP(O)(O)=O)CP(O)(O)=O QENHYFFLZQXXCB-UHFFFAOYSA-N 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- HSVLGQVUNHEEGH-UHFFFAOYSA-N 2-phosphonopentan-2-ylphosphonic acid Chemical compound CCCC(C)(P(O)(O)=O)P(O)(O)=O HSVLGQVUNHEEGH-UHFFFAOYSA-N 0.000 description 1
- ROPQINLWRARCTM-UHFFFAOYSA-N 2-phosphonopropan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)P(O)(O)=O ROPQINLWRARCTM-UHFFFAOYSA-N 0.000 description 1
- RBJBFHZUIPIEJX-UHFFFAOYSA-N 5-phosphonononan-5-ylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)(P(O)(O)=O)CCCC RBJBFHZUIPIEJX-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 101100025412 Arabidopsis thaliana XI-A gene Proteins 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- RKJNORHZFBIKKY-UHFFFAOYSA-N C.OOP(=O)OP(O)=O Chemical compound C.OOP(=O)OP(O)=O RKJNORHZFBIKKY-UHFFFAOYSA-N 0.000 description 1
- FOLKCBRADAKWQI-UHFFFAOYSA-N CNC(C)=O.OP(=O)OP(O)=O Chemical compound CNC(C)=O.OP(=O)OP(O)=O FOLKCBRADAKWQI-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HWZUDASOMGNLSM-UHFFFAOYSA-N O=P1OCOP(=O)O1 Chemical compound O=P1OCOP(=O)O1 HWZUDASOMGNLSM-UHFFFAOYSA-N 0.000 description 1
- NVCBLOZVMWSNST-UHFFFAOYSA-N OP(=O)OP(O)=O.CNC1=CC=CC=C1 Chemical compound OP(=O)OP(O)=O.CNC1=CC=CC=C1 NVCBLOZVMWSNST-UHFFFAOYSA-N 0.000 description 1
- QPCMSEVGGYOTQK-UHFFFAOYSA-N P(=O)(O)OP(=O)O.OCO Chemical compound P(=O)(O)OP(=O)O.OCO QPCMSEVGGYOTQK-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- FRCICXIVPRNPLM-UHFFFAOYSA-N [amino(phosphono)methyl]phosphonic acid Chemical compound OP(=O)(O)C(N)P(O)(O)=O FRCICXIVPRNPLM-UHFFFAOYSA-N 0.000 description 1
- LJSAJMXWXGSVNA-UHFFFAOYSA-N a805044 Chemical compound OC1=CC=C(O)C=C1.OC1=CC=C(O)C=C1 LJSAJMXWXGSVNA-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940058344 antitrematodals organophosphorous compound Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000006701 autoxidation reaction Methods 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- WXQWKYFPCLREEY-UHFFFAOYSA-N azane;ethanol Chemical class N.CCO.CCO.CCO WXQWKYFPCLREEY-UHFFFAOYSA-N 0.000 description 1
- WZEMSIKSCALWJZ-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO.CCO WZEMSIKSCALWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 230000002308 calcification Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006388 chemical passivation reaction Methods 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 229960002286 clodronic acid Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- UOQACRNTVQWTFF-UHFFFAOYSA-N decane-1,10-dithiol Chemical compound SCCCCCCCCCCS UOQACRNTVQWTFF-UHFFFAOYSA-N 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000007323 disproportionation reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019261 food antioxidant Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 229960005219 gentisic acid Drugs 0.000 description 1
- PUZSUVGRVHEUQO-UHFFFAOYSA-N gentisyl alcohol Chemical compound OCC1=CC(O)=CC=C1O PUZSUVGRVHEUQO-UHFFFAOYSA-N 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000012216 imaging agent Substances 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940102859 methylene diphosphonate Drugs 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical class NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000941 radioactive substance Substances 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 238000010405 reoxidation reaction Methods 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/025—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus inorganic Tc complexes or compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/04—Organic compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2123/00—Preparations for testing in vivo
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Inorganic Chemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Investigating Or Analysing Biological Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/920,081 US4229427A (en) | 1978-06-28 | 1978-06-28 | Radioactive scanning agents with hydroquinone stabilizer |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5536795A JPS5536795A (en) | 1980-03-14 |
| JPS6255627B2 true JPS6255627B2 (enExample) | 1987-11-20 |
Family
ID=25443120
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8198279A Granted JPS5536795A (en) | 1978-06-28 | 1979-06-28 | Radioactive scanning agent containing hydroquinone stabilizing agent |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4229427A (enExample) |
| EP (1) | EP0006658B1 (enExample) |
| JP (1) | JPS5536795A (enExample) |
| AU (1) | AU522235B2 (enExample) |
| CA (1) | CA1118682A (enExample) |
| DE (1) | DE2963532D1 (enExample) |
| IE (1) | IE48765B1 (enExample) |
| NZ (1) | NZ190819A (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4432963A (en) * | 1978-07-31 | 1984-02-21 | Mallinckrodt, Inc. | Radiographic scanning agent |
| US4390517A (en) * | 1979-12-19 | 1983-06-28 | New England Nuclear Corporation | Method, composition and kit for stabilizing radiolabeled compounds |
| US4515766A (en) * | 1980-06-23 | 1985-05-07 | The Massachusetts General Hospital | Labeled phosphonic acid compositions for investigations of in vivo deposits of calcium |
| JPS5750928A (en) * | 1980-09-13 | 1982-03-25 | Nippon Mejifuijitsukusu Kk | Diagnostic agent for scanning bone |
| DE78642T1 (de) * | 1981-10-30 | 1983-10-27 | Amersham International Plc, Amersham, Buckinghamshire | Radiopharmazeutische zubereitung auf grund von technetium-99m und reagenz zur herstellung derselben. |
| JPS5896031A (ja) * | 1981-12-03 | 1983-06-07 | Nippon Mejifuijitsukusu Kk | 放射性診断剤およびその製造用組成物 |
| US4455291A (en) * | 1982-01-22 | 1984-06-19 | New England Nuclear Corporation | Accelerators for forming cationic technetium complexes useful as radiodiagnostic agents |
| ATE26071T1 (de) | 1982-06-10 | 1987-04-15 | Mallinckrodt Inc | Roentgen-sichtbarmachungsmittel. |
| US4504463A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| US4504462A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| US4440738A (en) * | 1982-06-10 | 1984-04-03 | Mallinckrodt, Inc. | Stable radiographic imaging agents |
| US4707353A (en) * | 1982-12-08 | 1987-11-17 | Mallinckrodt, Inc. | Radiographic imaging agents |
| US4510125A (en) * | 1982-12-08 | 1985-04-09 | Mallinckrodt, Inc. | Process for making lyophilized radiographic imaging kit |
| US4749560A (en) * | 1984-08-13 | 1988-06-07 | Research Corporation | Metal organo phosphorous compounds for NMR analysis |
| DE3780820D1 (enExample) * | 1987-10-30 | 1992-09-03 | Sorin Biomedica S.P.A., Saluggia, Vercelli, It | |
| JP3853354B2 (ja) * | 1991-08-29 | 2006-12-06 | マリンクロッド・インコーポレイテッド | 放射性標識ペプチドおよびタンパク質の自己放射線分解を防止する安定剤 |
| WO1994012523A1 (en) * | 1992-11-30 | 1994-06-09 | Mallinckrodt Medical, Inc. | Steroid-21-phosphate complex of technetium-99m |
| EP0692978A4 (en) * | 1993-03-31 | 1998-05-06 | Mallinckrodt Medical Inc | RADIOPHARMACEUTICAL PREPARATIONS THAT DO NOT CONTAIN TIN REDUCER |
| WO1998029139A1 (fr) * | 1996-12-25 | 1998-07-09 | Gosudarstvenny Nauchny Tsentr Fiziko-Energetichesky Institut | PREPARATION CONTENANT UN COMPOSE ORGANIQUE MARQUE A L'AIDE D'UN RADIONUCLEIDE $g(b) |
| DE60140219D1 (de) * | 2000-10-19 | 2009-11-26 | Bracco Imaging Spa | Radiopharmazeutische formulierungen |
| US6881396B2 (en) * | 2000-10-24 | 2005-04-19 | Diatide, Inc. | Stabilization of radiopharmaceutical compositions using hydrophilic 6-hydroxy-chromans |
| US6989138B2 (en) | 2000-10-24 | 2006-01-24 | Diatide, Inc. | Stabilization of radiopharmaceutical compositions using hydrophilic thioethers and hydrophilic 6-hydroxy chromans |
| US6902718B2 (en) * | 2000-10-24 | 2005-06-07 | Diatide, Inc. | Stabilization of radiopharmaceutical compositions using hydrophilic thioethers |
| US20070189965A1 (en) * | 2004-06-17 | 2007-08-16 | Kuperus John H | Copper-complex isonitrile positron emission tomography (pet) imaging agent and method |
| US7229603B2 (en) * | 2004-06-17 | 2007-06-12 | Anazaohealth Corporation | Stablilized and lyophilized radiopharmaceutical agents |
| US10252088B2 (en) | 2004-12-02 | 2019-04-09 | Obagi Cosmeceuticals Llc | Topical compositions and methods of manufacturing them in specifically treated steel vessels |
| US20060251598A1 (en) * | 2004-12-02 | 2006-11-09 | Ramirez Jose E | System for improved percutaneous absorption of skin benefiting agents |
| US8999356B1 (en) | 2004-12-03 | 2015-04-07 | Omp, Inc. | Drug delivery system |
| US20070154418A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin requiring radiofrequency procedure |
| US20070154421A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin needing collagen treatment |
| US20070249714A1 (en) * | 2005-12-30 | 2007-10-25 | Judy Hattendorf | Method of treating skin requiring fractional resurfacing treatment |
| US20070154420A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin subject to or affected by aesthetic surgical procedures |
| US20070154422A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin needing ablative treatment |
| US20070155842A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin requiring Intense Pulse Light (IPL) procedure |
| US20070154419A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin requiring chemical peel procedure |
| US20070154493A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin needing botulinum toxin type a treatment |
| US20070154416A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin needing hyaluronic acid treatment |
| US20070154501A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin having incision from surgical procedures |
| US7976854B2 (en) * | 2005-12-30 | 2011-07-12 | Omp, Inc. | Method of treating skin requiring skin cancer treatment |
| US20070154417A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin requiring non-ablative procedure |
| US20070154502A1 (en) * | 2005-12-30 | 2007-07-05 | Judy Hattendorf | Method of treating skin requiring microdermabrasion |
| KR20090008290A (ko) * | 2006-03-27 | 2009-01-21 | 글로브이뮨 | Ras 돌연변이와 그에 관련된 조성물 및 방법 |
| PL2209458T3 (pl) | 2007-11-14 | 2019-01-31 | Obagi Cosmeceuticals Llc | Kompozycje do traktowania skóry |
| US8273791B2 (en) | 2008-01-04 | 2012-09-25 | Jr Chem, Llc | Compositions, kits and regimens for the treatment of skin, especially décolletage |
| WO2015199977A1 (en) * | 2014-06-27 | 2015-12-30 | Psi Systems, Inc. | Systems and methods providing payment transactions |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091088A (en) * | 1975-02-19 | 1978-05-23 | Australian Atomic Energy Commission | Phenolic amino-carboxylic acid complexes for forming radiopharmaceuticals |
| US4062933A (en) * | 1975-05-27 | 1977-12-13 | Mallinckrodt, Inc. | Colloidal compositions with protective agents suitable for radioactive labeling |
| DE2543350C2 (de) * | 1975-09-29 | 1984-10-11 | Henkel KGaA, 4000 Düsseldorf | Präparate zur Herstellung von ↑9↑↑9↑↑m↑ Technetium-Radiodiagnostika |
| DE2543349C2 (de) * | 1975-09-29 | 1984-05-10 | Henkel KGaA, 4000 Düsseldorf | Preaparate zur herstellung von99m technetium-radiagnostica |
| US4071613A (en) * | 1976-02-26 | 1978-01-31 | Abbott Laboratories | Stabilized alcohol solution of reducing salt formulations for use in preparing radioisotope labeled scanning agents: liver scanning technetium-99m colloid and method of preparation |
-
1978
- 1978-06-28 US US05/920,081 patent/US4229427A/en not_active Expired - Lifetime
-
1979
- 1979-06-18 DE DE7979200315T patent/DE2963532D1/de not_active Expired
- 1979-06-18 EP EP79200315A patent/EP0006658B1/en not_active Expired
- 1979-06-25 NZ NZ190819A patent/NZ190819A/en unknown
- 1979-06-27 CA CA000330697A patent/CA1118682A/en not_active Expired
- 1979-06-27 AU AU48460/79A patent/AU522235B2/en not_active Ceased
- 1979-06-28 JP JP8198279A patent/JPS5536795A/ja active Granted
- 1979-08-08 IE IE1203/79A patent/IE48765B1/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NZ190819A (en) | 1986-07-11 |
| AU4846079A (en) | 1980-01-03 |
| AU522235B2 (en) | 1982-05-20 |
| DE2963532D1 (en) | 1982-10-07 |
| EP0006658A1 (en) | 1980-01-09 |
| IE48765B1 (en) | 1985-05-15 |
| CA1118682A (en) | 1982-02-23 |
| US4229427A (en) | 1980-10-21 |
| IE791203L (en) | 1979-12-28 |
| EP0006658B1 (en) | 1982-08-11 |
| JPS5536795A (en) | 1980-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6255627B2 (enExample) | ||
| EP0004684B1 (en) | Stabilized radiographic scanning agents and method for preparing them | |
| EP0006659B1 (en) | Compositions useful in the preparation of stabilized radiographic scanning agents, a method of preparing them and the use of stannous gentisilate as stabilizer in these compositions | |
| Davis et al. | Comparison of 99mTc-labeled phosphate and phosphonate agents for skeletal imaging | |
| US4247534A (en) | Radiographic scanning agent | |
| CA1186992A (en) | Stable radiographic imaging agents | |
| US3983227A (en) | Dry mixture containing diphosphonates and a stannous salt useful in the preparation of Tc99M containing bone scanning agents | |
| US4104366A (en) | Compositions for preparation of aqueous solutions of low valence 99 technitium salts | |
| US4497744A (en) | Gentisic acid salts as radiographic scanning agent stabilizers | |
| IE43086B1 (en) | Stable radiographic scannin agents | |
| JPH0513929B2 (enExample) | ||
| JPH0253409B2 (enExample) | ||
| US4234562A (en) | Radiographic scanning | |
| US4504463A (en) | Process for making a lyophilized product for use in skeletal imaging | |
| US4432963A (en) | Radiographic scanning agent | |
| Fawzi | Radioactive scanning agents with stabilizer | |
| Bevan | Radiographic scanning agent | |
| Pauwels | Tc99m Bone Seeking Phosphate Compounds: Studies on In Vivo and In Vitro Behaviour |