JPS6247293B2 - - Google Patents
Info
- Publication number
- JPS6247293B2 JPS6247293B2 JP55039630A JP3963080A JPS6247293B2 JP S6247293 B2 JPS6247293 B2 JP S6247293B2 JP 55039630 A JP55039630 A JP 55039630A JP 3963080 A JP3963080 A JP 3963080A JP S6247293 B2 JPS6247293 B2 JP S6247293B2
- Authority
- JP
- Japan
- Prior art keywords
- photopolymerizable composition
- water
- photosensitive
- organic
- composition according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims abstract description 85
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 64
- 239000003822 epoxy resin Substances 0.000 claims abstract description 50
- 229920000647 polyepoxide Polymers 0.000 claims abstract description 50
- 238000007639 printing Methods 0.000 claims abstract description 34
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 20
- 239000007822 coupling agent Substances 0.000 claims abstract description 18
- 206010034972 Photosensitivity reaction Diseases 0.000 claims abstract description 17
- 239000003960 organic solvent Substances 0.000 claims abstract description 17
- 239000004593 Epoxy Substances 0.000 claims abstract description 15
- 150000001989 diazonium salts Chemical class 0.000 claims abstract description 14
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 11
- 239000007859 condensation product Substances 0.000 claims abstract description 6
- 238000009833 condensation Methods 0.000 claims abstract description 3
- 230000005494 condensation Effects 0.000 claims abstract description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical group O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 45
- 229920005989 resin Polymers 0.000 claims description 32
- 239000011347 resin Substances 0.000 claims description 32
- 239000000047 product Substances 0.000 claims description 27
- 239000000463 material Substances 0.000 claims description 26
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 230000008018 melting Effects 0.000 claims description 12
- 238000002844 melting Methods 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 claims description 10
- 239000005293 duran Substances 0.000 claims description 10
- -1 Aryl sulfonic acid Chemical compound 0.000 claims description 9
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 8
- 229910000831 Steel Inorganic materials 0.000 claims description 7
- 239000010959 steel Substances 0.000 claims description 7
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- 229920002866 paraformaldehyde Polymers 0.000 claims description 6
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 claims description 5
- 229920003986 novolac Polymers 0.000 claims description 5
- 230000005855 radiation Effects 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000000178 monomer Substances 0.000 claims description 4
- 229920000728 polyester Polymers 0.000 claims description 4
- ZZXDRXVIRVJQBT-UHFFFAOYSA-N 2,3-dimethylbenzenesulfonic acid Chemical compound CC1=CC=CC(S(O)(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-N 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- IRLYGRLEBKCYPY-UHFFFAOYSA-N 2,5-dimethylbenzenesulfonic acid Chemical compound CC1=CC=C(C)C(S(O)(=O)=O)=C1 IRLYGRLEBKCYPY-UHFFFAOYSA-N 0.000 claims description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims description 2
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical group OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 2
- 229930003836 cresol Natural products 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims 1
- 239000004411 aluminium Substances 0.000 claims 1
- 239000011135 tin Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 4
- 239000012530 fluid Substances 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 47
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 23
- 238000011161 development Methods 0.000 description 19
- 238000002360 preparation method Methods 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 239000000976 ink Substances 0.000 description 7
- CEQFOVLGLXCDCX-WUKNDPDISA-N methyl red Chemical compound C1=CC(N(C)C)=CC=C1\N=N\C1=CC=CC=C1C(O)=O CEQFOVLGLXCDCX-WUKNDPDISA-N 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 7
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- 229920003319 Araldite® Polymers 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 150000008049 diazo compounds Chemical class 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 239000001044 red dye Substances 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229920000084 Gum arabic Polymers 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- 241000978776 Senegalia senegal Species 0.000 description 3
- 239000000205 acacia gum Substances 0.000 description 3
- 235000010489 acacia gum Nutrition 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000000151 deposition Methods 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000004850 liquid epoxy resins (LERs) Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CUOZYXPNIFEQTK-UHFFFAOYSA-N benzenesulfonic acid;formaldehyde Chemical compound O=C.OS(=O)(=O)C1=CC=CC=C1 CUOZYXPNIFEQTK-UHFFFAOYSA-N 0.000 description 2
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 2
- 229940043264 dodecyl sulfate Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 239000004843 novolac epoxy resin Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- KUBDPQJOLOUJRM-UHFFFAOYSA-N 2-(chloromethyl)oxirane;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical group ClCC1CO1.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 KUBDPQJOLOUJRM-UHFFFAOYSA-N 0.000 description 1
- RJXRFOHFBDZFQP-UHFFFAOYSA-N 4-(4-diazo-2,5-diethoxy-3-fluorocyclohexa-1,5-dien-1-yl)morpholine Chemical compound C(C)OC=1C(C(C(=CC=1N1CCOCC1)OCC)=[N+]=[N-])F RJXRFOHFBDZFQP-UHFFFAOYSA-N 0.000 description 1
- BFRPLICXLZSSMF-UHFFFAOYSA-N 4-(diazomethyl)benzenesulfonic acid Chemical class [N+](=[N-])=CC1=CC=C(C=C1)S(=O)(=O)O BFRPLICXLZSSMF-UHFFFAOYSA-N 0.000 description 1
- OHNKSVVCUPOUDJ-UHFFFAOYSA-N 5-nitro-1h-indene Chemical compound [O-][N+](=O)C1=CC=C2CC=CC2=C1 OHNKSVVCUPOUDJ-UHFFFAOYSA-N 0.000 description 1
- BWZMRNIRVONKRB-UHFFFAOYSA-N 6-diazo-n-phenylcyclohexa-2,4-dien-1-amine;formaldehyde Chemical compound O=C.[N-]=[N+]=C1C=CC=CC1NC1=CC=CC=C1 BWZMRNIRVONKRB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- ZTXONRUJVYXVTJ-UHFFFAOYSA-N chromium copper Chemical compound [Cr][Cu][Cr] ZTXONRUJVYXVTJ-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- PKJZYOFPPJHDRW-UHFFFAOYSA-N formaldehyde;sulfuric acid Chemical compound O=C.OS(O)(=O)=O PKJZYOFPPJHDRW-UHFFFAOYSA-N 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VXLFYNFOITWQPM-UHFFFAOYSA-N n-phenyl-4-phenyldiazenylaniline Chemical compound C=1C=C(N=NC=2C=CC=CC=2)C=CC=1NC1=CC=CC=C1 VXLFYNFOITWQPM-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 229940077386 sodium benzenesulfonate Drugs 0.000 description 1
- MZSDGDXXBZSFTG-UHFFFAOYSA-M sodium;benzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC=C1 MZSDGDXXBZSFTG-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/016—Diazonium salts or compounds
- G03F7/021—Macromolecular diazonium compounds; Macromolecular additives, e.g. binders
- G03F7/0212—Macromolecular diazonium compounds; Macromolecular additives, e.g. binders characterised by the polymeric binder or the macromolecular additives other than the diazo resins or the polymeric diazonium compounds
- G03F7/0217—Polyurethanes; Epoxy resins
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Exposure And Positioning Against Photoresist Photosensitive Materials (AREA)
- Detergent Compositions (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Epoxy Resins (AREA)
- Macromonomer-Based Addition Polymer (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7907746A FR2452731A1 (fr) | 1979-03-28 | 1979-03-28 | Compositions photopolymerisables filmogenes developpables a l'eau |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55159433A JPS55159433A (en) | 1980-12-11 |
| JPS6247293B2 true JPS6247293B2 (enExample) | 1987-10-07 |
Family
ID=9223645
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3963080A Granted JPS55159433A (en) | 1979-03-28 | 1980-03-27 | Waterrdeveloping filmmforming photopolymerizable composition |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4299905A (enExample) |
| EP (1) | EP0018860B1 (enExample) |
| JP (1) | JPS55159433A (enExample) |
| AT (1) | ATE7336T1 (enExample) |
| DE (1) | DE3067670D1 (enExample) |
| ES (1) | ES8204182A1 (enExample) |
| FR (1) | FR2452731A1 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5837639A (ja) * | 1981-07-31 | 1983-03-04 | Konishiroku Photo Ind Co Ltd | 画像形成材料 |
| US4447512A (en) * | 1982-01-25 | 1984-05-08 | Polychrome Corporation | Method for making a negative working lithographic printing plate |
| US6966153B2 (en) * | 2001-06-16 | 2005-11-22 | Atticap Corporation | Insulating cover |
| US20050277053A1 (en) * | 2004-06-01 | 2005-12-15 | Anocoil Corporation | Increased sensitivity, IR, and UV imageable photographic elements |
| US20050277051A1 (en) * | 2004-06-01 | 2005-12-15 | Anocoil Corporation | Increased sensitivity, UV imageable photographic elements |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE593423A (enExample) * | 1959-07-29 | |||
| BE606888A (enExample) * | 1960-08-05 | 1900-01-01 | ||
| CH440975A (de) * | 1960-08-05 | 1967-07-31 | Kalle Ag | Zur Herstellung einer Flachdruckform bestimmtes flächenförmiges Material |
| US3205157A (en) * | 1962-03-13 | 1965-09-07 | North American Aviation Inc | Electromagnetic radiation polymerization |
| FR1363984A (fr) * | 1962-04-27 | 1964-06-19 | Minnesota Mining & Mfg | Feuille composite à revêtement diazoïque photo-sensible |
| DE1447016C3 (de) * | 1963-10-25 | 1973-11-15 | Kalle Ag, 6202 Wiesbaden-Biebrich | Vorsensibilisierte Druckplatte |
| DE1797282A1 (de) * | 1967-11-21 | 1971-03-04 | Inst Fuer Grafische Technik | Kopierloesung zur Herstellung von Kopierschichten fuer fotomechanische Verfahren |
| CA924954A (en) * | 1968-06-21 | 1973-04-24 | Polychrome Corporation | Resin-diazo light-sensitive materials |
| US3708296A (en) * | 1968-08-20 | 1973-01-02 | American Can Co | Photopolymerization of epoxy monomers |
| BE757479A (fr) * | 1969-10-15 | 1971-04-14 | Xidex Corp | Element vesiculaire de formation d'une image |
| US3660097A (en) * | 1969-11-28 | 1972-05-02 | Polychrome Corp | Diazo-polyurethane light-sensitive compositions |
| FR2087414A5 (en) * | 1970-05-20 | 1971-12-31 | Giudicelli Rene | Presensitisation of offset printing plates - using a combination of three solns |
| NL7109179A (enExample) * | 1970-07-13 | 1972-01-17 | ||
| US3794576A (en) * | 1971-05-18 | 1974-02-26 | American Can Co | Epoxide blend radiation sensitive catalyst precursor |
| GB1376840A (en) * | 1972-08-02 | 1974-12-11 | Ozalid Group Holdings Ltd De M | Photosensitive compositions and their uses |
| US3829369A (en) * | 1972-10-19 | 1974-08-13 | American Can Co | 4-methoxy benzene diazonium hexafluorophosphate catalyst for photopolymers in epoxy systems |
| US4093465A (en) * | 1973-08-14 | 1978-06-06 | Polychrome Corporation | Photosensitive diazo condensate compositions |
| GB1523762A (en) * | 1975-02-25 | 1978-09-06 | Oce Van Der Grinten Nv | Photocopying materials |
| NL7506406A (nl) * | 1975-05-30 | 1976-12-02 | Oce Van Der Grinten Nv | Lichtgevoelig kopieermateriaal. |
| DE2551347A1 (de) * | 1975-08-14 | 1977-02-24 | Alusuisse | Verfahren zur herstellung einer negativ arbeitenden, lichtempfindlichen masse |
| US4104072A (en) * | 1977-05-19 | 1978-08-01 | Polychrome Corporation | Water developable lithographic printing plate having dual photosensitive layering |
| US4218531A (en) * | 1978-02-08 | 1980-08-19 | Minnesota Mining And Manufacturing Company | Addition of ethylenically unsaturated materials to control odor in photopolymerizable epoxy compositions |
-
1979
- 1979-03-28 FR FR7907746A patent/FR2452731A1/fr active Granted
-
1980
- 1980-03-26 AT AT80400403T patent/ATE7336T1/de not_active IP Right Cessation
- 1980-03-26 EP EP80400403A patent/EP0018860B1/fr not_active Expired
- 1980-03-26 US US06/134,328 patent/US4299905A/en not_active Expired - Lifetime
- 1980-03-26 DE DE8080400403T patent/DE3067670D1/de not_active Expired
- 1980-03-27 JP JP3963080A patent/JPS55159433A/ja active Granted
- 1980-03-28 ES ES490059A patent/ES8204182A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4299905A (en) | 1981-11-10 |
| FR2452731B1 (enExample) | 1982-06-11 |
| FR2452731A1 (fr) | 1980-10-24 |
| JPS55159433A (en) | 1980-12-11 |
| ES490059A0 (es) | 1982-04-16 |
| DE3067670D1 (en) | 1984-06-07 |
| ATE7336T1 (de) | 1984-05-15 |
| ES8204182A1 (es) | 1982-04-16 |
| EP0018860A1 (fr) | 1980-11-12 |
| EP0018860B1 (fr) | 1984-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3890152A (en) | Light-sensitive copying composition containing diazo resin and quinone diazide | |
| US3785825A (en) | Light-sensitive quinone diazide compounds,compositions,and presensitized lithographic plate | |
| US3679419A (en) | Light-sensitive diazo condensate containing reproduction material | |
| CA1174097A (en) | Light-sensitive copying material including a surface-active copolymer consisting of dialkyl- siloxane and oxyalkylene units | |
| US4487823A (en) | Light-sensitive copying material and process for the manufacture thereof utilizing non-ionic fluorinated ester surfactant | |
| CA1172492A (en) | Process for the production of lithographic printing forms using a light-sensitive material based on diazonium salt polycondensation products | |
| US3790385A (en) | Light-sensitive diazo copying composition and copying material produced therewith | |
| US3295974A (en) | Light sensitive epoxy material for the photomechanical production of printing plates | |
| CA1241862A (en) | Negative working photosensitive composition and photosensitive element prepared therewith | |
| JPH039455B2 (enExample) | ||
| JPH0138289B2 (enExample) | ||
| JPH0146861B2 (enExample) | ||
| JPH0727201B2 (ja) | 感光性記録材料 | |
| GB1572016A (en) | Metal image-forming materials | |
| US3313233A (en) | Process of lacquering planographic printing plates | |
| JPH01263647A (ja) | 感光性組成物、感光性複写材料及びネガチブレリーフ複写の製法 | |
| US4299893A (en) | Photosensitive article for making visual aids with diazonium compounds and liquid epoxy resin | |
| US4592992A (en) | Developer compositions for lithographic plates | |
| JPH024260A (ja) | 放射線感応性記録材料及び画像の形成法 | |
| JPH0145901B2 (enExample) | ||
| JPS6247293B2 (enExample) | ||
| US5122442A (en) | Method for forming an image from a high speed screen printing composition on a screen mesh | |
| JPS5986046A (ja) | 感光性組成物 | |
| JPH09235438A (ja) | 画像コントラストの改良された水性現像可能なネガ型の感光性組成物 | |
| US4517275A (en) | Light-sensitive mixture based on O-naphthoquinone-diazides, and light-sensitive copying material prepared therefrom |