JPS57176943A - 4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl ester - Google Patents
4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl esterInfo
- Publication number
- JPS57176943A JPS57176943A JP6195981A JP6195981A JPS57176943A JP S57176943 A JPS57176943 A JP S57176943A JP 6195981 A JP6195981 A JP 6195981A JP 6195981 A JP6195981 A JP 6195981A JP S57176943 A JPS57176943 A JP S57176943A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- reacting
- liquid crystal
- trans
- benzoic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 title abstract 4
- 239000005711 Benzoic acid Substances 0.000 title abstract 2
- 235000010233 benzoic acid Nutrition 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 5
- 239000004973 liquid crystal related substance Substances 0.000 abstract 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 abstract 2
- 239000003795 chemical substances by application Substances 0.000 abstract 2
- 230000002140 halogenating effect Effects 0.000 abstract 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 abstract 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 abstract 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 abstract 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 abstract 1
- 229910006124 SOCl2 Inorganic materials 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- -1 carbinol compound Chemical class 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6195981A JPS57176943A (en) | 1981-04-24 | 1981-04-24 | 4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl ester |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6195981A JPS57176943A (en) | 1981-04-24 | 1981-04-24 | 4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl ester |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57176943A true JPS57176943A (en) | 1982-10-30 |
| JPH0131500B2 JPH0131500B2 (cg-RX-API-DMAC7.html) | 1989-06-26 |
Family
ID=13186228
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP6195981A Granted JPS57176943A (en) | 1981-04-24 | 1981-04-24 | 4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl ester |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57176943A (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997029071A1 (en) * | 1996-02-07 | 1997-08-14 | Chisso Corporation | Carboxylic ester derivatives containing ether group and liquid-crystal composition containing the same |
| US6149990A (en) * | 1996-02-07 | 2000-11-21 | Chisso Corporation | Carboxylate derivatives comprising an ether group and liquid crystal composition comprising the same |
-
1981
- 1981-04-24 JP JP6195981A patent/JPS57176943A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997029071A1 (en) * | 1996-02-07 | 1997-08-14 | Chisso Corporation | Carboxylic ester derivatives containing ether group and liquid-crystal composition containing the same |
| US6149990A (en) * | 1996-02-07 | 2000-11-21 | Chisso Corporation | Carboxylate derivatives comprising an ether group and liquid crystal composition comprising the same |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0131500B2 (cg-RX-API-DMAC7.html) | 1989-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| WO1989008102A1 (en) | Laterally fluorinated 4-cyanophenyl and 4'-cyanobiphenyl benzoates | |
| JPS5721359A (en) | 4'''-cyano-4"-biphenylyl 4-(trans-4'-alkylcyclohexyl)benzoate | |
| JPS54109949A (en) | Trans-(equatorial-equatorial) 1,4-disubstituted cyclohexane derivative | |
| JPS5764645A (en) | 4-fluoro-4'-hydroxybiphenyl cyclohexanecarboxylate derivative | |
| JPS57176943A (en) | 4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl ester | |
| JPS57114531A (en) | 4-(trans 4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene | |
| JPS5777658A (en) | 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate | |
| JPS56158751A (en) | 4"-cyanophenyl 4-(trans-4'-alkylcyclohexylmethoxy)benzoate | |
| JPS57185230A (en) | 3,4-difluoro-4'-(trans-4"-alkylcyclohexyl)biphenyl | |
| JPS5572143A (en) | Fluorine-containing phenylbenzoate compound, and its preparation and use | |
| JPS56104844A (en) | Carboxylic ester derivative of 4-fluorophenol | |
| JPS574927A (en) | 4'-substituted-1'-cyclohexen-1'-yl-4-fluorobenzene | |
| JPS57118538A (en) | 4-halogenobenzoic acid 4-(4'-alkylphenyl)phenol ester derivative | |
| JPS5665845A (en) | Liquid crystal ester compound | |
| JPS54106453A (en) | P-(4-alkyl-1-cyclohexenyl)benzoic acid p-cyanophenyl ester | |
| JPS5718649A (en) | 4-(trans-4'-alkylcyclohexylmethoxy)benzoic acid trans-4"- alkylcyclohexyl ester | |
| JPS5583743A (en) | Ester compound | |
| JPS5738760A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl 4"-cyanophenyl ether | |
| JPS5572156A (en) | 3-butoxy-6-cyclohexanecarboxy-phthalonitriles | |
| JP4094742B2 (ja) | エステル化合物ならびにそれを含有する液晶組成物 | |
| JPS5616458A (en) | Ester compound | |
| JPS57183727A (en) | 4-chloro-4'-(trans-4"-alkylcyclohexyl)biphenyl | |
| JP3636676B2 (ja) | エステル誘導体 | |
| JPS56113743A (en) | Ester derivative of p-hydroxybenzoic acid p'-fluorophenyl ester | |
| JPS5448740A (en) | Biphenyl esters |