JPS57165334A - Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl group - Google Patents
Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl groupInfo
- Publication number
- JPS57165334A JPS57165334A JP4968781A JP4968781A JPS57165334A JP S57165334 A JPS57165334 A JP S57165334A JP 4968781 A JP4968781 A JP 4968781A JP 4968781 A JP4968781 A JP 4968781A JP S57165334 A JPS57165334 A JP S57165334A
- Authority
- JP
- Japan
- Prior art keywords
- compound shown
- formula
- methylbutyloxyphenyl
- group
- optical active
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 2- methylbutyloxyphenyl group Chemical group 0.000 title 1
- 230000003287 optical effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N anhydrous diethylene glycol Natural products OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 239000004973 liquid crystal related substance Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Landscapes
- Liquid Crystal Substances (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4968781A JPS57165334A (en) | 1981-04-02 | 1981-04-02 | Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl group |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4968781A JPS57165334A (en) | 1981-04-02 | 1981-04-02 | Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl group |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57165334A true JPS57165334A (en) | 1982-10-12 |
| JPH0132810B2 JPH0132810B2 (enExample) | 1989-07-10 |
Family
ID=12838089
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4968781A Granted JPS57165334A (en) | 1981-04-02 | 1981-04-02 | Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl group |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57165334A (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4689176A (en) * | 1984-12-26 | 1987-08-25 | Chisso Corporation | Novel optically active compound and liquid crystal composition containing same |
| US4886619A (en) * | 1986-06-30 | 1989-12-12 | Minnesota Mining And Manufacturing Company | Fluorine-containing chiral smectic liquid crystals |
| US5254747A (en) * | 1986-06-30 | 1993-10-19 | Minnesota Mining And Manufacturing Company | Fluorine-containing chiral smectic liquid crystals |
| US5658491A (en) * | 1995-10-12 | 1997-08-19 | Minnesota Mining And Manufacturing Company | Process for controlling cone tilt angle in mixtures of smectic liquid crystal compounds |
| US5702637A (en) * | 1995-04-19 | 1997-12-30 | Minnesota Mining And Manufacturing Company | Liquid crystal compounds having a chiral fluorinated terminal portion |
| US5855812A (en) * | 1997-04-11 | 1999-01-05 | Minnesota Mining And Manufacturing Company | Compounds and process for controlling cone tilt angle in mixtures of smectic liquid crystal compounds |
| US6309561B1 (en) | 1997-12-24 | 2001-10-30 | 3M Innovative Properties Company | Liquid crystal compounds having a chiral fluorinated terminal portion |
| US20140064053A1 (en) * | 2011-05-13 | 2014-03-06 | Fujifilm Corporation | Non-resonant two-photon absorption material, non-resonant two-photon absorption recording material, recording medium, recording/reproducing method and non-resonant two-photon absorption compound |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5257139A (en) * | 1975-11-06 | 1977-05-11 | Dainippon Toryo Kk | Production of cairal nematic compound and liquid crystal composition |
| JPS5285988A (en) * | 1976-01-10 | 1977-07-16 | Thomson Csf | Liquid crystal anisotropic matters for liquid crystal cell |
| JPS6059893A (ja) * | 1983-09-12 | 1985-04-06 | Nec Corp | 時分割通話路構成方式 |
-
1981
- 1981-04-02 JP JP4968781A patent/JPS57165334A/ja active Granted
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5257139A (en) * | 1975-11-06 | 1977-05-11 | Dainippon Toryo Kk | Production of cairal nematic compound and liquid crystal composition |
| JPS5285988A (en) * | 1976-01-10 | 1977-07-16 | Thomson Csf | Liquid crystal anisotropic matters for liquid crystal cell |
| JPS6059893A (ja) * | 1983-09-12 | 1985-04-06 | Nec Corp | 時分割通話路構成方式 |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4689176A (en) * | 1984-12-26 | 1987-08-25 | Chisso Corporation | Novel optically active compound and liquid crystal composition containing same |
| US4886619A (en) * | 1986-06-30 | 1989-12-12 | Minnesota Mining And Manufacturing Company | Fluorine-containing chiral smectic liquid crystals |
| US5254747A (en) * | 1986-06-30 | 1993-10-19 | Minnesota Mining And Manufacturing Company | Fluorine-containing chiral smectic liquid crystals |
| US5399701A (en) * | 1986-06-30 | 1995-03-21 | Minnesota Mining And Manufacturing Company | Fluorine-containing chiral smectic liquid crystals |
| US5702637A (en) * | 1995-04-19 | 1997-12-30 | Minnesota Mining And Manufacturing Company | Liquid crystal compounds having a chiral fluorinated terminal portion |
| US5972241A (en) * | 1995-04-19 | 1999-10-26 | 3M Innovative Properties Company | Liquid crystal compounds having a chiral fluorinated terminal portion |
| US5658491A (en) * | 1995-10-12 | 1997-08-19 | Minnesota Mining And Manufacturing Company | Process for controlling cone tilt angle in mixtures of smectic liquid crystal compounds |
| US5928562A (en) * | 1995-10-12 | 1999-07-27 | Minnesota Mining And Manufacturing Company | Process for controlling cone tilt angle in mixtures of smectic liquid crystal compounds |
| US5855812A (en) * | 1997-04-11 | 1999-01-05 | Minnesota Mining And Manufacturing Company | Compounds and process for controlling cone tilt angle in mixtures of smectic liquid crystal compounds |
| US6309561B1 (en) | 1997-12-24 | 2001-10-30 | 3M Innovative Properties Company | Liquid crystal compounds having a chiral fluorinated terminal portion |
| US20140064053A1 (en) * | 2011-05-13 | 2014-03-06 | Fujifilm Corporation | Non-resonant two-photon absorption material, non-resonant two-photon absorption recording material, recording medium, recording/reproducing method and non-resonant two-photon absorption compound |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0132810B2 (enExample) | 1989-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57118526A (en) | Dicyclohexylethane derivative | |
| AU4888179A (en) | Display of plant-like chemical growths | |
| JPS57165334A (en) | Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl group | |
| IT7924631A0 (it) | Ammidi dell'acido 1,2,3-triazolcarbossilico, procedimento per preparare questi composti nonche' mezzi biocidi cheli contengono. | |
| ES8303284A1 (es) | Procedimiento para la obtencion de 3-alquen-i-il-2,3-dimetil-ciclopropancarboxilatos de 4-fluor-3-fenoxi-bencilo. | |
| JPS57169465A (en) | Pyrazole derivative, its preparation and herbicide | |
| JPS5791953A (en) | 4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivative | |
| JPS5566556A (en) | 3-pentyloxy-6-cyclohexanecarboxy-phthalonitrile | |
| ES479033A1 (es) | Un procedimiento para la preparacion de derivados de n-iminometil piperidina. | |
| JPS5735552A (en) | Cinnamonitrile compound | |
| JPS5711944A (en) | Optically active ester | |
| JPS52105141A (en) | Preparation of perfluorononenyloxybenzoic acid | |
| JPS56140944A (en) | Cyclohexylmethyl phenyl ether derivative | |
| JPS57183730A (en) | Liquid crystal compound | |
| JPS5283716A (en) | Novel 16-substituted prostadienoic acid derivatives | |
| JPS5268155A (en) | Preparation of 4'-alkyl-4-biphenylcarbonitrile | |
| JPS56123947A (en) | Ester compound | |
| JPS57106654A (en) | Phenyl ether type compound and herbicide comprising it | |
| JPS54154736A (en) | 1,4-di(trans-4-n-alkylcyclohexanecarbonyloxy)-2-chlorobenzene | |
| JPS572264A (en) | Preparation of n-substituted thiolcarbamate | |
| JPS572281A (en) | Aralkylcarboxylic acid phthalidyl ester | |
| JPS5649367A (en) | Preparation of novel pyrazole derivative | |
| JPS57175181A (en) | Novel phenothiazine derivative | |
| JPS5781440A (en) | 4-fluorophenol cinnamic acid ester derivative | |
| JPS57176979A (en) | Novel derivative of secalonic acid and its preparation |