JPS5657799A - 22deoxyy22substituted fortimicin a and b and derivative - Google Patents
22deoxyy22substituted fortimicin a and b and derivativeInfo
- Publication number
- JPS5657799A JPS5657799A JP13315080A JP13315080A JPS5657799A JP S5657799 A JPS5657799 A JP S5657799A JP 13315080 A JP13315080 A JP 13315080A JP 13315080 A JP13315080 A JP 13315080A JP S5657799 A JPS5657799 A JP S5657799A
- Authority
- JP
- Japan
- Prior art keywords
- fortimicin
- derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- BIDUPMYXGFNAEJ-APGVDKLISA-N astromicin Chemical class O[C@@H]1[C@H](N(C)C(=O)CN)[C@@H](OC)[C@@H](O)[C@H](N)[C@H]1O[C@@H]1[C@H](N)CC[C@@H]([C@H](C)N)O1 BIDUPMYXGFNAEJ-APGVDKLISA-N 0.000 title 1
- 229950004074 astromicin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/20—Carbocyclic rings
- C07H15/22—Cyclohexane rings, substituted by nitrogen atoms
- C07H15/222—Cyclohexane rings substituted by at least two nitrogen atoms
- C07H15/224—Cyclohexane rings substituted by at least two nitrogen atoms with only one saccharide radical directly attached to the cyclohexyl radical, e.g. destomycin, fortimicin, neamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/079,145 US4250304A (en) | 1979-09-26 | 1979-09-26 | 2-Deoxy-2-substituted fortimicin A and B and derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS5657799A true JPS5657799A (en) | 1981-05-20 |
Family
ID=22148726
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13315080A Pending JPS5657799A (en) | 1979-09-26 | 1980-09-26 | 22deoxyy22substituted fortimicin a and b and derivative |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4250304A (en:Method) |
| JP (1) | JPS5657799A (en:Method) |
| AR (1) | AR226437A1 (en:Method) |
| AU (1) | AU6199180A (en:Method) |
| BE (1) | BE885402A (en:Method) |
| DE (1) | DE3036185A1 (en:Method) |
| ES (1) | ES495313A0 (en:Method) |
| FR (1) | FR2465743A1 (en:Method) |
| GB (1) | GB2059958A (en:Method) |
| GR (1) | GR70198B (en:Method) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5659792A (en) * | 1979-10-23 | 1981-05-23 | Kyowa Hakko Kogyo Co Ltd | Fortimicin derivative and its preparation |
| JPS5721399A (en) * | 1980-07-12 | 1982-02-04 | Kyowa Hakko Kogyo Co Ltd | Fortimicin a derivative and its preparation |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5740496A (en) * | 1980-08-22 | 1982-03-06 | Microbial Chem Res Found | Low toxic derivative of istamycin antibiotic |
| JPS58128395A (ja) * | 1982-01-27 | 1983-07-30 | Microbial Chem Res Found | 3−0−デメチルイスタマイシンbの低毒性誘導体 |
| GB2118179A (en) * | 1982-04-09 | 1983-10-26 | Abbott Lab | 2-Deoxy-3- demethoxyfortimicin A and B and related compounds |
| JPS6042394A (ja) * | 1983-08-18 | 1985-03-06 | Kowa Co | 新規なアミノグリコシド及びその製法 |
| US7794713B2 (en) * | 2004-04-07 | 2010-09-14 | Lpath, Inc. | Compositions and methods for the treatment and prevention of hyperproliferative diseases |
| US20090074720A1 (en) * | 2005-10-28 | 2009-03-19 | Sabbadini Roger A | Methods for decreasing immune response and treating immune conditions |
| US20080213274A1 (en) * | 2005-10-28 | 2008-09-04 | Sabbadini Roger A | Compositions and methods for the treatment and prevention of fibrotic, inflammatory, and neovascularization conditions of the eye |
| US7862812B2 (en) * | 2006-05-31 | 2011-01-04 | Lpath, Inc. | Methods for decreasing immune response and treating immune conditions |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4192867A (en) * | 1977-12-21 | 1980-03-11 | Abbott Laboratories | 2-Deoxyfortimicin A, 4-N-alkyl and 4-N-acyl-2-deoxyfortimicin B derivatives |
| US4176178A (en) * | 1977-12-21 | 1979-11-27 | Abbott Laboratories | 2-Deoxy-2'-N-acyl and alkyl fortimicins A and B |
| US4169198A (en) * | 1977-12-21 | 1979-09-25 | Abbott Laboratories | 2-Deoxyfortimicin B |
-
1979
- 1979-09-26 US US06/079,145 patent/US4250304A/en not_active Expired - Lifetime
-
1980
- 1980-09-03 AU AU61991/80A patent/AU6199180A/en not_active Abandoned
- 1980-09-08 GR GR62833A patent/GR70198B/el unknown
- 1980-09-11 GB GB8029336A patent/GB2059958A/en not_active Withdrawn
- 1980-09-16 AR AR282549A patent/AR226437A1/es active
- 1980-09-24 ES ES495313A patent/ES495313A0/es active Granted
- 1980-09-25 FR FR8020601A patent/FR2465743A1/fr active Granted
- 1980-09-25 DE DE19803036185 patent/DE3036185A1/de not_active Withdrawn
- 1980-09-25 BE BE0/202235A patent/BE885402A/fr unknown
- 1980-09-26 JP JP13315080A patent/JPS5657799A/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5659792A (en) * | 1979-10-23 | 1981-05-23 | Kyowa Hakko Kogyo Co Ltd | Fortimicin derivative and its preparation |
| JPS5721399A (en) * | 1980-07-12 | 1982-02-04 | Kyowa Hakko Kogyo Co Ltd | Fortimicin a derivative and its preparation |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2465743B1 (en:Method) | 1983-07-08 |
| GB2059958A (en) | 1981-04-29 |
| GR70198B (en:Method) | 1982-08-31 |
| FR2465743A1 (fr) | 1981-03-27 |
| AU6199180A (en) | 1981-04-02 |
| AR226437A1 (es) | 1982-07-15 |
| ES8200119A1 (es) | 1981-10-16 |
| ES495313A0 (es) | 1981-10-16 |
| DE3036185A1 (de) | 1981-04-16 |
| BE885402A (fr) | 1981-03-25 |
| US4250304A (en) | 1981-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS924680A2 (en) | Castic nosicoveho systemu a zpusob jejich vyrby | |
| CS492580A2 (en) | Zpusob rozvadeni elektrickeho proudu v elektrolyzeru a elektrolyzer pro provadeni tohoto zpusobu | |
| CS165680A2 (en) | Diagnosticky prostredek pro dukaz latek obsazenych v kapalinach a zpusob jeho vyroby | |
| CS544180A2 (en) | Zpsob aerobniho vyhnivani a nebo suseni organickych odpadnich latek a zarizeni k jeho provadeni | |
| AU78476S (en) | a knobset | |
| CS770280A2 (en) | Prostredek ke sterilizaci samcich prasniku a zpusob vyroby jeho ucinne latky | |
| CS828180A2 (en) | Zpusob zpracovani tezke nebo kompaktni pudy a kultivacni zarizeni k provadeni tohoto zpusobu | |
| CS781980A2 (en) | Zpusob vyroby spojitych vlaken a zarizeni k provadeni zpusobu | |
| JPS56124651A (en) | Lockerrhousing and lockerrcover | |
| JPS5657799A (en) | 22deoxyy22substituted fortimicin a and b and derivative | |
| JPS55154994A (en) | Amtibiotic aa6888c and aa6888x | |
| ZA805556B (en) | A cephalosporing antibiotic | |
| CS613280A2 (en) | Zpusob suseni produktu a zarizeni k provadeni zpusobu | |
| JPS579777A (en) | 1-epi-2-deoxyfortimicin b and derivative | |
| GB2051041B (en) | 2-epi-fortimicin a and b and derivatives thereof | |
| GB2047688B (en) | Fortimicin derivatives | |
| JPS55130968A (en) | 11epiifortimicin a and derivative | |
| CS335080A2 (en) | Zpusob smesovani pevnych casticovych materialu a zarizeni k provadeni tohoto zpusobu | |
| JPS55130969A (en) | 11epiifortimicin a and derivative | |
| EG14656A (en) | Pneumatique a carcasse radiale dissymetrique | |
| KR820001222Y1 (en) | A rollerskate | |
| AU79802S (en) | a door | |
| JPS5646900A (en) | 1*22denatured fortimicin a and b* its intermediate and its manufacture | |
| CS582579A1 (en) | Konstrukcia spoja vhodneho najma pre spajanie nabytkovych dielcov | |
| CS789479A1 (en) | Zapojenie pre urcovanie urovni intermodulacnych produktov a intermodulacnych odstupov kanalovych a sirokopasmovych zosilnovacov |