JPS5571744A - Chlorine-containing resin composition - Google Patents
Chlorine-containing resin compositionInfo
- Publication number
- JPS5571744A JPS5571744A JP14563478A JP14563478A JPS5571744A JP S5571744 A JPS5571744 A JP S5571744A JP 14563478 A JP14563478 A JP 14563478A JP 14563478 A JP14563478 A JP 14563478A JP S5571744 A JPS5571744 A JP S5571744A
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- chlorine
- containing resin
- alkylene
- resin composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 title abstract 4
- 229910052801 chlorine Inorganic materials 0.000 title abstract 4
- 239000000460 chlorine Substances 0.000 title abstract 4
- 239000011342 resin composition Substances 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 125000002947 alkylene group Chemical group 0.000 abstract 3
- -1 diketone compound Chemical class 0.000 abstract 3
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- 239000011347 resin Substances 0.000 abstract 2
- 229920005989 resin Polymers 0.000 abstract 2
- 125000001118 alkylidene group Chemical group 0.000 abstract 1
- 238000013329 compounding Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 230000006866 deterioration Effects 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 abstract 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14563478A JPS5571744A (en) | 1978-11-24 | 1978-11-24 | Chlorine-containing resin composition |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14563478A JPS5571744A (en) | 1978-11-24 | 1978-11-24 | Chlorine-containing resin composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5571744A true JPS5571744A (en) | 1980-05-30 |
| JPS6126809B2 JPS6126809B2 (enExample) | 1986-06-23 |
Family
ID=15389537
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP14563478A Granted JPS5571744A (en) | 1978-11-24 | 1978-11-24 | Chlorine-containing resin composition |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5571744A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5969015A (en) * | 1996-09-25 | 1999-10-19 | Witco Vinyl Additives Gmbh | Monomeric and oligomeric bisphosphites as stabilisers for polyvinyl chloride |
| US20130225736A1 (en) * | 2010-02-19 | 2013-08-29 | Dover Chemical Corporation | Alkylphenol free - liquid polymeric polyphosphite polymer stabilizers |
| US20140329943A1 (en) * | 2010-02-19 | 2014-11-06 | Dover Chemical Corporation | Alkylphenol free - liquid polymeric polyphosphite polymer stabilizers |
Citations (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3375304A (en) * | 1965-01-04 | 1968-03-26 | Small Business Administ | Polyphosphites |
| GB1180398A (en) * | 1966-09-08 | 1970-02-04 | Pure Chem Ltd | Improvements relating to Organic Phosphites |
| JPS5167349A (ja) * | 1974-12-07 | 1976-06-10 | Adeka Argus Chemical Co Ltd | Harogenganjujushisoseibutsu |
| JPS5195447A (enExample) * | 1975-01-10 | 1976-08-21 | ||
| JPS51111252A (en) * | 1975-03-26 | 1976-10-01 | Akishima Kagaku Kogyo Kk | Stabilized halogen-containing resin composition |
| JPS51111852A (en) * | 1975-03-27 | 1976-10-02 | Kyodo Yakuhin Kk | A method for stabilizing vinyl chloride resin |
| JPS5215621A (en) * | 1975-07-25 | 1977-02-05 | Teijin Ltd | Apparatus for producing pulp particles |
| JPS5247948A (en) * | 1975-10-14 | 1977-04-16 | Kiichirou Sarui | Method of producing combined body of paste food of konjak and derivative thereof and animal protein |
| JPS5247949A (en) * | 1975-10-08 | 1977-04-16 | Kyupi Kk | Method of producing processed egg white food |
| JPS52126452A (en) * | 1976-04-16 | 1977-10-24 | Akishima Kagaku Kogyo | Stabilized halogenncontained resin composition |
| JPS52139155A (en) * | 1976-05-18 | 1977-11-19 | Katsuta Kako Kk | Compositions of high molecular compounds stabilized |
| JPS52141855A (en) * | 1976-05-20 | 1977-11-26 | Rhone Poulenc Ind | Stabilized composition based on polyvinyl chloride |
| JPS52145452A (en) * | 1976-05-12 | 1977-12-03 | Katsuta Kako Kk | Stabilized high molecular material compositions |
| JPS54102348A (en) * | 1978-01-31 | 1979-08-11 | Adeka Argus Chem Co Ltd | Halogen-containing resin composition |
-
1978
- 1978-11-24 JP JP14563478A patent/JPS5571744A/ja active Granted
Patent Citations (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3375304A (en) * | 1965-01-04 | 1968-03-26 | Small Business Administ | Polyphosphites |
| GB1180398A (en) * | 1966-09-08 | 1970-02-04 | Pure Chem Ltd | Improvements relating to Organic Phosphites |
| JPS5167349A (ja) * | 1974-12-07 | 1976-06-10 | Adeka Argus Chemical Co Ltd | Harogenganjujushisoseibutsu |
| JPS5195447A (enExample) * | 1975-01-10 | 1976-08-21 | ||
| JPS51111252A (en) * | 1975-03-26 | 1976-10-01 | Akishima Kagaku Kogyo Kk | Stabilized halogen-containing resin composition |
| JPS51111852A (en) * | 1975-03-27 | 1976-10-02 | Kyodo Yakuhin Kk | A method for stabilizing vinyl chloride resin |
| JPS5215621A (en) * | 1975-07-25 | 1977-02-05 | Teijin Ltd | Apparatus for producing pulp particles |
| JPS5247949A (en) * | 1975-10-08 | 1977-04-16 | Kyupi Kk | Method of producing processed egg white food |
| JPS5247948A (en) * | 1975-10-14 | 1977-04-16 | Kiichirou Sarui | Method of producing combined body of paste food of konjak and derivative thereof and animal protein |
| JPS52126452A (en) * | 1976-04-16 | 1977-10-24 | Akishima Kagaku Kogyo | Stabilized halogenncontained resin composition |
| JPS52145452A (en) * | 1976-05-12 | 1977-12-03 | Katsuta Kako Kk | Stabilized high molecular material compositions |
| JPS52139155A (en) * | 1976-05-18 | 1977-11-19 | Katsuta Kako Kk | Compositions of high molecular compounds stabilized |
| JPS52141855A (en) * | 1976-05-20 | 1977-11-26 | Rhone Poulenc Ind | Stabilized composition based on polyvinyl chloride |
| JPS54102348A (en) * | 1978-01-31 | 1979-08-11 | Adeka Argus Chem Co Ltd | Halogen-containing resin composition |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5969015A (en) * | 1996-09-25 | 1999-10-19 | Witco Vinyl Additives Gmbh | Monomeric and oligomeric bisphosphites as stabilisers for polyvinyl chloride |
| US20130225736A1 (en) * | 2010-02-19 | 2013-08-29 | Dover Chemical Corporation | Alkylphenol free - liquid polymeric polyphosphite polymer stabilizers |
| US20140329943A1 (en) * | 2010-02-19 | 2014-11-06 | Dover Chemical Corporation | Alkylphenol free - liquid polymeric polyphosphite polymer stabilizers |
| US9982112B2 (en) * | 2010-02-19 | 2018-05-29 | Dover Chemical Corporation | Copolymeric polyphosphite polymer stabilizers |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6126809B2 (enExample) | 1986-06-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5592758A (en) | Resin composition | |
| JPS5674249A (en) | Silver halide color photographic material | |
| JPS5736142A (en) | Composition of resin containing halogen | |
| JPS5550063A (en) | Flame retarding of combustible synthetic resin | |
| FI854603A0 (fi) | Foerfarande och mellanprodukter foer framstaellning av 5-alkyl-1-fenyl-2-piperazino-alkylpyrazolin-3-on -foereningar. | |
| JPS5571744A (en) | Chlorine-containing resin composition | |
| JPS5595953A (en) | Electrophotographic photoreceptor | |
| JPS55135158A (en) | Stabilizer for resin | |
| JPS5536838A (en) | Novel light absorber and photoresist composition containing this | |
| JPS5589347A (en) | Prevention of discoloration of polyvinyl chloride resin | |
| JPS55106246A (en) | Polymer composition | |
| JPS55106255A (en) | Halogen-containing resin composition | |
| JPS5540730A (en) | Stabilized polyphenylene oxide resin composition | |
| JPS5340745A (en) | Organophosphorus compound and chlorine-containing resin composition | |
| JPS5424882A (en) | Novel heterocyclic compounds and their preparation | |
| JPS52108943A (en) | Alkyl phenyl ketone derivative | |
| JPS5774345A (en) | Halogen-containing resin composition | |
| JPS5414956A (en) | Novel 3-amino-4-homoisotwistan derivative | |
| JPS56118442A (en) | Halogen-containing resin composition | |
| JPS5698243A (en) | Synthetic resin composition | |
| JPS5575443A (en) | Polycarbonate compositon | |
| JPS5527330A (en) | Acrylonitrile-butadiene-styrene resin composition having improved weather resistance and low-temperature resistance | |
| JPS5550043A (en) | Halogen-containing resin composition | |
| JPS54119544A (en) | Flame-retardant synthetic resin composition | |
| JPS5525424A (en) | Stabilization of halogen-containing polymer |