JPH0621105B2 - 置換ナフトエ酸化合物の製造方法 - Google Patents
置換ナフトエ酸化合物の製造方法Info
- Publication number
- JPH0621105B2 JPH0621105B2 JP61091440A JP9144086A JPH0621105B2 JP H0621105 B2 JPH0621105 B2 JP H0621105B2 JP 61091440 A JP61091440 A JP 61091440A JP 9144086 A JP9144086 A JP 9144086A JP H0621105 B2 JPH0621105 B2 JP H0621105B2
- Authority
- JP
- Japan
- Prior art keywords
- alkoxy
- cyanonaphthalene
- trifluoromethyl
- methoxy
- halo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 7
- -1 naphthoic acid compound Chemical class 0.000 title claims description 12
- 238000000034 method Methods 0.000 claims abstract description 40
- 125000001183 hydrocarbyl group Chemical group 0.000 claims abstract description 13
- 239000002243 precursor Substances 0.000 claims abstract description 13
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000001475 halogen functional group Chemical group 0.000 claims abstract description 11
- 230000002140 halogenating effect Effects 0.000 claims abstract description 3
- 230000003301 hydrolyzing effect Effects 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 25
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 claims description 19
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 13
- NPULUKJLDRIOAW-UHFFFAOYSA-N 6-methoxy-3,4-dihydronaphthalene-1-carbonitrile Chemical compound N#CC1=CCCC2=CC(OC)=CC=C21 NPULUKJLDRIOAW-UHFFFAOYSA-N 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 239000002841 Lewis acid Substances 0.000 claims description 6
- 150000007517 lewis acids Chemical class 0.000 claims description 6
- OBVHIQXSTOJOBZ-UHFFFAOYSA-N 6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=C(C(F)(F)F)C(OC)=CC=C21 OBVHIQXSTOJOBZ-UHFFFAOYSA-N 0.000 claims description 5
- 150000002825 nitriles Chemical group 0.000 claims description 5
- PGQFNNJLLVRLLW-UHFFFAOYSA-N 6-methoxynaphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=CC(OC)=CC=C21 PGQFNNJLLVRLLW-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- MLTJLVQKLKQHPC-UHFFFAOYSA-N 5-bromo-6-methoxynaphthalene-1-carbonitrile Chemical group N#CC1=CC=CC2=C(Br)C(OC)=CC=C21 MLTJLVQKLKQHPC-UHFFFAOYSA-N 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- RREGHWCOJVMOQL-UHFFFAOYSA-N 2-(trifluoromethyl)naphthalene-1-carbonitrile Chemical compound C1=CC=CC2=C(C#N)C(C(F)(F)F)=CC=C21 RREGHWCOJVMOQL-UHFFFAOYSA-N 0.000 claims 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 claims 1
- 239000000047 product Substances 0.000 abstract description 9
- 239000013067 intermediate product Substances 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 18
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 238000007333 cyanation reaction Methods 0.000 description 11
- 125000003545 alkoxy group Chemical group 0.000 description 10
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000005658 halogenation reaction Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 230000026030 halogenation Effects 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000006692 trifluoromethylation reaction Methods 0.000 description 5
- 238000010626 work up procedure Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- YJMNOKOLADGBKA-UHFFFAOYSA-N naphthalene-1-carbonitrile Chemical compound C1=CC=C2C(C#N)=CC=CC2=C1 YJMNOKOLADGBKA-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 230000031709 bromination Effects 0.000 description 3
- 238000005893 bromination reaction Methods 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- UYCAUPASBSROMS-AWQJXPNKSA-M sodium;2,2,2-trifluoroacetate Chemical compound [Na+].[O-][13C](=O)[13C](F)(F)F UYCAUPASBSROMS-AWQJXPNKSA-M 0.000 description 3
- DHMJKHNLPGQGDX-UHFFFAOYSA-N 5-iodo-6-methoxynaphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=C(I)C(OC)=CC=C21 DHMJKHNLPGQGDX-UHFFFAOYSA-N 0.000 description 2
- WRZAWKSSADRYTA-UHFFFAOYSA-N 6-methoxynaphthalene-1-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=CC(OC)=CC=C21 WRZAWKSSADRYTA-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- LUKAEGULILILON-UHFFFAOYSA-M CC([O-])=O.F.F.F.[Na+] Chemical compound CC([O-])=O.F.F.F.[Na+] LUKAEGULILILON-UHFFFAOYSA-M 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000005899 aromatization reaction Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000026045 iodination Effects 0.000 description 2
- 238000006192 iodination reaction Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- RHWIHRLTIWWWCD-UHFFFAOYSA-N methyl 6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylate Chemical compound COC1=CC=C2C(C(=O)OC)=CC=CC2=C1C(F)(F)F RHWIHRLTIWWWCD-UHFFFAOYSA-N 0.000 description 2
- OIEDIIUKHOBNIG-UHFFFAOYSA-N methyl 6-methoxynaphthalene-1-carboxylate Chemical compound COC1=CC=C2C(C(=O)OC)=CC=CC2=C1 OIEDIIUKHOBNIG-UHFFFAOYSA-N 0.000 description 2
- 150000005209 naphthoic acids Chemical class 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000012450 pharmaceutical intermediate Substances 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- KEIFWROAQVVDBN-UHFFFAOYSA-N 1,2-dihydronaphthalene Chemical compound C1=CC=C2C=CCCC2=C1 KEIFWROAQVVDBN-UHFFFAOYSA-N 0.000 description 1
- LDMKXMSMYUYUNU-UHFFFAOYSA-N 2-(trifluoromethyl)naphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(C(F)(F)F)C=CC2=C1 LDMKXMSMYUYUNU-UHFFFAOYSA-N 0.000 description 1
- OSTYZAHQVPMQHI-UHFFFAOYSA-N 2-methoxynaphthalene-1-carboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(OC)=CC=C21 OSTYZAHQVPMQHI-UHFFFAOYSA-N 0.000 description 1
- AEBBCDMWPOXGSG-UHFFFAOYSA-N 6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C(C(F)(F)F)C(OC)=CC=C21 AEBBCDMWPOXGSG-UHFFFAOYSA-N 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminium flouride Chemical compound F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000272194 Ciconiiformes Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001442654 Percnon planissimum Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- YCLAMANSVUJYPT-UHFFFAOYSA-K aluminum;chloride;dihydroxide Chemical compound O[Al](O)Cl YCLAMANSVUJYPT-UHFFFAOYSA-K 0.000 description 1
- IDOSCGGXFAKNLS-UHFFFAOYSA-K aluminum;dichloride;hydroxide Chemical compound [Cl-].[Cl-].[Al+2]O IDOSCGGXFAKNLS-UHFFFAOYSA-K 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- WQAJKGNQVZTJAE-UHFFFAOYSA-M chloro(diethoxy)alumane Chemical compound [Cl-].CCO[Al+]OCC WQAJKGNQVZTJAE-UHFFFAOYSA-M 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- NPEFICOHWIZPMC-UHFFFAOYSA-L dichloroalumanylium;ethanolate Chemical compound [Cl-].[Cl-].CCO[Al+2] NPEFICOHWIZPMC-UHFFFAOYSA-L 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- 238000005906 dihydroxylation reaction Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940088679 drug related substance Drugs 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- UPWPDUACHOATKO-UHFFFAOYSA-K gallium trichloride Chemical compound Cl[Ga](Cl)Cl UPWPDUACHOATKO-UHFFFAOYSA-K 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010813 internal standard method Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- OVJOQRHZXHGGSK-UHFFFAOYSA-N methyl 5-iodo-6-methoxynaphthalene-1-carboxylate Chemical compound COC1=CC=C2C(C(=O)OC)=CC=CC2=C1I OVJOQRHZXHGGSK-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- LQNUZADURLCDLV-IDEBNGHGSA-N nitrobenzene Chemical group [O-][N+](=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 LQNUZADURLCDLV-IDEBNGHGSA-N 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- KRRBFUJMQBDDPR-UHFFFAOYSA-N tetrabutylazanium;cyanide Chemical compound N#[C-].CCCC[N+](CCCC)(CCCC)CCCC KRRBFUJMQBDDPR-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- HJHUXWBTVVFLQI-UHFFFAOYSA-N tributyl(methyl)azanium Chemical compound CCCC[N+](C)(CCCC)CCCC HJHUXWBTVVFLQI-UHFFFAOYSA-N 0.000 description 1
- IPILPUZVTYHGIL-UHFFFAOYSA-M tributyl(methyl)azanium;chloride Chemical compound [Cl-].CCCC[N+](C)(CCCC)CCCC IPILPUZVTYHGIL-UHFFFAOYSA-M 0.000 description 1
- VPAYJEUHKVESSD-UHFFFAOYSA-N trifluoroiodomethane Chemical compound FC(F)(F)I VPAYJEUHKVESSD-UHFFFAOYSA-N 0.000 description 1
- WRTMQOHKMFDUKX-UHFFFAOYSA-N triiodide Chemical compound I[I-]I WRTMQOHKMFDUKX-UHFFFAOYSA-N 0.000 description 1
- SEEUAESSVMEHKD-UHFFFAOYSA-O trimethylazanium;cyanide Chemical compound N#[C-].C[NH+](C)C SEEUAESSVMEHKD-UHFFFAOYSA-O 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/08—Preparation of carboxylic acids or their salts, halides or anhydrides from nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US724474 | 1985-04-18 | ||
| US06/724,474 US4590010A (en) | 1985-04-18 | 1985-04-18 | Substituted naphthoic acid process |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS61280449A JPS61280449A (ja) | 1986-12-11 |
| JPH0621105B2 true JPH0621105B2 (ja) | 1994-03-23 |
Family
ID=24910582
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP61091440A Expired - Lifetime JPH0621105B2 (ja) | 1985-04-18 | 1986-04-18 | 置換ナフトエ酸化合物の製造方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4590010A (enExample) |
| EP (1) | EP0199646B1 (enExample) |
| JP (1) | JPH0621105B2 (enExample) |
| AT (1) | ATE67175T1 (enExample) |
| CA (1) | CA1265529A1 (enExample) |
| DE (1) | DE3681324D1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4629808A (en) * | 1985-06-20 | 1986-12-16 | Ethyl Corporation | Process for hydrolyzing nitriles |
| US4808748A (en) * | 1985-12-12 | 1989-02-28 | Ethyl Corporation | Trifluoromethylation process |
| US4699993A (en) * | 1985-12-12 | 1987-10-13 | Ethyl Corporation | Perfluoroalkylnaphthalene compounds |
| US4822904A (en) * | 1985-12-12 | 1989-04-18 | Ethyl Corporation | Perfluoroalkylation process |
| US4762943A (en) * | 1986-06-30 | 1988-08-09 | Ethyl Corporation | Aromatization process |
| US4764635A (en) * | 1986-08-14 | 1988-08-16 | Ethyl Corporation | Aromatization process |
| US4731380A (en) * | 1986-08-26 | 1988-03-15 | American Home Products Corporation (Del.) | Tolerstat as an agent for diabetic periodontitis |
| US4824989A (en) * | 1987-03-03 | 1989-04-25 | Ethyl Corporation | Recovery process |
| US4785131A (en) * | 1987-10-26 | 1988-11-15 | Ethyl Corporation | Substituted cyanonaphthalene process |
| US4824988A (en) * | 1987-10-26 | 1989-04-25 | Ethyl Corporation | Process for recovering cuprous iodide catalyst used in synthesis of (trifluoromethyl)napthalenes |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1176269A (en) * | 1981-03-02 | 1984-10-16 | Kazimir Sestanj | N-naphthoylglycine derivatives |
| US4408077A (en) * | 1981-11-13 | 1983-10-04 | Ayerst, Mckeena & Harrison, Inc. | 6-(Lower alkoxy)-5-(trifluoromethyl)-1-naphthalenecarboxaldehydes |
| US4562286A (en) * | 1984-11-01 | 1985-12-31 | Occidental Chemical Corporation | Process for preparing methoxytrifluoromethylnaphthoic acid from dimethylnaphthalene |
| US4536343A (en) * | 1984-11-29 | 1985-08-20 | Ethyl Corporation | Process for preparing alpha-arylacrylonitriles |
-
1985
- 1985-04-18 US US06/724,474 patent/US4590010A/en not_active Expired - Fee Related
-
1986
- 1986-03-27 CA CA000505467A patent/CA1265529A1/en active Granted
- 1986-04-17 DE DE8686400837T patent/DE3681324D1/de not_active Expired - Fee Related
- 1986-04-17 AT AT86400837T patent/ATE67175T1/de active
- 1986-04-17 EP EP86400837A patent/EP0199646B1/en not_active Expired
- 1986-04-18 JP JP61091440A patent/JPH0621105B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0199646B1 (en) | 1991-09-11 |
| DE3681324D1 (de) | 1991-10-17 |
| JPS61280449A (ja) | 1986-12-11 |
| US4590010A (en) | 1986-05-20 |
| EP0199646A3 (en) | 1988-03-23 |
| CA1269671C (enExample) | 1990-05-29 |
| CA1265529A1 (en) | 1990-02-06 |
| ATE67175T1 (de) | 1991-09-15 |
| EP0199646A2 (en) | 1986-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0621105B2 (ja) | 置換ナフトエ酸化合物の製造方法 | |
| US4326087A (en) | 3-Bromo-4-fluoro-benzyl derivatives | |
| JP4511359B2 (ja) | 殺虫剤用の合成中間体を調製するための新規方法 | |
| US6580002B2 (en) | Process for the preparation of trifluoromethyl-substituted biphenylcarboxylic acids and novel trichloromethyl-and trifluoromethyl-substituted biphenylcarbonitriles | |
| JPS6185350A (ja) | 2,4‐ジクロロ‐5‐フルオロ安息香酸の製法 | |
| US6350915B1 (en) | Process for the synthesis of 1-(3,5-bis(trifluoromethyl)-phenyl)ethan-1-one | |
| CA1269671A (en) | Intermediates for substituted naphthoic acid process | |
| CA1220226A (fr) | Procede de preparation d'anilines meta substituees | |
| US3424804A (en) | Preparation of highly fluorinated aromatic compounds | |
| JPS6133829B2 (enExample) | ||
| EP1094053B1 (en) | Method of preparing fluoroaromatic compounds | |
| JPS6352611B2 (enExample) | ||
| US4144264A (en) | Process for producing a 3-methyl-2-(4-halophenyl)butyronitrile | |
| JPH0546331B2 (enExample) | ||
| EP0022607B1 (en) | Process for the preparation of halogenated hydrocarbons | |
| US6814895B2 (en) | Process for the synthesis of 1-(3,5-bis(trifluoromethyl)phenyl)ethan-1-one | |
| US4581176A (en) | Process for preparing alpha-arylacrylonitriles | |
| US4590013A (en) | Process for preparing alpha arylacrylonitriles | |
| EP0183249B1 (en) | Process for preparing alpha-arylacrylonitriles | |
| US3388155A (en) | 4, 4-dihalo-2-(4-biphenylyl)-3-butenoic acids | |
| JP2845587B2 (ja) | トリフルオロメチル誘導体の製造方法 | |
| US4590012A (en) | Process for preparing alpha-arylacrylonitriles | |
| US4629808A (en) | Process for hydrolyzing nitriles | |
| HU188283B (en) | Process for preparing 3-bromo-4-fluoro-toluene | |
| CA1255696A (en) | PROCESS FOR PREPARING .alpha.-ARYLACRYLONITRILES |