JPH0536415B2 - - Google Patents
Info
- Publication number
- JPH0536415B2 JPH0536415B2 JP58104088A JP10408883A JPH0536415B2 JP H0536415 B2 JPH0536415 B2 JP H0536415B2 JP 58104088 A JP58104088 A JP 58104088A JP 10408883 A JP10408883 A JP 10408883A JP H0536415 B2 JPH0536415 B2 JP H0536415B2
- Authority
- JP
- Japan
- Prior art keywords
- acid
- composition
- pertechnetate
- deoxyascorbic
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 claims abstract description 68
- 239000003638 chemical reducing agent Substances 0.000 claims abstract description 40
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- CRTGSPPMTACQBL-UHFFFAOYSA-N 2,3-dihydroxycyclopent-2-en-1-one Chemical compound OC1=C(O)C(=O)CC1 CRTGSPPMTACQBL-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000003381 stabilizer Substances 0.000 claims description 55
- 239000002872 contrast media Substances 0.000 claims description 46
- 239000000243 solution Substances 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 31
- 229910052713 technetium Inorganic materials 0.000 claims description 30
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 210000000056 organ Anatomy 0.000 claims description 17
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 claims description 13
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical group 0.000 claims description 13
- 159000000000 sodium salts Chemical class 0.000 claims description 13
- 235000011150 stannous chloride Nutrition 0.000 claims description 13
- 239000001119 stannous chloride Substances 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- GKLVYJBZJHMRIY-OUBTZVSYSA-N Technetium-99 Chemical compound [99Tc] GKLVYJBZJHMRIY-OUBTZVSYSA-N 0.000 claims description 11
- LKVQNCTVFJZFIV-JLAZNSOCSA-N (2r)-2-[(1r)-2-bromo-1-hydroxyethyl]-3,4-dihydroxy-2h-furan-5-one Chemical group BrC[C@H](O)[C@H]1OC(=O)C(O)=C1O LKVQNCTVFJZFIV-JLAZNSOCSA-N 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 229940056501 technetium 99m Drugs 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 8
- 150000005480 nicotinamides Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims description 6
- AXBKGZYBZKJIMK-JLAZNSOCSA-N (2r)-2-[(1r)-2-chloro-1-hydroxyethyl]-3,4-dihydroxy-2h-furan-5-one Chemical compound ClC[C@H](O)[C@H]1OC(=O)C(O)=C1O AXBKGZYBZKJIMK-JLAZNSOCSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical group OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 claims description 5
- 229960003512 nicotinic acid Drugs 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 150000001721 carbon Chemical group 0.000 claims description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 4
- 235000005152 nicotinamide Nutrition 0.000 claims description 4
- 239000011570 nicotinamide Substances 0.000 claims description 4
- DFPAKSUCGFBDDF-UHFFFAOYSA-N nicotinic acid amide Natural products NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- IUKBJLIGIPTHPT-JLAZNSOCSA-N (2r)-3,4-dihydroxy-2-[(1r)-1-hydroxy-2-iodoethyl]-2h-furan-5-one Chemical compound IC[C@H](O)[C@H]1OC(=O)C(O)=C1O IUKBJLIGIPTHPT-JLAZNSOCSA-N 0.000 claims description 3
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 claims description 3
- 230000002285 radioactive effect Effects 0.000 claims description 3
- FKXWTUADKHXMMA-UHFFFAOYSA-N C.CN(C)P(O)(=O)OP(O)=O Chemical compound C.CN(C)P(O)(=O)OP(O)=O FKXWTUADKHXMMA-UHFFFAOYSA-N 0.000 claims description 2
- ZFIJYRJDDOSEIT-UHFFFAOYSA-N C.CNP(O)(=O)OP(O)=O Chemical compound C.CNP(O)(=O)OP(O)=O ZFIJYRJDDOSEIT-UHFFFAOYSA-N 0.000 claims description 2
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 claims description 2
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 2
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 claims description 2
- 229940109126 chromous chloride Drugs 0.000 claims description 2
- 239000011790 ferrous sulphate Substances 0.000 claims description 2
- 235000003891 ferrous sulphate Nutrition 0.000 claims description 2
- 229910052816 inorganic phosphate Inorganic materials 0.000 claims description 2
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 3
- LGBPWIAXPVUTMY-JLAZNSOCSA-N (2r)-3,4-dihydroxy-2-[(1s)-1-hydroxyethyl]-2h-furan-5-one Chemical compound C[C@H](O)[C@H]1OC(=O)C(O)=C1O LGBPWIAXPVUTMY-JLAZNSOCSA-N 0.000 claims 1
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 claims 1
- 238000003384 imaging method Methods 0.000 abstract description 22
- 229910019142 PO4 Inorganic materials 0.000 abstract description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 abstract description 3
- 239000010452 phosphate Substances 0.000 abstract description 3
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 abstract description 3
- 239000012216 imaging agent Substances 0.000 abstract 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- 210000001519 tissue Anatomy 0.000 description 15
- -1 chloro-6-deoxyascorbic acid Chemical compound 0.000 description 14
- 238000000034 method Methods 0.000 description 14
- 239000000969 carrier Substances 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 9
- 150000003863 ammonium salts Chemical class 0.000 description 8
- XQRLCLUYWUNEEH-UHFFFAOYSA-L diphosphonate(2-) Chemical compound [O-]P(=O)OP([O-])=O XQRLCLUYWUNEEH-UHFFFAOYSA-L 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 6
- 210000000988 bone and bone Anatomy 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 235000011180 diphosphates Nutrition 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 230000008685 targeting Effects 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 4
- HJZKOAYDRQLPME-UHFFFAOYSA-N oxidronic acid Chemical compound OP(=O)(O)C(O)P(O)(O)=O HJZKOAYDRQLPME-UHFFFAOYSA-N 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 229940048084 pyrophosphate Drugs 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 235000010323 ascorbic acid Nutrition 0.000 description 3
- 229960005070 ascorbic acid Drugs 0.000 description 3
- 239000011668 ascorbic acid Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- GBHRVZIGDIUCJB-UHFFFAOYSA-N hydrogenphosphite Chemical class OP([O-])[O-] GBHRVZIGDIUCJB-UHFFFAOYSA-N 0.000 description 3
- 230000002452 interceptive effect Effects 0.000 description 3
- 238000010253 intravenous injection Methods 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- HXKKHQJGJAFBHI-GSVOUGTGSA-O (2R)-2-hydroxypropylammonium Chemical class C[C@@H](O)C[NH3+] HXKKHQJGJAFBHI-GSVOUGTGSA-O 0.000 description 2
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-DUZGATOHSA-N D-araboascorbic acid Natural products OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-DUZGATOHSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 150000000996 L-ascorbic acids Chemical class 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 235000010350 erythorbic acid Nutrition 0.000 description 2
- 239000004318 erythorbic acid Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- PUZSUVGRVHEUQO-UHFFFAOYSA-N gentisyl alcohol Chemical compound OCC1=CC(O)=CC=C1O PUZSUVGRVHEUQO-UHFFFAOYSA-N 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229940026239 isoascorbic acid Drugs 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- 210000004872 soft tissue Anatomy 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- 125000005209 triethanolammonium group Chemical class 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- YXTDAZMTQFUZHK-ZVGUSBNCSA-L (2r,3r)-2,3-dihydroxybutanedioate;tin(2+) Chemical compound [Sn+2].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O YXTDAZMTQFUZHK-ZVGUSBNCSA-L 0.000 description 1
- ILBBPBRROBHKQL-SAMGZKJBSA-N (2s)-3,4-dihydroxy-2-[(1r,2r)-1,2,3-trihydroxypropyl]-2h-furan-5-one Chemical compound OC[C@@H](O)[C@@H](O)[C@@H]1OC(=O)C(O)=C1O ILBBPBRROBHKQL-SAMGZKJBSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- USYAMXSCYLGBPT-UHFFFAOYSA-L 3-carboxy-3-hydroxypentanedioate;tin(2+) Chemical compound [Sn+2].OC(=O)CC(O)(C([O-])=O)CC([O-])=O USYAMXSCYLGBPT-UHFFFAOYSA-L 0.000 description 1
- JDJBRMNTXORYEN-UHFFFAOYSA-N 6-bromopyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=C(Br)N=C1 JDJBRMNTXORYEN-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical class NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- ZJZOHFDIYSCSPH-UHFFFAOYSA-N C.OP(=O)OP(O)(O)=O Chemical compound C.OP(=O)OP(O)(O)=O ZJZOHFDIYSCSPH-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241001148502 Colysis Species 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical class NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- KPNHHAHNJHLDMX-UHFFFAOYSA-N NOP(OP(O)=O)=O Chemical class NOP(OP(O)=O)=O KPNHHAHNJHLDMX-UHFFFAOYSA-N 0.000 description 1
- RXBSVWDGDCSOSJ-UHFFFAOYSA-N ONP(=O)(O)OP(=O)O.C Chemical compound ONP(=O)(O)OP(=O)O.C RXBSVWDGDCSOSJ-UHFFFAOYSA-N 0.000 description 1
- 229910018828 PO3H2 Inorganic materials 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 230000002308 calcification Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 229960005219 gentisic acid Drugs 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000012857 radioactive material Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 210000002356 skeleton Anatomy 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 229960002799 stannous fluoride Drugs 0.000 description 1
- RCIVOBGSMSSVTR-UHFFFAOYSA-L stannous sulfate Chemical compound [SnH2+2].[O-]S([O-])(=O)=O RCIVOBGSMSSVTR-UHFFFAOYSA-L 0.000 description 1
- 229940007163 stannous tartrate Drugs 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- BKVIYDNLLOSFOA-OIOBTWANSA-N thallium-201 Chemical compound [201Tl] BKVIYDNLLOSFOA-OIOBTWANSA-N 0.000 description 1
- 210000001685 thyroid gland Anatomy 0.000 description 1
- 229910000375 tin(II) sulfate Inorganic materials 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/025—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus inorganic Tc complexes or compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/04—Organic compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2123/00—Preparations for testing in vivo
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Optics & Photonics (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Physics & Mathematics (AREA)
- Public Health (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Inorganic Chemistry (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Apparatus For Radiation Diagnosis (AREA)
- Medicinal Preparation (AREA)
- Measurement Of Radiation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/387,138 US4440738A (en) | 1982-06-10 | 1982-06-10 | Stable radiographic imaging agents |
| US387138 | 1982-06-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS595126A JPS595126A (ja) | 1984-01-12 |
| JPH0536415B2 true JPH0536415B2 (enExample) | 1993-05-31 |
Family
ID=23528633
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58104088A Granted JPS595126A (ja) | 1982-06-10 | 1983-06-10 | 安定な放射線写真造影剤 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4440738A (enExample) |
| EP (1) | EP0096930B1 (enExample) |
| JP (1) | JPS595126A (enExample) |
| AT (1) | ATE26537T1 (enExample) |
| AU (1) | AU555898B2 (enExample) |
| CA (1) | CA1186992A (enExample) |
| DE (1) | DE3370935D1 (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4504462A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| DE3237573A1 (de) * | 1982-10-09 | 1984-04-12 | Hoechst Ag, 6230 Frankfurt | Technetium-99m-tri- und tetraphosphonate zur szintigraphischen dastellung res-haltiger organe und der lymphgefaesse und verfahren zu deren herstellung |
| US4707353A (en) * | 1982-12-08 | 1987-11-17 | Mallinckrodt, Inc. | Radiographic imaging agents |
| US4510125A (en) * | 1982-12-08 | 1985-04-09 | Mallinckrodt, Inc. | Process for making lyophilized radiographic imaging kit |
| EP0111414A3 (en) * | 1982-12-08 | 1985-05-02 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| US5393512A (en) * | 1985-01-14 | 1995-02-28 | Vanderheyden; Jean-Luc | Stable therapeutic radionuclide compositions and methods for preparation thereof |
| GB8510726D0 (en) * | 1985-04-26 | 1985-06-26 | Amersham Int Plc | Stabilised radio-labelled compounds |
| US4778672A (en) * | 1985-11-27 | 1988-10-18 | University Of Cincinnati | Method of isolating radioactive perrhenate or pertechnetate from an aqueous solution |
| US4935222A (en) * | 1986-06-13 | 1990-06-19 | University Of Cincinnati | Procedure for isolating and purifying radioactive ligated rhenium pharmaceuticals and use thereof and kit |
| DE3728599A1 (de) * | 1986-12-10 | 1988-06-23 | Hoechst Ag | Verfahren zur herstellung einer mit technetium-99m-markierten organspezifischen substanz |
| DE3780820D1 (enExample) * | 1987-10-30 | 1992-09-03 | Sorin Biomedica S.P.A., Saluggia, Vercelli, It | |
| DE3810819A1 (de) * | 1988-03-30 | 1989-10-12 | Hoechst Ag | Tc-99m-(omega)-alkylphosphinico-1-hydroxyalkan-1, 1-diphosphonate enthaltende praeparate zur knochenszintigraphie sowie verfahren zur herstellung dieser praeparate |
| US4880615A (en) * | 1988-11-25 | 1989-11-14 | Merck & Co., Inc. | Stabilized radiopharmaceutical compositions |
| US5116944A (en) * | 1989-12-29 | 1992-05-26 | Neorx Corporation | Conjugates having improved characteristics for in vivo administration |
| WO1993004702A1 (en) * | 1991-08-29 | 1993-03-18 | Mallinckrodt Medical, Inc. | Use of gentisic acid or gentisyl alcohol for stabilising radiolabeled peptides and proteins |
| HRP930131A2 (en) * | 1993-02-05 | 1997-02-28 | Bozidar Suskovic | Amino-ascorbic acid derivatives, process for the preparation and use thereof |
| US5559251A (en) * | 1993-02-05 | 1996-09-24 | Pliva, Farmaceutska | Derivatives of amino-ascorbic acid, the processes for their preparation and use |
| US6187286B1 (en) * | 1996-12-27 | 2001-02-13 | The General Hospital Corporation | Tumor imaging agents, methods and kits |
| US6548042B2 (en) * | 2000-08-07 | 2003-04-15 | Arstad Erik | Bis-phosphonate compounds |
| JP5139678B2 (ja) * | 2003-07-24 | 2013-02-06 | ブラッコ・イメージング・ソシエタ・ペル・アチオニ | 安定な放射性医薬品組成物およびその製法 |
| US8440787B2 (en) | 2007-10-23 | 2013-05-14 | Nektar Therapeutics | Hydroxyapatite-targeting multiarm polymers and conjugates made therefrom |
| EP2572736A1 (en) * | 2011-09-23 | 2013-03-27 | Spago Imaging AB | Nanostructures comprising manganese |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2832689A (en) * | 1952-01-24 | 1958-04-29 | Research Corp | Preservation of organic materials by irradiation |
| US3735295A (en) * | 1972-03-28 | 1973-05-22 | Westinghouse Electric Corp | Electric control devices with mechanical interlock |
| US3735001A (en) * | 1972-05-24 | 1973-05-22 | Atomic Energy Commission | Technetium bone scanning medium |
| CA1027135A (en) * | 1973-06-11 | 1978-02-28 | Research Corporation | Bone-seeking technetium-99m complex |
| ZA761944B (en) * | 1975-04-30 | 1977-03-30 | Procter & Gamble | Stable radiographic scanning agents |
| US4364920A (en) * | 1975-04-30 | 1982-12-21 | Medi-Physics, Inc. | Stable diagnostic reagents |
| DE2543349C2 (de) * | 1975-09-29 | 1984-05-10 | Henkel KGaA, 4000 Düsseldorf | Preaparate zur herstellung von99m technetium-radiagnostica |
| US4054645A (en) * | 1976-08-24 | 1977-10-18 | Minnesota Mining And Manufacturing Company | Radiodiagnostic complexes employing fluorine-containing tin reducing agents |
| US4233284A (en) * | 1978-03-31 | 1980-11-11 | The Procter & Gamble Company | Stabilized radiographic scanning agents |
| US4229427A (en) * | 1978-06-28 | 1980-10-21 | The Procter & Gamble Company | Radioactive scanning agents with hydroquinone stabilizer |
| US4247534A (en) * | 1978-07-31 | 1981-01-27 | The Procter & Gamble Company | Radiographic scanning agent |
| US4427647A (en) * | 1980-08-12 | 1984-01-24 | Amersham International Limited | Method and reagent for making a radiopharmaceutical composition based on pertechnetate |
| JPS5750928A (en) * | 1980-09-13 | 1982-03-25 | Nippon Mejifuijitsukusu Kk | Diagnostic agent for scanning bone |
| DE3047107A1 (de) * | 1980-12-13 | 1982-07-29 | Hoechst Ag, 6000 Frankfurt | Verfahren zur hertellung von 1-amino-alkan-1,1-diphosphonsaeuren |
-
1982
- 1982-06-10 US US06/387,138 patent/US4440738A/en not_active Expired - Fee Related
-
1983
- 1983-06-07 AT AT83200826T patent/ATE26537T1/de not_active IP Right Cessation
- 1983-06-07 EP EP83200826A patent/EP0096930B1/en not_active Expired
- 1983-06-07 DE DE8383200826T patent/DE3370935D1/de not_active Expired
- 1983-06-09 CA CA000430066A patent/CA1186992A/en not_active Expired
- 1983-06-09 AU AU15672/83A patent/AU555898B2/en not_active Ceased
- 1983-06-10 JP JP58104088A patent/JPS595126A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU555898B2 (en) | 1986-10-16 |
| JPS595126A (ja) | 1984-01-12 |
| DE3370935D1 (en) | 1987-05-21 |
| EP0096930B1 (en) | 1987-04-15 |
| AU1567283A (en) | 1983-12-15 |
| CA1186992A (en) | 1985-05-14 |
| US4440738A (en) | 1984-04-03 |
| EP0096930A2 (en) | 1983-12-28 |
| ATE26537T1 (de) | 1987-05-15 |
| EP0096930A3 (en) | 1984-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0096930B1 (en) | Stable radiographic imaging agents | |
| US4233284A (en) | Stabilized radiographic scanning agents | |
| EP0006658B1 (en) | Radioactive scanning agents with hydroquinone as stabilizer and method for preparing them | |
| US4247534A (en) | Radiographic scanning agent | |
| EP0006659B1 (en) | Compositions useful in the preparation of stabilized radiographic scanning agents, a method of preparing them and the use of stannous gentisilate as stabilizer in these compositions | |
| US4497744A (en) | Gentisic acid salts as radiographic scanning agent stabilizers | |
| US4504462A (en) | Process for making a lyophilized product for use in skeletal imaging | |
| EP0096931B1 (en) | Radiographic imaging agents | |
| US4504463A (en) | Process for making a lyophilized product for use in skeletal imaging | |
| EP0096934B1 (en) | Radiographic imaging agents | |
| US4432963A (en) | Radiographic scanning agent | |
| Fawzi | Stabilized radiographic scanning agents | |
| Bevan | Radiographic scanning agent |