JPH048424B2 - - Google Patents
Info
- Publication number
- JPH048424B2 JPH048424B2 JP55058769A JP5876980A JPH048424B2 JP H048424 B2 JPH048424 B2 JP H048424B2 JP 55058769 A JP55058769 A JP 55058769A JP 5876980 A JP5876980 A JP 5876980A JP H048424 B2 JPH048424 B2 JP H048424B2
- Authority
- JP
- Japan
- Prior art keywords
- general formula
- stabilizer
- thermoplastic synthetic
- stabilizer according
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000003381 stabilizer Substances 0.000 claims description 24
- 229910052757 nitrogen Inorganic materials 0.000 claims description 20
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 13
- -1 polypropylene Polymers 0.000 claims description 12
- 229920001059 synthetic polymer Polymers 0.000 claims description 12
- 150000005690 diesters Chemical class 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 229920001169 thermoplastic Polymers 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000000654 additive Substances 0.000 claims description 8
- 239000004416 thermosoftening plastic Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 229920000098 polyolefin Polymers 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 3
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 claims description 3
- 230000000996 additive effect Effects 0.000 claims description 3
- 239000003963 antioxidant agent Substances 0.000 claims description 3
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 3
- 239000004800 polyvinyl chloride Substances 0.000 claims description 3
- 239000005033 polyvinylidene chloride Substances 0.000 claims description 3
- 239000006096 absorbing agent Substances 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 229920002521 macromolecule Polymers 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 230000000087 stabilizing effect Effects 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000004885 piperazines Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- VARKIGWTYBUWNT-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol Chemical compound OCCN1CCN(CCO)CC1 VARKIGWTYBUWNT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- 238000012430 stability testing Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 150000007970 thio esters Chemical class 0.000 description 2
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- VVURKMSVSTUWJQ-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)-2,5-dimethylpiperazin-1-yl]ethanol Chemical compound CC1CN(CCO)C(C)CN1CCO VVURKMSVSTUWJQ-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 229920000292 Polyquinoline Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- YTFJQDNGSQJFNA-UHFFFAOYSA-L benzyl phosphate Chemical compound [O-]P([O-])(=O)OCC1=CC=CC=C1 YTFJQDNGSQJFNA-UHFFFAOYSA-L 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003413 degradative effect Effects 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 229940063583 high-density polyethylene Drugs 0.000 description 1
- 125000000687 hydroquinonyl group Chemical class C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 229940093474 manganese carbonate Drugs 0.000 description 1
- 235000006748 manganese carbonate Nutrition 0.000 description 1
- 239000011656 manganese carbonate Substances 0.000 description 1
- 229910000016 manganese(II) carbonate Inorganic materials 0.000 description 1
- XMWCXZJXESXBBY-UHFFFAOYSA-L manganese(ii) carbonate Chemical compound [Mn+2].[O-]C([O-])=O XMWCXZJXESXBBY-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- QOHGMEYPUKSMST-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)propanoate Chemical compound COC(=O)C(C)C1=CC=C(O)C=C1 QOHGMEYPUKSMST-UHFFFAOYSA-N 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3442—Heterocyclic compounds having nitrogen in the ring having two nitrogen atoms in the ring
- C08K5/3462—Six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT22515/79A IT1113364B (it) | 1979-05-10 | 1979-05-10 | N,n'-di-(idrossi-fenil)derivati della piperrazina e loro impiego come stabilizzanti per polimeri |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55151572A JPS55151572A (en) | 1980-11-26 |
| JPH048424B2 true JPH048424B2 (esLanguage) | 1992-02-17 |
Family
ID=11197295
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5876980A Granted JPS55151572A (en) | 1979-05-10 | 1980-05-06 | N*n**dii*hydroxyphenyl* derivative of piperazine and use as polymer stabilizer |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4373042A (esLanguage) |
| EP (1) | EP0019237B1 (esLanguage) |
| JP (1) | JPS55151572A (esLanguage) |
| DE (1) | DE3069738D1 (esLanguage) |
| IT (1) | IT1113364B (esLanguage) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57203060A (en) * | 1981-06-05 | 1982-12-13 | Kowa Co | Piperazine derivative |
| US4404302A (en) * | 1982-05-27 | 1983-09-13 | Ferro Corporation | Acylated hindered hexahydropyrimidines and their use as light stabilizing agents |
| DE3687231T2 (de) * | 1986-07-16 | 1993-04-22 | Goodrich Co B F | N-(substituiertes-cyclisches-alkylenimin)-alpha-(3,5-dialkyl-4-hydroxyphenyl)-alpha, alpha-dialkylacetamide. |
| US4829111A (en) * | 1988-02-02 | 1989-05-09 | Mitsubishi Petrochemical Co., Ltd. | Stabilizer composition for synthetic resin and synthetic resin composition containing the same |
| EP0956958B1 (en) * | 1998-04-28 | 2004-06-30 | Canon Kabushiki Kaisha | Ink jet recording apparatus |
| CN105732537B (zh) * | 2014-12-11 | 2018-07-13 | 中国石油天然气股份有限公司 | 一种包含受阻酚和冠醚结构的双功能化合物、合成方法及其应用 |
| TW202517616A (zh) * | 2023-07-06 | 2025-05-01 | 比利時商eTheRNA免疫治療公司 | 可離子化脂質 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1391479A (fr) * | 1963-04-29 | 1965-03-05 | Geigy Ag J R | Nouveaux esters dérivés d'alkylhydroxy-benzènes et leurs applications, notamment à la stabilisation de matières organiques, par exemple de polyoléfines et de matières élastomères |
| US3435065A (en) * | 1965-10-22 | 1969-03-25 | Geigy Chem Corp | N,n,n',n' - (ethylenediamine) - tetrakis (ethylene - 3 - (3',5' - di-tert-butyl-4' - hydroxyphenyl)propionate) and compositions stabilized therewith |
| US3584047A (en) * | 1967-12-29 | 1971-06-08 | Geigy Chem Corp | Alkylhydroxyphenyl polyamides |
| US3681358A (en) * | 1968-12-09 | 1972-08-01 | Ciba Geigy Corp | Hindered phenolic esters of cyclic amino carboxylic acids |
| CH540954A (de) * | 1970-12-07 | 1973-08-31 | Ciba Geigy Ag | Stabilisatorsystem für Polyamide |
| US4070338A (en) * | 1975-04-10 | 1978-01-24 | Ciba-Geigy Corporation | Phenolic imidazolones and polymers stabilized therewith |
| DE2656769A1 (de) * | 1975-12-29 | 1977-07-14 | Ciba Geigy Ag | Neue phenol-stabilisatoren |
| DE2820716A1 (de) * | 1977-05-23 | 1978-12-07 | Sandoz Ag | Karbonate und urethane von 2,2'-alkylenoder cycloalkylen- bis-2,4-disubstituiertem phenol, deren herstellung und verwendung als antioxydantien in polymeren organischen materialien |
| IT1088576B (it) * | 1977-11-29 | 1985-06-10 | Montedison Spa | Stabilizzanti per polimeri e composizioni polimeriche con essi stabilizzati |
-
1979
- 1979-05-10 IT IT22515/79A patent/IT1113364B/it active
-
1980
- 1980-05-06 JP JP5876980A patent/JPS55151572A/ja active Granted
- 1980-05-09 US US06/148,389 patent/US4373042A/en not_active Expired - Lifetime
- 1980-05-09 DE DE8080102586T patent/DE3069738D1/de not_active Expired
- 1980-05-09 EP EP80102586A patent/EP0019237B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE3069738D1 (en) | 1985-01-17 |
| IT1113364B (it) | 1986-01-20 |
| EP0019237B1 (en) | 1984-12-05 |
| EP0019237A1 (en) | 1980-11-26 |
| US4373042A (en) | 1983-02-08 |
| JPS55151572A (en) | 1980-11-26 |
| IT7922515A0 (it) | 1979-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4525514A (en) | Stabilizer for polymeric substance and polymeric substance composition containing the same | |
| SU708995A3 (ru) | Полимерна композици | |
| US4210576A (en) | Stabilizers for polymers and polymers stabilized thereby | |
| US4148783A (en) | Hydroxybenzylmalonic acid derivatives | |
| US4246198A (en) | Hindered phenolic amides | |
| EP0022501B1 (en) | Polycondensates of substituted piperidines and use thereof as stabilizers for polymers | |
| US4276232A (en) | Phosphorus stabilizers | |
| JPH048424B2 (esLanguage) | ||
| JPH0219143B2 (esLanguage) | ||
| US4413075A (en) | Piperidine polymers and use thereof as stabilizers | |
| US3828052A (en) | Acyl hydrazones of 2,2,6,6-tetramethyl-piperidine-4-ones | |
| US4293466A (en) | Piperidine phosphite stabilizers for polymers and polymers stabilized thereby | |
| US4361695A (en) | Polyesters of N,N-di-alkanol-amines with di-(hydroxy-alkyl-benzyl) malonic acids and use thereof as stabilizers for polymers | |
| US4317767A (en) | Stabilizers for polymers and polymers stabilized thereby | |
| US3853890A (en) | Azine derivatives of piperidine | |
| US3745163A (en) | 2,2,6,6-tetramethyl piperidinyl-4-(dialkyl-hydroxy-benzoyl or phenyl alkanoyl)hydrazones | |
| EP0114658B1 (en) | Alkyl-substituted 4-methyl-piperidine derivatives and use thereof as stabilizers | |
| US4162247A (en) | Bis-(alkylphenyl)-alkanecarboxylic acid hydrazides, their preparation and use | |
| US3627725A (en) | Bis (3,5-dialkyl-4-hydroxybenzyl) malonic esters for stabilizing polymers | |
| JPS6412276B2 (esLanguage) | ||
| US3833636A (en) | Polymers stabilized with acyl hydrazones | |
| US3878237A (en) | Preparation of (4-hydroxy-3,5-dialkyl-benzyl) carboxylic acid esters | |
| EP0229655B1 (en) | Morpholine derivatives containing substituted piperidine groups and use thereof as stabilizers | |
| SU843763A3 (ru) | Полимерна композици | |
| JPH047341B2 (esLanguage) |