JPH0472579B2 - - Google Patents
Info
- Publication number
- JPH0472579B2 JPH0472579B2 JP59212747A JP21274784A JPH0472579B2 JP H0472579 B2 JPH0472579 B2 JP H0472579B2 JP 59212747 A JP59212747 A JP 59212747A JP 21274784 A JP21274784 A JP 21274784A JP H0472579 B2 JPH0472579 B2 JP H0472579B2
- Authority
- JP
- Japan
- Prior art keywords
- catalyst
- zeolite
- component
- silica
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000010457 zeolite Substances 0.000 claims description 123
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 111
- 229910021536 Zeolite Inorganic materials 0.000 claims description 108
- 239000003054 catalyst Substances 0.000 claims description 96
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 53
- 238000000034 method Methods 0.000 claims description 44
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 29
- 239000000377 silicon dioxide Substances 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 23
- 229910052751 metal Inorganic materials 0.000 claims description 20
- 239000002184 metal Substances 0.000 claims description 20
- 230000008569 process Effects 0.000 claims description 20
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 18
- 229930195733 hydrocarbon Natural products 0.000 claims description 18
- 150000002430 hydrocarbons Chemical class 0.000 claims description 18
- 238000005984 hydrogenation reaction Methods 0.000 claims description 18
- 239000004215 Carbon black (E152) Substances 0.000 claims description 15
- 238000004517 catalytic hydrocracking Methods 0.000 claims description 15
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 10
- 150000002739 metals Chemical class 0.000 claims description 9
- 229910052759 nickel Inorganic materials 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000011159 matrix material Substances 0.000 claims description 8
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 6
- 229910052750 molybdenum Inorganic materials 0.000 claims description 6
- 239000011733 molybdenum Substances 0.000 claims description 6
- 229910052697 platinum Inorganic materials 0.000 claims description 6
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052721 tungsten Inorganic materials 0.000 claims description 6
- 239000010937 tungsten Substances 0.000 claims description 6
- -1 hydride metals Chemical class 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- 230000000737 periodic effect Effects 0.000 claims description 5
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052741 iridium Inorganic materials 0.000 claims description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052703 rhodium Inorganic materials 0.000 claims description 3
- 239000010948 rhodium Substances 0.000 claims description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 3
- 150000003568 thioethers Chemical class 0.000 claims description 3
- 239000002253 acid Substances 0.000 description 30
- 239000003921 oil Substances 0.000 description 23
- 239000000047 product Substances 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 16
- 238000009835 boiling Methods 0.000 description 14
- 150000001768 cations Chemical class 0.000 description 11
- 239000002994 raw material Substances 0.000 description 11
- 239000011148 porous material Substances 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 8
- 238000010586 diagram Methods 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 238000000605 extraction Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 5
- 125000002091 cationic group Chemical group 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 229910052761 rare earth metal Inorganic materials 0.000 description 5
- 150000002910 rare earth metals Chemical group 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000005342 ion exchange Methods 0.000 description 4
- 229910000510 noble metal Inorganic materials 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000001354 calcination Methods 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012188 paraffin wax Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229910017090 AlO 2 Inorganic materials 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 238000002447 crystallographic data Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000003058 platinum compounds Chemical class 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000010025 steaming Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 229910004283 SiO 4 Inorganic materials 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000011959 amorphous silica alumina Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 1
- RMGVZKRVHHSUIM-UHFFFAOYSA-N dithionic acid Chemical compound OS(=O)(=O)S(O)(=O)=O RMGVZKRVHHSUIM-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052680 mordenite Inorganic materials 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 1
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 238000002411 thermogravimetry Methods 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10G—CRACKING HYDROCARBON OILS; PRODUCTION OF LIQUID HYDROCARBON MIXTURES, e.g. BY DESTRUCTIVE HYDROGENATION, OLIGOMERISATION, POLYMERISATION; RECOVERY OF HYDROCARBON OILS FROM OIL-SHALE, OIL-SAND, OR GASES; REFINING MIXTURES MAINLY CONSISTING OF HYDROCARBONS; REFORMING OF NAPHTHA; MINERAL WAXES
- C10G45/00—Refining of hydrocarbon oils using hydrogen or hydrogen-generating compounds
- C10G45/58—Refining of hydrocarbon oils using hydrogen or hydrogen-generating compounds to change the structural skeleton of some of the hydrocarbon content without cracking the other hydrocarbons present, e.g. lowering pour point; Selective hydrocracking of normal paraffins
- C10G45/60—Refining of hydrocarbon oils using hydrogen or hydrogen-generating compounds to change the structural skeleton of some of the hydrocarbon content without cracking the other hydrocarbons present, e.g. lowering pour point; Selective hydrocracking of normal paraffins characterised by the catalyst used
- C10G45/64—Refining of hydrocarbon oils using hydrogen or hydrogen-generating compounds to change the structural skeleton of some of the hydrocarbon content without cracking the other hydrocarbons present, e.g. lowering pour point; Selective hydrocracking of normal paraffins characterised by the catalyst used containing crystalline alumino-silicates, e.g. molecular sieves
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10G—CRACKING HYDROCARBON OILS; PRODUCTION OF LIQUID HYDROCARBON MIXTURES, e.g. BY DESTRUCTIVE HYDROGENATION, OLIGOMERISATION, POLYMERISATION; RECOVERY OF HYDROCARBON OILS FROM OIL-SHALE, OIL-SAND, OR GASES; REFINING MIXTURES MAINLY CONSISTING OF HYDROCARBONS; REFORMING OF NAPHTHA; MINERAL WAXES
- C10G47/00—Cracking of hydrocarbon oils, in the presence of hydrogen or hydrogen- generating compounds, to obtain lower boiling fractions
- C10G47/02—Cracking of hydrocarbon oils, in the presence of hydrogen or hydrogen- generating compounds, to obtain lower boiling fractions characterised by the catalyst used
- C10G47/10—Cracking of hydrocarbon oils, in the presence of hydrogen or hydrogen- generating compounds, to obtain lower boiling fractions characterised by the catalyst used with catalysts deposited on a carrier
- C10G47/12—Inorganic carriers
- C10G47/16—Crystalline alumino-silicate carriers
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Catalysts (AREA)
- Production Of Liquid Hydrocarbon Mixture For Refining Petroleum (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/541,763 US4486296A (en) | 1983-10-13 | 1983-10-13 | Process for hydrocracking and dewaxing hydrocarbon oils |
| US541763 | 1983-10-13 | ||
| US541764 | 1983-10-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6097051A JPS6097051A (ja) | 1985-05-30 |
| JPH0472579B2 true JPH0472579B2 (enFirst) | 1992-11-18 |
Family
ID=24160943
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59212747A Granted JPS6097051A (ja) | 1983-10-13 | 1984-10-12 | 炭化水素油の水素化分解及び水素化脱ロウ方法及び触媒 |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4486296A (enFirst) |
| JP (1) | JPS6097051A (enFirst) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4962269A (en) * | 1982-05-18 | 1990-10-09 | Mobil Oil Corporation | Isomerization process |
| US4820402A (en) * | 1982-05-18 | 1989-04-11 | Mobil Oil Corporation | Hydrocracking process with improved distillate selectivity with high silica large pore zeolites |
| US4757041A (en) * | 1983-10-13 | 1988-07-12 | Mobil Oil Corporation | Catalysts for cracking and dewaxing hydrocarbon oils |
| CA1264880A (en) * | 1984-07-06 | 1990-01-23 | John Brooke Gardiner | Viscosity index improver - dispersant additive useful in oil compositions |
| US4767522A (en) * | 1984-11-28 | 1988-08-30 | Mobil Oil Corporation | Distillate dewaxing process with mixed zeolites |
| EP0183419A3 (en) * | 1984-11-28 | 1987-04-15 | Mobil Oil Corporation | Distillate dewaxing process |
| CA1275400C (en) * | 1984-12-18 | 1990-10-23 | Frank Peter Gortsema | Dewaxing catalysts and processes employing non- zeolitic molecular sieves |
| US4960504A (en) * | 1984-12-18 | 1990-10-02 | Uop | Dewaxing catalysts and processes employing silicoaluminophosphate molecular sieves |
| US4919788A (en) * | 1984-12-21 | 1990-04-24 | Mobil Oil Corporation | Lubricant production process |
| AU582404B2 (en) * | 1984-12-27 | 1989-03-23 | Mobil Oil Corporation | Catalytic cracking with a mixture of faujasite-type zeolites and zeolite beta |
| US4867861A (en) * | 1985-06-18 | 1989-09-19 | Union Oil Company Of California | Process and catalyst for the dewaxing of shale oil |
| US5084159A (en) * | 1985-06-18 | 1992-01-28 | Union Oil Company Of California | Process and catalyst for the dewaxing of shale oil |
| US4740292A (en) * | 1985-09-12 | 1988-04-26 | Mobil Oil Corporation | Catalytic cracking with a mixture of faujasite-type zeolite and zeolite beta |
| US4913797A (en) * | 1985-11-21 | 1990-04-03 | Mobil Oil Corporation | Catalyst hydrotreating and dewaxing process |
| US4810355A (en) * | 1985-12-12 | 1989-03-07 | Amoco Corporation | Process for preparing dehazed white oils |
| US4898846A (en) * | 1986-03-21 | 1990-02-06 | W. R. Grace & Co.-Conn. | Cracking catalysts with octane enhancement |
| US4784749A (en) * | 1986-05-13 | 1988-11-15 | Mobil Oil Corporation | Cracking/dewaxing |
| US4788378A (en) * | 1986-05-13 | 1988-11-29 | Mobil Oil Corporation | Dewaxing by isomerization |
| US4880787A (en) * | 1986-08-15 | 1989-11-14 | Mobil Oil Corporation | Cracking catalyst |
| US4861741A (en) * | 1986-09-03 | 1989-08-29 | Mobil Oil Corporation | Mixed catalyst system and catalytic conversion process employing same |
| US5041208A (en) * | 1986-12-04 | 1991-08-20 | Mobil Oil Corporation | Process for increasing octane and reducing sulfur content of olefinic gasolines |
| US4837396A (en) * | 1987-12-11 | 1989-06-06 | Mobil Oil Corporation | Zeolite beta containing hydrocarbon conversion catalyst of stability |
| US5208197A (en) * | 1988-03-30 | 1993-05-04 | Uop | Octane gasoline catalyst |
| US5160033A (en) * | 1988-03-30 | 1992-11-03 | Uop | Octane gasoline catalyst and process using same in a hydrocracking process |
| US5139647A (en) * | 1989-08-14 | 1992-08-18 | Chevron Research And Technology Company | Process for preparing low pour middle distillates and lube oil using a catalyst containing a silicoaluminophosphate molecular sieve |
| US4925546A (en) * | 1989-09-12 | 1990-05-15 | Amoco Corporation | Hydrocracking process |
| US4980328A (en) * | 1989-09-12 | 1990-12-25 | Amoco Corporation | Hydrocracking catalyst |
| GB8925980D0 (en) * | 1989-11-16 | 1990-01-04 | Shell Int Research | Process for converting hydrocarbon oils |
| US5279726A (en) * | 1990-05-22 | 1994-01-18 | Union Oil Company Of California | Catalyst containing zeolite beta and processes for its use |
| US5350501A (en) * | 1990-05-22 | 1994-09-27 | Union Oil Company Of California | Hydrocracking catalyst and process |
| US5275720A (en) * | 1990-11-30 | 1994-01-04 | Union Oil Company Of California | Gasoline hydrocracking catalyst and process |
| US5171422A (en) * | 1991-01-11 | 1992-12-15 | Mobil Oil Corporation | Process for producing a high quality lube base stock in increased yield |
| US5183557A (en) * | 1991-07-24 | 1993-02-02 | Mobil Oil Corporation | Hydrocracking process using ultra-large pore size catalysts |
| US5374349A (en) * | 1991-09-11 | 1994-12-20 | Union Oil Company Of California | Hydrocracking process employing catalyst containing zeolite beta and a pillared clay |
| US5228979A (en) * | 1991-12-05 | 1993-07-20 | Union Oil Company Of California | Hydrocracking with a catalyst containing a noble metal and zeolite beta |
| US5328590A (en) * | 1992-02-27 | 1994-07-12 | Union Oil Company Of California | Hydrocracking process using a catalyst containing zeolite beta and a layered magnesium silicate |
| CN1030287C (zh) * | 1992-10-22 | 1995-11-22 | 中国石油化工总公司 | 制取高质量汽油、丙烯、丁烯的烃转化催化剂 |
| WO2004002623A1 (en) * | 2002-06-28 | 2004-01-08 | Haldor Topsoe A/S | Catalyst comprising zeolite beta and its use in hydrocarbon conversion process |
| US7169291B1 (en) * | 2003-12-31 | 2007-01-30 | Uop Llc | Selective hydrocracking process using beta zeolite |
| WO2006063777A1 (en) * | 2004-12-17 | 2006-06-22 | Haldor Topsøe A/S | Hydrocracking process |
| US7510645B2 (en) * | 2005-11-04 | 2009-03-31 | Uop Llc | Hydrocracking catalyst containing beta and Y zeolites, and process for its use to produce naphtha |
| US7585405B2 (en) * | 2005-11-04 | 2009-09-08 | Uop Llc | Hydrocracking catalyst containing beta and Y zeolites, and process for its use to make jet fuel or distillate |
| US20080011649A1 (en) * | 2006-07-17 | 2008-01-17 | Li Wang | Hydrocracking Catalyst Containing Beta and Y Zeolites, and Process for its use to make Distillate |
| US20080011648A1 (en) * | 2006-07-17 | 2008-01-17 | Li Wang | Hydrocracking Catalyst Containing Beta and Y Zeolites, and Process for its use to make Distillate |
| US20080011647A1 (en) * | 2006-07-17 | 2008-01-17 | Li Wang | Hydrocracking Catalyst Containing Beta and Y Zeolites, and Process for its use to make Distillate |
| US8231778B2 (en) * | 2008-12-31 | 2012-07-31 | Uop Llc | Hydrocracking processes yielding a hydroisomerized product for lube base stocks |
| US9157036B2 (en) * | 2010-03-31 | 2015-10-13 | Exxonmobil Research And Engineering Company | Hydroprocessing of gas oil boiling range feeds |
| US8882993B2 (en) * | 2011-03-07 | 2014-11-11 | Exxonmobil Research And Engineering Company | Stabilized aggregates of small crystallites of zeolite Y |
| US20130261365A1 (en) * | 2012-04-02 | 2013-10-03 | Saudi Arabian Oil Company | Process for the Production of Xylenes and Light Olefins from Heavy Aromatics |
| KR20230160252A (ko) * | 2021-03-29 | 2023-11-23 | 셰브런 유.에스.에이.인크. | 방향족 및 시클로파라핀 고리를 포함하는 탄화수소 종에 대한 개환 공정 및 촉매 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3764520A (en) * | 1962-05-11 | 1973-10-09 | Exxon Research Engineering Co | Hydrocarbon conversion system |
| US3769202A (en) * | 1962-07-16 | 1973-10-30 | Mobil Oil Corp | Catalytic conversion of hydrocarbons |
| US3308069A (en) * | 1964-05-01 | 1967-03-07 | Mobil Oil Corp | Catalytic composition of a crystalline zeolite |
| US3812199A (en) * | 1968-07-02 | 1974-05-21 | Mobil Oil Corp | Disproportionation of paraffin hydrocarbons |
| US3861005A (en) * | 1969-05-28 | 1975-01-21 | Sun Oil Co Pennsylvania | Catalytic isomerization of lube streams and waxes |
| GB1314879A (en) * | 1970-06-01 | 1973-04-26 | British Petroleum Co | Production of lubricating oils |
| US3923641A (en) * | 1974-02-20 | 1975-12-02 | Mobil Oil Corp | Hydrocracking naphthas using zeolite beta |
| US4340465A (en) * | 1980-09-29 | 1982-07-20 | Chevron Research Company | Dual component crystalline silicate cracking catalyst |
| US4405445A (en) * | 1981-08-24 | 1983-09-20 | Ashland Oil, Inc. | Homogenization of water and reduced crude for catalytic cracking |
| US4419220A (en) * | 1982-05-18 | 1983-12-06 | Mobil Oil Corporation | Catalytic dewaxing process |
-
1983
- 1983-10-13 US US06/541,763 patent/US4486296A/en not_active Expired - Lifetime
-
1984
- 1984-10-12 JP JP59212747A patent/JPS6097051A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4486296A (en) | 1984-12-04 |
| JPS6097051A (ja) | 1985-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0472579B2 (enFirst) | ||
| US4501926A (en) | Catalytic dewaxing process with zeolite beta | |
| US4419220A (en) | Catalytic dewaxing process | |
| US4554065A (en) | Isomerization process to produce low pour point distillate fuels and lubricating oil stocks | |
| US4518485A (en) | Hydrotreating/isomerization process to produce low pour point distillate fuels and lubricating oil stocks | |
| EP0094827B1 (en) | Simultaneous catalytic hydrocracking and hydrodewaxing of hydrocarbon oils with zeolite beta | |
| AU2002314751B2 (en) | Process for isomerization dewaxing of hydrocarbon streams | |
| DE68905478T2 (de) | Verfahren zur herstellung eines zeolith-beta-kohlenwasserstoffumwandlungskatalysators. | |
| US4500417A (en) | Conversion of Fischer-Tropsch products | |
| US4757041A (en) | Catalysts for cracking and dewaxing hydrocarbon oils | |
| US4913797A (en) | Catalyst hydrotreating and dewaxing process | |
| US4855530A (en) | Isomerization process | |
| US4788378A (en) | Dewaxing by isomerization | |
| US4962269A (en) | Isomerization process | |
| JP2002534557A (ja) | 低圧水素化分解方法 | |
| CA1204717A (en) | Hydrocracking process with improved distillate selectivity | |
| EP0140608B1 (en) | Catalyst and process for hydrocracking and dewaxing hydrocarbon oils | |
| EP0094826B1 (en) | Isomerization process | |
| US5284573A (en) | Simultaneous catalytic hydrocracking and hydrodewaxing of hydrocarbon oils with zeolite beta | |
| US5128024A (en) | Simultaneous catalytic hydrocracking and hydrodewaxing of hydrocarbon oils with zeolite beta | |
| KR100700999B1 (ko) | 파라핀 함유 원료의 유동점을 개선시키는 eu-1제올라이트 촉매 및 그 개선 방법 |