JPH0215551B2 - - Google Patents
Info
- Publication number
- JPH0215551B2 JPH0215551B2 JP8845781A JP8845781A JPH0215551B2 JP H0215551 B2 JPH0215551 B2 JP H0215551B2 JP 8845781 A JP8845781 A JP 8845781A JP 8845781 A JP8845781 A JP 8845781A JP H0215551 B2 JPH0215551 B2 JP H0215551B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- lower alkyl
- alkyl group
- oxo
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- -1 benzoxazepine-7-carboxylic acid Chemical compound 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000004043 oxo group Chemical group O=* 0.000 claims description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- JOHZPMXAZQZXHR-UHFFFAOYSA-N pipemidic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CN=C1N1CCNCC1 JOHZPMXAZQZXHR-UHFFFAOYSA-N 0.000 description 1
- 229960001732 pipemidic acid Drugs 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8845781A JPS57203085A (en) | 1981-06-09 | 1981-06-09 | 1,8-cyclic substituted quinoline derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8845781A JPS57203085A (en) | 1981-06-09 | 1981-06-09 | 1,8-cyclic substituted quinoline derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57203085A JPS57203085A (en) | 1982-12-13 |
| JPH0215551B2 true JPH0215551B2 (en:Method) | 1990-04-12 |
Family
ID=13943316
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8845781A Granted JPS57203085A (en) | 1981-06-09 | 1981-06-09 | 1,8-cyclic substituted quinoline derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57203085A (en:Method) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5976091A (ja) * | 1982-10-22 | 1984-04-28 | Otsuka Pharmaceut Co Ltd | ピリド〔1,2,3−de〕〔1,4〕ベンゾチアジン誘導体 |
| IT1173374B (it) * | 1984-02-24 | 1987-06-24 | Mediolanum Farmaceutici Srl | Derivati pirido-benzotiazinici ad elevata attivita' antimicrobica |
| US4571396A (en) * | 1984-04-16 | 1986-02-18 | Warner-Lambert Company | Antibacterial agents |
| DE3543513A1 (de) * | 1985-12-10 | 1987-06-11 | Bayer Ag | Enantiomerenreine 1,8-verbrueckte 4-chinolon-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende arzneimittel und ihre verwendung zur herstellung von arzneimitteln |
| IT1196429B (it) * | 1986-07-01 | 1988-11-16 | Mediolanum Farmaceutici Srl | Processo per la preparazione di pirido benzotiazine ad attivita' antibatterica e loro sali con acidi solfonici |
| IT1222833B (it) * | 1987-10-06 | 1990-09-12 | Mediolanum Farmaceutici Srl | Derivati pirido benzotiazinici dotati di elevata attivita' antibatterica e di elevata biodisponibilita' tissutale |
| US5175160A (en) * | 1988-08-09 | 1992-12-29 | Daiichi Pharmaceutical Co., Ltd. | Antimicrobial agent for animals |
| CA2081891C (en) * | 1990-05-02 | 1999-03-16 | Daniel T. Chu | Quinolizinone type compounds |
| CN111170941B (zh) * | 2018-11-12 | 2023-07-25 | 江西农业大学 | 1-环丙基-6,7-二氟-8-甲氧基氟喹诺酮-3-羧酸酯的制备方法 |
-
1981
- 1981-06-09 JP JP8845781A patent/JPS57203085A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS57203085A (en) | 1982-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Matsumoto et al. | 1, 4-Dihydro-4-oxopyridinecarboxylic acids as antibacterial agents. 2. Synthesis and structure-activity relationships of 1, 6, 7-trisubstituted 1, 4-dihydro-4-oxo-1, 8-naphthyridine-3-carboxylic acids, including enoxacin, a new antibacterial agent | |
| SU1635898A3 (ru) | Способ получени производных хинолина или их фармацевтически приемлемых сложных эфиров, или фармацевтически приемлемых солей указанных производных или сложных эфиров | |
| Sanchez et al. | Quinolone antibacterial agents. Synthesis and structure-activity relationships of 8-substituted quinoline-3-carboxylic acids and 1, 8-naphthyridine-3-carboxylic acids | |
| KR0156238B1 (ko) | 7-(1-피롤리디닐)-3-퀴놀론-및 -나프티리돈카르복실산 유도체, 그의 제조 방법, 및 그의 제조를 위한 중간 생성물인 치환된 모노-및 비시클릭 피롤리딘 유도체, 및 이를 함유하는 항균제 및 사료 첨가제 | |
| CA2247020C (en) | Possibly substituted 8-cyano-1-cyclopropyl-7-(2,8-diazabicyclo-[4.3.0]-nonan-8-yl)-6-fluoro-1,4-dihydro-4-oxo-3-quinolin carboxylic acids and their derivatives | |
| CS235502B2 (en) | Method of 1-ethyl or vinyl-6-halogen-1-4-dihydro-4-oxo-7- (1-piperazinyl)-1,8-naphtyridin-3-carboxyl acid production | |
| CA2072207A1 (en) | 7-azaisoindolinyl-quinolone-and-naphthyridonecarboxylic- acid derivatives | |
| GB2057440A (en) | Quinoline carboxylic acid derivatives | |
| NZ198224A (en) | 9-halo-7-oxo-2,3-dihydro-7h-pyrido(1,2,3,-de)(1,4)benzoxazine-6-carboxylic acid derivatives | |
| IL102261A (en) | 7-isoindolinyl-quinolone- and -naphthridonecarboxylic acid derivatives their preparation and pharmaceutical compositions containing them | |
| US3300499A (en) | 4-alkyl (or alkenyl)-1, 4-dihydro-1-oxobenzo [f] [1, 7] naphthyridine 2-carboxylic acid derivatives | |
| EP0588166A2 (de) | Antibakterielle 7-Isoindolinyl-chinolon- und naphthyridon-Derivate | |
| JPH0215551B2 (en:Method) | ||
| SE459809B (sv) | Bensokinolizin-karboxylsyraderivat och foerfarande foer framstaellning daerav | |
| JPH0145468B2 (en:Method) | ||
| NO870126L (no) | 7-(azabicykloalkyl)-chinolonkarboksylsyre- og naftyridon-karboksylsyre-derivater. | |
| US3917609A (en) | Pyrroloquinoline carboxylic acids and derivatives | |
| EP0274033A1 (de) | Verfahren zur Herstellung von Chinolincarbonsäuren | |
| EP0312085B1 (en) | Novel quinoline derivatives, processes for preparation thereof and antibacterial agent containing them | |
| US4847375A (en) | Antibacterial 1,8-bridged 4-quinoline-3-carboxylic acids | |
| EP0326916A2 (de) | Chinolon- und Naphthyridoncarbonsäurederivate, Verfahren zu ihrer Herstellung und sie enthaltende antibakterielle Mittel und Futterzusatzstoffe | |
| Alyamkina et al. | 4-Amino-2-phenylindole-based compounds with potential antibacterial activity | |
| SU1701110A3 (ru) | Способ получени хинолинкарбоновых кислот или их фармацевтически приемлемых солей | |
| NO885426L (no) | Kinolinderivater, samt fremgangsmaate ved fremstilling derav. | |
| US4720495A (en) | Benzo[ij]quinolizine-2-carboxylic acids useful for treating bacterial infection |