JPH0129224B2 - - Google Patents
Info
- Publication number
- JPH0129224B2 JPH0129224B2 JP56196721A JP19672181A JPH0129224B2 JP H0129224 B2 JPH0129224 B2 JP H0129224B2 JP 56196721 A JP56196721 A JP 56196721A JP 19672181 A JP19672181 A JP 19672181A JP H0129224 B2 JPH0129224 B2 JP H0129224B2
- Authority
- JP
- Japan
- Prior art keywords
- flame retardant
- sulfate
- borate
- boric acid
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 42
- 239000003063 flame retardant Substances 0.000 claims description 28
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 22
- -1 alkaline earth metal sulfate Chemical class 0.000 claims description 16
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 16
- 239000004327 boric acid Substances 0.000 claims description 16
- 229910052936 alkali metal sulfate Inorganic materials 0.000 claims description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 10
- 239000002952 polymeric resin Substances 0.000 claims description 10
- 229910000410 antimony oxide Inorganic materials 0.000 claims description 8
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 claims description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical group [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 7
- 229920000620 organic polymer Polymers 0.000 claims description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 7
- 235000011152 sodium sulphate Nutrition 0.000 claims description 7
- 239000004800 polyvinyl chloride Substances 0.000 claims description 5
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 229920005989 resin Polymers 0.000 description 12
- 239000011347 resin Substances 0.000 description 12
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 10
- 229910021538 borax Inorganic materials 0.000 description 10
- 235000010339 sodium tetraborate Nutrition 0.000 description 10
- 229920000642 polymer Polymers 0.000 description 9
- 150000001642 boronic acid derivatives Chemical class 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 239000004328 sodium tetraborate Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 229920003002 synthetic resin Polymers 0.000 description 5
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 2
- NGJLGEKRRYVYAZ-UHFFFAOYSA-L S(=O)(=O)([O-])[O-].[Na+].B(O)(O)O.[Na+] Chemical compound S(=O)(=O)([O-])[O-].[Na+].B(O)(O)O.[Na+] NGJLGEKRRYVYAZ-UHFFFAOYSA-L 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 229910001730 borate mineral Inorganic materials 0.000 description 2
- 239000010429 borate mineral Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- STNGULMWFPMOCE-UHFFFAOYSA-N ethyl 4-butyl-3,5-dimethyl-1h-pyrrole-2-carboxylate Chemical compound CCCCC1=C(C)NC(C(=O)OCC)=C1C STNGULMWFPMOCE-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 230000009970 fire resistant effect Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011819 refractory material Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 229920001187 thermosetting polymer Polymers 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WFUGQJXVXHBTEM-UHFFFAOYSA-N 2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane Chemical compound CCC(C)(OO)OOC(C)(CC)OO WFUGQJXVXHBTEM-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910021537 Kernite Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920001944 Plastisol Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- FUQHZPGSFAWKGW-UHFFFAOYSA-N [Na+].[Na+].[Na+].[O-]B([O-])[O-].OS(O)(=O)=O Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-].OS(O)(=O)=O FUQHZPGSFAWKGW-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910021540 colemanite Inorganic materials 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Polymers C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000012774 insulation material Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 239000010899 old newspaper Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004999 plastisol Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- VLCLHFYFMCKBRP-UHFFFAOYSA-N tricalcium;diborate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]B([O-])[O-].[O-]B([O-])[O-] VLCLHFYFMCKBRP-UHFFFAOYSA-N 0.000 description 1
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical class [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 description 1
- 229910021539 ulexite Inorganic materials 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/38—Boron-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/30—Sulfur-, selenium- or tellurium-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/213,979 US4377506A (en) | 1980-12-08 | 1980-12-08 | Fire retardant polymer compositions containing a borate-sulfate mixture |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57121039A JPS57121039A (en) | 1982-07-28 |
| JPH0129224B2 true JPH0129224B2 (enExample) | 1989-06-08 |
Family
ID=22797288
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56196721A Granted JPS57121039A (en) | 1980-12-08 | 1981-12-07 | Flame retardant polymer composition |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4377506A (enExample) |
| JP (1) | JPS57121039A (enExample) |
| AU (1) | AU542035B2 (enExample) |
| CA (1) | CA1158389A (enExample) |
| DE (1) | DE3147601A1 (enExample) |
| FR (1) | FR2495629B1 (enExample) |
| GB (1) | GB2088881B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3858708A1 (en) | 2020-01-29 | 2021-08-04 | Jtekt Corporation | Steering apparatus |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL61383A (en) * | 1979-11-03 | 1984-02-29 | Raychem Ltd | Polymeric compositions having improved water stability and alumina-antimony compound fillers for use therein |
| IL71108A (en) * | 1984-02-29 | 1986-11-30 | Bromine Compounds Ltd | Sulfur-containing halogenate esters of neopentyl alcohol,methods for their preparation and use thereof |
| US4619954A (en) * | 1984-06-22 | 1986-10-28 | Sequentia, Incorporated | Fiberglass reinforced plastic sheet material with fire retardant filler |
| IL80021A (en) * | 1985-11-13 | 1993-04-04 | Bromine Compounds Ltd | Granular flame retardant agents, process for their preparation and articles obtained thereby |
| US5593619A (en) * | 1992-10-22 | 1997-01-14 | Albemarle Corporation | Granulated flame retardant products |
| US5492881A (en) * | 1994-03-25 | 1996-02-20 | Diamond; Charles M. | Sorbent system |
| US5679277A (en) * | 1995-03-02 | 1997-10-21 | Niibe; Akitoshi | Flame-resistant heating body and method for making same |
| US5922296A (en) * | 1997-10-02 | 1999-07-13 | In-Cide Technologies, Inc. | Method for making particulate sodium polyborate |
| US6239197B1 (en) | 1999-04-23 | 2001-05-29 | Great Lakes Chemical Corporation | Vacuum de-aerated powdered polymer additives |
| US6759476B1 (en) * | 1999-07-14 | 2004-07-06 | Claude Q. C. Hayes | Flexible thermal control composite |
| US20010037035A1 (en) * | 2000-05-24 | 2001-11-01 | Kevin Kutcel | Method for preparing polyborate compounds and uses for same |
| US20030221775A1 (en) * | 2002-05-31 | 2003-12-04 | Martin Feng | Method for producing wood composite products with phenolic resins and borate-treated wood materials |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3385819A (en) * | 1965-09-13 | 1968-05-28 | Hooker Chemical Corp | Fire retardant compositions |
| NL6803595A (enExample) * | 1967-06-19 | 1968-12-20 | ||
| US3560441A (en) * | 1968-12-16 | 1971-02-02 | M & T Chemicals Inc | Antimony trioxide inorganic compound glass flame retardant compositions and methods for their preparation |
| US3816307A (en) * | 1970-07-13 | 1974-06-11 | W Woods | Fire retardant resins |
| US3718615A (en) * | 1971-03-05 | 1973-02-27 | United States Borax Chem | Halogenated polymeric compositions containing zinc borate |
| US3983040A (en) * | 1975-08-07 | 1976-09-28 | Draganov Samuel M | Fire-retardant composition and process of producing same |
| DE2632741B2 (de) * | 1976-07-21 | 1979-05-03 | Hoechst Ag, 6000 Frankfurt | Gummimischung und daraus hergestellte, gewebeverstärkte Formkörper |
| US4172804A (en) * | 1977-11-21 | 1979-10-30 | George Christianson | Method of preparing fire retardant insulation |
| US4132655A (en) * | 1977-12-13 | 1979-01-02 | Draganov Samuel M | Fire-retardant composition and method of rendering cellulosic materials fire-retardant |
| US4156654A (en) * | 1978-03-31 | 1979-05-29 | Blasius James R | Method for making crude boric acid from borate and sulfuric acid |
| DE2831616C2 (de) * | 1978-07-19 | 1984-08-09 | Kataflox Patentverwaltungs-Gesellschaft mbH, 7500 Karlsruhe | Verfahren zum Herstellen eines nicht brennbaren Formkörpers |
| US4173666A (en) * | 1978-09-11 | 1979-11-06 | Quinto Mario J | Flame resistant cellulose fiber insulation and process of preparing it |
| GB2037832A (en) * | 1978-12-19 | 1980-07-16 | Draganov S M | Fire-retardant Composition and Method of Rendering Cellulosic Materials Fire-retardant |
-
1980
- 1980-12-08 US US06/213,979 patent/US4377506A/en not_active Expired - Lifetime
-
1981
- 1981-10-07 CA CA000387529A patent/CA1158389A/en not_active Expired
- 1981-11-24 GB GB8135388A patent/GB2088881B/en not_active Expired
- 1981-12-02 DE DE19813147601 patent/DE3147601A1/de not_active Ceased
- 1981-12-07 AU AU78330/81A patent/AU542035B2/en not_active Ceased
- 1981-12-07 FR FR8122836A patent/FR2495629B1/fr not_active Expired
- 1981-12-07 JP JP56196721A patent/JPS57121039A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3858708A1 (en) | 2020-01-29 | 2021-08-04 | Jtekt Corporation | Steering apparatus |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3147601A1 (de) | 1982-08-12 |
| GB2088881B (en) | 1984-03-21 |
| CA1158389A (en) | 1983-12-06 |
| AU542035B2 (en) | 1985-01-31 |
| FR2495629A1 (fr) | 1982-06-11 |
| JPS57121039A (en) | 1982-07-28 |
| FR2495629B1 (fr) | 1985-09-13 |
| AU7833081A (en) | 1982-06-17 |
| US4377506A (en) | 1983-03-22 |
| GB2088881A (en) | 1982-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0129224B2 (enExample) | ||
| EP0023764B1 (en) | Intumescent fire-retardant granules and their use in a sheet material | |
| US4209561A (en) | Structural wood panels with improved fire resistance | |
| WO1993020156A1 (en) | Intumescent coating and method of manufacture | |
| SE466154B (sv) | Flamskyddande ytbelaeggning | |
| GB1575708A (en) | Fire-retarding epoxy resin material and manufacture thereof | |
| CN102634256A (zh) | 一种水性膨胀型隧道防火防霉涂料 | |
| CN109880176B (zh) | 低温度陶瓷化聚合物基复合材料 | |
| WO2010109218A1 (en) | Fire retardant comprising glass frit in combination with an additive | |
| US4144288A (en) | Sodium tetraborate pentahydrate as a smoke suppressant for styrenic resins | |
| US3183107A (en) | Glass sphere filled plastering compositions | |
| CN105802436A (zh) | 一种纳米膨胀型透明防火涂料及其制备方法 | |
| KR950006533B1 (ko) | 난연성 중합체 조성물 및 그의 제조 방법 | |
| US3860692A (en) | Sodium aluminum borate | |
| KR20100107327A (ko) | 발포성 폴리스티렌용 난연 조성물 및 그 제조방법 | |
| SU1020007A3 (ru) | Способ получени неорганическо-органического пеноматериала | |
| US3705128A (en) | Flame resistant polymers containing amide complexes of metal salts | |
| KR100699591B1 (ko) | 난연성 스티로폼의 난연성 첨가물 | |
| KR20170062990A (ko) | 난연성 목분 합성재의 제조방법 | |
| US4048135A (en) | Polyester molding compositions of reduced flammability | |
| JPH05156072A (ja) | 熱可塑性ポリマーのためのハロゲン非含有難燃剤系 | |
| US3740245A (en) | Antimony-containing inorganic composition of matter and method for preparing same | |
| Shen | Boron-based flame retardants | |
| EP0671452A2 (de) | Rauchgasarme, temperaturbeständige Binde- und Beschichtungsmittel und deren Verwendung | |
| US3780142A (en) | Flame-retardant polyolefin compositions |