JP2547714C

JP2547714C -

Info

Publication number: JP2547714C
Authority: JP; Japan
Prior art keywords: oligonucleotide; sequence; protein; mrna; ribonucleic acid
Prior art date: 1999-07-12
Legal status : Expired - Lifetime

Application number

Other languages

English (en)

Japanese (ja)

Original Assignee

モルキユラーバイオシステムズインコーポレイテツド

Publication date

1999-07-12

Links

229920000272 Oligonucleotide Polymers 0.000 claims description 82
102000004169 proteins and genes Human genes 0.000 claims description 46
108090000623 proteins and genes Proteins 0.000 claims description 46
229920002477 rna polymer Polymers 0.000 claims description 25
230000000295 complement Effects 0.000 claims description 11
230000002194 synthesizing Effects 0.000 claims description 10
229940088597 Hormone Drugs 0.000 claims description 7
239000005556 hormone Substances 0.000 claims description 7
230000036961 partial Effects 0.000 claims description 6
230000015556 catabolic process Effects 0.000 claims description 5
230000004059 degradation Effects 0.000 claims description 5
238000006731 degradation reaction Methods 0.000 claims description 5
230000002401 inhibitory effect Effects 0.000 claims description 5
230000003612 virological Effects 0.000 claims description 5
101700080605 NUC1 Proteins 0.000 claims description 4
101700006494 nucA Proteins 0.000 claims description 4
108020004705 Codon Proteins 0.000 claims description 3
229920000978 Start codon Polymers 0.000 claims description 3
230000015572 biosynthetic process Effects 0.000 description 14
229920003013 deoxyribonucleic acid Polymers 0.000 description 14
229940028334 Follicle Stimulating Hormone Drugs 0.000 description 11
102000012673 Follicle Stimulating Hormone Human genes 0.000 description 11
108010079345 Follicle Stimulating Hormone Proteins 0.000 description 11
241000700605 Viruses Species 0.000 description 11
239000003814 drug Substances 0.000 description 11
210000004027 cells Anatomy 0.000 description 10
125000003275 alpha amino acid group Chemical group 0.000 description 8
238000003786 synthesis reaction Methods 0.000 description 8
238000005755 formation reaction Methods 0.000 description 7
238000009396 hybridization Methods 0.000 description 7
238000000034 method Methods 0.000 description 7
229920001850 Nucleic acid sequence Polymers 0.000 description 6
150000001413 amino acids Chemical class 0.000 description 6
239000002773 nucleotide Substances 0.000 description 6
125000003729 nucleotide group Chemical group 0.000 description 6
229920002676 Complementary DNA Polymers 0.000 description 5
230000003115 biocidal Effects 0.000 description 5
238000010367 cloning Methods 0.000 description 5
239000002299 complementary DNA Substances 0.000 description 5
150000007523 nucleic acids Chemical class 0.000 description 5
108091007521 restriction endonucleases Proteins 0.000 description 5
102000006771 Gonadotropins Human genes 0.000 description 4
108010086677 Gonadotropins Proteins 0.000 description 4
108020004999 Messenger RNA Proteins 0.000 description 4
RWQNBRDOKXIBIV-UHFFFAOYSA-N Thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 4
239000003242 anti bacterial agent Substances 0.000 description 4
102000038129 antigens Human genes 0.000 description 4
108091007172 antigens Proteins 0.000 description 4
238000006243 chemical reaction Methods 0.000 description 4
230000002068 genetic Effects 0.000 description 4
239000002622 gonadotropin Substances 0.000 description 4
229920002106 messenger RNA Polymers 0.000 description 4
239000000203 mixture Substances 0.000 description 4
108020004707 nucleic acids Proteins 0.000 description 4
229920000642 polymer Polymers 0.000 description 4
238000001243 protein synthesis Methods 0.000 description 4
230000001225 therapeutic Effects 0.000 description 4
230000014616 translation Effects 0.000 description 4
229940064005 Antibiotic throat preparations Drugs 0.000 description 3
229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 description 3
229940042052 Antibiotics for systemic use Drugs 0.000 description 3
229940042786 Antitubercular Antibiotics Drugs 0.000 description 3
241000894006 Bacteria Species 0.000 description 3
229940093922 Gynecological Antibiotics Drugs 0.000 description 3
229940024982 Topical Antifungal Antibiotics Drugs 0.000 description 3
241000209140 Triticum Species 0.000 description 3
239000000427 antigen Substances 0.000 description 3
230000001276 controlling effect Effects 0.000 description 3
230000000694 effects Effects 0.000 description 3
LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
238000000338 in vitro Methods 0.000 description 3
229940079866 intestinal antibiotics Drugs 0.000 description 3
238000004519 manufacturing process Methods 0.000 description 3
238000002844 melting Methods 0.000 description 3
229940005935 ophthalmologic Antibiotics Drugs 0.000 description 3
239000000047 product Substances 0.000 description 3
239000000126 substance Substances 0.000 description 3
230000001629 suppression Effects 0.000 description 3
235000021307 wheat Nutrition 0.000 description 3
YYROPELSRYBVMQ-UHFFFAOYSA-N 4-Toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
108090000790 Enzymes Proteins 0.000 description 2
102000004190 Enzymes Human genes 0.000 description 2
DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
229940113082 Thymine Drugs 0.000 description 2
ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
238000000137 annealing Methods 0.000 description 2
230000001580 bacterial Effects 0.000 description 2
239000005547 deoxyribonucleotide Substances 0.000 description 2
125000002637 deoxyribonucleotide group Chemical group 0.000 description 2
RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
201000010099 disease Diseases 0.000 description 2
201000009910 diseases by infectious agent Diseases 0.000 description 2
210000004602 germ cell Anatomy 0.000 description 2
238000004128 high performance liquid chromatography Methods 0.000 description 2
229910052739 hydrogen Inorganic materials 0.000 description 2
239000001257 hydrogen Substances 0.000 description 2
229910052588 hydroxylapatite Inorganic materials 0.000 description 2
230000002452 interceptive Effects 0.000 description 2
238000002955 isolation Methods 0.000 description 2
235000019333 sodium laurylsulphate Nutrition 0.000 description 2
229960000643 Adenine Drugs 0.000 description 1
GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Natural products NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 1
206010060945 Bacterial infection Diseases 0.000 description 1
210000000170 Cell Membrane Anatomy 0.000 description 1
241000282552 Chlorocebus aethiops Species 0.000 description 1
229940015047 Chorionic Gonadotropin Drugs 0.000 description 1
102000011022 Chorionic Gonadotropin Human genes 0.000 description 1
108010062540 Chorionic Gonadotropin Proteins 0.000 description 1
108020004635 Complementary DNA Proteins 0.000 description 1
108020004394 Complementary RNA Proteins 0.000 description 1
241000699800 Cricetinae Species 0.000 description 1
229940104302 Cytosine Drugs 0.000 description 1
OPTASPLRGRRNAP-UHFFFAOYSA-N Cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 1
ASJSAQIRZKANQN-CRCLSJGQSA-N Deoxyribose Chemical class OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 description 1
102000008422 EC 2.7.1.78 Human genes 0.000 description 1
108010021757 EC 2.7.1.78 Proteins 0.000 description 1
108010042407 Endonucleases Proteins 0.000 description 1
102000004533 Endonucleases Human genes 0.000 description 1
241000588724 Escherichia coli Species 0.000 description 1
229960004666 Glucagon Drugs 0.000 description 1
108060003199 Glucagon Proteins 0.000 description 1
MASNOZXLGMXCHN-ZLPAWPGGSA-N Glucagonum Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 1
229940094892 Gonadotropins Drugs 0.000 description 1
229960000789 Guanidine Hydrochloride Drugs 0.000 description 1
PJJJBBJSCAKJQF-UHFFFAOYSA-N Guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
UYTPUPDQBNUYGX-UHFFFAOYSA-N Guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 1
235000008694 Humulus lupulus Nutrition 0.000 description 1
102000003960 Ligases Human genes 0.000 description 1
108090000364 Ligases Proteins 0.000 description 1
102000009151 Luteinizing Hormone Human genes 0.000 description 1
108010073521 Luteinizing Hormone Proteins 0.000 description 1
229940040129 Luteinizing Hormone Drugs 0.000 description 1
206010028980 Neoplasm Diseases 0.000 description 1
108010076181 Proinsulin Proteins 0.000 description 1
240000004808 Saccharomyces cerevisiae Species 0.000 description 1
BBBFJLBPOGFECG-UHFFFAOYSA-N Salmon calcitonin Chemical compound C=1N=CNC=1CC(C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CCC(N)=O)C(=O)NC(C(C)O)C(=O)NC(CC=1C=CC(O)=CC=1)C(=O)N1C(CCC1)C(=O)NC(CCCNC(N)=N)C(=O)NC(C(C)O)C(=O)NC(CC(N)=O)C(=O)NC(C(C)O)C(=O)NCC(=O)NC(CO)C(=O)NCC(=O)NC(C(C)O)C(=O)N1C(CCC1)C(N)=O)NC(=O)C(CC(C)C)NC(=O)C(CCC(O)=O)NC(=O)C(CCC(N)=O)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C1CSSCC(N)C(=O)NC(CO)C(=O)NC(CC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)N1 BBBFJLBPOGFECG-UHFFFAOYSA-N 0.000 description 1
102000011923 Thyrotropin Human genes 0.000 description 1
108010061174 Thyrotropin Proteins 0.000 description 1
229940035893 Uracil Drugs 0.000 description 1
206010047461 Viral infection Diseases 0.000 description 1
208000001756 Virus Disease Diseases 0.000 description 1
BLAKAEFIFWAFGH-UHFFFAOYSA-N acetyl acetate;pyridine Chemical compound C1=CC=NC=C1.CC(=O)OC(C)=O BLAKAEFIFWAFGH-UHFFFAOYSA-N 0.000 description 1
125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
238000007792 addition Methods 0.000 description 1
OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 1
VHUUQVKOLVNVRT-UHFFFAOYSA-N ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
239000000908 ammonium hydroxide Substances 0.000 description 1
230000003042 antagnostic Effects 0.000 description 1
239000005557 antagonist Substances 0.000 description 1
230000000840 anti-viral Effects 0.000 description 1
102000004965 antibodies Human genes 0.000 description 1
108090001123 antibodies Proteins 0.000 description 1
239000003443 antiviral agent Substances 0.000 description 1
229940121357 antivirals Drugs 0.000 description 1
229960000074 biopharmaceuticals Drugs 0.000 description 1
239000006227 byproduct Substances 0.000 description 1
238000010804 cDNA synthesis Methods 0.000 description 1
239000000969 carrier Substances 0.000 description 1
239000001913 cellulose Substances 0.000 description 1
229920002678 cellulose Polymers 0.000 description 1
239000003153 chemical reaction reagent Substances 0.000 description 1
239000003795 chemical substances by application Substances 0.000 description 1
238000011097 chromatography purification Methods 0.000 description 1
238000003776 cleavage reaction Methods 0.000 description 1
239000003184 complementary RNA Substances 0.000 description 1
230000000875 corresponding Effects 0.000 description 1
230000037029 cross reaction Effects 0.000 description 1
230000000593 degrading Effects 0.000 description 1
ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
235000013601 eggs Nutrition 0.000 description 1
210000002257 embryonic structures Anatomy 0.000 description 1
125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
238000006200 ethylation reaction Methods 0.000 description 1
238000002474 experimental method Methods 0.000 description 1
238000000605 extraction Methods 0.000 description 1
238000001502 gel electrophoresis Methods 0.000 description 1
238000002523 gelfiltration Methods 0.000 description 1
239000011521 glass Substances 0.000 description 1
102000018146 globin family Human genes 0.000 description 1
108060003196 globin family Proteins 0.000 description 1
230000002458 infectious Effects 0.000 description 1
238000011081 inoculation Methods 0.000 description 1
238000003780 insertion Methods 0.000 description 1
101710017890 large T Proteins 0.000 description 1
238000011031 large scale production Methods 0.000 description 1
230000001665 lethal Effects 0.000 description 1
231100000518 lethal Toxicity 0.000 description 1
101710030587 ligN Proteins 0.000 description 1
101700077585 ligd Proteins 0.000 description 1
210000004962 mammalian cells Anatomy 0.000 description 1
230000035800 maturation Effects 0.000 description 1
230000004048 modification Effects 0.000 description 1
238000006011 modification reaction Methods 0.000 description 1
230000003472 neutralizing Effects 0.000 description 1
229940005943 ophthalmologic Antivirals Drugs 0.000 description 1
238000004816 paper chromatography Methods 0.000 description 1
230000001575 pathological Effects 0.000 description 1
XYJRXVWERLGGKC-UHFFFAOYSA-D pentacalcium;hydroxide;triphosphate Chemical compound [OH-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O XYJRXVWERLGGKC-UHFFFAOYSA-D 0.000 description 1
239000008177 pharmaceutical agent Substances 0.000 description 1
230000004962 physiological condition Effects 0.000 description 1
230000035479 physiological effects, processes and functions Effects 0.000 description 1
229920002401 polyacrylamide Polymers 0.000 description 1
239000002244 precipitate Substances 0.000 description 1
238000000746 purification Methods 0.000 description 1
230000002829 reduced Effects 0.000 description 1
125000000548 ribosyl group Chemical group C1([C@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
239000012064 sodium phosphate buffer Substances 0.000 description 1
241000894007 species Species 0.000 description 1
230000002269 spontaneous Effects 0.000 description 1
230000004083 survival Effects 0.000 description 1
229940026754 topical Antivirals Drugs 0.000 description 1
230000001131 transforming Effects 0.000 description 1
230000001960 triggered Effects 0.000 description 1
230000035899 viability Effects 0.000 description 1
230000017613 viral reproduction Effects 0.000 description 1